var ProLayout =
/******/ (function(modules) { // webpackBootstrap
/******/ 	// The module cache
/******/ 	var installedModules = {};
/******/
/******/ 	// The require function
/******/ 	function __webpack_require__(moduleId) {
/******/
/******/ 		// Check if module is in cache
/******/ 		if(installedModules[moduleId]) {
/******/ 			return installedModules[moduleId].exports;
/******/ 		}
/******/ 		// Create a new module (and put it into the cache)
/******/ 		var module = installedModules[moduleId] = {
/******/ 			i: moduleId,
/******/ 			l: false,
/******/ 			exports: {}
/******/ 		};
/******/
/******/ 		// Execute the module function
/******/ 		modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
/******/
/******/ 		// Flag the module as loaded
/******/ 		module.l = true;
/******/
/******/ 		// Return the exports of the module
/******/ 		return module.exports;
/******/ 	}
/******/
/******/
/******/ 	// expose the modules object (__webpack_modules__)
/******/ 	__webpack_require__.m = modules;
/******/
/******/ 	// expose the module cache
/******/ 	__webpack_require__.c = installedModules;
/******/
/******/ 	// define getter function for harmony exports
/******/ 	__webpack_require__.d = function(exports, name, getter) {
/******/ 		if(!__webpack_require__.o(exports, name)) {
/******/ 			Object.defineProperty(exports, name, { enumerable: true, get: getter });
/******/ 		}
/******/ 	};
/******/
/******/ 	// define __esModule on exports
/******/ 	__webpack_require__.r = function(exports) {
/******/ 		if(typeof Symbol !== 'undefined' && Symbol.toStringTag) {
/******/ 			Object.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });
/******/ 		}
/******/ 		Object.defineProperty(exports, '__esModule', { value: true });
/******/ 	};
/******/
/******/ 	// create a fake namespace object
/******/ 	// mode & 1: value is a module id, require it
/******/ 	// mode & 2: merge all properties of value into the ns
/******/ 	// mode & 4: return value when already ns object
/******/ 	// mode & 8|1: behave like require
/******/ 	__webpack_require__.t = function(value, mode) {
/******/ 		if(mode & 1) value = __webpack_require__(value);
/******/ 		if(mode & 8) return value;
/******/ 		if((mode & 4) && typeof value === 'object' && value && value.__esModule) return value;
/******/ 		var ns = Object.create(null);
/******/ 		__webpack_require__.r(ns);
/******/ 		Object.defineProperty(ns, 'default', { enumerable: true, value: value });
/******/ 		if(mode & 2 && typeof value != 'string') for(var key in value) __webpack_require__.d(ns, key, function(key) { return value[key]; }.bind(null, key));
/******/ 		return ns;
/******/ 	};
/******/
/******/ 	// getDefaultExport function for compatibility with non-harmony modules
/******/ 	__webpack_require__.n = function(module) {
/******/ 		var getter = module && module.__esModule ?
/******/ 			function getDefault() { return module['default']; } :
/******/ 			function getModuleExports() { return module; };
/******/ 		__webpack_require__.d(getter, 'a', getter);
/******/ 		return getter;
/******/ 	};
/******/
/******/ 	// Object.prototype.hasOwnProperty.call
/******/ 	__webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); };
/******/
/******/ 	// __webpack_public_path__
/******/ 	__webpack_require__.p = "";
/******/
/******/
/******/ 	// Load entry module and return exports
/******/ 	return __webpack_require__(__webpack_require__.s = 173);
/******/ })
/************************************************************************/
/******/ ([
/* 0 */
/***/ (function(module, exports) {

module.exports = React;

/***/ }),
/* 1 */
/***/ (function(module, exports) {

module.exports = antd;

/***/ }),
/* 2 */
/***/ (function(module, exports, __webpack_require__) {

var __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_RESULT__;function _typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }

/*!
  Copyright (c) 2017 Jed Watson.
  Licensed under the MIT License (MIT), see
  http://jedwatson.github.io/classnames
*/

/* global define */
(function () {
  'use strict';

  var hasOwn = {}.hasOwnProperty;

  function classNames() {
    var classes = [];

    for (var i = 0; i < arguments.length; i++) {
      var arg = arguments[i];
      if (!arg) continue;

      var argType = _typeof(arg);

      if (argType === 'string' || argType === 'number') {
        classes.push(arg);
      } else if (Array.isArray(arg) && arg.length) {
        var inner = classNames.apply(null, arg);

        if (inner) {
          classes.push(inner);
        }
      } else if (argType === 'object') {
        for (var key in arg) {
          if (hasOwn.call(arg, key) && arg[key]) {
            classes.push(key);
          }
        }
      }
    }

    return classes.join(' ');
  }

  if ( true && module.exports) {
    classNames.default = classNames;
    module.exports = classNames;
  } else if ( true && _typeof(__webpack_require__(55)) === 'object' && __webpack_require__(55)) {
    // register as 'classnames', consistent with npm package name
    !(__WEBPACK_AMD_DEFINE_ARRAY__ = [], __WEBPACK_AMD_DEFINE_RESULT__ = (function () {
      return classNames;
    }).apply(exports, __WEBPACK_AMD_DEFINE_ARRAY__),
				__WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__));
  } else {
    window.classNames = classNames;
  }
})();

/***/ }),
/* 3 */
/***/ (function(module, exports) {

function _extends() {
  module.exports = _extends = Object.assign || function (target) {
    for (var i = 1; i < arguments.length; i++) {
      var source = arguments[i];

      for (var key in source) {
        if (Object.prototype.hasOwnProperty.call(source, key)) {
          target[key] = source[key];
        }
      }
    }

    return target;
  };

  return _extends.apply(this, arguments);
}

module.exports = _extends;

/***/ }),
/* 4 */
/***/ (function(module, exports) {

function _interopRequireDefault(obj) {
  return obj && obj.__esModule ? obj : {
    "default": obj
  };
}

module.exports = _interopRequireDefault;

/***/ }),
/* 5 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _defineProperty; });
function _defineProperty(obj, key, value) {
  if (key in obj) {
    Object.defineProperty(obj, key, {
      value: value,
      enumerable: true,
      configurable: true,
      writable: true
    });
  } else {
    obj[key] = value;
  }

  return obj;
}

/***/ }),
/* 6 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";

// EXPORTS
__webpack_require__.d(__webpack_exports__, "a", function() { return /* binding */ _toConsumableArray; });

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/arrayLikeToArray.js
var arrayLikeToArray = __webpack_require__(37);

// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/arrayWithoutHoles.js

function _arrayWithoutHoles(arr) {
  if (Array.isArray(arr)) return Object(arrayLikeToArray["a" /* default */])(arr);
}
// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/iterableToArray.js
function _iterableToArray(iter) {
  if (typeof Symbol !== "undefined" && Symbol.iterator in Object(iter)) return Array.from(iter);
}
// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/unsupportedIterableToArray.js
var unsupportedIterableToArray = __webpack_require__(43);

// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/nonIterableSpread.js
function _nonIterableSpread() {
  throw new TypeError("Invalid attempt to spread non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
}
// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/toConsumableArray.js




function _toConsumableArray(arr) {
  return _arrayWithoutHoles(arr) || _iterableToArray(arr) || Object(unsupportedIterableToArray["a" /* default */])(arr) || _nonIterableSpread();
}

/***/ }),
/* 7 */
/***/ (function(module, exports, __webpack_require__) {

var _typeof = __webpack_require__(47);

function _getRequireWildcardCache() {
  if (typeof WeakMap !== "function") return null;
  var cache = new WeakMap();

  _getRequireWildcardCache = function _getRequireWildcardCache() {
    return cache;
  };

  return cache;
}

function _interopRequireWildcard(obj) {
  if (obj && obj.__esModule) {
    return obj;
  }

  if (obj === null || _typeof(obj) !== "object" && typeof obj !== "function") {
    return {
      "default": obj
    };
  }

  var cache = _getRequireWildcardCache();

  if (cache && cache.has(obj)) {
    return cache.get(obj);
  }

  var newObj = {};
  var hasPropertyDescriptor = Object.defineProperty && Object.getOwnPropertyDescriptor;

  for (var key in obj) {
    if (Object.prototype.hasOwnProperty.call(obj, key)) {
      var desc = hasPropertyDescriptor ? Object.getOwnPropertyDescriptor(obj, key) : null;

      if (desc && (desc.get || desc.set)) {
        Object.defineProperty(newObj, key, desc);
      } else {
        newObj[key] = obj[key];
      }
    }
  }

  newObj["default"] = obj;

  if (cache) {
    cache.set(obj, newObj);
  }

  return newObj;
}

module.exports = _interopRequireWildcard;

/***/ }),
/* 8 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";

// EXPORTS
__webpack_require__.d(__webpack_exports__, "a", function() { return /* binding */ _objectWithoutProperties; });

// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/objectWithoutPropertiesLoose.js
function _objectWithoutPropertiesLoose(source, excluded) {
  if (source == null) return {};
  var target = {};
  var sourceKeys = Object.keys(source);
  var key, i;

  for (i = 0; i < sourceKeys.length; i++) {
    key = sourceKeys[i];
    if (excluded.indexOf(key) >= 0) continue;
    target[key] = source[key];
  }

  return target;
}
// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/objectWithoutProperties.js

function _objectWithoutProperties(source, excluded) {
  if (source == null) return {};
  var target = _objectWithoutPropertiesLoose(source, excluded);
  var key, i;

  if (Object.getOwnPropertySymbols) {
    var sourceSymbolKeys = Object.getOwnPropertySymbols(source);

    for (i = 0; i < sourceSymbolKeys.length; i++) {
      key = sourceSymbolKeys[i];
      if (excluded.indexOf(key) >= 0) continue;
      if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue;
      target[key] = source[key];
    }
  }

  return target;
}

/***/ }),
/* 9 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _classCallCheck; });
function _classCallCheck(instance, Constructor) {
  if (!(instance instanceof Constructor)) {
    throw new TypeError("Cannot call a class as a function");
  }
}

/***/ }),
/* 10 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _typeof; });
function _typeof(obj) {
  "@babel/helpers - typeof";

  if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") {
    _typeof = function _typeof(obj) {
      return typeof obj;
    };
  } else {
    _typeof = function _typeof(obj) {
      return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj;
    };
  }

  return _typeof(obj);
}

/***/ }),
/* 11 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _createClass; });
function _defineProperties(target, props) {
  for (var i = 0; i < props.length; i++) {
    var descriptor = props[i];
    descriptor.enumerable = descriptor.enumerable || false;
    descriptor.configurable = true;
    if ("value" in descriptor) descriptor.writable = true;
    Object.defineProperty(target, descriptor.key, descriptor);
  }
}

function _createClass(Constructor, protoProps, staticProps) {
  if (protoProps) _defineProperties(Constructor.prototype, protoProps);
  if (staticProps) _defineProperties(Constructor, staticProps);
  return Constructor;
}

/***/ }),
/* 12 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";
/* unused harmony export warning */
/* unused harmony export note */
/* unused harmony export resetWarned */
/* unused harmony export call */
/* unused harmony export warningOnce */
/* unused harmony export noteOnce */
/* eslint-disable no-console */
var warned = {};
function warning(valid, message) {
  // Support uglify
  if (false) {}
}
function note(valid, message) {
  // Support uglify
  if (false) {}
}
function resetWarned() {
  warned = {};
}
function call(method, valid, message) {
  if (!valid && !warned[message]) {
    method(false, message);
    warned[message] = true;
  }
}
function warningOnce(valid, message) {
  call(warning, valid, message);
}
function noteOnce(valid, message) {
  call(note, valid, message);
}
/* harmony default export */ __webpack_exports__["a"] = (warningOnce);
/* eslint-enable */

/***/ }),
/* 13 */
/***/ (function(module, exports) {

function _defineProperty(obj, key, value) {
  if (key in obj) {
    Object.defineProperty(obj, key, {
      value: value,
      enumerable: true,
      configurable: true,
      writable: true
    });
  } else {
    obj[key] = value;
  }

  return obj;
}

module.exports = _defineProperty;

/***/ }),
/* 14 */
/***/ (function(module, exports) {

module.exports = ReactDOM;

/***/ }),
/* 15 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";

// EXPORTS
__webpack_require__.d(__webpack_exports__, "a", function() { return /* binding */ _inherits; });

// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/setPrototypeOf.js
function _setPrototypeOf(o, p) {
  _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) {
    o.__proto__ = p;
    return o;
  };

  return _setPrototypeOf(o, p);
}
// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/inherits.js

function _inherits(subClass, superClass) {
  if (typeof superClass !== "function" && superClass !== null) {
    throw new TypeError("Super expression must either be null or a function");
  }

  subClass.prototype = Object.create(superClass && superClass.prototype, {
    constructor: {
      value: subClass,
      writable: true,
      configurable: true
    }
  });
  if (superClass) _setPrototypeOf(subClass, superClass);
}

/***/ }),
/* 16 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _getPrototypeOf; });
function _getPrototypeOf(o) {
  _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) {
    return o.__proto__ || Object.getPrototypeOf(o);
  };
  return _getPrototypeOf(o);
}

/***/ }),
/* 17 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";

// EXPORTS
__webpack_require__.d(__webpack_exports__, "a", function() { return /* binding */ _slicedToArray; });

// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/arrayWithHoles.js
function _arrayWithHoles(arr) {
  if (Array.isArray(arr)) return arr;
}
// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/iterableToArrayLimit.js
function _iterableToArrayLimit(arr, i) {
  if (typeof Symbol === "undefined" || !(Symbol.iterator in Object(arr))) return;
  var _arr = [];
  var _n = true;
  var _d = false;
  var _e = undefined;

  try {
    for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) {
      _arr.push(_s.value);

      if (i && _arr.length === i) break;
    }
  } catch (err) {
    _d = true;
    _e = err;
  } finally {
    try {
      if (!_n && _i["return"] != null) _i["return"]();
    } finally {
      if (_d) throw _e;
    }
  }

  return _arr;
}
// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/unsupportedIterableToArray.js
var unsupportedIterableToArray = __webpack_require__(43);

// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/nonIterableRest.js
function _nonIterableRest() {
  throw new TypeError("Invalid attempt to destructure non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
}
// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/slicedToArray.js




function _slicedToArray(arr, i) {
  return _arrayWithHoles(arr) || _iterableToArrayLimit(arr, i) || Object(unsupportedIterableToArray["a" /* default */])(arr, i) || _nonIterableRest();
}

/***/ }),
/* 18 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireWildcard = __webpack_require__(7);

var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var _slicedToArray2 = _interopRequireDefault(__webpack_require__(24));

var _defineProperty2 = _interopRequireDefault(__webpack_require__(13));

var _objectWithoutProperties2 = _interopRequireDefault(__webpack_require__(68));

var React = _interopRequireWildcard(__webpack_require__(0));

var _classnames = _interopRequireDefault(__webpack_require__(2));

var _IconBase = _interopRequireDefault(__webpack_require__(69));

var _twoTonePrimaryColor = __webpack_require__(115);

var _utils = __webpack_require__(49); // Initial setting
// should move it to antd main repo?


(0, _twoTonePrimaryColor.setTwoToneColor)('#1890ff');
var Icon = React.forwardRef(function (props, ref) {
  var className = props.className,
      icon = props.icon,
      spin = props.spin,
      rotate = props.rotate,
      tabIndex = props.tabIndex,
      onClick = props.onClick,
      twoToneColor = props.twoToneColor,
      restProps = (0, _objectWithoutProperties2.default)(props, ["className", "icon", "spin", "rotate", "tabIndex", "onClick", "twoToneColor"]);
  var classString = (0, _classnames.default)('anticon', (0, _defineProperty2.default)({}, "anticon-".concat(icon.name), Boolean(icon.name)), className);
  var svgClassString = (0, _classnames.default)({
    'anticon-spin': !!spin || icon.name === 'loading'
  });
  var iconTabIndex = tabIndex;

  if (iconTabIndex === undefined && onClick) {
    iconTabIndex = -1;
  }

  var svgStyle = rotate ? {
    msTransform: "rotate(".concat(rotate, "deg)"),
    transform: "rotate(".concat(rotate, "deg)")
  } : undefined;

  var _normalizeTwoToneColo = (0, _utils.normalizeTwoToneColors)(twoToneColor),
      _normalizeTwoToneColo2 = (0, _slicedToArray2.default)(_normalizeTwoToneColo, 2),
      primaryColor = _normalizeTwoToneColo2[0],
      secondaryColor = _normalizeTwoToneColo2[1];

  return React.createElement("span", Object.assign({
    role: "img",
    "aria-label": icon.name
  }, restProps, {
    ref: ref,
    tabIndex: iconTabIndex,
    onClick: onClick,
    className: classString
  }), React.createElement(_IconBase.default, {
    className: svgClassString,
    icon: icon,
    primaryColor: primaryColor,
    secondaryColor: secondaryColor,
    style: svgStyle
  }));
});
Icon.displayName = 'AntdIcon';
Icon.getTwoToneColor = _twoTonePrimaryColor.getTwoToneColor;
Icon.setTwoToneColor = _twoTonePrimaryColor.setTwoToneColor;
var _default = Icon;
exports.default = _default;

/***/ }),
/* 19 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var assert = __webpack_require__(31);

var inherits = __webpack_require__(154);

exports.inherits = inherits;

function isSurrogatePair(msg, i) {
  if ((msg.charCodeAt(i) & 0xFC00) !== 0xD800) {
    return false;
  }

  if (i < 0 || i + 1 >= msg.length) {
    return false;
  }

  return (msg.charCodeAt(i + 1) & 0xFC00) === 0xDC00;
}

function toArray(msg, enc) {
  if (Array.isArray(msg)) return msg.slice();
  if (!msg) return [];
  var res = [];

  if (typeof msg === 'string') {
    if (!enc) {
      // Inspired by stringToUtf8ByteArray() in closure-library by Google
      // https://github.com/google/closure-library/blob/8598d87242af59aac233270742c8984e2b2bdbe0/closure/goog/crypt/crypt.js#L117-L143
      // Apache License 2.0
      // https://github.com/google/closure-library/blob/master/LICENSE
      var p = 0;

      for (var i = 0; i < msg.length; i++) {
        var c = msg.charCodeAt(i);

        if (c < 128) {
          res[p++] = c;
        } else if (c < 2048) {
          res[p++] = c >> 6 | 192;
          res[p++] = c & 63 | 128;
        } else if (isSurrogatePair(msg, i)) {
          c = 0x10000 + ((c & 0x03FF) << 10) + (msg.charCodeAt(++i) & 0x03FF);
          res[p++] = c >> 18 | 240;
          res[p++] = c >> 12 & 63 | 128;
          res[p++] = c >> 6 & 63 | 128;
          res[p++] = c & 63 | 128;
        } else {
          res[p++] = c >> 12 | 224;
          res[p++] = c >> 6 & 63 | 128;
          res[p++] = c & 63 | 128;
        }
      }
    } else if (enc === 'hex') {
      msg = msg.replace(/[^a-z0-9]+/ig, '');
      if (msg.length % 2 !== 0) msg = '0' + msg;

      for (i = 0; i < msg.length; i += 2) {
        res.push(parseInt(msg[i] + msg[i + 1], 16));
      }
    }
  } else {
    for (i = 0; i < msg.length; i++) {
      res[i] = msg[i] | 0;
    }
  }

  return res;
}

exports.toArray = toArray;

function toHex(msg) {
  var res = '';

  for (var i = 0; i < msg.length; i++) {
    res += zero2(msg[i].toString(16));
  }

  return res;
}

exports.toHex = toHex;

function htonl(w) {
  var res = w >>> 24 | w >>> 8 & 0xff00 | w << 8 & 0xff0000 | (w & 0xff) << 24;
  return res >>> 0;
}

exports.htonl = htonl;

function toHex32(msg, endian) {
  var res = '';

  for (var i = 0; i < msg.length; i++) {
    var w = msg[i];
    if (endian === 'little') w = htonl(w);
    res += zero8(w.toString(16));
  }

  return res;
}

exports.toHex32 = toHex32;

function zero2(word) {
  if (word.length === 1) return '0' + word;else return word;
}

exports.zero2 = zero2;

function zero8(word) {
  if (word.length === 7) return '0' + word;else if (word.length === 6) return '00' + word;else if (word.length === 5) return '000' + word;else if (word.length === 4) return '0000' + word;else if (word.length === 3) return '00000' + word;else if (word.length === 2) return '000000' + word;else if (word.length === 1) return '0000000' + word;else return word;
}

exports.zero8 = zero8;

function join32(msg, start, end, endian) {
  var len = end - start;
  assert(len % 4 === 0);
  var res = new Array(len / 4);

  for (var i = 0, k = start; i < res.length; i++, k += 4) {
    var w;
    if (endian === 'big') w = msg[k] << 24 | msg[k + 1] << 16 | msg[k + 2] << 8 | msg[k + 3];else w = msg[k + 3] << 24 | msg[k + 2] << 16 | msg[k + 1] << 8 | msg[k];
    res[i] = w >>> 0;
  }

  return res;
}

exports.join32 = join32;

function split32(msg, endian) {
  var res = new Array(msg.length * 4);

  for (var i = 0, k = 0; i < msg.length; i++, k += 4) {
    var m = msg[i];

    if (endian === 'big') {
      res[k] = m >>> 24;
      res[k + 1] = m >>> 16 & 0xff;
      res[k + 2] = m >>> 8 & 0xff;
      res[k + 3] = m & 0xff;
    } else {
      res[k + 3] = m >>> 24;
      res[k + 2] = m >>> 16 & 0xff;
      res[k + 1] = m >>> 8 & 0xff;
      res[k] = m & 0xff;
    }
  }

  return res;
}

exports.split32 = split32;

function rotr32(w, b) {
  return w >>> b | w << 32 - b;
}

exports.rotr32 = rotr32;

function rotl32(w, b) {
  return w << b | w >>> 32 - b;
}

exports.rotl32 = rotl32;

function sum32(a, b) {
  return a + b >>> 0;
}

exports.sum32 = sum32;

function sum32_3(a, b, c) {
  return a + b + c >>> 0;
}

exports.sum32_3 = sum32_3;

function sum32_4(a, b, c, d) {
  return a + b + c + d >>> 0;
}

exports.sum32_4 = sum32_4;

function sum32_5(a, b, c, d, e) {
  return a + b + c + d + e >>> 0;
}

exports.sum32_5 = sum32_5;

function sum64(buf, pos, ah, al) {
  var bh = buf[pos];
  var bl = buf[pos + 1];
  var lo = al + bl >>> 0;
  var hi = (lo < al ? 1 : 0) + ah + bh;
  buf[pos] = hi >>> 0;
  buf[pos + 1] = lo;
}

exports.sum64 = sum64;

function sum64_hi(ah, al, bh, bl) {
  var lo = al + bl >>> 0;
  var hi = (lo < al ? 1 : 0) + ah + bh;
  return hi >>> 0;
}

exports.sum64_hi = sum64_hi;

function sum64_lo(ah, al, bh, bl) {
  var lo = al + bl;
  return lo >>> 0;
}

exports.sum64_lo = sum64_lo;

function sum64_4_hi(ah, al, bh, bl, ch, cl, dh, dl) {
  var carry = 0;
  var lo = al;
  lo = lo + bl >>> 0;
  carry += lo < al ? 1 : 0;
  lo = lo + cl >>> 0;
  carry += lo < cl ? 1 : 0;
  lo = lo + dl >>> 0;
  carry += lo < dl ? 1 : 0;
  var hi = ah + bh + ch + dh + carry;
  return hi >>> 0;
}

exports.sum64_4_hi = sum64_4_hi;

function sum64_4_lo(ah, al, bh, bl, ch, cl, dh, dl) {
  var lo = al + bl + cl + dl;
  return lo >>> 0;
}

exports.sum64_4_lo = sum64_4_lo;

function sum64_5_hi(ah, al, bh, bl, ch, cl, dh, dl, eh, el) {
  var carry = 0;
  var lo = al;
  lo = lo + bl >>> 0;
  carry += lo < al ? 1 : 0;
  lo = lo + cl >>> 0;
  carry += lo < cl ? 1 : 0;
  lo = lo + dl >>> 0;
  carry += lo < dl ? 1 : 0;
  lo = lo + el >>> 0;
  carry += lo < el ? 1 : 0;
  var hi = ah + bh + ch + dh + eh + carry;
  return hi >>> 0;
}

exports.sum64_5_hi = sum64_5_hi;

function sum64_5_lo(ah, al, bh, bl, ch, cl, dh, dl, eh, el) {
  var lo = al + bl + cl + dl + el;
  return lo >>> 0;
}

exports.sum64_5_lo = sum64_5_lo;

function rotr64_hi(ah, al, num) {
  var r = al << 32 - num | ah >>> num;
  return r >>> 0;
}

exports.rotr64_hi = rotr64_hi;

function rotr64_lo(ah, al, num) {
  var r = ah << 32 - num | al >>> num;
  return r >>> 0;
}

exports.rotr64_lo = rotr64_lo;

function shr64_hi(ah, al, num) {
  return ah >>> num;
}

exports.shr64_hi = shr64_hi;

function shr64_lo(ah, al, num) {
  var r = ah << 32 - num | al >>> num;
  return r >>> 0;
}

exports.shr64_lo = shr64_lo;

/***/ }),
/* 20 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireWildcard = __webpack_require__(7);

var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
Object.defineProperty(exports, "ConfigConsumer", {
  enumerable: true,
  get: function get() {
    return _context.ConfigConsumer;
  }
});
Object.defineProperty(exports, "ConfigContext", {
  enumerable: true,
  get: function get() {
    return _context.ConfigContext;
  }
});
exports["default"] = exports.configConsumerProps = void 0;

var _extends2 = _interopRequireDefault(__webpack_require__(3));

var React = _interopRequireWildcard(__webpack_require__(0));

var _rcFieldForm = __webpack_require__(174);

var _localeProvider = _interopRequireWildcard(__webpack_require__(90));

var _LocaleReceiver = _interopRequireDefault(__webpack_require__(64));

var _context = __webpack_require__(100);

var _SizeContext = __webpack_require__(105);

var _message = _interopRequireDefault(__webpack_require__(65));

var _notification = _interopRequireDefault(__webpack_require__(134)); // TODO: remove this lint
// SFC has specified a displayName, but not worked.

/* eslint-disable react/display-name */


var configConsumerProps = ['getTargetContainer', 'getPopupContainer', 'rootPrefixCls', 'getPrefixCls', 'renderEmpty', 'csp', 'autoInsertSpaceInButton', 'locale', 'pageHeader'];
exports.configConsumerProps = configConsumerProps;

var ConfigProvider = function ConfigProvider(props) {
  React.useEffect(function () {
    if (props.direction) {
      _message["default"].config({
        rtl: props.direction === 'rtl'
      });

      _notification["default"].config({
        rtl: props.direction === 'rtl'
      });
    }
  }, [props.direction]);

  var getPrefixClsWrapper = function getPrefixClsWrapper(context) {
    return function (suffixCls, customizePrefixCls) {
      var prefixCls = props.prefixCls;
      if (customizePrefixCls) return customizePrefixCls;
      var mergedPrefixCls = prefixCls || context.getPrefixCls('');
      return suffixCls ? "".concat(mergedPrefixCls, "-").concat(suffixCls) : mergedPrefixCls;
    };
  };

  var renderProvider = function renderProvider(context, legacyLocale) {
    var children = props.children,
        getTargetContainer = props.getTargetContainer,
        getPopupContainer = props.getPopupContainer,
        renderEmpty = props.renderEmpty,
        csp = props.csp,
        autoInsertSpaceInButton = props.autoInsertSpaceInButton,
        form = props.form,
        input = props.input,
        locale = props.locale,
        pageHeader = props.pageHeader,
        componentSize = props.componentSize,
        direction = props.direction,
        space = props.space,
        virtual = props.virtual,
        dropdownMatchSelectWidth = props.dropdownMatchSelectWidth;
    var config = (0, _extends2["default"])((0, _extends2["default"])({}, context), {
      getPrefixCls: getPrefixClsWrapper(context),
      csp: csp,
      autoInsertSpaceInButton: autoInsertSpaceInButton,
      locale: locale || legacyLocale,
      direction: direction,
      space: space,
      virtual: virtual,
      dropdownMatchSelectWidth: dropdownMatchSelectWidth
    });

    if (getTargetContainer) {
      config.getTargetContainer = getTargetContainer;
    }

    if (getPopupContainer) {
      config.getPopupContainer = getPopupContainer;
    }

    if (renderEmpty) {
      config.renderEmpty = renderEmpty;
    }

    if (pageHeader) {
      config.pageHeader = pageHeader;
    }

    if (input) {
      config.input = input;
    }

    var childNode = children; // Additional Form provider

    var validateMessages = {};

    if (locale && locale.Form && locale.Form.defaultValidateMessages) {
      validateMessages = locale.Form.defaultValidateMessages;
    }

    if (form && form.validateMessages) {
      validateMessages = (0, _extends2["default"])((0, _extends2["default"])({}, validateMessages), form.validateMessages);
    }

    if (Object.keys(validateMessages).length > 0) {
      childNode = /*#__PURE__*/React.createElement(_rcFieldForm.FormProvider, {
        validateMessages: validateMessages
      }, children);
    }

    return /*#__PURE__*/React.createElement(_SizeContext.SizeContextProvider, {
      size: componentSize
    }, /*#__PURE__*/React.createElement(_context.ConfigContext.Provider, {
      value: config
    }, /*#__PURE__*/React.createElement(_localeProvider["default"], {
      locale: locale || legacyLocale,
      _ANT_MARK__: _localeProvider.ANT_MARK
    }, childNode)));
  };

  return /*#__PURE__*/React.createElement(_LocaleReceiver["default"], null, function (_, __, legacyLocale) {
    return /*#__PURE__*/React.createElement(_context.ConfigConsumer, null, function (context) {
      return renderProvider(context, legacyLocale);
    });
  });
};

var _default = ConfigProvider;
exports["default"] = _default;

/***/ }),
/* 21 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _possibleConstructorReturn; });
/* harmony import */ var _helpers_esm_typeof__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(10);
/* harmony import */ var _assertThisInitialized__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(25);


function _possibleConstructorReturn(self, call) {
  if (call && (Object(_helpers_esm_typeof__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])(call) === "object" || typeof call === "function")) {
    return call;
  }

  return Object(_assertThisInitialized__WEBPACK_IMPORTED_MODULE_1__[/* default */ "a"])(self);
}

/***/ }),
/* 22 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


function _typeof(obj) {
  "@babel/helpers - typeof";

  if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") {
    _typeof = function _typeof(obj) {
      return typeof obj;
    };
  } else {
    _typeof = function _typeof(obj) {
      return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj;
    };
  }

  return _typeof(obj);
}

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = useControlledState;

var React = _interopRequireWildcard(__webpack_require__(0));

function _getRequireWildcardCache() {
  if (typeof WeakMap !== "function") return null;
  var cache = new WeakMap();

  _getRequireWildcardCache = function _getRequireWildcardCache() {
    return cache;
  };

  return cache;
}

function _interopRequireWildcard(obj) {
  if (obj && obj.__esModule) {
    return obj;
  }

  if (obj === null || _typeof(obj) !== "object" && typeof obj !== "function") {
    return {
      default: obj
    };
  }

  var cache = _getRequireWildcardCache();

  if (cache && cache.has(obj)) {
    return cache.get(obj);
  }

  var newObj = {};
  var hasPropertyDescriptor = Object.defineProperty && Object.getOwnPropertyDescriptor;

  for (var key in obj) {
    if (Object.prototype.hasOwnProperty.call(obj, key)) {
      var desc = hasPropertyDescriptor ? Object.getOwnPropertyDescriptor(obj, key) : null;

      if (desc && (desc.get || desc.set)) {
        Object.defineProperty(newObj, key, desc);
      } else {
        newObj[key] = obj[key];
      }
    }
  }

  newObj.default = obj;

  if (cache) {
    cache.set(obj, newObj);
  }

  return newObj;
}

function _slicedToArray(arr, i) {
  return _arrayWithHoles(arr) || _iterableToArrayLimit(arr, i) || _unsupportedIterableToArray(arr, i) || _nonIterableRest();
}

function _nonIterableRest() {
  throw new TypeError("Invalid attempt to destructure non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
}

function _unsupportedIterableToArray(o, minLen) {
  if (!o) return;
  if (typeof o === "string") return _arrayLikeToArray(o, minLen);
  var n = Object.prototype.toString.call(o).slice(8, -1);
  if (n === "Object" && o.constructor) n = o.constructor.name;
  if (n === "Map" || n === "Set") return Array.from(o);
  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen);
}

function _arrayLikeToArray(arr, len) {
  if (len == null || len > arr.length) len = arr.length;

  for (var i = 0, arr2 = new Array(len); i < len; i++) {
    arr2[i] = arr[i];
  }

  return arr2;
}

function _iterableToArrayLimit(arr, i) {
  if (typeof Symbol === "undefined" || !(Symbol.iterator in Object(arr))) return;
  var _arr = [];
  var _n = true;
  var _d = false;
  var _e = undefined;

  try {
    for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) {
      _arr.push(_s.value);

      if (i && _arr.length === i) break;
    }
  } catch (err) {
    _d = true;
    _e = err;
  } finally {
    try {
      if (!_n && _i["return"] != null) _i["return"]();
    } finally {
      if (_d) throw _e;
    }
  }

  return _arr;
}

function _arrayWithHoles(arr) {
  if (Array.isArray(arr)) return arr;
}

function useControlledState(defaultStateValue, option) {
  var _ref = option || {},
      defaultValue = _ref.defaultValue,
      value = _ref.value,
      onChange = _ref.onChange,
      postState = _ref.postState;

  var _React$useState = React.useState(function () {
    if (value !== undefined) {
      return value;
    }

    if (defaultValue !== undefined) {
      return typeof defaultValue === 'function' ? defaultValue() : defaultValue;
    }

    return typeof defaultStateValue === 'function' ? defaultStateValue() : defaultStateValue;
  }),
      _React$useState2 = _slicedToArray(_React$useState, 2),
      innerValue = _React$useState2[0],
      setInnerValue = _React$useState2[1];

  var mergedValue = value !== undefined ? value : innerValue;

  if (postState) {
    mergedValue = postState(mergedValue);
  }

  function triggerChange(newValue) {
    setInnerValue(newValue);

    if (mergedValue !== newValue && onChange) {
      onChange(newValue, mergedValue);
    }
  } // Effect of reset value to `undefined`


  var firstRenderRef = React.useRef(true);
  React.useEffect(function () {
    if (firstRenderRef.current) {
      firstRenderRef.current = false;
      return;
    }

    if (value === undefined) {
      setInnerValue(value);
    }
  }, [value]);
  return [mergedValue, triggerChange];
}

/***/ }),
/* 23 */
/***/ (function(module, exports, __webpack_require__) {

module.exports = __webpack_require__(89);

/***/ }),
/* 24 */
/***/ (function(module, exports, __webpack_require__) {

var arrayWithHoles = __webpack_require__(109);

var iterableToArrayLimit = __webpack_require__(110);

var unsupportedIterableToArray = __webpack_require__(66);

var nonIterableRest = __webpack_require__(111);

function _slicedToArray(arr, i) {
  return arrayWithHoles(arr) || iterableToArrayLimit(arr, i) || unsupportedIterableToArray(arr, i) || nonIterableRest();
}

module.exports = _slicedToArray;

/***/ }),
/* 25 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _assertThisInitialized; });
function _assertThisInitialized(self) {
  if (self === void 0) {
    throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
  }

  return self;
}

/***/ }),
/* 26 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(module) {var __WEBPACK_AMD_DEFINE_FACTORY__, __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_RESULT__;function _typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }

!function (root, factory) {
  "object" == ( false ? undefined : _typeof(exports)) && "object" == ( false ? undefined : _typeof(module)) ? module.exports = factory(__webpack_require__(0)) :  true ? !(__WEBPACK_AMD_DEFINE_ARRAY__ = [__webpack_require__(0)], __WEBPACK_AMD_DEFINE_FACTORY__ = (factory),
				__WEBPACK_AMD_DEFINE_RESULT__ = (typeof __WEBPACK_AMD_DEFINE_FACTORY__ === 'function' ?
				(__WEBPACK_AMD_DEFINE_FACTORY__.apply(exports, __WEBPACK_AMD_DEFINE_ARRAY__)) : __WEBPACK_AMD_DEFINE_FACTORY__),
				__WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__)) : undefined;
}("undefined" != typeof self ? self : this, function (__WEBPACK_EXTERNAL_MODULE_1__) {
  return function (modules) {
    function __webpack_require__(moduleId) {
      if (installedModules[moduleId]) return installedModules[moduleId].exports;
      var module = installedModules[moduleId] = {
        i: moduleId,
        l: !1,
        exports: {}
      };
      return modules[moduleId].call(module.exports, module, module.exports, __webpack_require__), module.l = !0, module.exports;
    }

    var installedModules = {};
    return __webpack_require__.m = modules, __webpack_require__.c = installedModules, __webpack_require__.d = function (exports, name, getter) {
      __webpack_require__.o(exports, name) || Object.defineProperty(exports, name, {
        configurable: !1,
        enumerable: !0,
        get: getter
      });
    }, __webpack_require__.n = function (module) {
      var getter = module && module.__esModule ? function () {
        return module.default;
      } : function () {
        return module;
      };
      return __webpack_require__.d(getter, "a", getter), getter;
    }, __webpack_require__.o = function (object, property) {
      return Object.prototype.hasOwnProperty.call(object, property);
    }, __webpack_require__.p = "", __webpack_require__(__webpack_require__.s = 7);
  }([function (module, __webpack_exports__, __webpack_require__) {
    "use strict";

    function _slicedToArray(arr, i) {
      return _arrayWithHoles(arr) || _iterableToArrayLimit(arr, i) || _unsupportedIterableToArray(arr, i) || _nonIterableRest();
    }

    function _nonIterableRest() {
      throw new TypeError("Invalid attempt to destructure non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
    }

    function _unsupportedIterableToArray(o, minLen) {
      if (o) {
        if ("string" == typeof o) return _arrayLikeToArray(o, minLen);
        var n = Object.prototype.toString.call(o).slice(8, -1);
        return "Object" === n && o.constructor && (n = o.constructor.name), "Map" === n || "Set" === n ? Array.from(o) : "Arguments" === n || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n) ? _arrayLikeToArray(o, minLen) : void 0;
      }
    }

    function _arrayLikeToArray(arr, len) {
      (null == len || len > arr.length) && (len = arr.length);

      for (var i = 0, arr2 = new Array(len); i < len; i++) {
        arr2[i] = arr[i];
      }

      return arr2;
    }

    function _iterableToArrayLimit(arr, i) {
      if ("undefined" != typeof Symbol && Symbol.iterator in Object(arr)) {
        var _arr = [],
            _n = !0,
            _d = !1,
            _e = void 0;

        try {
          for (var _s, _i = arr[Symbol.iterator](); !(_n = (_s = _i.next()).done) && (_arr.push(_s.value), !i || _arr.length !== i); _n = !0) {
            ;
          }
        } catch (err) {
          _d = !0, _e = err;
        } finally {
          try {
            _n || null == _i.return || _i.return();
          } finally {
            if (_d) throw _e;
          }
        }

        return _arr;
      }
    }

    function _arrayWithHoles(arr) {
      if (Array.isArray(arr)) return arr;
    }

    var __WEBPACK_IMPORTED_MODULE_0_react__ = __webpack_require__(1),
        __WEBPACK_IMPORTED_MODULE_0_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react__),
        __WEBPACK_IMPORTED_MODULE_1_matchmediaquery__ = __webpack_require__(8),
        __WEBPACK_IMPORTED_MODULE_1_matchmediaquery___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_1_matchmediaquery__),
        __WEBPACK_IMPORTED_MODULE_2_hyphenate_style_name__ = __webpack_require__(2),
        __WEBPACK_IMPORTED_MODULE_3_shallow_equal_objects__ = __webpack_require__(10),
        __WEBPACK_IMPORTED_MODULE_3_shallow_equal_objects___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_3_shallow_equal_objects__),
        __WEBPACK_IMPORTED_MODULE_4__toQuery__ = __webpack_require__(3),
        __WEBPACK_IMPORTED_MODULE_5__Context__ = __webpack_require__(6),
        makeQuery = function makeQuery(settings) {
      return settings.query || Object(__WEBPACK_IMPORTED_MODULE_4__toQuery__.a)(settings);
    },
        hyphenateKeys = function hyphenateKeys(obj) {
      if (!obj) return null;
      var keys = Object.keys(obj);
      return 0 === keys.length ? null : keys.reduce(function (result, key) {
        return result[Object(__WEBPACK_IMPORTED_MODULE_2_hyphenate_style_name__.a)(key)] = obj[key], result;
      }, {});
    },
        useIsUpdate = function useIsUpdate() {
      var ref = __WEBPACK_IMPORTED_MODULE_0_react___default.a.useRef(!1);

      return __WEBPACK_IMPORTED_MODULE_0_react___default.a.useEffect(function () {
        ref.current = !0;
      }, []), ref.current;
    },
        useDevice = function useDevice(deviceFromProps) {
      var deviceFromContext = __WEBPACK_IMPORTED_MODULE_0_react___default.a.useContext(__WEBPACK_IMPORTED_MODULE_5__Context__.a),
          getDevice = function getDevice() {
        return hyphenateKeys(deviceFromProps) || hyphenateKeys(deviceFromContext);
      },
          _React$useState = __WEBPACK_IMPORTED_MODULE_0_react___default.a.useState(getDevice),
          _React$useState2 = _slicedToArray(_React$useState, 2),
          device = _React$useState2[0],
          setDevice = _React$useState2[1];

      return __WEBPACK_IMPORTED_MODULE_0_react___default.a.useEffect(function () {
        var newDevice = getDevice();
        __WEBPACK_IMPORTED_MODULE_3_shallow_equal_objects___default()(device, newDevice) || setDevice(newDevice);
      }, [deviceFromProps, deviceFromContext]), device;
    },
        useQuery = function useQuery(settings) {
      var getQuery = function getQuery() {
        return makeQuery(settings);
      },
          _React$useState3 = __WEBPACK_IMPORTED_MODULE_0_react___default.a.useState(getQuery),
          _React$useState4 = _slicedToArray(_React$useState3, 2),
          query = _React$useState4[0],
          setQuery = _React$useState4[1];

      return __WEBPACK_IMPORTED_MODULE_0_react___default.a.useEffect(function () {
        var newQuery = getQuery();
        query !== newQuery && setQuery(newQuery);
      }, [settings]), query;
    },
        useMatchMedia = function useMatchMedia(query, device) {
      var getMatchMedia = function getMatchMedia() {
        return __WEBPACK_IMPORTED_MODULE_1_matchmediaquery___default()(query, device || {}, !!device);
      },
          _React$useState5 = __WEBPACK_IMPORTED_MODULE_0_react___default.a.useState(getMatchMedia),
          _React$useState6 = _slicedToArray(_React$useState5, 2),
          mq = _React$useState6[0],
          setMq = _React$useState6[1],
          isUpdate = useIsUpdate();

      return __WEBPACK_IMPORTED_MODULE_0_react___default.a.useEffect(function () {
        return isUpdate && setMq(getMatchMedia()), function () {
          mq.dispose();
        };
      }, [query, device]), mq;
    },
        useMatches = function useMatches(mediaQuery) {
      var _React$useState7 = __WEBPACK_IMPORTED_MODULE_0_react___default.a.useState(mediaQuery.matches),
          _React$useState8 = _slicedToArray(_React$useState7, 2),
          matches = _React$useState8[0],
          setMatches = _React$useState8[1];

      return __WEBPACK_IMPORTED_MODULE_0_react___default.a.useEffect(function () {
        var updateMatches = function updateMatches() {
          setMatches(mediaQuery.matches);
        };

        return mediaQuery.addListener(updateMatches), updateMatches(), function () {
          mediaQuery.removeListener(updateMatches);
        };
      }, [mediaQuery]), matches;
    },
        useMediaQuery = function useMediaQuery(settings, device, onChange) {
      var deviceSettings = useDevice(device),
          query = useQuery(settings);
      if (!query) throw new Error("Invalid or missing MediaQuery!");
      var mq = useMatchMedia(query, deviceSettings),
          matches = useMatches(mq),
          isUpdate = useIsUpdate();
      return __WEBPACK_IMPORTED_MODULE_0_react___default.a.useEffect(function () {
        isUpdate && onChange && onChange(matches);
      }, [matches]), matches;
    };

    __webpack_exports__.a = useMediaQuery;
  }, function (module, exports) {
    module.exports = __WEBPACK_EXTERNAL_MODULE_1__;
  }, function (module, __webpack_exports__, __webpack_require__) {
    "use strict";

    function toHyphenLower(match) {
      return "-" + match.toLowerCase();
    }

    function hyphenateStyleName(name) {
      if (cache.hasOwnProperty(name)) return cache[name];
      var hName = name.replace(uppercasePattern, toHyphenLower);
      return cache[name] = msPattern.test(hName) ? "-" + hName : hName;
    }

    var uppercasePattern = /[A-Z]/g,
        msPattern = /^ms-/,
        cache = {};
    __webpack_exports__.a = hyphenateStyleName;
  }, function (module, __webpack_exports__, __webpack_require__) {
    "use strict";

    var __WEBPACK_IMPORTED_MODULE_0_hyphenate_style_name__ = __webpack_require__(2),
        __WEBPACK_IMPORTED_MODULE_1__mediaQuery__ = __webpack_require__(11),
        negate = function negate(cond) {
      return "not ".concat(cond);
    },
        keyVal = function keyVal(k, v) {
      var realKey = Object(__WEBPACK_IMPORTED_MODULE_0_hyphenate_style_name__.a)(k);
      return "number" == typeof v && (v = "".concat(v, "px")), !0 === v ? realKey : !1 === v ? negate(realKey) : "(".concat(realKey, ": ").concat(v, ")");
    },
        join = function join(conds) {
      return conds.join(" and ");
    },
        toQuery = function toQuery(obj) {
      var rules = [];
      return Object.keys(__WEBPACK_IMPORTED_MODULE_1__mediaQuery__.a.all).forEach(function (k) {
        var v = obj[k];
        null != v && rules.push(keyVal(k, v));
      }), join(rules);
    };

    __webpack_exports__.a = toQuery;
  }, function (module, exports, __webpack_require__) {
    "use strict";

    module.exports = __webpack_require__(13);
  }, function (module, exports, __webpack_require__) {
    "use strict";

    module.exports = "SECRET_DO_NOT_PASS_THIS_OR_YOU_WILL_BE_FIRED";
  }, function (module, __webpack_exports__, __webpack_require__) {
    "use strict";

    var __WEBPACK_IMPORTED_MODULE_0_react__ = __webpack_require__(1),
        __WEBPACK_IMPORTED_MODULE_0_react___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_react__),
        Context = __WEBPACK_IMPORTED_MODULE_0_react___default.a.createContext();

    __webpack_exports__.a = Context;
  }, function (module, __webpack_exports__, __webpack_require__) {
    "use strict";

    Object.defineProperty(__webpack_exports__, "__esModule", {
      value: !0
    });

    var __WEBPACK_IMPORTED_MODULE_0__useMediaQuery__ = __webpack_require__(0),
        __WEBPACK_IMPORTED_MODULE_1__Component__ = __webpack_require__(17),
        __WEBPACK_IMPORTED_MODULE_2__toQuery__ = __webpack_require__(3),
        __WEBPACK_IMPORTED_MODULE_3__Context__ = __webpack_require__(6);

    __webpack_require__.d(__webpack_exports__, "default", function () {
      return __WEBPACK_IMPORTED_MODULE_1__Component__.a;
    }), __webpack_require__.d(__webpack_exports__, "useMediaQuery", function () {
      return __WEBPACK_IMPORTED_MODULE_0__useMediaQuery__.a;
    }), __webpack_require__.d(__webpack_exports__, "toQuery", function () {
      return __WEBPACK_IMPORTED_MODULE_2__toQuery__.a;
    }), __webpack_require__.d(__webpack_exports__, "Context", function () {
      return __WEBPACK_IMPORTED_MODULE_3__Context__.a;
    });
  }, function (module, exports, __webpack_require__) {
    "use strict";

    function Mql(query, values, forceStatic) {
      function addListener(listener) {
        mql && mql.addListener(listener);
      }

      function removeListener(listener) {
        mql && mql.removeListener(listener);
      }

      function update(evt) {
        self.matches = evt.matches, self.media = evt.media;
      }

      function dispose() {
        mql && mql.removeListener(update);
      }

      var self = this;

      if (dynamicMatch && !forceStatic) {
        var mql = dynamicMatch.call(window, query);
        this.matches = mql.matches, this.media = mql.media, mql.addListener(update);
      } else this.matches = staticMatch(query, values), this.media = query;

      this.addListener = addListener, this.removeListener = removeListener, this.dispose = dispose;
    }

    function matchMedia(query, values, forceStatic) {
      return new Mql(query, values, forceStatic);
    }

    var staticMatch = __webpack_require__(9).match,
        dynamicMatch = "undefined" != typeof window ? window.matchMedia : null;

    module.exports = matchMedia;
  }, function (module, exports, __webpack_require__) {
    "use strict";

    function matchQuery(mediaQuery, values) {
      return parseQuery(mediaQuery).some(function (query) {
        var inverse = query.inverse,
            typeMatch = "all" === query.type || values.type === query.type;
        if (typeMatch && inverse || !typeMatch && !inverse) return !1;
        var expressionsMatch = query.expressions.every(function (expression) {
          var feature = expression.feature,
              modifier = expression.modifier,
              expValue = expression.value,
              value = values[feature];
          if (!value) return !1;

          switch (feature) {
            case "orientation":
            case "scan":
              return value.toLowerCase() === expValue.toLowerCase();

            case "width":
            case "height":
            case "device-width":
            case "device-height":
              expValue = toPx(expValue), value = toPx(value);
              break;

            case "resolution":
              expValue = toDpi(expValue), value = toDpi(value);
              break;

            case "aspect-ratio":
            case "device-aspect-ratio":
            case "device-pixel-ratio":
              expValue = toDecimal(expValue), value = toDecimal(value);
              break;

            case "grid":
            case "color":
            case "color-index":
            case "monochrome":
              expValue = parseInt(expValue, 10) || 1, value = parseInt(value, 10) || 0;
          }

          switch (modifier) {
            case "min":
              return value >= expValue;

            case "max":
              return value <= expValue;

            default:
              return value === expValue;
          }
        });
        return expressionsMatch && !inverse || !expressionsMatch && inverse;
      });
    }

    function parseQuery(mediaQuery) {
      return mediaQuery.split(",").map(function (query) {
        query = query.trim();
        var captures = query.match(RE_MEDIA_QUERY),
            modifier = captures[1],
            type = captures[2],
            expressions = captures[3] || "",
            parsed = {};
        return parsed.inverse = !!modifier && "not" === modifier.toLowerCase(), parsed.type = type ? type.toLowerCase() : "all", expressions = expressions.match(/\([^\)]+\)/g) || [], parsed.expressions = expressions.map(function (expression) {
          var captures = expression.match(RE_MQ_EXPRESSION),
              feature = captures[1].toLowerCase().match(RE_MQ_FEATURE);
          return {
            modifier: feature[1],
            feature: feature[2],
            value: captures[2]
          };
        }), parsed;
      });
    }

    function toDecimal(ratio) {
      var numbers,
          decimal = Number(ratio);
      return decimal || (numbers = ratio.match(/^(\d+)\s*\/\s*(\d+)$/), decimal = numbers[1] / numbers[2]), decimal;
    }

    function toDpi(resolution) {
      var value = parseFloat(resolution);

      switch (String(resolution).match(RE_RESOLUTION_UNIT)[1]) {
        case "dpcm":
          return value / 2.54;

        case "dppx":
          return 96 * value;

        default:
          return value;
      }
    }

    function toPx(length) {
      var value = parseFloat(length);

      switch (String(length).match(RE_LENGTH_UNIT)[1]) {
        case "em":
        case "rem":
          return 16 * value;

        case "cm":
          return 96 * value / 2.54;

        case "mm":
          return 96 * value / 2.54 / 10;

        case "in":
          return 96 * value;

        case "pt":
          return 72 * value;

        case "pc":
          return 72 * value / 12;

        default:
          return value;
      }
    }

    exports.match = matchQuery, exports.parse = parseQuery;
    var RE_MEDIA_QUERY = /(?:(only|not)?\s*([^\s\(\)]+)(?:\s*and)?\s*)?(.+)?/i,
        RE_MQ_EXPRESSION = /\(\s*([^\s\:\)]+)\s*(?:\:\s*([^\s\)]+))?\s*\)/,
        RE_MQ_FEATURE = /^(?:(min|max)-)?(.+)/,
        RE_LENGTH_UNIT = /(em|rem|px|cm|mm|in|pt|pc)?$/,
        RE_RESOLUTION_UNIT = /(dpi|dpcm|dppx)?$/;
  }, function (module, exports, __webpack_require__) {
    "use strict";

    function shallowEqualObjects(objA, objB) {
      if (objA === objB) return !0;
      if (!objA || !objB) return !1;
      var aKeys = Object.keys(objA),
          bKeys = Object.keys(objB),
          len = aKeys.length;
      if (bKeys.length !== len) return !1;

      for (var i = 0; i < len; i++) {
        var key = aKeys[i];
        if (objA[key] !== objB[key] || !Object.prototype.hasOwnProperty.call(objB, key)) return !1;
      }

      return !0;
    }

    module.exports = shallowEqualObjects;
  }, function (module, __webpack_exports__, __webpack_require__) {
    "use strict";

    function ownKeys(object, enumerableOnly) {
      var keys = Object.keys(object);

      if (Object.getOwnPropertySymbols) {
        var symbols = Object.getOwnPropertySymbols(object);
        enumerableOnly && (symbols = symbols.filter(function (sym) {
          return Object.getOwnPropertyDescriptor(object, sym).enumerable;
        })), keys.push.apply(keys, symbols);
      }

      return keys;
    }

    function _objectSpread(target) {
      for (var i = 1; i < arguments.length; i++) {
        var source = null != arguments[i] ? arguments[i] : {};
        i % 2 ? ownKeys(Object(source), !0).forEach(function (key) {
          _defineProperty(target, key, source[key]);
        }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)) : ownKeys(Object(source)).forEach(function (key) {
          Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
        });
      }

      return target;
    }

    function _defineProperty(obj, key, value) {
      return key in obj ? Object.defineProperty(obj, key, {
        value: value,
        enumerable: !0,
        configurable: !0,
        writable: !0
      }) : obj[key] = value, obj;
    }

    var __WEBPACK_IMPORTED_MODULE_0_prop_types__ = __webpack_require__(12),
        __WEBPACK_IMPORTED_MODULE_0_prop_types___default = __webpack_require__.n(__WEBPACK_IMPORTED_MODULE_0_prop_types__),
        stringOrNumber = __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.oneOfType([__WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.string, __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.number]),
        matchers = {
      orientation: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.oneOf(["portrait", "landscape"]),
      scan: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.oneOf(["progressive", "interlace"]),
      aspectRatio: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.string,
      deviceAspectRatio: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.string,
      height: stringOrNumber,
      deviceHeight: stringOrNumber,
      width: stringOrNumber,
      deviceWidth: stringOrNumber,
      color: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.bool,
      colorIndex: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.bool,
      monochrome: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.bool,
      resolution: stringOrNumber
    },
        features = _objectSpread({
      minAspectRatio: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.string,
      maxAspectRatio: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.string,
      minDeviceAspectRatio: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.string,
      maxDeviceAspectRatio: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.string,
      minHeight: stringOrNumber,
      maxHeight: stringOrNumber,
      minDeviceHeight: stringOrNumber,
      maxDeviceHeight: stringOrNumber,
      minWidth: stringOrNumber,
      maxWidth: stringOrNumber,
      minDeviceWidth: stringOrNumber,
      maxDeviceWidth: stringOrNumber,
      minColor: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.number,
      maxColor: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.number,
      minColorIndex: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.number,
      maxColorIndex: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.number,
      minMonochrome: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.number,
      maxMonochrome: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.number,
      minResolution: stringOrNumber,
      maxResolution: stringOrNumber
    }, matchers),
        types = {
      all: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.bool,
      grid: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.bool,
      aural: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.bool,
      braille: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.bool,
      handheld: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.bool,
      print: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.bool,
      projection: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.bool,
      screen: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.bool,
      tty: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.bool,
      tv: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.bool,
      embossed: __WEBPACK_IMPORTED_MODULE_0_prop_types___default.a.bool
    },
        all = _objectSpread(_objectSpread({}, types), features);

    matchers.type = Object.keys(types), __webpack_exports__.a = {
      all: all,
      types: types,
      matchers: matchers,
      features: features
    };
  }, function (module, exports, __webpack_require__) {
    var ReactIs = __webpack_require__(4);

    module.exports = __webpack_require__(14)(ReactIs.isElement, !0);
  }, function (module, exports, __webpack_require__) {
    "use strict";

    !function () {
      function isValidElementType(type) {
        return "string" == typeof type || "function" == typeof type || type === REACT_FRAGMENT_TYPE || type === REACT_CONCURRENT_MODE_TYPE || type === REACT_PROFILER_TYPE || type === REACT_STRICT_MODE_TYPE || type === REACT_SUSPENSE_TYPE || type === REACT_SUSPENSE_LIST_TYPE || "object" == _typeof(type) && null !== type && (type.$$typeof === REACT_LAZY_TYPE || type.$$typeof === REACT_MEMO_TYPE || type.$$typeof === REACT_PROVIDER_TYPE || type.$$typeof === REACT_CONTEXT_TYPE || type.$$typeof === REACT_FORWARD_REF_TYPE || type.$$typeof === REACT_FUNDAMENTAL_TYPE || type.$$typeof === REACT_RESPONDER_TYPE || type.$$typeof === REACT_SCOPE_TYPE || type.$$typeof === REACT_BLOCK_TYPE);
      }

      function typeOf(object) {
        if ("object" == _typeof(object) && null !== object) {
          var $$typeof = object.$$typeof;

          switch ($$typeof) {
            case REACT_ELEMENT_TYPE:
              var type = object.type;

              switch (type) {
                case REACT_ASYNC_MODE_TYPE:
                case REACT_CONCURRENT_MODE_TYPE:
                case REACT_FRAGMENT_TYPE:
                case REACT_PROFILER_TYPE:
                case REACT_STRICT_MODE_TYPE:
                case REACT_SUSPENSE_TYPE:
                  return type;

                default:
                  var $$typeofType = type && type.$$typeof;

                  switch ($$typeofType) {
                    case REACT_CONTEXT_TYPE:
                    case REACT_FORWARD_REF_TYPE:
                    case REACT_LAZY_TYPE:
                    case REACT_MEMO_TYPE:
                    case REACT_PROVIDER_TYPE:
                      return $$typeofType;

                    default:
                      return $$typeof;
                  }

              }

            case REACT_PORTAL_TYPE:
              return $$typeof;
          }
        }
      }

      function isAsyncMode(object) {
        return hasWarnedAboutDeprecatedIsAsyncMode || (hasWarnedAboutDeprecatedIsAsyncMode = !0, console.warn("The ReactIs.isAsyncMode() alias has been deprecated, and will be removed in React 17+. Update your code to use ReactIs.isConcurrentMode() instead. It has the exact same API.")), isConcurrentMode(object) || typeOf(object) === REACT_ASYNC_MODE_TYPE;
      }

      function isConcurrentMode(object) {
        return typeOf(object) === REACT_CONCURRENT_MODE_TYPE;
      }

      function isContextConsumer(object) {
        return typeOf(object) === REACT_CONTEXT_TYPE;
      }

      function isContextProvider(object) {
        return typeOf(object) === REACT_PROVIDER_TYPE;
      }

      function isElement(object) {
        return "object" == _typeof(object) && null !== object && object.$$typeof === REACT_ELEMENT_TYPE;
      }

      function isForwardRef(object) {
        return typeOf(object) === REACT_FORWARD_REF_TYPE;
      }

      function isFragment(object) {
        return typeOf(object) === REACT_FRAGMENT_TYPE;
      }

      function isLazy(object) {
        return typeOf(object) === REACT_LAZY_TYPE;
      }

      function isMemo(object) {
        return typeOf(object) === REACT_MEMO_TYPE;
      }

      function isPortal(object) {
        return typeOf(object) === REACT_PORTAL_TYPE;
      }

      function isProfiler(object) {
        return typeOf(object) === REACT_PROFILER_TYPE;
      }

      function isStrictMode(object) {
        return typeOf(object) === REACT_STRICT_MODE_TYPE;
      }

      function isSuspense(object) {
        return typeOf(object) === REACT_SUSPENSE_TYPE;
      }

      var hasSymbol = "function" == typeof Symbol && Symbol.for,
          REACT_ELEMENT_TYPE = hasSymbol ? Symbol.for("react.element") : 60103,
          REACT_PORTAL_TYPE = hasSymbol ? Symbol.for("react.portal") : 60106,
          REACT_FRAGMENT_TYPE = hasSymbol ? Symbol.for("react.fragment") : 60107,
          REACT_STRICT_MODE_TYPE = hasSymbol ? Symbol.for("react.strict_mode") : 60108,
          REACT_PROFILER_TYPE = hasSymbol ? Symbol.for("react.profiler") : 60114,
          REACT_PROVIDER_TYPE = hasSymbol ? Symbol.for("react.provider") : 60109,
          REACT_CONTEXT_TYPE = hasSymbol ? Symbol.for("react.context") : 60110,
          REACT_ASYNC_MODE_TYPE = hasSymbol ? Symbol.for("react.async_mode") : 60111,
          REACT_CONCURRENT_MODE_TYPE = hasSymbol ? Symbol.for("react.concurrent_mode") : 60111,
          REACT_FORWARD_REF_TYPE = hasSymbol ? Symbol.for("react.forward_ref") : 60112,
          REACT_SUSPENSE_TYPE = hasSymbol ? Symbol.for("react.suspense") : 60113,
          REACT_SUSPENSE_LIST_TYPE = hasSymbol ? Symbol.for("react.suspense_list") : 60120,
          REACT_MEMO_TYPE = hasSymbol ? Symbol.for("react.memo") : 60115,
          REACT_LAZY_TYPE = hasSymbol ? Symbol.for("react.lazy") : 60116,
          REACT_BLOCK_TYPE = hasSymbol ? Symbol.for("react.block") : 60121,
          REACT_FUNDAMENTAL_TYPE = hasSymbol ? Symbol.for("react.fundamental") : 60117,
          REACT_RESPONDER_TYPE = hasSymbol ? Symbol.for("react.responder") : 60118,
          REACT_SCOPE_TYPE = hasSymbol ? Symbol.for("react.scope") : 60119,
          AsyncMode = REACT_ASYNC_MODE_TYPE,
          ConcurrentMode = REACT_CONCURRENT_MODE_TYPE,
          ContextConsumer = REACT_CONTEXT_TYPE,
          ContextProvider = REACT_PROVIDER_TYPE,
          Element = REACT_ELEMENT_TYPE,
          ForwardRef = REACT_FORWARD_REF_TYPE,
          Fragment = REACT_FRAGMENT_TYPE,
          Lazy = REACT_LAZY_TYPE,
          Memo = REACT_MEMO_TYPE,
          Portal = REACT_PORTAL_TYPE,
          Profiler = REACT_PROFILER_TYPE,
          StrictMode = REACT_STRICT_MODE_TYPE,
          Suspense = REACT_SUSPENSE_TYPE,
          hasWarnedAboutDeprecatedIsAsyncMode = !1;
      exports.AsyncMode = AsyncMode, exports.ConcurrentMode = ConcurrentMode, exports.ContextConsumer = ContextConsumer, exports.ContextProvider = ContextProvider, exports.Element = Element, exports.ForwardRef = ForwardRef, exports.Fragment = Fragment, exports.Lazy = Lazy, exports.Memo = Memo, exports.Portal = Portal, exports.Profiler = Profiler, exports.StrictMode = StrictMode, exports.Suspense = Suspense, exports.isAsyncMode = isAsyncMode, exports.isConcurrentMode = isConcurrentMode, exports.isContextConsumer = isContextConsumer, exports.isContextProvider = isContextProvider, exports.isElement = isElement, exports.isForwardRef = isForwardRef, exports.isFragment = isFragment, exports.isLazy = isLazy, exports.isMemo = isMemo, exports.isPortal = isPortal, exports.isProfiler = isProfiler, exports.isStrictMode = isStrictMode, exports.isSuspense = isSuspense, exports.isValidElementType = isValidElementType, exports.typeOf = typeOf;
    }();
  }, function (module, exports, __webpack_require__) {
    "use strict";

    function emptyFunctionThatReturnsNull() {
      return null;
    }

    var ReactIs = __webpack_require__(4),
        assign = __webpack_require__(15),
        ReactPropTypesSecret = __webpack_require__(5),
        checkPropTypes = __webpack_require__(16),
        has = Function.call.bind(Object.prototype.hasOwnProperty),
        printWarning = function printWarning() {};

    printWarning = function printWarning(text) {
      var message = "Warning: " + text;
      "undefined" != typeof console && console.error(message);

      try {
        throw new Error(message);
      } catch (x) {}
    }, module.exports = function (isValidElement, throwOnDirectAccess) {
      function getIteratorFn(maybeIterable) {
        var iteratorFn = maybeIterable && (ITERATOR_SYMBOL && maybeIterable[ITERATOR_SYMBOL] || maybeIterable[FAUX_ITERATOR_SYMBOL]);
        if ("function" == typeof iteratorFn) return iteratorFn;
      }

      function is(x, y) {
        return x === y ? 0 !== x || 1 / x == 1 / y : x !== x && y !== y;
      }

      function PropTypeError(message) {
        this.message = message, this.stack = "";
      }

      function createChainableTypeChecker(validate) {
        function checkType(isRequired, props, propName, componentName, location, propFullName, secret) {
          if (componentName = componentName || ANONYMOUS, propFullName = propFullName || propName, secret !== ReactPropTypesSecret) {
            if (throwOnDirectAccess) {
              var err = new Error("Calling PropTypes validators directly is not supported by the `prop-types` package. Use `PropTypes.checkPropTypes()` to call them. Read more at http://fb.me/use-check-prop-types");
              throw err.name = "Invariant Violation", err;
            }

            if ("undefined" != typeof console) {
              var cacheKey = componentName + ":" + propName;
              !manualPropTypeCallCache[cacheKey] && manualPropTypeWarningCount < 3 && (printWarning("You are manually calling a React.PropTypes validation function for the `" + propFullName + "` prop on `" + componentName + "`. This is deprecated and will throw in the standalone `prop-types` package. You may be seeing this warning due to a third-party PropTypes library. See https://fb.me/react-warning-dont-call-proptypes for details."), manualPropTypeCallCache[cacheKey] = !0, manualPropTypeWarningCount++);
            }
          }

          return null == props[propName] ? isRequired ? new PropTypeError(null === props[propName] ? "The " + location + " `" + propFullName + "` is marked as required in `" + componentName + "`, but its value is `null`." : "The " + location + " `" + propFullName + "` is marked as required in `" + componentName + "`, but its value is `undefined`.") : null : validate(props, propName, componentName, location, propFullName);
        }

        var manualPropTypeCallCache = {},
            manualPropTypeWarningCount = 0,
            chainedCheckType = checkType.bind(null, !1);
        return chainedCheckType.isRequired = checkType.bind(null, !0), chainedCheckType;
      }

      function createPrimitiveTypeChecker(expectedType) {
        function validate(props, propName, componentName, location, propFullName, secret) {
          var propValue = props[propName];
          if (getPropType(propValue) !== expectedType) return new PropTypeError("Invalid " + location + " `" + propFullName + "` of type `" + getPreciseType(propValue) + "` supplied to `" + componentName + "`, expected `" + expectedType + "`.");
          return null;
        }

        return createChainableTypeChecker(validate);
      }

      function createArrayOfTypeChecker(typeChecker) {
        function validate(props, propName, componentName, location, propFullName) {
          if ("function" != typeof typeChecker) return new PropTypeError("Property `" + propFullName + "` of component `" + componentName + "` has invalid PropType notation inside arrayOf.");
          var propValue = props[propName];

          if (!Array.isArray(propValue)) {
            return new PropTypeError("Invalid " + location + " `" + propFullName + "` of type `" + getPropType(propValue) + "` supplied to `" + componentName + "`, expected an array.");
          }

          for (var i = 0; i < propValue.length; i++) {
            var error = typeChecker(propValue, i, componentName, location, propFullName + "[" + i + "]", ReactPropTypesSecret);
            if (error instanceof Error) return error;
          }

          return null;
        }

        return createChainableTypeChecker(validate);
      }

      function createInstanceTypeChecker(expectedClass) {
        function validate(props, propName, componentName, location, propFullName) {
          if (!(props[propName] instanceof expectedClass)) {
            var expectedClassName = expectedClass.name || ANONYMOUS;
            return new PropTypeError("Invalid " + location + " `" + propFullName + "` of type `" + getClassName(props[propName]) + "` supplied to `" + componentName + "`, expected instance of `" + expectedClassName + "`.");
          }

          return null;
        }

        return createChainableTypeChecker(validate);
      }

      function createEnumTypeChecker(expectedValues) {
        function validate(props, propName, componentName, location, propFullName) {
          for (var propValue = props[propName], i = 0; i < expectedValues.length; i++) {
            if (is(propValue, expectedValues[i])) return null;
          }

          var valuesString = JSON.stringify(expectedValues, function (key, value) {
            return "symbol" === getPreciseType(value) ? String(value) : value;
          });
          return new PropTypeError("Invalid " + location + " `" + propFullName + "` of value `" + String(propValue) + "` supplied to `" + componentName + "`, expected one of " + valuesString + ".");
        }

        return Array.isArray(expectedValues) ? createChainableTypeChecker(validate) : (printWarning(arguments.length > 1 ? "Invalid arguments supplied to oneOf, expected an array, got " + arguments.length + " arguments. A common mistake is to write oneOf(x, y, z) instead of oneOf([x, y, z])." : "Invalid argument supplied to oneOf, expected an array."), emptyFunctionThatReturnsNull);
      }

      function createObjectOfTypeChecker(typeChecker) {
        function validate(props, propName, componentName, location, propFullName) {
          if ("function" != typeof typeChecker) return new PropTypeError("Property `" + propFullName + "` of component `" + componentName + "` has invalid PropType notation inside objectOf.");
          var propValue = props[propName],
              propType = getPropType(propValue);
          if ("object" !== propType) return new PropTypeError("Invalid " + location + " `" + propFullName + "` of type `" + propType + "` supplied to `" + componentName + "`, expected an object.");

          for (var key in propValue) {
            if (has(propValue, key)) {
              var error = typeChecker(propValue, key, componentName, location, propFullName + "." + key, ReactPropTypesSecret);
              if (error instanceof Error) return error;
            }
          }

          return null;
        }

        return createChainableTypeChecker(validate);
      }

      function createUnionTypeChecker(arrayOfTypeCheckers) {
        function validate(props, propName, componentName, location, propFullName) {
          for (var i = 0; i < arrayOfTypeCheckers.length; i++) {
            if (null == (0, arrayOfTypeCheckers[i])(props, propName, componentName, location, propFullName, ReactPropTypesSecret)) return null;
          }

          return new PropTypeError("Invalid " + location + " `" + propFullName + "` supplied to `" + componentName + "`.");
        }

        if (!Array.isArray(arrayOfTypeCheckers)) return printWarning("Invalid argument supplied to oneOfType, expected an instance of array."), emptyFunctionThatReturnsNull;

        for (var i = 0; i < arrayOfTypeCheckers.length; i++) {
          var checker = arrayOfTypeCheckers[i];
          if ("function" != typeof checker) return printWarning("Invalid argument supplied to oneOfType. Expected an array of check functions, but received " + getPostfixForTypeWarning(checker) + " at index " + i + "."), emptyFunctionThatReturnsNull;
        }

        return createChainableTypeChecker(validate);
      }

      function createShapeTypeChecker(shapeTypes) {
        function validate(props, propName, componentName, location, propFullName) {
          var propValue = props[propName],
              propType = getPropType(propValue);
          if ("object" !== propType) return new PropTypeError("Invalid " + location + " `" + propFullName + "` of type `" + propType + "` supplied to `" + componentName + "`, expected `object`.");

          for (var key in shapeTypes) {
            var checker = shapeTypes[key];

            if (checker) {
              var error = checker(propValue, key, componentName, location, propFullName + "." + key, ReactPropTypesSecret);
              if (error) return error;
            }
          }

          return null;
        }

        return createChainableTypeChecker(validate);
      }

      function createStrictShapeTypeChecker(shapeTypes) {
        function validate(props, propName, componentName, location, propFullName) {
          var propValue = props[propName],
              propType = getPropType(propValue);
          if ("object" !== propType) return new PropTypeError("Invalid " + location + " `" + propFullName + "` of type `" + propType + "` supplied to `" + componentName + "`, expected `object`.");
          var allKeys = assign({}, props[propName], shapeTypes);

          for (var key in allKeys) {
            var checker = shapeTypes[key];
            if (!checker) return new PropTypeError("Invalid " + location + " `" + propFullName + "` key `" + key + "` supplied to `" + componentName + "`.\nBad object: " + JSON.stringify(props[propName], null, "  ") + "\nValid keys: " + JSON.stringify(Object.keys(shapeTypes), null, "  "));
            var error = checker(propValue, key, componentName, location, propFullName + "." + key, ReactPropTypesSecret);
            if (error) return error;
          }

          return null;
        }

        return createChainableTypeChecker(validate);
      }

      function isNode(propValue) {
        switch (_typeof(propValue)) {
          case "number":
          case "string":
          case "undefined":
            return !0;

          case "boolean":
            return !propValue;

          case "object":
            if (Array.isArray(propValue)) return propValue.every(isNode);
            if (null === propValue || isValidElement(propValue)) return !0;
            var iteratorFn = getIteratorFn(propValue);
            if (!iteratorFn) return !1;
            var step,
                iterator = iteratorFn.call(propValue);

            if (iteratorFn !== propValue.entries) {
              for (; !(step = iterator.next()).done;) {
                if (!isNode(step.value)) return !1;
              }
            } else for (; !(step = iterator.next()).done;) {
              var entry = step.value;
              if (entry && !isNode(entry[1])) return !1;
            }

            return !0;

          default:
            return !1;
        }
      }

      function isSymbol(propType, propValue) {
        return "symbol" === propType || !!propValue && ("Symbol" === propValue["@@toStringTag"] || "function" == typeof Symbol && propValue instanceof Symbol);
      }

      function getPropType(propValue) {
        var propType = _typeof(propValue);

        return Array.isArray(propValue) ? "array" : propValue instanceof RegExp ? "object" : isSymbol(propType, propValue) ? "symbol" : propType;
      }

      function getPreciseType(propValue) {
        if (void 0 === propValue || null === propValue) return "" + propValue;
        var propType = getPropType(propValue);

        if ("object" === propType) {
          if (propValue instanceof Date) return "date";
          if (propValue instanceof RegExp) return "regexp";
        }

        return propType;
      }

      function getPostfixForTypeWarning(value) {
        var type = getPreciseType(value);

        switch (type) {
          case "array":
          case "object":
            return "an " + type;

          case "boolean":
          case "date":
          case "regexp":
            return "a " + type;

          default:
            return type;
        }
      }

      function getClassName(propValue) {
        return propValue.constructor && propValue.constructor.name ? propValue.constructor.name : ANONYMOUS;
      }

      var ITERATOR_SYMBOL = "function" == typeof Symbol && Symbol.iterator,
          FAUX_ITERATOR_SYMBOL = "@@iterator",
          ANONYMOUS = "<<anonymous>>",
          ReactPropTypes = {
        array: createPrimitiveTypeChecker("array"),
        bool: createPrimitiveTypeChecker("boolean"),
        func: createPrimitiveTypeChecker("function"),
        number: createPrimitiveTypeChecker("number"),
        object: createPrimitiveTypeChecker("object"),
        string: createPrimitiveTypeChecker("string"),
        symbol: createPrimitiveTypeChecker("symbol"),
        any: function () {
          return createChainableTypeChecker(emptyFunctionThatReturnsNull);
        }(),
        arrayOf: createArrayOfTypeChecker,
        element: function () {
          function validate(props, propName, componentName, location, propFullName) {
            var propValue = props[propName];

            if (!isValidElement(propValue)) {
              return new PropTypeError("Invalid " + location + " `" + propFullName + "` of type `" + getPropType(propValue) + "` supplied to `" + componentName + "`, expected a single ReactElement.");
            }

            return null;
          }

          return createChainableTypeChecker(validate);
        }(),
        elementType: function () {
          function validate(props, propName, componentName, location, propFullName) {
            var propValue = props[propName];

            if (!ReactIs.isValidElementType(propValue)) {
              return new PropTypeError("Invalid " + location + " `" + propFullName + "` of type `" + getPropType(propValue) + "` supplied to `" + componentName + "`, expected a single ReactElement type.");
            }

            return null;
          }

          return createChainableTypeChecker(validate);
        }(),
        instanceOf: createInstanceTypeChecker,
        node: function () {
          function validate(props, propName, componentName, location, propFullName) {
            return isNode(props[propName]) ? null : new PropTypeError("Invalid " + location + " `" + propFullName + "` supplied to `" + componentName + "`, expected a ReactNode.");
          }

          return createChainableTypeChecker(validate);
        }(),
        objectOf: createObjectOfTypeChecker,
        oneOf: createEnumTypeChecker,
        oneOfType: createUnionTypeChecker,
        shape: createShapeTypeChecker,
        exact: createStrictShapeTypeChecker
      };
      return PropTypeError.prototype = Error.prototype, ReactPropTypes.checkPropTypes = checkPropTypes, ReactPropTypes.resetWarningCache = checkPropTypes.resetWarningCache, ReactPropTypes.PropTypes = ReactPropTypes, ReactPropTypes;
    };
  }, function (module, exports, __webpack_require__) {
    "use strict";

    function toObject(val) {
      if (null === val || void 0 === val) throw new TypeError("Object.assign cannot be called with null or undefined");
      return Object(val);
    }
    /*
    object-assign
    (c) Sindre Sorhus
    @license MIT
    */


    var getOwnPropertySymbols = Object.getOwnPropertySymbols,
        hasOwnProperty = Object.prototype.hasOwnProperty,
        propIsEnumerable = Object.prototype.propertyIsEnumerable;
    module.exports = function () {
      try {
        if (!Object.assign) return !1;
        var test1 = new String("abc");
        if (test1[5] = "de", "5" === Object.getOwnPropertyNames(test1)[0]) return !1;

        for (var test2 = {}, i = 0; i < 10; i++) {
          test2["_" + String.fromCharCode(i)] = i;
        }

        if ("0123456789" !== Object.getOwnPropertyNames(test2).map(function (n) {
          return test2[n];
        }).join("")) return !1;
        var test3 = {};
        return "abcdefghijklmnopqrst".split("").forEach(function (letter) {
          test3[letter] = letter;
        }), "abcdefghijklmnopqrst" === Object.keys(Object.assign({}, test3)).join("");
      } catch (err) {
        return !1;
      }
    }() ? Object.assign : function (target, source) {
      for (var from, symbols, to = toObject(target), s = 1; s < arguments.length; s++) {
        from = Object(arguments[s]);

        for (var key in from) {
          hasOwnProperty.call(from, key) && (to[key] = from[key]);
        }

        if (getOwnPropertySymbols) {
          symbols = getOwnPropertySymbols(from);

          for (var i = 0; i < symbols.length; i++) {
            propIsEnumerable.call(from, symbols[i]) && (to[symbols[i]] = from[symbols[i]]);
          }
        }
      }

      return to;
    };
  }, function (module, exports, __webpack_require__) {
    "use strict";

    function checkPropTypes(typeSpecs, values, location, componentName, getStack) {
      for (var typeSpecName in typeSpecs) {
        if (has(typeSpecs, typeSpecName)) {
          var error;

          try {
            if ("function" != typeof typeSpecs[typeSpecName]) {
              var err = Error((componentName || "React class") + ": " + location + " type `" + typeSpecName + "` is invalid; it must be a function, usually from the `prop-types` package, but received `" + _typeof(typeSpecs[typeSpecName]) + "`.");
              throw err.name = "Invariant Violation", err;
            }

            error = typeSpecs[typeSpecName](values, typeSpecName, componentName, location, null, ReactPropTypesSecret);
          } catch (ex) {
            error = ex;
          }

          if (!error || error instanceof Error || printWarning((componentName || "React class") + ": type specification of " + location + " `" + typeSpecName + "` is invalid; the type checker function must return `null` or an `Error` but returned a " + _typeof(error) + ". You may have forgotten to pass an argument to the type checker creator (arrayOf, instanceOf, objectOf, oneOf, oneOfType, and shape all require an argument)."), error instanceof Error && !(error.message in loggedTypeFailures)) {
            loggedTypeFailures[error.message] = !0;
            var stack = getStack ? getStack() : "";
            printWarning("Failed " + location + " type: " + error.message + (null != stack ? stack : ""));
          }
        }
      }
    }

    var printWarning = function printWarning() {},
        ReactPropTypesSecret = __webpack_require__(5),
        loggedTypeFailures = {},
        has = Function.call.bind(Object.prototype.hasOwnProperty);

    printWarning = function printWarning(text) {
      var message = "Warning: " + text;
      "undefined" != typeof console && console.error(message);

      try {
        throw new Error(message);
      } catch (x) {}
    }, checkPropTypes.resetWarningCache = function () {
      loggedTypeFailures = {};
    }, module.exports = checkPropTypes;
  }, function (module, __webpack_exports__, __webpack_require__) {
    "use strict";

    function _objectWithoutProperties(source, excluded) {
      if (null == source) return {};

      var key,
          i,
          target = _objectWithoutPropertiesLoose(source, excluded);

      if (Object.getOwnPropertySymbols) {
        var sourceSymbolKeys = Object.getOwnPropertySymbols(source);

        for (i = 0; i < sourceSymbolKeys.length; i++) {
          key = sourceSymbolKeys[i], excluded.indexOf(key) >= 0 || Object.prototype.propertyIsEnumerable.call(source, key) && (target[key] = source[key]);
        }
      }

      return target;
    }

    function _objectWithoutPropertiesLoose(source, excluded) {
      if (null == source) return {};
      var key,
          i,
          target = {},
          sourceKeys = Object.keys(source);

      for (i = 0; i < sourceKeys.length; i++) {
        key = sourceKeys[i], excluded.indexOf(key) >= 0 || (target[key] = source[key]);
      }

      return target;
    }

    function MediaQuery(_ref) {
      var children = _ref.children,
          device = _ref.device,
          onChange = _ref.onChange,
          settings = _objectWithoutProperties(_ref, ["children", "device", "onChange"]),
          matches = Object(__WEBPACK_IMPORTED_MODULE_0__useMediaQuery__.a)(settings, device, onChange);

      return "function" == typeof children ? children(matches) : matches ? children : null;
    }

    __webpack_exports__.a = MediaQuery;

    var __WEBPACK_IMPORTED_MODULE_0__useMediaQuery__ = __webpack_require__(0);
  }]);
});
/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(46)(module)))

/***/ }),
/* 27 */,
/* 28 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return toArray; });
/* harmony import */ var react__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(0);
/* harmony import */ var react__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(react__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var react_is__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(44);
/* harmony import */ var react_is__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(react_is__WEBPACK_IMPORTED_MODULE_1__);


function toArray(children) {
  var ret = [];
  react__WEBPACK_IMPORTED_MODULE_0___default.a.Children.forEach(children, function (child) {
    if (child === undefined || child === null) {
      return;
    }

    if (Array.isArray(child)) {
      ret = ret.concat(toArray(child));
    } else if (Object(react_is__WEBPACK_IMPORTED_MODULE_1__["isFragment"])(child) && child.props) {
      ret = ret.concat(toArray(child.props.children));
    } else {
      ret.push(child);
    }
  });
  return ret;
}

/***/ }),
/* 29 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(global) {var now = __webpack_require__(151),
    root = typeof window === 'undefined' ? global : window,
    vendors = ['moz', 'webkit'],
    suffix = 'AnimationFrame',
    raf = root['request' + suffix],
    caf = root['cancel' + suffix] || root['cancelRequest' + suffix];

for (var i = 0; !raf && i < vendors.length; i++) {
  raf = root[vendors[i] + 'Request' + suffix];
  caf = root[vendors[i] + 'Cancel' + suffix] || root[vendors[i] + 'CancelRequest' + suffix];
} // Some versions of FF have rAF but not cAF


if (!raf || !caf) {
  var last = 0,
      id = 0,
      queue = [],
      frameDuration = 1000 / 60;

  raf = function raf(callback) {
    if (queue.length === 0) {
      var _now = now(),
          next = Math.max(0, frameDuration - (_now - last));

      last = next + _now;
      setTimeout(function () {
        var cp = queue.slice(0); // Clear queue here to prevent
        // callbacks from appending listeners
        // to the current frame's queue

        queue.length = 0;

        for (var i = 0; i < cp.length; i++) {
          if (!cp[i].cancelled) {
            try {
              cp[i].callback(last);
            } catch (e) {
              setTimeout(function () {
                throw e;
              }, 0);
            }
          }
        }
      }, Math.round(next));
    }

    queue.push({
      handle: ++id,
      callback: callback,
      cancelled: false
    });
    return id;
  };

  caf = function caf(handle) {
    for (var i = 0; i < queue.length; i++) {
      if (queue[i].handle === handle) {
        queue[i].cancelled = true;
      }
    }
  };
}

module.exports = function (fn) {
  // Wrap in a new function to prevent
  // `cancel` potentially being assigned
  // to the native rAF function
  return raf.call(root, fn);
};

module.exports.cancel = function () {
  caf.apply(root, arguments);
};

module.exports.polyfill = function (object) {
  if (!object) {
    object = root;
  }

  object.requestAnimationFrame = raf;
  object.cancelAnimationFrame = caf;
};
/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(50)))

/***/ }),
/* 30 */,
/* 31 */
/***/ (function(module, exports) {

module.exports = assert;

function assert(val, msg) {
  if (!val) throw new Error(msg || 'Assertion failed');
}

assert.equal = function assertEqual(l, r, msg) {
  if (l != r) throw new Error(msg || 'Assertion failed: ' + l + ' != ' + r);
};

/***/ }),
/* 32 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = __webpack_require__(19);

var assert = __webpack_require__(31);

function BlockHash() {
  this.pending = null;
  this.pendingTotal = 0;
  this.blockSize = this.constructor.blockSize;
  this.outSize = this.constructor.outSize;
  this.hmacStrength = this.constructor.hmacStrength;
  this.padLength = this.constructor.padLength / 8;
  this.endian = 'big';
  this._delta8 = this.blockSize / 8;
  this._delta32 = this.blockSize / 32;
}

exports.BlockHash = BlockHash;

BlockHash.prototype.update = function update(msg, enc) {
  // Convert message to array, pad it, and join into 32bit blocks
  msg = utils.toArray(msg, enc);
  if (!this.pending) this.pending = msg;else this.pending = this.pending.concat(msg);
  this.pendingTotal += msg.length; // Enough data, try updating

  if (this.pending.length >= this._delta8) {
    msg = this.pending; // Process pending data in blocks

    var r = msg.length % this._delta8;
    this.pending = msg.slice(msg.length - r, msg.length);
    if (this.pending.length === 0) this.pending = null;
    msg = utils.join32(msg, 0, msg.length - r, this.endian);

    for (var i = 0; i < msg.length; i += this._delta32) {
      this._update(msg, i, i + this._delta32);
    }
  }

  return this;
};

BlockHash.prototype.digest = function digest(enc) {
  this.update(this._pad());
  assert(this.pending === null);
  return this._digest(enc);
};

BlockHash.prototype._pad = function pad() {
  var len = this.pendingTotal;
  var bytes = this._delta8;
  var k = bytes - (len + this.padLength) % bytes;
  var res = new Array(k + this.padLength);
  res[0] = 0x80;

  for (var i = 1; i < k; i++) {
    res[i] = 0;
  } // Append length


  len <<= 3;

  if (this.endian === 'big') {
    for (var t = 8; t < this.padLength; t++) {
      res[i++] = 0;
    }

    res[i++] = 0;
    res[i++] = 0;
    res[i++] = 0;
    res[i++] = 0;
    res[i++] = len >>> 24 & 0xff;
    res[i++] = len >>> 16 & 0xff;
    res[i++] = len >>> 8 & 0xff;
    res[i++] = len & 0xff;
  } else {
    res[i++] = len & 0xff;
    res[i++] = len >>> 8 & 0xff;
    res[i++] = len >>> 16 & 0xff;
    res[i++] = len >>> 24 & 0xff;
    res[i++] = 0;
    res[i++] = 0;
    res[i++] = 0;
    res[i++] = 0;

    for (t = 8; t < this.padLength; t++) {
      res[i++] = 0;
    }
  }

  return res;
};

/***/ }),
/* 33 */
/***/ (function(module, exports) {

function _classCallCheck(instance, Constructor) {
  if (!(instance instanceof Constructor)) {
    throw new TypeError("Cannot call a class as a function");
  }
}

module.exports = _classCallCheck;

/***/ }),
/* 34 */
/***/ (function(module, exports) {

function _defineProperties(target, props) {
  for (var i = 0; i < props.length; i++) {
    var descriptor = props[i];
    descriptor.enumerable = descriptor.enumerable || false;
    descriptor.configurable = true;
    if ("value" in descriptor) descriptor.writable = true;
    Object.defineProperty(target, descriptor.key, descriptor);
  }
}

function _createClass(Constructor, protoProps, staticProps) {
  if (protoProps) _defineProperties(Constructor.prototype, protoProps);
  if (staticProps) _defineProperties(Constructor, staticProps);
  return Constructor;
}

module.exports = _createClass;

/***/ }),
/* 35 */
/***/ (function(module, exports, __webpack_require__) {

var setPrototypeOf = __webpack_require__(91);

function _inherits(subClass, superClass) {
  if (typeof superClass !== "function" && superClass !== null) {
    throw new TypeError("Super expression must either be null or a function");
  }

  subClass.prototype = Object.create(superClass && superClass.prototype, {
    constructor: {
      value: subClass,
      writable: true,
      configurable: true
    }
  });
  if (superClass) setPrototypeOf(subClass, superClass);
}

module.exports = _inherits;

/***/ }),
/* 36 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.warning = warning;
exports.note = note;
exports.resetWarned = resetWarned;
exports.call = call;
exports.warningOnce = warningOnce;
exports.noteOnce = noteOnce;
exports.default = void 0;
/* eslint-disable no-console */

var warned = {};

function warning(valid, message) {
  // Support uglify
  if (false) {}
}

function note(valid, message) {
  // Support uglify
  if (false) {}
}

function resetWarned() {
  warned = {};
}

function call(method, valid, message) {
  if (!valid && !warned[message]) {
    method(false, message);
    warned[message] = true;
  }
}

function warningOnce(valid, message) {
  call(warning, valid, message);
}

function noteOnce(valid, message) {
  call(note, valid, message);
}

var _default = warningOnce;
/* eslint-enable */

exports.default = _default;

/***/ }),
/* 37 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _arrayLikeToArray; });
function _arrayLikeToArray(arr, len) {
  if (len == null || len > arr.length) len = arr.length;

  for (var i = 0, arr2 = new Array(len); i < len; i++) {
    arr2[i] = arr[i];
  }

  return arr2;
}

/***/ }),
/* 38 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(global, module) {function _typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }

/**
 * Lodash (Custom Build) <https://lodash.com/>
 * Build: `lodash modularize exports="npm" -o ./`
 * Copyright JS Foundation and other contributors <https://js.foundation/>
 * Released under MIT license <https://lodash.com/license>
 * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE>
 * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors
 */

/** Used as the size to enable large array optimizations. */
var LARGE_ARRAY_SIZE = 200;
/** Used to stand-in for `undefined` hash values. */

var HASH_UNDEFINED = '__lodash_hash_undefined__';
/** Used to compose bitmasks for value comparisons. */

var COMPARE_PARTIAL_FLAG = 1,
    COMPARE_UNORDERED_FLAG = 2;
/** Used as references for various `Number` constants. */

var MAX_SAFE_INTEGER = 9007199254740991;
/** `Object#toString` result references. */

var argsTag = '[object Arguments]',
    arrayTag = '[object Array]',
    asyncTag = '[object AsyncFunction]',
    boolTag = '[object Boolean]',
    dateTag = '[object Date]',
    errorTag = '[object Error]',
    funcTag = '[object Function]',
    genTag = '[object GeneratorFunction]',
    mapTag = '[object Map]',
    numberTag = '[object Number]',
    nullTag = '[object Null]',
    objectTag = '[object Object]',
    promiseTag = '[object Promise]',
    proxyTag = '[object Proxy]',
    regexpTag = '[object RegExp]',
    setTag = '[object Set]',
    stringTag = '[object String]',
    symbolTag = '[object Symbol]',
    undefinedTag = '[object Undefined]',
    weakMapTag = '[object WeakMap]';
var arrayBufferTag = '[object ArrayBuffer]',
    dataViewTag = '[object DataView]',
    float32Tag = '[object Float32Array]',
    float64Tag = '[object Float64Array]',
    int8Tag = '[object Int8Array]',
    int16Tag = '[object Int16Array]',
    int32Tag = '[object Int32Array]',
    uint8Tag = '[object Uint8Array]',
    uint8ClampedTag = '[object Uint8ClampedArray]',
    uint16Tag = '[object Uint16Array]',
    uint32Tag = '[object Uint32Array]';
/**
 * Used to match `RegExp`
 * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).
 */

var reRegExpChar = /[\\^$.*+?()[\]{}|]/g;
/** Used to detect host constructors (Safari). */

var reIsHostCtor = /^\[object .+?Constructor\]$/;
/** Used to detect unsigned integer values. */

var reIsUint = /^(?:0|[1-9]\d*)$/;
/** Used to identify `toStringTag` values of typed arrays. */

var typedArrayTags = {};
typedArrayTags[float32Tag] = typedArrayTags[float64Tag] = typedArrayTags[int8Tag] = typedArrayTags[int16Tag] = typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] = typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] = typedArrayTags[uint32Tag] = true;
typedArrayTags[argsTag] = typedArrayTags[arrayTag] = typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] = typedArrayTags[dataViewTag] = typedArrayTags[dateTag] = typedArrayTags[errorTag] = typedArrayTags[funcTag] = typedArrayTags[mapTag] = typedArrayTags[numberTag] = typedArrayTags[objectTag] = typedArrayTags[regexpTag] = typedArrayTags[setTag] = typedArrayTags[stringTag] = typedArrayTags[weakMapTag] = false;
/** Detect free variable `global` from Node.js. */

var freeGlobal = (typeof global === "undefined" ? "undefined" : _typeof(global)) == 'object' && global && global.Object === Object && global;
/** Detect free variable `self`. */

var freeSelf = (typeof self === "undefined" ? "undefined" : _typeof(self)) == 'object' && self && self.Object === Object && self;
/** Used as a reference to the global object. */

var root = freeGlobal || freeSelf || Function('return this')();
/** Detect free variable `exports`. */

var freeExports = ( false ? undefined : _typeof(exports)) == 'object' && exports && !exports.nodeType && exports;
/** Detect free variable `module`. */

var freeModule = freeExports && ( false ? undefined : _typeof(module)) == 'object' && module && !module.nodeType && module;
/** Detect the popular CommonJS extension `module.exports`. */

var moduleExports = freeModule && freeModule.exports === freeExports;
/** Detect free variable `process` from Node.js. */

var freeProcess = moduleExports && freeGlobal.process;
/** Used to access faster Node.js helpers. */

var nodeUtil = function () {
  try {
    return freeProcess && freeProcess.binding && freeProcess.binding('util');
  } catch (e) {}
}();
/* Node.js helper references. */


var nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray;
/**
 * A specialized version of `_.filter` for arrays without support for
 * iteratee shorthands.
 *
 * @private
 * @param {Array} [array] The array to iterate over.
 * @param {Function} predicate The function invoked per iteration.
 * @returns {Array} Returns the new filtered array.
 */

function arrayFilter(array, predicate) {
  var index = -1,
      length = array == null ? 0 : array.length,
      resIndex = 0,
      result = [];

  while (++index < length) {
    var value = array[index];

    if (predicate(value, index, array)) {
      result[resIndex++] = value;
    }
  }

  return result;
}
/**
 * Appends the elements of `values` to `array`.
 *
 * @private
 * @param {Array} array The array to modify.
 * @param {Array} values The values to append.
 * @returns {Array} Returns `array`.
 */


function arrayPush(array, values) {
  var index = -1,
      length = values.length,
      offset = array.length;

  while (++index < length) {
    array[offset + index] = values[index];
  }

  return array;
}
/**
 * A specialized version of `_.some` for arrays without support for iteratee
 * shorthands.
 *
 * @private
 * @param {Array} [array] The array to iterate over.
 * @param {Function} predicate The function invoked per iteration.
 * @returns {boolean} Returns `true` if any element passes the predicate check,
 *  else `false`.
 */


function arraySome(array, predicate) {
  var index = -1,
      length = array == null ? 0 : array.length;

  while (++index < length) {
    if (predicate(array[index], index, array)) {
      return true;
    }
  }

  return false;
}
/**
 * The base implementation of `_.times` without support for iteratee shorthands
 * or max array length checks.
 *
 * @private
 * @param {number} n The number of times to invoke `iteratee`.
 * @param {Function} iteratee The function invoked per iteration.
 * @returns {Array} Returns the array of results.
 */


function baseTimes(n, iteratee) {
  var index = -1,
      result = Array(n);

  while (++index < n) {
    result[index] = iteratee(index);
  }

  return result;
}
/**
 * The base implementation of `_.unary` without support for storing metadata.
 *
 * @private
 * @param {Function} func The function to cap arguments for.
 * @returns {Function} Returns the new capped function.
 */


function baseUnary(func) {
  return function (value) {
    return func(value);
  };
}
/**
 * Checks if a `cache` value for `key` exists.
 *
 * @private
 * @param {Object} cache The cache to query.
 * @param {string} key The key of the entry to check.
 * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
 */


function cacheHas(cache, key) {
  return cache.has(key);
}
/**
 * Gets the value at `key` of `object`.
 *
 * @private
 * @param {Object} [object] The object to query.
 * @param {string} key The key of the property to get.
 * @returns {*} Returns the property value.
 */


function getValue(object, key) {
  return object == null ? undefined : object[key];
}
/**
 * Converts `map` to its key-value pairs.
 *
 * @private
 * @param {Object} map The map to convert.
 * @returns {Array} Returns the key-value pairs.
 */


function mapToArray(map) {
  var index = -1,
      result = Array(map.size);
  map.forEach(function (value, key) {
    result[++index] = [key, value];
  });
  return result;
}
/**
 * Creates a unary function that invokes `func` with its argument transformed.
 *
 * @private
 * @param {Function} func The function to wrap.
 * @param {Function} transform The argument transform.
 * @returns {Function} Returns the new function.
 */


function overArg(func, transform) {
  return function (arg) {
    return func(transform(arg));
  };
}
/**
 * Converts `set` to an array of its values.
 *
 * @private
 * @param {Object} set The set to convert.
 * @returns {Array} Returns the values.
 */


function setToArray(set) {
  var index = -1,
      result = Array(set.size);
  set.forEach(function (value) {
    result[++index] = value;
  });
  return result;
}
/** Used for built-in method references. */


var arrayProto = Array.prototype,
    funcProto = Function.prototype,
    objectProto = Object.prototype;
/** Used to detect overreaching core-js shims. */

var coreJsData = root['__core-js_shared__'];
/** Used to resolve the decompiled source of functions. */

var funcToString = funcProto.toString;
/** Used to check objects for own properties. */

var hasOwnProperty = objectProto.hasOwnProperty;
/** Used to detect methods masquerading as native. */

var maskSrcKey = function () {
  var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || '');
  return uid ? 'Symbol(src)_1.' + uid : '';
}();
/**
 * Used to resolve the
 * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)
 * of values.
 */


var nativeObjectToString = objectProto.toString;
/** Used to detect if a method is native. */

var reIsNative = RegExp('^' + funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&').replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$');
/** Built-in value references. */

var Buffer = moduleExports ? root.Buffer : undefined,
    _Symbol = root.Symbol,
    Uint8Array = root.Uint8Array,
    propertyIsEnumerable = objectProto.propertyIsEnumerable,
    splice = arrayProto.splice,
    symToStringTag = _Symbol ? _Symbol.toStringTag : undefined;
/* Built-in method references for those with the same name as other `lodash` methods. */

var nativeGetSymbols = Object.getOwnPropertySymbols,
    nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined,
    nativeKeys = overArg(Object.keys, Object);
/* Built-in method references that are verified to be native. */

var DataView = getNative(root, 'DataView'),
    Map = getNative(root, 'Map'),
    Promise = getNative(root, 'Promise'),
    Set = getNative(root, 'Set'),
    WeakMap = getNative(root, 'WeakMap'),
    nativeCreate = getNative(Object, 'create');
/** Used to detect maps, sets, and weakmaps. */

var dataViewCtorString = toSource(DataView),
    mapCtorString = toSource(Map),
    promiseCtorString = toSource(Promise),
    setCtorString = toSource(Set),
    weakMapCtorString = toSource(WeakMap);
/** Used to convert symbols to primitives and strings. */

var symbolProto = _Symbol ? _Symbol.prototype : undefined,
    symbolValueOf = symbolProto ? symbolProto.valueOf : undefined;
/**
 * Creates a hash object.
 *
 * @private
 * @constructor
 * @param {Array} [entries] The key-value pairs to cache.
 */

function Hash(entries) {
  var index = -1,
      length = entries == null ? 0 : entries.length;
  this.clear();

  while (++index < length) {
    var entry = entries[index];
    this.set(entry[0], entry[1]);
  }
}
/**
 * Removes all key-value entries from the hash.
 *
 * @private
 * @name clear
 * @memberOf Hash
 */


function hashClear() {
  this.__data__ = nativeCreate ? nativeCreate(null) : {};
  this.size = 0;
}
/**
 * Removes `key` and its value from the hash.
 *
 * @private
 * @name delete
 * @memberOf Hash
 * @param {Object} hash The hash to modify.
 * @param {string} key The key of the value to remove.
 * @returns {boolean} Returns `true` if the entry was removed, else `false`.
 */


function hashDelete(key) {
  var result = this.has(key) && delete this.__data__[key];
  this.size -= result ? 1 : 0;
  return result;
}
/**
 * Gets the hash value for `key`.
 *
 * @private
 * @name get
 * @memberOf Hash
 * @param {string} key The key of the value to get.
 * @returns {*} Returns the entry value.
 */


function hashGet(key) {
  var data = this.__data__;

  if (nativeCreate) {
    var result = data[key];
    return result === HASH_UNDEFINED ? undefined : result;
  }

  return hasOwnProperty.call(data, key) ? data[key] : undefined;
}
/**
 * Checks if a hash value for `key` exists.
 *
 * @private
 * @name has
 * @memberOf Hash
 * @param {string} key The key of the entry to check.
 * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
 */


function hashHas(key) {
  var data = this.__data__;
  return nativeCreate ? data[key] !== undefined : hasOwnProperty.call(data, key);
}
/**
 * Sets the hash `key` to `value`.
 *
 * @private
 * @name set
 * @memberOf Hash
 * @param {string} key The key of the value to set.
 * @param {*} value The value to set.
 * @returns {Object} Returns the hash instance.
 */


function hashSet(key, value) {
  var data = this.__data__;
  this.size += this.has(key) ? 0 : 1;
  data[key] = nativeCreate && value === undefined ? HASH_UNDEFINED : value;
  return this;
} // Add methods to `Hash`.


Hash.prototype.clear = hashClear;
Hash.prototype['delete'] = hashDelete;
Hash.prototype.get = hashGet;
Hash.prototype.has = hashHas;
Hash.prototype.set = hashSet;
/**
 * Creates an list cache object.
 *
 * @private
 * @constructor
 * @param {Array} [entries] The key-value pairs to cache.
 */

function ListCache(entries) {
  var index = -1,
      length = entries == null ? 0 : entries.length;
  this.clear();

  while (++index < length) {
    var entry = entries[index];
    this.set(entry[0], entry[1]);
  }
}
/**
 * Removes all key-value entries from the list cache.
 *
 * @private
 * @name clear
 * @memberOf ListCache
 */


function listCacheClear() {
  this.__data__ = [];
  this.size = 0;
}
/**
 * Removes `key` and its value from the list cache.
 *
 * @private
 * @name delete
 * @memberOf ListCache
 * @param {string} key The key of the value to remove.
 * @returns {boolean} Returns `true` if the entry was removed, else `false`.
 */


function listCacheDelete(key) {
  var data = this.__data__,
      index = assocIndexOf(data, key);

  if (index < 0) {
    return false;
  }

  var lastIndex = data.length - 1;

  if (index == lastIndex) {
    data.pop();
  } else {
    splice.call(data, index, 1);
  }

  --this.size;
  return true;
}
/**
 * Gets the list cache value for `key`.
 *
 * @private
 * @name get
 * @memberOf ListCache
 * @param {string} key The key of the value to get.
 * @returns {*} Returns the entry value.
 */


function listCacheGet(key) {
  var data = this.__data__,
      index = assocIndexOf(data, key);
  return index < 0 ? undefined : data[index][1];
}
/**
 * Checks if a list cache value for `key` exists.
 *
 * @private
 * @name has
 * @memberOf ListCache
 * @param {string} key The key of the entry to check.
 * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
 */


function listCacheHas(key) {
  return assocIndexOf(this.__data__, key) > -1;
}
/**
 * Sets the list cache `key` to `value`.
 *
 * @private
 * @name set
 * @memberOf ListCache
 * @param {string} key The key of the value to set.
 * @param {*} value The value to set.
 * @returns {Object} Returns the list cache instance.
 */


function listCacheSet(key, value) {
  var data = this.__data__,
      index = assocIndexOf(data, key);

  if (index < 0) {
    ++this.size;
    data.push([key, value]);
  } else {
    data[index][1] = value;
  }

  return this;
} // Add methods to `ListCache`.


ListCache.prototype.clear = listCacheClear;
ListCache.prototype['delete'] = listCacheDelete;
ListCache.prototype.get = listCacheGet;
ListCache.prototype.has = listCacheHas;
ListCache.prototype.set = listCacheSet;
/**
 * Creates a map cache object to store key-value pairs.
 *
 * @private
 * @constructor
 * @param {Array} [entries] The key-value pairs to cache.
 */

function MapCache(entries) {
  var index = -1,
      length = entries == null ? 0 : entries.length;
  this.clear();

  while (++index < length) {
    var entry = entries[index];
    this.set(entry[0], entry[1]);
  }
}
/**
 * Removes all key-value entries from the map.
 *
 * @private
 * @name clear
 * @memberOf MapCache
 */


function mapCacheClear() {
  this.size = 0;
  this.__data__ = {
    'hash': new Hash(),
    'map': new (Map || ListCache)(),
    'string': new Hash()
  };
}
/**
 * Removes `key` and its value from the map.
 *
 * @private
 * @name delete
 * @memberOf MapCache
 * @param {string} key The key of the value to remove.
 * @returns {boolean} Returns `true` if the entry was removed, else `false`.
 */


function mapCacheDelete(key) {
  var result = getMapData(this, key)['delete'](key);
  this.size -= result ? 1 : 0;
  return result;
}
/**
 * Gets the map value for `key`.
 *
 * @private
 * @name get
 * @memberOf MapCache
 * @param {string} key The key of the value to get.
 * @returns {*} Returns the entry value.
 */


function mapCacheGet(key) {
  return getMapData(this, key).get(key);
}
/**
 * Checks if a map value for `key` exists.
 *
 * @private
 * @name has
 * @memberOf MapCache
 * @param {string} key The key of the entry to check.
 * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
 */


function mapCacheHas(key) {
  return getMapData(this, key).has(key);
}
/**
 * Sets the map `key` to `value`.
 *
 * @private
 * @name set
 * @memberOf MapCache
 * @param {string} key The key of the value to set.
 * @param {*} value The value to set.
 * @returns {Object} Returns the map cache instance.
 */


function mapCacheSet(key, value) {
  var data = getMapData(this, key),
      size = data.size;
  data.set(key, value);
  this.size += data.size == size ? 0 : 1;
  return this;
} // Add methods to `MapCache`.


MapCache.prototype.clear = mapCacheClear;
MapCache.prototype['delete'] = mapCacheDelete;
MapCache.prototype.get = mapCacheGet;
MapCache.prototype.has = mapCacheHas;
MapCache.prototype.set = mapCacheSet;
/**
 *
 * Creates an array cache object to store unique values.
 *
 * @private
 * @constructor
 * @param {Array} [values] The values to cache.
 */

function SetCache(values) {
  var index = -1,
      length = values == null ? 0 : values.length;
  this.__data__ = new MapCache();

  while (++index < length) {
    this.add(values[index]);
  }
}
/**
 * Adds `value` to the array cache.
 *
 * @private
 * @name add
 * @memberOf SetCache
 * @alias push
 * @param {*} value The value to cache.
 * @returns {Object} Returns the cache instance.
 */


function setCacheAdd(value) {
  this.__data__.set(value, HASH_UNDEFINED);

  return this;
}
/**
 * Checks if `value` is in the array cache.
 *
 * @private
 * @name has
 * @memberOf SetCache
 * @param {*} value The value to search for.
 * @returns {number} Returns `true` if `value` is found, else `false`.
 */


function setCacheHas(value) {
  return this.__data__.has(value);
} // Add methods to `SetCache`.


SetCache.prototype.add = SetCache.prototype.push = setCacheAdd;
SetCache.prototype.has = setCacheHas;
/**
 * Creates a stack cache object to store key-value pairs.
 *
 * @private
 * @constructor
 * @param {Array} [entries] The key-value pairs to cache.
 */

function Stack(entries) {
  var data = this.__data__ = new ListCache(entries);
  this.size = data.size;
}
/**
 * Removes all key-value entries from the stack.
 *
 * @private
 * @name clear
 * @memberOf Stack
 */


function stackClear() {
  this.__data__ = new ListCache();
  this.size = 0;
}
/**
 * Removes `key` and its value from the stack.
 *
 * @private
 * @name delete
 * @memberOf Stack
 * @param {string} key The key of the value to remove.
 * @returns {boolean} Returns `true` if the entry was removed, else `false`.
 */


function stackDelete(key) {
  var data = this.__data__,
      result = data['delete'](key);
  this.size = data.size;
  return result;
}
/**
 * Gets the stack value for `key`.
 *
 * @private
 * @name get
 * @memberOf Stack
 * @param {string} key The key of the value to get.
 * @returns {*} Returns the entry value.
 */


function stackGet(key) {
  return this.__data__.get(key);
}
/**
 * Checks if a stack value for `key` exists.
 *
 * @private
 * @name has
 * @memberOf Stack
 * @param {string} key The key of the entry to check.
 * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
 */


function stackHas(key) {
  return this.__data__.has(key);
}
/**
 * Sets the stack `key` to `value`.
 *
 * @private
 * @name set
 * @memberOf Stack
 * @param {string} key The key of the value to set.
 * @param {*} value The value to set.
 * @returns {Object} Returns the stack cache instance.
 */


function stackSet(key, value) {
  var data = this.__data__;

  if (data instanceof ListCache) {
    var pairs = data.__data__;

    if (!Map || pairs.length < LARGE_ARRAY_SIZE - 1) {
      pairs.push([key, value]);
      this.size = ++data.size;
      return this;
    }

    data = this.__data__ = new MapCache(pairs);
  }

  data.set(key, value);
  this.size = data.size;
  return this;
} // Add methods to `Stack`.


Stack.prototype.clear = stackClear;
Stack.prototype['delete'] = stackDelete;
Stack.prototype.get = stackGet;
Stack.prototype.has = stackHas;
Stack.prototype.set = stackSet;
/**
 * Creates an array of the enumerable property names of the array-like `value`.
 *
 * @private
 * @param {*} value The value to query.
 * @param {boolean} inherited Specify returning inherited property names.
 * @returns {Array} Returns the array of property names.
 */

function arrayLikeKeys(value, inherited) {
  var isArr = isArray(value),
      isArg = !isArr && isArguments(value),
      isBuff = !isArr && !isArg && isBuffer(value),
      isType = !isArr && !isArg && !isBuff && isTypedArray(value),
      skipIndexes = isArr || isArg || isBuff || isType,
      result = skipIndexes ? baseTimes(value.length, String) : [],
      length = result.length;

  for (var key in value) {
    if ((inherited || hasOwnProperty.call(value, key)) && !(skipIndexes && ( // Safari 9 has enumerable `arguments.length` in strict mode.
    key == 'length' || // Node.js 0.10 has enumerable non-index properties on buffers.
    isBuff && (key == 'offset' || key == 'parent') || // PhantomJS 2 has enumerable non-index properties on typed arrays.
    isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset') || // Skip index properties.
    isIndex(key, length)))) {
      result.push(key);
    }
  }

  return result;
}
/**
 * Gets the index at which the `key` is found in `array` of key-value pairs.
 *
 * @private
 * @param {Array} array The array to inspect.
 * @param {*} key The key to search for.
 * @returns {number} Returns the index of the matched value, else `-1`.
 */


function assocIndexOf(array, key) {
  var length = array.length;

  while (length--) {
    if (eq(array[length][0], key)) {
      return length;
    }
  }

  return -1;
}
/**
 * The base implementation of `getAllKeys` and `getAllKeysIn` which uses
 * `keysFunc` and `symbolsFunc` to get the enumerable property names and
 * symbols of `object`.
 *
 * @private
 * @param {Object} object The object to query.
 * @param {Function} keysFunc The function to get the keys of `object`.
 * @param {Function} symbolsFunc The function to get the symbols of `object`.
 * @returns {Array} Returns the array of property names and symbols.
 */


function baseGetAllKeys(object, keysFunc, symbolsFunc) {
  var result = keysFunc(object);
  return isArray(object) ? result : arrayPush(result, symbolsFunc(object));
}
/**
 * The base implementation of `getTag` without fallbacks for buggy environments.
 *
 * @private
 * @param {*} value The value to query.
 * @returns {string} Returns the `toStringTag`.
 */


function baseGetTag(value) {
  if (value == null) {
    return value === undefined ? undefinedTag : nullTag;
  }

  return symToStringTag && symToStringTag in Object(value) ? getRawTag(value) : objectToString(value);
}
/**
 * The base implementation of `_.isArguments`.
 *
 * @private
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is an `arguments` object,
 */


function baseIsArguments(value) {
  return isObjectLike(value) && baseGetTag(value) == argsTag;
}
/**
 * The base implementation of `_.isEqual` which supports partial comparisons
 * and tracks traversed objects.
 *
 * @private
 * @param {*} value The value to compare.
 * @param {*} other The other value to compare.
 * @param {boolean} bitmask The bitmask flags.
 *  1 - Unordered comparison
 *  2 - Partial comparison
 * @param {Function} [customizer] The function to customize comparisons.
 * @param {Object} [stack] Tracks traversed `value` and `other` objects.
 * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
 */


function baseIsEqual(value, other, bitmask, customizer, stack) {
  if (value === other) {
    return true;
  }

  if (value == null || other == null || !isObjectLike(value) && !isObjectLike(other)) {
    return value !== value && other !== other;
  }

  return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack);
}
/**
 * A specialized version of `baseIsEqual` for arrays and objects which performs
 * deep comparisons and tracks traversed objects enabling objects with circular
 * references to be compared.
 *
 * @private
 * @param {Object} object The object to compare.
 * @param {Object} other The other object to compare.
 * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
 * @param {Function} customizer The function to customize comparisons.
 * @param {Function} equalFunc The function to determine equivalents of values.
 * @param {Object} [stack] Tracks traversed `object` and `other` objects.
 * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
 */


function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) {
  var objIsArr = isArray(object),
      othIsArr = isArray(other),
      objTag = objIsArr ? arrayTag : getTag(object),
      othTag = othIsArr ? arrayTag : getTag(other);
  objTag = objTag == argsTag ? objectTag : objTag;
  othTag = othTag == argsTag ? objectTag : othTag;
  var objIsObj = objTag == objectTag,
      othIsObj = othTag == objectTag,
      isSameTag = objTag == othTag;

  if (isSameTag && isBuffer(object)) {
    if (!isBuffer(other)) {
      return false;
    }

    objIsArr = true;
    objIsObj = false;
  }

  if (isSameTag && !objIsObj) {
    stack || (stack = new Stack());
    return objIsArr || isTypedArray(object) ? equalArrays(object, other, bitmask, customizer, equalFunc, stack) : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack);
  }

  if (!(bitmask & COMPARE_PARTIAL_FLAG)) {
    var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'),
        othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__');

    if (objIsWrapped || othIsWrapped) {
      var objUnwrapped = objIsWrapped ? object.value() : object,
          othUnwrapped = othIsWrapped ? other.value() : other;
      stack || (stack = new Stack());
      return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack);
    }
  }

  if (!isSameTag) {
    return false;
  }

  stack || (stack = new Stack());
  return equalObjects(object, other, bitmask, customizer, equalFunc, stack);
}
/**
 * The base implementation of `_.isNative` without bad shim checks.
 *
 * @private
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is a native function,
 *  else `false`.
 */


function baseIsNative(value) {
  if (!isObject(value) || isMasked(value)) {
    return false;
  }

  var pattern = isFunction(value) ? reIsNative : reIsHostCtor;
  return pattern.test(toSource(value));
}
/**
 * The base implementation of `_.isTypedArray` without Node.js optimizations.
 *
 * @private
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.
 */


function baseIsTypedArray(value) {
  return isObjectLike(value) && isLength(value.length) && !!typedArrayTags[baseGetTag(value)];
}
/**
 * The base implementation of `_.keys` which doesn't treat sparse arrays as dense.
 *
 * @private
 * @param {Object} object The object to query.
 * @returns {Array} Returns the array of property names.
 */


function baseKeys(object) {
  if (!isPrototype(object)) {
    return nativeKeys(object);
  }

  var result = [];

  for (var key in Object(object)) {
    if (hasOwnProperty.call(object, key) && key != 'constructor') {
      result.push(key);
    }
  }

  return result;
}
/**
 * A specialized version of `baseIsEqualDeep` for arrays with support for
 * partial deep comparisons.
 *
 * @private
 * @param {Array} array The array to compare.
 * @param {Array} other The other array to compare.
 * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
 * @param {Function} customizer The function to customize comparisons.
 * @param {Function} equalFunc The function to determine equivalents of values.
 * @param {Object} stack Tracks traversed `array` and `other` objects.
 * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`.
 */


function equalArrays(array, other, bitmask, customizer, equalFunc, stack) {
  var isPartial = bitmask & COMPARE_PARTIAL_FLAG,
      arrLength = array.length,
      othLength = other.length;

  if (arrLength != othLength && !(isPartial && othLength > arrLength)) {
    return false;
  } // Assume cyclic values are equal.


  var stacked = stack.get(array);

  if (stacked && stack.get(other)) {
    return stacked == other;
  }

  var index = -1,
      result = true,
      seen = bitmask & COMPARE_UNORDERED_FLAG ? new SetCache() : undefined;
  stack.set(array, other);
  stack.set(other, array); // Ignore non-index properties.

  while (++index < arrLength) {
    var arrValue = array[index],
        othValue = other[index];

    if (customizer) {
      var compared = isPartial ? customizer(othValue, arrValue, index, other, array, stack) : customizer(arrValue, othValue, index, array, other, stack);
    }

    if (compared !== undefined) {
      if (compared) {
        continue;
      }

      result = false;
      break;
    } // Recursively compare arrays (susceptible to call stack limits).


    if (seen) {
      if (!arraySome(other, function (othValue, othIndex) {
        if (!cacheHas(seen, othIndex) && (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) {
          return seen.push(othIndex);
        }
      })) {
        result = false;
        break;
      }
    } else if (!(arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) {
      result = false;
      break;
    }
  }

  stack['delete'](array);
  stack['delete'](other);
  return result;
}
/**
 * A specialized version of `baseIsEqualDeep` for comparing objects of
 * the same `toStringTag`.
 *
 * **Note:** This function only supports comparing values with tags of
 * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`.
 *
 * @private
 * @param {Object} object The object to compare.
 * @param {Object} other The other object to compare.
 * @param {string} tag The `toStringTag` of the objects to compare.
 * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
 * @param {Function} customizer The function to customize comparisons.
 * @param {Function} equalFunc The function to determine equivalents of values.
 * @param {Object} stack Tracks traversed `object` and `other` objects.
 * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
 */


function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) {
  switch (tag) {
    case dataViewTag:
      if (object.byteLength != other.byteLength || object.byteOffset != other.byteOffset) {
        return false;
      }

      object = object.buffer;
      other = other.buffer;

    case arrayBufferTag:
      if (object.byteLength != other.byteLength || !equalFunc(new Uint8Array(object), new Uint8Array(other))) {
        return false;
      }

      return true;

    case boolTag:
    case dateTag:
    case numberTag:
      // Coerce booleans to `1` or `0` and dates to milliseconds.
      // Invalid dates are coerced to `NaN`.
      return eq(+object, +other);

    case errorTag:
      return object.name == other.name && object.message == other.message;

    case regexpTag:
    case stringTag:
      // Coerce regexes to strings and treat strings, primitives and objects,
      // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring
      // for more details.
      return object == other + '';

    case mapTag:
      var convert = mapToArray;

    case setTag:
      var isPartial = bitmask & COMPARE_PARTIAL_FLAG;
      convert || (convert = setToArray);

      if (object.size != other.size && !isPartial) {
        return false;
      } // Assume cyclic values are equal.


      var stacked = stack.get(object);

      if (stacked) {
        return stacked == other;
      }

      bitmask |= COMPARE_UNORDERED_FLAG; // Recursively compare objects (susceptible to call stack limits).

      stack.set(object, other);
      var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack);
      stack['delete'](object);
      return result;

    case symbolTag:
      if (symbolValueOf) {
        return symbolValueOf.call(object) == symbolValueOf.call(other);
      }

  }

  return false;
}
/**
 * A specialized version of `baseIsEqualDeep` for objects with support for
 * partial deep comparisons.
 *
 * @private
 * @param {Object} object The object to compare.
 * @param {Object} other The other object to compare.
 * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
 * @param {Function} customizer The function to customize comparisons.
 * @param {Function} equalFunc The function to determine equivalents of values.
 * @param {Object} stack Tracks traversed `object` and `other` objects.
 * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
 */


function equalObjects(object, other, bitmask, customizer, equalFunc, stack) {
  var isPartial = bitmask & COMPARE_PARTIAL_FLAG,
      objProps = getAllKeys(object),
      objLength = objProps.length,
      othProps = getAllKeys(other),
      othLength = othProps.length;

  if (objLength != othLength && !isPartial) {
    return false;
  }

  var index = objLength;

  while (index--) {
    var key = objProps[index];

    if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) {
      return false;
    }
  } // Assume cyclic values are equal.


  var stacked = stack.get(object);

  if (stacked && stack.get(other)) {
    return stacked == other;
  }

  var result = true;
  stack.set(object, other);
  stack.set(other, object);
  var skipCtor = isPartial;

  while (++index < objLength) {
    key = objProps[index];
    var objValue = object[key],
        othValue = other[key];

    if (customizer) {
      var compared = isPartial ? customizer(othValue, objValue, key, other, object, stack) : customizer(objValue, othValue, key, object, other, stack);
    } // Recursively compare objects (susceptible to call stack limits).


    if (!(compared === undefined ? objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack) : compared)) {
      result = false;
      break;
    }

    skipCtor || (skipCtor = key == 'constructor');
  }

  if (result && !skipCtor) {
    var objCtor = object.constructor,
        othCtor = other.constructor; // Non `Object` object instances with different constructors are not equal.

    if (objCtor != othCtor && 'constructor' in object && 'constructor' in other && !(typeof objCtor == 'function' && objCtor instanceof objCtor && typeof othCtor == 'function' && othCtor instanceof othCtor)) {
      result = false;
    }
  }

  stack['delete'](object);
  stack['delete'](other);
  return result;
}
/**
 * Creates an array of own enumerable property names and symbols of `object`.
 *
 * @private
 * @param {Object} object The object to query.
 * @returns {Array} Returns the array of property names and symbols.
 */


function getAllKeys(object) {
  return baseGetAllKeys(object, keys, getSymbols);
}
/**
 * Gets the data for `map`.
 *
 * @private
 * @param {Object} map The map to query.
 * @param {string} key The reference key.
 * @returns {*} Returns the map data.
 */


function getMapData(map, key) {
  var data = map.__data__;
  return isKeyable(key) ? data[typeof key == 'string' ? 'string' : 'hash'] : data.map;
}
/**
 * Gets the native function at `key` of `object`.
 *
 * @private
 * @param {Object} object The object to query.
 * @param {string} key The key of the method to get.
 * @returns {*} Returns the function if it's native, else `undefined`.
 */


function getNative(object, key) {
  var value = getValue(object, key);
  return baseIsNative(value) ? value : undefined;
}
/**
 * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values.
 *
 * @private
 * @param {*} value The value to query.
 * @returns {string} Returns the raw `toStringTag`.
 */


function getRawTag(value) {
  var isOwn = hasOwnProperty.call(value, symToStringTag),
      tag = value[symToStringTag];

  try {
    value[symToStringTag] = undefined;
    var unmasked = true;
  } catch (e) {}

  var result = nativeObjectToString.call(value);

  if (unmasked) {
    if (isOwn) {
      value[symToStringTag] = tag;
    } else {
      delete value[symToStringTag];
    }
  }

  return result;
}
/**
 * Creates an array of the own enumerable symbols of `object`.
 *
 * @private
 * @param {Object} object The object to query.
 * @returns {Array} Returns the array of symbols.
 */


var getSymbols = !nativeGetSymbols ? stubArray : function (object) {
  if (object == null) {
    return [];
  }

  object = Object(object);
  return arrayFilter(nativeGetSymbols(object), function (symbol) {
    return propertyIsEnumerable.call(object, symbol);
  });
};
/**
 * Gets the `toStringTag` of `value`.
 *
 * @private
 * @param {*} value The value to query.
 * @returns {string} Returns the `toStringTag`.
 */

var getTag = baseGetTag; // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6.

if (DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag || Map && getTag(new Map()) != mapTag || Promise && getTag(Promise.resolve()) != promiseTag || Set && getTag(new Set()) != setTag || WeakMap && getTag(new WeakMap()) != weakMapTag) {
  getTag = function getTag(value) {
    var result = baseGetTag(value),
        Ctor = result == objectTag ? value.constructor : undefined,
        ctorString = Ctor ? toSource(Ctor) : '';

    if (ctorString) {
      switch (ctorString) {
        case dataViewCtorString:
          return dataViewTag;

        case mapCtorString:
          return mapTag;

        case promiseCtorString:
          return promiseTag;

        case setCtorString:
          return setTag;

        case weakMapCtorString:
          return weakMapTag;
      }
    }

    return result;
  };
}
/**
 * Checks if `value` is a valid array-like index.
 *
 * @private
 * @param {*} value The value to check.
 * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.
 * @returns {boolean} Returns `true` if `value` is a valid index, else `false`.
 */


function isIndex(value, length) {
  length = length == null ? MAX_SAFE_INTEGER : length;
  return !!length && (typeof value == 'number' || reIsUint.test(value)) && value > -1 && value % 1 == 0 && value < length;
}
/**
 * Checks if `value` is suitable for use as unique object key.
 *
 * @private
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is suitable, else `false`.
 */


function isKeyable(value) {
  var type = _typeof(value);

  return type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean' ? value !== '__proto__' : value === null;
}
/**
 * Checks if `func` has its source masked.
 *
 * @private
 * @param {Function} func The function to check.
 * @returns {boolean} Returns `true` if `func` is masked, else `false`.
 */


function isMasked(func) {
  return !!maskSrcKey && maskSrcKey in func;
}
/**
 * Checks if `value` is likely a prototype object.
 *
 * @private
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is a prototype, else `false`.
 */


function isPrototype(value) {
  var Ctor = value && value.constructor,
      proto = typeof Ctor == 'function' && Ctor.prototype || objectProto;
  return value === proto;
}
/**
 * Converts `value` to a string using `Object.prototype.toString`.
 *
 * @private
 * @param {*} value The value to convert.
 * @returns {string} Returns the converted string.
 */


function objectToString(value) {
  return nativeObjectToString.call(value);
}
/**
 * Converts `func` to its source code.
 *
 * @private
 * @param {Function} func The function to convert.
 * @returns {string} Returns the source code.
 */


function toSource(func) {
  if (func != null) {
    try {
      return funcToString.call(func);
    } catch (e) {}

    try {
      return func + '';
    } catch (e) {}
  }

  return '';
}
/**
 * Performs a
 * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
 * comparison between two values to determine if they are equivalent.
 *
 * @static
 * @memberOf _
 * @since 4.0.0
 * @category Lang
 * @param {*} value The value to compare.
 * @param {*} other The other value to compare.
 * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
 * @example
 *
 * var object = { 'a': 1 };
 * var other = { 'a': 1 };
 *
 * _.eq(object, object);
 * // => true
 *
 * _.eq(object, other);
 * // => false
 *
 * _.eq('a', 'a');
 * // => true
 *
 * _.eq('a', Object('a'));
 * // => false
 *
 * _.eq(NaN, NaN);
 * // => true
 */


function eq(value, other) {
  return value === other || value !== value && other !== other;
}
/**
 * Checks if `value` is likely an `arguments` object.
 *
 * @static
 * @memberOf _
 * @since 0.1.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is an `arguments` object,
 *  else `false`.
 * @example
 *
 * _.isArguments(function() { return arguments; }());
 * // => true
 *
 * _.isArguments([1, 2, 3]);
 * // => false
 */


var isArguments = baseIsArguments(function () {
  return arguments;
}()) ? baseIsArguments : function (value) {
  return isObjectLike(value) && hasOwnProperty.call(value, 'callee') && !propertyIsEnumerable.call(value, 'callee');
};
/**
 * Checks if `value` is classified as an `Array` object.
 *
 * @static
 * @memberOf _
 * @since 0.1.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is an array, else `false`.
 * @example
 *
 * _.isArray([1, 2, 3]);
 * // => true
 *
 * _.isArray(document.body.children);
 * // => false
 *
 * _.isArray('abc');
 * // => false
 *
 * _.isArray(_.noop);
 * // => false
 */

var isArray = Array.isArray;
/**
 * Checks if `value` is array-like. A value is considered array-like if it's
 * not a function and has a `value.length` that's an integer greater than or
 * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`.
 *
 * @static
 * @memberOf _
 * @since 4.0.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is array-like, else `false`.
 * @example
 *
 * _.isArrayLike([1, 2, 3]);
 * // => true
 *
 * _.isArrayLike(document.body.children);
 * // => true
 *
 * _.isArrayLike('abc');
 * // => true
 *
 * _.isArrayLike(_.noop);
 * // => false
 */

function isArrayLike(value) {
  return value != null && isLength(value.length) && !isFunction(value);
}
/**
 * Checks if `value` is a buffer.
 *
 * @static
 * @memberOf _
 * @since 4.3.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is a buffer, else `false`.
 * @example
 *
 * _.isBuffer(new Buffer(2));
 * // => true
 *
 * _.isBuffer(new Uint8Array(2));
 * // => false
 */


var isBuffer = nativeIsBuffer || stubFalse;
/**
 * Performs a deep comparison between two values to determine if they are
 * equivalent.
 *
 * **Note:** This method supports comparing arrays, array buffers, booleans,
 * date objects, error objects, maps, numbers, `Object` objects, regexes,
 * sets, strings, symbols, and typed arrays. `Object` objects are compared
 * by their own, not inherited, enumerable properties. Functions and DOM
 * nodes are compared by strict equality, i.e. `===`.
 *
 * @static
 * @memberOf _
 * @since 0.1.0
 * @category Lang
 * @param {*} value The value to compare.
 * @param {*} other The other value to compare.
 * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
 * @example
 *
 * var object = { 'a': 1 };
 * var other = { 'a': 1 };
 *
 * _.isEqual(object, other);
 * // => true
 *
 * object === other;
 * // => false
 */

function isEqual(value, other) {
  return baseIsEqual(value, other);
}
/**
 * Checks if `value` is classified as a `Function` object.
 *
 * @static
 * @memberOf _
 * @since 0.1.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is a function, else `false`.
 * @example
 *
 * _.isFunction(_);
 * // => true
 *
 * _.isFunction(/abc/);
 * // => false
 */


function isFunction(value) {
  if (!isObject(value)) {
    return false;
  } // The use of `Object#toString` avoids issues with the `typeof` operator
  // in Safari 9 which returns 'object' for typed arrays and other constructors.


  var tag = baseGetTag(value);
  return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag;
}
/**
 * Checks if `value` is a valid array-like length.
 *
 * **Note:** This method is loosely based on
 * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).
 *
 * @static
 * @memberOf _
 * @since 4.0.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.
 * @example
 *
 * _.isLength(3);
 * // => true
 *
 * _.isLength(Number.MIN_VALUE);
 * // => false
 *
 * _.isLength(Infinity);
 * // => false
 *
 * _.isLength('3');
 * // => false
 */


function isLength(value) {
  return typeof value == 'number' && value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;
}
/**
 * Checks if `value` is the
 * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)
 * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
 *
 * @static
 * @memberOf _
 * @since 0.1.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is an object, else `false`.
 * @example
 *
 * _.isObject({});
 * // => true
 *
 * _.isObject([1, 2, 3]);
 * // => true
 *
 * _.isObject(_.noop);
 * // => true
 *
 * _.isObject(null);
 * // => false
 */


function isObject(value) {
  var type = _typeof(value);

  return value != null && (type == 'object' || type == 'function');
}
/**
 * Checks if `value` is object-like. A value is object-like if it's not `null`
 * and has a `typeof` result of "object".
 *
 * @static
 * @memberOf _
 * @since 4.0.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is object-like, else `false`.
 * @example
 *
 * _.isObjectLike({});
 * // => true
 *
 * _.isObjectLike([1, 2, 3]);
 * // => true
 *
 * _.isObjectLike(_.noop);
 * // => false
 *
 * _.isObjectLike(null);
 * // => false
 */


function isObjectLike(value) {
  return value != null && _typeof(value) == 'object';
}
/**
 * Checks if `value` is classified as a typed array.
 *
 * @static
 * @memberOf _
 * @since 3.0.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.
 * @example
 *
 * _.isTypedArray(new Uint8Array);
 * // => true
 *
 * _.isTypedArray([]);
 * // => false
 */


var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray;
/**
 * Creates an array of the own enumerable property names of `object`.
 *
 * **Note:** Non-object values are coerced to objects. See the
 * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)
 * for more details.
 *
 * @static
 * @since 0.1.0
 * @memberOf _
 * @category Object
 * @param {Object} object The object to query.
 * @returns {Array} Returns the array of property names.
 * @example
 *
 * function Foo() {
 *   this.a = 1;
 *   this.b = 2;
 * }
 *
 * Foo.prototype.c = 3;
 *
 * _.keys(new Foo);
 * // => ['a', 'b'] (iteration order is not guaranteed)
 *
 * _.keys('hi');
 * // => ['0', '1']
 */

function keys(object) {
  return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object);
}
/**
 * This method returns a new empty array.
 *
 * @static
 * @memberOf _
 * @since 4.13.0
 * @category Util
 * @returns {Array} Returns the new empty array.
 * @example
 *
 * var arrays = _.times(2, _.stubArray);
 *
 * console.log(arrays);
 * // => [[], []]
 *
 * console.log(arrays[0] === arrays[1]);
 * // => false
 */


function stubArray() {
  return [];
}
/**
 * This method returns `false`.
 *
 * @static
 * @memberOf _
 * @since 4.13.0
 * @category Util
 * @returns {boolean} Returns `false`.
 * @example
 *
 * _.times(2, _.stubFalse);
 * // => [false, false]
 */


function stubFalse() {
  return false;
}

module.exports = isEqual;
/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(50), __webpack_require__(46)(module)))

/***/ }),
/* 39 */
/***/ (function(module, exports) {

function _typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }

/**
 * Expose `pathToRegexp`.
 */
module.exports = pathToRegexp;
module.exports.parse = parse;
module.exports.compile = compile;
module.exports.tokensToFunction = tokensToFunction;
module.exports.tokensToRegExp = tokensToRegExp;
/**
 * Default configs.
 */

var DEFAULT_DELIMITER = '/';
var DEFAULT_DELIMITERS = './';
/**
 * The main path matching regexp utility.
 *
 * @type {RegExp}
 */

var PATH_REGEXP = new RegExp([// Match escaped characters that would otherwise appear in future matches.
// This allows the user to escape special characters that won't transform.
'(\\\\.)', // Match Express-style parameters and un-named parameters with a prefix
// and optional suffixes. Matches appear as:
//
// ":test(\\d+)?" => ["test", "\d+", undefined, "?"]
// "(\\d+)"  => [undefined, undefined, "\d+", undefined]
'(?:\\:(\\w+)(?:\\(((?:\\\\.|[^\\\\()])+)\\))?|\\(((?:\\\\.|[^\\\\()])+)\\))([+*?])?'].join('|'), 'g');
/**
 * Parse a string for the raw tokens.
 *
 * @param  {string}  str
 * @param  {Object=} options
 * @return {!Array}
 */

function parse(str, options) {
  var tokens = [];
  var key = 0;
  var index = 0;
  var path = '';
  var defaultDelimiter = options && options.delimiter || DEFAULT_DELIMITER;
  var delimiters = options && options.delimiters || DEFAULT_DELIMITERS;
  var pathEscaped = false;
  var res;

  while ((res = PATH_REGEXP.exec(str)) !== null) {
    var m = res[0];
    var escaped = res[1];
    var offset = res.index;
    path += str.slice(index, offset);
    index = offset + m.length; // Ignore already escaped sequences.

    if (escaped) {
      path += escaped[1];
      pathEscaped = true;
      continue;
    }

    var prev = '';
    var next = str[index];
    var name = res[2];
    var capture = res[3];
    var group = res[4];
    var modifier = res[5];

    if (!pathEscaped && path.length) {
      var k = path.length - 1;

      if (delimiters.indexOf(path[k]) > -1) {
        prev = path[k];
        path = path.slice(0, k);
      }
    } // Push the current path onto the tokens.


    if (path) {
      tokens.push(path);
      path = '';
      pathEscaped = false;
    }

    var partial = prev !== '' && next !== undefined && next !== prev;
    var repeat = modifier === '+' || modifier === '*';
    var optional = modifier === '?' || modifier === '*';
    var delimiter = prev || defaultDelimiter;
    var pattern = capture || group;
    tokens.push({
      name: name || key++,
      prefix: prev,
      delimiter: delimiter,
      optional: optional,
      repeat: repeat,
      partial: partial,
      pattern: pattern ? escapeGroup(pattern) : '[^' + escapeString(delimiter) + ']+?'
    });
  } // Push any remaining characters.


  if (path || index < str.length) {
    tokens.push(path + str.substr(index));
  }

  return tokens;
}
/**
 * Compile a string to a template function for the path.
 *
 * @param  {string}             str
 * @param  {Object=}            options
 * @return {!function(Object=, Object=)}
 */


function compile(str, options) {
  return tokensToFunction(parse(str, options));
}
/**
 * Expose a method for transforming tokens into the path function.
 */


function tokensToFunction(tokens) {
  // Compile all the tokens into regexps.
  var matches = new Array(tokens.length); // Compile all the patterns before compilation.

  for (var i = 0; i < tokens.length; i++) {
    if (_typeof(tokens[i]) === 'object') {
      matches[i] = new RegExp('^(?:' + tokens[i].pattern + ')$');
    }
  }

  return function (data, options) {
    var path = '';
    var encode = options && options.encode || encodeURIComponent;

    for (var i = 0; i < tokens.length; i++) {
      var token = tokens[i];

      if (typeof token === 'string') {
        path += token;
        continue;
      }

      var value = data ? data[token.name] : undefined;
      var segment;

      if (Array.isArray(value)) {
        if (!token.repeat) {
          throw new TypeError('Expected "' + token.name + '" to not repeat, but got array');
        }

        if (value.length === 0) {
          if (token.optional) continue;
          throw new TypeError('Expected "' + token.name + '" to not be empty');
        }

        for (var j = 0; j < value.length; j++) {
          segment = encode(value[j], token);

          if (!matches[i].test(segment)) {
            throw new TypeError('Expected all "' + token.name + '" to match "' + token.pattern + '"');
          }

          path += (j === 0 ? token.prefix : token.delimiter) + segment;
        }

        continue;
      }

      if (typeof value === 'string' || typeof value === 'number' || typeof value === 'boolean') {
        segment = encode(String(value), token);

        if (!matches[i].test(segment)) {
          throw new TypeError('Expected "' + token.name + '" to match "' + token.pattern + '", but got "' + segment + '"');
        }

        path += token.prefix + segment;
        continue;
      }

      if (token.optional) {
        // Prepend partial segment prefixes.
        if (token.partial) path += token.prefix;
        continue;
      }

      throw new TypeError('Expected "' + token.name + '" to be ' + (token.repeat ? 'an array' : 'a string'));
    }

    return path;
  };
}
/**
 * Escape a regular expression string.
 *
 * @param  {string} str
 * @return {string}
 */


function escapeString(str) {
  return str.replace(/([.+*?=^!:${}()[\]|/\\])/g, '\\$1');
}
/**
 * Escape the capturing group by escaping special characters and meaning.
 *
 * @param  {string} group
 * @return {string}
 */


function escapeGroup(group) {
  return group.replace(/([=!:$/()])/g, '\\$1');
}
/**
 * Get the flags for a regexp from the options.
 *
 * @param  {Object} options
 * @return {string}
 */


function flags(options) {
  return options && options.sensitive ? '' : 'i';
}
/**
 * Pull out keys from a regexp.
 *
 * @param  {!RegExp} path
 * @param  {Array=}  keys
 * @return {!RegExp}
 */


function regexpToRegexp(path, keys) {
  if (!keys) return path; // Use a negative lookahead to match only capturing groups.

  var groups = path.source.match(/\((?!\?)/g);

  if (groups) {
    for (var i = 0; i < groups.length; i++) {
      keys.push({
        name: i,
        prefix: null,
        delimiter: null,
        optional: false,
        repeat: false,
        partial: false,
        pattern: null
      });
    }
  }

  return path;
}
/**
 * Transform an array into a regexp.
 *
 * @param  {!Array}  path
 * @param  {Array=}  keys
 * @param  {Object=} options
 * @return {!RegExp}
 */


function arrayToRegexp(path, keys, options) {
  var parts = [];

  for (var i = 0; i < path.length; i++) {
    parts.push(pathToRegexp(path[i], keys, options).source);
  }

  return new RegExp('(?:' + parts.join('|') + ')', flags(options));
}
/**
 * Create a path regexp from string input.
 *
 * @param  {string}  path
 * @param  {Array=}  keys
 * @param  {Object=} options
 * @return {!RegExp}
 */


function stringToRegexp(path, keys, options) {
  return tokensToRegExp(parse(path, options), keys, options);
}
/**
 * Expose a function for taking tokens and returning a RegExp.
 *
 * @param  {!Array}  tokens
 * @param  {Array=}  keys
 * @param  {Object=} options
 * @return {!RegExp}
 */


function tokensToRegExp(tokens, keys, options) {
  options = options || {};
  var strict = options.strict;
  var start = options.start !== false;
  var end = options.end !== false;
  var delimiter = escapeString(options.delimiter || DEFAULT_DELIMITER);
  var delimiters = options.delimiters || DEFAULT_DELIMITERS;
  var endsWith = [].concat(options.endsWith || []).map(escapeString).concat('$').join('|');
  var route = start ? '^' : '';
  var isEndDelimited = tokens.length === 0; // Iterate over the tokens and create our regexp string.

  for (var i = 0; i < tokens.length; i++) {
    var token = tokens[i];

    if (typeof token === 'string') {
      route += escapeString(token);
      isEndDelimited = i === tokens.length - 1 && delimiters.indexOf(token[token.length - 1]) > -1;
    } else {
      var capture = token.repeat ? '(?:' + token.pattern + ')(?:' + escapeString(token.delimiter) + '(?:' + token.pattern + '))*' : token.pattern;
      if (keys) keys.push(token);

      if (token.optional) {
        if (token.partial) {
          route += escapeString(token.prefix) + '(' + capture + ')?';
        } else {
          route += '(?:' + escapeString(token.prefix) + '(' + capture + '))?';
        }
      } else {
        route += escapeString(token.prefix) + '(' + capture + ')';
      }
    }
  }

  if (end) {
    if (!strict) route += '(?:' + delimiter + ')?';
    route += endsWith === '$' ? '$' : '(?=' + endsWith + ')';
  } else {
    if (!strict) route += '(?:' + delimiter + '(?=' + endsWith + '))?';
    if (!isEndDelimited) route += '(?=' + delimiter + '|' + endsWith + ')';
  }

  return new RegExp(route, flags(options));
}
/**
 * Normalize the given path string, returning a regular expression.
 *
 * An empty array can be passed in for the keys, which will hold the
 * placeholder key descriptions. For example, using `/user/:id`, `keys` will
 * contain `[{ name: 'id', delimiter: '/', optional: false, repeat: false }]`.
 *
 * @param  {(string|RegExp|Array)} path
 * @param  {Array=}                keys
 * @param  {Object=}               options
 * @return {!RegExp}
 */


function pathToRegexp(path, keys, options) {
  if (path instanceof RegExp) {
    return regexpToRegexp(path, keys);
  }

  if (Array.isArray(path)) {
    return arrayToRegexp(
    /** @type {!Array} */
    path, keys, options);
  }

  return stringToRegexp(
  /** @type {string} */
  path, keys, options);
}

/***/ }),
/* 40 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var stringify = __webpack_require__(164);

var parse = __webpack_require__(165);

var formats = __webpack_require__(76);

module.exports = {
  formats: formats,
  parse: parse,
  stringify: stringify
};

/***/ }),
/* 41 */
/***/ (function(module, exports, __webpack_require__) {

var getPrototypeOf = __webpack_require__(58);

var isNativeReflectConstruct = __webpack_require__(92);

var possibleConstructorReturn = __webpack_require__(59);

function _createSuper(Derived) {
  var hasNativeReflectConstruct = isNativeReflectConstruct();
  return function _createSuperInternal() {
    var Super = getPrototypeOf(Derived),
        result;

    if (hasNativeReflectConstruct) {
      var NewTarget = getPrototypeOf(this).constructor;
      result = Reflect.construct(Super, arguments, NewTarget);
    } else {
      result = Super.apply(this, arguments);
    }

    return possibleConstructorReturn(this, result);
  };
}

module.exports = _createSuper;

/***/ }),
/* 42 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";
/* WEBPACK VAR INJECTION */(function(process) {var isNode = typeof process !== 'undefined' && process.versions != null && process.versions.node != null;

var isBrowser = function isBrowser() {
  return typeof window !== 'undefined' && typeof window.document !== 'undefined' && !isNode;
};

/* harmony default export */ __webpack_exports__["a"] = (isBrowser);
/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(48)))

/***/ }),
/* 43 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";
/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _unsupportedIterableToArray; });
/* harmony import */ var _arrayLikeToArray__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(37);

function _unsupportedIterableToArray(o, minLen) {
  if (!o) return;
  if (typeof o === "string") return Object(_arrayLikeToArray__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])(o, minLen);
  var n = Object.prototype.toString.call(o).slice(8, -1);
  if (n === "Object" && o.constructor) n = o.constructor.name;
  if (n === "Map" || n === "Set") return Array.from(o);
  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return Object(_arrayLikeToArray__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])(o, minLen);
}

/***/ }),
/* 44 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


if (true) {
  module.exports = __webpack_require__(88);
} else {}

/***/ }),
/* 45 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";
/* WEBPACK VAR INJECTION */(function(global) {/**
 * A collection of shims that provide minimal functionality of the ES6 collections.
 *
 * These implementations are not meant to be used outside of the ResizeObserver
 * modules as they cover only a limited range of use cases.
 */

/* eslint-disable require-jsdoc, valid-jsdoc */
var MapShim = function () {
  if (typeof Map !== 'undefined') {
    return Map;
  }
  /**
   * Returns index in provided array that matches the specified key.
   *
   * @param {Array<Array>} arr
   * @param {*} key
   * @returns {number}
   */


  function getIndex(arr, key) {
    var result = -1;
    arr.some(function (entry, index) {
      if (entry[0] === key) {
        result = index;
        return true;
      }

      return false;
    });
    return result;
  }

  return (
    /** @class */
    function () {
      function class_1() {
        this.__entries__ = [];
      }

      Object.defineProperty(class_1.prototype, "size", {
        /**
         * @returns {boolean}
         */
        get: function get() {
          return this.__entries__.length;
        },
        enumerable: true,
        configurable: true
      });
      /**
       * @param {*} key
       * @returns {*}
       */

      class_1.prototype.get = function (key) {
        var index = getIndex(this.__entries__, key);
        var entry = this.__entries__[index];
        return entry && entry[1];
      };
      /**
       * @param {*} key
       * @param {*} value
       * @returns {void}
       */


      class_1.prototype.set = function (key, value) {
        var index = getIndex(this.__entries__, key);

        if (~index) {
          this.__entries__[index][1] = value;
        } else {
          this.__entries__.push([key, value]);
        }
      };
      /**
       * @param {*} key
       * @returns {void}
       */


      class_1.prototype.delete = function (key) {
        var entries = this.__entries__;
        var index = getIndex(entries, key);

        if (~index) {
          entries.splice(index, 1);
        }
      };
      /**
       * @param {*} key
       * @returns {void}
       */


      class_1.prototype.has = function (key) {
        return !!~getIndex(this.__entries__, key);
      };
      /**
       * @returns {void}
       */


      class_1.prototype.clear = function () {
        this.__entries__.splice(0);
      };
      /**
       * @param {Function} callback
       * @param {*} [ctx=null]
       * @returns {void}
       */


      class_1.prototype.forEach = function (callback, ctx) {
        if (ctx === void 0) {
          ctx = null;
        }

        for (var _i = 0, _a = this.__entries__; _i < _a.length; _i++) {
          var entry = _a[_i];
          callback.call(ctx, entry[1], entry[0]);
        }
      };

      return class_1;
    }()
  );
}();
/**
 * Detects whether window and document objects are available in current environment.
 */


var isBrowser = typeof window !== 'undefined' && typeof document !== 'undefined' && window.document === document; // Returns global object of a current environment.

var global$1 = function () {
  if (typeof global !== 'undefined' && global.Math === Math) {
    return global;
  }

  if (typeof self !== 'undefined' && self.Math === Math) {
    return self;
  }

  if (typeof window !== 'undefined' && window.Math === Math) {
    return window;
  } // eslint-disable-next-line no-new-func


  return Function('return this')();
}();
/**
 * A shim for the requestAnimationFrame which falls back to the setTimeout if
 * first one is not supported.
 *
 * @returns {number} Requests' identifier.
 */


var requestAnimationFrame$1 = function () {
  if (typeof requestAnimationFrame === 'function') {
    // It's required to use a bounded function because IE sometimes throws
    // an "Invalid calling object" error if rAF is invoked without the global
    // object on the left hand side.
    return requestAnimationFrame.bind(global$1);
  }

  return function (callback) {
    return setTimeout(function () {
      return callback(Date.now());
    }, 1000 / 60);
  };
}(); // Defines minimum timeout before adding a trailing call.


var trailingTimeout = 2;
/**
 * Creates a wrapper function which ensures that provided callback will be
 * invoked only once during the specified delay period.
 *
 * @param {Function} callback - Function to be invoked after the delay period.
 * @param {number} delay - Delay after which to invoke callback.
 * @returns {Function}
 */

function throttle(callback, delay) {
  var leadingCall = false,
      trailingCall = false,
      lastCallTime = 0;
  /**
   * Invokes the original callback function and schedules new invocation if
   * the "proxy" was called during current request.
   *
   * @returns {void}
   */

  function resolvePending() {
    if (leadingCall) {
      leadingCall = false;
      callback();
    }

    if (trailingCall) {
      proxy();
    }
  }
  /**
   * Callback invoked after the specified delay. It will further postpone
   * invocation of the original function delegating it to the
   * requestAnimationFrame.
   *
   * @returns {void}
   */


  function timeoutCallback() {
    requestAnimationFrame$1(resolvePending);
  }
  /**
   * Schedules invocation of the original function.
   *
   * @returns {void}
   */


  function proxy() {
    var timeStamp = Date.now();

    if (leadingCall) {
      // Reject immediately following calls.
      if (timeStamp - lastCallTime < trailingTimeout) {
        return;
      } // Schedule new call to be in invoked when the pending one is resolved.
      // This is important for "transitions" which never actually start
      // immediately so there is a chance that we might miss one if change
      // happens amids the pending invocation.


      trailingCall = true;
    } else {
      leadingCall = true;
      trailingCall = false;
      setTimeout(timeoutCallback, delay);
    }

    lastCallTime = timeStamp;
  }

  return proxy;
} // Minimum delay before invoking the update of observers.


var REFRESH_DELAY = 20; // A list of substrings of CSS properties used to find transition events that
// might affect dimensions of observed elements.

var transitionKeys = ['top', 'right', 'bottom', 'left', 'width', 'height', 'size', 'weight']; // Check if MutationObserver is available.

var mutationObserverSupported = typeof MutationObserver !== 'undefined';
/**
 * Singleton controller class which handles updates of ResizeObserver instances.
 */

var ResizeObserverController =
/** @class */
function () {
  /**
   * Creates a new instance of ResizeObserverController.
   *
   * @private
   */
  function ResizeObserverController() {
    /**
     * Indicates whether DOM listeners have been added.
     *
     * @private {boolean}
     */
    this.connected_ = false;
    /**
     * Tells that controller has subscribed for Mutation Events.
     *
     * @private {boolean}
     */

    this.mutationEventsAdded_ = false;
    /**
     * Keeps reference to the instance of MutationObserver.
     *
     * @private {MutationObserver}
     */

    this.mutationsObserver_ = null;
    /**
     * A list of connected observers.
     *
     * @private {Array<ResizeObserverSPI>}
     */

    this.observers_ = [];
    this.onTransitionEnd_ = this.onTransitionEnd_.bind(this);
    this.refresh = throttle(this.refresh.bind(this), REFRESH_DELAY);
  }
  /**
   * Adds observer to observers list.
   *
   * @param {ResizeObserverSPI} observer - Observer to be added.
   * @returns {void}
   */


  ResizeObserverController.prototype.addObserver = function (observer) {
    if (!~this.observers_.indexOf(observer)) {
      this.observers_.push(observer);
    } // Add listeners if they haven't been added yet.


    if (!this.connected_) {
      this.connect_();
    }
  };
  /**
   * Removes observer from observers list.
   *
   * @param {ResizeObserverSPI} observer - Observer to be removed.
   * @returns {void}
   */


  ResizeObserverController.prototype.removeObserver = function (observer) {
    var observers = this.observers_;
    var index = observers.indexOf(observer); // Remove observer if it's present in registry.

    if (~index) {
      observers.splice(index, 1);
    } // Remove listeners if controller has no connected observers.


    if (!observers.length && this.connected_) {
      this.disconnect_();
    }
  };
  /**
   * Invokes the update of observers. It will continue running updates insofar
   * it detects changes.
   *
   * @returns {void}
   */


  ResizeObserverController.prototype.refresh = function () {
    var changesDetected = this.updateObservers_(); // Continue running updates if changes have been detected as there might
    // be future ones caused by CSS transitions.

    if (changesDetected) {
      this.refresh();
    }
  };
  /**
   * Updates every observer from observers list and notifies them of queued
   * entries.
   *
   * @private
   * @returns {boolean} Returns "true" if any observer has detected changes in
   *      dimensions of it's elements.
   */


  ResizeObserverController.prototype.updateObservers_ = function () {
    // Collect observers that have active observations.
    var activeObservers = this.observers_.filter(function (observer) {
      return observer.gatherActive(), observer.hasActive();
    }); // Deliver notifications in a separate cycle in order to avoid any
    // collisions between observers, e.g. when multiple instances of
    // ResizeObserver are tracking the same element and the callback of one
    // of them changes content dimensions of the observed target. Sometimes
    // this may result in notifications being blocked for the rest of observers.

    activeObservers.forEach(function (observer) {
      return observer.broadcastActive();
    });
    return activeObservers.length > 0;
  };
  /**
   * Initializes DOM listeners.
   *
   * @private
   * @returns {void}
   */


  ResizeObserverController.prototype.connect_ = function () {
    // Do nothing if running in a non-browser environment or if listeners
    // have been already added.
    if (!isBrowser || this.connected_) {
      return;
    } // Subscription to the "Transitionend" event is used as a workaround for
    // delayed transitions. This way it's possible to capture at least the
    // final state of an element.


    document.addEventListener('transitionend', this.onTransitionEnd_);
    window.addEventListener('resize', this.refresh);

    if (mutationObserverSupported) {
      this.mutationsObserver_ = new MutationObserver(this.refresh);
      this.mutationsObserver_.observe(document, {
        attributes: true,
        childList: true,
        characterData: true,
        subtree: true
      });
    } else {
      document.addEventListener('DOMSubtreeModified', this.refresh);
      this.mutationEventsAdded_ = true;
    }

    this.connected_ = true;
  };
  /**
   * Removes DOM listeners.
   *
   * @private
   * @returns {void}
   */


  ResizeObserverController.prototype.disconnect_ = function () {
    // Do nothing if running in a non-browser environment or if listeners
    // have been already removed.
    if (!isBrowser || !this.connected_) {
      return;
    }

    document.removeEventListener('transitionend', this.onTransitionEnd_);
    window.removeEventListener('resize', this.refresh);

    if (this.mutationsObserver_) {
      this.mutationsObserver_.disconnect();
    }

    if (this.mutationEventsAdded_) {
      document.removeEventListener('DOMSubtreeModified', this.refresh);
    }

    this.mutationsObserver_ = null;
    this.mutationEventsAdded_ = false;
    this.connected_ = false;
  };
  /**
   * "Transitionend" event handler.
   *
   * @private
   * @param {TransitionEvent} event
   * @returns {void}
   */


  ResizeObserverController.prototype.onTransitionEnd_ = function (_a) {
    var _b = _a.propertyName,
        propertyName = _b === void 0 ? '' : _b; // Detect whether transition may affect dimensions of an element.

    var isReflowProperty = transitionKeys.some(function (key) {
      return !!~propertyName.indexOf(key);
    });

    if (isReflowProperty) {
      this.refresh();
    }
  };
  /**
   * Returns instance of the ResizeObserverController.
   *
   * @returns {ResizeObserverController}
   */


  ResizeObserverController.getInstance = function () {
    if (!this.instance_) {
      this.instance_ = new ResizeObserverController();
    }

    return this.instance_;
  };
  /**
   * Holds reference to the controller's instance.
   *
   * @private {ResizeObserverController}
   */


  ResizeObserverController.instance_ = null;
  return ResizeObserverController;
}();
/**
 * Defines non-writable/enumerable properties of the provided target object.
 *
 * @param {Object} target - Object for which to define properties.
 * @param {Object} props - Properties to be defined.
 * @returns {Object} Target object.
 */


var defineConfigurable = function defineConfigurable(target, props) {
  for (var _i = 0, _a = Object.keys(props); _i < _a.length; _i++) {
    var key = _a[_i];
    Object.defineProperty(target, key, {
      value: props[key],
      enumerable: false,
      writable: false,
      configurable: true
    });
  }

  return target;
};
/**
 * Returns the global object associated with provided element.
 *
 * @param {Object} target
 * @returns {Object}
 */


var getWindowOf = function getWindowOf(target) {
  // Assume that the element is an instance of Node, which means that it
  // has the "ownerDocument" property from which we can retrieve a
  // corresponding global object.
  var ownerGlobal = target && target.ownerDocument && target.ownerDocument.defaultView; // Return the local global object if it's not possible extract one from
  // provided element.

  return ownerGlobal || global$1;
}; // Placeholder of an empty content rectangle.


var emptyRect = createRectInit(0, 0, 0, 0);
/**
 * Converts provided string to a number.
 *
 * @param {number|string} value
 * @returns {number}
 */

function toFloat(value) {
  return parseFloat(value) || 0;
}
/**
 * Extracts borders size from provided styles.
 *
 * @param {CSSStyleDeclaration} styles
 * @param {...string} positions - Borders positions (top, right, ...)
 * @returns {number}
 */


function getBordersSize(styles) {
  var positions = [];

  for (var _i = 1; _i < arguments.length; _i++) {
    positions[_i - 1] = arguments[_i];
  }

  return positions.reduce(function (size, position) {
    var value = styles['border-' + position + '-width'];
    return size + toFloat(value);
  }, 0);
}
/**
 * Extracts paddings sizes from provided styles.
 *
 * @param {CSSStyleDeclaration} styles
 * @returns {Object} Paddings box.
 */


function getPaddings(styles) {
  var positions = ['top', 'right', 'bottom', 'left'];
  var paddings = {};

  for (var _i = 0, positions_1 = positions; _i < positions_1.length; _i++) {
    var position = positions_1[_i];
    var value = styles['padding-' + position];
    paddings[position] = toFloat(value);
  }

  return paddings;
}
/**
 * Calculates content rectangle of provided SVG element.
 *
 * @param {SVGGraphicsElement} target - Element content rectangle of which needs
 *      to be calculated.
 * @returns {DOMRectInit}
 */


function getSVGContentRect(target) {
  var bbox = target.getBBox();
  return createRectInit(0, 0, bbox.width, bbox.height);
}
/**
 * Calculates content rectangle of provided HTMLElement.
 *
 * @param {HTMLElement} target - Element for which to calculate the content rectangle.
 * @returns {DOMRectInit}
 */


function getHTMLElementContentRect(target) {
  // Client width & height properties can't be
  // used exclusively as they provide rounded values.
  var clientWidth = target.clientWidth,
      clientHeight = target.clientHeight; // By this condition we can catch all non-replaced inline, hidden and
  // detached elements. Though elements with width & height properties less
  // than 0.5 will be discarded as well.
  //
  // Without it we would need to implement separate methods for each of
  // those cases and it's not possible to perform a precise and performance
  // effective test for hidden elements. E.g. even jQuery's ':visible' filter
  // gives wrong results for elements with width & height less than 0.5.

  if (!clientWidth && !clientHeight) {
    return emptyRect;
  }

  var styles = getWindowOf(target).getComputedStyle(target);
  var paddings = getPaddings(styles);
  var horizPad = paddings.left + paddings.right;
  var vertPad = paddings.top + paddings.bottom; // Computed styles of width & height are being used because they are the
  // only dimensions available to JS that contain non-rounded values. It could
  // be possible to utilize the getBoundingClientRect if only it's data wasn't
  // affected by CSS transformations let alone paddings, borders and scroll bars.

  var width = toFloat(styles.width),
      height = toFloat(styles.height); // Width & height include paddings and borders when the 'border-box' box
  // model is applied (except for IE).

  if (styles.boxSizing === 'border-box') {
    // Following conditions are required to handle Internet Explorer which
    // doesn't include paddings and borders to computed CSS dimensions.
    //
    // We can say that if CSS dimensions + paddings are equal to the "client"
    // properties then it's either IE, and thus we don't need to subtract
    // anything, or an element merely doesn't have paddings/borders styles.
    if (Math.round(width + horizPad) !== clientWidth) {
      width -= getBordersSize(styles, 'left', 'right') + horizPad;
    }

    if (Math.round(height + vertPad) !== clientHeight) {
      height -= getBordersSize(styles, 'top', 'bottom') + vertPad;
    }
  } // Following steps can't be applied to the document's root element as its
  // client[Width/Height] properties represent viewport area of the window.
  // Besides, it's as well not necessary as the <html> itself neither has
  // rendered scroll bars nor it can be clipped.


  if (!isDocumentElement(target)) {
    // In some browsers (only in Firefox, actually) CSS width & height
    // include scroll bars size which can be removed at this step as scroll
    // bars are the only difference between rounded dimensions + paddings
    // and "client" properties, though that is not always true in Chrome.
    var vertScrollbar = Math.round(width + horizPad) - clientWidth;
    var horizScrollbar = Math.round(height + vertPad) - clientHeight; // Chrome has a rather weird rounding of "client" properties.
    // E.g. for an element with content width of 314.2px it sometimes gives
    // the client width of 315px and for the width of 314.7px it may give
    // 314px. And it doesn't happen all the time. So just ignore this delta
    // as a non-relevant.

    if (Math.abs(vertScrollbar) !== 1) {
      width -= vertScrollbar;
    }

    if (Math.abs(horizScrollbar) !== 1) {
      height -= horizScrollbar;
    }
  }

  return createRectInit(paddings.left, paddings.top, width, height);
}
/**
 * Checks whether provided element is an instance of the SVGGraphicsElement.
 *
 * @param {Element} target - Element to be checked.
 * @returns {boolean}
 */


var isSVGGraphicsElement = function () {
  // Some browsers, namely IE and Edge, don't have the SVGGraphicsElement
  // interface.
  if (typeof SVGGraphicsElement !== 'undefined') {
    return function (target) {
      return target instanceof getWindowOf(target).SVGGraphicsElement;
    };
  } // If it's so, then check that element is at least an instance of the
  // SVGElement and that it has the "getBBox" method.
  // eslint-disable-next-line no-extra-parens


  return function (target) {
    return target instanceof getWindowOf(target).SVGElement && typeof target.getBBox === 'function';
  };
}();
/**
 * Checks whether provided element is a document element (<html>).
 *
 * @param {Element} target - Element to be checked.
 * @returns {boolean}
 */


function isDocumentElement(target) {
  return target === getWindowOf(target).document.documentElement;
}
/**
 * Calculates an appropriate content rectangle for provided html or svg element.
 *
 * @param {Element} target - Element content rectangle of which needs to be calculated.
 * @returns {DOMRectInit}
 */


function getContentRect(target) {
  if (!isBrowser) {
    return emptyRect;
  }

  if (isSVGGraphicsElement(target)) {
    return getSVGContentRect(target);
  }

  return getHTMLElementContentRect(target);
}
/**
 * Creates rectangle with an interface of the DOMRectReadOnly.
 * Spec: https://drafts.fxtf.org/geometry/#domrectreadonly
 *
 * @param {DOMRectInit} rectInit - Object with rectangle's x/y coordinates and dimensions.
 * @returns {DOMRectReadOnly}
 */


function createReadOnlyRect(_a) {
  var x = _a.x,
      y = _a.y,
      width = _a.width,
      height = _a.height; // If DOMRectReadOnly is available use it as a prototype for the rectangle.

  var Constr = typeof DOMRectReadOnly !== 'undefined' ? DOMRectReadOnly : Object;
  var rect = Object.create(Constr.prototype); // Rectangle's properties are not writable and non-enumerable.

  defineConfigurable(rect, {
    x: x,
    y: y,
    width: width,
    height: height,
    top: y,
    right: x + width,
    bottom: height + y,
    left: x
  });
  return rect;
}
/**
 * Creates DOMRectInit object based on the provided dimensions and the x/y coordinates.
 * Spec: https://drafts.fxtf.org/geometry/#dictdef-domrectinit
 *
 * @param {number} x - X coordinate.
 * @param {number} y - Y coordinate.
 * @param {number} width - Rectangle's width.
 * @param {number} height - Rectangle's height.
 * @returns {DOMRectInit}
 */


function createRectInit(x, y, width, height) {
  return {
    x: x,
    y: y,
    width: width,
    height: height
  };
}
/**
 * Class that is responsible for computations of the content rectangle of
 * provided DOM element and for keeping track of it's changes.
 */


var ResizeObservation =
/** @class */
function () {
  /**
   * Creates an instance of ResizeObservation.
   *
   * @param {Element} target - Element to be observed.
   */
  function ResizeObservation(target) {
    /**
     * Broadcasted width of content rectangle.
     *
     * @type {number}
     */
    this.broadcastWidth = 0;
    /**
     * Broadcasted height of content rectangle.
     *
     * @type {number}
     */

    this.broadcastHeight = 0;
    /**
     * Reference to the last observed content rectangle.
     *
     * @private {DOMRectInit}
     */

    this.contentRect_ = createRectInit(0, 0, 0, 0);
    this.target = target;
  }
  /**
   * Updates content rectangle and tells whether it's width or height properties
   * have changed since the last broadcast.
   *
   * @returns {boolean}
   */


  ResizeObservation.prototype.isActive = function () {
    var rect = getContentRect(this.target);
    this.contentRect_ = rect;
    return rect.width !== this.broadcastWidth || rect.height !== this.broadcastHeight;
  };
  /**
   * Updates 'broadcastWidth' and 'broadcastHeight' properties with a data
   * from the corresponding properties of the last observed content rectangle.
   *
   * @returns {DOMRectInit} Last observed content rectangle.
   */


  ResizeObservation.prototype.broadcastRect = function () {
    var rect = this.contentRect_;
    this.broadcastWidth = rect.width;
    this.broadcastHeight = rect.height;
    return rect;
  };

  return ResizeObservation;
}();

var ResizeObserverEntry =
/** @class */
function () {
  /**
   * Creates an instance of ResizeObserverEntry.
   *
   * @param {Element} target - Element that is being observed.
   * @param {DOMRectInit} rectInit - Data of the element's content rectangle.
   */
  function ResizeObserverEntry(target, rectInit) {
    var contentRect = createReadOnlyRect(rectInit); // According to the specification following properties are not writable
    // and are also not enumerable in the native implementation.
    //
    // Property accessors are not being used as they'd require to define a
    // private WeakMap storage which may cause memory leaks in browsers that
    // don't support this type of collections.

    defineConfigurable(this, {
      target: target,
      contentRect: contentRect
    });
  }

  return ResizeObserverEntry;
}();

var ResizeObserverSPI =
/** @class */
function () {
  /**
   * Creates a new instance of ResizeObserver.
   *
   * @param {ResizeObserverCallback} callback - Callback function that is invoked
   *      when one of the observed elements changes it's content dimensions.
   * @param {ResizeObserverController} controller - Controller instance which
   *      is responsible for the updates of observer.
   * @param {ResizeObserver} callbackCtx - Reference to the public
   *      ResizeObserver instance which will be passed to callback function.
   */
  function ResizeObserverSPI(callback, controller, callbackCtx) {
    /**
     * Collection of resize observations that have detected changes in dimensions
     * of elements.
     *
     * @private {Array<ResizeObservation>}
     */
    this.activeObservations_ = [];
    /**
     * Registry of the ResizeObservation instances.
     *
     * @private {Map<Element, ResizeObservation>}
     */

    this.observations_ = new MapShim();

    if (typeof callback !== 'function') {
      throw new TypeError('The callback provided as parameter 1 is not a function.');
    }

    this.callback_ = callback;
    this.controller_ = controller;
    this.callbackCtx_ = callbackCtx;
  }
  /**
   * Starts observing provided element.
   *
   * @param {Element} target - Element to be observed.
   * @returns {void}
   */


  ResizeObserverSPI.prototype.observe = function (target) {
    if (!arguments.length) {
      throw new TypeError('1 argument required, but only 0 present.');
    } // Do nothing if current environment doesn't have the Element interface.


    if (typeof Element === 'undefined' || !(Element instanceof Object)) {
      return;
    }

    if (!(target instanceof getWindowOf(target).Element)) {
      throw new TypeError('parameter 1 is not of type "Element".');
    }

    var observations = this.observations_; // Do nothing if element is already being observed.

    if (observations.has(target)) {
      return;
    }

    observations.set(target, new ResizeObservation(target));
    this.controller_.addObserver(this); // Force the update of observations.

    this.controller_.refresh();
  };
  /**
   * Stops observing provided element.
   *
   * @param {Element} target - Element to stop observing.
   * @returns {void}
   */


  ResizeObserverSPI.prototype.unobserve = function (target) {
    if (!arguments.length) {
      throw new TypeError('1 argument required, but only 0 present.');
    } // Do nothing if current environment doesn't have the Element interface.


    if (typeof Element === 'undefined' || !(Element instanceof Object)) {
      return;
    }

    if (!(target instanceof getWindowOf(target).Element)) {
      throw new TypeError('parameter 1 is not of type "Element".');
    }

    var observations = this.observations_; // Do nothing if element is not being observed.

    if (!observations.has(target)) {
      return;
    }

    observations.delete(target);

    if (!observations.size) {
      this.controller_.removeObserver(this);
    }
  };
  /**
   * Stops observing all elements.
   *
   * @returns {void}
   */


  ResizeObserverSPI.prototype.disconnect = function () {
    this.clearActive();
    this.observations_.clear();
    this.controller_.removeObserver(this);
  };
  /**
   * Collects observation instances the associated element of which has changed
   * it's content rectangle.
   *
   * @returns {void}
   */


  ResizeObserverSPI.prototype.gatherActive = function () {
    var _this = this;

    this.clearActive();
    this.observations_.forEach(function (observation) {
      if (observation.isActive()) {
        _this.activeObservations_.push(observation);
      }
    });
  };
  /**
   * Invokes initial callback function with a list of ResizeObserverEntry
   * instances collected from active resize observations.
   *
   * @returns {void}
   */


  ResizeObserverSPI.prototype.broadcastActive = function () {
    // Do nothing if observer doesn't have active observations.
    if (!this.hasActive()) {
      return;
    }

    var ctx = this.callbackCtx_; // Create ResizeObserverEntry instance for every active observation.

    var entries = this.activeObservations_.map(function (observation) {
      return new ResizeObserverEntry(observation.target, observation.broadcastRect());
    });
    this.callback_.call(ctx, entries, ctx);
    this.clearActive();
  };
  /**
   * Clears the collection of active observations.
   *
   * @returns {void}
   */


  ResizeObserverSPI.prototype.clearActive = function () {
    this.activeObservations_.splice(0);
  };
  /**
   * Tells whether observer has active observations.
   *
   * @returns {boolean}
   */


  ResizeObserverSPI.prototype.hasActive = function () {
    return this.activeObservations_.length > 0;
  };

  return ResizeObserverSPI;
}(); // Registry of internal observers. If WeakMap is not available use current shim
// for the Map collection as it has all required methods and because WeakMap
// can't be fully polyfilled anyway.


var observers = typeof WeakMap !== 'undefined' ? new WeakMap() : new MapShim();
/**
 * ResizeObserver API. Encapsulates the ResizeObserver SPI implementation
 * exposing only those methods and properties that are defined in the spec.
 */

var ResizeObserver =
/** @class */
function () {
  /**
   * Creates a new instance of ResizeObserver.
   *
   * @param {ResizeObserverCallback} callback - Callback that is invoked when
   *      dimensions of the observed elements change.
   */
  function ResizeObserver(callback) {
    if (!(this instanceof ResizeObserver)) {
      throw new TypeError('Cannot call a class as a function.');
    }

    if (!arguments.length) {
      throw new TypeError('1 argument required, but only 0 present.');
    }

    var controller = ResizeObserverController.getInstance();
    var observer = new ResizeObserverSPI(callback, controller, this);
    observers.set(this, observer);
  }

  return ResizeObserver;
}(); // Expose public methods of ResizeObserver.


['observe', 'unobserve', 'disconnect'].forEach(function (method) {
  ResizeObserver.prototype[method] = function () {
    var _a;

    return (_a = observers.get(this))[method].apply(_a, arguments);
  };
});

var index = function () {
  // Export existing implementation if available.
  if (typeof global$1.ResizeObserver !== 'undefined') {
    return global$1.ResizeObserver;
  }

  return ResizeObserver;
}();

/* harmony default export */ __webpack_exports__["a"] = (index);
/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(50)))

/***/ }),
/* 46 */
/***/ (function(module, exports) {

module.exports = function (module) {
  if (!module.webpackPolyfill) {
    module.deprecate = function () {};

    module.paths = []; // module.parent = undefined by default

    if (!module.children) module.children = [];
    Object.defineProperty(module, "loaded", {
      enumerable: true,
      get: function get() {
        return module.l;
      }
    });
    Object.defineProperty(module, "id", {
      enumerable: true,
      get: function get() {
        return module.i;
      }
    });
    module.webpackPolyfill = 1;
  }

  return module;
};

/***/ }),
/* 47 */
/***/ (function(module, exports) {

function _typeof(obj) {
  "@babel/helpers - typeof";

  if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") {
    module.exports = _typeof = function _typeof(obj) {
      return typeof obj;
    };
  } else {
    module.exports = _typeof = function _typeof(obj) {
      return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj;
    };
  }

  return _typeof(obj);
}

module.exports = _typeof;

/***/ }),
/* 48 */
/***/ (function(module, exports) {

// shim for using process in browser
var process = module.exports = {}; // cached from whatever global is present so that test runners that stub it
// don't break things.  But we need to wrap it in a try catch in case it is
// wrapped in strict mode code which doesn't define any globals.  It's inside a
// function because try/catches deoptimize in certain engines.

var cachedSetTimeout;
var cachedClearTimeout;

function defaultSetTimout() {
  throw new Error('setTimeout has not been defined');
}

function defaultClearTimeout() {
  throw new Error('clearTimeout has not been defined');
}

(function () {
  try {
    if (typeof setTimeout === 'function') {
      cachedSetTimeout = setTimeout;
    } else {
      cachedSetTimeout = defaultSetTimout;
    }
  } catch (e) {
    cachedSetTimeout = defaultSetTimout;
  }

  try {
    if (typeof clearTimeout === 'function') {
      cachedClearTimeout = clearTimeout;
    } else {
      cachedClearTimeout = defaultClearTimeout;
    }
  } catch (e) {
    cachedClearTimeout = defaultClearTimeout;
  }
})();

function runTimeout(fun) {
  if (cachedSetTimeout === setTimeout) {
    //normal enviroments in sane situations
    return setTimeout(fun, 0);
  } // if setTimeout wasn't available but was latter defined


  if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) {
    cachedSetTimeout = setTimeout;
    return setTimeout(fun, 0);
  }

  try {
    // when when somebody has screwed with setTimeout but no I.E. maddness
    return cachedSetTimeout(fun, 0);
  } catch (e) {
    try {
      // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally
      return cachedSetTimeout.call(null, fun, 0);
    } catch (e) {
      // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error
      return cachedSetTimeout.call(this, fun, 0);
    }
  }
}

function runClearTimeout(marker) {
  if (cachedClearTimeout === clearTimeout) {
    //normal enviroments in sane situations
    return clearTimeout(marker);
  } // if clearTimeout wasn't available but was latter defined


  if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) {
    cachedClearTimeout = clearTimeout;
    return clearTimeout(marker);
  }

  try {
    // when when somebody has screwed with setTimeout but no I.E. maddness
    return cachedClearTimeout(marker);
  } catch (e) {
    try {
      // When we are in I.E. but the script has been evaled so I.E. doesn't  trust the global object when called normally
      return cachedClearTimeout.call(null, marker);
    } catch (e) {
      // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error.
      // Some versions of I.E. have different rules for clearTimeout vs setTimeout
      return cachedClearTimeout.call(this, marker);
    }
  }
}

var queue = [];
var draining = false;
var currentQueue;
var queueIndex = -1;

function cleanUpNextTick() {
  if (!draining || !currentQueue) {
    return;
  }

  draining = false;

  if (currentQueue.length) {
    queue = currentQueue.concat(queue);
  } else {
    queueIndex = -1;
  }

  if (queue.length) {
    drainQueue();
  }
}

function drainQueue() {
  if (draining) {
    return;
  }

  var timeout = runTimeout(cleanUpNextTick);
  draining = true;
  var len = queue.length;

  while (len) {
    currentQueue = queue;
    queue = [];

    while (++queueIndex < len) {
      if (currentQueue) {
        currentQueue[queueIndex].run();
      }
    }

    queueIndex = -1;
    len = queue.length;
  }

  currentQueue = null;
  draining = false;
  runClearTimeout(timeout);
}

process.nextTick = function (fun) {
  var args = new Array(arguments.length - 1);

  if (arguments.length > 1) {
    for (var i = 1; i < arguments.length; i++) {
      args[i - 1] = arguments[i];
    }
  }

  queue.push(new Item(fun, args));

  if (queue.length === 1 && !draining) {
    runTimeout(drainQueue);
  }
}; // v8 likes predictible objects


function Item(fun, array) {
  this.fun = fun;
  this.array = array;
}

Item.prototype.run = function () {
  this.fun.apply(null, this.array);
};

process.title = 'browser';
process.browser = true;
process.env = {};
process.argv = [];
process.version = ''; // empty string to avoid regexp issues

process.versions = {};

function noop() {}

process.on = noop;
process.addListener = noop;
process.once = noop;
process.off = noop;
process.removeListener = noop;
process.removeAllListeners = noop;
process.emit = noop;
process.prependListener = noop;
process.prependOnceListener = noop;

process.listeners = function (name) {
  return [];
};

process.binding = function (name) {
  throw new Error('process.binding is not supported');
};

process.cwd = function () {
  return '/';
};

process.chdir = function (dir) {
  throw new Error('process.chdir is not supported');
};

process.umask = function () {
  return 0;
};

/***/ }),
/* 49 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireWildcard = __webpack_require__(7);

var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.warning = warning;
exports.isIconDefinition = isIconDefinition;
exports.normalizeAttrs = normalizeAttrs;
exports.generate = generate;
exports.getSecondaryColor = getSecondaryColor;
exports.normalizeTwoToneColors = normalizeTwoToneColors;
exports.useInsertStyles = exports.iconStyles = exports.svgBaseProps = void 0;

var _objectSpread2 = _interopRequireDefault(__webpack_require__(70));

var _typeof2 = _interopRequireDefault(__webpack_require__(47));

var _colors = __webpack_require__(52);

var _react = _interopRequireWildcard(__webpack_require__(0));

var _warning = _interopRequireDefault(__webpack_require__(36));

var _insertCss = __webpack_require__(53);

function warning(valid, message) {
  (0, _warning.default)(valid, "[@ant-design/icons] ".concat(message));
}

function isIconDefinition(target) {
  return (0, _typeof2.default)(target) === 'object' && typeof target.name === 'string' && typeof target.theme === 'string' && ((0, _typeof2.default)(target.icon) === 'object' || typeof target.icon === 'function');
}

function normalizeAttrs() {
  var attrs = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  return Object.keys(attrs).reduce(function (acc, key) {
    var val = attrs[key];

    switch (key) {
      case 'class':
        acc.className = val;
        delete acc.class;
        break;

      default:
        acc[key] = val;
    }

    return acc;
  }, {});
}

function generate(node, key, rootProps) {
  if (!rootProps) {
    return _react.default.createElement(node.tag, (0, _objectSpread2.default)({
      key: key
    }, normalizeAttrs(node.attrs)), (node.children || []).map(function (child, index) {
      return generate(child, "".concat(key, "-").concat(node.tag, "-").concat(index));
    }));
  }

  return _react.default.createElement(node.tag, (0, _objectSpread2.default)((0, _objectSpread2.default)({
    key: key
  }, normalizeAttrs(node.attrs)), rootProps), (node.children || []).map(function (child, index) {
    return generate(child, "".concat(key, "-").concat(node.tag, "-").concat(index));
  }));
}

function getSecondaryColor(primaryColor) {
  // choose the second color
  return (0, _colors.generate)(primaryColor)[0];
}

function normalizeTwoToneColors(twoToneColor) {
  if (!twoToneColor) {
    return [];
  }

  return Array.isArray(twoToneColor) ? twoToneColor : [twoToneColor];
} // These props make sure that the SVG behaviours like general text.
// Reference: https://blog.prototypr.io/align-svg-icons-to-text-and-say-goodbye-to-font-icons-d44b3d7b26b4


var svgBaseProps = {
  width: '1em',
  height: '1em',
  fill: 'currentColor',
  'aria-hidden': 'true',
  focusable: 'false'
};
exports.svgBaseProps = svgBaseProps;
var iconStyles = "\n.anticon {\n  display: inline-block;\n  color: inherit;\n  font-style: normal;\n  line-height: 0;\n  text-align: center;\n  text-transform: none;\n  vertical-align: -0.125em;\n  text-rendering: optimizeLegibility;\n  -webkit-font-smoothing: antialiased;\n  -moz-osx-font-smoothing: grayscale;\n}\n\n.anticon > * {\n  line-height: 1;\n}\n\n.anticon svg {\n  display: inline-block;\n}\n\n.anticon::before {\n  display: none;\n}\n\n.anticon .anticon-icon {\n  display: block;\n}\n\n.anticon[tabindex] {\n  cursor: pointer;\n}\n\n.anticon-spin::before,\n.anticon-spin {\n  display: inline-block;\n  -webkit-animation: loadingCircle 1s infinite linear;\n  animation: loadingCircle 1s infinite linear;\n}\n\n@-webkit-keyframes loadingCircle {\n  100% {\n    -webkit-transform: rotate(360deg);\n    transform: rotate(360deg);\n  }\n}\n\n@keyframes loadingCircle {\n  100% {\n    -webkit-transform: rotate(360deg);\n    transform: rotate(360deg);\n  }\n}\n";
exports.iconStyles = iconStyles;
var cssInjectedFlag = false;

var useInsertStyles = function useInsertStyles() {
  var styleStr = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : iconStyles;
  (0, _react.useEffect)(function () {
    if (!cssInjectedFlag) {
      (0, _insertCss.insertCss)(styleStr, {
        prepend: true
      });
      cssInjectedFlag = true;
    }
  }, []);
};

exports.useInsertStyles = useInsertStyles;

/***/ }),
/* 50 */
/***/ (function(module, exports) {

function _typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }

var g; // This works in non-strict mode

g = function () {
  return this;
}();

try {
  // This works if eval is allowed (see CSP)
  g = g || new Function("return this")();
} catch (e) {
  // This works if the window reference is available
  if ((typeof window === "undefined" ? "undefined" : _typeof(window)) === "object") g = window;
} // g can still be undefined, but nothing to do about it...
// We return undefined, instead of nothing here, so it's
// easier to handle this case. if(!global) { ...}


module.exports = g;

/***/ }),
/* 51 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


function _typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }

var has = Object.prototype.hasOwnProperty;
var isArray = Array.isArray;

var hexTable = function () {
  var array = [];

  for (var i = 0; i < 256; ++i) {
    array.push('%' + ((i < 16 ? '0' : '') + i.toString(16)).toUpperCase());
  }

  return array;
}();

var compactQueue = function compactQueue(queue) {
  while (queue.length > 1) {
    var item = queue.pop();
    var obj = item.obj[item.prop];

    if (isArray(obj)) {
      var compacted = [];

      for (var j = 0; j < obj.length; ++j) {
        if (typeof obj[j] !== 'undefined') {
          compacted.push(obj[j]);
        }
      }

      item.obj[item.prop] = compacted;
    }
  }
};

var arrayToObject = function arrayToObject(source, options) {
  var obj = options && options.plainObjects ? Object.create(null) : {};

  for (var i = 0; i < source.length; ++i) {
    if (typeof source[i] !== 'undefined') {
      obj[i] = source[i];
    }
  }

  return obj;
};

var merge = function merge(target, source, options) {
  /* eslint no-param-reassign: 0 */
  if (!source) {
    return target;
  }

  if (_typeof(source) !== 'object') {
    if (isArray(target)) {
      target.push(source);
    } else if (target && _typeof(target) === 'object') {
      if (options && (options.plainObjects || options.allowPrototypes) || !has.call(Object.prototype, source)) {
        target[source] = true;
      }
    } else {
      return [target, source];
    }

    return target;
  }

  if (!target || _typeof(target) !== 'object') {
    return [target].concat(source);
  }

  var mergeTarget = target;

  if (isArray(target) && !isArray(source)) {
    mergeTarget = arrayToObject(target, options);
  }

  if (isArray(target) && isArray(source)) {
    source.forEach(function (item, i) {
      if (has.call(target, i)) {
        var targetItem = target[i];

        if (targetItem && _typeof(targetItem) === 'object' && item && _typeof(item) === 'object') {
          target[i] = merge(targetItem, item, options);
        } else {
          target.push(item);
        }
      } else {
        target[i] = item;
      }
    });
    return target;
  }

  return Object.keys(source).reduce(function (acc, key) {
    var value = source[key];

    if (has.call(acc, key)) {
      acc[key] = merge(acc[key], value, options);
    } else {
      acc[key] = value;
    }

    return acc;
  }, mergeTarget);
};

var assign = function assignSingleSource(target, source) {
  return Object.keys(source).reduce(function (acc, key) {
    acc[key] = source[key];
    return acc;
  }, target);
};

var decode = function decode(str, decoder, charset) {
  var strWithoutPlus = str.replace(/\+/g, ' ');

  if (charset === 'iso-8859-1') {
    // unescape never throws, no try...catch needed:
    return strWithoutPlus.replace(/%[0-9a-f]{2}/gi, unescape);
  } // utf-8


  try {
    return decodeURIComponent(strWithoutPlus);
  } catch (e) {
    return strWithoutPlus;
  }
};

var encode = function encode(str, defaultEncoder, charset) {
  // This code was originally written by Brian White (mscdex) for the io.js core querystring library.
  // It has been adapted here for stricter adherence to RFC 3986
  if (str.length === 0) {
    return str;
  }

  var string = str;

  if (_typeof(str) === 'symbol') {
    string = Symbol.prototype.toString.call(str);
  } else if (typeof str !== 'string') {
    string = String(str);
  }

  if (charset === 'iso-8859-1') {
    return escape(string).replace(/%u[0-9a-f]{4}/gi, function ($0) {
      return '%26%23' + parseInt($0.slice(2), 16) + '%3B';
    });
  }

  var out = '';

  for (var i = 0; i < string.length; ++i) {
    var c = string.charCodeAt(i);

    if (c === 0x2D // -
    || c === 0x2E // .
    || c === 0x5F // _
    || c === 0x7E // ~
    || c >= 0x30 && c <= 0x39 // 0-9
    || c >= 0x41 && c <= 0x5A // a-z
    || c >= 0x61 && c <= 0x7A // A-Z
    ) {
        out += string.charAt(i);
        continue;
      }

    if (c < 0x80) {
      out = out + hexTable[c];
      continue;
    }

    if (c < 0x800) {
      out = out + (hexTable[0xC0 | c >> 6] + hexTable[0x80 | c & 0x3F]);
      continue;
    }

    if (c < 0xD800 || c >= 0xE000) {
      out = out + (hexTable[0xE0 | c >> 12] + hexTable[0x80 | c >> 6 & 0x3F] + hexTable[0x80 | c & 0x3F]);
      continue;
    }

    i += 1;
    c = 0x10000 + ((c & 0x3FF) << 10 | string.charCodeAt(i) & 0x3FF);
    out += hexTable[0xF0 | c >> 18] + hexTable[0x80 | c >> 12 & 0x3F] + hexTable[0x80 | c >> 6 & 0x3F] + hexTable[0x80 | c & 0x3F];
  }

  return out;
};

var compact = function compact(value) {
  var queue = [{
    obj: {
      o: value
    },
    prop: 'o'
  }];
  var refs = [];

  for (var i = 0; i < queue.length; ++i) {
    var item = queue[i];
    var obj = item.obj[item.prop];
    var keys = Object.keys(obj);

    for (var j = 0; j < keys.length; ++j) {
      var key = keys[j];
      var val = obj[key];

      if (_typeof(val) === 'object' && val !== null && refs.indexOf(val) === -1) {
        queue.push({
          obj: obj,
          prop: key
        });
        refs.push(val);
      }
    }
  }

  compactQueue(queue);
  return value;
};

var isRegExp = function isRegExp(obj) {
  return Object.prototype.toString.call(obj) === '[object RegExp]';
};

var isBuffer = function isBuffer(obj) {
  if (!obj || _typeof(obj) !== 'object') {
    return false;
  }

  return !!(obj.constructor && obj.constructor.isBuffer && obj.constructor.isBuffer(obj));
};

var combine = function combine(a, b) {
  return [].concat(a, b);
};

var maybeMap = function maybeMap(val, fn) {
  if (isArray(val)) {
    var mapped = [];

    for (var i = 0; i < val.length; i += 1) {
      mapped.push(fn(val[i]));
    }

    return mapped;
  }

  return fn(val);
};

module.exports = {
  arrayToObject: arrayToObject,
  assign: assign,
  combine: combine,
  compact: compact,
  decode: decode,
  encode: encode,
  isBuffer: isBuffer,
  isRegExp: isRegExp,
  maybeMap: maybeMap,
  merge: merge
};

/***/ }),
/* 52 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var __importDefault = this && this.__importDefault || function (mod) {
  return mod && mod.__esModule ? mod : {
    "default": mod
  };
};

Object.defineProperty(exports, "__esModule", {
  value: true
});

var generate_1 = __importDefault(__webpack_require__(113));

exports.generate = generate_1.default;
var presetPrimaryColors = {
  red: '#F5222D',
  volcano: '#FA541C',
  orange: '#FA8C16',
  gold: '#FAAD14',
  yellow: '#FADB14',
  lime: '#A0D911',
  green: '#52C41A',
  cyan: '#13C2C2',
  blue: '#1890FF',
  geekblue: '#2F54EB',
  purple: '#722ED1',
  magenta: '#EB2F96',
  grey: '#666666'
};
exports.presetPrimaryColors = presetPrimaryColors;
var presetPalettes = {};
exports.presetPalettes = presetPalettes;
Object.keys(presetPrimaryColors).forEach(function (key) {
  presetPalettes[key] = generate_1.default(presetPrimaryColors[key]);
  presetPalettes[key].primary = presetPalettes[key][5];
});
var red = presetPalettes.red;
exports.red = red;
var volcano = presetPalettes.volcano;
exports.volcano = volcano;
var gold = presetPalettes.gold;
exports.gold = gold;
var orange = presetPalettes.orange;
exports.orange = orange;
var yellow = presetPalettes.yellow;
exports.yellow = yellow;
var lime = presetPalettes.lime;
exports.lime = lime;
var green = presetPalettes.green;
exports.green = green;
var cyan = presetPalettes.cyan;
exports.cyan = cyan;
var blue = presetPalettes.blue;
exports.blue = blue;
var geekblue = presetPalettes.geekblue;
exports.geekblue = geekblue;
var purple = presetPalettes.purple;
exports.purple = purple;
var magenta = presetPalettes.magenta;
exports.magenta = magenta;
var grey = presetPalettes.grey;
exports.grey = grey;

/***/ }),
/* 53 */
/***/ (function(module, exports) {

var containers = []; // will store container HTMLElement references

var styleElements = []; // will store {prepend: HTMLElement, append: HTMLElement}

var usage = 'insert-css: You need to provide a CSS string. Usage: insertCss(cssString[, options]).';

function insertCss(css, options) {
  options = options || {};

  if (css === undefined) {
    throw new Error(usage);
  }

  var position = options.prepend === true ? 'prepend' : 'append';
  var container = options.container !== undefined ? options.container : document.querySelector('head');
  var containerId = containers.indexOf(container); // first time we see this container, create the necessary entries

  if (containerId === -1) {
    containerId = containers.push(container) - 1;
    styleElements[containerId] = {};
  } // try to get the correponding container + position styleElement, create it otherwise


  var styleElement;

  if (styleElements[containerId] !== undefined && styleElements[containerId][position] !== undefined) {
    styleElement = styleElements[containerId][position];
  } else {
    styleElement = styleElements[containerId][position] = createStyleElement();

    if (position === 'prepend') {
      container.insertBefore(styleElement, container.childNodes[0]);
    } else {
      container.appendChild(styleElement);
    }
  } // strip potential UTF-8 BOM if css was read from a file


  if (css.charCodeAt(0) === 0xFEFF) {
    css = css.substr(1, css.length);
  } // actually add the stylesheet


  if (styleElement.styleSheet) {
    styleElement.styleSheet.cssText += css;
  } else {
    styleElement.textContent += css;
  }

  return styleElement;
}

;

function createStyleElement() {
  var styleElement = document.createElement('style');
  styleElement.setAttribute('type', 'text/css');
  return styleElement;
}

module.exports = insertCss;
module.exports.insertCss = insertCss;

/***/ }),
/* 54 */
/***/ (function(module, exports) {

module.exports = moment;

/***/ }),
/* 55 */
/***/ (function(module, exports) {

/* WEBPACK VAR INJECTION */(function(__webpack_amd_options__) {/* globals __webpack_amd_options__ */
module.exports = __webpack_amd_options__;

/* WEBPACK VAR INJECTION */}.call(this, {}))

/***/ }),
/* 56 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var isOldIE = function isOldIE() {
  var memo;
  return function memorize() {
    if (typeof memo === 'undefined') {
      // Test for IE <= 9 as proposed by Browserhacks
      // @see http://browserhacks.com/#hack-e71d8692f65334173fee715c222cb805
      // Tests for existence of standard globals is to allow style-loader
      // to operate correctly into non-standard environments
      // @see https://github.com/webpack-contrib/style-loader/issues/177
      memo = Boolean(window && document && document.all && !window.atob);
    }

    return memo;
  };
}();

var getTarget = function getTarget() {
  var memo = {};
  return function memorize(target) {
    if (typeof memo[target] === 'undefined') {
      var styleTarget = document.querySelector(target); // Special case to return head of iframe instead of iframe itself

      if (window.HTMLIFrameElement && styleTarget instanceof window.HTMLIFrameElement) {
        try {
          // This will throw an exception if access to iframe is blocked
          // due to cross-origin restrictions
          styleTarget = styleTarget.contentDocument.head;
        } catch (e) {
          // istanbul ignore next
          styleTarget = null;
        }
      }

      memo[target] = styleTarget;
    }

    return memo[target];
  };
}();

var stylesInDom = [];

function getIndexByIdentifier(identifier) {
  var result = -1;

  for (var i = 0; i < stylesInDom.length; i++) {
    if (stylesInDom[i].identifier === identifier) {
      result = i;
      break;
    }
  }

  return result;
}

function modulesToDom(list, options) {
  var idCountMap = {};
  var identifiers = [];

  for (var i = 0; i < list.length; i++) {
    var item = list[i];
    var id = options.base ? item[0] + options.base : item[0];
    var count = idCountMap[id] || 0;
    var identifier = "".concat(id, " ").concat(count);
    idCountMap[id] = count + 1;
    var index = getIndexByIdentifier(identifier);
    var obj = {
      css: item[1],
      media: item[2],
      sourceMap: item[3]
    };

    if (index !== -1) {
      stylesInDom[index].references++;
      stylesInDom[index].updater(obj);
    } else {
      stylesInDom.push({
        identifier: identifier,
        updater: addStyle(obj, options),
        references: 1
      });
    }

    identifiers.push(identifier);
  }

  return identifiers;
}

function insertStyleElement(options) {
  var style = document.createElement('style');
  var attributes = options.attributes || {};

  if (typeof attributes.nonce === 'undefined') {
    var nonce =  true ? __webpack_require__.nc : undefined;

    if (nonce) {
      attributes.nonce = nonce;
    }
  }

  Object.keys(attributes).forEach(function (key) {
    style.setAttribute(key, attributes[key]);
  });

  if (typeof options.insert === 'function') {
    options.insert(style);
  } else {
    var target = getTarget(options.insert || 'head');

    if (!target) {
      throw new Error("Couldn't find a style target. This probably means that the value for the 'insert' parameter is invalid.");
    }

    target.appendChild(style);
  }

  return style;
}

function removeStyleElement(style) {
  // istanbul ignore if
  if (style.parentNode === null) {
    return false;
  }

  style.parentNode.removeChild(style);
}
/* istanbul ignore next  */


var replaceText = function replaceText() {
  var textStore = [];
  return function replace(index, replacement) {
    textStore[index] = replacement;
    return textStore.filter(Boolean).join('\n');
  };
}();

function applyToSingletonTag(style, index, remove, obj) {
  var css = remove ? '' : obj.media ? "@media ".concat(obj.media, " {").concat(obj.css, "}") : obj.css; // For old IE

  /* istanbul ignore if  */

  if (style.styleSheet) {
    style.styleSheet.cssText = replaceText(index, css);
  } else {
    var cssNode = document.createTextNode(css);
    var childNodes = style.childNodes;

    if (childNodes[index]) {
      style.removeChild(childNodes[index]);
    }

    if (childNodes.length) {
      style.insertBefore(cssNode, childNodes[index]);
    } else {
      style.appendChild(cssNode);
    }
  }
}

function applyToTag(style, options, obj) {
  var css = obj.css;
  var media = obj.media;
  var sourceMap = obj.sourceMap;

  if (media) {
    style.setAttribute('media', media);
  } else {
    style.removeAttribute('media');
  }

  if (sourceMap && btoa) {
    css += "\n/*# sourceMappingURL=data:application/json;base64,".concat(btoa(unescape(encodeURIComponent(JSON.stringify(sourceMap)))), " */");
  } // For old IE

  /* istanbul ignore if  */


  if (style.styleSheet) {
    style.styleSheet.cssText = css;
  } else {
    while (style.firstChild) {
      style.removeChild(style.firstChild);
    }

    style.appendChild(document.createTextNode(css));
  }
}

var singleton = null;
var singletonCounter = 0;

function addStyle(obj, options) {
  var style;
  var update;
  var remove;

  if (options.singleton) {
    var styleIndex = singletonCounter++;
    style = singleton || (singleton = insertStyleElement(options));
    update = applyToSingletonTag.bind(null, style, styleIndex, false);
    remove = applyToSingletonTag.bind(null, style, styleIndex, true);
  } else {
    style = insertStyleElement(options);
    update = applyToTag.bind(null, style, options);

    remove = function remove() {
      removeStyleElement(style);
    };
  }

  update(obj);
  return function updateStyle(newObj) {
    if (newObj) {
      if (newObj.css === obj.css && newObj.media === obj.media && newObj.sourceMap === obj.sourceMap) {
        return;
      }

      update(obj = newObj);
    } else {
      remove();
    }
  };
}

module.exports = function (list, options) {
  options = options || {}; // Force single-tag solution on IE6-9, which has a hard limit on the # of <style>
  // tags it will allow on a page

  if (!options.singleton && typeof options.singleton !== 'boolean') {
    options.singleton = isOldIE();
  }

  list = list || [];
  var lastIdentifiers = modulesToDom(list, options);
  return function update(newList) {
    newList = newList || [];

    if (Object.prototype.toString.call(newList) !== '[object Array]') {
      return;
    }

    for (var i = 0; i < lastIdentifiers.length; i++) {
      var identifier = lastIdentifiers[i];
      var index = getIndexByIdentifier(identifier);
      stylesInDom[index].references--;
    }

    var newLastIdentifiers = modulesToDom(newList, options);

    for (var _i = 0; _i < lastIdentifiers.length; _i++) {
      var _identifier = lastIdentifiers[_i];

      var _index = getIndexByIdentifier(_identifier);

      if (stylesInDom[_index].references === 0) {
        stylesInDom[_index].updater();

        stylesInDom.splice(_index, 1);
      }
    }

    lastIdentifiers = newLastIdentifiers;
  };
};

/***/ }),
/* 57 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";

/*
  MIT License http://www.opensource.org/licenses/mit-license.php
  Author Tobias Koppers @sokra
*/
// css base code, injected by the css-loader
// eslint-disable-next-line func-names

module.exports = function (useSourceMap) {
  var list = []; // return the list of modules as css string

  list.toString = function toString() {
    return this.map(function (item) {
      var content = cssWithMappingToString(item, useSourceMap);

      if (item[2]) {
        return "@media ".concat(item[2], " {").concat(content, "}");
      }

      return content;
    }).join('');
  }; // import a list of modules into the list
  // eslint-disable-next-line func-names


  list.i = function (modules, mediaQuery, dedupe) {
    if (typeof modules === 'string') {
      // eslint-disable-next-line no-param-reassign
      modules = [[null, modules, '']];
    }

    var alreadyImportedModules = {};

    if (dedupe) {
      for (var i = 0; i < this.length; i++) {
        // eslint-disable-next-line prefer-destructuring
        var id = this[i][0];

        if (id != null) {
          alreadyImportedModules[id] = true;
        }
      }
    }

    for (var _i = 0; _i < modules.length; _i++) {
      var item = [].concat(modules[_i]);

      if (dedupe && alreadyImportedModules[item[0]]) {
        // eslint-disable-next-line no-continue
        continue;
      }

      if (mediaQuery) {
        if (!item[2]) {
          item[2] = mediaQuery;
        } else {
          item[2] = "".concat(mediaQuery, " and ").concat(item[2]);
        }
      }

      list.push(item);
    }
  };

  return list;
};

function cssWithMappingToString(item, useSourceMap) {
  var content = item[1] || ''; // eslint-disable-next-line prefer-destructuring

  var cssMapping = item[3];

  if (!cssMapping) {
    return content;
  }

  if (useSourceMap && typeof btoa === 'function') {
    var sourceMapping = toComment(cssMapping);
    var sourceURLs = cssMapping.sources.map(function (source) {
      return "/*# sourceURL=".concat(cssMapping.sourceRoot || '').concat(source, " */");
    });
    return [content].concat(sourceURLs).concat([sourceMapping]).join('\n');
  }

  return [content].join('\n');
} // Adapted from convert-source-map (MIT)


function toComment(sourceMap) {
  // eslint-disable-next-line no-undef
  var base64 = btoa(unescape(encodeURIComponent(JSON.stringify(sourceMap))));
  var data = "sourceMappingURL=data:application/json;charset=utf-8;base64,".concat(base64);
  return "/*# ".concat(data, " */");
}

/***/ }),
/* 58 */
/***/ (function(module, exports) {

function _getPrototypeOf(o) {
  module.exports = _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) {
    return o.__proto__ || Object.getPrototypeOf(o);
  };
  return _getPrototypeOf(o);
}

module.exports = _getPrototypeOf;

/***/ }),
/* 59 */
/***/ (function(module, exports, __webpack_require__) {

var _typeof = __webpack_require__(47);

var assertThisInitialized = __webpack_require__(93);

function _possibleConstructorReturn(self, call) {
  if (call && (_typeof(call) === "object" || typeof call === "function")) {
    return call;
  }

  return assertThisInitialized(self);
}

module.exports = _possibleConstructorReturn;

/***/ }),
/* 60 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports["default"] = void 0;

var _en_US = _interopRequireDefault(__webpack_require__(96));

var _en_US2 = _interopRequireDefault(__webpack_require__(61));

var _en_US3 = _interopRequireDefault(__webpack_require__(62));

var _en_US4 = _interopRequireDefault(__webpack_require__(98));
/* eslint-disable no-template-curly-in-string */


var typeTemplate = '${label} is not a valid ${type}';
var localeValues = {
  locale: 'en',
  Pagination: _en_US["default"],
  DatePicker: _en_US2["default"],
  TimePicker: _en_US3["default"],
  Calendar: _en_US4["default"],
  global: {
    placeholder: 'Please select'
  },
  Table: {
    filterTitle: 'Filter menu',
    filterConfirm: 'OK',
    filterReset: 'Reset',
    filterEmptyText: 'No filters',
    emptyText: 'No data',
    selectAll: 'Select current page',
    selectInvert: 'Invert current page',
    selectionAll: 'Select all data',
    sortTitle: 'Sort',
    expand: 'Expand row',
    collapse: 'Collapse row',
    triggerDesc: 'Click sort by descend',
    triggerAsc: 'Click sort by ascend',
    cancelSort: 'Click to cancel sort'
  },
  Modal: {
    okText: 'OK',
    cancelText: 'Cancel',
    justOkText: 'OK'
  },
  Popconfirm: {
    okText: 'OK',
    cancelText: 'Cancel'
  },
  Transfer: {
    titles: ['', ''],
    searchPlaceholder: 'Search here',
    itemUnit: 'item',
    itemsUnit: 'items',
    remove: 'Remove',
    selectCurrent: 'Select current page',
    removeCurrent: 'Remove current page',
    selectAll: 'Select all data',
    removeAll: 'Remove all data',
    selectInvert: 'Invert current page'
  },
  Upload: {
    uploading: 'Uploading...',
    removeFile: 'Remove file',
    uploadError: 'Upload error',
    previewFile: 'Preview file',
    downloadFile: 'Download file'
  },
  Empty: {
    description: 'No Data'
  },
  Icon: {
    icon: 'icon'
  },
  Text: {
    edit: 'Edit',
    copy: 'Copy',
    copied: 'Copied',
    expand: 'Expand'
  },
  PageHeader: {
    back: 'Back'
  },
  Form: {
    defaultValidateMessages: {
      "default": 'Field validation error ${label}',
      required: 'Please enter ${label}',
      "enum": '${label} must be one of [${enum}]',
      whitespace: '${label} cannot be a blank character',
      date: {
        format: '${label} date format is invalid',
        parse: '${label} cannot be converted to a date',
        invalid: '${label} is an invalid date'
      },
      types: {
        string: typeTemplate,
        method: typeTemplate,
        array: typeTemplate,
        object: typeTemplate,
        number: typeTemplate,
        date: typeTemplate,
        "boolean": typeTemplate,
        integer: typeTemplate,
        "float": typeTemplate,
        regexp: typeTemplate,
        email: typeTemplate,
        url: typeTemplate,
        hex: typeTemplate
      },
      string: {
        len: '${label} must be ${len} characters',
        min: '${label} at least ${min} characters',
        max: '${label} up to ${max} characters',
        range: '${label} must be between ${min}-${max} characters'
      },
      number: {
        len: '${label} must be equal to ${len}',
        min: '${label} minimum value is ${min}',
        max: '${label} maximum value is ${max}',
        range: '${label} must be between ${min}-${max}'
      },
      array: {
        len: 'Must be ${len} ${label}',
        min: 'At least ${min} ${label}',
        max: 'At most ${max} ${label}',
        range: 'The amount of ${label} must be between ${min}-${max}'
      },
      pattern: {
        mismatch: '${label} does not match the pattern ${pattern}'
      }
    }
  }
};
var _default = localeValues;
exports["default"] = _default;

/***/ }),
/* 61 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports["default"] = void 0;

var _extends2 = _interopRequireDefault(__webpack_require__(3));

var _en_US = _interopRequireDefault(__webpack_require__(97));

var _en_US2 = _interopRequireDefault(__webpack_require__(62)); // Merge into a locale object


var locale = {
  lang: (0, _extends2["default"])({
    placeholder: 'Select date',
    yearPlaceholder: 'Select year',
    quarterPlaceholder: 'Select quarter',
    monthPlaceholder: 'Select month',
    weekPlaceholder: 'Select week',
    rangePlaceholder: ['Start date', 'End date'],
    rangeYearPlaceholder: ['Start year', 'End year'],
    rangeMonthPlaceholder: ['Start month', 'End month'],
    rangeWeekPlaceholder: ['Start week', 'End week']
  }, _en_US["default"]),
  timePickerLocale: (0, _extends2["default"])({}, _en_US2["default"])
}; // All settings at:
// https://github.com/ant-design/ant-design/blob/master/components/date-picker/locale/example.json

var _default = locale;
exports["default"] = _default;

/***/ }),
/* 62 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


Object.defineProperty(exports, "__esModule", {
  value: true
});
exports["default"] = void 0;
var locale = {
  placeholder: 'Select time',
  rangePlaceholder: ['Start time', 'End time']
};
var _default = locale;
exports["default"] = _default;

/***/ }),
/* 63 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


Object.defineProperty(exports, "__esModule", {
  value: true
});
exports["default"] = void 0;

var _react = __webpack_require__(0);

var LocaleContext = /*#__PURE__*/(0, _react.createContext)(undefined);
var _default = LocaleContext;
exports["default"] = _default;

/***/ }),
/* 64 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireWildcard = __webpack_require__(7);

var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports["default"] = void 0;

var _extends2 = _interopRequireDefault(__webpack_require__(3));

var _classCallCheck2 = _interopRequireDefault(__webpack_require__(33));

var _createClass2 = _interopRequireDefault(__webpack_require__(34));

var _inherits2 = _interopRequireDefault(__webpack_require__(35));

var _createSuper2 = _interopRequireDefault(__webpack_require__(41));

var React = _interopRequireWildcard(__webpack_require__(0));

var _default = _interopRequireDefault(__webpack_require__(99));

var _context = _interopRequireDefault(__webpack_require__(63));

var LocaleReceiver = /*#__PURE__*/function (_React$Component) {
  (0, _inherits2["default"])(LocaleReceiver, _React$Component);

  var _super = (0, _createSuper2["default"])(LocaleReceiver);

  function LocaleReceiver() {
    (0, _classCallCheck2["default"])(this, LocaleReceiver);
    return _super.apply(this, arguments);
  }

  (0, _createClass2["default"])(LocaleReceiver, [{
    key: "getLocale",
    value: function getLocale() {
      var _this$props = this.props,
          componentName = _this$props.componentName,
          defaultLocale = _this$props.defaultLocale;
      var locale = defaultLocale || _default["default"][componentName || 'global'];
      var antLocale = this.context;
      var localeFromContext = componentName && antLocale ? antLocale[componentName] : {};
      return (0, _extends2["default"])((0, _extends2["default"])({}, typeof locale === 'function' ? locale() : locale), localeFromContext || {});
    }
  }, {
    key: "getLocaleCode",
    value: function getLocaleCode() {
      var antLocale = this.context;
      var localeCode = antLocale && antLocale.locale; // Had use LocaleProvide but didn't set locale

      if (antLocale && antLocale.exist && !localeCode) {
        return _default["default"].locale;
      }

      return localeCode;
    }
  }, {
    key: "render",
    value: function render() {
      return this.props.children(this.getLocale(), this.getLocaleCode(), this.context);
    }
  }]);
  return LocaleReceiver;
}(React.Component);

exports["default"] = LocaleReceiver;
LocaleReceiver.defaultProps = {
  componentName: 'global'
};
LocaleReceiver.contextType = _context["default"];

/***/ }),
/* 65 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireWildcard = __webpack_require__(7);

var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.getKeyThenIncreaseKey = getKeyThenIncreaseKey;
exports.attachTypeApi = attachTypeApi;
exports["default"] = void 0;

var _extends2 = _interopRequireDefault(__webpack_require__(3));

var _defineProperty2 = _interopRequireDefault(__webpack_require__(13));

var React = _interopRequireWildcard(__webpack_require__(0));

var _classnames = _interopRequireDefault(__webpack_require__(2));

var _rcNotification = _interopRequireDefault(__webpack_require__(77));

var _LoadingOutlined = _interopRequireDefault(__webpack_require__(106));

var _ExclamationCircleFilled = _interopRequireDefault(__webpack_require__(116));

var _CloseCircleFilled = _interopRequireDefault(__webpack_require__(119));

var _CheckCircleFilled = _interopRequireDefault(__webpack_require__(122));

var _InfoCircleFilled = _interopRequireDefault(__webpack_require__(125));

var _useMessage = _interopRequireDefault(__webpack_require__(128));

var messageInstance;
var defaultDuration = 3;
var defaultTop;
var key = 1;
var localPrefixCls = 'ant-message';
var transitionName = 'move-up';
var getContainer;
var maxCount;
var rtl = false;

function getKeyThenIncreaseKey() {
  return key++;
}

function setMessageConfig(options) {
  if (options.top !== undefined) {
    defaultTop = options.top;
    messageInstance = null; // delete messageInstance for new defaultTop
  }

  if (options.duration !== undefined) {
    defaultDuration = options.duration;
  }

  if (options.prefixCls !== undefined) {
    localPrefixCls = options.prefixCls;
  }

  if (options.getContainer !== undefined) {
    getContainer = options.getContainer;
  }

  if (options.transitionName !== undefined) {
    transitionName = options.transitionName;
    messageInstance = null; // delete messageInstance for new transitionName
  }

  if (options.maxCount !== undefined) {
    maxCount = options.maxCount;
    messageInstance = null;
  }

  if (options.rtl !== undefined) {
    rtl = options.rtl;
  }
}

function getRCNotificationInstance(args, callback) {
  var prefixCls = args.prefixCls || localPrefixCls;

  if (messageInstance) {
    callback({
      prefixCls: prefixCls,
      instance: messageInstance
    });
    return;
  }

  _rcNotification["default"].newInstance({
    prefixCls: prefixCls,
    transitionName: transitionName,
    style: {
      top: defaultTop
    },
    getContainer: getContainer,
    maxCount: maxCount
  }, function (instance) {
    if (messageInstance) {
      callback({
        prefixCls: prefixCls,
        instance: messageInstance
      });
      return;
    }

    messageInstance = instance;
    callback({
      prefixCls: prefixCls,
      instance: instance
    });
  });
}

var typeToIcon = {
  info: _InfoCircleFilled["default"],
  success: _CheckCircleFilled["default"],
  error: _CloseCircleFilled["default"],
  warning: _ExclamationCircleFilled["default"],
  loading: _LoadingOutlined["default"]
};

function getRCNoticeProps(args, prefixCls) {
  var _classNames;

  var duration = args.duration !== undefined ? args.duration : defaultDuration;
  var IconComponent = typeToIcon[args.type];
  var messageClass = (0, _classnames["default"])("".concat(prefixCls, "-custom-content"), (_classNames = {}, (0, _defineProperty2["default"])(_classNames, "".concat(prefixCls, "-").concat(args.type), args.type), (0, _defineProperty2["default"])(_classNames, "".concat(prefixCls, "-rtl"), rtl === true), _classNames));
  return {
    key: args.key,
    duration: duration,
    style: args.style || {},
    className: args.className,
    content: /*#__PURE__*/React.createElement("div", {
      className: messageClass
    }, args.icon || IconComponent && /*#__PURE__*/React.createElement(IconComponent, null), /*#__PURE__*/React.createElement("span", null, args.content)),
    onClose: args.onClose
  };
}

function notice(args) {
  var target = args.key || key++;
  var closePromise = new Promise(function (resolve) {
    var callback = function callback() {
      if (typeof args.onClose === 'function') {
        args.onClose();
      }

      return resolve(true);
    };

    getRCNotificationInstance(args, function (_ref) {
      var prefixCls = _ref.prefixCls,
          instance = _ref.instance;
      instance.notice(getRCNoticeProps((0, _extends2["default"])((0, _extends2["default"])({}, args), {
        key: target,
        onClose: callback
      }), prefixCls));
    });
  });

  var result = function result() {
    if (messageInstance) {
      messageInstance.removeNotice(target);
    }
  };

  result.then = function (filled, rejected) {
    return closePromise.then(filled, rejected);
  };

  result.promise = closePromise;
  return result;
}

function isArgsProps(content) {
  return Object.prototype.toString.call(content) === '[object Object]' && !!content.content;
}

var api = {
  open: notice,
  config: setMessageConfig,
  destroy: function destroy() {
    if (messageInstance) {
      messageInstance.destroy();
      messageInstance = null;
    }
  }
};

function attachTypeApi(originalApi, type) {
  originalApi[type] = function (content, duration, onClose) {
    if (isArgsProps(content)) {
      return originalApi.open((0, _extends2["default"])((0, _extends2["default"])({}, content), {
        type: type
      }));
    }

    if (typeof duration === 'function') {
      onClose = duration;
      duration = undefined;
    }

    return originalApi.open({
      content: content,
      duration: duration,
      type: type,
      onClose: onClose
    });
  };
}

['success', 'info', 'warning', 'error', 'loading'].forEach(function (type) {
  return attachTypeApi(api, type);
});
api.warn = api.warning;
api.useMessage = (0, _useMessage["default"])(getRCNotificationInstance, getRCNoticeProps);
var _default = api;
exports["default"] = _default;

/***/ }),
/* 66 */
/***/ (function(module, exports, __webpack_require__) {

var arrayLikeToArray = __webpack_require__(67);

function _unsupportedIterableToArray(o, minLen) {
  if (!o) return;
  if (typeof o === "string") return arrayLikeToArray(o, minLen);
  var n = Object.prototype.toString.call(o).slice(8, -1);
  if (n === "Object" && o.constructor) n = o.constructor.name;
  if (n === "Map" || n === "Set") return Array.from(o);
  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return arrayLikeToArray(o, minLen);
}

module.exports = _unsupportedIterableToArray;

/***/ }),
/* 67 */
/***/ (function(module, exports) {

function _arrayLikeToArray(arr, len) {
  if (len == null || len > arr.length) len = arr.length;

  for (var i = 0, arr2 = new Array(len); i < len; i++) {
    arr2[i] = arr[i];
  }

  return arr2;
}

module.exports = _arrayLikeToArray;

/***/ }),
/* 68 */
/***/ (function(module, exports, __webpack_require__) {

var objectWithoutPropertiesLoose = __webpack_require__(112);

function _objectWithoutProperties(source, excluded) {
  if (source == null) return {};
  var target = objectWithoutPropertiesLoose(source, excluded);
  var key, i;

  if (Object.getOwnPropertySymbols) {
    var sourceSymbolKeys = Object.getOwnPropertySymbols(source);

    for (i = 0; i < sourceSymbolKeys.length; i++) {
      key = sourceSymbolKeys[i];
      if (excluded.indexOf(key) >= 0) continue;
      if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue;
      target[key] = source[key];
    }
  }

  return target;
}

module.exports = _objectWithoutProperties;

/***/ }),
/* 69 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var _objectWithoutProperties2 = _interopRequireDefault(__webpack_require__(68));

var _objectSpread2 = _interopRequireDefault(__webpack_require__(70));

var _utils = __webpack_require__(49);

var twoToneColorPalette = {
  primaryColor: '#333',
  secondaryColor: '#E6E6E6',
  calculated: false
};

function setTwoToneColors(_ref) {
  var primaryColor = _ref.primaryColor,
      secondaryColor = _ref.secondaryColor;
  twoToneColorPalette.primaryColor = primaryColor;
  twoToneColorPalette.secondaryColor = secondaryColor || (0, _utils.getSecondaryColor)(primaryColor);
  twoToneColorPalette.calculated = !!secondaryColor;
}

function getTwoToneColors() {
  return (0, _objectSpread2.default)({}, twoToneColorPalette);
}

var IconBase = function IconBase(props) {
  var icon = props.icon,
      className = props.className,
      onClick = props.onClick,
      style = props.style,
      primaryColor = props.primaryColor,
      secondaryColor = props.secondaryColor,
      restProps = (0, _objectWithoutProperties2.default)(props, ["icon", "className", "onClick", "style", "primaryColor", "secondaryColor"]);
  var colors = twoToneColorPalette;

  if (primaryColor) {
    colors = {
      primaryColor: primaryColor,
      secondaryColor: secondaryColor || (0, _utils.getSecondaryColor)(primaryColor)
    };
  }

  (0, _utils.useInsertStyles)();
  (0, _utils.warning)((0, _utils.isIconDefinition)(icon), "icon should be icon definiton, but got ".concat(icon));

  if (!(0, _utils.isIconDefinition)(icon)) {
    return null;
  }

  var target = icon;

  if (target && typeof target.icon === 'function') {
    target = (0, _objectSpread2.default)((0, _objectSpread2.default)({}, target), {}, {
      icon: target.icon(colors.primaryColor, colors.secondaryColor)
    });
  }

  return (0, _utils.generate)(target.icon, "svg-".concat(target.name), (0, _objectSpread2.default)({
    className: className,
    onClick: onClick,
    style: style,
    'data-icon': target.name,
    width: '1em',
    height: '1em',
    fill: 'currentColor',
    'aria-hidden': 'true'
  }, restProps));
};

IconBase.displayName = 'IconReact';
IconBase.getTwoToneColors = getTwoToneColors;
IconBase.setTwoToneColors = setTwoToneColors;
var _default = IconBase;
exports.default = _default;

/***/ }),
/* 70 */
/***/ (function(module, exports, __webpack_require__) {

var defineProperty = __webpack_require__(13);

function ownKeys(object, enumerableOnly) {
  var keys = Object.keys(object);

  if (Object.getOwnPropertySymbols) {
    var symbols = Object.getOwnPropertySymbols(object);
    if (enumerableOnly) symbols = symbols.filter(function (sym) {
      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
    });
    keys.push.apply(keys, symbols);
  }

  return keys;
}

function _objectSpread2(target) {
  for (var i = 1; i < arguments.length; i++) {
    var source = arguments[i] != null ? arguments[i] : {};

    if (i % 2) {
      ownKeys(Object(source), true).forEach(function (key) {
        defineProperty(target, key, source[key]);
      });
    } else if (Object.getOwnPropertyDescriptors) {
      Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
    } else {
      ownKeys(Object(source)).forEach(function (key) {
        Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
      });
    }
  }

  return target;
}

module.exports = _objectSpread2;

/***/ }),
/* 71 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireWildcard = __webpack_require__(7);

var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = useNotification;

var _toConsumableArray2 = _interopRequireDefault(__webpack_require__(129));

var _slicedToArray2 = _interopRequireDefault(__webpack_require__(24));

var React = _interopRequireWildcard(__webpack_require__(0));

var _Notice = _interopRequireDefault(__webpack_require__(133));

function useNotification(notificationInstance) {
  var createdRef = React.useRef({});

  var _React$useState = React.useState([]),
      _React$useState2 = (0, _slicedToArray2.default)(_React$useState, 2),
      elements = _React$useState2[0],
      setElements = _React$useState2[1];

  function notify(noticeProps) {
    notificationInstance.add(noticeProps, function (div, props) {
      var key = props.key;

      if (div && !createdRef.current[key]) {
        var noticeEle = React.createElement(_Notice.default, Object.assign({}, props, {
          holder: div
        }));
        createdRef.current[key] = noticeEle;
        setElements(function (originElements) {
          return [].concat((0, _toConsumableArray2.default)(originElements), [noticeEle]);
        });
      }
    });
  }

  return [notify, React.createElement(React.Fragment, null, elements)];
}

/***/ }),
/* 72 */
/***/ (function(module, exports, __webpack_require__) {

// extracted by mini-css-extract-plugin

/***/ }),
/* 73 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = __webpack_require__(19);

var rotr32 = utils.rotr32;

function ft_1(s, x, y, z) {
  if (s === 0) return ch32(x, y, z);
  if (s === 1 || s === 3) return p32(x, y, z);
  if (s === 2) return maj32(x, y, z);
}

exports.ft_1 = ft_1;

function ch32(x, y, z) {
  return x & y ^ ~x & z;
}

exports.ch32 = ch32;

function maj32(x, y, z) {
  return x & y ^ x & z ^ y & z;
}

exports.maj32 = maj32;

function p32(x, y, z) {
  return x ^ y ^ z;
}

exports.p32 = p32;

function s0_256(x) {
  return rotr32(x, 2) ^ rotr32(x, 13) ^ rotr32(x, 22);
}

exports.s0_256 = s0_256;

function s1_256(x) {
  return rotr32(x, 6) ^ rotr32(x, 11) ^ rotr32(x, 25);
}

exports.s1_256 = s1_256;

function g0_256(x) {
  return rotr32(x, 7) ^ rotr32(x, 18) ^ x >>> 3;
}

exports.g0_256 = g0_256;

function g1_256(x) {
  return rotr32(x, 17) ^ rotr32(x, 19) ^ x >>> 10;
}

exports.g1_256 = g1_256;

/***/ }),
/* 74 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = __webpack_require__(19);

var common = __webpack_require__(32);

var shaCommon = __webpack_require__(73);

var assert = __webpack_require__(31);

var sum32 = utils.sum32;
var sum32_4 = utils.sum32_4;
var sum32_5 = utils.sum32_5;
var ch32 = shaCommon.ch32;
var maj32 = shaCommon.maj32;
var s0_256 = shaCommon.s0_256;
var s1_256 = shaCommon.s1_256;
var g0_256 = shaCommon.g0_256;
var g1_256 = shaCommon.g1_256;
var BlockHash = common.BlockHash;
var sha256_K = [0x428a2f98, 0x71374491, 0xb5c0fbcf, 0xe9b5dba5, 0x3956c25b, 0x59f111f1, 0x923f82a4, 0xab1c5ed5, 0xd807aa98, 0x12835b01, 0x243185be, 0x550c7dc3, 0x72be5d74, 0x80deb1fe, 0x9bdc06a7, 0xc19bf174, 0xe49b69c1, 0xefbe4786, 0x0fc19dc6, 0x240ca1cc, 0x2de92c6f, 0x4a7484aa, 0x5cb0a9dc, 0x76f988da, 0x983e5152, 0xa831c66d, 0xb00327c8, 0xbf597fc7, 0xc6e00bf3, 0xd5a79147, 0x06ca6351, 0x14292967, 0x27b70a85, 0x2e1b2138, 0x4d2c6dfc, 0x53380d13, 0x650a7354, 0x766a0abb, 0x81c2c92e, 0x92722c85, 0xa2bfe8a1, 0xa81a664b, 0xc24b8b70, 0xc76c51a3, 0xd192e819, 0xd6990624, 0xf40e3585, 0x106aa070, 0x19a4c116, 0x1e376c08, 0x2748774c, 0x34b0bcb5, 0x391c0cb3, 0x4ed8aa4a, 0x5b9cca4f, 0x682e6ff3, 0x748f82ee, 0x78a5636f, 0x84c87814, 0x8cc70208, 0x90befffa, 0xa4506ceb, 0xbef9a3f7, 0xc67178f2];

function SHA256() {
  if (!(this instanceof SHA256)) return new SHA256();
  BlockHash.call(this);
  this.h = [0x6a09e667, 0xbb67ae85, 0x3c6ef372, 0xa54ff53a, 0x510e527f, 0x9b05688c, 0x1f83d9ab, 0x5be0cd19];
  this.k = sha256_K;
  this.W = new Array(64);
}

utils.inherits(SHA256, BlockHash);
module.exports = SHA256;
SHA256.blockSize = 512;
SHA256.outSize = 256;
SHA256.hmacStrength = 192;
SHA256.padLength = 64;

SHA256.prototype._update = function _update(msg, start) {
  var W = this.W;

  for (var i = 0; i < 16; i++) {
    W[i] = msg[start + i];
  }

  for (; i < W.length; i++) {
    W[i] = sum32_4(g1_256(W[i - 2]), W[i - 7], g0_256(W[i - 15]), W[i - 16]);
  }

  var a = this.h[0];
  var b = this.h[1];
  var c = this.h[2];
  var d = this.h[3];
  var e = this.h[4];
  var f = this.h[5];
  var g = this.h[6];
  var h = this.h[7];
  assert(this.k.length === W.length);

  for (i = 0; i < W.length; i++) {
    var T1 = sum32_5(h, s1_256(e), ch32(e, f, g), this.k[i], W[i]);
    var T2 = sum32(s0_256(a), maj32(a, b, c));
    h = g;
    g = f;
    f = e;
    e = sum32(d, T1);
    d = c;
    c = b;
    b = a;
    a = sum32(T1, T2);
  }

  this.h[0] = sum32(this.h[0], a);
  this.h[1] = sum32(this.h[1], b);
  this.h[2] = sum32(this.h[2], c);
  this.h[3] = sum32(this.h[3], d);
  this.h[4] = sum32(this.h[4], e);
  this.h[5] = sum32(this.h[5], f);
  this.h[6] = sum32(this.h[6], g);
  this.h[7] = sum32(this.h[7], h);
};

SHA256.prototype._digest = function digest(enc) {
  if (enc === 'hex') return utils.toHex32(this.h, 'big');else return utils.split32(this.h, 'big');
};

/***/ }),
/* 75 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = __webpack_require__(19);

var common = __webpack_require__(32);

var assert = __webpack_require__(31);

var rotr64_hi = utils.rotr64_hi;
var rotr64_lo = utils.rotr64_lo;
var shr64_hi = utils.shr64_hi;
var shr64_lo = utils.shr64_lo;
var sum64 = utils.sum64;
var sum64_hi = utils.sum64_hi;
var sum64_lo = utils.sum64_lo;
var sum64_4_hi = utils.sum64_4_hi;
var sum64_4_lo = utils.sum64_4_lo;
var sum64_5_hi = utils.sum64_5_hi;
var sum64_5_lo = utils.sum64_5_lo;
var BlockHash = common.BlockHash;
var sha512_K = [0x428a2f98, 0xd728ae22, 0x71374491, 0x23ef65cd, 0xb5c0fbcf, 0xec4d3b2f, 0xe9b5dba5, 0x8189dbbc, 0x3956c25b, 0xf348b538, 0x59f111f1, 0xb605d019, 0x923f82a4, 0xaf194f9b, 0xab1c5ed5, 0xda6d8118, 0xd807aa98, 0xa3030242, 0x12835b01, 0x45706fbe, 0x243185be, 0x4ee4b28c, 0x550c7dc3, 0xd5ffb4e2, 0x72be5d74, 0xf27b896f, 0x80deb1fe, 0x3b1696b1, 0x9bdc06a7, 0x25c71235, 0xc19bf174, 0xcf692694, 0xe49b69c1, 0x9ef14ad2, 0xefbe4786, 0x384f25e3, 0x0fc19dc6, 0x8b8cd5b5, 0x240ca1cc, 0x77ac9c65, 0x2de92c6f, 0x592b0275, 0x4a7484aa, 0x6ea6e483, 0x5cb0a9dc, 0xbd41fbd4, 0x76f988da, 0x831153b5, 0x983e5152, 0xee66dfab, 0xa831c66d, 0x2db43210, 0xb00327c8, 0x98fb213f, 0xbf597fc7, 0xbeef0ee4, 0xc6e00bf3, 0x3da88fc2, 0xd5a79147, 0x930aa725, 0x06ca6351, 0xe003826f, 0x14292967, 0x0a0e6e70, 0x27b70a85, 0x46d22ffc, 0x2e1b2138, 0x5c26c926, 0x4d2c6dfc, 0x5ac42aed, 0x53380d13, 0x9d95b3df, 0x650a7354, 0x8baf63de, 0x766a0abb, 0x3c77b2a8, 0x81c2c92e, 0x47edaee6, 0x92722c85, 0x1482353b, 0xa2bfe8a1, 0x4cf10364, 0xa81a664b, 0xbc423001, 0xc24b8b70, 0xd0f89791, 0xc76c51a3, 0x0654be30, 0xd192e819, 0xd6ef5218, 0xd6990624, 0x5565a910, 0xf40e3585, 0x5771202a, 0x106aa070, 0x32bbd1b8, 0x19a4c116, 0xb8d2d0c8, 0x1e376c08, 0x5141ab53, 0x2748774c, 0xdf8eeb99, 0x34b0bcb5, 0xe19b48a8, 0x391c0cb3, 0xc5c95a63, 0x4ed8aa4a, 0xe3418acb, 0x5b9cca4f, 0x7763e373, 0x682e6ff3, 0xd6b2b8a3, 0x748f82ee, 0x5defb2fc, 0x78a5636f, 0x43172f60, 0x84c87814, 0xa1f0ab72, 0x8cc70208, 0x1a6439ec, 0x90befffa, 0x23631e28, 0xa4506ceb, 0xde82bde9, 0xbef9a3f7, 0xb2c67915, 0xc67178f2, 0xe372532b, 0xca273ece, 0xea26619c, 0xd186b8c7, 0x21c0c207, 0xeada7dd6, 0xcde0eb1e, 0xf57d4f7f, 0xee6ed178, 0x06f067aa, 0x72176fba, 0x0a637dc5, 0xa2c898a6, 0x113f9804, 0xbef90dae, 0x1b710b35, 0x131c471b, 0x28db77f5, 0x23047d84, 0x32caab7b, 0x40c72493, 0x3c9ebe0a, 0x15c9bebc, 0x431d67c4, 0x9c100d4c, 0x4cc5d4be, 0xcb3e42b6, 0x597f299c, 0xfc657e2a, 0x5fcb6fab, 0x3ad6faec, 0x6c44198c, 0x4a475817];

function SHA512() {
  if (!(this instanceof SHA512)) return new SHA512();
  BlockHash.call(this);
  this.h = [0x6a09e667, 0xf3bcc908, 0xbb67ae85, 0x84caa73b, 0x3c6ef372, 0xfe94f82b, 0xa54ff53a, 0x5f1d36f1, 0x510e527f, 0xade682d1, 0x9b05688c, 0x2b3e6c1f, 0x1f83d9ab, 0xfb41bd6b, 0x5be0cd19, 0x137e2179];
  this.k = sha512_K;
  this.W = new Array(160);
}

utils.inherits(SHA512, BlockHash);
module.exports = SHA512;
SHA512.blockSize = 1024;
SHA512.outSize = 512;
SHA512.hmacStrength = 192;
SHA512.padLength = 128;

SHA512.prototype._prepareBlock = function _prepareBlock(msg, start) {
  var W = this.W; // 32 x 32bit words

  for (var i = 0; i < 32; i++) {
    W[i] = msg[start + i];
  }

  for (; i < W.length; i += 2) {
    var c0_hi = g1_512_hi(W[i - 4], W[i - 3]); // i - 2

    var c0_lo = g1_512_lo(W[i - 4], W[i - 3]);
    var c1_hi = W[i - 14]; // i - 7

    var c1_lo = W[i - 13];
    var c2_hi = g0_512_hi(W[i - 30], W[i - 29]); // i - 15

    var c2_lo = g0_512_lo(W[i - 30], W[i - 29]);
    var c3_hi = W[i - 32]; // i - 16

    var c3_lo = W[i - 31];
    W[i] = sum64_4_hi(c0_hi, c0_lo, c1_hi, c1_lo, c2_hi, c2_lo, c3_hi, c3_lo);
    W[i + 1] = sum64_4_lo(c0_hi, c0_lo, c1_hi, c1_lo, c2_hi, c2_lo, c3_hi, c3_lo);
  }
};

SHA512.prototype._update = function _update(msg, start) {
  this._prepareBlock(msg, start);

  var W = this.W;
  var ah = this.h[0];
  var al = this.h[1];
  var bh = this.h[2];
  var bl = this.h[3];
  var ch = this.h[4];
  var cl = this.h[5];
  var dh = this.h[6];
  var dl = this.h[7];
  var eh = this.h[8];
  var el = this.h[9];
  var fh = this.h[10];
  var fl = this.h[11];
  var gh = this.h[12];
  var gl = this.h[13];
  var hh = this.h[14];
  var hl = this.h[15];
  assert(this.k.length === W.length);

  for (var i = 0; i < W.length; i += 2) {
    var c0_hi = hh;
    var c0_lo = hl;
    var c1_hi = s1_512_hi(eh, el);
    var c1_lo = s1_512_lo(eh, el);
    var c2_hi = ch64_hi(eh, el, fh, fl, gh, gl);
    var c2_lo = ch64_lo(eh, el, fh, fl, gh, gl);
    var c3_hi = this.k[i];
    var c3_lo = this.k[i + 1];
    var c4_hi = W[i];
    var c4_lo = W[i + 1];
    var T1_hi = sum64_5_hi(c0_hi, c0_lo, c1_hi, c1_lo, c2_hi, c2_lo, c3_hi, c3_lo, c4_hi, c4_lo);
    var T1_lo = sum64_5_lo(c0_hi, c0_lo, c1_hi, c1_lo, c2_hi, c2_lo, c3_hi, c3_lo, c4_hi, c4_lo);
    c0_hi = s0_512_hi(ah, al);
    c0_lo = s0_512_lo(ah, al);
    c1_hi = maj64_hi(ah, al, bh, bl, ch, cl);
    c1_lo = maj64_lo(ah, al, bh, bl, ch, cl);
    var T2_hi = sum64_hi(c0_hi, c0_lo, c1_hi, c1_lo);
    var T2_lo = sum64_lo(c0_hi, c0_lo, c1_hi, c1_lo);
    hh = gh;
    hl = gl;
    gh = fh;
    gl = fl;
    fh = eh;
    fl = el;
    eh = sum64_hi(dh, dl, T1_hi, T1_lo);
    el = sum64_lo(dl, dl, T1_hi, T1_lo);
    dh = ch;
    dl = cl;
    ch = bh;
    cl = bl;
    bh = ah;
    bl = al;
    ah = sum64_hi(T1_hi, T1_lo, T2_hi, T2_lo);
    al = sum64_lo(T1_hi, T1_lo, T2_hi, T2_lo);
  }

  sum64(this.h, 0, ah, al);
  sum64(this.h, 2, bh, bl);
  sum64(this.h, 4, ch, cl);
  sum64(this.h, 6, dh, dl);
  sum64(this.h, 8, eh, el);
  sum64(this.h, 10, fh, fl);
  sum64(this.h, 12, gh, gl);
  sum64(this.h, 14, hh, hl);
};

SHA512.prototype._digest = function digest(enc) {
  if (enc === 'hex') return utils.toHex32(this.h, 'big');else return utils.split32(this.h, 'big');
};

function ch64_hi(xh, xl, yh, yl, zh) {
  var r = xh & yh ^ ~xh & zh;
  if (r < 0) r += 0x100000000;
  return r;
}

function ch64_lo(xh, xl, yh, yl, zh, zl) {
  var r = xl & yl ^ ~xl & zl;
  if (r < 0) r += 0x100000000;
  return r;
}

function maj64_hi(xh, xl, yh, yl, zh) {
  var r = xh & yh ^ xh & zh ^ yh & zh;
  if (r < 0) r += 0x100000000;
  return r;
}

function maj64_lo(xh, xl, yh, yl, zh, zl) {
  var r = xl & yl ^ xl & zl ^ yl & zl;
  if (r < 0) r += 0x100000000;
  return r;
}

function s0_512_hi(xh, xl) {
  var c0_hi = rotr64_hi(xh, xl, 28);
  var c1_hi = rotr64_hi(xl, xh, 2); // 34

  var c2_hi = rotr64_hi(xl, xh, 7); // 39

  var r = c0_hi ^ c1_hi ^ c2_hi;
  if (r < 0) r += 0x100000000;
  return r;
}

function s0_512_lo(xh, xl) {
  var c0_lo = rotr64_lo(xh, xl, 28);
  var c1_lo = rotr64_lo(xl, xh, 2); // 34

  var c2_lo = rotr64_lo(xl, xh, 7); // 39

  var r = c0_lo ^ c1_lo ^ c2_lo;
  if (r < 0) r += 0x100000000;
  return r;
}

function s1_512_hi(xh, xl) {
  var c0_hi = rotr64_hi(xh, xl, 14);
  var c1_hi = rotr64_hi(xh, xl, 18);
  var c2_hi = rotr64_hi(xl, xh, 9); // 41

  var r = c0_hi ^ c1_hi ^ c2_hi;
  if (r < 0) r += 0x100000000;
  return r;
}

function s1_512_lo(xh, xl) {
  var c0_lo = rotr64_lo(xh, xl, 14);
  var c1_lo = rotr64_lo(xh, xl, 18);
  var c2_lo = rotr64_lo(xl, xh, 9); // 41

  var r = c0_lo ^ c1_lo ^ c2_lo;
  if (r < 0) r += 0x100000000;
  return r;
}

function g0_512_hi(xh, xl) {
  var c0_hi = rotr64_hi(xh, xl, 1);
  var c1_hi = rotr64_hi(xh, xl, 8);
  var c2_hi = shr64_hi(xh, xl, 7);
  var r = c0_hi ^ c1_hi ^ c2_hi;
  if (r < 0) r += 0x100000000;
  return r;
}

function g0_512_lo(xh, xl) {
  var c0_lo = rotr64_lo(xh, xl, 1);
  var c1_lo = rotr64_lo(xh, xl, 8);
  var c2_lo = shr64_lo(xh, xl, 7);
  var r = c0_lo ^ c1_lo ^ c2_lo;
  if (r < 0) r += 0x100000000;
  return r;
}

function g1_512_hi(xh, xl) {
  var c0_hi = rotr64_hi(xh, xl, 19);
  var c1_hi = rotr64_hi(xl, xh, 29); // 61

  var c2_hi = shr64_hi(xh, xl, 6);
  var r = c0_hi ^ c1_hi ^ c2_hi;
  if (r < 0) r += 0x100000000;
  return r;
}

function g1_512_lo(xh, xl) {
  var c0_lo = rotr64_lo(xh, xl, 19);
  var c1_lo = rotr64_lo(xl, xh, 29); // 61

  var c2_lo = shr64_lo(xh, xl, 6);
  var r = c0_lo ^ c1_lo ^ c2_lo;
  if (r < 0) r += 0x100000000;
  return r;
}

/***/ }),
/* 76 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var replace = String.prototype.replace;
var percentTwenties = /%20/g;

var util = __webpack_require__(51);

var Format = {
  RFC1738: 'RFC1738',
  RFC3986: 'RFC3986'
};
module.exports = util.assign({
  'default': Format.RFC3986,
  formatters: {
    RFC1738: function RFC1738(value) {
      return replace.call(value, percentTwenties, '+');
    },
    RFC3986: function RFC3986(value) {
      return String(value);
    }
  }
}, Format);

/***/ }),
/* 77 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";
// ESM COMPAT FLAG
__webpack_require__.r(__webpack_exports__);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/objectWithoutProperties.js + 1 modules
var objectWithoutProperties = __webpack_require__(8);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/defineProperty.js
var defineProperty = __webpack_require__(5);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/classCallCheck.js
var classCallCheck = __webpack_require__(9);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/createClass.js
var createClass = __webpack_require__(11);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/inherits.js + 1 modules
var inherits = __webpack_require__(15);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/possibleConstructorReturn.js
var possibleConstructorReturn = __webpack_require__(21);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/getPrototypeOf.js
var getPrototypeOf = __webpack_require__(16);

// EXTERNAL MODULE: external "React"
var external_React_ = __webpack_require__(0);
var external_React_default = /*#__PURE__*/__webpack_require__.n(external_React_);

// EXTERNAL MODULE: external "ReactDOM"
var external_ReactDOM_ = __webpack_require__(14);
var external_ReactDOM_default = /*#__PURE__*/__webpack_require__.n(external_ReactDOM_);

// CONCATENATED MODULE: ./node_modules/rc-util/es/unsafeLifecyclesPolyfill.js


var unsafeLifecyclesPolyfill_unsafeLifecyclesPolyfill = function unsafeLifecyclesPolyfill(Component) {
  var prototype = Component.prototype;

  if (!prototype || !prototype.isReactComponent) {
    throw new Error('Can only polyfill class components');
  } // only handle componentWillReceiveProps


  if (typeof prototype.componentWillReceiveProps !== 'function') {
    return Component;
  } // In React 16.9, React.Profiler was introduced together with UNSAFE_componentWillReceiveProps
  // https://reactjs.org/blog/2019/08/08/react-v16.9.0.html#performance-measurements-with-reactprofiler


  if (!external_React_default.a.Profiler) {
    return Component;
  } // Here polyfill get started


  prototype.UNSAFE_componentWillReceiveProps = prototype.componentWillReceiveProps;
  delete prototype.componentWillReceiveProps;
  return Component;
};

/* harmony default export */ var es_unsafeLifecyclesPolyfill = (unsafeLifecyclesPolyfill_unsafeLifecyclesPolyfill);
// CONCATENATED MODULE: ./node_modules/rc-animate/es/ChildrenUtils.js

function toArrayChildren(children) {
  var ret = [];
  external_React_default.a.Children.forEach(children, function (child) {
    ret.push(child);
  });
  return ret;
}
function findChildInChildrenByKey(children, key) {
  var ret = null;

  if (children) {
    children.forEach(function (child) {
      if (ret) {
        return;
      }

      if (child && child.key === key) {
        ret = child;
      }
    });
  }

  return ret;
}
function findShownChildInChildrenByKey(children, key, showProp) {
  var ret = null;

  if (children) {
    children.forEach(function (child) {
      if (child && child.key === key && child.props[showProp]) {
        if (ret) {
          throw new Error('two child with same key for <rc-animate> children');
        }

        ret = child;
      }
    });
  }

  return ret;
}
function findHiddenChildInChildrenByKey(children, key, showProp) {
  var found = 0;

  if (children) {
    children.forEach(function (child) {
      if (found) {
        return;
      }

      found = child && child.key === key && !child.props[showProp];
    });
  }

  return found;
}
function isSameChildren(c1, c2, showProp) {
  var same = c1.length === c2.length;

  if (same) {
    c1.forEach(function (child, index) {
      var child2 = c2[index];

      if (child && child2) {
        if (child && !child2 || !child && child2) {
          same = false;
        } else if (child.key !== child2.key) {
          same = false;
        } else if (showProp && child.props[showProp] !== child2.props[showProp]) {
          same = false;
        }
      }
    });
  }

  return same;
}
function mergeChildren(prev, next) {
  var ret = []; // For each key of `next`, the list of keys to insert before that key in
  // the combined list

  var nextChildrenPending = {};
  var pendingChildren = [];
  prev.forEach(function (child) {
    if (child && findChildInChildrenByKey(next, child.key)) {
      if (pendingChildren.length) {
        nextChildrenPending[child.key] = pendingChildren;
        pendingChildren = [];
      }
    } else {
      pendingChildren.push(child);
    }
  });
  next.forEach(function (child) {
    if (child && Object.prototype.hasOwnProperty.call(nextChildrenPending, child.key)) {
      ret = ret.concat(nextChildrenPending[child.key]);
    }

    ret.push(child);
  });
  ret = ret.concat(pendingChildren);
  return ret;
}
// CONCATENATED MODULE: ./node_modules/@ant-design/css-animation/es/Event.js
var START_EVENT_NAME_MAP = {
  transitionstart: {
    transition: 'transitionstart',
    WebkitTransition: 'webkitTransitionStart',
    MozTransition: 'mozTransitionStart',
    OTransition: 'oTransitionStart',
    msTransition: 'MSTransitionStart'
  },
  animationstart: {
    animation: 'animationstart',
    WebkitAnimation: 'webkitAnimationStart',
    MozAnimation: 'mozAnimationStart',
    OAnimation: 'oAnimationStart',
    msAnimation: 'MSAnimationStart'
  }
};
var END_EVENT_NAME_MAP = {
  transitionend: {
    transition: 'transitionend',
    WebkitTransition: 'webkitTransitionEnd',
    MozTransition: 'mozTransitionEnd',
    OTransition: 'oTransitionEnd',
    msTransition: 'MSTransitionEnd'
  },
  animationend: {
    animation: 'animationend',
    WebkitAnimation: 'webkitAnimationEnd',
    MozAnimation: 'mozAnimationEnd',
    OAnimation: 'oAnimationEnd',
    msAnimation: 'MSAnimationEnd'
  }
};
var startEvents = [];
var endEvents = [];

function detectEvents() {
  var testEl = document.createElement('div');
  var style = testEl.style;

  if (!('AnimationEvent' in window)) {
    delete START_EVENT_NAME_MAP.animationstart.animation;
    delete END_EVENT_NAME_MAP.animationend.animation;
  }

  if (!('TransitionEvent' in window)) {
    delete START_EVENT_NAME_MAP.transitionstart.transition;
    delete END_EVENT_NAME_MAP.transitionend.transition;
  }

  function process(EVENT_NAME_MAP, events) {
    for (var baseEventName in EVENT_NAME_MAP) {
      if (EVENT_NAME_MAP.hasOwnProperty(baseEventName)) {
        var baseEvents = EVENT_NAME_MAP[baseEventName];

        for (var styleName in baseEvents) {
          if (styleName in style) {
            events.push(baseEvents[styleName]);
            break;
          }
        }
      }
    }
  }

  process(START_EVENT_NAME_MAP, startEvents);
  process(END_EVENT_NAME_MAP, endEvents);
}

if (typeof window !== 'undefined' && typeof document !== 'undefined') {
  detectEvents();
}

function addEventListener(node, eventName, eventListener) {
  node.addEventListener(eventName, eventListener, false);
}

function removeEventListener(node, eventName, eventListener) {
  node.removeEventListener(eventName, eventListener, false);
}

var TransitionEvents = {
  // Start events
  startEvents: startEvents,
  addStartEventListener: function addStartEventListener(node, eventListener) {
    if (startEvents.length === 0) {
      window.setTimeout(eventListener, 0);
      return;
    }

    startEvents.forEach(function (startEvent) {
      addEventListener(node, startEvent, eventListener);
    });
  },
  removeStartEventListener: function removeStartEventListener(node, eventListener) {
    if (startEvents.length === 0) {
      return;
    }

    startEvents.forEach(function (startEvent) {
      removeEventListener(node, startEvent, eventListener);
    });
  },
  // End events
  endEvents: endEvents,
  addEndEventListener: function addEndEventListener(node, eventListener) {
    if (endEvents.length === 0) {
      window.setTimeout(eventListener, 0);
      return;
    }

    endEvents.forEach(function (endEvent) {
      addEventListener(node, endEvent, eventListener);
    });
  },
  removeEndEventListener: function removeEndEventListener(node, eventListener) {
    if (endEvents.length === 0) {
      return;
    }

    endEvents.forEach(function (endEvent) {
      removeEventListener(node, endEvent, eventListener);
    });
  }
};
/* harmony default export */ var Event = (TransitionEvents);
// CONCATENATED MODULE: ./node_modules/@ant-design/css-animation/es/index.js
function _typeof2(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof2 = function _typeof2(obj) { return typeof obj; }; } else { _typeof2 = function _typeof2(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof2(obj); }

var _typeof = typeof Symbol === "function" && _typeof2(Symbol.iterator) === "symbol" ? function (obj) {
  return _typeof2(obj);
} : function (obj) {
  return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : _typeof2(obj);
};


var isCssAnimationSupported = Event.endEvents.length !== 0;
var capitalPrefixes = ['Webkit', 'Moz', 'O', // ms is special .... !
'ms'];
var prefixes = ['-webkit-', '-moz-', '-o-', 'ms-', ''];

function getStyleProperty(node, name) {
  // old ff need null, https://developer.mozilla.org/en-US/docs/Web/API/Window/getComputedStyle
  var style = window.getComputedStyle(node, null);
  var ret = '';

  for (var i = 0; i < prefixes.length; i++) {
    ret = style.getPropertyValue(prefixes[i] + name);

    if (ret) {
      break;
    }
  }

  return ret;
}

function fixBrowserByTimeout(node) {
  if (isCssAnimationSupported) {
    var transitionDelay = parseFloat(getStyleProperty(node, 'transition-delay')) || 0;
    var transitionDuration = parseFloat(getStyleProperty(node, 'transition-duration')) || 0;
    var animationDelay = parseFloat(getStyleProperty(node, 'animation-delay')) || 0;
    var animationDuration = parseFloat(getStyleProperty(node, 'animation-duration')) || 0;
    var time = Math.max(transitionDuration + transitionDelay, animationDuration + animationDelay); // sometimes, browser bug

    node.rcEndAnimTimeout = setTimeout(function () {
      node.rcEndAnimTimeout = null;

      if (node.rcEndListener) {
        node.rcEndListener();
      }
    }, time * 1000 + 200);
  }
}

function clearBrowserBugTimeout(node) {
  if (node.rcEndAnimTimeout) {
    clearTimeout(node.rcEndAnimTimeout);
    node.rcEndAnimTimeout = null;
  }
}

var es_cssAnimation = function cssAnimation(node, transitionName, endCallback) {
  var nameIsObj = (typeof transitionName === 'undefined' ? 'undefined' : _typeof(transitionName)) === 'object';
  var className = nameIsObj ? transitionName.name : transitionName;
  var activeClassName = nameIsObj ? transitionName.active : transitionName + '-active';
  var end = endCallback;
  var start = void 0;
  var active = void 0;

  if (endCallback && Object.prototype.toString.call(endCallback) === '[object Object]') {
    end = endCallback.end;
    start = endCallback.start;
    active = endCallback.active;
  }

  if (node.rcEndListener) {
    node.rcEndListener();
  }

  node.rcEndListener = function (e) {
    if (e && e.target !== node) {
      return;
    }

    if (node.rcAnimTimeout) {
      clearTimeout(node.rcAnimTimeout);
      node.rcAnimTimeout = null;
    }

    clearBrowserBugTimeout(node);
    node.classList.remove(className);
    node.classList.remove(activeClassName);
    Event.removeEndEventListener(node, node.rcEndListener);
    node.rcEndListener = null; // Usually this optional end is used for informing an owner of
    // a leave animation and telling it to remove the child.

    if (end) {
      end();
    }
  };

  Event.addEndEventListener(node, node.rcEndListener);

  if (start) {
    start();
  }

  node.classList.add(className);
  node.rcAnimTimeout = setTimeout(function () {
    node.rcAnimTimeout = null;
    node.classList.add(activeClassName);

    if (active) {
      active();
    }

    fixBrowserByTimeout(node);
  }, 0);
  return {
    stop: function stop() {
      if (node.rcEndListener) {
        node.rcEndListener();
      }
    }
  };
};

es_cssAnimation.style = function (node, style, callback) {
  if (node.rcEndListener) {
    node.rcEndListener();
  }

  node.rcEndListener = function (e) {
    if (e && e.target !== node) {
      return;
    }

    if (node.rcAnimTimeout) {
      clearTimeout(node.rcAnimTimeout);
      node.rcAnimTimeout = null;
    }

    clearBrowserBugTimeout(node);
    Event.removeEndEventListener(node, node.rcEndListener);
    node.rcEndListener = null; // Usually this optional callback is used for informing an owner of
    // a leave animation and telling it to remove the child.

    if (callback) {
      callback();
    }
  };

  Event.addEndEventListener(node, node.rcEndListener);
  node.rcAnimTimeout = setTimeout(function () {
    for (var s in style) {
      if (style.hasOwnProperty(s)) {
        node.style[s] = style[s];
      }
    }

    node.rcAnimTimeout = null;
    fixBrowserByTimeout(node);
  }, 0);
};

es_cssAnimation.setTransition = function (node, p, value) {
  var property = p;
  var v = value;

  if (value === undefined) {
    v = property;
    property = '';
  }

  property = property || '';
  capitalPrefixes.forEach(function (prefix) {
    node.style[prefix + 'Transition' + property] = v;
  });
};

es_cssAnimation.isCssAnimationSupported = isCssAnimationSupported;

/* harmony default export */ var es = (es_cssAnimation);
// CONCATENATED MODULE: ./node_modules/rc-animate/es/util/animate.js
var util = {
  isAppearSupported: function isAppearSupported(props) {
    return props.transitionName && props.transitionAppear || props.animation.appear;
  },
  isEnterSupported: function isEnterSupported(props) {
    return props.transitionName && props.transitionEnter || props.animation.enter;
  },
  isLeaveSupported: function isLeaveSupported(props) {
    return props.transitionName && props.transitionLeave || props.animation.leave;
  },
  allowAppearCallback: function allowAppearCallback(props) {
    return props.transitionAppear || props.animation.appear;
  },
  allowEnterCallback: function allowEnterCallback(props) {
    return props.transitionEnter || props.animation.enter;
  },
  allowLeaveCallback: function allowLeaveCallback(props) {
    return props.transitionLeave || props.animation.leave;
  }
};
/* harmony default export */ var animate = (util);
// CONCATENATED MODULE: ./node_modules/rc-animate/es/AnimateChild.js
function AnimateChild_typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { AnimateChild_typeof = function _typeof(obj) { return typeof obj; }; } else { AnimateChild_typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return AnimateChild_typeof(obj); }

var _createClass = function () {
  function defineProperties(target, props) {
    for (var i = 0; i < props.length; i++) {
      var descriptor = props[i];
      descriptor.enumerable = descriptor.enumerable || false;
      descriptor.configurable = true;
      if ("value" in descriptor) descriptor.writable = true;
      Object.defineProperty(target, descriptor.key, descriptor);
    }
  }

  return function (Constructor, protoProps, staticProps) {
    if (protoProps) defineProperties(Constructor.prototype, protoProps);
    if (staticProps) defineProperties(Constructor, staticProps);
    return Constructor;
  };
}();

function _classCallCheck(instance, Constructor) {
  if (!(instance instanceof Constructor)) {
    throw new TypeError("Cannot call a class as a function");
  }
}

function _possibleConstructorReturn(self, call) {
  if (!self) {
    throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
  }

  return call && (AnimateChild_typeof(call) === "object" || typeof call === "function") ? call : self;
}

function _inherits(subClass, superClass) {
  if (typeof superClass !== "function" && superClass !== null) {
    throw new TypeError("Super expression must either be null or a function, not " + AnimateChild_typeof(superClass));
  }

  subClass.prototype = Object.create(superClass && superClass.prototype, {
    constructor: {
      value: subClass,
      enumerable: false,
      writable: true,
      configurable: true
    }
  });
  if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass;
}
/* eslint react/prop-types: 0 */






var transitionMap = {
  enter: 'transitionEnter',
  appear: 'transitionAppear',
  leave: 'transitionLeave'
};

var AnimateChild_AnimateChild = function (_React$Component) {
  _inherits(AnimateChild, _React$Component);

  function AnimateChild() {
    _classCallCheck(this, AnimateChild);

    return _possibleConstructorReturn(this, (AnimateChild.__proto__ || Object.getPrototypeOf(AnimateChild)).apply(this, arguments));
  }

  _createClass(AnimateChild, [{
    key: 'componentWillUnmount',
    value: function componentWillUnmount() {
      this.stop();
    }
  }, {
    key: 'componentWillEnter',
    value: function componentWillEnter(done) {
      if (animate.isEnterSupported(this.props)) {
        this.transition('enter', done);
      } else {
        done();
      }
    }
  }, {
    key: 'componentWillAppear',
    value: function componentWillAppear(done) {
      if (animate.isAppearSupported(this.props)) {
        this.transition('appear', done);
      } else {
        done();
      }
    }
  }, {
    key: 'componentWillLeave',
    value: function componentWillLeave(done) {
      if (animate.isLeaveSupported(this.props)) {
        this.transition('leave', done);
      } else {
        // always sync, do not interupt with react component life cycle
        // update hidden -> animate hidden ->
        // didUpdate -> animate leave -> unmount (if animate is none)
        done();
      }
    }
  }, {
    key: 'transition',
    value: function transition(animationType, finishCallback) {
      var _this2 = this;

      var node = external_ReactDOM_default.a.findDOMNode(this);
      var props = this.props;
      var transitionName = props.transitionName;
      var nameIsObj = AnimateChild_typeof(transitionName) === 'object';
      this.stop();

      var end = function end() {
        _this2.stopper = null;
        finishCallback();
      };

      if ((isCssAnimationSupported || !props.animation[animationType]) && transitionName && props[transitionMap[animationType]]) {
        var name = nameIsObj ? transitionName[animationType] : transitionName + '-' + animationType;
        var activeName = name + '-active';

        if (nameIsObj && transitionName[animationType + 'Active']) {
          activeName = transitionName[animationType + 'Active'];
        }

        this.stopper = es(node, {
          name: name,
          active: activeName
        }, end);
      } else {
        this.stopper = props.animation[animationType](node, end);
      }
    }
  }, {
    key: 'stop',
    value: function stop() {
      var stopper = this.stopper;

      if (stopper) {
        this.stopper = null;
        stopper.stop();
      }
    }
  }, {
    key: 'render',
    value: function render() {
      return this.props.children;
    }
  }]);

  return AnimateChild;
}(external_React_default.a.Component);

/* harmony default export */ var es_AnimateChild = (AnimateChild_AnimateChild);
// CONCATENATED MODULE: ./node_modules/rc-animate/es/Animate.js
function Animate_typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { Animate_typeof = function _typeof(obj) { return typeof obj; }; } else { Animate_typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return Animate_typeof(obj); }

var _extends = Object.assign || function (target) {
  for (var i = 1; i < arguments.length; i++) {
    var source = arguments[i];

    for (var key in source) {
      if (Object.prototype.hasOwnProperty.call(source, key)) {
        target[key] = source[key];
      }
    }
  }

  return target;
};

var Animate_createClass = function () {
  function defineProperties(target, props) {
    for (var i = 0; i < props.length; i++) {
      var descriptor = props[i];
      descriptor.enumerable = descriptor.enumerable || false;
      descriptor.configurable = true;
      if ("value" in descriptor) descriptor.writable = true;
      Object.defineProperty(target, descriptor.key, descriptor);
    }
  }

  return function (Constructor, protoProps, staticProps) {
    if (protoProps) defineProperties(Constructor.prototype, protoProps);
    if (staticProps) defineProperties(Constructor, staticProps);
    return Constructor;
  };
}();

function _defineProperty(obj, key, value) {
  if (key in obj) {
    Object.defineProperty(obj, key, {
      value: value,
      enumerable: true,
      configurable: true,
      writable: true
    });
  } else {
    obj[key] = value;
  }

  return obj;
}

function Animate_classCallCheck(instance, Constructor) {
  if (!(instance instanceof Constructor)) {
    throw new TypeError("Cannot call a class as a function");
  }
}

function Animate_possibleConstructorReturn(self, call) {
  if (!self) {
    throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
  }

  return call && (Animate_typeof(call) === "object" || typeof call === "function") ? call : self;
}

function Animate_inherits(subClass, superClass) {
  if (typeof superClass !== "function" && superClass !== null) {
    throw new TypeError("Super expression must either be null or a function, not " + Animate_typeof(superClass));
  }

  subClass.prototype = Object.create(superClass && superClass.prototype, {
    constructor: {
      value: subClass,
      enumerable: false,
      writable: true,
      configurable: true
    }
  });
  if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass;
}
/* eslint react/prop-types: 0 */







var defaultKey = 'rc_animate_' + Date.now();

function getChildrenFromProps(props) {
  var children = props.children;

  if ( /*#__PURE__*/external_React_default.a.isValidElement(children)) {
    if (!children.key) {
      return /*#__PURE__*/external_React_default.a.cloneElement(children, {
        key: defaultKey
      });
    }
  }

  return children;
}

function noop() {}

var Animate_Animate = function (_React$Component) {
  Animate_inherits(Animate, _React$Component);

  function Animate(props) {
    Animate_classCallCheck(this, Animate);

    var _this = Animate_possibleConstructorReturn(this, (Animate.__proto__ || Object.getPrototypeOf(Animate)).call(this, props));

    Animate_initialiseProps.call(_this);

    _this.currentlyAnimatingKeys = {};
    _this.keysToEnter = [];
    _this.keysToLeave = [];
    _this.state = {
      children: toArrayChildren(getChildrenFromProps(props))
    };
    _this.childrenRefs = {};
    return _this;
  } // eslint-disable-line


  Animate_createClass(Animate, [{
    key: 'componentDidMount',
    value: function componentDidMount() {
      var _this2 = this;

      var showProp = this.props.showProp;
      var children = this.state.children;

      if (showProp) {
        children = children.filter(function (child) {
          return !!child.props[showProp];
        });
      }

      children.forEach(function (child) {
        if (child) {
          _this2.performAppear(child.key);
        }
      });
    }
  }, {
    key: 'componentWillReceiveProps',
    value: function componentWillReceiveProps(nextProps) {
      var _this3 = this;

      this.nextProps = nextProps;
      var nextChildren = toArrayChildren(getChildrenFromProps(nextProps));
      var props = this.props; // exclusive needs immediate response

      if (props.exclusive) {
        Object.keys(this.currentlyAnimatingKeys).forEach(function (key) {
          _this3.stop(key);
        });
      }

      var showProp = props.showProp;
      var currentlyAnimatingKeys = this.currentlyAnimatingKeys; // last props children if exclusive

      var currentChildren = props.exclusive ? toArrayChildren(getChildrenFromProps(props)) : this.state.children; // in case destroy in showProp mode

      var newChildren = [];

      if (showProp) {
        currentChildren.forEach(function (currentChild) {
          var nextChild = currentChild && findChildInChildrenByKey(nextChildren, currentChild.key);
          var newChild = void 0;

          if ((!nextChild || !nextChild.props[showProp]) && currentChild.props[showProp]) {
            newChild = /*#__PURE__*/external_React_default.a.cloneElement(nextChild || currentChild, _defineProperty({}, showProp, true));
          } else {
            newChild = nextChild;
          }

          if (newChild) {
            newChildren.push(newChild);
          }
        });
        nextChildren.forEach(function (nextChild) {
          if (!nextChild || !findChildInChildrenByKey(currentChildren, nextChild.key)) {
            newChildren.push(nextChild);
          }
        });
      } else {
        newChildren = mergeChildren(currentChildren, nextChildren);
      } // need render to avoid update


      this.setState({
        children: newChildren
      });
      nextChildren.forEach(function (child) {
        var key = child && child.key;

        if (child && currentlyAnimatingKeys[key]) {
          return;
        }

        var hasPrev = child && findChildInChildrenByKey(currentChildren, key);

        if (showProp) {
          var showInNext = child.props[showProp];

          if (hasPrev) {
            var showInNow = findShownChildInChildrenByKey(currentChildren, key, showProp);

            if (!showInNow && showInNext) {
              _this3.keysToEnter.push(key);
            }
          } else if (showInNext) {
            _this3.keysToEnter.push(key);
          }
        } else if (!hasPrev) {
          _this3.keysToEnter.push(key);
        }
      });
      currentChildren.forEach(function (child) {
        var key = child && child.key;

        if (child && currentlyAnimatingKeys[key]) {
          return;
        }

        var hasNext = child && findChildInChildrenByKey(nextChildren, key);

        if (showProp) {
          var showInNow = child.props[showProp];

          if (hasNext) {
            var showInNext = findShownChildInChildrenByKey(nextChildren, key, showProp);

            if (!showInNext && showInNow) {
              _this3.keysToLeave.push(key);
            }
          } else if (showInNow) {
            _this3.keysToLeave.push(key);
          }
        } else if (!hasNext) {
          _this3.keysToLeave.push(key);
        }
      });
    }
  }, {
    key: 'componentDidUpdate',
    value: function componentDidUpdate() {
      var keysToEnter = this.keysToEnter;
      this.keysToEnter = [];
      keysToEnter.forEach(this.performEnter);
      var keysToLeave = this.keysToLeave;
      this.keysToLeave = [];
      keysToLeave.forEach(this.performLeave);
    }
  }, {
    key: 'isValidChildByKey',
    value: function isValidChildByKey(currentChildren, key) {
      var showProp = this.props.showProp;

      if (showProp) {
        return findShownChildInChildrenByKey(currentChildren, key, showProp);
      }

      return findChildInChildrenByKey(currentChildren, key);
    }
  }, {
    key: 'stop',
    value: function stop(key) {
      delete this.currentlyAnimatingKeys[key];
      var component = this.childrenRefs[key];

      if (component) {
        component.stop();
      }
    }
  }, {
    key: 'render',
    value: function render() {
      var _this4 = this;

      var props = this.props;
      this.nextProps = props;
      var stateChildren = this.state.children;
      var children = null;

      if (stateChildren) {
        children = stateChildren.map(function (child) {
          if (child === null || child === undefined) {
            return child;
          }

          if (!child.key) {
            throw new Error('must set key for <rc-animate> children');
          }

          return /*#__PURE__*/external_React_default.a.createElement(es_AnimateChild, {
            key: child.key,
            ref: function ref(node) {
              _this4.childrenRefs[child.key] = node;
            },
            animation: props.animation,
            transitionName: props.transitionName,
            transitionEnter: props.transitionEnter,
            transitionAppear: props.transitionAppear,
            transitionLeave: props.transitionLeave
          }, child);
        });
      }

      var Component = props.component;

      if (Component) {
        var passedProps = props;

        if (typeof Component === 'string') {
          passedProps = _extends({
            className: props.className,
            style: props.style
          }, props.componentProps);
        }

        return /*#__PURE__*/external_React_default.a.createElement(Component, passedProps, children);
      }

      return children[0] || null;
    }
  }]);

  return Animate;
}(external_React_default.a.Component);

Animate_Animate.isAnimate = true;
Animate_Animate.defaultProps = {
  animation: {},
  component: 'span',
  componentProps: {},
  transitionEnter: true,
  transitionLeave: true,
  transitionAppear: false,
  onEnd: noop,
  onEnter: noop,
  onLeave: noop,
  onAppear: noop
};

var Animate_initialiseProps = function _initialiseProps() {
  var _this5 = this;

  this.performEnter = function (key) {
    // may already remove by exclusive
    if (_this5.childrenRefs[key]) {
      _this5.currentlyAnimatingKeys[key] = true;

      _this5.childrenRefs[key].componentWillEnter(_this5.handleDoneAdding.bind(_this5, key, 'enter'));
    }
  };

  this.performAppear = function (key) {
    if (_this5.childrenRefs[key]) {
      _this5.currentlyAnimatingKeys[key] = true;

      _this5.childrenRefs[key].componentWillAppear(_this5.handleDoneAdding.bind(_this5, key, 'appear'));
    }
  };

  this.handleDoneAdding = function (key, type) {
    var props = _this5.props;
    delete _this5.currentlyAnimatingKeys[key]; // if update on exclusive mode, skip check

    if (props.exclusive && props !== _this5.nextProps) {
      return;
    }

    var currentChildren = toArrayChildren(getChildrenFromProps(props));

    if (!_this5.isValidChildByKey(currentChildren, key)) {
      // exclusive will not need this
      _this5.performLeave(key);
    } else if (type === 'appear') {
      if (animate.allowAppearCallback(props)) {
        props.onAppear(key);
        props.onEnd(key, true);
      }
    } else if (animate.allowEnterCallback(props)) {
      props.onEnter(key);
      props.onEnd(key, true);
    }
  };

  this.performLeave = function (key) {
    // may already remove by exclusive
    if (_this5.childrenRefs[key]) {
      _this5.currentlyAnimatingKeys[key] = true;

      _this5.childrenRefs[key].componentWillLeave(_this5.handleDoneLeaving.bind(_this5, key));
    }
  };

  this.handleDoneLeaving = function (key) {
    var props = _this5.props;
    delete _this5.currentlyAnimatingKeys[key]; // if update on exclusive mode, skip check

    if (props.exclusive && props !== _this5.nextProps) {
      return;
    }

    var currentChildren = toArrayChildren(getChildrenFromProps(props)); // in case state change is too fast

    if (_this5.isValidChildByKey(currentChildren, key)) {
      _this5.performEnter(key);
    } else {
      var end = function end() {
        if (animate.allowLeaveCallback(props)) {
          props.onLeave(key);
          props.onEnd(key, false);
        }
      };

      if (!isSameChildren(_this5.state.children, currentChildren, props.showProp)) {
        _this5.setState({
          children: currentChildren
        }, end);
      } else {
        end();
      }
    }
  };
};

/* harmony default export */ var es_Animate = (es_unsafeLifecyclesPolyfill(Animate_Animate));
// CONCATENATED MODULE: ./node_modules/rc-util/es/createChainedFunction.js
/**
 * Safe chained function
 *
 * Will only create a new function if needed,
 * otherwise will pass back existing functions or null.
 *
 * @returns {function|null}
 */
function createChainedFunction() {
  var args = [].slice.call(arguments, 0);

  if (args.length === 1) {
    return args[0];
  }

  return function chainedFunction() {
    for (var i = 0; i < args.length; i++) {
      if (args[i] && args[i].apply) {
        args[i].apply(this, arguments);
      }
    }
  };
}
// EXTERNAL MODULE: ./node_modules/classnames/index.js
var classnames = __webpack_require__(2);
var classnames_default = /*#__PURE__*/__webpack_require__.n(classnames);

// CONCATENATED MODULE: ./node_modules/rc-notification/es/Notice.js







function _createSuper(Derived) {
  var hasNativeReflectConstruct = _isNativeReflectConstruct();

  return function () {
    var Super = Object(getPrototypeOf["a" /* default */])(Derived),
        result;

    if (hasNativeReflectConstruct) {
      var NewTarget = Object(getPrototypeOf["a" /* default */])(this).constructor;

      result = Reflect.construct(Super, arguments, NewTarget);
    } else {
      result = Super.apply(this, arguments);
    }

    return Object(possibleConstructorReturn["a" /* default */])(this, result);
  };
}

function _isNativeReflectConstruct() {
  if (typeof Reflect === "undefined" || !Reflect.construct) return false;
  if (Reflect.construct.sham) return false;
  if (typeof Proxy === "function") return true;

  try {
    Date.prototype.toString.call(Reflect.construct(Date, [], function () {}));
    return true;
  } catch (e) {
    return false;
  }
}





var Notice_Notice = /*#__PURE__*/function (_Component) {
  Object(inherits["a" /* default */])(Notice, _Component);

  var _super = _createSuper(Notice);

  function Notice() {
    var _this;

    Object(classCallCheck["a" /* default */])(this, Notice);

    _this = _super.apply(this, arguments);
    _this.closeTimer = null;

    _this.close = function (e) {
      if (e) {
        e.stopPropagation();
      }

      _this.clearCloseTimer();

      var onClose = _this.props.onClose;

      if (onClose) {
        onClose();
      }
    };

    _this.startCloseTimer = function () {
      if (_this.props.duration) {
        _this.closeTimer = window.setTimeout(function () {
          _this.close();
        }, _this.props.duration * 1000);
      }
    };

    _this.clearCloseTimer = function () {
      if (_this.closeTimer) {
        clearTimeout(_this.closeTimer);
        _this.closeTimer = null;
      }
    };

    return _this;
  }

  Object(createClass["a" /* default */])(Notice, [{
    key: "componentDidMount",
    value: function componentDidMount() {
      this.startCloseTimer();
    }
  }, {
    key: "componentDidUpdate",
    value: function componentDidUpdate(prevProps) {
      if (this.props.duration !== prevProps.duration || this.props.update) {
        this.restartCloseTimer();
      }
    }
  }, {
    key: "componentWillUnmount",
    value: function componentWillUnmount() {
      this.clearCloseTimer();
    }
  }, {
    key: "restartCloseTimer",
    value: function restartCloseTimer() {
      this.clearCloseTimer();
      this.startCloseTimer();
    }
  }, {
    key: "render",
    value: function render() {
      var _this2 = this;

      var _this$props = this.props,
          prefixCls = _this$props.prefixCls,
          className = _this$props.className,
          closable = _this$props.closable,
          closeIcon = _this$props.closeIcon,
          style = _this$props.style,
          onClick = _this$props.onClick,
          children = _this$props.children,
          holder = _this$props.holder;
      var componentClass = "".concat(prefixCls, "-notice");
      var dataOrAriaAttributeProps = Object.keys(this.props).reduce(function (acc, key) {
        if (key.substr(0, 5) === 'data-' || key.substr(0, 5) === 'aria-' || key === 'role') {
          acc[key] = _this2.props[key];
        }

        return acc;
      }, {});
      var node = /*#__PURE__*/external_React_default.a.createElement("div", Object.assign({
        className: classnames_default()(componentClass, className, Object(defineProperty["a" /* default */])({}, "".concat(componentClass, "-closable"), closable)),
        style: style,
        onMouseEnter: this.clearCloseTimer,
        onMouseLeave: this.startCloseTimer,
        onClick: onClick
      }, dataOrAriaAttributeProps), /*#__PURE__*/external_React_default.a.createElement("div", {
        className: "".concat(componentClass, "-content")
      }, children), closable ? /*#__PURE__*/external_React_default.a.createElement("a", {
        tabIndex: 0,
        onClick: this.close,
        className: "".concat(componentClass, "-close")
      }, closeIcon || /*#__PURE__*/external_React_default.a.createElement("span", {
        className: "".concat(componentClass, "-close-x")
      })) : null);

      if (holder) {
        return /*#__PURE__*/external_ReactDOM_default.a.createPortal(node, holder);
      }

      return node;
    }
  }]);

  return Notice;
}(external_React_["Component"]);


Notice_Notice.defaultProps = {
  onClose: function onClose() {},
  duration: 1.5,
  style: {
    right: '50%'
  }
};
// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/toConsumableArray.js + 3 modules
var toConsumableArray = __webpack_require__(6);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/slicedToArray.js + 3 modules
var slicedToArray = __webpack_require__(17);

// CONCATENATED MODULE: ./node_modules/rc-notification/es/useNotification.js




function useNotification_useNotification(notificationInstance) {
  var createdRef = external_React_["useRef"]({});

  var _React$useState = external_React_["useState"]([]),
      _React$useState2 = Object(slicedToArray["a" /* default */])(_React$useState, 2),
      elements = _React$useState2[0],
      setElements = _React$useState2[1];

  function notify(noticeProps) {
    notificationInstance.add(noticeProps, function (div, props) {
      var key = props.key;

      if (div && !createdRef.current[key]) {
        var noticeEle = /*#__PURE__*/external_React_["createElement"](Notice_Notice, Object.assign({}, props, {
          holder: div
        }));
        createdRef.current[key] = noticeEle;
        setElements(function (originElements) {
          return [].concat(Object(toConsumableArray["a" /* default */])(originElements), [noticeEle]);
        });
      }
    });
  }

  return [notify, /*#__PURE__*/external_React_["createElement"](external_React_["Fragment"], null, elements)];
}
// CONCATENATED MODULE: ./node_modules/rc-notification/es/Notification.js








function ownKeys(object, enumerableOnly) {
  var keys = Object.keys(object);

  if (Object.getOwnPropertySymbols) {
    var symbols = Object.getOwnPropertySymbols(object);
    if (enumerableOnly) symbols = symbols.filter(function (sym) {
      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
    });
    keys.push.apply(keys, symbols);
  }

  return keys;
}

function _objectSpread(target) {
  for (var i = 1; i < arguments.length; i++) {
    var source = arguments[i] != null ? arguments[i] : {};

    if (i % 2) {
      ownKeys(Object(source), true).forEach(function (key) {
        Object(defineProperty["a" /* default */])(target, key, source[key]);
      });
    } else if (Object.getOwnPropertyDescriptors) {
      Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
    } else {
      ownKeys(Object(source)).forEach(function (key) {
        Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
      });
    }
  }

  return target;
}

function Notification_createSuper(Derived) {
  var hasNativeReflectConstruct = Notification_isNativeReflectConstruct();

  return function () {
    var Super = Object(getPrototypeOf["a" /* default */])(Derived),
        result;

    if (hasNativeReflectConstruct) {
      var NewTarget = Object(getPrototypeOf["a" /* default */])(this).constructor;

      result = Reflect.construct(Super, arguments, NewTarget);
    } else {
      result = Super.apply(this, arguments);
    }

    return Object(possibleConstructorReturn["a" /* default */])(this, result);
  };
}

function Notification_isNativeReflectConstruct() {
  if (typeof Reflect === "undefined" || !Reflect.construct) return false;
  if (Reflect.construct.sham) return false;
  if (typeof Proxy === "function") return true;

  try {
    Date.prototype.toString.call(Reflect.construct(Date, [], function () {}));
    return true;
  } catch (e) {
    return false;
  }
}








var seed = 0;
var now = Date.now();

function getUuid() {
  var id = seed;
  seed += 1;
  return "rcNotification_".concat(now, "_").concat(id);
}

var Notification_Notification = /*#__PURE__*/function (_Component) {
  Object(inherits["a" /* default */])(Notification, _Component);

  var _super = Notification_createSuper(Notification);

  function Notification() {
    var _this;

    Object(classCallCheck["a" /* default */])(this, Notification);

    _this = _super.apply(this, arguments);
    _this.state = {
      notices: []
    };
    _this.hookRefs = new Map();

    _this.add = function (notice, holderCallback) {
      // eslint-disable-next-line no-param-reassign
      notice.key = notice.key || getUuid();
      var key = notice.key;
      var maxCount = _this.props.maxCount;

      _this.setState(function (previousState) {
        var notices = previousState.notices;
        var noticeIndex = notices.map(function (v) {
          return v.notice.key;
        }).indexOf(key);
        var updatedNotices = notices.concat();

        if (noticeIndex !== -1) {
          updatedNotices.splice(noticeIndex, 1, {
            notice: notice,
            holderCallback: holderCallback
          });
        } else {
          if (maxCount && notices.length >= maxCount) {
            // XXX, use key of first item to update new added (let React to move exsiting
            // instead of remove and mount). Same key was used before for both a) external
            // manual control and b) internal react 'key' prop , which is not that good.
            // eslint-disable-next-line no-param-reassign
            notice.updateKey = updatedNotices[0].notice.updateKey || updatedNotices[0].notice.key;
            updatedNotices.shift();
          }

          updatedNotices.push({
            notice: notice,
            holderCallback: holderCallback
          });
        }

        return {
          notices: updatedNotices
        };
      });
    };

    _this.remove = function (key) {
      _this.setState(function (previousState) {
        return {
          notices: previousState.notices.filter(function (_ref) {
            var notice = _ref.notice;
            return notice.key !== key;
          })
        };
      });
    };

    return _this;
  }

  Object(createClass["a" /* default */])(Notification, [{
    key: "getTransitionName",
    value: function getTransitionName() {
      var _this$props = this.props,
          prefixCls = _this$props.prefixCls,
          animation = _this$props.animation;
      var transitionName = this.props.transitionName;

      if (!transitionName && animation) {
        transitionName = "".concat(prefixCls, "-").concat(animation);
      }

      return transitionName;
    }
  }, {
    key: "render",
    value: function render() {
      var _this2 = this;

      var notices = this.state.notices;
      var _this$props2 = this.props,
          prefixCls = _this$props2.prefixCls,
          className = _this$props2.className,
          closeIcon = _this$props2.closeIcon,
          style = _this$props2.style;
      var noticeNodes = notices.map(function (_ref2, index) {
        var notice = _ref2.notice,
            holderCallback = _ref2.holderCallback;
        var update = Boolean(index === notices.length - 1 && notice.updateKey);
        var key = notice.updateKey ? notice.updateKey : notice.key;
        var onClose = createChainedFunction(_this2.remove.bind(_this2, notice.key), notice.onClose);

        var noticeProps = _objectSpread(_objectSpread(_objectSpread({
          prefixCls: prefixCls,
          closeIcon: closeIcon
        }, notice), notice.props), {}, {
          key: key,
          update: update,
          onClose: onClose,
          onClick: notice.onClick,
          children: notice.content
        });

        if (holderCallback) {
          return /*#__PURE__*/external_React_default.a.createElement("div", {
            key: key,
            className: "".concat(prefixCls, "-hook-holder"),
            ref: function ref(div) {
              if (typeof key === 'undefined') {
                return;
              }

              if (div) {
                _this2.hookRefs.set(key, div);

                holderCallback(div, noticeProps);
              } else {
                _this2.hookRefs.delete(key);
              }
            }
          });
        }

        return /*#__PURE__*/external_React_default.a.createElement(Notice_Notice, Object.assign({}, noticeProps));
      });
      return /*#__PURE__*/external_React_default.a.createElement("div", {
        className: classnames_default()(prefixCls, className),
        style: style
      }, /*#__PURE__*/external_React_default.a.createElement(es_Animate, {
        transitionName: this.getTransitionName()
      }, noticeNodes));
    }
  }]);

  return Notification;
}(external_React_["Component"]);

Notification_Notification.defaultProps = {
  prefixCls: 'rc-notification',
  animation: 'fade',
  style: {
    top: 65,
    left: '50%'
  }
};

Notification_Notification.newInstance = function newNotificationInstance(properties, callback) {
  var _ref3 = properties || {},
      getContainer = _ref3.getContainer,
      props = Object(objectWithoutProperties["a" /* default */])(_ref3, ["getContainer"]);

  var div = document.createElement('div');

  if (getContainer) {
    var root = getContainer();
    root.appendChild(div);
  } else {
    document.body.appendChild(div);
  }

  var called = false;

  function ref(notification) {
    if (called) {
      return;
    }

    called = true;
    callback({
      notice: function notice(noticeProps) {
        notification.add(noticeProps);
      },
      removeNotice: function removeNotice(key) {
        notification.remove(key);
      },
      component: notification,
      destroy: function destroy() {
        external_ReactDOM_default.a.unmountComponentAtNode(div);

        if (div.parentNode) {
          div.parentNode.removeChild(div);
        }
      },
      // Hooks
      useNotification: function useNotification() {
        return useNotification_useNotification(notification);
      }
    });
  } // Only used for test case usage


  if (false) {}

  external_ReactDOM_default.a.render( /*#__PURE__*/external_React_default.a.createElement(Notification_Notification, Object.assign({}, props, {
    ref: ref
  })), div);
};

/* harmony default export */ var es_Notification = (Notification_Notification);
// CONCATENATED MODULE: ./node_modules/rc-notification/es/index.js

/* harmony default export */ var rc_notification_es = __webpack_exports__["default"] = (es_Notification);

/***/ }),
/* 78 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
/**
 * Copyright (c) 2014-present, Facebook, Inc.
 *
 * This source code is licensed under the MIT license found in the
 * LICENSE file in the root directory of this source tree.
 */

/**
 * Similar to invariant but only logs a warning if the condition is not met.
 * This can be used to log issues in development environments in critical
 * paths. Removing the logging code for production environments will keep the
 * same logic and follow the same code paths.
 */

var __DEV__ = "production" !== 'production';

var warning = function warning() {};

if (__DEV__) {
  var printWarning = function printWarning(format, args) {
    var len = arguments.length;
    args = new Array(len > 1 ? len - 1 : 0);

    for (var key = 1; key < len; key++) {
      args[key - 1] = arguments[key];
    }

    var argIndex = 0;
    var message = 'Warning: ' + format.replace(/%s/g, function () {
      return args[argIndex++];
    });

    if (typeof console !== 'undefined') {
      console.error(message);
    }

    try {
      // --- Welcome to debugging React ---
      // This error was thrown as a convenience so that you can use this stack
      // to find the callsite that caused this warning to fire.
      throw new Error(message);
    } catch (x) {}
  };

  warning = function warning(condition, format, args) {
    var len = arguments.length;
    args = new Array(len > 2 ? len - 2 : 0);

    for (var key = 2; key < len; key++) {
      args[key - 2] = arguments[key];
    }

    if (format === undefined) {
      throw new Error('`warning(condition, format, ...args)` requires a warning ' + 'message argument');
    }

    if (!condition) {
      printWarning.apply(null, [format].concat(args));
    }
  };
}

module.exports = warning;

/***/ }),
/* 79 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";
/* WEBPACK VAR INJECTION */(function(process) {function _typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }

function _extends() {
  _extends = Object.assign || function (target) {
    for (var i = 1; i < arguments.length; i++) {
      var source = arguments[i];

      for (var key in source) {
        if (Object.prototype.hasOwnProperty.call(source, key)) {
          target[key] = source[key];
        }
      }
    }

    return target;
  };

  return _extends.apply(this, arguments);
}

function _inheritsLoose(subClass, superClass) {
  subClass.prototype = Object.create(superClass.prototype);
  subClass.prototype.constructor = subClass;
  subClass.__proto__ = superClass;
}

function _getPrototypeOf(o) {
  _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) {
    return o.__proto__ || Object.getPrototypeOf(o);
  };
  return _getPrototypeOf(o);
}

function _setPrototypeOf(o, p) {
  _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) {
    o.__proto__ = p;
    return o;
  };

  return _setPrototypeOf(o, p);
}

function _isNativeReflectConstruct() {
  if (typeof Reflect === "undefined" || !Reflect.construct) return false;
  if (Reflect.construct.sham) return false;
  if (typeof Proxy === "function") return true;

  try {
    Date.prototype.toString.call(Reflect.construct(Date, [], function () {}));
    return true;
  } catch (e) {
    return false;
  }
}

function _construct(Parent, args, Class) {
  if (_isNativeReflectConstruct()) {
    _construct = Reflect.construct;
  } else {
    _construct = function _construct(Parent, args, Class) {
      var a = [null];
      a.push.apply(a, args);
      var Constructor = Function.bind.apply(Parent, a);
      var instance = new Constructor();
      if (Class) _setPrototypeOf(instance, Class.prototype);
      return instance;
    };
  }

  return _construct.apply(null, arguments);
}

function _isNativeFunction(fn) {
  return Function.toString.call(fn).indexOf("[native code]") !== -1;
}

function _wrapNativeSuper(Class) {
  var _cache = typeof Map === "function" ? new Map() : undefined;

  _wrapNativeSuper = function _wrapNativeSuper(Class) {
    if (Class === null || !_isNativeFunction(Class)) return Class;

    if (typeof Class !== "function") {
      throw new TypeError("Super expression must either be null or a function");
    }

    if (typeof _cache !== "undefined") {
      if (_cache.has(Class)) return _cache.get(Class);

      _cache.set(Class, Wrapper);
    }

    function Wrapper() {
      return _construct(Class, arguments, _getPrototypeOf(this).constructor);
    }

    Wrapper.prototype = Object.create(Class.prototype, {
      constructor: {
        value: Wrapper,
        enumerable: false,
        writable: true,
        configurable: true
      }
    });
    return _setPrototypeOf(Wrapper, Class);
  };

  return _wrapNativeSuper(Class);
}
/* eslint no-console:0 */


var formatRegExp = /%[sdj%]/g;

var warning = function warning() {}; // don't print warning message when in production env or node runtime


if (typeof process !== 'undefined' && process.env && "production" !== 'production' && typeof window !== 'undefined' && typeof document !== 'undefined') {
  warning = function warning(type, errors) {
    if (typeof console !== 'undefined' && console.warn) {
      if (errors.every(function (e) {
        return typeof e === 'string';
      })) {
        console.warn(type, errors);
      }
    }
  };
}

function convertFieldsError(errors) {
  if (!errors || !errors.length) return null;
  var fields = {};
  errors.forEach(function (error) {
    var field = error.field;
    fields[field] = fields[field] || [];
    fields[field].push(error);
  });
  return fields;
}

function format() {
  for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
    args[_key] = arguments[_key];
  }

  var i = 1;
  var f = args[0];
  var len = args.length;

  if (typeof f === 'function') {
    return f.apply(null, args.slice(1));
  }

  if (typeof f === 'string') {
    var str = String(f).replace(formatRegExp, function (x) {
      if (x === '%%') {
        return '%';
      }

      if (i >= len) {
        return x;
      }

      switch (x) {
        case '%s':
          return String(args[i++]);

        case '%d':
          return Number(args[i++]);

        case '%j':
          try {
            return JSON.stringify(args[i++]);
          } catch (_) {
            return '[Circular]';
          }

          break;

        default:
          return x;
      }
    });
    return str;
  }

  return f;
}

function isNativeStringType(type) {
  return type === 'string' || type === 'url' || type === 'hex' || type === 'email' || type === 'date' || type === 'pattern';
}

function isEmptyValue(value, type) {
  if (value === undefined || value === null) {
    return true;
  }

  if (type === 'array' && Array.isArray(value) && !value.length) {
    return true;
  }

  if (isNativeStringType(type) && typeof value === 'string' && !value) {
    return true;
  }

  return false;
}

function asyncParallelArray(arr, func, callback) {
  var results = [];
  var total = 0;
  var arrLength = arr.length;

  function count(errors) {
    results.push.apply(results, errors);
    total++;

    if (total === arrLength) {
      callback(results);
    }
  }

  arr.forEach(function (a) {
    func(a, count);
  });
}

function asyncSerialArray(arr, func, callback) {
  var index = 0;
  var arrLength = arr.length;

  function next(errors) {
    if (errors && errors.length) {
      callback(errors);
      return;
    }

    var original = index;
    index = index + 1;

    if (original < arrLength) {
      func(arr[original], next);
    } else {
      callback([]);
    }
  }

  next([]);
}

function flattenObjArr(objArr) {
  var ret = [];
  Object.keys(objArr).forEach(function (k) {
    ret.push.apply(ret, objArr[k]);
  });
  return ret;
}

var AsyncValidationError = /*#__PURE__*/function (_Error) {
  _inheritsLoose(AsyncValidationError, _Error);

  function AsyncValidationError(errors, fields) {
    var _this;

    _this = _Error.call(this, 'Async Validation Error') || this;
    _this.errors = errors;
    _this.fields = fields;
    return _this;
  }

  return AsyncValidationError;
}( /*#__PURE__*/_wrapNativeSuper(Error));

function asyncMap(objArr, option, func, callback) {
  if (option.first) {
    var _pending = new Promise(function (resolve, reject) {
      var next = function next(errors) {
        callback(errors);
        return errors.length ? reject(new AsyncValidationError(errors, convertFieldsError(errors))) : resolve();
      };

      var flattenArr = flattenObjArr(objArr);
      asyncSerialArray(flattenArr, func, next);
    });

    _pending["catch"](function (e) {
      return e;
    });

    return _pending;
  }

  var firstFields = option.firstFields || [];

  if (firstFields === true) {
    firstFields = Object.keys(objArr);
  }

  var objArrKeys = Object.keys(objArr);
  var objArrLength = objArrKeys.length;
  var total = 0;
  var results = [];
  var pending = new Promise(function (resolve, reject) {
    var next = function next(errors) {
      results.push.apply(results, errors);
      total++;

      if (total === objArrLength) {
        callback(results);
        return results.length ? reject(new AsyncValidationError(results, convertFieldsError(results))) : resolve();
      }
    };

    if (!objArrKeys.length) {
      callback(results);
      resolve();
    }

    objArrKeys.forEach(function (key) {
      var arr = objArr[key];

      if (firstFields.indexOf(key) !== -1) {
        asyncSerialArray(arr, func, next);
      } else {
        asyncParallelArray(arr, func, next);
      }
    });
  });
  pending["catch"](function (e) {
    return e;
  });
  return pending;
}

function complementError(rule) {
  return function (oe) {
    if (oe && oe.message) {
      oe.field = oe.field || rule.fullField;
      return oe;
    }

    return {
      message: typeof oe === 'function' ? oe() : oe,
      field: oe.field || rule.fullField
    };
  };
}

function deepMerge(target, source) {
  if (source) {
    for (var s in source) {
      if (source.hasOwnProperty(s)) {
        var value = source[s];

        if (_typeof(value) === 'object' && _typeof(target[s]) === 'object') {
          target[s] = _extends(_extends({}, target[s]), value);
        } else {
          target[s] = value;
        }
      }
    }
  }

  return target;
}
/**
 *  Rule for validating required fields.
 *
 *  @param rule The validation rule.
 *  @param value The value of the field on the source object.
 *  @param source The source object being validated.
 *  @param errors An array of errors that this rule may add
 *  validation errors to.
 *  @param options The validation options.
 *  @param options.messages The validation messages.
 */


function required(rule, value, source, errors, options, type) {
  if (rule.required && (!source.hasOwnProperty(rule.field) || isEmptyValue(value, type || rule.type))) {
    errors.push(format(options.messages.required, rule.fullField));
  }
}
/**
 *  Rule for validating whitespace.
 *
 *  @param rule The validation rule.
 *  @param value The value of the field on the source object.
 *  @param source The source object being validated.
 *  @param errors An array of errors that this rule may add
 *  validation errors to.
 *  @param options The validation options.
 *  @param options.messages The validation messages.
 */


function whitespace(rule, value, source, errors, options) {
  if (/^\s+$/.test(value) || value === '') {
    errors.push(format(options.messages.whitespace, rule.fullField));
  }
}
/* eslint max-len:0 */


var pattern = {
  // http://emailregex.com/
  email: /^(([^<>()\[\]\\.,;:\s@"]+(\.[^<>()\[\]\\.,;:\s@"]+)*)|(".+"))@((\[[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}])|(([a-zA-Z\-0-9]+\.)+[a-zA-Z]{2,}))$/,
  url: new RegExp("^(?!mailto:)(?:(?:http|https|ftp)://|//)(?:\\S+(?::\\S*)?@)?(?:(?:(?:[1-9]\\d?|1\\d\\d|2[01]\\d|22[0-3])(?:\\.(?:1?\\d{1,2}|2[0-4]\\d|25[0-5])){2}(?:\\.(?:[0-9]\\d?|1\\d\\d|2[0-4]\\d|25[0-4]))|(?:(?:[a-z\\u00a1-\\uffff0-9]+-*)*[a-z\\u00a1-\\uffff0-9]+)(?:\\.(?:[a-z\\u00a1-\\uffff0-9]+-*)*[a-z\\u00a1-\\uffff0-9]+)*(?:\\.(?:[a-z\\u00a1-\\uffff]{2,})))|localhost)(?::\\d{2,5})?(?:(/|\\?|#)[^\\s]*)?$", 'i'),
  hex: /^#?([a-f0-9]{6}|[a-f0-9]{3})$/i
};
var types = {
  integer: function integer(value) {
    return types.number(value) && parseInt(value, 10) === value;
  },
  "float": function float(value) {
    return types.number(value) && !types.integer(value);
  },
  array: function array(value) {
    return Array.isArray(value);
  },
  regexp: function regexp(value) {
    if (value instanceof RegExp) {
      return true;
    }

    try {
      return !!new RegExp(value);
    } catch (e) {
      return false;
    }
  },
  date: function date(value) {
    return typeof value.getTime === 'function' && typeof value.getMonth === 'function' && typeof value.getYear === 'function' && !isNaN(value.getTime());
  },
  number: function number(value) {
    if (isNaN(value)) {
      return false;
    }

    return typeof value === 'number';
  },
  object: function object(value) {
    return _typeof(value) === 'object' && !types.array(value);
  },
  method: function method(value) {
    return typeof value === 'function';
  },
  email: function email(value) {
    return typeof value === 'string' && !!value.match(pattern.email) && value.length < 255;
  },
  url: function url(value) {
    return typeof value === 'string' && !!value.match(pattern.url);
  },
  hex: function hex(value) {
    return typeof value === 'string' && !!value.match(pattern.hex);
  }
};
/**
 *  Rule for validating the type of a value.
 *
 *  @param rule The validation rule.
 *  @param value The value of the field on the source object.
 *  @param source The source object being validated.
 *  @param errors An array of errors that this rule may add
 *  validation errors to.
 *  @param options The validation options.
 *  @param options.messages The validation messages.
 */

function type(rule, value, source, errors, options) {
  if (rule.required && value === undefined) {
    required(rule, value, source, errors, options);
    return;
  }

  var custom = ['integer', 'float', 'array', 'regexp', 'object', 'method', 'email', 'number', 'date', 'url', 'hex'];
  var ruleType = rule.type;

  if (custom.indexOf(ruleType) > -1) {
    if (!types[ruleType](value)) {
      errors.push(format(options.messages.types[ruleType], rule.fullField, rule.type));
    } // straight typeof check

  } else if (ruleType && _typeof(value) !== rule.type) {
    errors.push(format(options.messages.types[ruleType], rule.fullField, rule.type));
  }
}
/**
 *  Rule for validating minimum and maximum allowed values.
 *
 *  @param rule The validation rule.
 *  @param value The value of the field on the source object.
 *  @param source The source object being validated.
 *  @param errors An array of errors that this rule may add
 *  validation errors to.
 *  @param options The validation options.
 *  @param options.messages The validation messages.
 */


function range(rule, value, source, errors, options) {
  var len = typeof rule.len === 'number';
  var min = typeof rule.min === 'number';
  var max = typeof rule.max === 'number'; // 正则匹配码点范围从U+010000一直到U+10FFFF的文字（补充平面Supplementary Plane）

  var spRegexp = /[\uD800-\uDBFF][\uDC00-\uDFFF]/g;
  var val = value;
  var key = null;
  var num = typeof value === 'number';
  var str = typeof value === 'string';
  var arr = Array.isArray(value);

  if (num) {
    key = 'number';
  } else if (str) {
    key = 'string';
  } else if (arr) {
    key = 'array';
  } // if the value is not of a supported type for range validation
  // the validation rule rule should use the
  // type property to also test for a particular type


  if (!key) {
    return false;
  }

  if (arr) {
    val = value.length;
  }

  if (str) {
    // 处理码点大于U+010000的文字length属性不准确的bug，如"𠮷𠮷𠮷".lenght !== 3
    val = value.replace(spRegexp, '_').length;
  }

  if (len) {
    if (val !== rule.len) {
      errors.push(format(options.messages[key].len, rule.fullField, rule.len));
    }
  } else if (min && !max && val < rule.min) {
    errors.push(format(options.messages[key].min, rule.fullField, rule.min));
  } else if (max && !min && val > rule.max) {
    errors.push(format(options.messages[key].max, rule.fullField, rule.max));
  } else if (min && max && (val < rule.min || val > rule.max)) {
    errors.push(format(options.messages[key].range, rule.fullField, rule.min, rule.max));
  }
}

var ENUM = 'enum';
/**
 *  Rule for validating a value exists in an enumerable list.
 *
 *  @param rule The validation rule.
 *  @param value The value of the field on the source object.
 *  @param source The source object being validated.
 *  @param errors An array of errors that this rule may add
 *  validation errors to.
 *  @param options The validation options.
 *  @param options.messages The validation messages.
 */

function enumerable(rule, value, source, errors, options) {
  rule[ENUM] = Array.isArray(rule[ENUM]) ? rule[ENUM] : [];

  if (rule[ENUM].indexOf(value) === -1) {
    errors.push(format(options.messages[ENUM], rule.fullField, rule[ENUM].join(', ')));
  }
}
/**
 *  Rule for validating a regular expression pattern.
 *
 *  @param rule The validation rule.
 *  @param value The value of the field on the source object.
 *  @param source The source object being validated.
 *  @param errors An array of errors that this rule may add
 *  validation errors to.
 *  @param options The validation options.
 *  @param options.messages The validation messages.
 */


function pattern$1(rule, value, source, errors, options) {
  if (rule.pattern) {
    if (rule.pattern instanceof RegExp) {
      // if a RegExp instance is passed, reset `lastIndex` in case its `global`
      // flag is accidentally set to `true`, which in a validation scenario
      // is not necessary and the result might be misleading
      rule.pattern.lastIndex = 0;

      if (!rule.pattern.test(value)) {
        errors.push(format(options.messages.pattern.mismatch, rule.fullField, value, rule.pattern));
      }
    } else if (typeof rule.pattern === 'string') {
      var _pattern = new RegExp(rule.pattern);

      if (!_pattern.test(value)) {
        errors.push(format(options.messages.pattern.mismatch, rule.fullField, value, rule.pattern));
      }
    }
  }
}

var rules = {
  required: required,
  whitespace: whitespace,
  type: type,
  range: range,
  "enum": enumerable,
  pattern: pattern$1
};
/**
 *  Performs validation for string types.
 *
 *  @param rule The validation rule.
 *  @param value The value of the field on the source object.
 *  @param callback The callback function.
 *  @param source The source object being validated.
 *  @param options The validation options.
 *  @param options.messages The validation messages.
 */

function string(rule, value, callback, source, options) {
  var errors = [];
  var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);

  if (validate) {
    if (isEmptyValue(value, 'string') && !rule.required) {
      return callback();
    }

    rules.required(rule, value, source, errors, options, 'string');

    if (!isEmptyValue(value, 'string')) {
      rules.type(rule, value, source, errors, options);
      rules.range(rule, value, source, errors, options);
      rules.pattern(rule, value, source, errors, options);

      if (rule.whitespace === true) {
        rules.whitespace(rule, value, source, errors, options);
      }
    }
  }

  callback(errors);
}
/**
 *  Validates a function.
 *
 *  @param rule The validation rule.
 *  @param value The value of the field on the source object.
 *  @param callback The callback function.
 *  @param source The source object being validated.
 *  @param options The validation options.
 *  @param options.messages The validation messages.
 */


function method(rule, value, callback, source, options) {
  var errors = [];
  var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);

  if (validate) {
    if (isEmptyValue(value) && !rule.required) {
      return callback();
    }

    rules.required(rule, value, source, errors, options);

    if (value !== undefined) {
      rules.type(rule, value, source, errors, options);
    }
  }

  callback(errors);
}
/**
 *  Validates a number.
 *
 *  @param rule The validation rule.
 *  @param value The value of the field on the source object.
 *  @param callback The callback function.
 *  @param source The source object being validated.
 *  @param options The validation options.
 *  @param options.messages The validation messages.
 */


function number(rule, value, callback, source, options) {
  var errors = [];
  var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);

  if (validate) {
    if (value === '') {
      value = undefined;
    }

    if (isEmptyValue(value) && !rule.required) {
      return callback();
    }

    rules.required(rule, value, source, errors, options);

    if (value !== undefined) {
      rules.type(rule, value, source, errors, options);
      rules.range(rule, value, source, errors, options);
    }
  }

  callback(errors);
}
/**
 *  Validates a boolean.
 *
 *  @param rule The validation rule.
 *  @param value The value of the field on the source object.
 *  @param callback The callback function.
 *  @param source The source object being validated.
 *  @param options The validation options.
 *  @param options.messages The validation messages.
 */


function _boolean(rule, value, callback, source, options) {
  var errors = [];
  var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);

  if (validate) {
    if (isEmptyValue(value) && !rule.required) {
      return callback();
    }

    rules.required(rule, value, source, errors, options);

    if (value !== undefined) {
      rules.type(rule, value, source, errors, options);
    }
  }

  callback(errors);
}
/**
 *  Validates the regular expression type.
 *
 *  @param rule The validation rule.
 *  @param value The value of the field on the source object.
 *  @param callback The callback function.
 *  @param source The source object being validated.
 *  @param options The validation options.
 *  @param options.messages The validation messages.
 */


function regexp(rule, value, callback, source, options) {
  var errors = [];
  var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);

  if (validate) {
    if (isEmptyValue(value) && !rule.required) {
      return callback();
    }

    rules.required(rule, value, source, errors, options);

    if (!isEmptyValue(value)) {
      rules.type(rule, value, source, errors, options);
    }
  }

  callback(errors);
}
/**
 *  Validates a number is an integer.
 *
 *  @param rule The validation rule.
 *  @param value The value of the field on the source object.
 *  @param callback The callback function.
 *  @param source The source object being validated.
 *  @param options The validation options.
 *  @param options.messages The validation messages.
 */


function integer(rule, value, callback, source, options) {
  var errors = [];
  var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);

  if (validate) {
    if (isEmptyValue(value) && !rule.required) {
      return callback();
    }

    rules.required(rule, value, source, errors, options);

    if (value !== undefined) {
      rules.type(rule, value, source, errors, options);
      rules.range(rule, value, source, errors, options);
    }
  }

  callback(errors);
}
/**
 *  Validates a number is a floating point number.
 *
 *  @param rule The validation rule.
 *  @param value The value of the field on the source object.
 *  @param callback The callback function.
 *  @param source The source object being validated.
 *  @param options The validation options.
 *  @param options.messages The validation messages.
 */


function floatFn(rule, value, callback, source, options) {
  var errors = [];
  var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);

  if (validate) {
    if (isEmptyValue(value) && !rule.required) {
      return callback();
    }

    rules.required(rule, value, source, errors, options);

    if (value !== undefined) {
      rules.type(rule, value, source, errors, options);
      rules.range(rule, value, source, errors, options);
    }
  }

  callback(errors);
}
/**
 *  Validates an array.
 *
 *  @param rule The validation rule.
 *  @param value The value of the field on the source object.
 *  @param callback The callback function.
 *  @param source The source object being validated.
 *  @param options The validation options.
 *  @param options.messages The validation messages.
 */


function array(rule, value, callback, source, options) {
  var errors = [];
  var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);

  if (validate) {
    if (isEmptyValue(value, 'array') && !rule.required) {
      return callback();
    }

    rules.required(rule, value, source, errors, options, 'array');

    if (!isEmptyValue(value, 'array')) {
      rules.type(rule, value, source, errors, options);
      rules.range(rule, value, source, errors, options);
    }
  }

  callback(errors);
}
/**
 *  Validates an object.
 *
 *  @param rule The validation rule.
 *  @param value The value of the field on the source object.
 *  @param callback The callback function.
 *  @param source The source object being validated.
 *  @param options The validation options.
 *  @param options.messages The validation messages.
 */


function object(rule, value, callback, source, options) {
  var errors = [];
  var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);

  if (validate) {
    if (isEmptyValue(value) && !rule.required) {
      return callback();
    }

    rules.required(rule, value, source, errors, options);

    if (value !== undefined) {
      rules.type(rule, value, source, errors, options);
    }
  }

  callback(errors);
}

var ENUM$1 = 'enum';
/**
 *  Validates an enumerable list.
 *
 *  @param rule The validation rule.
 *  @param value The value of the field on the source object.
 *  @param callback The callback function.
 *  @param source The source object being validated.
 *  @param options The validation options.
 *  @param options.messages The validation messages.
 */

function enumerable$1(rule, value, callback, source, options) {
  var errors = [];
  var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);

  if (validate) {
    if (isEmptyValue(value) && !rule.required) {
      return callback();
    }

    rules.required(rule, value, source, errors, options);

    if (value !== undefined) {
      rules[ENUM$1](rule, value, source, errors, options);
    }
  }

  callback(errors);
}
/**
 *  Validates a regular expression pattern.
 *
 *  Performs validation when a rule only contains
 *  a pattern property but is not declared as a string type.
 *
 *  @param rule The validation rule.
 *  @param value The value of the field on the source object.
 *  @param callback The callback function.
 *  @param source The source object being validated.
 *  @param options The validation options.
 *  @param options.messages The validation messages.
 */


function pattern$2(rule, value, callback, source, options) {
  var errors = [];
  var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);

  if (validate) {
    if (isEmptyValue(value, 'string') && !rule.required) {
      return callback();
    }

    rules.required(rule, value, source, errors, options);

    if (!isEmptyValue(value, 'string')) {
      rules.pattern(rule, value, source, errors, options);
    }
  }

  callback(errors);
}

function date(rule, value, callback, source, options) {
  // console.log('integer rule called %j', rule);
  var errors = [];
  var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field); // console.log('validate on %s value', value);

  if (validate) {
    if (isEmptyValue(value, 'date') && !rule.required) {
      return callback();
    }

    rules.required(rule, value, source, errors, options);

    if (!isEmptyValue(value, 'date')) {
      var dateObject;

      if (value instanceof Date) {
        dateObject = value;
      } else {
        dateObject = new Date(value);
      }

      rules.type(rule, dateObject, source, errors, options);

      if (dateObject) {
        rules.range(rule, dateObject.getTime(), source, errors, options);
      }
    }
  }

  callback(errors);
}

function required$1(rule, value, callback, source, options) {
  var errors = [];
  var type = Array.isArray(value) ? 'array' : _typeof(value);
  rules.required(rule, value, source, errors, options, type);
  callback(errors);
}

function type$1(rule, value, callback, source, options) {
  var ruleType = rule.type;
  var errors = [];
  var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);

  if (validate) {
    if (isEmptyValue(value, ruleType) && !rule.required) {
      return callback();
    }

    rules.required(rule, value, source, errors, options, ruleType);

    if (!isEmptyValue(value, ruleType)) {
      rules.type(rule, value, source, errors, options);
    }
  }

  callback(errors);
}
/**
 *  Performs validation for any type.
 *
 *  @param rule The validation rule.
 *  @param value The value of the field on the source object.
 *  @param callback The callback function.
 *  @param source The source object being validated.
 *  @param options The validation options.
 *  @param options.messages The validation messages.
 */


function any(rule, value, callback, source, options) {
  var errors = [];
  var validate = rule.required || !rule.required && source.hasOwnProperty(rule.field);

  if (validate) {
    if (isEmptyValue(value) && !rule.required) {
      return callback();
    }

    rules.required(rule, value, source, errors, options);
  }

  callback(errors);
}

var validators = {
  string: string,
  method: method,
  number: number,
  "boolean": _boolean,
  regexp: regexp,
  integer: integer,
  "float": floatFn,
  array: array,
  object: object,
  "enum": enumerable$1,
  pattern: pattern$2,
  date: date,
  url: type$1,
  hex: type$1,
  email: type$1,
  required: required$1,
  any: any
};

function newMessages() {
  return {
    "default": 'Validation error on field %s',
    required: '%s is required',
    "enum": '%s must be one of %s',
    whitespace: '%s cannot be empty',
    date: {
      format: '%s date %s is invalid for format %s',
      parse: '%s date could not be parsed, %s is invalid ',
      invalid: '%s date %s is invalid'
    },
    types: {
      string: '%s is not a %s',
      method: '%s is not a %s (function)',
      array: '%s is not an %s',
      object: '%s is not an %s',
      number: '%s is not a %s',
      date: '%s is not a %s',
      "boolean": '%s is not a %s',
      integer: '%s is not an %s',
      "float": '%s is not a %s',
      regexp: '%s is not a valid %s',
      email: '%s is not a valid %s',
      url: '%s is not a valid %s',
      hex: '%s is not a valid %s'
    },
    string: {
      len: '%s must be exactly %s characters',
      min: '%s must be at least %s characters',
      max: '%s cannot be longer than %s characters',
      range: '%s must be between %s and %s characters'
    },
    number: {
      len: '%s must equal %s',
      min: '%s cannot be less than %s',
      max: '%s cannot be greater than %s',
      range: '%s must be between %s and %s'
    },
    array: {
      len: '%s must be exactly %s in length',
      min: '%s cannot be less than %s in length',
      max: '%s cannot be greater than %s in length',
      range: '%s must be between %s and %s in length'
    },
    pattern: {
      mismatch: '%s value %s does not match pattern %s'
    },
    clone: function clone() {
      var cloned = JSON.parse(JSON.stringify(this));
      cloned.clone = this.clone;
      return cloned;
    }
  };
}

var messages = newMessages();
/**
 *  Encapsulates a validation schema.
 *
 *  @param descriptor An object declaring validation rules
 *  for this schema.
 */

function Schema(descriptor) {
  this.rules = null;
  this._messages = messages;
  this.define(descriptor);
}

Schema.prototype = {
  messages: function messages(_messages) {
    if (_messages) {
      this._messages = deepMerge(newMessages(), _messages);
    }

    return this._messages;
  },
  define: function define(rules) {
    if (!rules) {
      throw new Error('Cannot configure a schema with no rules');
    }

    if (_typeof(rules) !== 'object' || Array.isArray(rules)) {
      throw new Error('Rules must be an object');
    }

    this.rules = {};
    var z;
    var item;

    for (z in rules) {
      if (rules.hasOwnProperty(z)) {
        item = rules[z];
        this.rules[z] = Array.isArray(item) ? item : [item];
      }
    }
  },
  validate: function validate(source_, o, oc) {
    var _this = this;

    if (o === void 0) {
      o = {};
    }

    if (oc === void 0) {
      oc = function oc() {};
    }

    var source = source_;
    var options = o;
    var callback = oc;

    if (typeof options === 'function') {
      callback = options;
      options = {};
    }

    if (!this.rules || Object.keys(this.rules).length === 0) {
      if (callback) {
        callback();
      }

      return Promise.resolve();
    }

    function complete(results) {
      var i;
      var errors = [];
      var fields = {};

      function add(e) {
        if (Array.isArray(e)) {
          var _errors;

          errors = (_errors = errors).concat.apply(_errors, e);
        } else {
          errors.push(e);
        }
      }

      for (i = 0; i < results.length; i++) {
        add(results[i]);
      }

      if (!errors.length) {
        errors = null;
        fields = null;
      } else {
        fields = convertFieldsError(errors);
      }

      callback(errors, fields);
    }

    if (options.messages) {
      var messages$1 = this.messages();

      if (messages$1 === messages) {
        messages$1 = newMessages();
      }

      deepMerge(messages$1, options.messages);
      options.messages = messages$1;
    } else {
      options.messages = this.messages();
    }

    var arr;
    var value;
    var series = {};
    var keys = options.keys || Object.keys(this.rules);
    keys.forEach(function (z) {
      arr = _this.rules[z];
      value = source[z];
      arr.forEach(function (r) {
        var rule = r;

        if (typeof rule.transform === 'function') {
          if (source === source_) {
            source = _extends({}, source);
          }

          value = source[z] = rule.transform(value);
        }

        if (typeof rule === 'function') {
          rule = {
            validator: rule
          };
        } else {
          rule = _extends({}, rule);
        }

        rule.validator = _this.getValidationMethod(rule);
        rule.field = z;
        rule.fullField = rule.fullField || z;
        rule.type = _this.getType(rule);

        if (!rule.validator) {
          return;
        }

        series[z] = series[z] || [];
        series[z].push({
          rule: rule,
          value: value,
          source: source,
          field: z
        });
      });
    });
    var errorFields = {};
    return asyncMap(series, options, function (data, doIt) {
      var rule = data.rule;
      var deep = (rule.type === 'object' || rule.type === 'array') && (_typeof(rule.fields) === 'object' || _typeof(rule.defaultField) === 'object');
      deep = deep && (rule.required || !rule.required && data.value);
      rule.field = data.field;

      function addFullfield(key, schema) {
        return _extends(_extends({}, schema), {}, {
          fullField: rule.fullField + "." + key
        });
      }

      function cb(e) {
        if (e === void 0) {
          e = [];
        }

        var errors = e;

        if (!Array.isArray(errors)) {
          errors = [errors];
        }

        if (!options.suppressWarning && errors.length) {
          Schema.warning('async-validator:', errors);
        }

        if (errors.length && rule.message) {
          errors = [].concat(rule.message);
        }

        errors = errors.map(complementError(rule));

        if (options.first && errors.length) {
          errorFields[rule.field] = 1;
          return doIt(errors);
        }

        if (!deep) {
          doIt(errors);
        } else {
          // if rule is required but the target object
          // does not exist fail at the rule level and don't
          // go deeper
          if (rule.required && !data.value) {
            if (rule.message) {
              errors = [].concat(rule.message).map(complementError(rule));
            } else if (options.error) {
              errors = [options.error(rule, format(options.messages.required, rule.field))];
            }

            return doIt(errors);
          }

          var fieldsSchema = {};

          if (rule.defaultField) {
            for (var k in data.value) {
              if (data.value.hasOwnProperty(k)) {
                fieldsSchema[k] = rule.defaultField;
              }
            }
          }

          fieldsSchema = _extends(_extends({}, fieldsSchema), data.rule.fields);

          for (var f in fieldsSchema) {
            if (fieldsSchema.hasOwnProperty(f)) {
              var fieldSchema = Array.isArray(fieldsSchema[f]) ? fieldsSchema[f] : [fieldsSchema[f]];
              fieldsSchema[f] = fieldSchema.map(addFullfield.bind(null, f));
            }
          }

          var schema = new Schema(fieldsSchema);
          schema.messages(options.messages);

          if (data.rule.options) {
            data.rule.options.messages = options.messages;
            data.rule.options.error = options.error;
          }

          schema.validate(data.value, data.rule.options || options, function (errs) {
            var finalErrors = [];

            if (errors && errors.length) {
              finalErrors.push.apply(finalErrors, errors);
            }

            if (errs && errs.length) {
              finalErrors.push.apply(finalErrors, errs);
            }

            doIt(finalErrors.length ? finalErrors : null);
          });
        }
      }

      var res;

      if (rule.asyncValidator) {
        res = rule.asyncValidator(rule, data.value, cb, data.source, options);
      } else if (rule.validator) {
        res = rule.validator(rule, data.value, cb, data.source, options);

        if (res === true) {
          cb();
        } else if (res === false) {
          cb(rule.message || rule.field + " fails");
        } else if (res instanceof Array) {
          cb(res);
        } else if (res instanceof Error) {
          cb(res.message);
        }
      }

      if (res && res.then) {
        res.then(function () {
          return cb();
        }, function (e) {
          return cb(e);
        });
      }
    }, function (results) {
      complete(results);
    });
  },
  getType: function getType(rule) {
    if (rule.type === undefined && rule.pattern instanceof RegExp) {
      rule.type = 'pattern';
    }

    if (typeof rule.validator !== 'function' && rule.type && !validators.hasOwnProperty(rule.type)) {
      throw new Error(format('Unknown rule type %s', rule.type));
    }

    return rule.type || 'string';
  },
  getValidationMethod: function getValidationMethod(rule) {
    if (typeof rule.validator === 'function') {
      return rule.validator;
    }

    var keys = Object.keys(rule);
    var messageIndex = keys.indexOf('message');

    if (messageIndex !== -1) {
      keys.splice(messageIndex, 1);
    }

    if (keys.length === 1 && keys[0] === 'required') {
      return validators.required;
    }

    return validators[this.getType(rule)] || false;
  }
};

Schema.register = function register(type, validator) {
  if (typeof validator !== 'function') {
    throw new Error('Cannot register a validator by type, validator is not a function');
  }

  validators[type] = validator;
};

Schema.warning = warning;
Schema.messages = messages;
Schema.validators = validators;
/* harmony default export */ __webpack_exports__["a"] = (Schema);
/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(48)))

/***/ }),
/* 80 */
/***/ (function(module, exports, __webpack_require__) {

var hash = exports;
hash.utils = __webpack_require__(19);
hash.common = __webpack_require__(32);
hash.sha = __webpack_require__(155);
hash.ripemd = __webpack_require__(159);
hash.hmac = __webpack_require__(160); // Proxy hash functions to the main object

hash.sha1 = hash.sha.sha1;
hash.sha256 = hash.sha.sha256;
hash.sha224 = hash.sha.sha224;
hash.sha384 = hash.sha.sha384;
hash.sha512 = hash.sha.sha512;
hash.ripemd160 = hash.ripemd.ripemd160;

/***/ }),
/* 81 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _require = __webpack_require__(166),
    CopyToClipboard = _require.CopyToClipboard;

CopyToClipboard.CopyToClipboard = CopyToClipboard;
module.exports = CopyToClipboard;

/***/ }),
/* 82 */
/***/ (function(module, exports, __webpack_require__) {

// extracted by mini-css-extract-plugin

/***/ }),
/* 83 */
/***/ (function(module, exports, __webpack_require__) {

var api = __webpack_require__(56);
            var content = __webpack_require__(84);

            content = content.__esModule ? content.default : content;

            if (typeof content === 'string') {
              content = [[module.i, content, '']];
            }

var options = {};

options.insert = "head";
options.singleton = false;

var update = api(content, options);



module.exports = content.locals || {};

/***/ }),
/* 84 */
/***/ (function(module, exports, __webpack_require__) {

// Imports
var ___CSS_LOADER_API_IMPORT___ = __webpack_require__(57);
exports = ___CSS_LOADER_API_IMPORT___(false);
// Module
exports.push([module.i, "/* stylelint-disable at-rule-empty-line-before,at-rule-name-space-after,at-rule-no-unknown */\n/* stylelint-disable no-duplicate-selectors */\n/* stylelint-disable */\n/* stylelint-disable declaration-bang-space-before,no-duplicate-selectors,string-no-newline */\n.ant-space {\n  display: -webkit-inline-box;\n  display: -ms-inline-flexbox;\n  display: inline-flex;\n}\n.ant-space-vertical {\n  -webkit-box-orient: vertical;\n  -webkit-box-direction: normal;\n      -ms-flex-direction: column;\n          flex-direction: column;\n}\n.ant-space-align-center {\n  -webkit-box-align: center;\n      -ms-flex-align: center;\n          align-items: center;\n}\n.ant-space-align-start {\n  -webkit-box-align: start;\n      -ms-flex-align: start;\n          align-items: flex-start;\n}\n.ant-space-align-end {\n  -webkit-box-align: end;\n      -ms-flex-align: end;\n          align-items: flex-end;\n}\n.ant-space-align-baseline {\n  -webkit-box-align: baseline;\n      -ms-flex-align: baseline;\n          align-items: baseline;\n}\n.ant-space-rtl {\n  direction: rtl;\n}\n", ""]);
// Exports
module.exports = exports;


/***/ }),
/* 85 */
/***/ (function(module, exports, __webpack_require__) {

var api = __webpack_require__(56);
            var content = __webpack_require__(86);

            content = content.__esModule ? content.default : content;

            if (typeof content === 'string') {
              content = [[module.i, content, '']];
            }

var options = {};

options.insert = "head";
options.singleton = false;

var update = api(content, options);



module.exports = content.locals || {};

/***/ }),
/* 86 */
/***/ (function(module, exports, __webpack_require__) {

// Imports
var ___CSS_LOADER_API_IMPORT___ = __webpack_require__(57);
exports = ___CSS_LOADER_API_IMPORT___(false);
// Module
exports.push([module.i, "/* stylelint-disable at-rule-empty-line-before,at-rule-name-space-after,at-rule-no-unknown */\n/* stylelint-disable no-duplicate-selectors */\n/* stylelint-disable */\n/* stylelint-disable declaration-bang-space-before,no-duplicate-selectors,string-no-newline */\n.ant-tooltip {\n  -webkit-box-sizing: border-box;\n          box-sizing: border-box;\n  margin: 0;\n  padding: 0;\n  color: rgba(0, 0, 0, 0.65);\n  font-size: 14px;\n  font-variant: tabular-nums;\n  line-height: 1.5715;\n  list-style: none;\n  -webkit-font-feature-settings: 'tnum';\n          font-feature-settings: 'tnum';\n  position: absolute;\n  z-index: 1070;\n  display: block;\n  max-width: 250px;\n  visibility: visible;\n}\n.ant-tooltip-hidden {\n  display: none;\n}\n.ant-tooltip-placement-top,\n.ant-tooltip-placement-topLeft,\n.ant-tooltip-placement-topRight {\n  padding-bottom: 8px;\n}\n.ant-tooltip-placement-right,\n.ant-tooltip-placement-rightTop,\n.ant-tooltip-placement-rightBottom {\n  padding-left: 8px;\n}\n.ant-tooltip-placement-bottom,\n.ant-tooltip-placement-bottomLeft,\n.ant-tooltip-placement-bottomRight {\n  padding-top: 8px;\n}\n.ant-tooltip-placement-left,\n.ant-tooltip-placement-leftTop,\n.ant-tooltip-placement-leftBottom {\n  padding-right: 8px;\n}\n.ant-tooltip-inner {\n  min-width: 30px;\n  min-height: 32px;\n  padding: 6px 8px;\n  color: #fff;\n  text-align: left;\n  text-decoration: none;\n  word-wrap: break-word;\n  background-color: rgba(0, 0, 0, 0.75);\n  border-radius: 2px;\n  -webkit-box-shadow: 0 3px 6px -4px rgba(0, 0, 0, 0.12), 0 6px 16px 0 rgba(0, 0, 0, 0.08), 0 9px 28px 8px rgba(0, 0, 0, 0.05);\n          box-shadow: 0 3px 6px -4px rgba(0, 0, 0, 0.12), 0 6px 16px 0 rgba(0, 0, 0, 0.08), 0 9px 28px 8px rgba(0, 0, 0, 0.05);\n}\n.ant-tooltip-arrow {\n  position: absolute;\n  display: block;\n  width: 13.07106781px;\n  height: 13.07106781px;\n  overflow: hidden;\n  background: transparent;\n  pointer-events: none;\n}\n.ant-tooltip-arrow-content {\n  position: absolute;\n  top: 0;\n  right: 0;\n  bottom: 0;\n  left: 0;\n  display: block;\n  width: 5px;\n  height: 5px;\n  margin: auto;\n  background-color: rgba(0, 0, 0, 0.75);\n  content: '';\n  pointer-events: auto;\n}\n.ant-tooltip-placement-top .ant-tooltip-arrow,\n.ant-tooltip-placement-topLeft .ant-tooltip-arrow,\n.ant-tooltip-placement-topRight .ant-tooltip-arrow {\n  bottom: -5.07106781px;\n}\n.ant-tooltip-placement-top .ant-tooltip-arrow-content,\n.ant-tooltip-placement-topLeft .ant-tooltip-arrow-content,\n.ant-tooltip-placement-topRight .ant-tooltip-arrow-content {\n  -webkit-box-shadow: 3px 3px 7px rgba(0, 0, 0, 0.07);\n          box-shadow: 3px 3px 7px rgba(0, 0, 0, 0.07);\n  -webkit-transform: translateY(-6.53553391px) rotate(45deg);\n          transform: translateY(-6.53553391px) rotate(45deg);\n}\n.ant-tooltip-placement-top .ant-tooltip-arrow {\n  left: 50%;\n  -webkit-transform: translateX(-50%);\n          transform: translateX(-50%);\n}\n.ant-tooltip-placement-topLeft .ant-tooltip-arrow {\n  left: 13px;\n}\n.ant-tooltip-placement-topRight .ant-tooltip-arrow {\n  right: 13px;\n}\n.ant-tooltip-placement-right .ant-tooltip-arrow,\n.ant-tooltip-placement-rightTop .ant-tooltip-arrow,\n.ant-tooltip-placement-rightBottom .ant-tooltip-arrow {\n  left: -5.07106781px;\n}\n.ant-tooltip-placement-right .ant-tooltip-arrow-content,\n.ant-tooltip-placement-rightTop .ant-tooltip-arrow-content,\n.ant-tooltip-placement-rightBottom .ant-tooltip-arrow-content {\n  -webkit-box-shadow: -3px 3px 7px rgba(0, 0, 0, 0.07);\n          box-shadow: -3px 3px 7px rgba(0, 0, 0, 0.07);\n  -webkit-transform: translateX(6.53553391px) rotate(45deg);\n          transform: translateX(6.53553391px) rotate(45deg);\n}\n.ant-tooltip-placement-right .ant-tooltip-arrow {\n  top: 50%;\n  -webkit-transform: translateY(-50%);\n          transform: translateY(-50%);\n}\n.ant-tooltip-placement-rightTop .ant-tooltip-arrow {\n  top: 5px;\n}\n.ant-tooltip-placement-rightBottom .ant-tooltip-arrow {\n  bottom: 5px;\n}\n.ant-tooltip-placement-left .ant-tooltip-arrow,\n.ant-tooltip-placement-leftTop .ant-tooltip-arrow,\n.ant-tooltip-placement-leftBottom .ant-tooltip-arrow {\n  right: -5.07106781px;\n}\n.ant-tooltip-placement-left .ant-tooltip-arrow-content,\n.ant-tooltip-placement-leftTop .ant-tooltip-arrow-content,\n.ant-tooltip-placement-leftBottom .ant-tooltip-arrow-content {\n  -webkit-box-shadow: 3px -3px 7px rgba(0, 0, 0, 0.07);\n          box-shadow: 3px -3px 7px rgba(0, 0, 0, 0.07);\n  -webkit-transform: translateX(-6.53553391px) rotate(45deg);\n          transform: translateX(-6.53553391px) rotate(45deg);\n}\n.ant-tooltip-placement-left .ant-tooltip-arrow {\n  top: 50%;\n  -webkit-transform: translateY(-50%);\n          transform: translateY(-50%);\n}\n.ant-tooltip-placement-leftTop .ant-tooltip-arrow {\n  top: 5px;\n}\n.ant-tooltip-placement-leftBottom .ant-tooltip-arrow {\n  bottom: 5px;\n}\n.ant-tooltip-placement-bottom .ant-tooltip-arrow,\n.ant-tooltip-placement-bottomLeft .ant-tooltip-arrow,\n.ant-tooltip-placement-bottomRight .ant-tooltip-arrow {\n  top: -5.07106781px;\n}\n.ant-tooltip-placement-bottom .ant-tooltip-arrow-content,\n.ant-tooltip-placement-bottomLeft .ant-tooltip-arrow-content,\n.ant-tooltip-placement-bottomRight .ant-tooltip-arrow-content {\n  -webkit-box-shadow: -3px -3px 7px rgba(0, 0, 0, 0.07);\n          box-shadow: -3px -3px 7px rgba(0, 0, 0, 0.07);\n  -webkit-transform: translateY(6.53553391px) rotate(45deg);\n          transform: translateY(6.53553391px) rotate(45deg);\n}\n.ant-tooltip-placement-bottom .ant-tooltip-arrow {\n  left: 50%;\n  -webkit-transform: translateX(-50%);\n          transform: translateX(-50%);\n}\n.ant-tooltip-placement-bottomLeft .ant-tooltip-arrow {\n  left: 13px;\n}\n.ant-tooltip-placement-bottomRight .ant-tooltip-arrow {\n  right: 13px;\n}\n.ant-tooltip-pink .ant-tooltip-inner {\n  background-color: #eb2f96;\n}\n.ant-tooltip-pink .ant-tooltip-arrow-content {\n  background-color: #eb2f96;\n}\n.ant-tooltip-magenta .ant-tooltip-inner {\n  background-color: #eb2f96;\n}\n.ant-tooltip-magenta .ant-tooltip-arrow-content {\n  background-color: #eb2f96;\n}\n.ant-tooltip-red .ant-tooltip-inner {\n  background-color: #f5222d;\n}\n.ant-tooltip-red .ant-tooltip-arrow-content {\n  background-color: #f5222d;\n}\n.ant-tooltip-volcano .ant-tooltip-inner {\n  background-color: #fa541c;\n}\n.ant-tooltip-volcano .ant-tooltip-arrow-content {\n  background-color: #fa541c;\n}\n.ant-tooltip-orange .ant-tooltip-inner {\n  background-color: #fa8c16;\n}\n.ant-tooltip-orange .ant-tooltip-arrow-content {\n  background-color: #fa8c16;\n}\n.ant-tooltip-yellow .ant-tooltip-inner {\n  background-color: #fadb14;\n}\n.ant-tooltip-yellow .ant-tooltip-arrow-content {\n  background-color: #fadb14;\n}\n.ant-tooltip-gold .ant-tooltip-inner {\n  background-color: #faad14;\n}\n.ant-tooltip-gold .ant-tooltip-arrow-content {\n  background-color: #faad14;\n}\n.ant-tooltip-cyan .ant-tooltip-inner {\n  background-color: #13c2c2;\n}\n.ant-tooltip-cyan .ant-tooltip-arrow-content {\n  background-color: #13c2c2;\n}\n.ant-tooltip-lime .ant-tooltip-inner {\n  background-color: #a0d911;\n}\n.ant-tooltip-lime .ant-tooltip-arrow-content {\n  background-color: #a0d911;\n}\n.ant-tooltip-green .ant-tooltip-inner {\n  background-color: #52c41a;\n}\n.ant-tooltip-green .ant-tooltip-arrow-content {\n  background-color: #52c41a;\n}\n.ant-tooltip-blue .ant-tooltip-inner {\n  background-color: #1890ff;\n}\n.ant-tooltip-blue .ant-tooltip-arrow-content {\n  background-color: #1890ff;\n}\n.ant-tooltip-geekblue .ant-tooltip-inner {\n  background-color: #2f54eb;\n}\n.ant-tooltip-geekblue .ant-tooltip-arrow-content {\n  background-color: #2f54eb;\n}\n.ant-tooltip-purple .ant-tooltip-inner {\n  background-color: #722ed1;\n}\n.ant-tooltip-purple .ant-tooltip-arrow-content {\n  background-color: #722ed1;\n}\n.ant-tooltip-rtl {\n  direction: rtl;\n}\n.ant-tooltip-rtl .ant-tooltip-inner {\n  text-align: right;\n}\n", ""]);
// Exports
module.exports = exports;


/***/ }),
/* 87 */
/***/ (function(module, exports, __webpack_require__) {

// extracted by mini-css-extract-plugin

/***/ }),
/* 88 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
/** @license React v16.13.1
 * react-is.production.min.js
 *
 * Copyright (c) Facebook, Inc. and its affiliates.
 *
 * This source code is licensed under the MIT license found in the
 * LICENSE file in the root directory of this source tree.
 */


function _typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }

var b = "function" === typeof Symbol && Symbol.for,
    c = b ? Symbol.for("react.element") : 60103,
    d = b ? Symbol.for("react.portal") : 60106,
    e = b ? Symbol.for("react.fragment") : 60107,
    f = b ? Symbol.for("react.strict_mode") : 60108,
    g = b ? Symbol.for("react.profiler") : 60114,
    h = b ? Symbol.for("react.provider") : 60109,
    k = b ? Symbol.for("react.context") : 60110,
    l = b ? Symbol.for("react.async_mode") : 60111,
    m = b ? Symbol.for("react.concurrent_mode") : 60111,
    n = b ? Symbol.for("react.forward_ref") : 60112,
    p = b ? Symbol.for("react.suspense") : 60113,
    q = b ? Symbol.for("react.suspense_list") : 60120,
    r = b ? Symbol.for("react.memo") : 60115,
    t = b ? Symbol.for("react.lazy") : 60116,
    v = b ? Symbol.for("react.block") : 60121,
    w = b ? Symbol.for("react.fundamental") : 60117,
    x = b ? Symbol.for("react.responder") : 60118,
    y = b ? Symbol.for("react.scope") : 60119;

function z(a) {
  if ("object" === _typeof(a) && null !== a) {
    var u = a.$$typeof;

    switch (u) {
      case c:
        switch (a = a.type, a) {
          case l:
          case m:
          case e:
          case g:
          case f:
          case p:
            return a;

          default:
            switch (a = a && a.$$typeof, a) {
              case k:
              case n:
              case t:
              case r:
              case h:
                return a;

              default:
                return u;
            }

        }

      case d:
        return u;
    }
  }
}

function A(a) {
  return z(a) === m;
}

exports.AsyncMode = l;
exports.ConcurrentMode = m;
exports.ContextConsumer = k;
exports.ContextProvider = h;
exports.Element = c;
exports.ForwardRef = n;
exports.Fragment = e;
exports.Lazy = t;
exports.Memo = r;
exports.Portal = d;
exports.Profiler = g;
exports.StrictMode = f;
exports.Suspense = p;

exports.isAsyncMode = function (a) {
  return A(a) || z(a) === l;
};

exports.isConcurrentMode = A;

exports.isContextConsumer = function (a) {
  return z(a) === k;
};

exports.isContextProvider = function (a) {
  return z(a) === h;
};

exports.isElement = function (a) {
  return "object" === _typeof(a) && null !== a && a.$$typeof === c;
};

exports.isForwardRef = function (a) {
  return z(a) === n;
};

exports.isFragment = function (a) {
  return z(a) === e;
};

exports.isLazy = function (a) {
  return z(a) === t;
};

exports.isMemo = function (a) {
  return z(a) === r;
};

exports.isPortal = function (a) {
  return z(a) === d;
};

exports.isProfiler = function (a) {
  return z(a) === g;
};

exports.isStrictMode = function (a) {
  return z(a) === f;
};

exports.isSuspense = function (a) {
  return z(a) === p;
};

exports.isValidElementType = function (a) {
  return "string" === typeof a || "function" === typeof a || a === e || a === m || a === g || a === f || a === p || a === q || "object" === _typeof(a) && null !== a && (a.$$typeof === t || a.$$typeof === r || a.$$typeof === h || a.$$typeof === k || a.$$typeof === n || a.$$typeof === w || a.$$typeof === x || a.$$typeof === y || a.$$typeof === v);
};

exports.typeOf = z;

/***/ }),
/* 89 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(module) {function _typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }

/**
 * Copyright (c) 2014-present, Facebook, Inc.
 *
 * This source code is licensed under the MIT license found in the
 * LICENSE file in the root directory of this source tree.
 */
var runtime = function (exports) {
  "use strict";

  var Op = Object.prototype;
  var hasOwn = Op.hasOwnProperty;
  var undefined; // More compressible than void 0.

  var $Symbol = typeof Symbol === "function" ? Symbol : {};
  var iteratorSymbol = $Symbol.iterator || "@@iterator";
  var asyncIteratorSymbol = $Symbol.asyncIterator || "@@asyncIterator";
  var toStringTagSymbol = $Symbol.toStringTag || "@@toStringTag";

  function define(obj, key, value) {
    Object.defineProperty(obj, key, {
      value: value,
      enumerable: true,
      configurable: true,
      writable: true
    });
    return obj[key];
  }

  try {
    // IE 8 has a broken Object.defineProperty that only works on DOM objects.
    define({}, "");
  } catch (err) {
    define = function define(obj, key, value) {
      return obj[key] = value;
    };
  }

  function wrap(innerFn, outerFn, self, tryLocsList) {
    // If outerFn provided and outerFn.prototype is a Generator, then outerFn.prototype instanceof Generator.
    var protoGenerator = outerFn && outerFn.prototype instanceof Generator ? outerFn : Generator;
    var generator = Object.create(protoGenerator.prototype);
    var context = new Context(tryLocsList || []); // The ._invoke method unifies the implementations of the .next,
    // .throw, and .return methods.

    generator._invoke = makeInvokeMethod(innerFn, self, context);
    return generator;
  }

  exports.wrap = wrap; // Try/catch helper to minimize deoptimizations. Returns a completion
  // record like context.tryEntries[i].completion. This interface could
  // have been (and was previously) designed to take a closure to be
  // invoked without arguments, but in all the cases we care about we
  // already have an existing method we want to call, so there's no need
  // to create a new function object. We can even get away with assuming
  // the method takes exactly one argument, since that happens to be true
  // in every case, so we don't have to touch the arguments object. The
  // only additional allocation required is the completion record, which
  // has a stable shape and so hopefully should be cheap to allocate.

  function tryCatch(fn, obj, arg) {
    try {
      return {
        type: "normal",
        arg: fn.call(obj, arg)
      };
    } catch (err) {
      return {
        type: "throw",
        arg: err
      };
    }
  }

  var GenStateSuspendedStart = "suspendedStart";
  var GenStateSuspendedYield = "suspendedYield";
  var GenStateExecuting = "executing";
  var GenStateCompleted = "completed"; // Returning this object from the innerFn has the same effect as
  // breaking out of the dispatch switch statement.

  var ContinueSentinel = {}; // Dummy constructor functions that we use as the .constructor and
  // .constructor.prototype properties for functions that return Generator
  // objects. For full spec compliance, you may wish to configure your
  // minifier not to mangle the names of these two functions.

  function Generator() {}

  function GeneratorFunction() {}

  function GeneratorFunctionPrototype() {} // This is a polyfill for %IteratorPrototype% for environments that
  // don't natively support it.


  var IteratorPrototype = {};

  IteratorPrototype[iteratorSymbol] = function () {
    return this;
  };

  var getProto = Object.getPrototypeOf;
  var NativeIteratorPrototype = getProto && getProto(getProto(values([])));

  if (NativeIteratorPrototype && NativeIteratorPrototype !== Op && hasOwn.call(NativeIteratorPrototype, iteratorSymbol)) {
    // This environment has a native %IteratorPrototype%; use it instead
    // of the polyfill.
    IteratorPrototype = NativeIteratorPrototype;
  }

  var Gp = GeneratorFunctionPrototype.prototype = Generator.prototype = Object.create(IteratorPrototype);
  GeneratorFunction.prototype = Gp.constructor = GeneratorFunctionPrototype;
  GeneratorFunctionPrototype.constructor = GeneratorFunction;
  GeneratorFunction.displayName = define(GeneratorFunctionPrototype, toStringTagSymbol, "GeneratorFunction"); // Helper for defining the .next, .throw, and .return methods of the
  // Iterator interface in terms of a single ._invoke method.

  function defineIteratorMethods(prototype) {
    ["next", "throw", "return"].forEach(function (method) {
      define(prototype, method, function (arg) {
        return this._invoke(method, arg);
      });
    });
  }

  exports.isGeneratorFunction = function (genFun) {
    var ctor = typeof genFun === "function" && genFun.constructor;
    return ctor ? ctor === GeneratorFunction || // For the native GeneratorFunction constructor, the best we can
    // do is to check its .name property.
    (ctor.displayName || ctor.name) === "GeneratorFunction" : false;
  };

  exports.mark = function (genFun) {
    if (Object.setPrototypeOf) {
      Object.setPrototypeOf(genFun, GeneratorFunctionPrototype);
    } else {
      genFun.__proto__ = GeneratorFunctionPrototype;
      define(genFun, toStringTagSymbol, "GeneratorFunction");
    }

    genFun.prototype = Object.create(Gp);
    return genFun;
  }; // Within the body of any async function, `await x` is transformed to
  // `yield regeneratorRuntime.awrap(x)`, so that the runtime can test
  // `hasOwn.call(value, "__await")` to determine if the yielded value is
  // meant to be awaited.


  exports.awrap = function (arg) {
    return {
      __await: arg
    };
  };

  function AsyncIterator(generator, PromiseImpl) {
    function invoke(method, arg, resolve, reject) {
      var record = tryCatch(generator[method], generator, arg);

      if (record.type === "throw") {
        reject(record.arg);
      } else {
        var result = record.arg;
        var value = result.value;

        if (value && _typeof(value) === "object" && hasOwn.call(value, "__await")) {
          return PromiseImpl.resolve(value.__await).then(function (value) {
            invoke("next", value, resolve, reject);
          }, function (err) {
            invoke("throw", err, resolve, reject);
          });
        }

        return PromiseImpl.resolve(value).then(function (unwrapped) {
          // When a yielded Promise is resolved, its final value becomes
          // the .value of the Promise<{value,done}> result for the
          // current iteration.
          result.value = unwrapped;
          resolve(result);
        }, function (error) {
          // If a rejected Promise was yielded, throw the rejection back
          // into the async generator function so it can be handled there.
          return invoke("throw", error, resolve, reject);
        });
      }
    }

    var previousPromise;

    function enqueue(method, arg) {
      function callInvokeWithMethodAndArg() {
        return new PromiseImpl(function (resolve, reject) {
          invoke(method, arg, resolve, reject);
        });
      }

      return previousPromise = // If enqueue has been called before, then we want to wait until
      // all previous Promises have been resolved before calling invoke,
      // so that results are always delivered in the correct order. If
      // enqueue has not been called before, then it is important to
      // call invoke immediately, without waiting on a callback to fire,
      // so that the async generator function has the opportunity to do
      // any necessary setup in a predictable way. This predictability
      // is why the Promise constructor synchronously invokes its
      // executor callback, and why async functions synchronously
      // execute code before the first await. Since we implement simple
      // async functions in terms of async generators, it is especially
      // important to get this right, even though it requires care.
      previousPromise ? previousPromise.then(callInvokeWithMethodAndArg, // Avoid propagating failures to Promises returned by later
      // invocations of the iterator.
      callInvokeWithMethodAndArg) : callInvokeWithMethodAndArg();
    } // Define the unified helper method that is used to implement .next,
    // .throw, and .return (see defineIteratorMethods).


    this._invoke = enqueue;
  }

  defineIteratorMethods(AsyncIterator.prototype);

  AsyncIterator.prototype[asyncIteratorSymbol] = function () {
    return this;
  };

  exports.AsyncIterator = AsyncIterator; // Note that simple async functions are implemented on top of
  // AsyncIterator objects; they just return a Promise for the value of
  // the final result produced by the iterator.

  exports.async = function (innerFn, outerFn, self, tryLocsList, PromiseImpl) {
    if (PromiseImpl === void 0) PromiseImpl = Promise;
    var iter = new AsyncIterator(wrap(innerFn, outerFn, self, tryLocsList), PromiseImpl);
    return exports.isGeneratorFunction(outerFn) ? iter // If outerFn is a generator, return the full iterator.
    : iter.next().then(function (result) {
      return result.done ? result.value : iter.next();
    });
  };

  function makeInvokeMethod(innerFn, self, context) {
    var state = GenStateSuspendedStart;
    return function invoke(method, arg) {
      if (state === GenStateExecuting) {
        throw new Error("Generator is already running");
      }

      if (state === GenStateCompleted) {
        if (method === "throw") {
          throw arg;
        } // Be forgiving, per 25.3.3.3.3 of the spec:
        // https://people.mozilla.org/~jorendorff/es6-draft.html#sec-generatorresume


        return doneResult();
      }

      context.method = method;
      context.arg = arg;

      while (true) {
        var delegate = context.delegate;

        if (delegate) {
          var delegateResult = maybeInvokeDelegate(delegate, context);

          if (delegateResult) {
            if (delegateResult === ContinueSentinel) continue;
            return delegateResult;
          }
        }

        if (context.method === "next") {
          // Setting context._sent for legacy support of Babel's
          // function.sent implementation.
          context.sent = context._sent = context.arg;
        } else if (context.method === "throw") {
          if (state === GenStateSuspendedStart) {
            state = GenStateCompleted;
            throw context.arg;
          }

          context.dispatchException(context.arg);
        } else if (context.method === "return") {
          context.abrupt("return", context.arg);
        }

        state = GenStateExecuting;
        var record = tryCatch(innerFn, self, context);

        if (record.type === "normal") {
          // If an exception is thrown from innerFn, we leave state ===
          // GenStateExecuting and loop back for another invocation.
          state = context.done ? GenStateCompleted : GenStateSuspendedYield;

          if (record.arg === ContinueSentinel) {
            continue;
          }

          return {
            value: record.arg,
            done: context.done
          };
        } else if (record.type === "throw") {
          state = GenStateCompleted; // Dispatch the exception by looping back around to the
          // context.dispatchException(context.arg) call above.

          context.method = "throw";
          context.arg = record.arg;
        }
      }
    };
  } // Call delegate.iterator[context.method](context.arg) and handle the
  // result, either by returning a { value, done } result from the
  // delegate iterator, or by modifying context.method and context.arg,
  // setting context.delegate to null, and returning the ContinueSentinel.


  function maybeInvokeDelegate(delegate, context) {
    var method = delegate.iterator[context.method];

    if (method === undefined) {
      // A .throw or .return when the delegate iterator has no .throw
      // method always terminates the yield* loop.
      context.delegate = null;

      if (context.method === "throw") {
        // Note: ["return"] must be used for ES3 parsing compatibility.
        if (delegate.iterator["return"]) {
          // If the delegate iterator has a return method, give it a
          // chance to clean up.
          context.method = "return";
          context.arg = undefined;
          maybeInvokeDelegate(delegate, context);

          if (context.method === "throw") {
            // If maybeInvokeDelegate(context) changed context.method from
            // "return" to "throw", let that override the TypeError below.
            return ContinueSentinel;
          }
        }

        context.method = "throw";
        context.arg = new TypeError("The iterator does not provide a 'throw' method");
      }

      return ContinueSentinel;
    }

    var record = tryCatch(method, delegate.iterator, context.arg);

    if (record.type === "throw") {
      context.method = "throw";
      context.arg = record.arg;
      context.delegate = null;
      return ContinueSentinel;
    }

    var info = record.arg;

    if (!info) {
      context.method = "throw";
      context.arg = new TypeError("iterator result is not an object");
      context.delegate = null;
      return ContinueSentinel;
    }

    if (info.done) {
      // Assign the result of the finished delegate to the temporary
      // variable specified by delegate.resultName (see delegateYield).
      context[delegate.resultName] = info.value; // Resume execution at the desired location (see delegateYield).

      context.next = delegate.nextLoc; // If context.method was "throw" but the delegate handled the
      // exception, let the outer generator proceed normally. If
      // context.method was "next", forget context.arg since it has been
      // "consumed" by the delegate iterator. If context.method was
      // "return", allow the original .return call to continue in the
      // outer generator.

      if (context.method !== "return") {
        context.method = "next";
        context.arg = undefined;
      }
    } else {
      // Re-yield the result returned by the delegate method.
      return info;
    } // The delegate iterator is finished, so forget it and continue with
    // the outer generator.


    context.delegate = null;
    return ContinueSentinel;
  } // Define Generator.prototype.{next,throw,return} in terms of the
  // unified ._invoke helper method.


  defineIteratorMethods(Gp);
  define(Gp, toStringTagSymbol, "Generator"); // A Generator should always return itself as the iterator object when the
  // @@iterator function is called on it. Some browsers' implementations of the
  // iterator prototype chain incorrectly implement this, causing the Generator
  // object to not be returned from this call. This ensures that doesn't happen.
  // See https://github.com/facebook/regenerator/issues/274 for more details.

  Gp[iteratorSymbol] = function () {
    return this;
  };

  Gp.toString = function () {
    return "[object Generator]";
  };

  function pushTryEntry(locs) {
    var entry = {
      tryLoc: locs[0]
    };

    if (1 in locs) {
      entry.catchLoc = locs[1];
    }

    if (2 in locs) {
      entry.finallyLoc = locs[2];
      entry.afterLoc = locs[3];
    }

    this.tryEntries.push(entry);
  }

  function resetTryEntry(entry) {
    var record = entry.completion || {};
    record.type = "normal";
    delete record.arg;
    entry.completion = record;
  }

  function Context(tryLocsList) {
    // The root entry object (effectively a try statement without a catch
    // or a finally block) gives us a place to store values thrown from
    // locations where there is no enclosing try statement.
    this.tryEntries = [{
      tryLoc: "root"
    }];
    tryLocsList.forEach(pushTryEntry, this);
    this.reset(true);
  }

  exports.keys = function (object) {
    var keys = [];

    for (var key in object) {
      keys.push(key);
    }

    keys.reverse(); // Rather than returning an object with a next method, we keep
    // things simple and return the next function itself.

    return function next() {
      while (keys.length) {
        var key = keys.pop();

        if (key in object) {
          next.value = key;
          next.done = false;
          return next;
        }
      } // To avoid creating an additional object, we just hang the .value
      // and .done properties off the next function object itself. This
      // also ensures that the minifier will not anonymize the function.


      next.done = true;
      return next;
    };
  };

  function values(iterable) {
    if (iterable) {
      var iteratorMethod = iterable[iteratorSymbol];

      if (iteratorMethod) {
        return iteratorMethod.call(iterable);
      }

      if (typeof iterable.next === "function") {
        return iterable;
      }

      if (!isNaN(iterable.length)) {
        var i = -1,
            next = function next() {
          while (++i < iterable.length) {
            if (hasOwn.call(iterable, i)) {
              next.value = iterable[i];
              next.done = false;
              return next;
            }
          }

          next.value = undefined;
          next.done = true;
          return next;
        };

        return next.next = next;
      }
    } // Return an iterator with no values.


    return {
      next: doneResult
    };
  }

  exports.values = values;

  function doneResult() {
    return {
      value: undefined,
      done: true
    };
  }

  Context.prototype = {
    constructor: Context,
    reset: function reset(skipTempReset) {
      this.prev = 0;
      this.next = 0; // Resetting context._sent for legacy support of Babel's
      // function.sent implementation.

      this.sent = this._sent = undefined;
      this.done = false;
      this.delegate = null;
      this.method = "next";
      this.arg = undefined;
      this.tryEntries.forEach(resetTryEntry);

      if (!skipTempReset) {
        for (var name in this) {
          // Not sure about the optimal order of these conditions:
          if (name.charAt(0) === "t" && hasOwn.call(this, name) && !isNaN(+name.slice(1))) {
            this[name] = undefined;
          }
        }
      }
    },
    stop: function stop() {
      this.done = true;
      var rootEntry = this.tryEntries[0];
      var rootRecord = rootEntry.completion;

      if (rootRecord.type === "throw") {
        throw rootRecord.arg;
      }

      return this.rval;
    },
    dispatchException: function dispatchException(exception) {
      if (this.done) {
        throw exception;
      }

      var context = this;

      function handle(loc, caught) {
        record.type = "throw";
        record.arg = exception;
        context.next = loc;

        if (caught) {
          // If the dispatched exception was caught by a catch block,
          // then let that catch block handle the exception normally.
          context.method = "next";
          context.arg = undefined;
        }

        return !!caught;
      }

      for (var i = this.tryEntries.length - 1; i >= 0; --i) {
        var entry = this.tryEntries[i];
        var record = entry.completion;

        if (entry.tryLoc === "root") {
          // Exception thrown outside of any try block that could handle
          // it, so set the completion value of the entire function to
          // throw the exception.
          return handle("end");
        }

        if (entry.tryLoc <= this.prev) {
          var hasCatch = hasOwn.call(entry, "catchLoc");
          var hasFinally = hasOwn.call(entry, "finallyLoc");

          if (hasCatch && hasFinally) {
            if (this.prev < entry.catchLoc) {
              return handle(entry.catchLoc, true);
            } else if (this.prev < entry.finallyLoc) {
              return handle(entry.finallyLoc);
            }
          } else if (hasCatch) {
            if (this.prev < entry.catchLoc) {
              return handle(entry.catchLoc, true);
            }
          } else if (hasFinally) {
            if (this.prev < entry.finallyLoc) {
              return handle(entry.finallyLoc);
            }
          } else {
            throw new Error("try statement without catch or finally");
          }
        }
      }
    },
    abrupt: function abrupt(type, arg) {
      for (var i = this.tryEntries.length - 1; i >= 0; --i) {
        var entry = this.tryEntries[i];

        if (entry.tryLoc <= this.prev && hasOwn.call(entry, "finallyLoc") && this.prev < entry.finallyLoc) {
          var finallyEntry = entry;
          break;
        }
      }

      if (finallyEntry && (type === "break" || type === "continue") && finallyEntry.tryLoc <= arg && arg <= finallyEntry.finallyLoc) {
        // Ignore the finally entry if control is not jumping to a
        // location outside the try/catch block.
        finallyEntry = null;
      }

      var record = finallyEntry ? finallyEntry.completion : {};
      record.type = type;
      record.arg = arg;

      if (finallyEntry) {
        this.method = "next";
        this.next = finallyEntry.finallyLoc;
        return ContinueSentinel;
      }

      return this.complete(record);
    },
    complete: function complete(record, afterLoc) {
      if (record.type === "throw") {
        throw record.arg;
      }

      if (record.type === "break" || record.type === "continue") {
        this.next = record.arg;
      } else if (record.type === "return") {
        this.rval = this.arg = record.arg;
        this.method = "return";
        this.next = "end";
      } else if (record.type === "normal" && afterLoc) {
        this.next = afterLoc;
      }

      return ContinueSentinel;
    },
    finish: function finish(finallyLoc) {
      for (var i = this.tryEntries.length - 1; i >= 0; --i) {
        var entry = this.tryEntries[i];

        if (entry.finallyLoc === finallyLoc) {
          this.complete(entry.completion, entry.afterLoc);
          resetTryEntry(entry);
          return ContinueSentinel;
        }
      }
    },
    "catch": function _catch(tryLoc) {
      for (var i = this.tryEntries.length - 1; i >= 0; --i) {
        var entry = this.tryEntries[i];

        if (entry.tryLoc === tryLoc) {
          var record = entry.completion;

          if (record.type === "throw") {
            var thrown = record.arg;
            resetTryEntry(entry);
          }

          return thrown;
        }
      } // The context.catch method must only be called with a location
      // argument that corresponds to a known catch block.


      throw new Error("illegal catch attempt");
    },
    delegateYield: function delegateYield(iterable, resultName, nextLoc) {
      this.delegate = {
        iterator: values(iterable),
        resultName: resultName,
        nextLoc: nextLoc
      };

      if (this.method === "next") {
        // Deliberately forget the last sent value so that we don't
        // accidentally pass it on to the delegate.
        this.arg = undefined;
      }

      return ContinueSentinel;
    }
  }; // Regardless of whether this script is executing as a CommonJS module
  // or not, return the runtime object so that we can declare the variable
  // regeneratorRuntime in the outer scope, which allows this module to be
  // injected easily by `bin/regenerator --include-runtime script.js`.

  return exports;
}( // If this script is executing as a CommonJS module, use module.exports
// as the regeneratorRuntime namespace. Otherwise create a new empty
// object. Either way, the resulting object will be used to initialize
// the regeneratorRuntime variable at the top of this file.
( false ? undefined : _typeof(module)) === "object" ? module.exports : {});

try {
  regeneratorRuntime = runtime;
} catch (accidentalStrictMode) {
  // This module should not be running in strict mode, so the above
  // assignment should always work unless something is misconfigured. Just
  // in case runtime.js accidentally runs in strict mode, we can escape
  // strict mode using a global Function call. This could conceivably fail
  // if a Content Security Policy forbids using Function, but in that case
  // the proper solution is to fix the accidental strict mode problem. If
  // you've misconfigured your bundler to force strict mode and applied a
  // CSP to forbid Function, and you're not willing to fix either of those
  // problems, please detail your unique predicament in a GitHub issue.
  Function("r", "regeneratorRuntime = r")(runtime);
}
/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(46)(module)))

/***/ }),
/* 90 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireWildcard = __webpack_require__(7);

var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports["default"] = exports.ANT_MARK = void 0;

var _extends2 = _interopRequireDefault(__webpack_require__(3));

var _classCallCheck2 = _interopRequireDefault(__webpack_require__(33));

var _createClass2 = _interopRequireDefault(__webpack_require__(34));

var _inherits2 = _interopRequireDefault(__webpack_require__(35));

var _createSuper2 = _interopRequireDefault(__webpack_require__(41));

var React = _interopRequireWildcard(__webpack_require__(0));

var _devWarning = _interopRequireDefault(__webpack_require__(94));

var _locale = __webpack_require__(95);

var _context = _interopRequireDefault(__webpack_require__(63));

var ANT_MARK = 'internalMark';
exports.ANT_MARK = ANT_MARK;

var LocaleProvider = /*#__PURE__*/function (_React$Component) {
  (0, _inherits2["default"])(LocaleProvider, _React$Component);

  var _super = (0, _createSuper2["default"])(LocaleProvider);

  function LocaleProvider(props) {
    var _this;

    (0, _classCallCheck2["default"])(this, LocaleProvider);
    _this = _super.call(this, props);
    (0, _locale.changeConfirmLocale)(props.locale && props.locale.Modal);
    (0, _devWarning["default"])(props._ANT_MARK__ === ANT_MARK, 'LocaleProvider', '`LocaleProvider` is deprecated. Please use `locale` with `ConfigProvider` instead: http://u.ant.design/locale');
    return _this;
  }

  (0, _createClass2["default"])(LocaleProvider, [{
    key: "componentDidUpdate",
    value: function componentDidUpdate(prevProps) {
      var locale = this.props.locale;

      if (prevProps.locale !== locale) {
        (0, _locale.changeConfirmLocale)(locale && locale.Modal);
      }
    }
  }, {
    key: "componentWillUnmount",
    value: function componentWillUnmount() {
      (0, _locale.changeConfirmLocale)();
    }
  }, {
    key: "render",
    value: function render() {
      var _this$props = this.props,
          locale = _this$props.locale,
          children = _this$props.children;
      return /*#__PURE__*/React.createElement(_context["default"].Provider, {
        value: (0, _extends2["default"])((0, _extends2["default"])({}, locale), {
          exist: true
        })
      }, children);
    }
  }]);
  return LocaleProvider;
}(React.Component);

exports["default"] = LocaleProvider;
LocaleProvider.defaultProps = {
  locale: {}
};

/***/ }),
/* 91 */
/***/ (function(module, exports) {

function _setPrototypeOf(o, p) {
  module.exports = _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) {
    o.__proto__ = p;
    return o;
  };

  return _setPrototypeOf(o, p);
}

module.exports = _setPrototypeOf;

/***/ }),
/* 92 */
/***/ (function(module, exports) {

function _isNativeReflectConstruct() {
  if (typeof Reflect === "undefined" || !Reflect.construct) return false;
  if (Reflect.construct.sham) return false;
  if (typeof Proxy === "function") return true;

  try {
    Date.prototype.toString.call(Reflect.construct(Date, [], function () {}));
    return true;
  } catch (e) {
    return false;
  }
}

module.exports = _isNativeReflectConstruct;

/***/ }),
/* 93 */
/***/ (function(module, exports) {

function _assertThisInitialized(self) {
  if (self === void 0) {
    throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
  }

  return self;
}

module.exports = _assertThisInitialized;

/***/ }),
/* 94 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireWildcard = __webpack_require__(7);

Object.defineProperty(exports, "__esModule", {
  value: true
});
Object.defineProperty(exports, "resetWarned", {
  enumerable: true,
  get: function get() {
    return _warning.resetWarned;
  }
});
exports["default"] = void 0;

var _warning = _interopRequireWildcard(__webpack_require__(36));

var _default = function _default(valid, component, message) {
  (0, _warning["default"])(valid, "[antd: ".concat(component, "] ").concat(message));
};

exports["default"] = _default;

/***/ }),
/* 95 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.changeConfirmLocale = changeConfirmLocale;
exports.getConfirmLocale = getConfirmLocale;

var _extends2 = _interopRequireDefault(__webpack_require__(3));

var _default = _interopRequireDefault(__webpack_require__(60));

var runtimeLocale = (0, _extends2["default"])({}, _default["default"].Modal);

function changeConfirmLocale(newLocale) {
  if (newLocale) {
    runtimeLocale = (0, _extends2["default"])((0, _extends2["default"])({}, runtimeLocale), newLocale);
  } else {
    runtimeLocale = (0, _extends2["default"])({}, _default["default"].Modal);
  }
}

function getConfirmLocale() {
  return runtimeLocale;
}

/***/ }),
/* 96 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;
var _default = {
  // Options.jsx
  items_per_page: '/ page',
  jump_to: 'Go to',
  jump_to_confirm: 'confirm',
  page: '',
  // Pagination.jsx
  prev_page: 'Previous Page',
  next_page: 'Next Page',
  prev_5: 'Previous 5 Pages',
  next_5: 'Next 5 Pages',
  prev_3: 'Previous 3 Pages',
  next_3: 'Next 3 Pages'
};
exports.default = _default;

/***/ }),
/* 97 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;
var locale = {
  locale: 'en_US',
  today: 'Today',
  now: 'Now',
  backToToday: 'Back to today',
  ok: 'Ok',
  clear: 'Clear',
  month: 'Month',
  year: 'Year',
  timeSelect: 'select time',
  dateSelect: 'select date',
  weekSelect: 'Choose a week',
  monthSelect: 'Choose a month',
  yearSelect: 'Choose a year',
  decadeSelect: 'Choose a decade',
  yearFormat: 'YYYY',
  dateFormat: 'M/D/YYYY',
  dayFormat: 'D',
  dateTimeFormat: 'M/D/YYYY HH:mm:ss',
  monthBeforeYear: true,
  previousMonth: 'Previous month (PageUp)',
  nextMonth: 'Next month (PageDown)',
  previousYear: 'Last year (Control + left)',
  nextYear: 'Next year (Control + right)',
  previousDecade: 'Last decade',
  nextDecade: 'Next decade',
  previousCentury: 'Last century',
  nextCentury: 'Next century'
};
var _default = locale;
exports.default = _default;

/***/ }),
/* 98 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports["default"] = void 0;

var _en_US = _interopRequireDefault(__webpack_require__(61));

var _default = _en_US["default"];
exports["default"] = _default;

/***/ }),
/* 99 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports["default"] = void 0;

var _default2 = _interopRequireDefault(__webpack_require__(60));

var _default = _default2["default"];
exports["default"] = _default;

/***/ }),
/* 100 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireWildcard = __webpack_require__(7);

var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.withConfigConsumer = withConfigConsumer;
exports.ConfigConsumer = exports.ConfigContext = void 0;

var _extends2 = _interopRequireDefault(__webpack_require__(3));

var React = _interopRequireWildcard(__webpack_require__(0));

var _renderEmpty = _interopRequireDefault(__webpack_require__(101));

var ConfigContext = /*#__PURE__*/React.createContext({
  // We provide a default function for Context without provider
  getPrefixCls: function getPrefixCls(suffixCls, customizePrefixCls) {
    if (customizePrefixCls) return customizePrefixCls;
    return suffixCls ? "ant-".concat(suffixCls) : 'ant';
  },
  renderEmpty: _renderEmpty["default"]
});
exports.ConfigContext = ConfigContext;
var ConfigConsumer = ConfigContext.Consumer;
exports.ConfigConsumer = ConfigConsumer;

function withConfigConsumer(config) {
  return function withConfigConsumerFunc(Component) {
    // Wrap with ConfigConsumer. Since we need compatible with react 15, be care when using ref methods
    var SFC = function SFC(props) {
      return /*#__PURE__*/React.createElement(ConfigConsumer, null, function (configProps) {
        var basicPrefixCls = config.prefixCls;
        var getPrefixCls = configProps.getPrefixCls;
        var customizePrefixCls = props.prefixCls;
        var prefixCls = getPrefixCls(basicPrefixCls, customizePrefixCls);
        return /*#__PURE__*/React.createElement(Component, (0, _extends2["default"])({}, configProps, props, {
          prefixCls: prefixCls
        }));
      });
    };

    var cons = Component.constructor;
    var name = cons && cons.displayName || Component.name || 'Component';
    SFC.displayName = "withConfigConsumer(".concat(name, ")");
    return SFC;
  };
}

/***/ }),
/* 101 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireDefault = __webpack_require__(4);

var _interopRequireWildcard = __webpack_require__(7);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports["default"] = void 0;

var React = _interopRequireWildcard(__webpack_require__(0));

var _empty = _interopRequireDefault(__webpack_require__(102));

var _ = __webpack_require__(20);

var renderEmpty = function renderEmpty(componentName) {
  return /*#__PURE__*/React.createElement(_.ConfigConsumer, null, function (_ref) {
    var getPrefixCls = _ref.getPrefixCls;
    var prefix = getPrefixCls('empty');

    switch (componentName) {
      case 'Table':
      case 'List':
        return /*#__PURE__*/React.createElement(_empty["default"], {
          image: _empty["default"].PRESENTED_IMAGE_SIMPLE
        });

      case 'Select':
      case 'TreeSelect':
      case 'Cascader':
      case 'Transfer':
      case 'Mentions':
        return /*#__PURE__*/React.createElement(_empty["default"], {
          image: _empty["default"].PRESENTED_IMAGE_SIMPLE,
          className: "".concat(prefix, "-small")
        });

      default:
        return /*#__PURE__*/React.createElement(_empty["default"], null);
    }
  });
};

var _default = renderEmpty;
exports["default"] = _default;

/***/ }),
/* 102 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireWildcard = __webpack_require__(7);

var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports["default"] = void 0;

var _extends2 = _interopRequireDefault(__webpack_require__(3));

var _defineProperty2 = _interopRequireDefault(__webpack_require__(13));

var React = _interopRequireWildcard(__webpack_require__(0));

var _classnames = _interopRequireDefault(__webpack_require__(2));

var _configProvider = __webpack_require__(20);

var _LocaleReceiver = _interopRequireDefault(__webpack_require__(64));

var _empty = _interopRequireDefault(__webpack_require__(103));

var _simple = _interopRequireDefault(__webpack_require__(104));

var __rest = void 0 && (void 0).__rest || function (s, e) {
  var t = {};

  for (var p in s) {
    if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0) t[p] = s[p];
  }

  if (s != null && typeof Object.getOwnPropertySymbols === "function") for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {
    if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i])) t[p[i]] = s[p[i]];
  }
  return t;
};

var defaultEmptyImg = /*#__PURE__*/React.createElement(_empty["default"], null);
var simpleEmptyImg = /*#__PURE__*/React.createElement(_simple["default"], null);

var Empty = function Empty(props) {
  return /*#__PURE__*/React.createElement(_configProvider.ConfigConsumer, null, function (_ref) {
    var getPrefixCls = _ref.getPrefixCls,
        direction = _ref.direction;

    var className = props.className,
        customizePrefixCls = props.prefixCls,
        _props$image = props.image,
        image = _props$image === void 0 ? defaultEmptyImg : _props$image,
        description = props.description,
        children = props.children,
        imageStyle = props.imageStyle,
        restProps = __rest(props, ["className", "prefixCls", "image", "description", "children", "imageStyle"]);

    return /*#__PURE__*/React.createElement(_LocaleReceiver["default"], {
      componentName: "Empty"
    }, function (locale) {
      var _classNames;

      var prefixCls = getPrefixCls('empty', customizePrefixCls);
      var des = typeof description !== 'undefined' ? description : locale.description;
      var alt = typeof des === 'string' ? des : 'empty';
      var imageNode = null;

      if (typeof image === 'string') {
        imageNode = /*#__PURE__*/React.createElement("img", {
          alt: alt,
          src: image
        });
      } else {
        imageNode = image;
      }

      return /*#__PURE__*/React.createElement("div", (0, _extends2["default"])({
        className: (0, _classnames["default"])(prefixCls, (_classNames = {}, (0, _defineProperty2["default"])(_classNames, "".concat(prefixCls, "-normal"), image === simpleEmptyImg), (0, _defineProperty2["default"])(_classNames, "".concat(prefixCls, "-rtl"), direction === 'rtl'), _classNames), className)
      }, restProps), /*#__PURE__*/React.createElement("div", {
        className: "".concat(prefixCls, "-image"),
        style: imageStyle
      }, imageNode), des && /*#__PURE__*/React.createElement("p", {
        className: "".concat(prefixCls, "-description")
      }, des), children && /*#__PURE__*/React.createElement("div", {
        className: "".concat(prefixCls, "-footer")
      }, children));
    });
  });
};

Empty.PRESENTED_IMAGE_DEFAULT = defaultEmptyImg;
Empty.PRESENTED_IMAGE_SIMPLE = simpleEmptyImg;
var _default = Empty;
exports["default"] = _default;

/***/ }),
/* 103 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireWildcard = __webpack_require__(7);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports["default"] = void 0;

var React = _interopRequireWildcard(__webpack_require__(0));

var _configProvider = __webpack_require__(20);

var Empty = function Empty() {
  var _React$useContext = React.useContext(_configProvider.ConfigContext),
      getPrefixCls = _React$useContext.getPrefixCls;

  var prefixCls = getPrefixCls('empty-img-default');
  return /*#__PURE__*/React.createElement("svg", {
    className: prefixCls,
    width: "184",
    height: "152",
    viewBox: "0 0 184 152",
    xmlns: "http://www.w3.org/2000/svg"
  }, /*#__PURE__*/React.createElement("g", {
    fill: "none",
    fillRule: "evenodd"
  }, /*#__PURE__*/React.createElement("g", {
    transform: "translate(24 31.67)"
  }, /*#__PURE__*/React.createElement("ellipse", {
    className: "".concat(prefixCls, "-ellipse"),
    cx: "67.797",
    cy: "106.89",
    rx: "67.797",
    ry: "12.668"
  }), /*#__PURE__*/React.createElement("path", {
    className: "".concat(prefixCls, "-path-1"),
    d: "M122.034 69.674L98.109 40.229c-1.148-1.386-2.826-2.225-4.593-2.225h-51.44c-1.766 0-3.444.839-4.592 2.225L13.56 69.674v15.383h108.475V69.674z"
  }), /*#__PURE__*/React.createElement("path", {
    className: "".concat(prefixCls, "-path-2"),
    d: "M101.537 86.214L80.63 61.102c-1.001-1.207-2.507-1.867-4.048-1.867H31.724c-1.54 0-3.047.66-4.048 1.867L6.769 86.214v13.792h94.768V86.214z",
    transform: "translate(13.56)"
  }), /*#__PURE__*/React.createElement("path", {
    className: "".concat(prefixCls, "-path-3"),
    d: "M33.83 0h67.933a4 4 0 0 1 4 4v93.344a4 4 0 0 1-4 4H33.83a4 4 0 0 1-4-4V4a4 4 0 0 1 4-4z"
  }), /*#__PURE__*/React.createElement("path", {
    className: "".concat(prefixCls, "-path-4"),
    d: "M42.678 9.953h50.237a2 2 0 0 1 2 2V36.91a2 2 0 0 1-2 2H42.678a2 2 0 0 1-2-2V11.953a2 2 0 0 1 2-2zM42.94 49.767h49.713a2.262 2.262 0 1 1 0 4.524H42.94a2.262 2.262 0 0 1 0-4.524zM42.94 61.53h49.713a2.262 2.262 0 1 1 0 4.525H42.94a2.262 2.262 0 0 1 0-4.525zM121.813 105.032c-.775 3.071-3.497 5.36-6.735 5.36H20.515c-3.238 0-5.96-2.29-6.734-5.36a7.309 7.309 0 0 1-.222-1.79V69.675h26.318c2.907 0 5.25 2.448 5.25 5.42v.04c0 2.971 2.37 5.37 5.277 5.37h34.785c2.907 0 5.277-2.421 5.277-5.393V75.1c0-2.972 2.343-5.426 5.25-5.426h26.318v33.569c0 .617-.077 1.216-.221 1.789z"
  })), /*#__PURE__*/React.createElement("path", {
    className: "".concat(prefixCls, "-path-5"),
    d: "M149.121 33.292l-6.83 2.65a1 1 0 0 1-1.317-1.23l1.937-6.207c-2.589-2.944-4.109-6.534-4.109-10.408C138.802 8.102 148.92 0 161.402 0 173.881 0 184 8.102 184 18.097c0 9.995-10.118 18.097-22.599 18.097-4.528 0-8.744-1.066-12.28-2.902z"
  }), /*#__PURE__*/React.createElement("g", {
    className: "".concat(prefixCls, "-g"),
    transform: "translate(149.65 15.383)"
  }, /*#__PURE__*/React.createElement("ellipse", {
    cx: "20.654",
    cy: "3.167",
    rx: "2.849",
    ry: "2.815"
  }), /*#__PURE__*/React.createElement("path", {
    d: "M5.698 5.63H0L2.898.704zM9.259.704h4.985V5.63H9.259z"
  }))));
};

var _default = Empty;
exports["default"] = _default;

/***/ }),
/* 104 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireWildcard = __webpack_require__(7);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports["default"] = void 0;

var React = _interopRequireWildcard(__webpack_require__(0));

var _configProvider = __webpack_require__(20);

var Simple = function Simple() {
  var _React$useContext = React.useContext(_configProvider.ConfigContext),
      getPrefixCls = _React$useContext.getPrefixCls;

  var prefixCls = getPrefixCls('empty-img-simple');
  return /*#__PURE__*/React.createElement("svg", {
    className: prefixCls,
    width: "64",
    height: "41",
    viewBox: "0 0 64 41",
    xmlns: "http://www.w3.org/2000/svg"
  }, /*#__PURE__*/React.createElement("g", {
    transform: "translate(0 1)",
    fill: "none",
    fillRule: "evenodd"
  }, /*#__PURE__*/React.createElement("ellipse", {
    className: "".concat(prefixCls, "-ellipse"),
    cx: "32",
    cy: "33",
    rx: "32",
    ry: "7"
  }), /*#__PURE__*/React.createElement("g", {
    className: "".concat(prefixCls, "-g"),
    fillRule: "nonzero"
  }, /*#__PURE__*/React.createElement("path", {
    d: "M55 12.76L44.854 1.258C44.367.474 43.656 0 42.907 0H21.093c-.749 0-1.46.474-1.947 1.257L9 12.761V22h46v-9.24z"
  }), /*#__PURE__*/React.createElement("path", {
    d: "M41.613 15.931c0-1.605.994-2.93 2.227-2.931H55v18.137C55 33.26 53.68 35 52.05 35h-40.1C10.32 35 9 33.259 9 31.137V13h11.16c1.233 0 2.227 1.323 2.227 2.928v.022c0 1.605 1.005 2.901 2.237 2.901h14.752c1.232 0 2.237-1.308 2.237-2.913v-.007z",
    className: "".concat(prefixCls, "-path")
  }))));
};

var _default = Simple;
exports["default"] = _default;

/***/ }),
/* 105 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireWildcard = __webpack_require__(7);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports["default"] = exports.SizeContextProvider = void 0;

var React = _interopRequireWildcard(__webpack_require__(0));

var SizeContext = /*#__PURE__*/React.createContext(undefined);

var SizeContextProvider = function SizeContextProvider(_ref) {
  var children = _ref.children,
      size = _ref.size;
  return /*#__PURE__*/React.createElement(SizeContext.Consumer, null, function (originSize) {
    return /*#__PURE__*/React.createElement(SizeContext.Provider, {
      value: size || originSize
    }, children);
  });
};

exports.SizeContextProvider = SizeContextProvider;
var _default = SizeContext;
exports["default"] = _default;

/***/ }),
/* 106 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var _LoadingOutlined = _interopRequireDefault(__webpack_require__(107));

function _interopRequireDefault(obj) {
  return obj && obj.__esModule ? obj : {
    'default': obj
  };
}

var _default = _LoadingOutlined;
exports.default = _default;
module.exports = _default;

/***/ }),
/* 107 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireDefault = __webpack_require__(4);

var _interopRequireWildcard = __webpack_require__(7);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var React = _interopRequireWildcard(__webpack_require__(0));

var _LoadingOutlined = _interopRequireDefault(__webpack_require__(108));

var _AntdIcon = _interopRequireDefault(__webpack_require__(18)); // GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY


var LoadingOutlined = function LoadingOutlined(props, ref) {
  return React.createElement(_AntdIcon.default, Object.assign({}, props, {
    ref: ref,
    icon: _LoadingOutlined.default
  }));
};

LoadingOutlined.displayName = 'LoadingOutlined';

var _default = React.forwardRef(LoadingOutlined);

exports.default = _default;

/***/ }),
/* 108 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
 // This icon file is generated automatically.

Object.defineProperty(exports, "__esModule", {
  value: true
});
var LoadingOutlined = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "0 0 1024 1024",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M988 548c-19.9 0-36-16.1-36-36 0-59.4-11.6-117-34.6-171.3a440.45 440.45 0 00-94.3-139.9 437.71 437.71 0 00-139.9-94.3C629 83.6 571.4 72 512 72c-19.9 0-36-16.1-36-36s16.1-36 36-36c69.1 0 136.2 13.5 199.3 40.3C772.3 66 827 103 874 150c47 47 83.9 101.8 109.7 162.7 26.7 63.1 40.2 130.2 40.2 199.3.1 19.9-16 36-35.9 36z"
      }
    }]
  },
  "name": "loading",
  "theme": "outlined"
};
exports.default = LoadingOutlined;

/***/ }),
/* 109 */
/***/ (function(module, exports) {

function _arrayWithHoles(arr) {
  if (Array.isArray(arr)) return arr;
}

module.exports = _arrayWithHoles;

/***/ }),
/* 110 */
/***/ (function(module, exports) {

function _iterableToArrayLimit(arr, i) {
  if (typeof Symbol === "undefined" || !(Symbol.iterator in Object(arr))) return;
  var _arr = [];
  var _n = true;
  var _d = false;
  var _e = undefined;

  try {
    for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) {
      _arr.push(_s.value);

      if (i && _arr.length === i) break;
    }
  } catch (err) {
    _d = true;
    _e = err;
  } finally {
    try {
      if (!_n && _i["return"] != null) _i["return"]();
    } finally {
      if (_d) throw _e;
    }
  }

  return _arr;
}

module.exports = _iterableToArrayLimit;

/***/ }),
/* 111 */
/***/ (function(module, exports) {

function _nonIterableRest() {
  throw new TypeError("Invalid attempt to destructure non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
}

module.exports = _nonIterableRest;

/***/ }),
/* 112 */
/***/ (function(module, exports) {

function _objectWithoutPropertiesLoose(source, excluded) {
  if (source == null) return {};
  var target = {};
  var sourceKeys = Object.keys(source);
  var key, i;

  for (i = 0; i < sourceKeys.length; i++) {
    key = sourceKeys[i];
    if (excluded.indexOf(key) >= 0) continue;
    target[key] = source[key];
  }

  return target;
}

module.exports = _objectWithoutPropertiesLoose;

/***/ }),
/* 113 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var __importDefault = this && this.__importDefault || function (mod) {
  return mod && mod.__esModule ? mod : {
    "default": mod
  };
};

Object.defineProperty(exports, "__esModule", {
  value: true
});

var tinycolor2_1 = __importDefault(__webpack_require__(114));

var hueStep = 2; // 色相阶梯

var saturationStep = 16; // 饱和度阶梯，浅色部分

var saturationStep2 = 5; // 饱和度阶梯，深色部分

var brightnessStep1 = 5; // 亮度阶梯，浅色部分

var brightnessStep2 = 15; // 亮度阶梯，深色部分

var lightColorCount = 5; // 浅色数量，主色上

var darkColorCount = 4; // 深色数量，主色下

function getHue(hsv, i, light) {
  var hue; // 根据色相不同，色相转向不同

  if (Math.round(hsv.h) >= 60 && Math.round(hsv.h) <= 240) {
    hue = light ? Math.round(hsv.h) - hueStep * i : Math.round(hsv.h) + hueStep * i;
  } else {
    hue = light ? Math.round(hsv.h) + hueStep * i : Math.round(hsv.h) - hueStep * i;
  }

  if (hue < 0) {
    hue += 360;
  } else if (hue >= 360) {
    hue -= 360;
  }

  return hue;
}

function getSaturation(hsv, i, light) {
  // grey color don't change saturation
  if (hsv.h === 0 && hsv.s === 0) {
    return hsv.s;
  }

  var saturation;

  if (light) {
    saturation = Math.round(hsv.s * 100) - saturationStep * i;
  } else if (i === darkColorCount) {
    saturation = Math.round(hsv.s * 100) + saturationStep;
  } else {
    saturation = Math.round(hsv.s * 100) + saturationStep2 * i;
  } // 边界值修正


  if (saturation > 100) {
    saturation = 100;
  } // 第一格的 s 限制在 6-10 之间


  if (light && i === lightColorCount && saturation > 10) {
    saturation = 10;
  }

  if (saturation < 6) {
    saturation = 6;
  }

  return saturation;
}

function getValue(hsv, i, light) {
  if (light) {
    return Math.round(hsv.v * 100) + brightnessStep1 * i;
  }

  return Math.round(hsv.v * 100) - brightnessStep2 * i;
}

function generate(color) {
  var patterns = [];
  var pColor = tinycolor2_1.default(color);

  for (var i = lightColorCount; i > 0; i -= 1) {
    var hsv = pColor.toHsv();
    var colorString = tinycolor2_1.default({
      h: getHue(hsv, i, true),
      s: getSaturation(hsv, i, true),
      v: getValue(hsv, i, true)
    }).toHexString();
    patterns.push(colorString);
  }

  patterns.push(pColor.toHexString());

  for (var i = 1; i <= darkColorCount; i += 1) {
    var hsv = pColor.toHsv();
    var colorString = tinycolor2_1.default({
      h: getHue(hsv, i),
      s: getSaturation(hsv, i),
      v: getValue(hsv, i)
    }).toHexString();
    patterns.push(colorString);
  }

  return patterns;
}

exports.default = generate;

/***/ }),
/* 114 */
/***/ (function(module, exports, __webpack_require__) {

var __WEBPACK_AMD_DEFINE_RESULT__;function _typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }

// TinyColor v1.4.1
// https://github.com/bgrins/TinyColor
// Brian Grinstead, MIT License
(function (Math) {
  var trimLeft = /^\s+/,
      trimRight = /\s+$/,
      tinyCounter = 0,
      mathRound = Math.round,
      mathMin = Math.min,
      mathMax = Math.max,
      mathRandom = Math.random;

  function tinycolor(color, opts) {
    color = color ? color : '';
    opts = opts || {}; // If input is already a tinycolor, return itself

    if (color instanceof tinycolor) {
      return color;
    } // If we are called as a function, call using new instead


    if (!(this instanceof tinycolor)) {
      return new tinycolor(color, opts);
    }

    var rgb = inputToRGB(color);
    this._originalInput = color, this._r = rgb.r, this._g = rgb.g, this._b = rgb.b, this._a = rgb.a, this._roundA = mathRound(100 * this._a) / 100, this._format = opts.format || rgb.format;
    this._gradientType = opts.gradientType; // Don't let the range of [0,255] come back in [0,1].
    // Potentially lose a little bit of precision here, but will fix issues where
    // .5 gets interpreted as half of the total, instead of half of 1
    // If it was supposed to be 128, this was already taken care of by `inputToRgb`

    if (this._r < 1) {
      this._r = mathRound(this._r);
    }

    if (this._g < 1) {
      this._g = mathRound(this._g);
    }

    if (this._b < 1) {
      this._b = mathRound(this._b);
    }

    this._ok = rgb.ok;
    this._tc_id = tinyCounter++;
  }

  tinycolor.prototype = {
    isDark: function isDark() {
      return this.getBrightness() < 128;
    },
    isLight: function isLight() {
      return !this.isDark();
    },
    isValid: function isValid() {
      return this._ok;
    },
    getOriginalInput: function getOriginalInput() {
      return this._originalInput;
    },
    getFormat: function getFormat() {
      return this._format;
    },
    getAlpha: function getAlpha() {
      return this._a;
    },
    getBrightness: function getBrightness() {
      //http://www.w3.org/TR/AERT#color-contrast
      var rgb = this.toRgb();
      return (rgb.r * 299 + rgb.g * 587 + rgb.b * 114) / 1000;
    },
    getLuminance: function getLuminance() {
      //http://www.w3.org/TR/2008/REC-WCAG20-20081211/#relativeluminancedef
      var rgb = this.toRgb();
      var RsRGB, GsRGB, BsRGB, R, G, B;
      RsRGB = rgb.r / 255;
      GsRGB = rgb.g / 255;
      BsRGB = rgb.b / 255;

      if (RsRGB <= 0.03928) {
        R = RsRGB / 12.92;
      } else {
        R = Math.pow((RsRGB + 0.055) / 1.055, 2.4);
      }

      if (GsRGB <= 0.03928) {
        G = GsRGB / 12.92;
      } else {
        G = Math.pow((GsRGB + 0.055) / 1.055, 2.4);
      }

      if (BsRGB <= 0.03928) {
        B = BsRGB / 12.92;
      } else {
        B = Math.pow((BsRGB + 0.055) / 1.055, 2.4);
      }

      return 0.2126 * R + 0.7152 * G + 0.0722 * B;
    },
    setAlpha: function setAlpha(value) {
      this._a = boundAlpha(value);
      this._roundA = mathRound(100 * this._a) / 100;
      return this;
    },
    toHsv: function toHsv() {
      var hsv = rgbToHsv(this._r, this._g, this._b);
      return {
        h: hsv.h * 360,
        s: hsv.s,
        v: hsv.v,
        a: this._a
      };
    },
    toHsvString: function toHsvString() {
      var hsv = rgbToHsv(this._r, this._g, this._b);
      var h = mathRound(hsv.h * 360),
          s = mathRound(hsv.s * 100),
          v = mathRound(hsv.v * 100);
      return this._a == 1 ? "hsv(" + h + ", " + s + "%, " + v + "%)" : "hsva(" + h + ", " + s + "%, " + v + "%, " + this._roundA + ")";
    },
    toHsl: function toHsl() {
      var hsl = rgbToHsl(this._r, this._g, this._b);
      return {
        h: hsl.h * 360,
        s: hsl.s,
        l: hsl.l,
        a: this._a
      };
    },
    toHslString: function toHslString() {
      var hsl = rgbToHsl(this._r, this._g, this._b);
      var h = mathRound(hsl.h * 360),
          s = mathRound(hsl.s * 100),
          l = mathRound(hsl.l * 100);
      return this._a == 1 ? "hsl(" + h + ", " + s + "%, " + l + "%)" : "hsla(" + h + ", " + s + "%, " + l + "%, " + this._roundA + ")";
    },
    toHex: function toHex(allow3Char) {
      return rgbToHex(this._r, this._g, this._b, allow3Char);
    },
    toHexString: function toHexString(allow3Char) {
      return '#' + this.toHex(allow3Char);
    },
    toHex8: function toHex8(allow4Char) {
      return rgbaToHex(this._r, this._g, this._b, this._a, allow4Char);
    },
    toHex8String: function toHex8String(allow4Char) {
      return '#' + this.toHex8(allow4Char);
    },
    toRgb: function toRgb() {
      return {
        r: mathRound(this._r),
        g: mathRound(this._g),
        b: mathRound(this._b),
        a: this._a
      };
    },
    toRgbString: function toRgbString() {
      return this._a == 1 ? "rgb(" + mathRound(this._r) + ", " + mathRound(this._g) + ", " + mathRound(this._b) + ")" : "rgba(" + mathRound(this._r) + ", " + mathRound(this._g) + ", " + mathRound(this._b) + ", " + this._roundA + ")";
    },
    toPercentageRgb: function toPercentageRgb() {
      return {
        r: mathRound(bound01(this._r, 255) * 100) + "%",
        g: mathRound(bound01(this._g, 255) * 100) + "%",
        b: mathRound(bound01(this._b, 255) * 100) + "%",
        a: this._a
      };
    },
    toPercentageRgbString: function toPercentageRgbString() {
      return this._a == 1 ? "rgb(" + mathRound(bound01(this._r, 255) * 100) + "%, " + mathRound(bound01(this._g, 255) * 100) + "%, " + mathRound(bound01(this._b, 255) * 100) + "%)" : "rgba(" + mathRound(bound01(this._r, 255) * 100) + "%, " + mathRound(bound01(this._g, 255) * 100) + "%, " + mathRound(bound01(this._b, 255) * 100) + "%, " + this._roundA + ")";
    },
    toName: function toName() {
      if (this._a === 0) {
        return "transparent";
      }

      if (this._a < 1) {
        return false;
      }

      return hexNames[rgbToHex(this._r, this._g, this._b, true)] || false;
    },
    toFilter: function toFilter(secondColor) {
      var hex8String = '#' + rgbaToArgbHex(this._r, this._g, this._b, this._a);
      var secondHex8String = hex8String;
      var gradientType = this._gradientType ? "GradientType = 1, " : "";

      if (secondColor) {
        var s = tinycolor(secondColor);
        secondHex8String = '#' + rgbaToArgbHex(s._r, s._g, s._b, s._a);
      }

      return "progid:DXImageTransform.Microsoft.gradient(" + gradientType + "startColorstr=" + hex8String + ",endColorstr=" + secondHex8String + ")";
    },
    toString: function toString(format) {
      var formatSet = !!format;
      format = format || this._format;
      var formattedString = false;
      var hasAlpha = this._a < 1 && this._a >= 0;
      var needsAlphaFormat = !formatSet && hasAlpha && (format === "hex" || format === "hex6" || format === "hex3" || format === "hex4" || format === "hex8" || format === "name");

      if (needsAlphaFormat) {
        // Special case for "transparent", all other non-alpha formats
        // will return rgba when there is transparency.
        if (format === "name" && this._a === 0) {
          return this.toName();
        }

        return this.toRgbString();
      }

      if (format === "rgb") {
        formattedString = this.toRgbString();
      }

      if (format === "prgb") {
        formattedString = this.toPercentageRgbString();
      }

      if (format === "hex" || format === "hex6") {
        formattedString = this.toHexString();
      }

      if (format === "hex3") {
        formattedString = this.toHexString(true);
      }

      if (format === "hex4") {
        formattedString = this.toHex8String(true);
      }

      if (format === "hex8") {
        formattedString = this.toHex8String();
      }

      if (format === "name") {
        formattedString = this.toName();
      }

      if (format === "hsl") {
        formattedString = this.toHslString();
      }

      if (format === "hsv") {
        formattedString = this.toHsvString();
      }

      return formattedString || this.toHexString();
    },
    clone: function clone() {
      return tinycolor(this.toString());
    },
    _applyModification: function _applyModification(fn, args) {
      var color = fn.apply(null, [this].concat([].slice.call(args)));
      this._r = color._r;
      this._g = color._g;
      this._b = color._b;
      this.setAlpha(color._a);
      return this;
    },
    lighten: function lighten() {
      return this._applyModification(_lighten, arguments);
    },
    brighten: function brighten() {
      return this._applyModification(_brighten, arguments);
    },
    darken: function darken() {
      return this._applyModification(_darken, arguments);
    },
    desaturate: function desaturate() {
      return this._applyModification(_desaturate, arguments);
    },
    saturate: function saturate() {
      return this._applyModification(_saturate, arguments);
    },
    greyscale: function greyscale() {
      return this._applyModification(_greyscale, arguments);
    },
    spin: function spin() {
      return this._applyModification(_spin, arguments);
    },
    _applyCombination: function _applyCombination(fn, args) {
      return fn.apply(null, [this].concat([].slice.call(args)));
    },
    analogous: function analogous() {
      return this._applyCombination(_analogous, arguments);
    },
    complement: function complement() {
      return this._applyCombination(_complement, arguments);
    },
    monochromatic: function monochromatic() {
      return this._applyCombination(_monochromatic, arguments);
    },
    splitcomplement: function splitcomplement() {
      return this._applyCombination(_splitcomplement, arguments);
    },
    triad: function triad() {
      return this._applyCombination(_triad, arguments);
    },
    tetrad: function tetrad() {
      return this._applyCombination(_tetrad, arguments);
    }
  }; // If input is an object, force 1 into "1.0" to handle ratios properly
  // String input requires "1.0" as input, so 1 will be treated as 1

  tinycolor.fromRatio = function (color, opts) {
    if (_typeof(color) == "object") {
      var newColor = {};

      for (var i in color) {
        if (color.hasOwnProperty(i)) {
          if (i === "a") {
            newColor[i] = color[i];
          } else {
            newColor[i] = convertToPercentage(color[i]);
          }
        }
      }

      color = newColor;
    }

    return tinycolor(color, opts);
  }; // Given a string or object, convert that input to RGB
  // Possible string inputs:
  //
  //     "red"
  //     "#f00" or "f00"
  //     "#ff0000" or "ff0000"
  //     "#ff000000" or "ff000000"
  //     "rgb 255 0 0" or "rgb (255, 0, 0)"
  //     "rgb 1.0 0 0" or "rgb (1, 0, 0)"
  //     "rgba (255, 0, 0, 1)" or "rgba 255, 0, 0, 1"
  //     "rgba (1.0, 0, 0, 1)" or "rgba 1.0, 0, 0, 1"
  //     "hsl(0, 100%, 50%)" or "hsl 0 100% 50%"
  //     "hsla(0, 100%, 50%, 1)" or "hsla 0 100% 50%, 1"
  //     "hsv(0, 100%, 100%)" or "hsv 0 100% 100%"
  //


  function inputToRGB(color) {
    var rgb = {
      r: 0,
      g: 0,
      b: 0
    };
    var a = 1;
    var s = null;
    var v = null;
    var l = null;
    var ok = false;
    var format = false;

    if (typeof color == "string") {
      color = stringInputToObject(color);
    }

    if (_typeof(color) == "object") {
      if (isValidCSSUnit(color.r) && isValidCSSUnit(color.g) && isValidCSSUnit(color.b)) {
        rgb = rgbToRgb(color.r, color.g, color.b);
        ok = true;
        format = String(color.r).substr(-1) === "%" ? "prgb" : "rgb";
      } else if (isValidCSSUnit(color.h) && isValidCSSUnit(color.s) && isValidCSSUnit(color.v)) {
        s = convertToPercentage(color.s);
        v = convertToPercentage(color.v);
        rgb = hsvToRgb(color.h, s, v);
        ok = true;
        format = "hsv";
      } else if (isValidCSSUnit(color.h) && isValidCSSUnit(color.s) && isValidCSSUnit(color.l)) {
        s = convertToPercentage(color.s);
        l = convertToPercentage(color.l);
        rgb = hslToRgb(color.h, s, l);
        ok = true;
        format = "hsl";
      }

      if (color.hasOwnProperty("a")) {
        a = color.a;
      }
    }

    a = boundAlpha(a);
    return {
      ok: ok,
      format: color.format || format,
      r: mathMin(255, mathMax(rgb.r, 0)),
      g: mathMin(255, mathMax(rgb.g, 0)),
      b: mathMin(255, mathMax(rgb.b, 0)),
      a: a
    };
  } // Conversion Functions
  // --------------------
  // `rgbToHsl`, `rgbToHsv`, `hslToRgb`, `hsvToRgb` modified from:
  // <http://mjijackson.com/2008/02/rgb-to-hsl-and-rgb-to-hsv-color-model-conversion-algorithms-in-javascript>
  // `rgbToRgb`
  // Handle bounds / percentage checking to conform to CSS color spec
  // <http://www.w3.org/TR/css3-color/>
  // *Assumes:* r, g, b in [0, 255] or [0, 1]
  // *Returns:* { r, g, b } in [0, 255]


  function rgbToRgb(r, g, b) {
    return {
      r: bound01(r, 255) * 255,
      g: bound01(g, 255) * 255,
      b: bound01(b, 255) * 255
    };
  } // `rgbToHsl`
  // Converts an RGB color value to HSL.
  // *Assumes:* r, g, and b are contained in [0, 255] or [0, 1]
  // *Returns:* { h, s, l } in [0,1]


  function rgbToHsl(r, g, b) {
    r = bound01(r, 255);
    g = bound01(g, 255);
    b = bound01(b, 255);
    var max = mathMax(r, g, b),
        min = mathMin(r, g, b);
    var h,
        s,
        l = (max + min) / 2;

    if (max == min) {
      h = s = 0; // achromatic
    } else {
      var d = max - min;
      s = l > 0.5 ? d / (2 - max - min) : d / (max + min);

      switch (max) {
        case r:
          h = (g - b) / d + (g < b ? 6 : 0);
          break;

        case g:
          h = (b - r) / d + 2;
          break;

        case b:
          h = (r - g) / d + 4;
          break;
      }

      h /= 6;
    }

    return {
      h: h,
      s: s,
      l: l
    };
  } // `hslToRgb`
  // Converts an HSL color value to RGB.
  // *Assumes:* h is contained in [0, 1] or [0, 360] and s and l are contained [0, 1] or [0, 100]
  // *Returns:* { r, g, b } in the set [0, 255]


  function hslToRgb(h, s, l) {
    var r, g, b;
    h = bound01(h, 360);
    s = bound01(s, 100);
    l = bound01(l, 100);

    function hue2rgb(p, q, t) {
      if (t < 0) t += 1;
      if (t > 1) t -= 1;
      if (t < 1 / 6) return p + (q - p) * 6 * t;
      if (t < 1 / 2) return q;
      if (t < 2 / 3) return p + (q - p) * (2 / 3 - t) * 6;
      return p;
    }

    if (s === 0) {
      r = g = b = l; // achromatic
    } else {
      var q = l < 0.5 ? l * (1 + s) : l + s - l * s;
      var p = 2 * l - q;
      r = hue2rgb(p, q, h + 1 / 3);
      g = hue2rgb(p, q, h);
      b = hue2rgb(p, q, h - 1 / 3);
    }

    return {
      r: r * 255,
      g: g * 255,
      b: b * 255
    };
  } // `rgbToHsv`
  // Converts an RGB color value to HSV
  // *Assumes:* r, g, and b are contained in the set [0, 255] or [0, 1]
  // *Returns:* { h, s, v } in [0,1]


  function rgbToHsv(r, g, b) {
    r = bound01(r, 255);
    g = bound01(g, 255);
    b = bound01(b, 255);
    var max = mathMax(r, g, b),
        min = mathMin(r, g, b);
    var h,
        s,
        v = max;
    var d = max - min;
    s = max === 0 ? 0 : d / max;

    if (max == min) {
      h = 0; // achromatic
    } else {
      switch (max) {
        case r:
          h = (g - b) / d + (g < b ? 6 : 0);
          break;

        case g:
          h = (b - r) / d + 2;
          break;

        case b:
          h = (r - g) / d + 4;
          break;
      }

      h /= 6;
    }

    return {
      h: h,
      s: s,
      v: v
    };
  } // `hsvToRgb`
  // Converts an HSV color value to RGB.
  // *Assumes:* h is contained in [0, 1] or [0, 360] and s and v are contained in [0, 1] or [0, 100]
  // *Returns:* { r, g, b } in the set [0, 255]


  function hsvToRgb(h, s, v) {
    h = bound01(h, 360) * 6;
    s = bound01(s, 100);
    v = bound01(v, 100);
    var i = Math.floor(h),
        f = h - i,
        p = v * (1 - s),
        q = v * (1 - f * s),
        t = v * (1 - (1 - f) * s),
        mod = i % 6,
        r = [v, q, p, p, t, v][mod],
        g = [t, v, v, q, p, p][mod],
        b = [p, p, t, v, v, q][mod];
    return {
      r: r * 255,
      g: g * 255,
      b: b * 255
    };
  } // `rgbToHex`
  // Converts an RGB color to hex
  // Assumes r, g, and b are contained in the set [0, 255]
  // Returns a 3 or 6 character hex


  function rgbToHex(r, g, b, allow3Char) {
    var hex = [pad2(mathRound(r).toString(16)), pad2(mathRound(g).toString(16)), pad2(mathRound(b).toString(16))]; // Return a 3 character hex if possible

    if (allow3Char && hex[0].charAt(0) == hex[0].charAt(1) && hex[1].charAt(0) == hex[1].charAt(1) && hex[2].charAt(0) == hex[2].charAt(1)) {
      return hex[0].charAt(0) + hex[1].charAt(0) + hex[2].charAt(0);
    }

    return hex.join("");
  } // `rgbaToHex`
  // Converts an RGBA color plus alpha transparency to hex
  // Assumes r, g, b are contained in the set [0, 255] and
  // a in [0, 1]. Returns a 4 or 8 character rgba hex


  function rgbaToHex(r, g, b, a, allow4Char) {
    var hex = [pad2(mathRound(r).toString(16)), pad2(mathRound(g).toString(16)), pad2(mathRound(b).toString(16)), pad2(convertDecimalToHex(a))]; // Return a 4 character hex if possible

    if (allow4Char && hex[0].charAt(0) == hex[0].charAt(1) && hex[1].charAt(0) == hex[1].charAt(1) && hex[2].charAt(0) == hex[2].charAt(1) && hex[3].charAt(0) == hex[3].charAt(1)) {
      return hex[0].charAt(0) + hex[1].charAt(0) + hex[2].charAt(0) + hex[3].charAt(0);
    }

    return hex.join("");
  } // `rgbaToArgbHex`
  // Converts an RGBA color to an ARGB Hex8 string
  // Rarely used, but required for "toFilter()"


  function rgbaToArgbHex(r, g, b, a) {
    var hex = [pad2(convertDecimalToHex(a)), pad2(mathRound(r).toString(16)), pad2(mathRound(g).toString(16)), pad2(mathRound(b).toString(16))];
    return hex.join("");
  } // `equals`
  // Can be called with any tinycolor input


  tinycolor.equals = function (color1, color2) {
    if (!color1 || !color2) {
      return false;
    }

    return tinycolor(color1).toRgbString() == tinycolor(color2).toRgbString();
  };

  tinycolor.random = function () {
    return tinycolor.fromRatio({
      r: mathRandom(),
      g: mathRandom(),
      b: mathRandom()
    });
  }; // Modification Functions
  // ----------------------
  // Thanks to less.js for some of the basics here
  // <https://github.com/cloudhead/less.js/blob/master/lib/less/functions.js>


  function _desaturate(color, amount) {
    amount = amount === 0 ? 0 : amount || 10;
    var hsl = tinycolor(color).toHsl();
    hsl.s -= amount / 100;
    hsl.s = clamp01(hsl.s);
    return tinycolor(hsl);
  }

  function _saturate(color, amount) {
    amount = amount === 0 ? 0 : amount || 10;
    var hsl = tinycolor(color).toHsl();
    hsl.s += amount / 100;
    hsl.s = clamp01(hsl.s);
    return tinycolor(hsl);
  }

  function _greyscale(color) {
    return tinycolor(color).desaturate(100);
  }

  function _lighten(color, amount) {
    amount = amount === 0 ? 0 : amount || 10;
    var hsl = tinycolor(color).toHsl();
    hsl.l += amount / 100;
    hsl.l = clamp01(hsl.l);
    return tinycolor(hsl);
  }

  function _brighten(color, amount) {
    amount = amount === 0 ? 0 : amount || 10;
    var rgb = tinycolor(color).toRgb();
    rgb.r = mathMax(0, mathMin(255, rgb.r - mathRound(255 * -(amount / 100))));
    rgb.g = mathMax(0, mathMin(255, rgb.g - mathRound(255 * -(amount / 100))));
    rgb.b = mathMax(0, mathMin(255, rgb.b - mathRound(255 * -(amount / 100))));
    return tinycolor(rgb);
  }

  function _darken(color, amount) {
    amount = amount === 0 ? 0 : amount || 10;
    var hsl = tinycolor(color).toHsl();
    hsl.l -= amount / 100;
    hsl.l = clamp01(hsl.l);
    return tinycolor(hsl);
  } // Spin takes a positive or negative amount within [-360, 360] indicating the change of hue.
  // Values outside of this range will be wrapped into this range.


  function _spin(color, amount) {
    var hsl = tinycolor(color).toHsl();
    var hue = (hsl.h + amount) % 360;
    hsl.h = hue < 0 ? 360 + hue : hue;
    return tinycolor(hsl);
  } // Combination Functions
  // ---------------------
  // Thanks to jQuery xColor for some of the ideas behind these
  // <https://github.com/infusion/jQuery-xcolor/blob/master/jquery.xcolor.js>


  function _complement(color) {
    var hsl = tinycolor(color).toHsl();
    hsl.h = (hsl.h + 180) % 360;
    return tinycolor(hsl);
  }

  function _triad(color) {
    var hsl = tinycolor(color).toHsl();
    var h = hsl.h;
    return [tinycolor(color), tinycolor({
      h: (h + 120) % 360,
      s: hsl.s,
      l: hsl.l
    }), tinycolor({
      h: (h + 240) % 360,
      s: hsl.s,
      l: hsl.l
    })];
  }

  function _tetrad(color) {
    var hsl = tinycolor(color).toHsl();
    var h = hsl.h;
    return [tinycolor(color), tinycolor({
      h: (h + 90) % 360,
      s: hsl.s,
      l: hsl.l
    }), tinycolor({
      h: (h + 180) % 360,
      s: hsl.s,
      l: hsl.l
    }), tinycolor({
      h: (h + 270) % 360,
      s: hsl.s,
      l: hsl.l
    })];
  }

  function _splitcomplement(color) {
    var hsl = tinycolor(color).toHsl();
    var h = hsl.h;
    return [tinycolor(color), tinycolor({
      h: (h + 72) % 360,
      s: hsl.s,
      l: hsl.l
    }), tinycolor({
      h: (h + 216) % 360,
      s: hsl.s,
      l: hsl.l
    })];
  }

  function _analogous(color, results, slices) {
    results = results || 6;
    slices = slices || 30;
    var hsl = tinycolor(color).toHsl();
    var part = 360 / slices;
    var ret = [tinycolor(color)];

    for (hsl.h = (hsl.h - (part * results >> 1) + 720) % 360; --results;) {
      hsl.h = (hsl.h + part) % 360;
      ret.push(tinycolor(hsl));
    }

    return ret;
  }

  function _monochromatic(color, results) {
    results = results || 6;
    var hsv = tinycolor(color).toHsv();
    var h = hsv.h,
        s = hsv.s,
        v = hsv.v;
    var ret = [];
    var modification = 1 / results;

    while (results--) {
      ret.push(tinycolor({
        h: h,
        s: s,
        v: v
      }));
      v = (v + modification) % 1;
    }

    return ret;
  } // Utility Functions
  // ---------------------


  tinycolor.mix = function (color1, color2, amount) {
    amount = amount === 0 ? 0 : amount || 50;
    var rgb1 = tinycolor(color1).toRgb();
    var rgb2 = tinycolor(color2).toRgb();
    var p = amount / 100;
    var rgba = {
      r: (rgb2.r - rgb1.r) * p + rgb1.r,
      g: (rgb2.g - rgb1.g) * p + rgb1.g,
      b: (rgb2.b - rgb1.b) * p + rgb1.b,
      a: (rgb2.a - rgb1.a) * p + rgb1.a
    };
    return tinycolor(rgba);
  }; // Readability Functions
  // ---------------------
  // <http://www.w3.org/TR/2008/REC-WCAG20-20081211/#contrast-ratiodef (WCAG Version 2)
  // `contrast`
  // Analyze the 2 colors and returns the color contrast defined by (WCAG Version 2)


  tinycolor.readability = function (color1, color2) {
    var c1 = tinycolor(color1);
    var c2 = tinycolor(color2);
    return (Math.max(c1.getLuminance(), c2.getLuminance()) + 0.05) / (Math.min(c1.getLuminance(), c2.getLuminance()) + 0.05);
  }; // `isReadable`
  // Ensure that foreground and background color combinations meet WCAG2 guidelines.
  // The third argument is an optional Object.
  //      the 'level' property states 'AA' or 'AAA' - if missing or invalid, it defaults to 'AA';
  //      the 'size' property states 'large' or 'small' - if missing or invalid, it defaults to 'small'.
  // If the entire object is absent, isReadable defaults to {level:"AA",size:"small"}.
  // *Example*
  //    tinycolor.isReadable("#000", "#111") => false
  //    tinycolor.isReadable("#000", "#111",{level:"AA",size:"large"}) => false


  tinycolor.isReadable = function (color1, color2, wcag2) {
    var readability = tinycolor.readability(color1, color2);
    var wcag2Parms, out;
    out = false;
    wcag2Parms = validateWCAG2Parms(wcag2);

    switch (wcag2Parms.level + wcag2Parms.size) {
      case "AAsmall":
      case "AAAlarge":
        out = readability >= 4.5;
        break;

      case "AAlarge":
        out = readability >= 3;
        break;

      case "AAAsmall":
        out = readability >= 7;
        break;
    }

    return out;
  }; // `mostReadable`
  // Given a base color and a list of possible foreground or background
  // colors for that base, returns the most readable color.
  // Optionally returns Black or White if the most readable color is unreadable.
  // *Example*
  //    tinycolor.mostReadable(tinycolor.mostReadable("#123", ["#124", "#125"],{includeFallbackColors:false}).toHexString(); // "#112255"
  //    tinycolor.mostReadable(tinycolor.mostReadable("#123", ["#124", "#125"],{includeFallbackColors:true}).toHexString();  // "#ffffff"
  //    tinycolor.mostReadable("#a8015a", ["#faf3f3"],{includeFallbackColors:true,level:"AAA",size:"large"}).toHexString(); // "#faf3f3"
  //    tinycolor.mostReadable("#a8015a", ["#faf3f3"],{includeFallbackColors:true,level:"AAA",size:"small"}).toHexString(); // "#ffffff"


  tinycolor.mostReadable = function (baseColor, colorList, args) {
    var bestColor = null;
    var bestScore = 0;
    var readability;
    var includeFallbackColors, level, size;
    args = args || {};
    includeFallbackColors = args.includeFallbackColors;
    level = args.level;
    size = args.size;

    for (var i = 0; i < colorList.length; i++) {
      readability = tinycolor.readability(baseColor, colorList[i]);

      if (readability > bestScore) {
        bestScore = readability;
        bestColor = tinycolor(colorList[i]);
      }
    }

    if (tinycolor.isReadable(baseColor, bestColor, {
      "level": level,
      "size": size
    }) || !includeFallbackColors) {
      return bestColor;
    } else {
      args.includeFallbackColors = false;
      return tinycolor.mostReadable(baseColor, ["#fff", "#000"], args);
    }
  }; // Big List of Colors
  // ------------------
  // <http://www.w3.org/TR/css3-color/#svg-color>


  var names = tinycolor.names = {
    aliceblue: "f0f8ff",
    antiquewhite: "faebd7",
    aqua: "0ff",
    aquamarine: "7fffd4",
    azure: "f0ffff",
    beige: "f5f5dc",
    bisque: "ffe4c4",
    black: "000",
    blanchedalmond: "ffebcd",
    blue: "00f",
    blueviolet: "8a2be2",
    brown: "a52a2a",
    burlywood: "deb887",
    burntsienna: "ea7e5d",
    cadetblue: "5f9ea0",
    chartreuse: "7fff00",
    chocolate: "d2691e",
    coral: "ff7f50",
    cornflowerblue: "6495ed",
    cornsilk: "fff8dc",
    crimson: "dc143c",
    cyan: "0ff",
    darkblue: "00008b",
    darkcyan: "008b8b",
    darkgoldenrod: "b8860b",
    darkgray: "a9a9a9",
    darkgreen: "006400",
    darkgrey: "a9a9a9",
    darkkhaki: "bdb76b",
    darkmagenta: "8b008b",
    darkolivegreen: "556b2f",
    darkorange: "ff8c00",
    darkorchid: "9932cc",
    darkred: "8b0000",
    darksalmon: "e9967a",
    darkseagreen: "8fbc8f",
    darkslateblue: "483d8b",
    darkslategray: "2f4f4f",
    darkslategrey: "2f4f4f",
    darkturquoise: "00ced1",
    darkviolet: "9400d3",
    deeppink: "ff1493",
    deepskyblue: "00bfff",
    dimgray: "696969",
    dimgrey: "696969",
    dodgerblue: "1e90ff",
    firebrick: "b22222",
    floralwhite: "fffaf0",
    forestgreen: "228b22",
    fuchsia: "f0f",
    gainsboro: "dcdcdc",
    ghostwhite: "f8f8ff",
    gold: "ffd700",
    goldenrod: "daa520",
    gray: "808080",
    green: "008000",
    greenyellow: "adff2f",
    grey: "808080",
    honeydew: "f0fff0",
    hotpink: "ff69b4",
    indianred: "cd5c5c",
    indigo: "4b0082",
    ivory: "fffff0",
    khaki: "f0e68c",
    lavender: "e6e6fa",
    lavenderblush: "fff0f5",
    lawngreen: "7cfc00",
    lemonchiffon: "fffacd",
    lightblue: "add8e6",
    lightcoral: "f08080",
    lightcyan: "e0ffff",
    lightgoldenrodyellow: "fafad2",
    lightgray: "d3d3d3",
    lightgreen: "90ee90",
    lightgrey: "d3d3d3",
    lightpink: "ffb6c1",
    lightsalmon: "ffa07a",
    lightseagreen: "20b2aa",
    lightskyblue: "87cefa",
    lightslategray: "789",
    lightslategrey: "789",
    lightsteelblue: "b0c4de",
    lightyellow: "ffffe0",
    lime: "0f0",
    limegreen: "32cd32",
    linen: "faf0e6",
    magenta: "f0f",
    maroon: "800000",
    mediumaquamarine: "66cdaa",
    mediumblue: "0000cd",
    mediumorchid: "ba55d3",
    mediumpurple: "9370db",
    mediumseagreen: "3cb371",
    mediumslateblue: "7b68ee",
    mediumspringgreen: "00fa9a",
    mediumturquoise: "48d1cc",
    mediumvioletred: "c71585",
    midnightblue: "191970",
    mintcream: "f5fffa",
    mistyrose: "ffe4e1",
    moccasin: "ffe4b5",
    navajowhite: "ffdead",
    navy: "000080",
    oldlace: "fdf5e6",
    olive: "808000",
    olivedrab: "6b8e23",
    orange: "ffa500",
    orangered: "ff4500",
    orchid: "da70d6",
    palegoldenrod: "eee8aa",
    palegreen: "98fb98",
    paleturquoise: "afeeee",
    palevioletred: "db7093",
    papayawhip: "ffefd5",
    peachpuff: "ffdab9",
    peru: "cd853f",
    pink: "ffc0cb",
    plum: "dda0dd",
    powderblue: "b0e0e6",
    purple: "800080",
    rebeccapurple: "663399",
    red: "f00",
    rosybrown: "bc8f8f",
    royalblue: "4169e1",
    saddlebrown: "8b4513",
    salmon: "fa8072",
    sandybrown: "f4a460",
    seagreen: "2e8b57",
    seashell: "fff5ee",
    sienna: "a0522d",
    silver: "c0c0c0",
    skyblue: "87ceeb",
    slateblue: "6a5acd",
    slategray: "708090",
    slategrey: "708090",
    snow: "fffafa",
    springgreen: "00ff7f",
    steelblue: "4682b4",
    tan: "d2b48c",
    teal: "008080",
    thistle: "d8bfd8",
    tomato: "ff6347",
    turquoise: "40e0d0",
    violet: "ee82ee",
    wheat: "f5deb3",
    white: "fff",
    whitesmoke: "f5f5f5",
    yellow: "ff0",
    yellowgreen: "9acd32"
  }; // Make it easy to access colors via `hexNames[hex]`

  var hexNames = tinycolor.hexNames = flip(names); // Utilities
  // ---------
  // `{ 'name1': 'val1' }` becomes `{ 'val1': 'name1' }`

  function flip(o) {
    var flipped = {};

    for (var i in o) {
      if (o.hasOwnProperty(i)) {
        flipped[o[i]] = i;
      }
    }

    return flipped;
  } // Return a valid alpha value [0,1] with all invalid values being set to 1


  function boundAlpha(a) {
    a = parseFloat(a);

    if (isNaN(a) || a < 0 || a > 1) {
      a = 1;
    }

    return a;
  } // Take input from [0, n] and return it as [0, 1]


  function bound01(n, max) {
    if (isOnePointZero(n)) {
      n = "100%";
    }

    var processPercent = isPercentage(n);
    n = mathMin(max, mathMax(0, parseFloat(n))); // Automatically convert percentage into number

    if (processPercent) {
      n = parseInt(n * max, 10) / 100;
    } // Handle floating point rounding errors


    if (Math.abs(n - max) < 0.000001) {
      return 1;
    } // Convert into [0, 1] range if it isn't already


    return n % max / parseFloat(max);
  } // Force a number between 0 and 1


  function clamp01(val) {
    return mathMin(1, mathMax(0, val));
  } // Parse a base-16 hex value into a base-10 integer


  function parseIntFromHex(val) {
    return parseInt(val, 16);
  } // Need to handle 1.0 as 100%, since once it is a number, there is no difference between it and 1
  // <http://stackoverflow.com/questions/7422072/javascript-how-to-detect-number-as-a-decimal-including-1-0>


  function isOnePointZero(n) {
    return typeof n == "string" && n.indexOf('.') != -1 && parseFloat(n) === 1;
  } // Check to see if string passed in is a percentage


  function isPercentage(n) {
    return typeof n === "string" && n.indexOf('%') != -1;
  } // Force a hex value to have 2 characters


  function pad2(c) {
    return c.length == 1 ? '0' + c : '' + c;
  } // Replace a decimal with it's percentage value


  function convertToPercentage(n) {
    if (n <= 1) {
      n = n * 100 + "%";
    }

    return n;
  } // Converts a decimal to a hex value


  function convertDecimalToHex(d) {
    return Math.round(parseFloat(d) * 255).toString(16);
  } // Converts a hex value to a decimal


  function convertHexToDecimal(h) {
    return parseIntFromHex(h) / 255;
  }

  var matchers = function () {
    // <http://www.w3.org/TR/css3-values/#integers>
    var CSS_INTEGER = "[-\\+]?\\d+%?"; // <http://www.w3.org/TR/css3-values/#number-value>

    var CSS_NUMBER = "[-\\+]?\\d*\\.\\d+%?"; // Allow positive/negative integer/number.  Don't capture the either/or, just the entire outcome.

    var CSS_UNIT = "(?:" + CSS_NUMBER + ")|(?:" + CSS_INTEGER + ")"; // Actual matching.
    // Parentheses and commas are optional, but not required.
    // Whitespace can take the place of commas or opening paren

    var PERMISSIVE_MATCH3 = "[\\s|\\(]+(" + CSS_UNIT + ")[,|\\s]+(" + CSS_UNIT + ")[,|\\s]+(" + CSS_UNIT + ")\\s*\\)?";
    var PERMISSIVE_MATCH4 = "[\\s|\\(]+(" + CSS_UNIT + ")[,|\\s]+(" + CSS_UNIT + ")[,|\\s]+(" + CSS_UNIT + ")[,|\\s]+(" + CSS_UNIT + ")\\s*\\)?";
    return {
      CSS_UNIT: new RegExp(CSS_UNIT),
      rgb: new RegExp("rgb" + PERMISSIVE_MATCH3),
      rgba: new RegExp("rgba" + PERMISSIVE_MATCH4),
      hsl: new RegExp("hsl" + PERMISSIVE_MATCH3),
      hsla: new RegExp("hsla" + PERMISSIVE_MATCH4),
      hsv: new RegExp("hsv" + PERMISSIVE_MATCH3),
      hsva: new RegExp("hsva" + PERMISSIVE_MATCH4),
      hex3: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/,
      hex6: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/,
      hex4: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/,
      hex8: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/
    };
  }(); // `isValidCSSUnit`
  // Take in a single string / number and check to see if it looks like a CSS unit
  // (see `matchers` above for definition).


  function isValidCSSUnit(color) {
    return !!matchers.CSS_UNIT.exec(color);
  } // `stringInputToObject`
  // Permissive string parsing.  Take in a number of formats, and output an object
  // based on detected format.  Returns `{ r, g, b }` or `{ h, s, l }` or `{ h, s, v}`


  function stringInputToObject(color) {
    color = color.replace(trimLeft, '').replace(trimRight, '').toLowerCase();
    var named = false;

    if (names[color]) {
      color = names[color];
      named = true;
    } else if (color == 'transparent') {
      return {
        r: 0,
        g: 0,
        b: 0,
        a: 0,
        format: "name"
      };
    } // Try to match string input using regular expressions.
    // Keep most of the number bounding out of this function - don't worry about [0,1] or [0,100] or [0,360]
    // Just return an object and let the conversion functions handle that.
    // This way the result will be the same whether the tinycolor is initialized with string or object.


    var match;

    if (match = matchers.rgb.exec(color)) {
      return {
        r: match[1],
        g: match[2],
        b: match[3]
      };
    }

    if (match = matchers.rgba.exec(color)) {
      return {
        r: match[1],
        g: match[2],
        b: match[3],
        a: match[4]
      };
    }

    if (match = matchers.hsl.exec(color)) {
      return {
        h: match[1],
        s: match[2],
        l: match[3]
      };
    }

    if (match = matchers.hsla.exec(color)) {
      return {
        h: match[1],
        s: match[2],
        l: match[3],
        a: match[4]
      };
    }

    if (match = matchers.hsv.exec(color)) {
      return {
        h: match[1],
        s: match[2],
        v: match[3]
      };
    }

    if (match = matchers.hsva.exec(color)) {
      return {
        h: match[1],
        s: match[2],
        v: match[3],
        a: match[4]
      };
    }

    if (match = matchers.hex8.exec(color)) {
      return {
        r: parseIntFromHex(match[1]),
        g: parseIntFromHex(match[2]),
        b: parseIntFromHex(match[3]),
        a: convertHexToDecimal(match[4]),
        format: named ? "name" : "hex8"
      };
    }

    if (match = matchers.hex6.exec(color)) {
      return {
        r: parseIntFromHex(match[1]),
        g: parseIntFromHex(match[2]),
        b: parseIntFromHex(match[3]),
        format: named ? "name" : "hex"
      };
    }

    if (match = matchers.hex4.exec(color)) {
      return {
        r: parseIntFromHex(match[1] + '' + match[1]),
        g: parseIntFromHex(match[2] + '' + match[2]),
        b: parseIntFromHex(match[3] + '' + match[3]),
        a: convertHexToDecimal(match[4] + '' + match[4]),
        format: named ? "name" : "hex8"
      };
    }

    if (match = matchers.hex3.exec(color)) {
      return {
        r: parseIntFromHex(match[1] + '' + match[1]),
        g: parseIntFromHex(match[2] + '' + match[2]),
        b: parseIntFromHex(match[3] + '' + match[3]),
        format: named ? "name" : "hex"
      };
    }

    return false;
  }

  function validateWCAG2Parms(parms) {
    // return valid WCAG2 parms for isReadable.
    // If input parms are invalid, return {"level":"AA", "size":"small"}
    var level, size;
    parms = parms || {
      "level": "AA",
      "size": "small"
    };
    level = (parms.level || "AA").toUpperCase();
    size = (parms.size || "small").toLowerCase();

    if (level !== "AA" && level !== "AAA") {
      level = "AA";
    }

    if (size !== "small" && size !== "large") {
      size = "small";
    }

    return {
      "level": level,
      "size": size
    };
  } // Node: Export function


  if ( true && module.exports) {
    module.exports = tinycolor;
  } // AMD/requirejs: Define the module
  else if (true) {
      !(__WEBPACK_AMD_DEFINE_RESULT__ = (function () {
        return tinycolor;
      }).call(exports, __webpack_require__, exports, module),
				__WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__));
    } // Browser: Expose to window
    else {}
})(Math);

/***/ }),
/* 115 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.setTwoToneColor = setTwoToneColor;
exports.getTwoToneColor = getTwoToneColor;

var _slicedToArray2 = _interopRequireDefault(__webpack_require__(24));

var _IconBase = _interopRequireDefault(__webpack_require__(69));

var _utils = __webpack_require__(49);

function setTwoToneColor(twoToneColor) {
  var _normalizeTwoToneColo = (0, _utils.normalizeTwoToneColors)(twoToneColor),
      _normalizeTwoToneColo2 = (0, _slicedToArray2.default)(_normalizeTwoToneColo, 2),
      primaryColor = _normalizeTwoToneColo2[0],
      secondaryColor = _normalizeTwoToneColo2[1];

  return _IconBase.default.setTwoToneColors({
    primaryColor: primaryColor,
    secondaryColor: secondaryColor
  });
}

function getTwoToneColor() {
  var colors = _IconBase.default.getTwoToneColors();

  if (!colors.calculated) {
    return colors.primaryColor;
  }

  return [colors.primaryColor, colors.secondaryColor];
}

/***/ }),
/* 116 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var _ExclamationCircleFilled = _interopRequireDefault(__webpack_require__(117));

function _interopRequireDefault(obj) {
  return obj && obj.__esModule ? obj : {
    'default': obj
  };
}

var _default = _ExclamationCircleFilled;
exports.default = _default;
module.exports = _default;

/***/ }),
/* 117 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireDefault = __webpack_require__(4);

var _interopRequireWildcard = __webpack_require__(7);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var React = _interopRequireWildcard(__webpack_require__(0));

var _ExclamationCircleFilled = _interopRequireDefault(__webpack_require__(118));

var _AntdIcon = _interopRequireDefault(__webpack_require__(18)); // GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY


var ExclamationCircleFilled = function ExclamationCircleFilled(props, ref) {
  return React.createElement(_AntdIcon.default, Object.assign({}, props, {
    ref: ref,
    icon: _ExclamationCircleFilled.default
  }));
};

ExclamationCircleFilled.displayName = 'ExclamationCircleFilled';

var _default = React.forwardRef(ExclamationCircleFilled);

exports.default = _default;

/***/ }),
/* 118 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
 // This icon file is generated automatically.

Object.defineProperty(exports, "__esModule", {
  value: true
});
var ExclamationCircleFilled = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "64 64 896 896",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M512 64C264.6 64 64 264.6 64 512s200.6 448 448 448 448-200.6 448-448S759.4 64 512 64zm-32 232c0-4.4 3.6-8 8-8h48c4.4 0 8 3.6 8 8v272c0 4.4-3.6 8-8 8h-48c-4.4 0-8-3.6-8-8V296zm32 440a48.01 48.01 0 010-96 48.01 48.01 0 010 96z"
      }
    }]
  },
  "name": "exclamation-circle",
  "theme": "filled"
};
exports.default = ExclamationCircleFilled;

/***/ }),
/* 119 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var _CloseCircleFilled = _interopRequireDefault(__webpack_require__(120));

function _interopRequireDefault(obj) {
  return obj && obj.__esModule ? obj : {
    'default': obj
  };
}

var _default = _CloseCircleFilled;
exports.default = _default;
module.exports = _default;

/***/ }),
/* 120 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireDefault = __webpack_require__(4);

var _interopRequireWildcard = __webpack_require__(7);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var React = _interopRequireWildcard(__webpack_require__(0));

var _CloseCircleFilled = _interopRequireDefault(__webpack_require__(121));

var _AntdIcon = _interopRequireDefault(__webpack_require__(18)); // GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY


var CloseCircleFilled = function CloseCircleFilled(props, ref) {
  return React.createElement(_AntdIcon.default, Object.assign({}, props, {
    ref: ref,
    icon: _CloseCircleFilled.default
  }));
};

CloseCircleFilled.displayName = 'CloseCircleFilled';

var _default = React.forwardRef(CloseCircleFilled);

exports.default = _default;

/***/ }),
/* 121 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
 // This icon file is generated automatically.

Object.defineProperty(exports, "__esModule", {
  value: true
});
var CloseCircleFilled = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "64 64 896 896",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M512 64C264.6 64 64 264.6 64 512s200.6 448 448 448 448-200.6 448-448S759.4 64 512 64zm165.4 618.2l-66-.3L512 563.4l-99.3 118.4-66.1.3c-4.4 0-8-3.5-8-8 0-1.9.7-3.7 1.9-5.2l130.1-155L340.5 359a8.32 8.32 0 01-1.9-5.2c0-4.4 3.6-8 8-8l66.1.3L512 464.6l99.3-118.4 66-.3c4.4 0 8 3.5 8 8 0 1.9-.7 3.7-1.9 5.2L553.5 514l130 155c1.2 1.5 1.9 3.3 1.9 5.2 0 4.4-3.6 8-8 8z"
      }
    }]
  },
  "name": "close-circle",
  "theme": "filled"
};
exports.default = CloseCircleFilled;

/***/ }),
/* 122 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var _CheckCircleFilled = _interopRequireDefault(__webpack_require__(123));

function _interopRequireDefault(obj) {
  return obj && obj.__esModule ? obj : {
    'default': obj
  };
}

var _default = _CheckCircleFilled;
exports.default = _default;
module.exports = _default;

/***/ }),
/* 123 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireDefault = __webpack_require__(4);

var _interopRequireWildcard = __webpack_require__(7);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var React = _interopRequireWildcard(__webpack_require__(0));

var _CheckCircleFilled = _interopRequireDefault(__webpack_require__(124));

var _AntdIcon = _interopRequireDefault(__webpack_require__(18)); // GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY


var CheckCircleFilled = function CheckCircleFilled(props, ref) {
  return React.createElement(_AntdIcon.default, Object.assign({}, props, {
    ref: ref,
    icon: _CheckCircleFilled.default
  }));
};

CheckCircleFilled.displayName = 'CheckCircleFilled';

var _default = React.forwardRef(CheckCircleFilled);

exports.default = _default;

/***/ }),
/* 124 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
 // This icon file is generated automatically.

Object.defineProperty(exports, "__esModule", {
  value: true
});
var CheckCircleFilled = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "64 64 896 896",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M512 64C264.6 64 64 264.6 64 512s200.6 448 448 448 448-200.6 448-448S759.4 64 512 64zm193.5 301.7l-210.6 292a31.8 31.8 0 01-51.7 0L318.5 484.9c-3.8-5.3 0-12.7 6.5-12.7h46.9c10.2 0 19.9 4.9 25.9 13.3l71.2 98.8 157.2-218c6-8.3 15.6-13.3 25.9-13.3H699c6.5 0 10.3 7.4 6.5 12.7z"
      }
    }]
  },
  "name": "check-circle",
  "theme": "filled"
};
exports.default = CheckCircleFilled;

/***/ }),
/* 125 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var _InfoCircleFilled = _interopRequireDefault(__webpack_require__(126));

function _interopRequireDefault(obj) {
  return obj && obj.__esModule ? obj : {
    'default': obj
  };
}

var _default = _InfoCircleFilled;
exports.default = _default;
module.exports = _default;

/***/ }),
/* 126 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireDefault = __webpack_require__(4);

var _interopRequireWildcard = __webpack_require__(7);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var React = _interopRequireWildcard(__webpack_require__(0));

var _InfoCircleFilled = _interopRequireDefault(__webpack_require__(127));

var _AntdIcon = _interopRequireDefault(__webpack_require__(18)); // GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY


var InfoCircleFilled = function InfoCircleFilled(props, ref) {
  return React.createElement(_AntdIcon.default, Object.assign({}, props, {
    ref: ref,
    icon: _InfoCircleFilled.default
  }));
};

InfoCircleFilled.displayName = 'InfoCircleFilled';

var _default = React.forwardRef(InfoCircleFilled);

exports.default = _default;

/***/ }),
/* 127 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
 // This icon file is generated automatically.

Object.defineProperty(exports, "__esModule", {
  value: true
});
var InfoCircleFilled = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "64 64 896 896",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M512 64C264.6 64 64 264.6 64 512s200.6 448 448 448 448-200.6 448-448S759.4 64 512 64zm32 664c0 4.4-3.6 8-8 8h-48c-4.4 0-8-3.6-8-8V456c0-4.4 3.6-8 8-8h48c4.4 0 8 3.6 8 8v272zm-32-344a48.01 48.01 0 010-96 48.01 48.01 0 010 96z"
      }
    }]
  },
  "name": "info-circle",
  "theme": "filled"
};
exports.default = InfoCircleFilled;

/***/ }),
/* 128 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireWildcard = __webpack_require__(7);

var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports["default"] = createUseMessage;

var _extends2 = _interopRequireDefault(__webpack_require__(3));

var _slicedToArray2 = _interopRequireDefault(__webpack_require__(24));

var React = _interopRequireWildcard(__webpack_require__(0));

var _useNotification = _interopRequireDefault(__webpack_require__(71));

var _configProvider = __webpack_require__(20);

var _ = __webpack_require__(65);

function createUseMessage(getRcNotificationInstance, getRCNoticeProps) {
  var useMessage = function useMessage() {
    // We can only get content by render
    var getPrefixCls; // We create a proxy to handle delay created instance

    var innerInstance = null;
    var proxy = {
      add: function add(noticeProps, holderCallback) {
        innerInstance === null || innerInstance === void 0 ? void 0 : innerInstance.component.add(noticeProps, holderCallback);
      }
    };

    var _useRCNotification = (0, _useNotification["default"])(proxy),
        _useRCNotification2 = (0, _slicedToArray2["default"])(_useRCNotification, 2),
        hookNotify = _useRCNotification2[0],
        holder = _useRCNotification2[1];

    function notify(args) {
      var customizePrefixCls = args.prefixCls;
      var mergedPrefixCls = getPrefixCls('message', customizePrefixCls);
      var target = args.key || (0, _.getKeyThenIncreaseKey)();
      var closePromise = new Promise(function (resolve) {
        var callback = function callback() {
          if (typeof args.onClose === 'function') {
            args.onClose();
          }

          return resolve(true);
        };

        getRcNotificationInstance((0, _extends2["default"])((0, _extends2["default"])({}, args), {
          prefixCls: mergedPrefixCls
        }), function (_ref) {
          var prefixCls = _ref.prefixCls,
              instance = _ref.instance;
          innerInstance = instance;
          hookNotify(getRCNoticeProps((0, _extends2["default"])((0, _extends2["default"])({}, args), {
            key: target,
            onClose: callback
          }), prefixCls));
        });
      });

      var result = function result() {
        if (innerInstance) {
          innerInstance.removeNotice(target);
        }
      };

      result.then = function (filled, rejected) {
        return closePromise.then(filled, rejected);
      };

      result.promise = closePromise;
      return result;
    } // Fill functions


    var hookApiRef = React.useRef({});
    hookApiRef.current.open = notify;
    ['success', 'info', 'warning', 'error', 'loading'].forEach(function (type) {
      return (0, _.attachTypeApi)(hookApiRef.current, type);
    });
    return [hookApiRef.current, /*#__PURE__*/React.createElement(_configProvider.ConfigConsumer, {
      key: "holder"
    }, function (context) {
      getPrefixCls = context.getPrefixCls;
      return holder;
    })];
  };

  return useMessage;
}

/***/ }),
/* 129 */
/***/ (function(module, exports, __webpack_require__) {

var arrayWithoutHoles = __webpack_require__(130);

var iterableToArray = __webpack_require__(131);

var unsupportedIterableToArray = __webpack_require__(66);

var nonIterableSpread = __webpack_require__(132);

function _toConsumableArray(arr) {
  return arrayWithoutHoles(arr) || iterableToArray(arr) || unsupportedIterableToArray(arr) || nonIterableSpread();
}

module.exports = _toConsumableArray;

/***/ }),
/* 130 */
/***/ (function(module, exports, __webpack_require__) {

var arrayLikeToArray = __webpack_require__(67);

function _arrayWithoutHoles(arr) {
  if (Array.isArray(arr)) return arrayLikeToArray(arr);
}

module.exports = _arrayWithoutHoles;

/***/ }),
/* 131 */
/***/ (function(module, exports) {

function _iterableToArray(iter) {
  if (typeof Symbol !== "undefined" && Symbol.iterator in Object(iter)) return Array.from(iter);
}

module.exports = _iterableToArray;

/***/ }),
/* 132 */
/***/ (function(module, exports) {

function _nonIterableSpread() {
  throw new TypeError("Invalid attempt to spread non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
}

module.exports = _nonIterableSpread;

/***/ }),
/* 133 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireWildcard = __webpack_require__(7);

var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var _defineProperty2 = _interopRequireDefault(__webpack_require__(13));

var _classCallCheck2 = _interopRequireDefault(__webpack_require__(33));

var _createClass2 = _interopRequireDefault(__webpack_require__(34));

var _inherits2 = _interopRequireDefault(__webpack_require__(35));

var _possibleConstructorReturn2 = _interopRequireDefault(__webpack_require__(59));

var _getPrototypeOf2 = _interopRequireDefault(__webpack_require__(58));

var _react = _interopRequireWildcard(__webpack_require__(0));

var _reactDom = _interopRequireDefault(__webpack_require__(14));

var _classnames = _interopRequireDefault(__webpack_require__(2));

function _createSuper(Derived) {
  var hasNativeReflectConstruct = _isNativeReflectConstruct();

  return function () {
    var Super = (0, _getPrototypeOf2.default)(Derived),
        result;

    if (hasNativeReflectConstruct) {
      var NewTarget = (0, _getPrototypeOf2.default)(this).constructor;
      result = Reflect.construct(Super, arguments, NewTarget);
    } else {
      result = Super.apply(this, arguments);
    }

    return (0, _possibleConstructorReturn2.default)(this, result);
  };
}

function _isNativeReflectConstruct() {
  if (typeof Reflect === "undefined" || !Reflect.construct) return false;
  if (Reflect.construct.sham) return false;
  if (typeof Proxy === "function") return true;

  try {
    Date.prototype.toString.call(Reflect.construct(Date, [], function () {}));
    return true;
  } catch (e) {
    return false;
  }
}

var Notice = /*#__PURE__*/function (_Component) {
  (0, _inherits2.default)(Notice, _Component);

  var _super = _createSuper(Notice);

  function Notice() {
    var _this;

    (0, _classCallCheck2.default)(this, Notice);
    _this = _super.apply(this, arguments);
    _this.closeTimer = null;

    _this.close = function (e) {
      if (e) {
        e.stopPropagation();
      }

      _this.clearCloseTimer();

      var onClose = _this.props.onClose;

      if (onClose) {
        onClose();
      }
    };

    _this.startCloseTimer = function () {
      if (_this.props.duration) {
        _this.closeTimer = window.setTimeout(function () {
          _this.close();
        }, _this.props.duration * 1000);
      }
    };

    _this.clearCloseTimer = function () {
      if (_this.closeTimer) {
        clearTimeout(_this.closeTimer);
        _this.closeTimer = null;
      }
    };

    return _this;
  }

  (0, _createClass2.default)(Notice, [{
    key: "componentDidMount",
    value: function componentDidMount() {
      this.startCloseTimer();
    }
  }, {
    key: "componentDidUpdate",
    value: function componentDidUpdate(prevProps) {
      if (this.props.duration !== prevProps.duration || this.props.update) {
        this.restartCloseTimer();
      }
    }
  }, {
    key: "componentWillUnmount",
    value: function componentWillUnmount() {
      this.clearCloseTimer();
    }
  }, {
    key: "restartCloseTimer",
    value: function restartCloseTimer() {
      this.clearCloseTimer();
      this.startCloseTimer();
    }
  }, {
    key: "render",
    value: function render() {
      var _this2 = this;

      var _this$props = this.props,
          prefixCls = _this$props.prefixCls,
          className = _this$props.className,
          closable = _this$props.closable,
          closeIcon = _this$props.closeIcon,
          style = _this$props.style,
          onClick = _this$props.onClick,
          children = _this$props.children,
          holder = _this$props.holder;
      var componentClass = "".concat(prefixCls, "-notice");
      var dataOrAriaAttributeProps = Object.keys(this.props).reduce(function (acc, key) {
        if (key.substr(0, 5) === 'data-' || key.substr(0, 5) === 'aria-' || key === 'role') {
          acc[key] = _this2.props[key];
        }

        return acc;
      }, {});

      var node = _react.default.createElement("div", Object.assign({
        className: (0, _classnames.default)(componentClass, className, (0, _defineProperty2.default)({}, "".concat(componentClass, "-closable"), closable)),
        style: style,
        onMouseEnter: this.clearCloseTimer,
        onMouseLeave: this.startCloseTimer,
        onClick: onClick
      }, dataOrAriaAttributeProps), _react.default.createElement("div", {
        className: "".concat(componentClass, "-content")
      }, children), closable ? _react.default.createElement("a", {
        tabIndex: 0,
        onClick: this.close,
        className: "".concat(componentClass, "-close")
      }, closeIcon || _react.default.createElement("span", {
        className: "".concat(componentClass, "-close-x")
      })) : null);

      if (holder) {
        return _reactDom.default.createPortal(node, holder);
      }

      return node;
    }
  }]);
  return Notice;
}(_react.Component);

exports.default = Notice;
Notice.defaultProps = {
  onClose: function onClose() {},
  duration: 1.5,
  style: {
    right: '50%'
  }
};

/***/ }),
/* 134 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireWildcard = __webpack_require__(7);

var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports["default"] = void 0;

var _extends2 = _interopRequireDefault(__webpack_require__(3));

var _defineProperty2 = _interopRequireDefault(__webpack_require__(13));

var React = _interopRequireWildcard(__webpack_require__(0));

var _rcNotification = _interopRequireDefault(__webpack_require__(77));

var _CloseOutlined = _interopRequireDefault(__webpack_require__(135));

var _classnames = _interopRequireDefault(__webpack_require__(2));

var _CheckCircleOutlined = _interopRequireDefault(__webpack_require__(138));

var _CloseCircleOutlined = _interopRequireDefault(__webpack_require__(141));

var _ExclamationCircleOutlined = _interopRequireDefault(__webpack_require__(144));

var _InfoCircleOutlined = _interopRequireDefault(__webpack_require__(147));

var _useNotification = _interopRequireDefault(__webpack_require__(150));

var notificationInstance = {};
var defaultDuration = 4.5;
var defaultTop = 24;
var defaultBottom = 24;
var defaultPrefixCls = 'ant-notification';
var defaultPlacement = 'topRight';
var defaultGetContainer;
var defaultCloseIcon;
var rtl = false;

function setNotificationConfig(options) {
  var duration = options.duration,
      placement = options.placement,
      bottom = options.bottom,
      top = options.top,
      getContainer = options.getContainer,
      closeIcon = options.closeIcon,
      prefixCls = options.prefixCls;

  if (prefixCls !== undefined) {
    defaultPrefixCls = prefixCls;
  }

  if (duration !== undefined) {
    defaultDuration = duration;
  }

  if (placement !== undefined) {
    defaultPlacement = placement;
  } else if (options.rtl) {
    defaultPlacement = 'topLeft';
  }

  if (bottom !== undefined) {
    defaultBottom = bottom;
  }

  if (top !== undefined) {
    defaultTop = top;
  }

  if (getContainer !== undefined) {
    defaultGetContainer = getContainer;
  }

  if (closeIcon !== undefined) {
    defaultCloseIcon = closeIcon;
  }

  if (options.rtl !== undefined) {
    rtl = options.rtl;
  }
}

function getPlacementStyle(placement) {
  var top = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : defaultTop;
  var bottom = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : defaultBottom;
  var style;

  switch (placement) {
    case 'topLeft':
      style = {
        left: 0,
        top: top,
        bottom: 'auto'
      };
      break;

    case 'topRight':
      style = {
        right: 0,
        top: top,
        bottom: 'auto'
      };
      break;

    case 'bottomLeft':
      style = {
        left: 0,
        top: 'auto',
        bottom: bottom
      };
      break;

    default:
      style = {
        right: 0,
        top: 'auto',
        bottom: bottom
      };
      break;
  }

  return style;
}

function getNotificationInstance(args, callback) {
  var _args$placement = args.placement,
      placement = _args$placement === void 0 ? defaultPlacement : _args$placement,
      top = args.top,
      bottom = args.bottom,
      _args$getContainer = args.getContainer,
      getContainer = _args$getContainer === void 0 ? defaultGetContainer : _args$getContainer,
      _args$closeIcon = args.closeIcon,
      closeIcon = _args$closeIcon === void 0 ? defaultCloseIcon : _args$closeIcon;
  var outerPrefixCls = args.prefixCls || defaultPrefixCls;
  var prefixCls = "".concat(outerPrefixCls, "-notice");
  var cacheKey = "".concat(outerPrefixCls, "-").concat(placement);
  var cacheInstance = notificationInstance[cacheKey];

  if (cacheInstance) {
    Promise.resolve(cacheInstance).then(function (instance) {
      callback({
        prefixCls: prefixCls,
        instance: instance
      });
    });
    return;
  }

  var closeIconToRender = /*#__PURE__*/React.createElement("span", {
    className: "".concat(outerPrefixCls, "-close-x")
  }, closeIcon || /*#__PURE__*/React.createElement(_CloseOutlined["default"], {
    className: "".concat(outerPrefixCls, "-close-icon")
  }));
  var notificationClass = (0, _classnames["default"])("".concat(outerPrefixCls, "-").concat(placement), (0, _defineProperty2["default"])({}, "".concat(outerPrefixCls, "-rtl"), rtl === true));
  notificationInstance[cacheKey] = new Promise(function (resolve) {
    _rcNotification["default"].newInstance({
      prefixCls: outerPrefixCls,
      className: notificationClass,
      style: getPlacementStyle(placement, top, bottom),
      getContainer: getContainer,
      closeIcon: closeIconToRender
    }, function (notification) {
      resolve(notification);
      callback({
        prefixCls: prefixCls,
        instance: notification
      });
    });
  });
}

var typeToIcon = {
  success: _CheckCircleOutlined["default"],
  info: _InfoCircleOutlined["default"],
  error: _CloseCircleOutlined["default"],
  warning: _ExclamationCircleOutlined["default"]
};

function getRCNoticeProps(args, prefixCls) {
  var duration = args.duration === undefined ? defaultDuration : args.duration;
  var iconNode = null;

  if (args.icon) {
    iconNode = /*#__PURE__*/React.createElement("span", {
      className: "".concat(prefixCls, "-icon")
    }, args.icon);
  } else if (args.type) {
    iconNode = /*#__PURE__*/React.createElement(typeToIcon[args.type] || null, {
      className: "".concat(prefixCls, "-icon ").concat(prefixCls, "-icon-").concat(args.type)
    });
  }

  var autoMarginTag = !args.description && iconNode ? /*#__PURE__*/React.createElement("span", {
    className: "".concat(prefixCls, "-message-single-line-auto-margin")
  }) : null;
  return {
    content: /*#__PURE__*/React.createElement("div", {
      className: iconNode ? "".concat(prefixCls, "-with-icon") : '',
      role: "alert"
    }, iconNode, /*#__PURE__*/React.createElement("div", {
      className: "".concat(prefixCls, "-message")
    }, autoMarginTag, args.message), /*#__PURE__*/React.createElement("div", {
      className: "".concat(prefixCls, "-description")
    }, args.description), args.btn ? /*#__PURE__*/React.createElement("span", {
      className: "".concat(prefixCls, "-btn")
    }, args.btn) : null),
    duration: duration,
    closable: true,
    onClose: args.onClose,
    onClick: args.onClick,
    key: args.key,
    style: args.style || {},
    className: args.className
  };
}

function notice(args) {
  getNotificationInstance(args, function (_ref) {
    var prefixCls = _ref.prefixCls,
        instance = _ref.instance;
    instance.notice(getRCNoticeProps(args, prefixCls));
  });
}

var api = {
  open: notice,
  close: function close(key) {
    Object.keys(notificationInstance).forEach(function (cacheKey) {
      return Promise.resolve(notificationInstance[cacheKey]).then(function (instance) {
        instance.removeNotice(key);
      });
    });
  },
  config: setNotificationConfig,
  destroy: function destroy() {
    Object.keys(notificationInstance).forEach(function (cacheKey) {
      Promise.resolve(notificationInstance[cacheKey]).then(function (instance) {
        instance.destroy();
      });
      delete notificationInstance[cacheKey]; // lgtm[js/missing-await]
    });
  }
};
['success', 'info', 'warning', 'error'].forEach(function (type) {
  api[type] = function (args) {
    return api.open((0, _extends2["default"])((0, _extends2["default"])({}, args), {
      type: type
    }));
  };
});
api.warn = api.warning;
api.useNotification = (0, _useNotification["default"])(getNotificationInstance, getRCNoticeProps);
var _default = api;
exports["default"] = _default;

/***/ }),
/* 135 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var _CloseOutlined = _interopRequireDefault(__webpack_require__(136));

function _interopRequireDefault(obj) {
  return obj && obj.__esModule ? obj : {
    'default': obj
  };
}

var _default = _CloseOutlined;
exports.default = _default;
module.exports = _default;

/***/ }),
/* 136 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireDefault = __webpack_require__(4);

var _interopRequireWildcard = __webpack_require__(7);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var React = _interopRequireWildcard(__webpack_require__(0));

var _CloseOutlined = _interopRequireDefault(__webpack_require__(137));

var _AntdIcon = _interopRequireDefault(__webpack_require__(18)); // GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY


var CloseOutlined = function CloseOutlined(props, ref) {
  return React.createElement(_AntdIcon.default, Object.assign({}, props, {
    ref: ref,
    icon: _CloseOutlined.default
  }));
};

CloseOutlined.displayName = 'CloseOutlined';

var _default = React.forwardRef(CloseOutlined);

exports.default = _default;

/***/ }),
/* 137 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
 // This icon file is generated automatically.

Object.defineProperty(exports, "__esModule", {
  value: true
});
var CloseOutlined = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "64 64 896 896",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M563.8 512l262.5-312.9c4.4-5.2.7-13.1-6.1-13.1h-79.8c-4.7 0-9.2 2.1-12.3 5.7L511.6 449.8 295.1 191.7c-3-3.6-7.5-5.7-12.3-5.7H203c-6.8 0-10.5 7.9-6.1 13.1L459.4 512 196.9 824.9A7.95 7.95 0 00203 838h79.8c4.7 0 9.2-2.1 12.3-5.7l216.5-258.1 216.5 258.1c3 3.6 7.5 5.7 12.3 5.7h79.8c6.8 0 10.5-7.9 6.1-13.1L563.8 512z"
      }
    }]
  },
  "name": "close",
  "theme": "outlined"
};
exports.default = CloseOutlined;

/***/ }),
/* 138 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var _CheckCircleOutlined = _interopRequireDefault(__webpack_require__(139));

function _interopRequireDefault(obj) {
  return obj && obj.__esModule ? obj : {
    'default': obj
  };
}

var _default = _CheckCircleOutlined;
exports.default = _default;
module.exports = _default;

/***/ }),
/* 139 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireDefault = __webpack_require__(4);

var _interopRequireWildcard = __webpack_require__(7);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var React = _interopRequireWildcard(__webpack_require__(0));

var _CheckCircleOutlined = _interopRequireDefault(__webpack_require__(140));

var _AntdIcon = _interopRequireDefault(__webpack_require__(18)); // GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY


var CheckCircleOutlined = function CheckCircleOutlined(props, ref) {
  return React.createElement(_AntdIcon.default, Object.assign({}, props, {
    ref: ref,
    icon: _CheckCircleOutlined.default
  }));
};

CheckCircleOutlined.displayName = 'CheckCircleOutlined';

var _default = React.forwardRef(CheckCircleOutlined);

exports.default = _default;

/***/ }),
/* 140 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
 // This icon file is generated automatically.

Object.defineProperty(exports, "__esModule", {
  value: true
});
var CheckCircleOutlined = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "64 64 896 896",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M699 353h-46.9c-10.2 0-19.9 4.9-25.9 13.3L469 584.3l-71.2-98.8c-6-8.3-15.6-13.3-25.9-13.3H325c-6.5 0-10.3 7.4-6.5 12.7l124.6 172.8a31.8 31.8 0 0051.7 0l210.6-292c3.9-5.3.1-12.7-6.4-12.7z"
      }
    }, {
      "tag": "path",
      "attrs": {
        "d": "M512 64C264.6 64 64 264.6 64 512s200.6 448 448 448 448-200.6 448-448S759.4 64 512 64zm0 820c-205.4 0-372-166.6-372-372s166.6-372 372-372 372 166.6 372 372-166.6 372-372 372z"
      }
    }]
  },
  "name": "check-circle",
  "theme": "outlined"
};
exports.default = CheckCircleOutlined;

/***/ }),
/* 141 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var _CloseCircleOutlined = _interopRequireDefault(__webpack_require__(142));

function _interopRequireDefault(obj) {
  return obj && obj.__esModule ? obj : {
    'default': obj
  };
}

var _default = _CloseCircleOutlined;
exports.default = _default;
module.exports = _default;

/***/ }),
/* 142 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireDefault = __webpack_require__(4);

var _interopRequireWildcard = __webpack_require__(7);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var React = _interopRequireWildcard(__webpack_require__(0));

var _CloseCircleOutlined = _interopRequireDefault(__webpack_require__(143));

var _AntdIcon = _interopRequireDefault(__webpack_require__(18)); // GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY


var CloseCircleOutlined = function CloseCircleOutlined(props, ref) {
  return React.createElement(_AntdIcon.default, Object.assign({}, props, {
    ref: ref,
    icon: _CloseCircleOutlined.default
  }));
};

CloseCircleOutlined.displayName = 'CloseCircleOutlined';

var _default = React.forwardRef(CloseCircleOutlined);

exports.default = _default;

/***/ }),
/* 143 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
 // This icon file is generated automatically.

Object.defineProperty(exports, "__esModule", {
  value: true
});
var CloseCircleOutlined = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "64 64 896 896",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M685.4 354.8c0-4.4-3.6-8-8-8l-66 .3L512 465.6l-99.3-118.4-66.1-.3c-4.4 0-8 3.5-8 8 0 1.9.7 3.7 1.9 5.2l130.1 155L340.5 670a8.32 8.32 0 00-1.9 5.2c0 4.4 3.6 8 8 8l66.1-.3L512 564.4l99.3 118.4 66 .3c4.4 0 8-3.5 8-8 0-1.9-.7-3.7-1.9-5.2L553.5 515l130.1-155c1.2-1.4 1.8-3.3 1.8-5.2z"
      }
    }, {
      "tag": "path",
      "attrs": {
        "d": "M512 65C264.6 65 64 265.6 64 513s200.6 448 448 448 448-200.6 448-448S759.4 65 512 65zm0 820c-205.4 0-372-166.6-372-372s166.6-372 372-372 372 166.6 372 372-166.6 372-372 372z"
      }
    }]
  },
  "name": "close-circle",
  "theme": "outlined"
};
exports.default = CloseCircleOutlined;

/***/ }),
/* 144 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var _ExclamationCircleOutlined = _interopRequireDefault(__webpack_require__(145));

function _interopRequireDefault(obj) {
  return obj && obj.__esModule ? obj : {
    'default': obj
  };
}

var _default = _ExclamationCircleOutlined;
exports.default = _default;
module.exports = _default;

/***/ }),
/* 145 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireDefault = __webpack_require__(4);

var _interopRequireWildcard = __webpack_require__(7);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var React = _interopRequireWildcard(__webpack_require__(0));

var _ExclamationCircleOutlined = _interopRequireDefault(__webpack_require__(146));

var _AntdIcon = _interopRequireDefault(__webpack_require__(18)); // GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY


var ExclamationCircleOutlined = function ExclamationCircleOutlined(props, ref) {
  return React.createElement(_AntdIcon.default, Object.assign({}, props, {
    ref: ref,
    icon: _ExclamationCircleOutlined.default
  }));
};

ExclamationCircleOutlined.displayName = 'ExclamationCircleOutlined';

var _default = React.forwardRef(ExclamationCircleOutlined);

exports.default = _default;

/***/ }),
/* 146 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
 // This icon file is generated automatically.

Object.defineProperty(exports, "__esModule", {
  value: true
});
var ExclamationCircleOutlined = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "64 64 896 896",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M512 64C264.6 64 64 264.6 64 512s200.6 448 448 448 448-200.6 448-448S759.4 64 512 64zm0 820c-205.4 0-372-166.6-372-372s166.6-372 372-372 372 166.6 372 372-166.6 372-372 372z"
      }
    }, {
      "tag": "path",
      "attrs": {
        "d": "M464 688a48 48 0 1096 0 48 48 0 10-96 0zm24-112h48c4.4 0 8-3.6 8-8V296c0-4.4-3.6-8-8-8h-48c-4.4 0-8 3.6-8 8v272c0 4.4 3.6 8 8 8z"
      }
    }]
  },
  "name": "exclamation-circle",
  "theme": "outlined"
};
exports.default = ExclamationCircleOutlined;

/***/ }),
/* 147 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var _InfoCircleOutlined = _interopRequireDefault(__webpack_require__(148));

function _interopRequireDefault(obj) {
  return obj && obj.__esModule ? obj : {
    'default': obj
  };
}

var _default = _InfoCircleOutlined;
exports.default = _default;
module.exports = _default;

/***/ }),
/* 148 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireDefault = __webpack_require__(4);

var _interopRequireWildcard = __webpack_require__(7);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.default = void 0;

var React = _interopRequireWildcard(__webpack_require__(0));

var _InfoCircleOutlined = _interopRequireDefault(__webpack_require__(149));

var _AntdIcon = _interopRequireDefault(__webpack_require__(18)); // GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY


var InfoCircleOutlined = function InfoCircleOutlined(props, ref) {
  return React.createElement(_AntdIcon.default, Object.assign({}, props, {
    ref: ref,
    icon: _InfoCircleOutlined.default
  }));
};

InfoCircleOutlined.displayName = 'InfoCircleOutlined';

var _default = React.forwardRef(InfoCircleOutlined);

exports.default = _default;

/***/ }),
/* 149 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";
 // This icon file is generated automatically.

Object.defineProperty(exports, "__esModule", {
  value: true
});
var InfoCircleOutlined = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "64 64 896 896",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M512 64C264.6 64 64 264.6 64 512s200.6 448 448 448 448-200.6 448-448S759.4 64 512 64zm0 820c-205.4 0-372-166.6-372-372s166.6-372 372-372 372 166.6 372 372-166.6 372-372 372z"
      }
    }, {
      "tag": "path",
      "attrs": {
        "d": "M464 336a48 48 0 1096 0 48 48 0 10-96 0zm72 112h-48c-4.4 0-8 3.6-8 8v272c0 4.4 3.6 8 8 8h48c4.4 0 8-3.6 8-8V456c0-4.4-3.6-8-8-8z"
      }
    }]
  },
  "name": "info-circle",
  "theme": "outlined"
};
exports.default = InfoCircleOutlined;

/***/ }),
/* 150 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var _interopRequireWildcard = __webpack_require__(7);

var _interopRequireDefault = __webpack_require__(4);

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports["default"] = createUseNotification;

var _extends2 = _interopRequireDefault(__webpack_require__(3));

var _slicedToArray2 = _interopRequireDefault(__webpack_require__(24));

var React = _interopRequireWildcard(__webpack_require__(0));

var _useNotification = _interopRequireDefault(__webpack_require__(71));

var _configProvider = __webpack_require__(20);

function createUseNotification(getNotificationInstance, getRCNoticeProps) {
  var useNotification = function useNotification() {
    // We can only get content by render
    var getPrefixCls; // We create a proxy to handle delay created instance

    var innerInstance = null;
    var proxy = {
      add: function add(noticeProps, holderCallback) {
        innerInstance === null || innerInstance === void 0 ? void 0 : innerInstance.component.add(noticeProps, holderCallback);
      }
    };

    var _useRCNotification = (0, _useNotification["default"])(proxy),
        _useRCNotification2 = (0, _slicedToArray2["default"])(_useRCNotification, 2),
        hookNotify = _useRCNotification2[0],
        holder = _useRCNotification2[1];

    function notify(args) {
      var customizePrefixCls = args.prefixCls;
      var mergedPrefixCls = getPrefixCls('notification', customizePrefixCls);
      getNotificationInstance((0, _extends2["default"])((0, _extends2["default"])({}, args), {
        prefixCls: mergedPrefixCls
      }), function (_ref) {
        var prefixCls = _ref.prefixCls,
            instance = _ref.instance;
        innerInstance = instance;
        hookNotify(getRCNoticeProps(args, prefixCls));
      });
    } // Fill functions


    var hookApiRef = React.useRef({});
    hookApiRef.current.open = notify;
    ['success', 'info', 'warning', 'error'].forEach(function (type) {
      hookApiRef.current[type] = function (args) {
        return hookApiRef.current.open((0, _extends2["default"])((0, _extends2["default"])({}, args), {
          type: type
        }));
      };
    });
    return [hookApiRef.current, /*#__PURE__*/React.createElement(_configProvider.ConfigConsumer, {
      key: "holder"
    }, function (context) {
      getPrefixCls = context.getPrefixCls;
      return holder;
    })];
  };

  return useNotification;
}

/***/ }),
/* 151 */
/***/ (function(module, exports, __webpack_require__) {

/* WEBPACK VAR INJECTION */(function(process) {// Generated by CoffeeScript 1.12.2
(function () {
  var getNanoSeconds, hrtime, loadTime, moduleLoadTime, nodeLoadTime, upTime;

  if (typeof performance !== "undefined" && performance !== null && performance.now) {
    module.exports = function () {
      return performance.now();
    };
  } else if (typeof process !== "undefined" && process !== null && process.hrtime) {
    module.exports = function () {
      return (getNanoSeconds() - nodeLoadTime) / 1e6;
    };

    hrtime = process.hrtime;

    getNanoSeconds = function getNanoSeconds() {
      var hr;
      hr = hrtime();
      return hr[0] * 1e9 + hr[1];
    };

    moduleLoadTime = getNanoSeconds();
    upTime = process.uptime() * 1e9;
    nodeLoadTime = moduleLoadTime - upTime;
  } else if (Date.now) {
    module.exports = function () {
      return Date.now() - loadTime;
    };

    loadTime = Date.now();
  } else {
    module.exports = function () {
      return new Date().getTime() - loadTime;
    };

    loadTime = new Date().getTime();
  }
}).call(this);
/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(48)))

/***/ }),
/* 152 */
/***/ (function(module, exports, __webpack_require__) {

// extracted by mini-css-extract-plugin

/***/ }),
/* 153 */
/***/ (function(module, exports, __webpack_require__) {

// extracted by mini-css-extract-plugin

/***/ }),
/* 154 */
/***/ (function(module, exports) {

if (typeof Object.create === 'function') {
  // implementation from standard node.js 'util' module
  module.exports = function inherits(ctor, superCtor) {
    if (superCtor) {
      ctor.super_ = superCtor;
      ctor.prototype = Object.create(superCtor.prototype, {
        constructor: {
          value: ctor,
          enumerable: false,
          writable: true,
          configurable: true
        }
      });
    }
  };
} else {
  // old school shim for old browsers
  module.exports = function inherits(ctor, superCtor) {
    if (superCtor) {
      ctor.super_ = superCtor;

      var TempCtor = function TempCtor() {};

      TempCtor.prototype = superCtor.prototype;
      ctor.prototype = new TempCtor();
      ctor.prototype.constructor = ctor;
    }
  };
}

/***/ }),
/* 155 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


exports.sha1 = __webpack_require__(156);
exports.sha224 = __webpack_require__(157);
exports.sha256 = __webpack_require__(74);
exports.sha384 = __webpack_require__(158);
exports.sha512 = __webpack_require__(75);

/***/ }),
/* 156 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = __webpack_require__(19);

var common = __webpack_require__(32);

var shaCommon = __webpack_require__(73);

var rotl32 = utils.rotl32;
var sum32 = utils.sum32;
var sum32_5 = utils.sum32_5;
var ft_1 = shaCommon.ft_1;
var BlockHash = common.BlockHash;
var sha1_K = [0x5A827999, 0x6ED9EBA1, 0x8F1BBCDC, 0xCA62C1D6];

function SHA1() {
  if (!(this instanceof SHA1)) return new SHA1();
  BlockHash.call(this);
  this.h = [0x67452301, 0xefcdab89, 0x98badcfe, 0x10325476, 0xc3d2e1f0];
  this.W = new Array(80);
}

utils.inherits(SHA1, BlockHash);
module.exports = SHA1;
SHA1.blockSize = 512;
SHA1.outSize = 160;
SHA1.hmacStrength = 80;
SHA1.padLength = 64;

SHA1.prototype._update = function _update(msg, start) {
  var W = this.W;

  for (var i = 0; i < 16; i++) {
    W[i] = msg[start + i];
  }

  for (; i < W.length; i++) {
    W[i] = rotl32(W[i - 3] ^ W[i - 8] ^ W[i - 14] ^ W[i - 16], 1);
  }

  var a = this.h[0];
  var b = this.h[1];
  var c = this.h[2];
  var d = this.h[3];
  var e = this.h[4];

  for (i = 0; i < W.length; i++) {
    var s = ~~(i / 20);
    var t = sum32_5(rotl32(a, 5), ft_1(s, b, c, d), e, W[i], sha1_K[s]);
    e = d;
    d = c;
    c = rotl32(b, 30);
    b = a;
    a = t;
  }

  this.h[0] = sum32(this.h[0], a);
  this.h[1] = sum32(this.h[1], b);
  this.h[2] = sum32(this.h[2], c);
  this.h[3] = sum32(this.h[3], d);
  this.h[4] = sum32(this.h[4], e);
};

SHA1.prototype._digest = function digest(enc) {
  if (enc === 'hex') return utils.toHex32(this.h, 'big');else return utils.split32(this.h, 'big');
};

/***/ }),
/* 157 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = __webpack_require__(19);

var SHA256 = __webpack_require__(74);

function SHA224() {
  if (!(this instanceof SHA224)) return new SHA224();
  SHA256.call(this);
  this.h = [0xc1059ed8, 0x367cd507, 0x3070dd17, 0xf70e5939, 0xffc00b31, 0x68581511, 0x64f98fa7, 0xbefa4fa4];
}

utils.inherits(SHA224, SHA256);
module.exports = SHA224;
SHA224.blockSize = 512;
SHA224.outSize = 224;
SHA224.hmacStrength = 192;
SHA224.padLength = 64;

SHA224.prototype._digest = function digest(enc) {
  // Just truncate output
  if (enc === 'hex') return utils.toHex32(this.h.slice(0, 7), 'big');else return utils.split32(this.h.slice(0, 7), 'big');
};

/***/ }),
/* 158 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = __webpack_require__(19);

var SHA512 = __webpack_require__(75);

function SHA384() {
  if (!(this instanceof SHA384)) return new SHA384();
  SHA512.call(this);
  this.h = [0xcbbb9d5d, 0xc1059ed8, 0x629a292a, 0x367cd507, 0x9159015a, 0x3070dd17, 0x152fecd8, 0xf70e5939, 0x67332667, 0xffc00b31, 0x8eb44a87, 0x68581511, 0xdb0c2e0d, 0x64f98fa7, 0x47b5481d, 0xbefa4fa4];
}

utils.inherits(SHA384, SHA512);
module.exports = SHA384;
SHA384.blockSize = 1024;
SHA384.outSize = 384;
SHA384.hmacStrength = 192;
SHA384.padLength = 128;

SHA384.prototype._digest = function digest(enc) {
  if (enc === 'hex') return utils.toHex32(this.h.slice(0, 12), 'big');else return utils.split32(this.h.slice(0, 12), 'big');
};

/***/ }),
/* 159 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = __webpack_require__(19);

var common = __webpack_require__(32);

var rotl32 = utils.rotl32;
var sum32 = utils.sum32;
var sum32_3 = utils.sum32_3;
var sum32_4 = utils.sum32_4;
var BlockHash = common.BlockHash;

function RIPEMD160() {
  if (!(this instanceof RIPEMD160)) return new RIPEMD160();
  BlockHash.call(this);
  this.h = [0x67452301, 0xefcdab89, 0x98badcfe, 0x10325476, 0xc3d2e1f0];
  this.endian = 'little';
}

utils.inherits(RIPEMD160, BlockHash);
exports.ripemd160 = RIPEMD160;
RIPEMD160.blockSize = 512;
RIPEMD160.outSize = 160;
RIPEMD160.hmacStrength = 192;
RIPEMD160.padLength = 64;

RIPEMD160.prototype._update = function update(msg, start) {
  var A = this.h[0];
  var B = this.h[1];
  var C = this.h[2];
  var D = this.h[3];
  var E = this.h[4];
  var Ah = A;
  var Bh = B;
  var Ch = C;
  var Dh = D;
  var Eh = E;

  for (var j = 0; j < 80; j++) {
    var T = sum32(rotl32(sum32_4(A, f(j, B, C, D), msg[r[j] + start], K(j)), s[j]), E);
    A = E;
    E = D;
    D = rotl32(C, 10);
    C = B;
    B = T;
    T = sum32(rotl32(sum32_4(Ah, f(79 - j, Bh, Ch, Dh), msg[rh[j] + start], Kh(j)), sh[j]), Eh);
    Ah = Eh;
    Eh = Dh;
    Dh = rotl32(Ch, 10);
    Ch = Bh;
    Bh = T;
  }

  T = sum32_3(this.h[1], C, Dh);
  this.h[1] = sum32_3(this.h[2], D, Eh);
  this.h[2] = sum32_3(this.h[3], E, Ah);
  this.h[3] = sum32_3(this.h[4], A, Bh);
  this.h[4] = sum32_3(this.h[0], B, Ch);
  this.h[0] = T;
};

RIPEMD160.prototype._digest = function digest(enc) {
  if (enc === 'hex') return utils.toHex32(this.h, 'little');else return utils.split32(this.h, 'little');
};

function f(j, x, y, z) {
  if (j <= 15) return x ^ y ^ z;else if (j <= 31) return x & y | ~x & z;else if (j <= 47) return (x | ~y) ^ z;else if (j <= 63) return x & z | y & ~z;else return x ^ (y | ~z);
}

function K(j) {
  if (j <= 15) return 0x00000000;else if (j <= 31) return 0x5a827999;else if (j <= 47) return 0x6ed9eba1;else if (j <= 63) return 0x8f1bbcdc;else return 0xa953fd4e;
}

function Kh(j) {
  if (j <= 15) return 0x50a28be6;else if (j <= 31) return 0x5c4dd124;else if (j <= 47) return 0x6d703ef3;else if (j <= 63) return 0x7a6d76e9;else return 0x00000000;
}

var r = [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 7, 4, 13, 1, 10, 6, 15, 3, 12, 0, 9, 5, 2, 14, 11, 8, 3, 10, 14, 4, 9, 15, 8, 1, 2, 7, 0, 6, 13, 11, 5, 12, 1, 9, 11, 10, 0, 8, 12, 4, 13, 3, 7, 15, 14, 5, 6, 2, 4, 0, 5, 9, 7, 12, 2, 10, 14, 1, 3, 8, 11, 6, 15, 13];
var rh = [5, 14, 7, 0, 9, 2, 11, 4, 13, 6, 15, 8, 1, 10, 3, 12, 6, 11, 3, 7, 0, 13, 5, 10, 14, 15, 8, 12, 4, 9, 1, 2, 15, 5, 1, 3, 7, 14, 6, 9, 11, 8, 12, 2, 10, 0, 4, 13, 8, 6, 4, 1, 3, 11, 15, 0, 5, 12, 2, 13, 9, 7, 10, 14, 12, 15, 10, 4, 1, 5, 8, 7, 6, 2, 13, 14, 0, 3, 9, 11];
var s = [11, 14, 15, 12, 5, 8, 7, 9, 11, 13, 14, 15, 6, 7, 9, 8, 7, 6, 8, 13, 11, 9, 7, 15, 7, 12, 15, 9, 11, 7, 13, 12, 11, 13, 6, 7, 14, 9, 13, 15, 14, 8, 13, 6, 5, 12, 7, 5, 11, 12, 14, 15, 14, 15, 9, 8, 9, 14, 5, 6, 8, 6, 5, 12, 9, 15, 5, 11, 6, 8, 13, 12, 5, 12, 13, 14, 11, 8, 5, 6];
var sh = [8, 9, 9, 11, 13, 15, 15, 5, 7, 7, 8, 11, 14, 14, 12, 6, 9, 13, 15, 7, 12, 8, 9, 11, 7, 7, 12, 7, 6, 15, 13, 11, 9, 7, 15, 11, 8, 6, 6, 14, 12, 13, 5, 14, 13, 13, 7, 5, 15, 5, 8, 11, 14, 14, 6, 14, 6, 9, 12, 9, 12, 5, 15, 8, 8, 5, 12, 9, 12, 5, 14, 6, 8, 13, 6, 5, 15, 13, 11, 11];

/***/ }),
/* 160 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = __webpack_require__(19);

var assert = __webpack_require__(31);

function Hmac(hash, key, enc) {
  if (!(this instanceof Hmac)) return new Hmac(hash, key, enc);
  this.Hash = hash;
  this.blockSize = hash.blockSize / 8;
  this.outSize = hash.outSize / 8;
  this.inner = null;
  this.outer = null;

  this._init(utils.toArray(key, enc));
}

module.exports = Hmac;

Hmac.prototype._init = function init(key) {
  // Shorten key, if needed
  if (key.length > this.blockSize) key = new this.Hash().update(key).digest();
  assert(key.length <= this.blockSize); // Add padding to key

  for (var i = key.length; i < this.blockSize; i++) {
    key.push(0);
  }

  for (i = 0; i < key.length; i++) {
    key[i] ^= 0x36;
  }

  this.inner = new this.Hash().update(key); // 0x36 ^ 0x5c = 0x6a

  for (i = 0; i < key.length; i++) {
    key[i] ^= 0x6a;
  }

  this.outer = new this.Hash().update(key);
};

Hmac.prototype.update = function update(msg, enc) {
  this.inner.update(msg, enc);
  return this;
};

Hmac.prototype.digest = function digest(enc) {
  this.outer.update(this.inner.digest());
  return this.outer.digest(enc);
};

/***/ }),
/* 161 */
/***/ (function(module, exports, __webpack_require__) {

// extracted by mini-css-extract-plugin

/***/ }),
/* 162 */
/***/ (function(module, exports, __webpack_require__) {

// extracted by mini-css-extract-plugin

/***/ }),
/* 163 */
/***/ (function(module, exports, __webpack_require__) {

// extracted by mini-css-extract-plugin

/***/ }),
/* 164 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


function _typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }

var utils = __webpack_require__(51);

var formats = __webpack_require__(76);

var has = Object.prototype.hasOwnProperty;
var arrayPrefixGenerators = {
  brackets: function brackets(prefix) {
    return prefix + '[]';
  },
  comma: 'comma',
  indices: function indices(prefix, key) {
    return prefix + '[' + key + ']';
  },
  repeat: function repeat(prefix) {
    return prefix;
  }
};
var isArray = Array.isArray;
var push = Array.prototype.push;

var pushToArray = function pushToArray(arr, valueOrArray) {
  push.apply(arr, isArray(valueOrArray) ? valueOrArray : [valueOrArray]);
};

var toISO = Date.prototype.toISOString;
var defaultFormat = formats['default'];
var defaults = {
  addQueryPrefix: false,
  allowDots: false,
  charset: 'utf-8',
  charsetSentinel: false,
  delimiter: '&',
  encode: true,
  encoder: utils.encode,
  encodeValuesOnly: false,
  format: defaultFormat,
  formatter: formats.formatters[defaultFormat],
  // deprecated
  indices: false,
  serializeDate: function serializeDate(date) {
    return toISO.call(date);
  },
  skipNulls: false,
  strictNullHandling: false
};

var isNonNullishPrimitive = function isNonNullishPrimitive(v) {
  return typeof v === 'string' || typeof v === 'number' || typeof v === 'boolean' || _typeof(v) === 'symbol' || typeof v === 'bigint';
};

var stringify = function stringify(object, prefix, generateArrayPrefix, strictNullHandling, skipNulls, encoder, filter, sort, allowDots, serializeDate, formatter, encodeValuesOnly, charset) {
  var obj = object;

  if (typeof filter === 'function') {
    obj = filter(prefix, obj);
  } else if (obj instanceof Date) {
    obj = serializeDate(obj);
  } else if (generateArrayPrefix === 'comma' && isArray(obj)) {
    obj = utils.maybeMap(obj, function (value) {
      if (value instanceof Date) {
        return serializeDate(value);
      }

      return value;
    }).join(',');
  }

  if (obj === null) {
    if (strictNullHandling) {
      return encoder && !encodeValuesOnly ? encoder(prefix, defaults.encoder, charset, 'key') : prefix;
    }

    obj = '';
  }

  if (isNonNullishPrimitive(obj) || utils.isBuffer(obj)) {
    if (encoder) {
      var keyValue = encodeValuesOnly ? prefix : encoder(prefix, defaults.encoder, charset, 'key');
      return [formatter(keyValue) + '=' + formatter(encoder(obj, defaults.encoder, charset, 'value'))];
    }

    return [formatter(prefix) + '=' + formatter(String(obj))];
  }

  var values = [];

  if (typeof obj === 'undefined') {
    return values;
  }

  var objKeys;

  if (isArray(filter)) {
    objKeys = filter;
  } else {
    var keys = Object.keys(obj);
    objKeys = sort ? keys.sort(sort) : keys;
  }

  for (var i = 0; i < objKeys.length; ++i) {
    var key = objKeys[i];
    var value = obj[key];

    if (skipNulls && value === null) {
      continue;
    }

    var keyPrefix = isArray(obj) ? typeof generateArrayPrefix === 'function' ? generateArrayPrefix(prefix, key) : prefix : prefix + (allowDots ? '.' + key : '[' + key + ']');
    pushToArray(values, stringify(value, keyPrefix, generateArrayPrefix, strictNullHandling, skipNulls, encoder, filter, sort, allowDots, serializeDate, formatter, encodeValuesOnly, charset));
  }

  return values;
};

var normalizeStringifyOptions = function normalizeStringifyOptions(opts) {
  if (!opts) {
    return defaults;
  }

  if (opts.encoder !== null && opts.encoder !== undefined && typeof opts.encoder !== 'function') {
    throw new TypeError('Encoder has to be a function.');
  }

  var charset = opts.charset || defaults.charset;

  if (typeof opts.charset !== 'undefined' && opts.charset !== 'utf-8' && opts.charset !== 'iso-8859-1') {
    throw new TypeError('The charset option must be either utf-8, iso-8859-1, or undefined');
  }

  var format = formats['default'];

  if (typeof opts.format !== 'undefined') {
    if (!has.call(formats.formatters, opts.format)) {
      throw new TypeError('Unknown format option provided.');
    }

    format = opts.format;
  }

  var formatter = formats.formatters[format];
  var filter = defaults.filter;

  if (typeof opts.filter === 'function' || isArray(opts.filter)) {
    filter = opts.filter;
  }

  return {
    addQueryPrefix: typeof opts.addQueryPrefix === 'boolean' ? opts.addQueryPrefix : defaults.addQueryPrefix,
    allowDots: typeof opts.allowDots === 'undefined' ? defaults.allowDots : !!opts.allowDots,
    charset: charset,
    charsetSentinel: typeof opts.charsetSentinel === 'boolean' ? opts.charsetSentinel : defaults.charsetSentinel,
    delimiter: typeof opts.delimiter === 'undefined' ? defaults.delimiter : opts.delimiter,
    encode: typeof opts.encode === 'boolean' ? opts.encode : defaults.encode,
    encoder: typeof opts.encoder === 'function' ? opts.encoder : defaults.encoder,
    encodeValuesOnly: typeof opts.encodeValuesOnly === 'boolean' ? opts.encodeValuesOnly : defaults.encodeValuesOnly,
    filter: filter,
    formatter: formatter,
    serializeDate: typeof opts.serializeDate === 'function' ? opts.serializeDate : defaults.serializeDate,
    skipNulls: typeof opts.skipNulls === 'boolean' ? opts.skipNulls : defaults.skipNulls,
    sort: typeof opts.sort === 'function' ? opts.sort : null,
    strictNullHandling: typeof opts.strictNullHandling === 'boolean' ? opts.strictNullHandling : defaults.strictNullHandling
  };
};

module.exports = function (object, opts) {
  var obj = object;
  var options = normalizeStringifyOptions(opts);
  var objKeys;
  var filter;

  if (typeof options.filter === 'function') {
    filter = options.filter;
    obj = filter('', obj);
  } else if (isArray(options.filter)) {
    filter = options.filter;
    objKeys = filter;
  }

  var keys = [];

  if (_typeof(obj) !== 'object' || obj === null) {
    return '';
  }

  var arrayFormat;

  if (opts && opts.arrayFormat in arrayPrefixGenerators) {
    arrayFormat = opts.arrayFormat;
  } else if (opts && 'indices' in opts) {
    arrayFormat = opts.indices ? 'indices' : 'repeat';
  } else {
    arrayFormat = 'indices';
  }

  var generateArrayPrefix = arrayPrefixGenerators[arrayFormat];

  if (!objKeys) {
    objKeys = Object.keys(obj);
  }

  if (options.sort) {
    objKeys.sort(options.sort);
  }

  for (var i = 0; i < objKeys.length; ++i) {
    var key = objKeys[i];

    if (options.skipNulls && obj[key] === null) {
      continue;
    }

    pushToArray(keys, stringify(obj[key], key, generateArrayPrefix, options.strictNullHandling, options.skipNulls, options.encode ? options.encoder : null, options.filter, options.sort, options.allowDots, options.serializeDate, options.formatter, options.encodeValuesOnly, options.charset));
  }

  var joined = keys.join(options.delimiter);
  var prefix = options.addQueryPrefix === true ? '?' : '';

  if (options.charsetSentinel) {
    if (options.charset === 'iso-8859-1') {
      // encodeURIComponent('&#10003;'), the "numeric entity" representation of a checkmark
      prefix += 'utf8=%26%2310003%3B&';
    } else {
      // encodeURIComponent('✓')
      prefix += 'utf8=%E2%9C%93&';
    }
  }

  return joined.length > 0 ? prefix + joined : '';
};

/***/ }),
/* 165 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var utils = __webpack_require__(51);

var has = Object.prototype.hasOwnProperty;
var isArray = Array.isArray;
var defaults = {
  allowDots: false,
  allowPrototypes: false,
  arrayLimit: 20,
  charset: 'utf-8',
  charsetSentinel: false,
  comma: false,
  decoder: utils.decode,
  delimiter: '&',
  depth: 5,
  ignoreQueryPrefix: false,
  interpretNumericEntities: false,
  parameterLimit: 1000,
  parseArrays: true,
  plainObjects: false,
  strictNullHandling: false
};

var interpretNumericEntities = function interpretNumericEntities(str) {
  return str.replace(/&#(\d+);/g, function ($0, numberStr) {
    return String.fromCharCode(parseInt(numberStr, 10));
  });
};

var parseArrayValue = function parseArrayValue(val, options) {
  if (val && typeof val === 'string' && options.comma && val.indexOf(',') > -1) {
    return val.split(',');
  }

  return val;
}; // This is what browsers will submit when the ✓ character occurs in an
// application/x-www-form-urlencoded body and the encoding of the page containing
// the form is iso-8859-1, or when the submitted form has an accept-charset
// attribute of iso-8859-1. Presumably also with other charsets that do not contain
// the ✓ character, such as us-ascii.


var isoSentinel = 'utf8=%26%2310003%3B'; // encodeURIComponent('&#10003;')
// These are the percent-encoded utf-8 octets representing a checkmark, indicating that the request actually is utf-8 encoded.

var charsetSentinel = 'utf8=%E2%9C%93'; // encodeURIComponent('✓')

var parseValues = function parseQueryStringValues(str, options) {
  var obj = {};
  var cleanStr = options.ignoreQueryPrefix ? str.replace(/^\?/, '') : str;
  var limit = options.parameterLimit === Infinity ? undefined : options.parameterLimit;
  var parts = cleanStr.split(options.delimiter, limit);
  var skipIndex = -1; // Keep track of where the utf8 sentinel was found

  var i;
  var charset = options.charset;

  if (options.charsetSentinel) {
    for (i = 0; i < parts.length; ++i) {
      if (parts[i].indexOf('utf8=') === 0) {
        if (parts[i] === charsetSentinel) {
          charset = 'utf-8';
        } else if (parts[i] === isoSentinel) {
          charset = 'iso-8859-1';
        }

        skipIndex = i;
        i = parts.length; // The eslint settings do not allow break;
      }
    }
  }

  for (i = 0; i < parts.length; ++i) {
    if (i === skipIndex) {
      continue;
    }

    var part = parts[i];
    var bracketEqualsPos = part.indexOf(']=');
    var pos = bracketEqualsPos === -1 ? part.indexOf('=') : bracketEqualsPos + 1;
    var key, val;

    if (pos === -1) {
      key = options.decoder(part, defaults.decoder, charset, 'key');
      val = options.strictNullHandling ? null : '';
    } else {
      key = options.decoder(part.slice(0, pos), defaults.decoder, charset, 'key');
      val = utils.maybeMap(parseArrayValue(part.slice(pos + 1), options), function (encodedVal) {
        return options.decoder(encodedVal, defaults.decoder, charset, 'value');
      });
    }

    if (val && options.interpretNumericEntities && charset === 'iso-8859-1') {
      val = interpretNumericEntities(val);
    }

    if (part.indexOf('[]=') > -1) {
      val = isArray(val) ? [val] : val;
    }

    if (has.call(obj, key)) {
      obj[key] = utils.combine(obj[key], val);
    } else {
      obj[key] = val;
    }
  }

  return obj;
};

var parseObject = function parseObject(chain, val, options, valuesParsed) {
  var leaf = valuesParsed ? val : parseArrayValue(val, options);

  for (var i = chain.length - 1; i >= 0; --i) {
    var obj;
    var root = chain[i];

    if (root === '[]' && options.parseArrays) {
      obj = [].concat(leaf);
    } else {
      obj = options.plainObjects ? Object.create(null) : {};
      var cleanRoot = root.charAt(0) === '[' && root.charAt(root.length - 1) === ']' ? root.slice(1, -1) : root;
      var index = parseInt(cleanRoot, 10);

      if (!options.parseArrays && cleanRoot === '') {
        obj = {
          0: leaf
        };
      } else if (!isNaN(index) && root !== cleanRoot && String(index) === cleanRoot && index >= 0 && options.parseArrays && index <= options.arrayLimit) {
        obj = [];
        obj[index] = leaf;
      } else {
        obj[cleanRoot] = leaf;
      }
    }

    leaf = obj; // eslint-disable-line no-param-reassign
  }

  return leaf;
};

var parseKeys = function parseQueryStringKeys(givenKey, val, options, valuesParsed) {
  if (!givenKey) {
    return;
  } // Transform dot notation to bracket notation


  var key = options.allowDots ? givenKey.replace(/\.([^.[]+)/g, '[$1]') : givenKey; // The regex chunks

  var brackets = /(\[[^[\]]*])/;
  var child = /(\[[^[\]]*])/g; // Get the parent

  var segment = options.depth > 0 && brackets.exec(key);
  var parent = segment ? key.slice(0, segment.index) : key; // Stash the parent if it exists

  var keys = [];

  if (parent) {
    // If we aren't using plain objects, optionally prefix keys that would overwrite object prototype properties
    if (!options.plainObjects && has.call(Object.prototype, parent)) {
      if (!options.allowPrototypes) {
        return;
      }
    }

    keys.push(parent);
  } // Loop through children appending to the array until we hit depth


  var i = 0;

  while (options.depth > 0 && (segment = child.exec(key)) !== null && i < options.depth) {
    i += 1;

    if (!options.plainObjects && has.call(Object.prototype, segment[1].slice(1, -1))) {
      if (!options.allowPrototypes) {
        return;
      }
    }

    keys.push(segment[1]);
  } // If there's a remainder, just add whatever is left


  if (segment) {
    keys.push('[' + key.slice(segment.index) + ']');
  }

  return parseObject(keys, val, options, valuesParsed);
};

var normalizeParseOptions = function normalizeParseOptions(opts) {
  if (!opts) {
    return defaults;
  }

  if (opts.decoder !== null && opts.decoder !== undefined && typeof opts.decoder !== 'function') {
    throw new TypeError('Decoder has to be a function.');
  }

  if (typeof opts.charset !== 'undefined' && opts.charset !== 'utf-8' && opts.charset !== 'iso-8859-1') {
    throw new TypeError('The charset option must be either utf-8, iso-8859-1, or undefined');
  }

  var charset = typeof opts.charset === 'undefined' ? defaults.charset : opts.charset;
  return {
    allowDots: typeof opts.allowDots === 'undefined' ? defaults.allowDots : !!opts.allowDots,
    allowPrototypes: typeof opts.allowPrototypes === 'boolean' ? opts.allowPrototypes : defaults.allowPrototypes,
    arrayLimit: typeof opts.arrayLimit === 'number' ? opts.arrayLimit : defaults.arrayLimit,
    charset: charset,
    charsetSentinel: typeof opts.charsetSentinel === 'boolean' ? opts.charsetSentinel : defaults.charsetSentinel,
    comma: typeof opts.comma === 'boolean' ? opts.comma : defaults.comma,
    decoder: typeof opts.decoder === 'function' ? opts.decoder : defaults.decoder,
    delimiter: typeof opts.delimiter === 'string' || utils.isRegExp(opts.delimiter) ? opts.delimiter : defaults.delimiter,
    // eslint-disable-next-line no-implicit-coercion, no-extra-parens
    depth: typeof opts.depth === 'number' || opts.depth === false ? +opts.depth : defaults.depth,
    ignoreQueryPrefix: opts.ignoreQueryPrefix === true,
    interpretNumericEntities: typeof opts.interpretNumericEntities === 'boolean' ? opts.interpretNumericEntities : defaults.interpretNumericEntities,
    parameterLimit: typeof opts.parameterLimit === 'number' ? opts.parameterLimit : defaults.parameterLimit,
    parseArrays: opts.parseArrays !== false,
    plainObjects: typeof opts.plainObjects === 'boolean' ? opts.plainObjects : defaults.plainObjects,
    strictNullHandling: typeof opts.strictNullHandling === 'boolean' ? opts.strictNullHandling : defaults.strictNullHandling
  };
};

module.exports = function (str, opts) {
  var options = normalizeParseOptions(opts);

  if (str === '' || str === null || typeof str === 'undefined') {
    return options.plainObjects ? Object.create(null) : {};
  }

  var tempObj = typeof str === 'string' ? parseValues(str, options) : str;
  var obj = options.plainObjects ? Object.create(null) : {}; // Iterate over the keys and setup the new object

  var keys = Object.keys(tempObj);

  for (var i = 0; i < keys.length; ++i) {
    var key = keys[i];
    var newObj = parseKeys(key, tempObj[key], options, typeof str === 'string');
    obj = utils.merge(obj, newObj, options);
  }

  return utils.compact(obj);
};

/***/ }),
/* 166 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


function _typeof2(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof2 = function _typeof2(obj) { return typeof obj; }; } else { _typeof2 = function _typeof2(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof2(obj); }

Object.defineProperty(exports, "__esModule", {
  value: true
});
exports.CopyToClipboard = void 0;

var _react = _interopRequireDefault(__webpack_require__(0));

var _copyToClipboard = _interopRequireDefault(__webpack_require__(167));

function _interopRequireDefault(obj) {
  return obj && obj.__esModule ? obj : {
    "default": obj
  };
}

function _typeof(obj) {
  if (typeof Symbol === "function" && _typeof2(Symbol.iterator) === "symbol") {
    _typeof = function _typeof(obj) {
      return _typeof2(obj);
    };
  } else {
    _typeof = function _typeof(obj) {
      return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : _typeof2(obj);
    };
  }

  return _typeof(obj);
}

function ownKeys(object, enumerableOnly) {
  var keys = Object.keys(object);

  if (Object.getOwnPropertySymbols) {
    var symbols = Object.getOwnPropertySymbols(object);
    if (enumerableOnly) symbols = symbols.filter(function (sym) {
      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
    });
    keys.push.apply(keys, symbols);
  }

  return keys;
}

function _objectSpread(target) {
  for (var i = 1; i < arguments.length; i++) {
    var source = arguments[i] != null ? arguments[i] : {};

    if (i % 2) {
      ownKeys(source, true).forEach(function (key) {
        _defineProperty(target, key, source[key]);
      });
    } else if (Object.getOwnPropertyDescriptors) {
      Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
    } else {
      ownKeys(source).forEach(function (key) {
        Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
      });
    }
  }

  return target;
}

function _objectWithoutProperties(source, excluded) {
  if (source == null) return {};

  var target = _objectWithoutPropertiesLoose(source, excluded);

  var key, i;

  if (Object.getOwnPropertySymbols) {
    var sourceSymbolKeys = Object.getOwnPropertySymbols(source);

    for (i = 0; i < sourceSymbolKeys.length; i++) {
      key = sourceSymbolKeys[i];
      if (excluded.indexOf(key) >= 0) continue;
      if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue;
      target[key] = source[key];
    }
  }

  return target;
}

function _objectWithoutPropertiesLoose(source, excluded) {
  if (source == null) return {};
  var target = {};
  var sourceKeys = Object.keys(source);
  var key, i;

  for (i = 0; i < sourceKeys.length; i++) {
    key = sourceKeys[i];
    if (excluded.indexOf(key) >= 0) continue;
    target[key] = source[key];
  }

  return target;
}

function _classCallCheck(instance, Constructor) {
  if (!(instance instanceof Constructor)) {
    throw new TypeError("Cannot call a class as a function");
  }
}

function _defineProperties(target, props) {
  for (var i = 0; i < props.length; i++) {
    var descriptor = props[i];
    descriptor.enumerable = descriptor.enumerable || false;
    descriptor.configurable = true;
    if ("value" in descriptor) descriptor.writable = true;
    Object.defineProperty(target, descriptor.key, descriptor);
  }
}

function _createClass(Constructor, protoProps, staticProps) {
  if (protoProps) _defineProperties(Constructor.prototype, protoProps);
  if (staticProps) _defineProperties(Constructor, staticProps);
  return Constructor;
}

function _possibleConstructorReturn(self, call) {
  if (call && (_typeof(call) === "object" || typeof call === "function")) {
    return call;
  }

  return _assertThisInitialized(self);
}

function _getPrototypeOf(o) {
  _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) {
    return o.__proto__ || Object.getPrototypeOf(o);
  };
  return _getPrototypeOf(o);
}

function _assertThisInitialized(self) {
  if (self === void 0) {
    throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
  }

  return self;
}

function _inherits(subClass, superClass) {
  if (typeof superClass !== "function" && superClass !== null) {
    throw new TypeError("Super expression must either be null or a function");
  }

  subClass.prototype = Object.create(superClass && superClass.prototype, {
    constructor: {
      value: subClass,
      writable: true,
      configurable: true
    }
  });
  if (superClass) _setPrototypeOf(subClass, superClass);
}

function _setPrototypeOf(o, p) {
  _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) {
    o.__proto__ = p;
    return o;
  };

  return _setPrototypeOf(o, p);
}

function _defineProperty(obj, key, value) {
  if (key in obj) {
    Object.defineProperty(obj, key, {
      value: value,
      enumerable: true,
      configurable: true,
      writable: true
    });
  } else {
    obj[key] = value;
  }

  return obj;
}

var CopyToClipboard = /*#__PURE__*/function (_React$PureComponent) {
  _inherits(CopyToClipboard, _React$PureComponent);

  function CopyToClipboard() {
    var _getPrototypeOf2;

    var _this;

    _classCallCheck(this, CopyToClipboard);

    for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
      args[_key] = arguments[_key];
    }

    _this = _possibleConstructorReturn(this, (_getPrototypeOf2 = _getPrototypeOf(CopyToClipboard)).call.apply(_getPrototypeOf2, [this].concat(args)));

    _defineProperty(_assertThisInitialized(_this), "onClick", function (event) {
      var _this$props = _this.props,
          text = _this$props.text,
          onCopy = _this$props.onCopy,
          children = _this$props.children,
          options = _this$props.options;

      var elem = _react["default"].Children.only(children);

      var result = (0, _copyToClipboard["default"])(text, options);

      if (onCopy) {
        onCopy(text, result);
      } // Bypass onClick if it was present


      if (elem && elem.props && typeof elem.props.onClick === 'function') {
        elem.props.onClick(event);
      }
    });

    return _this;
  }

  _createClass(CopyToClipboard, [{
    key: "render",
    value: function render() {
      var _this$props2 = this.props,
          _text = _this$props2.text,
          _onCopy = _this$props2.onCopy,
          _options = _this$props2.options,
          children = _this$props2.children,
          props = _objectWithoutProperties(_this$props2, ["text", "onCopy", "options", "children"]);

      var elem = _react["default"].Children.only(children);

      return _react["default"].cloneElement(elem, _objectSpread({}, props, {
        onClick: this.onClick
      }));
    }
  }]);

  return CopyToClipboard;
}(_react["default"].PureComponent);

exports.CopyToClipboard = CopyToClipboard;

_defineProperty(CopyToClipboard, "defaultProps", {
  onCopy: undefined,
  options: undefined
});

/***/ }),
/* 167 */
/***/ (function(module, exports, __webpack_require__) {

"use strict";


var deselectCurrent = __webpack_require__(168);

var clipboardToIE11Formatting = {
  "text/plain": "Text",
  "text/html": "Url",
  "default": "Text"
};
var defaultMessage = "Copy to clipboard: #{key}, Enter";

function format(message) {
  var copyKey = (/mac os x/i.test(navigator.userAgent) ? "⌘" : "Ctrl") + "+C";
  return message.replace(/#{\s*key\s*}/g, copyKey);
}

function copy(text, options) {
  var debug,
      message,
      reselectPrevious,
      range,
      selection,
      mark,
      success = false;

  if (!options) {
    options = {};
  }

  debug = options.debug || false;

  try {
    reselectPrevious = deselectCurrent();
    range = document.createRange();
    selection = document.getSelection();
    mark = document.createElement("span");
    mark.textContent = text; // reset user styles for span element

    mark.style.all = "unset"; // prevents scrolling to the end of the page

    mark.style.position = "fixed";
    mark.style.top = 0;
    mark.style.clip = "rect(0, 0, 0, 0)"; // used to preserve spaces and line breaks

    mark.style.whiteSpace = "pre"; // do not inherit user-select (it may be `none`)

    mark.style.webkitUserSelect = "text";
    mark.style.MozUserSelect = "text";
    mark.style.msUserSelect = "text";
    mark.style.userSelect = "text";
    mark.addEventListener("copy", function (e) {
      e.stopPropagation();

      if (options.format) {
        e.preventDefault();

        if (typeof e.clipboardData === "undefined") {
          // IE 11
          debug && console.warn("unable to use e.clipboardData");
          debug && console.warn("trying IE specific stuff");
          window.clipboardData.clearData();
          var format = clipboardToIE11Formatting[options.format] || clipboardToIE11Formatting["default"];
          window.clipboardData.setData(format, text);
        } else {
          // all other browsers
          e.clipboardData.clearData();
          e.clipboardData.setData(options.format, text);
        }
      }

      if (options.onCopy) {
        e.preventDefault();
        options.onCopy(e.clipboardData);
      }
    });
    document.body.appendChild(mark);
    range.selectNodeContents(mark);
    selection.addRange(range);
    var successful = document.execCommand("copy");

    if (!successful) {
      throw new Error("copy command was unsuccessful");
    }

    success = true;
  } catch (err) {
    debug && console.error("unable to copy using execCommand: ", err);
    debug && console.warn("trying IE specific stuff");

    try {
      window.clipboardData.setData(options.format || "text", text);
      options.onCopy && options.onCopy(window.clipboardData);
      success = true;
    } catch (err) {
      debug && console.error("unable to copy using clipboardData: ", err);
      debug && console.error("falling back to prompt");
      message = format("message" in options ? options.message : defaultMessage);
      window.prompt(message, text);
    }
  } finally {
    if (selection) {
      if (typeof selection.removeRange == "function") {
        selection.removeRange(range);
      } else {
        selection.removeAllRanges();
      }
    }

    if (mark) {
      document.body.removeChild(mark);
    }

    reselectPrevious();
  }

  return success;
}

module.exports = copy;

/***/ }),
/* 168 */
/***/ (function(module, exports) {

module.exports = function () {
  var selection = document.getSelection();

  if (!selection.rangeCount) {
    return function () {};
  }

  var active = document.activeElement;
  var ranges = [];

  for (var i = 0; i < selection.rangeCount; i++) {
    ranges.push(selection.getRangeAt(i));
  }

  switch (active.tagName.toUpperCase()) {
    // .toUpperCase handles XHTML
    case 'INPUT':
    case 'TEXTAREA':
      active.blur();
      break;

    default:
      active = null;
      break;
  }

  selection.removeAllRanges();
  return function () {
    selection.type === 'Caret' && selection.removeAllRanges();

    if (!selection.rangeCount) {
      ranges.forEach(function (range) {
        selection.addRange(range);
      });
    }

    active && active.focus();
  };
};

/***/ }),
/* 169 */
/***/ (function(module, exports, __webpack_require__) {

// extracted by mini-css-extract-plugin

/***/ }),
/* 170 */
/***/ (function(module, exports, __webpack_require__) {

// extracted by mini-css-extract-plugin

/***/ }),
/* 171 */
/***/ (function(module, exports, __webpack_require__) {

// extracted by mini-css-extract-plugin

/***/ }),
/* 172 */
/***/ (function(module, exports, __webpack_require__) {

// extracted by mini-css-extract-plugin

/***/ }),
/* 173 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";
// ESM COMPAT FLAG
__webpack_require__.r(__webpack_exports__);

// EXPORTS
__webpack_require__.d(__webpack_exports__, "BasicLayout", function() { return /* reexport */ layout_src_BasicLayout; });
__webpack_require__.d(__webpack_exports__, "RouteContext", function() { return /* reexport */ RouteContext; });
__webpack_require__.d(__webpack_exports__, "PageLoading", function() { return /* reexport */ src_PageLoading; });
__webpack_require__.d(__webpack_exports__, "GridContent", function() { return /* reexport */ src_GridContent; });
__webpack_require__.d(__webpack_exports__, "DefaultHeader", function() { return /* reexport */ src_Header; });
__webpack_require__.d(__webpack_exports__, "TopNavHeader", function() { return /* reexport */ layout_src_TopNavHeader; });
__webpack_require__.d(__webpack_exports__, "DefaultFooter", function() { return /* reexport */ src_Footer; });
__webpack_require__.d(__webpack_exports__, "SettingDrawer", function() { return /* reexport */ layout_src_SettingDrawer; });
__webpack_require__.d(__webpack_exports__, "getPageTitle", function() { return /* reexport */ src_getPageTitle; });
__webpack_require__.d(__webpack_exports__, "PageHeaderWrapper", function() { return /* binding */ PageHeaderWrapper; });
__webpack_require__.d(__webpack_exports__, "getMenuData", function() { return /* reexport */ getMenuData; });
__webpack_require__.d(__webpack_exports__, "PageContainer", function() { return /* reexport */ layout_src_PageContainer; });
__webpack_require__.d(__webpack_exports__, "FooterToolbar", function() { return /* reexport */ layout_src_FooterToolbar; });

// EXTERNAL MODULE: ./packages/layout/src/BasicLayout.less
var src_BasicLayout = __webpack_require__(82);

// EXTERNAL MODULE: external "React"
var external_React_ = __webpack_require__(0);
var external_React_default = /*#__PURE__*/__webpack_require__.n(external_React_);

// EXTERNAL MODULE: external "antd"
var external_antd_ = __webpack_require__(1);

// EXTERNAL MODULE: ./node_modules/classnames/index.js
var classnames = __webpack_require__(2);
var classnames_default = /*#__PURE__*/__webpack_require__.n(classnames);

// EXTERNAL MODULE: ./node_modules/warning/warning.js
var warning = __webpack_require__(78);
var warning_default = /*#__PURE__*/__webpack_require__.n(warning);

// EXTERNAL MODULE: ./node_modules/rc-util/lib/hooks/useMergedState.js
var useMergedState = __webpack_require__(22);
var useMergedState_default = /*#__PURE__*/__webpack_require__.n(useMergedState);

// CONCATENATED MODULE: ./node_modules/use-json-comparison/dist/index.esm.js
function _typeof2(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof2 = function _typeof2(obj) { return typeof obj; }; } else { _typeof2 = function _typeof2(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof2(obj); }



function _typeof(obj) {
  if (typeof Symbol === "function" && _typeof2(Symbol.iterator) === "symbol") {
    _typeof = function _typeof(obj) {
      return _typeof2(obj);
    };
  } else {
    _typeof = function _typeof(obj) {
      return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : _typeof2(obj);
    };
  }

  return _typeof(obj);
}

var getCircularReplacer = function getCircularReplacer() {
  var seen = new WeakSet();
  return function (key, value) {
    if (_typeof(value) === 'object' && value !== null) {
      if (seen.has(value)) {
        return;
      }

      seen.add(value);
    }

    return value;
  };
};
/**
 * 一个更加安全的 stringify，可以解决循环依赖的问题
 * @param value
 */


var stringify = function stringify(value) {
  return JSON.stringify(value, getCircularReplacer());
};

var jsonCompareEquals = function jsonCompareEquals(value, nextValue) {
  try {
    return stringify(value) === stringify(nextValue);
  } catch (error) {// do something
  }

  return false;
};

function useJsonCompareMemoize(value) {
  var ref = Object(external_React_["useRef"])(''); // it can be done by using useMemo as well
  // but useRef is rather cleaner and easier

  if (!jsonCompareEquals(value, ref.current)) {
    ref.current = JSON.stringify(value, getCircularReplacer());
  }

  return ref.current;
}

function useDeepJSONEffect(effect, dependencies) {
  Object(external_React_["useEffect"])(effect, [useJsonCompareMemoize(dependencies)]);
}

/* harmony default export */ var index_esm = (useDeepJSONEffect);

// EXTERNAL MODULE: ./node_modules/react-responsive/dist/react-responsive.js
var react_responsive = __webpack_require__(26);

// CONCATENATED MODULE: ./node_modules/use-media-antd-query/es/index.js
function _slicedToArray(arr, i) {
  return _arrayWithHoles(arr) || _iterableToArrayLimit(arr, i) || _nonIterableRest();
}

function _nonIterableRest() {
  throw new TypeError("Invalid attempt to destructure non-iterable instance");
}

function _iterableToArrayLimit(arr, i) {
  if (!(Symbol.iterator in Object(arr) || Object.prototype.toString.call(arr) === "[object Arguments]")) {
    return;
  }

  var _arr = [];
  var _n = true;
  var _d = false;
  var _e = undefined;

  try {
    for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) {
      _arr.push(_s.value);

      if (i && _arr.length === i) break;
    }
  } catch (err) {
    _d = true;
    _e = err;
  } finally {
    try {
      if (!_n && _i["return"] != null) _i["return"]();
    } finally {
      if (_d) throw _e;
    }
  }

  return _arr;
}

function _arrayWithHoles(arr) {
  if (Array.isArray(arr)) return arr;
}



var MediaQueryEnum = {
  xs: {
    maxWidth: 575,
    matchMedia: '(max-width: 575px)'
  },
  sm: {
    minWidth: 576,
    maxWidth: 767,
    matchMedia: '(min-width: 576px) and (max-width: 767px)'
  },
  md: {
    minWidth: 768,
    maxWidth: 991,
    matchMedia: '(min-width: 768px) and (max-width: 991px)'
  },
  lg: {
    minWidth: 992,
    maxWidth: 1199,
    matchMedia: '(min-width: 992px) and (max-width: 1199px)'
  },
  xl: {
    minWidth: 1200,
    maxWidth: 1599,
    matchMedia: '(min-width: 1200px) and (max-width: 1599px)'
  },
  xxl: {
    minWidth: 1600,
    matchMedia: '(min-width: 1600px)'
  }
};
/**
 * loop query screen className
 * Array.find will throw a error
 * `Rendered more hooks than during the previous render.`
 * So should use Array.forEach
 */

var getScreenClassName = function getScreenClassName() {
  var className = 'md'; // support ssr

  if (typeof window === 'undefined') {
    return className;
  }

  var mediaQueryKey = Object.keys(MediaQueryEnum).find(function (key) {
    var matchMedia = MediaQueryEnum[key].matchMedia;

    if (window.matchMedia(matchMedia).matches) {
      return true;
    }

    return false;
  });
  className = mediaQueryKey;
  return className;
};

var es_useMedia = function useMedia() {
  var isMd = Object(react_responsive["useMediaQuery"])(MediaQueryEnum.md);
  var isLg = Object(react_responsive["useMediaQuery"])(MediaQueryEnum.lg);
  var isXxl = Object(react_responsive["useMediaQuery"])(MediaQueryEnum.xxl);
  var isXl = Object(react_responsive["useMediaQuery"])(MediaQueryEnum.xl);
  var isSm = Object(react_responsive["useMediaQuery"])(MediaQueryEnum.sm);
  var isXs = Object(react_responsive["useMediaQuery"])(MediaQueryEnum.xs);

  var _useState = Object(external_React_["useState"])(getScreenClassName()),
      _useState2 = _slicedToArray(_useState, 2),
      colSpan = _useState2[0],
      setColSpan = _useState2[1];

  Object(external_React_["useEffect"])(function () {
    if (isXxl) {
      setColSpan('xxl');
      return;
    }

    if (isXl) {
      setColSpan('xl');
      return;
    }

    if (isLg) {
      setColSpan('lg');
      return;
    }

    if (isMd) {
      setColSpan('md');
      return;
    }

    if (isSm) {
      setColSpan('sm');
      return;
    }

    if (isXs) {
      setColSpan('xs');
      return;
    }

    setColSpan('md');
  }, [isMd, isLg, isXxl, isXl, isSm, isXs]);
  return colSpan;
};

/* harmony default export */ var es = (es_useMedia);
// EXTERNAL MODULE: ./node_modules/antd/es/space/style/index.css
var space_style = __webpack_require__(83);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/extends.js
var helpers_extends = __webpack_require__(3);
var extends_default = /*#__PURE__*/__webpack_require__.n(helpers_extends);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/defineProperty.js
var defineProperty = __webpack_require__(13);
var defineProperty_default = /*#__PURE__*/__webpack_require__.n(defineProperty);

// EXTERNAL MODULE: ./node_modules/rc-util/es/Children/toArray.js
var toArray = __webpack_require__(28);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/classCallCheck.js
var classCallCheck = __webpack_require__(33);
var classCallCheck_default = /*#__PURE__*/__webpack_require__.n(classCallCheck);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/createClass.js
var createClass = __webpack_require__(34);
var createClass_default = /*#__PURE__*/__webpack_require__.n(createClass);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/inherits.js
var inherits = __webpack_require__(35);
var inherits_default = /*#__PURE__*/__webpack_require__.n(inherits);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/createSuper.js
var createSuper = __webpack_require__(41);
var createSuper_default = /*#__PURE__*/__webpack_require__.n(createSuper);

// CONCATENATED MODULE: ./node_modules/rc-pagination/es/locale/en_US.js
/* harmony default export */ var en_US = ({
  // Options.jsx
  items_per_page: '/ page',
  jump_to: 'Go to',
  jump_to_confirm: 'confirm',
  page: '',
  // Pagination.jsx
  prev_page: 'Previous Page',
  next_page: 'Next Page',
  prev_5: 'Previous 5 Pages',
  next_5: 'Next 5 Pages',
  prev_3: 'Previous 3 Pages',
  next_3: 'Next 3 Pages'
});
// CONCATENATED MODULE: ./node_modules/rc-picker/es/locale/en_US.js
var en_US_locale = {
  locale: 'en_US',
  today: 'Today',
  now: 'Now',
  backToToday: 'Back to today',
  ok: 'Ok',
  clear: 'Clear',
  month: 'Month',
  year: 'Year',
  timeSelect: 'select time',
  dateSelect: 'select date',
  weekSelect: 'Choose a week',
  monthSelect: 'Choose a month',
  yearSelect: 'Choose a year',
  decadeSelect: 'Choose a decade',
  yearFormat: 'YYYY',
  dateFormat: 'M/D/YYYY',
  dayFormat: 'D',
  dateTimeFormat: 'M/D/YYYY HH:mm:ss',
  monthBeforeYear: true,
  previousMonth: 'Previous month (PageUp)',
  nextMonth: 'Next month (PageDown)',
  previousYear: 'Last year (Control + left)',
  nextYear: 'Next year (Control + right)',
  previousDecade: 'Last decade',
  nextDecade: 'Next decade',
  previousCentury: 'Last century',
  nextCentury: 'Next century'
};
/* harmony default export */ var locale_en_US = (en_US_locale);
// CONCATENATED MODULE: ./node_modules/antd/es/time-picker/locale/en_US.js
var locale_en_US_locale = {
  placeholder: 'Select time',
  rangePlaceholder: ['Start time', 'End time']
};
/* harmony default export */ var time_picker_locale_en_US = (locale_en_US_locale);
// CONCATENATED MODULE: ./node_modules/antd/es/date-picker/locale/en_US.js


 // Merge into a locale object

var date_picker_locale_en_US_locale = {
  lang: extends_default()({
    placeholder: 'Select date',
    yearPlaceholder: 'Select year',
    quarterPlaceholder: 'Select quarter',
    monthPlaceholder: 'Select month',
    weekPlaceholder: 'Select week',
    rangePlaceholder: ['Start date', 'End date'],
    rangeYearPlaceholder: ['Start year', 'End year'],
    rangeMonthPlaceholder: ['Start month', 'End month'],
    rangeWeekPlaceholder: ['Start week', 'End week']
  }, locale_en_US),
  timePickerLocale: extends_default()({}, time_picker_locale_en_US)
}; // All settings at:
// https://github.com/ant-design/ant-design/blob/master/components/date-picker/locale/example.json

/* harmony default export */ var date_picker_locale_en_US = (date_picker_locale_en_US_locale);
// CONCATENATED MODULE: ./node_modules/antd/es/calendar/locale/en_US.js

/* harmony default export */ var calendar_locale_en_US = (date_picker_locale_en_US);
// CONCATENATED MODULE: ./node_modules/antd/es/locale/default.js
/* eslint-disable no-template-curly-in-string */




var typeTemplate = '${label} is not a valid ${type}';
var localeValues = {
  locale: 'en',
  Pagination: en_US,
  DatePicker: date_picker_locale_en_US,
  TimePicker: time_picker_locale_en_US,
  Calendar: calendar_locale_en_US,
  global: {
    placeholder: 'Please select'
  },
  Table: {
    filterTitle: 'Filter menu',
    filterConfirm: 'OK',
    filterReset: 'Reset',
    filterEmptyText: 'No filters',
    emptyText: 'No data',
    selectAll: 'Select current page',
    selectInvert: 'Invert current page',
    selectionAll: 'Select all data',
    sortTitle: 'Sort',
    expand: 'Expand row',
    collapse: 'Collapse row',
    triggerDesc: 'Click sort by descend',
    triggerAsc: 'Click sort by ascend',
    cancelSort: 'Click to cancel sort'
  },
  Modal: {
    okText: 'OK',
    cancelText: 'Cancel',
    justOkText: 'OK'
  },
  Popconfirm: {
    okText: 'OK',
    cancelText: 'Cancel'
  },
  Transfer: {
    titles: ['', ''],
    searchPlaceholder: 'Search here',
    itemUnit: 'item',
    itemsUnit: 'items',
    remove: 'Remove',
    selectCurrent: 'Select current page',
    removeCurrent: 'Remove current page',
    selectAll: 'Select all data',
    removeAll: 'Remove all data',
    selectInvert: 'Invert current page'
  },
  Upload: {
    uploading: 'Uploading...',
    removeFile: 'Remove file',
    uploadError: 'Upload error',
    previewFile: 'Preview file',
    downloadFile: 'Download file'
  },
  Empty: {
    description: 'No Data'
  },
  Icon: {
    icon: 'icon'
  },
  Text: {
    edit: 'Edit',
    copy: 'Copy',
    copied: 'Copied',
    expand: 'Expand'
  },
  PageHeader: {
    back: 'Back'
  },
  Form: {
    defaultValidateMessages: {
      "default": 'Field validation error ${label}',
      required: 'Please enter ${label}',
      "enum": '${label} must be one of [${enum}]',
      whitespace: '${label} cannot be a blank character',
      date: {
        format: '${label} date format is invalid',
        parse: '${label} cannot be converted to a date',
        invalid: '${label} is an invalid date'
      },
      types: {
        string: typeTemplate,
        method: typeTemplate,
        array: typeTemplate,
        object: typeTemplate,
        number: typeTemplate,
        date: typeTemplate,
        "boolean": typeTemplate,
        integer: typeTemplate,
        "float": typeTemplate,
        regexp: typeTemplate,
        email: typeTemplate,
        url: typeTemplate,
        hex: typeTemplate
      },
      string: {
        len: '${label} must be ${len} characters',
        min: '${label} at least ${min} characters',
        max: '${label} up to ${max} characters',
        range: '${label} must be between ${min}-${max} characters'
      },
      number: {
        len: '${label} must be equal to ${len}',
        min: '${label} minimum value is ${min}',
        max: '${label} maximum value is ${max}',
        range: '${label} must be between ${min}-${max}'
      },
      array: {
        len: 'Must be ${len} ${label}',
        min: 'At least ${min} ${label}',
        max: 'At most ${max} ${label}',
        range: 'The amount of ${label} must be between ${min}-${max}'
      },
      pattern: {
        mismatch: '${label} does not match the pattern ${pattern}'
      }
    }
  }
};
/* harmony default export */ var locale_default = (localeValues);
// CONCATENATED MODULE: ./node_modules/antd/es/locale-provider/default.js

/* harmony default export */ var locale_provider_default = (locale_default);
// CONCATENATED MODULE: ./node_modules/antd/es/locale-provider/context.js

var LocaleContext = /*#__PURE__*/Object(external_React_["createContext"])(undefined);
/* harmony default export */ var locale_provider_context = (LocaleContext);
// CONCATENATED MODULE: ./node_modules/antd/es/locale-provider/LocaleReceiver.js









var LocaleReceiver_LocaleReceiver = /*#__PURE__*/function (_React$Component) {
  inherits_default()(LocaleReceiver, _React$Component);

  var _super = createSuper_default()(LocaleReceiver);

  function LocaleReceiver() {
    classCallCheck_default()(this, LocaleReceiver);

    return _super.apply(this, arguments);
  }

  createClass_default()(LocaleReceiver, [{
    key: "getLocale",
    value: function getLocale() {
      var _this$props = this.props,
          componentName = _this$props.componentName,
          defaultLocale = _this$props.defaultLocale;
      var locale = defaultLocale || locale_provider_default[componentName || 'global'];
      var antLocale = this.context;
      var localeFromContext = componentName && antLocale ? antLocale[componentName] : {};
      return extends_default()(extends_default()({}, typeof locale === 'function' ? locale() : locale), localeFromContext || {});
    }
  }, {
    key: "getLocaleCode",
    value: function getLocaleCode() {
      var antLocale = this.context;
      var localeCode = antLocale && antLocale.locale; // Had use LocaleProvide but didn't set locale

      if (antLocale && antLocale.exist && !localeCode) {
        return locale_provider_default.locale;
      }

      return localeCode;
    }
  }, {
    key: "render",
    value: function render() {
      return this.props.children(this.getLocale(), this.getLocaleCode(), this.context);
    }
  }]);

  return LocaleReceiver;
}(external_React_["Component"]);


LocaleReceiver_LocaleReceiver.defaultProps = {
  componentName: 'global'
};
LocaleReceiver_LocaleReceiver.contextType = locale_provider_context;
// CONCATENATED MODULE: ./node_modules/antd/es/empty/empty.js



var empty_Empty = function Empty() {
  var _React$useContext = external_React_["useContext"](ConfigContext),
      getPrefixCls = _React$useContext.getPrefixCls;

  var prefixCls = getPrefixCls('empty-img-default');
  return /*#__PURE__*/external_React_["createElement"]("svg", {
    className: prefixCls,
    width: "184",
    height: "152",
    viewBox: "0 0 184 152",
    xmlns: "http://www.w3.org/2000/svg"
  }, /*#__PURE__*/external_React_["createElement"]("g", {
    fill: "none",
    fillRule: "evenodd"
  }, /*#__PURE__*/external_React_["createElement"]("g", {
    transform: "translate(24 31.67)"
  }, /*#__PURE__*/external_React_["createElement"]("ellipse", {
    className: "".concat(prefixCls, "-ellipse"),
    cx: "67.797",
    cy: "106.89",
    rx: "67.797",
    ry: "12.668"
  }), /*#__PURE__*/external_React_["createElement"]("path", {
    className: "".concat(prefixCls, "-path-1"),
    d: "M122.034 69.674L98.109 40.229c-1.148-1.386-2.826-2.225-4.593-2.225h-51.44c-1.766 0-3.444.839-4.592 2.225L13.56 69.674v15.383h108.475V69.674z"
  }), /*#__PURE__*/external_React_["createElement"]("path", {
    className: "".concat(prefixCls, "-path-2"),
    d: "M101.537 86.214L80.63 61.102c-1.001-1.207-2.507-1.867-4.048-1.867H31.724c-1.54 0-3.047.66-4.048 1.867L6.769 86.214v13.792h94.768V86.214z",
    transform: "translate(13.56)"
  }), /*#__PURE__*/external_React_["createElement"]("path", {
    className: "".concat(prefixCls, "-path-3"),
    d: "M33.83 0h67.933a4 4 0 0 1 4 4v93.344a4 4 0 0 1-4 4H33.83a4 4 0 0 1-4-4V4a4 4 0 0 1 4-4z"
  }), /*#__PURE__*/external_React_["createElement"]("path", {
    className: "".concat(prefixCls, "-path-4"),
    d: "M42.678 9.953h50.237a2 2 0 0 1 2 2V36.91a2 2 0 0 1-2 2H42.678a2 2 0 0 1-2-2V11.953a2 2 0 0 1 2-2zM42.94 49.767h49.713a2.262 2.262 0 1 1 0 4.524H42.94a2.262 2.262 0 0 1 0-4.524zM42.94 61.53h49.713a2.262 2.262 0 1 1 0 4.525H42.94a2.262 2.262 0 0 1 0-4.525zM121.813 105.032c-.775 3.071-3.497 5.36-6.735 5.36H20.515c-3.238 0-5.96-2.29-6.734-5.36a7.309 7.309 0 0 1-.222-1.79V69.675h26.318c2.907 0 5.25 2.448 5.25 5.42v.04c0 2.971 2.37 5.37 5.277 5.37h34.785c2.907 0 5.277-2.421 5.277-5.393V75.1c0-2.972 2.343-5.426 5.25-5.426h26.318v33.569c0 .617-.077 1.216-.221 1.789z"
  })), /*#__PURE__*/external_React_["createElement"]("path", {
    className: "".concat(prefixCls, "-path-5"),
    d: "M149.121 33.292l-6.83 2.65a1 1 0 0 1-1.317-1.23l1.937-6.207c-2.589-2.944-4.109-6.534-4.109-10.408C138.802 8.102 148.92 0 161.402 0 173.881 0 184 8.102 184 18.097c0 9.995-10.118 18.097-22.599 18.097-4.528 0-8.744-1.066-12.28-2.902z"
  }), /*#__PURE__*/external_React_["createElement"]("g", {
    className: "".concat(prefixCls, "-g"),
    transform: "translate(149.65 15.383)"
  }, /*#__PURE__*/external_React_["createElement"]("ellipse", {
    cx: "20.654",
    cy: "3.167",
    rx: "2.849",
    ry: "2.815"
  }), /*#__PURE__*/external_React_["createElement"]("path", {
    d: "M5.698 5.63H0L2.898.704zM9.259.704h4.985V5.63H9.259z"
  }))));
};

/* harmony default export */ var empty = (empty_Empty);
// CONCATENATED MODULE: ./node_modules/antd/es/empty/simple.js



var simple_Simple = function Simple() {
  var _React$useContext = external_React_["useContext"](ConfigContext),
      getPrefixCls = _React$useContext.getPrefixCls;

  var prefixCls = getPrefixCls('empty-img-simple');
  return /*#__PURE__*/external_React_["createElement"]("svg", {
    className: prefixCls,
    width: "64",
    height: "41",
    viewBox: "0 0 64 41",
    xmlns: "http://www.w3.org/2000/svg"
  }, /*#__PURE__*/external_React_["createElement"]("g", {
    transform: "translate(0 1)",
    fill: "none",
    fillRule: "evenodd"
  }, /*#__PURE__*/external_React_["createElement"]("ellipse", {
    className: "".concat(prefixCls, "-ellipse"),
    cx: "32",
    cy: "33",
    rx: "32",
    ry: "7"
  }), /*#__PURE__*/external_React_["createElement"]("g", {
    className: "".concat(prefixCls, "-g"),
    fillRule: "nonzero"
  }, /*#__PURE__*/external_React_["createElement"]("path", {
    d: "M55 12.76L44.854 1.258C44.367.474 43.656 0 42.907 0H21.093c-.749 0-1.46.474-1.947 1.257L9 12.761V22h46v-9.24z"
  }), /*#__PURE__*/external_React_["createElement"]("path", {
    d: "M41.613 15.931c0-1.605.994-2.93 2.227-2.931H55v18.137C55 33.26 53.68 35 52.05 35h-40.1C10.32 35 9 33.259 9 31.137V13h11.16c1.233 0 2.227 1.323 2.227 2.928v.022c0 1.605 1.005 2.901 2.237 2.901h14.752c1.232 0 2.237-1.308 2.237-2.913v-.007z",
    className: "".concat(prefixCls, "-path")
  }))));
};

/* harmony default export */ var simple = (simple_Simple);
// CONCATENATED MODULE: ./node_modules/antd/es/empty/index.js



var __rest = undefined && undefined.__rest || function (s, e) {
  var t = {};

  for (var p in s) {
    if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0) t[p] = s[p];
  }

  if (s != null && typeof Object.getOwnPropertySymbols === "function") for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {
    if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i])) t[p[i]] = s[p[i]];
  }
  return t;
};







var defaultEmptyImg = /*#__PURE__*/external_React_["createElement"](empty, null);
var simpleEmptyImg = /*#__PURE__*/external_React_["createElement"](simple, null);

var es_empty_Empty = function Empty(props) {
  return /*#__PURE__*/external_React_["createElement"](ConfigConsumer, null, function (_ref) {
    var getPrefixCls = _ref.getPrefixCls,
        direction = _ref.direction;

    var className = props.className,
        customizePrefixCls = props.prefixCls,
        _props$image = props.image,
        image = _props$image === void 0 ? defaultEmptyImg : _props$image,
        description = props.description,
        children = props.children,
        imageStyle = props.imageStyle,
        restProps = __rest(props, ["className", "prefixCls", "image", "description", "children", "imageStyle"]);

    return /*#__PURE__*/external_React_["createElement"](LocaleReceiver_LocaleReceiver, {
      componentName: "Empty"
    }, function (locale) {
      var _classNames;

      var prefixCls = getPrefixCls('empty', customizePrefixCls);
      var des = typeof description !== 'undefined' ? description : locale.description;
      var alt = typeof des === 'string' ? des : 'empty';
      var imageNode = null;

      if (typeof image === 'string') {
        imageNode = /*#__PURE__*/external_React_["createElement"]("img", {
          alt: alt,
          src: image
        });
      } else {
        imageNode = image;
      }

      return /*#__PURE__*/external_React_["createElement"]("div", extends_default()({
        className: classnames_default()(prefixCls, (_classNames = {}, defineProperty_default()(_classNames, "".concat(prefixCls, "-normal"), image === simpleEmptyImg), defineProperty_default()(_classNames, "".concat(prefixCls, "-rtl"), direction === 'rtl'), _classNames), className)
      }, restProps), /*#__PURE__*/external_React_["createElement"]("div", {
        className: "".concat(prefixCls, "-image"),
        style: imageStyle
      }, imageNode), des && /*#__PURE__*/external_React_["createElement"]("p", {
        className: "".concat(prefixCls, "-description")
      }, des), children && /*#__PURE__*/external_React_["createElement"]("div", {
        className: "".concat(prefixCls, "-footer")
      }, children));
    });
  });
};

es_empty_Empty.PRESENTED_IMAGE_DEFAULT = defaultEmptyImg;
es_empty_Empty.PRESENTED_IMAGE_SIMPLE = simpleEmptyImg;
/* harmony default export */ var es_empty = (es_empty_Empty);
// CONCATENATED MODULE: ./node_modules/antd/es/config-provider/renderEmpty.js




var renderEmpty_renderEmpty = function renderEmpty(componentName) {
  return /*#__PURE__*/external_React_["createElement"](ConfigConsumer, null, function (_ref) {
    var getPrefixCls = _ref.getPrefixCls;
    var prefix = getPrefixCls('empty');

    switch (componentName) {
      case 'Table':
      case 'List':
        return /*#__PURE__*/external_React_["createElement"](es_empty, {
          image: es_empty.PRESENTED_IMAGE_SIMPLE
        });

      case 'Select':
      case 'TreeSelect':
      case 'Cascader':
      case 'Transfer':
      case 'Mentions':
        return /*#__PURE__*/external_React_["createElement"](es_empty, {
          image: es_empty.PRESENTED_IMAGE_SIMPLE,
          className: "".concat(prefix, "-small")
        });

      default:
        return /*#__PURE__*/external_React_["createElement"](es_empty, null);
    }
  });
};

/* harmony default export */ var config_provider_renderEmpty = (renderEmpty_renderEmpty);
// CONCATENATED MODULE: ./node_modules/antd/es/config-provider/context.js



var ConfigContext = /*#__PURE__*/external_React_["createContext"]({
  // We provide a default function for Context without provider
  getPrefixCls: function getPrefixCls(suffixCls, customizePrefixCls) {
    if (customizePrefixCls) return customizePrefixCls;
    return suffixCls ? "ant-".concat(suffixCls) : 'ant';
  },
  renderEmpty: config_provider_renderEmpty
});
var ConfigConsumer = ConfigContext.Consumer;
function withConfigConsumer(config) {
  return function withConfigConsumerFunc(Component) {
    // Wrap with ConfigConsumer. Since we need compatible with react 15, be care when using ref methods
    var SFC = function SFC(props) {
      return /*#__PURE__*/external_React_["createElement"](ConfigConsumer, null, function (configProps) {
        var basicPrefixCls = config.prefixCls;
        var getPrefixCls = configProps.getPrefixCls;
        var customizePrefixCls = props.prefixCls;
        var prefixCls = getPrefixCls(basicPrefixCls, customizePrefixCls);
        return /*#__PURE__*/external_React_["createElement"](Component, extends_default()({}, configProps, props, {
          prefixCls: prefixCls
        }));
      });
    };

    var cons = Component.constructor;
    var name = cons && cons.displayName || Component.name || 'Component';
    SFC.displayName = "withConfigConsumer(".concat(name, ")");
    return SFC;
  };
}
// CONCATENATED MODULE: ./node_modules/antd/es/space/index.js



var space_rest = undefined && undefined.__rest || function (s, e) {
  var t = {};

  for (var p in s) {
    if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0) t[p] = s[p];
  }

  if (s != null && typeof Object.getOwnPropertySymbols === "function") for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) {
    if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i])) t[p[i]] = s[p[i]];
  }
  return t;
};





var spaceSize = {
  small: 8,
  middle: 16,
  large: 24
};

var space_Space = function Space(props) {
  var _classNames;

  var _React$useContext = external_React_["useContext"](ConfigContext),
      getPrefixCls = _React$useContext.getPrefixCls,
      space = _React$useContext.space,
      directionConfig = _React$useContext.direction;

  var _props$size = props.size,
      size = _props$size === void 0 ? (space === null || space === void 0 ? void 0 : space.size) || 'small' : _props$size,
      align = props.align,
      className = props.className,
      children = props.children,
      _props$direction = props.direction,
      direction = _props$direction === void 0 ? 'horizontal' : _props$direction,
      customizePrefixCls = props.prefixCls,
      otherProps = space_rest(props, ["size", "align", "className", "children", "direction", "prefixCls"]);

  var items = Object(toArray["a" /* default */])(children);
  var len = items.length;

  if (len === 0) {
    return null;
  }

  var mergedAlign = align === undefined && direction === 'horizontal' ? 'center' : align;
  var prefixCls = getPrefixCls('space', customizePrefixCls);
  var cn = classnames_default()(prefixCls, "".concat(prefixCls, "-").concat(direction), (_classNames = {}, defineProperty_default()(_classNames, "".concat(prefixCls, "-rtl"), directionConfig === 'rtl'), defineProperty_default()(_classNames, "".concat(prefixCls, "-align-").concat(mergedAlign), mergedAlign), _classNames), className);
  var itemClassName = "".concat(prefixCls, "-item");
  var marginDirection = directionConfig === 'rtl' ? 'marginLeft' : 'marginRight';
  return /*#__PURE__*/external_React_["createElement"]("div", extends_default()({
    className: cn
  }, otherProps), items.map(function (child, i) {
    return /*#__PURE__*/external_React_["createElement"]("div", {
      className: itemClassName // eslint-disable-next-line react/no-array-index-key
      ,
      key: "".concat(itemClassName, "-").concat(i),
      style: i === len - 1 ? {} : defineProperty_default()({}, direction === 'vertical' ? 'marginBottom' : marginDirection, typeof size === 'string' ? spaceSize[size] : size)
    }, child);
  }));
};

/* harmony default export */ var es_space = (space_Space);
// EXTERNAL MODULE: ./node_modules/antd/es/tooltip/style/index.css
var tooltip_style = __webpack_require__(85);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/slicedToArray.js
var slicedToArray = __webpack_require__(24);
var slicedToArray_default = /*#__PURE__*/__webpack_require__.n(slicedToArray);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/defineProperty.js
var esm_defineProperty = __webpack_require__(5);

// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/objectSpread2.js


function ownKeys(object, enumerableOnly) {
  var keys = Object.keys(object);

  if (Object.getOwnPropertySymbols) {
    var symbols = Object.getOwnPropertySymbols(object);
    if (enumerableOnly) symbols = symbols.filter(function (sym) {
      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
    });
    keys.push.apply(keys, symbols);
  }

  return keys;
}

function _objectSpread2(target) {
  for (var i = 1; i < arguments.length; i++) {
    var source = arguments[i] != null ? arguments[i] : {};

    if (i % 2) {
      ownKeys(Object(source), true).forEach(function (key) {
        Object(esm_defineProperty["a" /* default */])(target, key, source[key]);
      });
    } else if (Object.getOwnPropertyDescriptors) {
      Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
    } else {
      ownKeys(Object(source)).forEach(function (key) {
        Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
      });
    }
  }

  return target;
}
// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/classCallCheck.js
var esm_classCallCheck = __webpack_require__(9);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/createClass.js
var esm_createClass = __webpack_require__(11);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/assertThisInitialized.js
var assertThisInitialized = __webpack_require__(25);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/inherits.js + 1 modules
var esm_inherits = __webpack_require__(15);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/getPrototypeOf.js
var getPrototypeOf = __webpack_require__(16);

// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/isNativeReflectConstruct.js
function _isNativeReflectConstruct() {
  if (typeof Reflect === "undefined" || !Reflect.construct) return false;
  if (Reflect.construct.sham) return false;
  if (typeof Proxy === "function") return true;

  try {
    Date.prototype.toString.call(Reflect.construct(Date, [], function () {}));
    return true;
  } catch (e) {
    return false;
  }
}
// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/possibleConstructorReturn.js
var possibleConstructorReturn = __webpack_require__(21);

// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/createSuper.js



function _createSuper(Derived) {
  var hasNativeReflectConstruct = _isNativeReflectConstruct();
  return function _createSuperInternal() {
    var Super = Object(getPrototypeOf["a" /* default */])(Derived),
        result;

    if (hasNativeReflectConstruct) {
      var NewTarget = Object(getPrototypeOf["a" /* default */])(this).constructor;
      result = Reflect.construct(Super, arguments, NewTarget);
    } else {
      result = Super.apply(this, arguments);
    }

    return Object(possibleConstructorReturn["a" /* default */])(this, result);
  };
}
// EXTERNAL MODULE: external "ReactDOM"
var external_ReactDOM_ = __webpack_require__(14);
var external_ReactDOM_default = /*#__PURE__*/__webpack_require__.n(external_ReactDOM_);

// CONCATENATED MODULE: ./node_modules/rc-util/es/Dom/contains.js
function contains(root, n) {
  var node = n;

  while (node) {
    if (node === root) {
      return true;
    }

    node = node.parentNode;
  }

  return false;
}
// CONCATENATED MODULE: ./node_modules/rc-util/es/Dom/findDOMNode.js

/**
 * Return if a node is a DOM node. Else will return by `findDOMNode`
 */

function findDOMNode(node) {
  if (node instanceof HTMLElement) {
    return node;
  }

  return external_ReactDOM_default.a.findDOMNode(node);
}
// EXTERNAL MODULE: ./node_modules/react-is/index.js
var react_is = __webpack_require__(44);

// CONCATENATED MODULE: ./node_modules/rc-util/es/ref.js
function ref_typeof(obj) {
  "@babel/helpers - typeof";

  if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") {
    ref_typeof = function _typeof(obj) {
      return typeof obj;
    };
  } else {
    ref_typeof = function _typeof(obj) {
      return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj;
    };
  }

  return ref_typeof(obj);
}


function fillRef(ref, node) {
  if (typeof ref === 'function') {
    ref(node);
  } else if (ref_typeof(ref) === 'object' && ref && 'current' in ref) {
    ref.current = node;
  }
}
/**
 * Merge refs into one ref function to support ref passing.
 */

function composeRef() {
  for (var _len = arguments.length, refs = new Array(_len), _key = 0; _key < _len; _key++) {
    refs[_key] = arguments[_key];
  }

  return function (node) {
    refs.forEach(function (ref) {
      fillRef(ref, node);
    });
  };
}
function supportRef(nodeOrComponent) {
  var _type$prototype, _nodeOrComponent$prot;

  var type = Object(react_is["isMemo"])(nodeOrComponent) ? nodeOrComponent.type.type : nodeOrComponent.type; // Function component node

  if (typeof type === 'function' && !((_type$prototype = type.prototype) === null || _type$prototype === void 0 ? void 0 : _type$prototype.render)) {
    return false;
  } // Class component


  if (typeof nodeOrComponent === 'function' && !((_nodeOrComponent$prot = nodeOrComponent.prototype) === null || _nodeOrComponent$prot === void 0 ? void 0 : _nodeOrComponent$prot.render)) {
    return false;
  }

  return true;
}
/* eslint-enable */
// CONCATENATED MODULE: ./node_modules/rc-util/es/Dom/addEventListener.js

function addEventListenerWrap(target, eventType, cb, option) {
  /* eslint camelcase: 2 */
  var callback = external_ReactDOM_default.a.unstable_batchedUpdates ? function run(e) {
    external_ReactDOM_default.a.unstable_batchedUpdates(cb, e);
  } : cb;

  if (target.addEventListener) {
    target.addEventListener(eventType, callback, option);
  }

  return {
    remove: function remove() {
      if (target.removeEventListener) {
        target.removeEventListener(eventType, callback);
      }
    }
  };
}
// CONCATENATED MODULE: ./node_modules/rc-util/es/Portal.js
function Portal_typeof(obj) {
  "@babel/helpers - typeof";

  if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") {
    Portal_typeof = function _typeof(obj) {
      return typeof obj;
    };
  } else {
    Portal_typeof = function _typeof(obj) {
      return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj;
    };
  }

  return Portal_typeof(obj);
}

function _classCallCheck(instance, Constructor) {
  if (!(instance instanceof Constructor)) {
    throw new TypeError("Cannot call a class as a function");
  }
}

function _defineProperties(target, props) {
  for (var i = 0; i < props.length; i++) {
    var descriptor = props[i];
    descriptor.enumerable = descriptor.enumerable || false;
    descriptor.configurable = true;
    if ("value" in descriptor) descriptor.writable = true;
    Object.defineProperty(target, descriptor.key, descriptor);
  }
}

function _createClass(Constructor, protoProps, staticProps) {
  if (protoProps) _defineProperties(Constructor.prototype, protoProps);
  if (staticProps) _defineProperties(Constructor, staticProps);
  return Constructor;
}

function _inherits(subClass, superClass) {
  if (typeof superClass !== "function" && superClass !== null) {
    throw new TypeError("Super expression must either be null or a function");
  }

  subClass.prototype = Object.create(superClass && superClass.prototype, {
    constructor: {
      value: subClass,
      writable: true,
      configurable: true
    }
  });
  if (superClass) _setPrototypeOf(subClass, superClass);
}

function _setPrototypeOf(o, p) {
  _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) {
    o.__proto__ = p;
    return o;
  };

  return _setPrototypeOf(o, p);
}

function Portal_createSuper(Derived) {
  var hasNativeReflectConstruct = Portal_isNativeReflectConstruct();

  return function _createSuperInternal() {
    var Super = _getPrototypeOf(Derived),
        result;

    if (hasNativeReflectConstruct) {
      var NewTarget = _getPrototypeOf(this).constructor;

      result = Reflect.construct(Super, arguments, NewTarget);
    } else {
      result = Super.apply(this, arguments);
    }

    return _possibleConstructorReturn(this, result);
  };
}

function _possibleConstructorReturn(self, call) {
  if (call && (Portal_typeof(call) === "object" || typeof call === "function")) {
    return call;
  }

  return _assertThisInitialized(self);
}

function _assertThisInitialized(self) {
  if (self === void 0) {
    throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
  }

  return self;
}

function Portal_isNativeReflectConstruct() {
  if (typeof Reflect === "undefined" || !Reflect.construct) return false;
  if (Reflect.construct.sham) return false;
  if (typeof Proxy === "function") return true;

  try {
    Date.prototype.toString.call(Reflect.construct(Date, [], function () {}));
    return true;
  } catch (e) {
    return false;
  }
}

function _getPrototypeOf(o) {
  _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) {
    return o.__proto__ || Object.getPrototypeOf(o);
  };
  return _getPrototypeOf(o);
}




var Portal_Portal = /*#__PURE__*/function (_React$Component) {
  _inherits(Portal, _React$Component);

  var _super = Portal_createSuper(Portal);

  function Portal() {
    _classCallCheck(this, Portal);

    return _super.apply(this, arguments);
  }

  _createClass(Portal, [{
    key: "componentDidMount",
    value: function componentDidMount() {
      this.createContainer();
    }
  }, {
    key: "componentDidUpdate",
    value: function componentDidUpdate(prevProps) {
      var didUpdate = this.props.didUpdate;

      if (didUpdate) {
        didUpdate(prevProps);
      }
    }
  }, {
    key: "componentWillUnmount",
    value: function componentWillUnmount() {
      this.removeContainer();
    }
  }, {
    key: "createContainer",
    value: function createContainer() {
      this._container = this.props.getContainer();
      this.forceUpdate();
    }
  }, {
    key: "removeContainer",
    value: function removeContainer() {
      if (this._container) {
        this._container.parentNode.removeChild(this._container);
      }
    }
  }, {
    key: "render",
    value: function render() {
      if (this._container) {
        return /*#__PURE__*/external_ReactDOM_default.a.createPortal(this.props.children, this._container);
      }

      return null;
    }
  }]);

  return Portal;
}(external_React_default.a.Component);


// CONCATENATED MODULE: ./node_modules/rc-trigger/es/utils/alignUtil.js


function isPointsEq(a1, a2, isAlignPoint) {
  if (isAlignPoint) {
    return a1[0] === a2[0];
  }

  return a1[0] === a2[0] && a1[1] === a2[1];
}

function getAlignFromPlacement(builtinPlacements, placementStr, align) {
  var baseAlign = builtinPlacements[placementStr] || {};
  return _objectSpread2(_objectSpread2({}, baseAlign), align);
}
function getAlignPopupClassName(builtinPlacements, prefixCls, align, isAlignPoint) {
  var points = align.points;
  var placements = Object.keys(builtinPlacements);

  for (var i = 0; i < placements.length; i += 1) {
    var placement = placements[i];

    if (isPointsEq(builtinPlacements[placement].points, points, isAlignPoint)) {
      return "".concat(prefixCls, "-placement-").concat(placement);
    }
  }

  return '';
}
// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/objectWithoutProperties.js + 1 modules
var objectWithoutProperties = __webpack_require__(8);

// EXTERNAL MODULE: ./node_modules/raf/index.js
var raf = __webpack_require__(29);
var raf_default = /*#__PURE__*/__webpack_require__.n(raf);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/slicedToArray.js + 3 modules
var esm_slicedToArray = __webpack_require__(17);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/typeof.js
var esm_typeof = __webpack_require__(10);

// CONCATENATED MODULE: ./node_modules/dom-align/dist-web/index.js
function dist_web_typeof2(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { dist_web_typeof2 = function _typeof2(obj) { return typeof obj; }; } else { dist_web_typeof2 = function _typeof2(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return dist_web_typeof2(obj); }

function dist_web_typeof(obj) {
  if (typeof Symbol === "function" && dist_web_typeof2(Symbol.iterator) === "symbol") {
    dist_web_typeof = function _typeof(obj) {
      return dist_web_typeof2(obj);
    };
  } else {
    dist_web_typeof = function _typeof(obj) {
      return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : dist_web_typeof2(obj);
    };
  }

  return dist_web_typeof(obj);
}

function _defineProperty(obj, key, value) {
  if (key in obj) {
    Object.defineProperty(obj, key, {
      value: value,
      enumerable: true,
      configurable: true,
      writable: true
    });
  } else {
    obj[key] = value;
  }

  return obj;
}

function dist_web_ownKeys(object, enumerableOnly) {
  var keys = Object.keys(object);

  if (Object.getOwnPropertySymbols) {
    var symbols = Object.getOwnPropertySymbols(object);
    if (enumerableOnly) symbols = symbols.filter(function (sym) {
      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
    });
    keys.push.apply(keys, symbols);
  }

  return keys;
}

function dist_web_objectSpread2(target) {
  for (var i = 1; i < arguments.length; i++) {
    var source = arguments[i] != null ? arguments[i] : {};

    if (i % 2) {
      dist_web_ownKeys(source, true).forEach(function (key) {
        _defineProperty(target, key, source[key]);
      });
    } else if (Object.getOwnPropertyDescriptors) {
      Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
    } else {
      dist_web_ownKeys(source).forEach(function (key) {
        Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
      });
    }
  }

  return target;
}

var vendorPrefix;
var jsCssMap = {
  Webkit: '-webkit-',
  Moz: '-moz-',
  // IE did it wrong again ...
  ms: '-ms-',
  O: '-o-'
};

function getVendorPrefix() {
  if (vendorPrefix !== undefined) {
    return vendorPrefix;
  }

  vendorPrefix = '';
  var style = document.createElement('p').style;
  var testProp = 'Transform';

  for (var key in jsCssMap) {
    if (key + testProp in style) {
      vendorPrefix = key;
    }
  }

  return vendorPrefix;
}

function getTransitionName() {
  return getVendorPrefix() ? "".concat(getVendorPrefix(), "TransitionProperty") : 'transitionProperty';
}

function getTransformName() {
  return getVendorPrefix() ? "".concat(getVendorPrefix(), "Transform") : 'transform';
}

function setTransitionProperty(node, value) {
  var name = getTransitionName();

  if (name) {
    node.style[name] = value;

    if (name !== 'transitionProperty') {
      node.style.transitionProperty = value;
    }
  }
}

function setTransform(node, value) {
  var name = getTransformName();

  if (name) {
    node.style[name] = value;

    if (name !== 'transform') {
      node.style.transform = value;
    }
  }
}

function getTransitionProperty(node) {
  return node.style.transitionProperty || node.style[getTransitionName()];
}

function getTransformXY(node) {
  var style = window.getComputedStyle(node, null);
  var transform = style.getPropertyValue('transform') || style.getPropertyValue(getTransformName());

  if (transform && transform !== 'none') {
    var matrix = transform.replace(/[^0-9\-.,]/g, '').split(',');
    return {
      x: parseFloat(matrix[12] || matrix[4], 0),
      y: parseFloat(matrix[13] || matrix[5], 0)
    };
  }

  return {
    x: 0,
    y: 0
  };
}

var matrix2d = /matrix\((.*)\)/;
var matrix3d = /matrix3d\((.*)\)/;

function setTransformXY(node, xy) {
  var style = window.getComputedStyle(node, null);
  var transform = style.getPropertyValue('transform') || style.getPropertyValue(getTransformName());

  if (transform && transform !== 'none') {
    var arr;
    var match2d = transform.match(matrix2d);

    if (match2d) {
      match2d = match2d[1];
      arr = match2d.split(',').map(function (item) {
        return parseFloat(item, 10);
      });
      arr[4] = xy.x;
      arr[5] = xy.y;
      setTransform(node, "matrix(".concat(arr.join(','), ")"));
    } else {
      var match3d = transform.match(matrix3d)[1];
      arr = match3d.split(',').map(function (item) {
        return parseFloat(item, 10);
      });
      arr[12] = xy.x;
      arr[13] = xy.y;
      setTransform(node, "matrix3d(".concat(arr.join(','), ")"));
    }
  } else {
    setTransform(node, "translateX(".concat(xy.x, "px) translateY(").concat(xy.y, "px) translateZ(0)"));
  }
}

var RE_NUM = /[\-+]?(?:\d*\.|)\d+(?:[eE][\-+]?\d+|)/.source;
var getComputedStyleX; // https://stackoverflow.com/a/3485654/3040605

function forceRelayout(elem) {
  var originalStyle = elem.style.display;
  elem.style.display = 'none';
  elem.offsetHeight; // eslint-disable-line

  elem.style.display = originalStyle;
}

function css(el, name, v) {
  var value = v;

  if (dist_web_typeof(name) === 'object') {
    for (var i in name) {
      if (name.hasOwnProperty(i)) {
        css(el, i, name[i]);
      }
    }

    return undefined;
  }

  if (typeof value !== 'undefined') {
    if (typeof value === 'number') {
      value = "".concat(value, "px");
    }

    el.style[name] = value;
    return undefined;
  }

  return getComputedStyleX(el, name);
}

function getClientPosition(elem) {
  var box;
  var x;
  var y;
  var doc = elem.ownerDocument;
  var body = doc.body;
  var docElem = doc && doc.documentElement; // 根据 GBS 最新数据，A-Grade Browsers 都已支持 getBoundingClientRect 方法，不用再考虑传统的实现方式

  box = elem.getBoundingClientRect(); // 注：jQuery 还考虑减去 docElem.clientLeft/clientTop
  // 但测试发现，这样反而会导致当 html 和 body 有边距/边框样式时，获取的值不正确
  // 此外，ie6 会忽略 html 的 margin 值，幸运地是没有谁会去设置 html 的 margin

  x = box.left;
  y = box.top; // In IE, most of the time, 2 extra pixels are added to the top and left
  // due to the implicit 2-pixel inset border.  In IE6/7 quirks mode and
  // IE6 standards mode, this border can be overridden by setting the
  // document element's border to zero -- thus, we cannot rely on the
  // offset always being 2 pixels.
  // In quirks mode, the offset can be determined by querying the body's
  // clientLeft/clientTop, but in standards mode, it is found by querying
  // the document element's clientLeft/clientTop.  Since we already called
  // getClientBoundingRect we have already forced a reflow, so it is not
  // too expensive just to query them all.
  // ie 下应该减去窗口的边框吧，毕竟默认 absolute 都是相对窗口定位的
  // 窗口边框标准是设 documentElement ,quirks 时设置 body
  // 最好禁止在 body 和 html 上边框 ，但 ie < 9 html 默认有 2px ，减去
  // 但是非 ie 不可能设置窗口边框，body html 也不是窗口 ,ie 可以通过 html,body 设置
  // 标准 ie 下 docElem.clientTop 就是 border-top
  // ie7 html 即窗口边框改变不了。永远为 2
  // 但标准 firefox/chrome/ie9 下 docElem.clientTop 是窗口边框，即使设了 border-top 也为 0

  x -= docElem.clientLeft || body.clientLeft || 0;
  y -= docElem.clientTop || body.clientTop || 0;
  return {
    left: x,
    top: y
  };
}

function getScroll(w, top) {
  var ret = w["page".concat(top ? 'Y' : 'X', "Offset")];
  var method = "scroll".concat(top ? 'Top' : 'Left');

  if (typeof ret !== 'number') {
    var d = w.document; // ie6,7,8 standard mode

    ret = d.documentElement[method];

    if (typeof ret !== 'number') {
      // quirks mode
      ret = d.body[method];
    }
  }

  return ret;
}

function getScrollLeft(w) {
  return getScroll(w);
}

function getScrollTop(w) {
  return getScroll(w, true);
}

function getOffset(el) {
  var pos = getClientPosition(el);
  var doc = el.ownerDocument;
  var w = doc.defaultView || doc.parentWindow;
  pos.left += getScrollLeft(w);
  pos.top += getScrollTop(w);
  return pos;
}
/**
 * A crude way of determining if an object is a window
 * @member util
 */


function isWindow(obj) {
  // must use == for ie8

  /* eslint eqeqeq:0 */
  return obj !== null && obj !== undefined && obj == obj.window;
}

function getDocument(node) {
  if (isWindow(node)) {
    return node.document;
  }

  if (node.nodeType === 9) {
    return node;
  }

  return node.ownerDocument;
}

function _getComputedStyle(elem, name, cs) {
  var computedStyle = cs;
  var val = '';
  var d = getDocument(elem);
  computedStyle = computedStyle || d.defaultView.getComputedStyle(elem, null); // https://github.com/kissyteam/kissy/issues/61

  if (computedStyle) {
    val = computedStyle.getPropertyValue(name) || computedStyle[name];
  }

  return val;
}

var _RE_NUM_NO_PX = new RegExp("^(".concat(RE_NUM, ")(?!px)[a-z%]+$"), 'i');

var RE_POS = /^(top|right|bottom|left)$/;
var CURRENT_STYLE = 'currentStyle';
var RUNTIME_STYLE = 'runtimeStyle';
var LEFT = 'left';
var PX = 'px';

function _getComputedStyleIE(elem, name) {
  // currentStyle maybe null
  // http://msdn.microsoft.com/en-us/library/ms535231.aspx
  var ret = elem[CURRENT_STYLE] && elem[CURRENT_STYLE][name]; // 当 width/height 设置为百分比时，通过 pixelLeft 方式转换的 width/height 值
  // 一开始就处理了! CUSTOM_STYLE.height,CUSTOM_STYLE.width ,cssHook 解决@2011-08-19
  // 在 ie 下不对，需要直接用 offset 方式
  // borderWidth 等值也有问题，但考虑到 borderWidth 设为百分比的概率很小，这里就不考虑了
  // From the awesome hack by Dean Edwards
  // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
  // If we're not dealing with a regular pixel number
  // but a number that has a weird ending, we need to convert it to pixels
  // exclude left right for relativity

  if (_RE_NUM_NO_PX.test(ret) && !RE_POS.test(name)) {
    // Remember the original values
    var style = elem.style;
    var left = style[LEFT];
    var rsLeft = elem[RUNTIME_STYLE][LEFT]; // prevent flashing of content

    elem[RUNTIME_STYLE][LEFT] = elem[CURRENT_STYLE][LEFT]; // Put in the new values to get a computed value out

    style[LEFT] = name === 'fontSize' ? '1em' : ret || 0;
    ret = style.pixelLeft + PX; // Revert the changed values

    style[LEFT] = left;
    elem[RUNTIME_STYLE][LEFT] = rsLeft;
  }

  return ret === '' ? 'auto' : ret;
}

if (typeof window !== 'undefined') {
  getComputedStyleX = window.getComputedStyle ? _getComputedStyle : _getComputedStyleIE;
}

function getOffsetDirection(dir, option) {
  if (dir === 'left') {
    return option.useCssRight ? 'right' : dir;
  }

  return option.useCssBottom ? 'bottom' : dir;
}

function oppositeOffsetDirection(dir) {
  if (dir === 'left') {
    return 'right';
  } else if (dir === 'right') {
    return 'left';
  } else if (dir === 'top') {
    return 'bottom';
  } else if (dir === 'bottom') {
    return 'top';
  }
} // 设置 elem 相对 elem.ownerDocument 的坐标


function setLeftTop(elem, offset, option) {
  // set position first, in-case top/left are set even on static elem
  if (css(elem, 'position') === 'static') {
    elem.style.position = 'relative';
  }

  var presetH = -999;
  var presetV = -999;
  var horizontalProperty = getOffsetDirection('left', option);
  var verticalProperty = getOffsetDirection('top', option);
  var oppositeHorizontalProperty = oppositeOffsetDirection(horizontalProperty);
  var oppositeVerticalProperty = oppositeOffsetDirection(verticalProperty);

  if (horizontalProperty !== 'left') {
    presetH = 999;
  }

  if (verticalProperty !== 'top') {
    presetV = 999;
  }

  var originalTransition = '';
  var originalOffset = getOffset(elem);

  if ('left' in offset || 'top' in offset) {
    originalTransition = getTransitionProperty(elem) || '';
    setTransitionProperty(elem, 'none');
  }

  if ('left' in offset) {
    elem.style[oppositeHorizontalProperty] = '';
    elem.style[horizontalProperty] = "".concat(presetH, "px");
  }

  if ('top' in offset) {
    elem.style[oppositeVerticalProperty] = '';
    elem.style[verticalProperty] = "".concat(presetV, "px");
  } // force relayout


  forceRelayout(elem);
  var old = getOffset(elem);
  var originalStyle = {};

  for (var key in offset) {
    if (offset.hasOwnProperty(key)) {
      var dir = getOffsetDirection(key, option);
      var preset = key === 'left' ? presetH : presetV;
      var off = originalOffset[key] - old[key];

      if (dir === key) {
        originalStyle[dir] = preset + off;
      } else {
        originalStyle[dir] = preset - off;
      }
    }
  }

  css(elem, originalStyle); // force relayout

  forceRelayout(elem);

  if ('left' in offset || 'top' in offset) {
    setTransitionProperty(elem, originalTransition);
  }

  var ret = {};

  for (var _key in offset) {
    if (offset.hasOwnProperty(_key)) {
      var _dir = getOffsetDirection(_key, option);

      var _off = offset[_key] - originalOffset[_key];

      if (_key === _dir) {
        ret[_dir] = originalStyle[_dir] + _off;
      } else {
        ret[_dir] = originalStyle[_dir] - _off;
      }
    }
  }

  css(elem, ret);
}

function setTransform$1(elem, offset) {
  var originalOffset = getOffset(elem);
  var originalXY = getTransformXY(elem);
  var resultXY = {
    x: originalXY.x,
    y: originalXY.y
  };

  if ('left' in offset) {
    resultXY.x = originalXY.x + offset.left - originalOffset.left;
  }

  if ('top' in offset) {
    resultXY.y = originalXY.y + offset.top - originalOffset.top;
  }

  setTransformXY(elem, resultXY);
}

function setOffset(elem, offset, option) {
  if (option.ignoreShake) {
    var oriOffset = getOffset(elem);
    var oLeft = oriOffset.left.toFixed(0);
    var oTop = oriOffset.top.toFixed(0);
    var tLeft = offset.left.toFixed(0);
    var tTop = offset.top.toFixed(0);

    if (oLeft === tLeft && oTop === tTop) {
      return;
    }
  }

  if (option.useCssRight || option.useCssBottom) {
    setLeftTop(elem, offset, option);
  } else if (option.useCssTransform && getTransformName() in document.body.style) {
    setTransform$1(elem, offset);
  } else {
    setLeftTop(elem, offset, option);
  }
}

function each(arr, fn) {
  for (var i = 0; i < arr.length; i++) {
    fn(arr[i]);
  }
}

function isBorderBoxFn(elem) {
  return getComputedStyleX(elem, 'boxSizing') === 'border-box';
}

var BOX_MODELS = ['margin', 'border', 'padding'];
var CONTENT_INDEX = -1;
var PADDING_INDEX = 2;
var BORDER_INDEX = 1;
var MARGIN_INDEX = 0;

function swap(elem, options, callback) {
  var old = {};
  var style = elem.style;
  var name; // Remember the old values, and insert the new ones

  for (name in options) {
    if (options.hasOwnProperty(name)) {
      old[name] = style[name];
      style[name] = options[name];
    }
  }

  callback.call(elem); // Revert the old values

  for (name in options) {
    if (options.hasOwnProperty(name)) {
      style[name] = old[name];
    }
  }
}

function getPBMWidth(elem, props, which) {
  var value = 0;
  var prop;
  var j;
  var i;

  for (j = 0; j < props.length; j++) {
    prop = props[j];

    if (prop) {
      for (i = 0; i < which.length; i++) {
        var cssProp = void 0;

        if (prop === 'border') {
          cssProp = "".concat(prop).concat(which[i], "Width");
        } else {
          cssProp = prop + which[i];
        }

        value += parseFloat(getComputedStyleX(elem, cssProp)) || 0;
      }
    }
  }

  return value;
}

var domUtils = {
  getParent: function getParent(element) {
    var parent = element;

    do {
      if (parent.nodeType === 11 && parent.host) {
        parent = parent.host;
      } else {
        parent = parent.parentNode;
      }
    } while (parent && parent.nodeType !== 1 && parent.nodeType !== 9);

    return parent;
  }
};
each(['Width', 'Height'], function (name) {
  domUtils["doc".concat(name)] = function (refWin) {
    var d = refWin.document;
    return Math.max( // firefox chrome documentElement.scrollHeight< body.scrollHeight
    // ie standard mode : documentElement.scrollHeight> body.scrollHeight
    d.documentElement["scroll".concat(name)], // quirks : documentElement.scrollHeight 最大等于可视窗口多一点？
    d.body["scroll".concat(name)], domUtils["viewport".concat(name)](d));
  };

  domUtils["viewport".concat(name)] = function (win) {
    // pc browser includes scrollbar in window.innerWidth
    var prop = "client".concat(name);
    var doc = win.document;
    var body = doc.body;
    var documentElement = doc.documentElement;
    var documentElementProp = documentElement[prop]; // 标准模式取 documentElement
    // backcompat 取 body

    return doc.compatMode === 'CSS1Compat' && documentElementProp || body && body[prop] || documentElementProp;
  };
});
/*
 得到元素的大小信息
 @param elem
 @param name
 @param {String} [extra]  'padding' : (css width) + padding
 'border' : (css width) + padding + border
 'margin' : (css width) + padding + border + margin
 */

function getWH(elem, name, ex) {
  var extra = ex;

  if (isWindow(elem)) {
    return name === 'width' ? domUtils.viewportWidth(elem) : domUtils.viewportHeight(elem);
  } else if (elem.nodeType === 9) {
    return name === 'width' ? domUtils.docWidth(elem) : domUtils.docHeight(elem);
  }

  var which = name === 'width' ? ['Left', 'Right'] : ['Top', 'Bottom'];
  var borderBoxValue = name === 'width' ? elem.getBoundingClientRect().width : elem.getBoundingClientRect().height;
  var computedStyle = getComputedStyleX(elem);
  var isBorderBox = isBorderBoxFn(elem);
  var cssBoxValue = 0;

  if (borderBoxValue === null || borderBoxValue === undefined || borderBoxValue <= 0) {
    borderBoxValue = undefined; // Fall back to computed then un computed css if necessary

    cssBoxValue = getComputedStyleX(elem, name);

    if (cssBoxValue === null || cssBoxValue === undefined || Number(cssBoxValue) < 0) {
      cssBoxValue = elem.style[name] || 0;
    } // Normalize '', auto, and prepare for extra


    cssBoxValue = parseFloat(cssBoxValue) || 0;
  }

  if (extra === undefined) {
    extra = isBorderBox ? BORDER_INDEX : CONTENT_INDEX;
  }

  var borderBoxValueOrIsBorderBox = borderBoxValue !== undefined || isBorderBox;
  var val = borderBoxValue || cssBoxValue;

  if (extra === CONTENT_INDEX) {
    if (borderBoxValueOrIsBorderBox) {
      return val - getPBMWidth(elem, ['border', 'padding'], which);
    }

    return cssBoxValue;
  } else if (borderBoxValueOrIsBorderBox) {
    if (extra === BORDER_INDEX) {
      return val;
    }

    return val + (extra === PADDING_INDEX ? -getPBMWidth(elem, ['border'], which) : getPBMWidth(elem, ['margin'], which));
  }

  return cssBoxValue + getPBMWidth(elem, BOX_MODELS.slice(extra), which);
}

var cssShow = {
  position: 'absolute',
  visibility: 'hidden',
  display: 'block'
}; // fix #119 : https://github.com/kissyteam/kissy/issues/119

function getWHIgnoreDisplay() {
  for (var _len = arguments.length, args = new Array(_len), _key2 = 0; _key2 < _len; _key2++) {
    args[_key2] = arguments[_key2];
  }

  var val;
  var elem = args[0]; // in case elem is window
  // elem.offsetWidth === undefined

  if (elem.offsetWidth !== 0) {
    val = getWH.apply(undefined, args);
  } else {
    swap(elem, cssShow, function () {
      val = getWH.apply(undefined, args);
    });
  }

  return val;
}

each(['width', 'height'], function (name) {
  var first = name.charAt(0).toUpperCase() + name.slice(1);

  domUtils["outer".concat(first)] = function (el, includeMargin) {
    return el && getWHIgnoreDisplay(el, name, includeMargin ? MARGIN_INDEX : BORDER_INDEX);
  };

  var which = name === 'width' ? ['Left', 'Right'] : ['Top', 'Bottom'];

  domUtils[name] = function (elem, v) {
    var val = v;

    if (val !== undefined) {
      if (elem) {
        var computedStyle = getComputedStyleX(elem);
        var isBorderBox = isBorderBoxFn(elem);

        if (isBorderBox) {
          val += getPBMWidth(elem, ['padding', 'border'], which);
        }

        return css(elem, name, val);
      }

      return undefined;
    }

    return elem && getWHIgnoreDisplay(elem, name, CONTENT_INDEX);
  };
});

function mix(to, from) {
  for (var i in from) {
    if (from.hasOwnProperty(i)) {
      to[i] = from[i];
    }
  }

  return to;
}

var utils = {
  getWindow: function getWindow(node) {
    if (node && node.document && node.setTimeout) {
      return node;
    }

    var doc = node.ownerDocument || node;
    return doc.defaultView || doc.parentWindow;
  },
  getDocument: getDocument,
  offset: function offset(el, value, option) {
    if (typeof value !== 'undefined') {
      setOffset(el, value, option || {});
    } else {
      return getOffset(el);
    }
  },
  isWindow: isWindow,
  each: each,
  css: css,
  clone: function clone(obj) {
    var i;
    var ret = {};

    for (i in obj) {
      if (obj.hasOwnProperty(i)) {
        ret[i] = obj[i];
      }
    }

    var overflow = obj.overflow;

    if (overflow) {
      for (i in obj) {
        if (obj.hasOwnProperty(i)) {
          ret.overflow[i] = obj.overflow[i];
        }
      }
    }

    return ret;
  },
  mix: mix,
  getWindowScrollLeft: function getWindowScrollLeft(w) {
    return getScrollLeft(w);
  },
  getWindowScrollTop: function getWindowScrollTop(w) {
    return getScrollTop(w);
  },
  merge: function merge() {
    var ret = {};

    for (var i = 0; i < arguments.length; i++) {
      utils.mix(ret, i < 0 || arguments.length <= i ? undefined : arguments[i]);
    }

    return ret;
  },
  viewportWidth: 0,
  viewportHeight: 0
};
mix(utils, domUtils);
/**
 * 得到会导致元素显示不全的祖先元素
 */

var getParent = utils.getParent;

function getOffsetParent(element) {
  if (utils.isWindow(element) || element.nodeType === 9) {
    return null;
  } // ie 这个也不是完全可行

  /*
   <div style="width: 50px;height: 100px;overflow: hidden">
   <div style="width: 50px;height: 100px;position: relative;" id="d6">
   元素 6 高 100px 宽 50px<br/>
   </div>
   </div>
   */
  // element.offsetParent does the right thing in ie7 and below. Return parent with layout!
  //  In other browsers it only includes elements with position absolute, relative or
  // fixed, not elements with overflow set to auto or scroll.
  //        if (UA.ie && ieMode < 8) {
  //            return element.offsetParent;
  //        }
  // 统一的 offsetParent 方法


  var doc = utils.getDocument(element);
  var body = doc.body;
  var parent;
  var positionStyle = utils.css(element, 'position');
  var skipStatic = positionStyle === 'fixed' || positionStyle === 'absolute';

  if (!skipStatic) {
    return element.nodeName.toLowerCase() === 'html' ? null : getParent(element);
  }

  for (parent = getParent(element); parent && parent !== body && parent.nodeType !== 9; parent = getParent(parent)) {
    positionStyle = utils.css(parent, 'position');

    if (positionStyle !== 'static') {
      return parent;
    }
  }

  return null;
}

var getParent$1 = utils.getParent;

function isAncestorFixed(element) {
  if (utils.isWindow(element) || element.nodeType === 9) {
    return false;
  }

  var doc = utils.getDocument(element);
  var body = doc.body;
  var parent = null;

  for (parent = getParent$1(element); parent && parent !== body; parent = getParent$1(parent)) {
    var positionStyle = utils.css(parent, 'position');

    if (positionStyle === 'fixed') {
      return true;
    }
  }

  return false;
}
/**
 * 获得元素的显示部分的区域
 */


function getVisibleRectForElement(element, alwaysByViewport) {
  var visibleRect = {
    left: 0,
    right: Infinity,
    top: 0,
    bottom: Infinity
  };
  var el = getOffsetParent(element);
  var doc = utils.getDocument(element);
  var win = doc.defaultView || doc.parentWindow;
  var body = doc.body;
  var documentElement = doc.documentElement; // Determine the size of the visible rect by climbing the dom accounting for
  // all scrollable containers.

  while (el) {
    // clientWidth is zero for inline block elements in ie.
    if ((navigator.userAgent.indexOf('MSIE') === -1 || el.clientWidth !== 0) && // body may have overflow set on it, yet we still get the entire
    // viewport. In some browsers, el.offsetParent may be
    // document.documentElement, so check for that too.
    el !== body && el !== documentElement && utils.css(el, 'overflow') !== 'visible') {
      var pos = utils.offset(el); // add border

      pos.left += el.clientLeft;
      pos.top += el.clientTop;
      visibleRect.top = Math.max(visibleRect.top, pos.top);
      visibleRect.right = Math.min(visibleRect.right, // consider area without scrollBar
      pos.left + el.clientWidth);
      visibleRect.bottom = Math.min(visibleRect.bottom, pos.top + el.clientHeight);
      visibleRect.left = Math.max(visibleRect.left, pos.left);
    } else if (el === body || el === documentElement) {
      break;
    }

    el = getOffsetParent(el);
  } // Set element position to fixed
  // make sure absolute element itself don't affect it's visible area
  // https://github.com/ant-design/ant-design/issues/7601


  var originalPosition = null;

  if (!utils.isWindow(element) && element.nodeType !== 9) {
    originalPosition = element.style.position;
    var position = utils.css(element, 'position');

    if (position === 'absolute') {
      element.style.position = 'fixed';
    }
  }

  var scrollX = utils.getWindowScrollLeft(win);
  var scrollY = utils.getWindowScrollTop(win);
  var viewportWidth = utils.viewportWidth(win);
  var viewportHeight = utils.viewportHeight(win);
  var documentWidth = documentElement.scrollWidth;
  var documentHeight = documentElement.scrollHeight; // scrollXXX on html is sync with body which means overflow: hidden on body gets wrong scrollXXX.
  // We should cut this ourself.

  var bodyStyle = window.getComputedStyle(body);

  if (bodyStyle.overflowX === 'hidden') {
    documentWidth = win.innerWidth;
  }

  if (bodyStyle.overflowY === 'hidden') {
    documentHeight = win.innerHeight;
  } // Reset element position after calculate the visible area


  if (element.style) {
    element.style.position = originalPosition;
  }

  if (alwaysByViewport || isAncestorFixed(element)) {
    // Clip by viewport's size.
    visibleRect.left = Math.max(visibleRect.left, scrollX);
    visibleRect.top = Math.max(visibleRect.top, scrollY);
    visibleRect.right = Math.min(visibleRect.right, scrollX + viewportWidth);
    visibleRect.bottom = Math.min(visibleRect.bottom, scrollY + viewportHeight);
  } else {
    // Clip by document's size.
    var maxVisibleWidth = Math.max(documentWidth, scrollX + viewportWidth);
    visibleRect.right = Math.min(visibleRect.right, maxVisibleWidth);
    var maxVisibleHeight = Math.max(documentHeight, scrollY + viewportHeight);
    visibleRect.bottom = Math.min(visibleRect.bottom, maxVisibleHeight);
  }

  return visibleRect.top >= 0 && visibleRect.left >= 0 && visibleRect.bottom > visibleRect.top && visibleRect.right > visibleRect.left ? visibleRect : null;
}

function adjustForViewport(elFuturePos, elRegion, visibleRect, overflow) {
  var pos = utils.clone(elFuturePos);
  var size = {
    width: elRegion.width,
    height: elRegion.height
  };

  if (overflow.adjustX && pos.left < visibleRect.left) {
    pos.left = visibleRect.left;
  } // Left edge inside and right edge outside viewport, try to resize it.


  if (overflow.resizeWidth && pos.left >= visibleRect.left && pos.left + size.width > visibleRect.right) {
    size.width -= pos.left + size.width - visibleRect.right;
  } // Right edge outside viewport, try to move it.


  if (overflow.adjustX && pos.left + size.width > visibleRect.right) {
    // 保证左边界和可视区域左边界对齐
    pos.left = Math.max(visibleRect.right - size.width, visibleRect.left);
  } // Top edge outside viewport, try to move it.


  if (overflow.adjustY && pos.top < visibleRect.top) {
    pos.top = visibleRect.top;
  } // Top edge inside and bottom edge outside viewport, try to resize it.


  if (overflow.resizeHeight && pos.top >= visibleRect.top && pos.top + size.height > visibleRect.bottom) {
    size.height -= pos.top + size.height - visibleRect.bottom;
  } // Bottom edge outside viewport, try to move it.


  if (overflow.adjustY && pos.top + size.height > visibleRect.bottom) {
    // 保证上边界和可视区域上边界对齐
    pos.top = Math.max(visibleRect.bottom - size.height, visibleRect.top);
  }

  return utils.mix(pos, size);
}

function getRegion(node) {
  var offset;
  var w;
  var h;

  if (!utils.isWindow(node) && node.nodeType !== 9) {
    offset = utils.offset(node);
    w = utils.outerWidth(node);
    h = utils.outerHeight(node);
  } else {
    var win = utils.getWindow(node);
    offset = {
      left: utils.getWindowScrollLeft(win),
      top: utils.getWindowScrollTop(win)
    };
    w = utils.viewportWidth(win);
    h = utils.viewportHeight(win);
  }

  offset.width = w;
  offset.height = h;
  return offset;
}
/**
 * 获取 node 上的 align 对齐点 相对于页面的坐标
 */


function getAlignOffset(region, align) {
  var V = align.charAt(0);
  var H = align.charAt(1);
  var w = region.width;
  var h = region.height;
  var x = region.left;
  var y = region.top;

  if (V === 'c') {
    y += h / 2;
  } else if (V === 'b') {
    y += h;
  }

  if (H === 'c') {
    x += w / 2;
  } else if (H === 'r') {
    x += w;
  }

  return {
    left: x,
    top: y
  };
}

function getElFuturePos(elRegion, refNodeRegion, points, offset, targetOffset) {
  var p1 = getAlignOffset(refNodeRegion, points[1]);
  var p2 = getAlignOffset(elRegion, points[0]);
  var diff = [p2.left - p1.left, p2.top - p1.top];
  return {
    left: Math.round(elRegion.left - diff[0] + offset[0] - targetOffset[0]),
    top: Math.round(elRegion.top - diff[1] + offset[1] - targetOffset[1])
  };
}
/**
 * align dom node flexibly
 * @author yiminghe@gmail.com
 */


function isFailX(elFuturePos, elRegion, visibleRect) {
  return elFuturePos.left < visibleRect.left || elFuturePos.left + elRegion.width > visibleRect.right;
}

function isFailY(elFuturePos, elRegion, visibleRect) {
  return elFuturePos.top < visibleRect.top || elFuturePos.top + elRegion.height > visibleRect.bottom;
}

function isCompleteFailX(elFuturePos, elRegion, visibleRect) {
  return elFuturePos.left > visibleRect.right || elFuturePos.left + elRegion.width < visibleRect.left;
}

function isCompleteFailY(elFuturePos, elRegion, visibleRect) {
  return elFuturePos.top > visibleRect.bottom || elFuturePos.top + elRegion.height < visibleRect.top;
}

function flip(points, reg, map) {
  var ret = [];
  utils.each(points, function (p) {
    ret.push(p.replace(reg, function (m) {
      return map[m];
    }));
  });
  return ret;
}

function flipOffset(offset, index) {
  offset[index] = -offset[index];
  return offset;
}

function convertOffset(str, offsetLen) {
  var n;

  if (/%$/.test(str)) {
    n = parseInt(str.substring(0, str.length - 1), 10) / 100 * offsetLen;
  } else {
    n = parseInt(str, 10);
  }

  return n || 0;
}

function normalizeOffset(offset, el) {
  offset[0] = convertOffset(offset[0], el.width);
  offset[1] = convertOffset(offset[1], el.height);
}
/**
 * @param el
 * @param tgtRegion 参照节点所占的区域: { left, top, width, height }
 * @param align
 */


function doAlign(el, tgtRegion, align, isTgtRegionVisible) {
  var points = align.points;
  var offset = align.offset || [0, 0];
  var targetOffset = align.targetOffset || [0, 0];
  var overflow = align.overflow;
  var source = align.source || el;
  offset = [].concat(offset);
  targetOffset = [].concat(targetOffset);
  overflow = overflow || {};
  var newOverflowCfg = {};
  var fail = 0;
  var alwaysByViewport = !!(overflow && overflow.alwaysByViewport); // 当前节点可以被放置的显示区域

  var visibleRect = getVisibleRectForElement(source, alwaysByViewport); // 当前节点所占的区域, left/top/width/height

  var elRegion = getRegion(source); // 将 offset 转换成数值，支持百分比

  normalizeOffset(offset, elRegion);
  normalizeOffset(targetOffset, tgtRegion); // 当前节点将要被放置的位置

  var elFuturePos = getElFuturePos(elRegion, tgtRegion, points, offset, targetOffset); // 当前节点将要所处的区域

  var newElRegion = utils.merge(elRegion, elFuturePos); // 如果可视区域不能完全放置当前节点时允许调整

  if (visibleRect && (overflow.adjustX || overflow.adjustY) && isTgtRegionVisible) {
    if (overflow.adjustX) {
      // 如果横向不能放下
      if (isFailX(elFuturePos, elRegion, visibleRect)) {
        // 对齐位置反下
        var newPoints = flip(points, /[lr]/gi, {
          l: 'r',
          r: 'l'
        }); // 偏移量也反下

        var newOffset = flipOffset(offset, 0);
        var newTargetOffset = flipOffset(targetOffset, 0);
        var newElFuturePos = getElFuturePos(elRegion, tgtRegion, newPoints, newOffset, newTargetOffset);

        if (!isCompleteFailX(newElFuturePos, elRegion, visibleRect)) {
          fail = 1;
          points = newPoints;
          offset = newOffset;
          targetOffset = newTargetOffset;
        }
      }
    }

    if (overflow.adjustY) {
      // 如果纵向不能放下
      if (isFailY(elFuturePos, elRegion, visibleRect)) {
        // 对齐位置反下
        var _newPoints = flip(points, /[tb]/gi, {
          t: 'b',
          b: 't'
        }); // 偏移量也反下


        var _newOffset = flipOffset(offset, 1);

        var _newTargetOffset = flipOffset(targetOffset, 1);

        var _newElFuturePos = getElFuturePos(elRegion, tgtRegion, _newPoints, _newOffset, _newTargetOffset);

        if (!isCompleteFailY(_newElFuturePos, elRegion, visibleRect)) {
          fail = 1;
          points = _newPoints;
          offset = _newOffset;
          targetOffset = _newTargetOffset;
        }
      }
    } // 如果失败，重新计算当前节点将要被放置的位置


    if (fail) {
      elFuturePos = getElFuturePos(elRegion, tgtRegion, points, offset, targetOffset);
      utils.mix(newElRegion, elFuturePos);
    }

    var isStillFailX = isFailX(elFuturePos, elRegion, visibleRect);
    var isStillFailY = isFailY(elFuturePos, elRegion, visibleRect); // 检查反下后的位置是否可以放下了，如果仍然放不下：
    // 1. 复原修改过的定位参数

    if (isStillFailX || isStillFailY) {
      var _newPoints2 = points; // 重置对应部分的翻转逻辑

      if (isStillFailX) {
        _newPoints2 = flip(points, /[lr]/gi, {
          l: 'r',
          r: 'l'
        });
      }

      if (isStillFailY) {
        _newPoints2 = flip(points, /[tb]/gi, {
          t: 'b',
          b: 't'
        });
      }

      points = _newPoints2;
      offset = align.offset || [0, 0];
      targetOffset = align.targetOffset || [0, 0];
    } // 2. 只有指定了可以调整当前方向才调整


    newOverflowCfg.adjustX = overflow.adjustX && isStillFailX;
    newOverflowCfg.adjustY = overflow.adjustY && isStillFailY; // 确实要调整，甚至可能会调整高度宽度

    if (newOverflowCfg.adjustX || newOverflowCfg.adjustY) {
      newElRegion = adjustForViewport(elFuturePos, elRegion, visibleRect, newOverflowCfg);
    }
  } // need judge to in case set fixed with in css on height auto element


  if (newElRegion.width !== elRegion.width) {
    utils.css(source, 'width', utils.width(source) + newElRegion.width - elRegion.width);
  }

  if (newElRegion.height !== elRegion.height) {
    utils.css(source, 'height', utils.height(source) + newElRegion.height - elRegion.height);
  } // https://github.com/kissyteam/kissy/issues/190
  // 相对于屏幕位置没变，而 left/top 变了
  // 例如 <div 'relative'><el absolute></div>


  utils.offset(source, {
    left: newElRegion.left,
    top: newElRegion.top
  }, {
    useCssRight: align.useCssRight,
    useCssBottom: align.useCssBottom,
    useCssTransform: align.useCssTransform,
    ignoreShake: align.ignoreShake
  });
  return {
    points: points,
    offset: offset,
    targetOffset: targetOffset,
    overflow: newOverflowCfg
  };
}
/**
 *  2012-04-26 yiminghe@gmail.com
 *   - 优化智能对齐算法
 *   - 慎用 resizeXX
 *
 *  2011-07-13 yiminghe@gmail.com note:
 *   - 增加智能对齐，以及大小调整选项
 **/


function isOutOfVisibleRect(target, alwaysByViewport) {
  var visibleRect = getVisibleRectForElement(target, alwaysByViewport);
  var targetRegion = getRegion(target);
  return !visibleRect || targetRegion.left + targetRegion.width <= visibleRect.left || targetRegion.top + targetRegion.height <= visibleRect.top || targetRegion.left >= visibleRect.right || targetRegion.top >= visibleRect.bottom;
}

function alignElement(el, refNode, align) {
  var target = align.target || refNode;
  var refNodeRegion = getRegion(target);
  var isTargetNotOutOfVisible = !isOutOfVisibleRect(target, align.overflow && align.overflow.alwaysByViewport);
  return doAlign(el, refNodeRegion, align, isTargetNotOutOfVisible);
}

alignElement.__getOffsetParent = getOffsetParent;
alignElement.__getVisibleRectForElement = getVisibleRectForElement;
/**
 * `tgtPoint`: { pageX, pageY } or { clientX, clientY }.
 * If client position provided, will internal convert to page position.
 */

function dist_web_alignPoint(el, tgtPoint, align) {
  var pageX;
  var pageY;
  var doc = utils.getDocument(el);
  var win = doc.defaultView || doc.parentWindow;
  var scrollX = utils.getWindowScrollLeft(win);
  var scrollY = utils.getWindowScrollTop(win);
  var viewportWidth = utils.viewportWidth(win);
  var viewportHeight = utils.viewportHeight(win);

  if ('pageX' in tgtPoint) {
    pageX = tgtPoint.pageX;
  } else {
    pageX = scrollX + tgtPoint.clientX;
  }

  if ('pageY' in tgtPoint) {
    pageY = tgtPoint.pageY;
  } else {
    pageY = scrollY + tgtPoint.clientY;
  }

  var tgtRegion = {
    left: pageX,
    top: pageY,
    width: 0,
    height: 0
  };
  var pointInView = pageX >= 0 && pageX <= scrollX + viewportWidth && pageY >= 0 && pageY <= scrollY + viewportHeight; // Provide default target point

  var points = [align.points[0], 'cc'];
  return doAlign(el, tgtRegion, dist_web_objectSpread2({}, align, {
    points: points
  }), pointInView);
}

/* harmony default export */ var dist_web = (alignElement);

// EXTERNAL MODULE: ./node_modules/resize-observer-polyfill/dist/ResizeObserver.es.js
var ResizeObserver_es = __webpack_require__(45);

// CONCATENATED MODULE: ./node_modules/rc-align/es/util.js



function isSamePoint(prev, next) {
  if (prev === next) return true;
  if (!prev || !next) return false;

  if ('pageX' in next && 'pageY' in next) {
    return prev.pageX === next.pageX && prev.pageY === next.pageY;
  }

  if ('clientX' in next && 'clientY' in next) {
    return prev.clientX === next.clientX && prev.clientY === next.clientY;
  }

  return false;
}
function restoreFocus(activeElement, container) {
  // Focus back if is in the container
  if (activeElement !== document.activeElement && contains(container, activeElement) && typeof activeElement.focus === 'function') {
    activeElement.focus();
  }
}
function monitorResize(element, callback) {
  var prevWidth = null;
  var prevHeight = null;

  function onResize(_ref) {
    var _ref2 = Object(esm_slicedToArray["a" /* default */])(_ref, 1),
        target = _ref2[0].target;

    var _target$getBoundingCl = target.getBoundingClientRect(),
        width = _target$getBoundingCl.width,
        height = _target$getBoundingCl.height;

    var fixedWidth = Math.floor(width);
    var fixedHeight = Math.floor(height);

    if (prevWidth !== fixedWidth || prevHeight !== fixedHeight) {
      callback({
        width: fixedWidth,
        height: fixedHeight
      });
    }

    prevWidth = fixedWidth;
    prevHeight = fixedHeight;
  }

  var resizeObserver = new ResizeObserver_es["a" /* default */](onResize);

  if (element) {
    resizeObserver.observe(element);
  }

  return function () {
    resizeObserver.disconnect();
  };
}
// CONCATENATED MODULE: ./node_modules/rc-align/es/hooks/useBuffer.js

/* harmony default export */ var useBuffer = (function (callback, buffer) {
  var calledRef = external_React_default.a.useRef(false);
  var timeoutRef = external_React_default.a.useRef(null);

  function cancelTrigger() {
    window.clearTimeout(timeoutRef.current);
  }

  function trigger(force) {
    if (!calledRef.current || force === true) {
      if (callback() === false) {
        // Not delay since callback cancelled self
        return;
      }

      calledRef.current = true;
      cancelTrigger();
      timeoutRef.current = window.setTimeout(function () {
        calledRef.current = false;
      }, buffer);
    } else {
      cancelTrigger();
      timeoutRef.current = window.setTimeout(function () {
        calledRef.current = false;
        trigger();
      }, buffer);
    }
  }

  return [trigger, function () {
    calledRef.current = false;
    cancelTrigger();
  }];
});
// CONCATENATED MODULE: ./node_modules/rc-align/es/Align.js


/**
 * Removed props:
 *  - childrenProps
 */








function getElement(func) {
  if (typeof func !== 'function') return null;
  return func();
}

function getPoint(point) {
  if (Object(esm_typeof["a" /* default */])(point) !== 'object' || !point) return null;
  return point;
}

var Align_Align = function Align(_ref, ref) {
  var children = _ref.children,
      disabled = _ref.disabled,
      target = _ref.target,
      align = _ref.align,
      onAlign = _ref.onAlign,
      monitorWindowResize = _ref.monitorWindowResize,
      _ref$monitorBufferTim = _ref.monitorBufferTime,
      monitorBufferTime = _ref$monitorBufferTim === void 0 ? 0 : _ref$monitorBufferTim;
  var cacheRef = external_React_default.a.useRef({});
  var nodeRef = external_React_default.a.useRef();
  var childNode = external_React_default.a.Children.only(children); // ===================== Align ======================
  // We save the props here to avoid closure makes props ood

  var forceAlignPropsRef = external_React_default.a.useRef({});
  forceAlignPropsRef.current.disabled = disabled;
  forceAlignPropsRef.current.target = target;
  forceAlignPropsRef.current.onAlign = onAlign;

  var _useBuffer = useBuffer(function () {
    var _forceAlignPropsRef$c = forceAlignPropsRef.current,
        latestDisabled = _forceAlignPropsRef$c.disabled,
        latestTarget = _forceAlignPropsRef$c.target;

    if (!latestDisabled && latestTarget) {
      var source = nodeRef.current;
      var result;
      var element = getElement(latestTarget);
      var point = getPoint(latestTarget);
      cacheRef.current.element = element;
      cacheRef.current.point = point; // IE lose focus after element realign
      // We should record activeElement and restore later

      var _document = document,
          activeElement = _document.activeElement;

      if (element) {
        result = alignElement(source, element, align);
      } else if (point) {
        result = dist_web_alignPoint(source, point, align);
      }

      restoreFocus(activeElement, source);

      if (onAlign) {
        onAlign(source, result);
      }

      return true;
    }

    return false;
  }, monitorBufferTime),
      _useBuffer2 = Object(esm_slicedToArray["a" /* default */])(_useBuffer, 2),
      _forceAlign = _useBuffer2[0],
      cancelForceAlign = _useBuffer2[1]; // ===================== Effect =====================
  // Listen for target updated


  var resizeMonitor = external_React_default.a.useRef({
    cancel: function cancel() {}
  }); // Listen for source updated

  var sourceResizeMonitor = external_React_default.a.useRef({
    cancel: function cancel() {}
  });
  external_React_default.a.useEffect(function () {
    var element = getElement(target);
    var point = getPoint(target);

    if (nodeRef.current !== sourceResizeMonitor.current.element) {
      sourceResizeMonitor.current.cancel();
      sourceResizeMonitor.current.element = nodeRef.current;
      sourceResizeMonitor.current.cancel = monitorResize(nodeRef.current, _forceAlign);
    }

    if (cacheRef.current.element !== element || !isSamePoint(cacheRef.current.point, point)) {
      _forceAlign(); // Add resize observer


      if (resizeMonitor.current.element !== element) {
        resizeMonitor.current.cancel();
        resizeMonitor.current.element = element;
        resizeMonitor.current.cancel = monitorResize(element, _forceAlign);
      }
    }
  }); // Listen for disabled change

  external_React_default.a.useEffect(function () {
    if (!disabled) {
      _forceAlign();
    } else {
      cancelForceAlign();
    }
  }, [disabled]); // Listen for window resize

  var winResizeRef = external_React_default.a.useRef(null);
  external_React_default.a.useEffect(function () {
    if (monitorWindowResize) {
      if (!winResizeRef.current) {
        winResizeRef.current = addEventListenerWrap(window, 'resize', _forceAlign);
      }
    } else if (winResizeRef.current) {
      winResizeRef.current.remove();
      winResizeRef.current = null;
    }
  }, [monitorWindowResize]); // Clear all if unmount

  external_React_default.a.useEffect(function () {
    return function () {
      resizeMonitor.current.cancel();
      sourceResizeMonitor.current.cancel();
      if (winResizeRef.current) winResizeRef.current.remove();
      cancelForceAlign();
    };
  }, []); // ====================== Ref =======================

  external_React_default.a.useImperativeHandle(ref, function () {
    return {
      forceAlign: function forceAlign() {
        return _forceAlign(true);
      }
    };
  }); // ===================== Render =====================

  if ( /*#__PURE__*/external_React_default.a.isValidElement(childNode)) {
    childNode = /*#__PURE__*/external_React_default.a.cloneElement(childNode, {
      ref: composeRef(childNode.ref, nodeRef)
    });
  }

  return childNode;
};

var RefAlign = /*#__PURE__*/external_React_default.a.forwardRef(Align_Align);
RefAlign.displayName = 'Align';
/* harmony default export */ var es_Align = (RefAlign);
// CONCATENATED MODULE: ./node_modules/rc-align/es/index.js
// export this package's api

/* harmony default export */ var rc_align_es = (es_Align);
// CONCATENATED MODULE: ./node_modules/rc-motion/es/util/motion.js

var canUseDOM = !!(typeof window !== 'undefined' && window.document && window.document.createElement); // ================= Transition =================
// Event wrapper. Copy from react source code

function makePrefixMap(styleProp, eventName) {
  var prefixes = {};
  prefixes[styleProp.toLowerCase()] = eventName.toLowerCase();
  prefixes["Webkit".concat(styleProp)] = "webkit".concat(eventName);
  prefixes["Moz".concat(styleProp)] = "moz".concat(eventName);
  prefixes["ms".concat(styleProp)] = "MS".concat(eventName);
  prefixes["O".concat(styleProp)] = "o".concat(eventName.toLowerCase());
  return prefixes;
}

function getVendorPrefixes(domSupport, win) {
  var prefixes = {
    animationend: makePrefixMap('Animation', 'AnimationEnd'),
    transitionend: makePrefixMap('Transition', 'TransitionEnd')
  };

  if (domSupport) {
    if (!('AnimationEvent' in win)) {
      delete prefixes.animationend.animation;
    }

    if (!('TransitionEvent' in win)) {
      delete prefixes.transitionend.transition;
    }
  }

  return prefixes;
}
var vendorPrefixes = getVendorPrefixes(canUseDOM, typeof window !== 'undefined' ? window : {});
var motion_style = {};

if (canUseDOM) {
  var _document$createEleme = document.createElement('div');

  motion_style = _document$createEleme.style;
}

var prefixedEventNames = {};
function getVendorPrefixedEventName(eventName) {
  if (prefixedEventNames[eventName]) {
    return prefixedEventNames[eventName];
  }

  var prefixMap = vendorPrefixes[eventName];

  if (prefixMap) {
    var stylePropList = Object.keys(prefixMap);
    var len = stylePropList.length;

    for (var i = 0; i < len; i += 1) {
      var styleProp = stylePropList[i];

      if (Object.prototype.hasOwnProperty.call(prefixMap, styleProp) && styleProp in motion_style) {
        prefixedEventNames[eventName] = prefixMap[styleProp];
        return prefixedEventNames[eventName];
      }
    }
  }

  return '';
}
var animationEndName = getVendorPrefixedEventName('animationend');
var transitionEndName = getVendorPrefixedEventName('transitionend');
var supportTransition = !!(animationEndName && transitionEndName);
function motion_getTransitionName(transitionName, transitionType) {
  if (!transitionName) return null;

  if (Object(esm_typeof["a" /* default */])(transitionName) === 'object') {
    var type = transitionType.replace(/-\w/g, function (match) {
      return match[1].toUpperCase();
    });
    return transitionName[type];
  }

  return "".concat(transitionName, "-").concat(transitionType);
}
// CONCATENATED MODULE: ./node_modules/rc-motion/es/CSSMotion.js








/* eslint-disable react/default-props-match-prop-types, react/no-multi-comp, react/prop-types */







var STATUS_NONE = 'none';
var STATUS_APPEAR = 'appear';
var STATUS_ENTER = 'enter';
var STATUS_LEAVE = 'leave';
/**
 * `transitionSupport` is used for none transition test case.
 * Default we use browser transition event support check.
 */

function genCSSMotion(config) {
  var transitionSupport = config;
  var forwardRef = !!external_React_default.a.forwardRef;

  if (Object(esm_typeof["a" /* default */])(config) === 'object') {
    transitionSupport = config.transitionSupport;
    forwardRef = 'forwardRef' in config ? config.forwardRef : forwardRef;
  }

  function isSupportTransition(props) {
    return !!(props.motionName && transitionSupport);
  }

  var CSSMotion = /*#__PURE__*/function (_React$Component) {
    Object(esm_inherits["a" /* default */])(CSSMotion, _React$Component);

    var _super = _createSuper(CSSMotion);

    function CSSMotion() {
      var _this;

      Object(esm_classCallCheck["a" /* default */])(this, CSSMotion);

      _this = _super.apply(this, arguments);
      _this.$cacheEle = null;
      _this.node = null;
      _this.raf = null;
      _this.destroyed = false;
      _this.deadlineId = null;
      _this.state = {
        status: STATUS_NONE,
        statusActive: false,
        newStatus: false,
        statusStyle: null
      };

      _this.onDomUpdate = function () {
        var _this$state = _this.state,
            status = _this$state.status,
            newStatus = _this$state.newStatus;
        var _this$props = _this.props,
            onAppearStart = _this$props.onAppearStart,
            onEnterStart = _this$props.onEnterStart,
            onLeaveStart = _this$props.onLeaveStart,
            onAppearActive = _this$props.onAppearActive,
            onEnterActive = _this$props.onEnterActive,
            onLeaveActive = _this$props.onLeaveActive,
            motionAppear = _this$props.motionAppear,
            motionEnter = _this$props.motionEnter,
            motionLeave = _this$props.motionLeave;

        if (!isSupportTransition(_this.props)) {
          return;
        } // Event injection


        var $ele = _this.getElement();

        if (_this.$cacheEle !== $ele) {
          _this.removeEventListener(_this.$cacheEle);

          _this.addEventListener($ele);

          _this.$cacheEle = $ele;
        } // Init status


        if (newStatus && status === STATUS_APPEAR && motionAppear) {
          _this.updateStatus(onAppearStart, null, null, function () {
            _this.updateActiveStatus(onAppearActive, STATUS_APPEAR);
          });
        } else if (newStatus && status === STATUS_ENTER && motionEnter) {
          _this.updateStatus(onEnterStart, null, null, function () {
            _this.updateActiveStatus(onEnterActive, STATUS_ENTER);
          });
        } else if (newStatus && status === STATUS_LEAVE && motionLeave) {
          _this.updateStatus(onLeaveStart, null, null, function () {
            _this.updateActiveStatus(onLeaveActive, STATUS_LEAVE);
          });
        }
      };

      _this.onMotionEnd = function (event) {
        var _this$state2 = _this.state,
            status = _this$state2.status,
            statusActive = _this$state2.statusActive;
        var _this$props2 = _this.props,
            onAppearEnd = _this$props2.onAppearEnd,
            onEnterEnd = _this$props2.onEnterEnd,
            onLeaveEnd = _this$props2.onLeaveEnd;

        if (status === STATUS_APPEAR && statusActive) {
          _this.updateStatus(onAppearEnd, {
            status: STATUS_NONE
          }, event);
        } else if (status === STATUS_ENTER && statusActive) {
          _this.updateStatus(onEnterEnd, {
            status: STATUS_NONE
          }, event);
        } else if (status === STATUS_LEAVE && statusActive) {
          _this.updateStatus(onLeaveEnd, {
            status: STATUS_NONE
          }, event);
        }
      };

      _this.setNodeRef = function (node) {
        var internalRef = _this.props.internalRef;
        _this.node = node;
        fillRef(internalRef, node);
      };

      _this.getElement = function () {
        try {
          return findDOMNode(_this.node || Object(assertThisInitialized["a" /* default */])(_this));
        } catch (e) {
          /**
           * Fallback to cache element.
           * This is only happen when `motionDeadline` trigger but element removed.
           */
          return _this.$cacheEle;
        }
      };

      _this.addEventListener = function ($ele) {
        if (!$ele) return;
        $ele.addEventListener(transitionEndName, _this.onMotionEnd);
        $ele.addEventListener(animationEndName, _this.onMotionEnd);
      };

      _this.removeEventListener = function ($ele) {
        if (!$ele) return;
        $ele.removeEventListener(transitionEndName, _this.onMotionEnd);
        $ele.removeEventListener(animationEndName, _this.onMotionEnd);
      };

      _this.updateStatus = function (styleFunc, additionalState, event, callback) {
        var statusStyle = styleFunc ? styleFunc(_this.getElement(), event) : null;
        if (statusStyle === false || _this.destroyed) return;
        var nextStep;

        if (callback) {
          nextStep = function nextStep() {
            _this.nextFrame(callback);
          };
        }

        _this.setState(_objectSpread2({
          statusStyle: Object(esm_typeof["a" /* default */])(statusStyle) === 'object' ? statusStyle : null,
          newStatus: false
        }, additionalState), nextStep); // Trigger before next frame & after `componentDidMount`

      };

      _this.updateActiveStatus = function (styleFunc, currentStatus) {
        // `setState` use `postMessage` to trigger at the end of frame.
        // Let's use requestAnimationFrame to update new state in next frame.
        _this.nextFrame(function () {
          var status = _this.state.status;
          if (status !== currentStatus) return;
          var motionDeadline = _this.props.motionDeadline;

          _this.updateStatus(styleFunc, {
            statusActive: true
          });

          if (motionDeadline > 0) {
            _this.deadlineId = setTimeout(function () {
              _this.onMotionEnd({
                deadline: true
              });
            }, motionDeadline);
          }
        });
      };

      _this.nextFrame = function (func) {
        _this.cancelNextFrame();

        _this.raf = raf_default()(func);
      };

      _this.cancelNextFrame = function () {
        if (_this.raf) {
          raf_default.a.cancel(_this.raf);
          _this.raf = null;
        }
      };

      return _this;
    }

    Object(esm_createClass["a" /* default */])(CSSMotion, [{
      key: "componentDidMount",
      value: function componentDidMount() {
        this.onDomUpdate();
      }
    }, {
      key: "componentDidUpdate",
      value: function componentDidUpdate() {
        this.onDomUpdate();
      }
    }, {
      key: "componentWillUnmount",
      value: function componentWillUnmount() {
        this.destroyed = true;
        this.removeEventListener(this.$cacheEle);
        this.cancelNextFrame();
        clearTimeout(this.deadlineId);
      }
    }, {
      key: "render",
      value: function render() {
        var _classNames;

        var _this$state3 = this.state,
            status = _this$state3.status,
            statusActive = _this$state3.statusActive,
            statusStyle = _this$state3.statusStyle;
        var _this$props3 = this.props,
            children = _this$props3.children,
            motionName = _this$props3.motionName,
            visible = _this$props3.visible,
            removeOnLeave = _this$props3.removeOnLeave,
            leavedClassName = _this$props3.leavedClassName,
            eventProps = _this$props3.eventProps;
        if (!children) return null;

        if (status === STATUS_NONE || !isSupportTransition(this.props)) {
          if (visible) {
            return children(_objectSpread2({}, eventProps), this.setNodeRef);
          }

          if (!removeOnLeave) {
            return children(_objectSpread2(_objectSpread2({}, eventProps), {}, {
              className: leavedClassName
            }), this.setNodeRef);
          }

          return null;
        }

        return children(_objectSpread2(_objectSpread2({}, eventProps), {}, {
          className: classnames_default()(motion_getTransitionName(motionName, status), (_classNames = {}, Object(esm_defineProperty["a" /* default */])(_classNames, motion_getTransitionName(motionName, "".concat(status, "-active")), statusActive), Object(esm_defineProperty["a" /* default */])(_classNames, motionName, typeof motionName === 'string'), _classNames)),
          style: statusStyle
        }), this.setNodeRef);
      }
    }], [{
      key: "getDerivedStateFromProps",
      value: function getDerivedStateFromProps(props, _ref) {
        var prevProps = _ref.prevProps,
            prevStatus = _ref.status;
        if (!isSupportTransition(props)) return {};
        var visible = props.visible,
            motionAppear = props.motionAppear,
            motionEnter = props.motionEnter,
            motionLeave = props.motionLeave,
            motionLeaveImmediately = props.motionLeaveImmediately;
        var newState = {
          prevProps: props
        }; // Clean up status if prop set to false

        if (prevStatus === STATUS_APPEAR && !motionAppear || prevStatus === STATUS_ENTER && !motionEnter || prevStatus === STATUS_LEAVE && !motionLeave) {
          newState.status = STATUS_NONE;
          newState.statusActive = false;
          newState.newStatus = false;
        } // Appear


        if (!prevProps && visible && motionAppear) {
          newState.status = STATUS_APPEAR;
          newState.statusActive = false;
          newState.newStatus = true;
        } // Enter


        if (prevProps && !prevProps.visible && visible && motionEnter) {
          newState.status = STATUS_ENTER;
          newState.statusActive = false;
          newState.newStatus = true;
        } // Leave


        if (prevProps && prevProps.visible && !visible && motionLeave || !prevProps && motionLeaveImmediately && !visible && motionLeave) {
          newState.status = STATUS_LEAVE;
          newState.statusActive = false;
          newState.newStatus = true;
        }

        return newState;
      }
    }]);

    return CSSMotion;
  }(external_React_default.a.Component);

  CSSMotion.defaultProps = {
    visible: true,
    motionEnter: true,
    motionAppear: true,
    motionLeave: true,
    removeOnLeave: true
  };

  if (!forwardRef) {
    return CSSMotion;
  }

  return /*#__PURE__*/external_React_default.a.forwardRef(function (props, ref) {
    return /*#__PURE__*/external_React_default.a.createElement(CSSMotion, Object.assign({
      internalRef: ref
    }, props));
  });
}
/* harmony default export */ var es_CSSMotion = (genCSSMotion(supportTransition));
// CONCATENATED MODULE: ./node_modules/rc-motion/es/util/diff.js


var STATUS_ADD = 'add';
var STATUS_KEEP = 'keep';
var STATUS_REMOVE = 'remove';
var STATUS_REMOVED = 'removed';
function wrapKeyToObject(key) {
  var keyObj;

  if (key && Object(esm_typeof["a" /* default */])(key) === 'object' && 'key' in key) {
    keyObj = key;
  } else {
    keyObj = {
      key: key
    };
  }

  return _objectSpread2(_objectSpread2({}, keyObj), {}, {
    key: String(keyObj.key)
  });
}
function parseKeys() {
  var keys = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : [];
  return keys.map(wrapKeyToObject);
}
function diffKeys() {
  var prevKeys = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : [];
  var currentKeys = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : [];
  var list = [];
  var currentIndex = 0;
  var currentLen = currentKeys.length;
  var prevKeyObjects = parseKeys(prevKeys);
  var currentKeyObjects = parseKeys(currentKeys); // Check prev keys to insert or keep

  prevKeyObjects.forEach(function (keyObj) {
    var hit = false;

    for (var i = currentIndex; i < currentLen; i += 1) {
      var currentKeyObj = currentKeyObjects[i];

      if (currentKeyObj.key === keyObj.key) {
        // New added keys should add before current key
        if (currentIndex < i) {
          list = list.concat(currentKeyObjects.slice(currentIndex, i).map(function (obj) {
            return _objectSpread2(_objectSpread2({}, obj), {}, {
              status: STATUS_ADD
            });
          }));
          currentIndex = i;
        }

        list.push(_objectSpread2(_objectSpread2({}, currentKeyObj), {}, {
          status: STATUS_KEEP
        }));
        currentIndex += 1;
        hit = true;
        break;
      }
    } // If not hit, it means key is removed


    if (!hit) {
      list.push(_objectSpread2(_objectSpread2({}, keyObj), {}, {
        status: STATUS_REMOVE
      }));
    }
  }); // Add rest to the list

  if (currentIndex < currentLen) {
    list = list.concat(currentKeyObjects.slice(currentIndex).map(function (obj) {
      return _objectSpread2(_objectSpread2({}, obj), {}, {
        status: STATUS_ADD
      });
    }));
  }
  /**
   * Merge same key when it remove and add again:
   *    [1 - add, 2 - keep, 1 - remove] -> [1 - keep, 2 - keep]
   */


  var keys = {};
  list.forEach(function (_ref) {
    var key = _ref.key;
    keys[key] = (keys[key] || 0) + 1;
  });
  var duplicatedKeys = Object.keys(keys).filter(function (key) {
    return keys[key] > 1;
  });
  duplicatedKeys.forEach(function (matchKey) {
    // Remove `STATUS_REMOVE` node.
    list = list.filter(function (_ref2) {
      var key = _ref2.key,
          status = _ref2.status;
      return key !== matchKey || status !== STATUS_REMOVE;
    }); // Update `STATUS_ADD` to `STATUS_KEEP`

    list.forEach(function (node) {
      if (node.key === matchKey) {
        // eslint-disable-next-line no-param-reassign
        node.status = STATUS_KEEP;
      }
    });
  });
  return list;
}
// CONCATENATED MODULE: ./node_modules/rc-motion/es/CSSMotionList.js






/* eslint react/prop-types: 0 */





var MOTION_PROP_NAMES = ['eventProps', 'visible', 'children', 'motionName', 'motionAppear', 'motionEnter', 'motionLeave', 'motionLeaveImmediately', 'motionDeadline', 'removeOnLeave', 'leavedClassName', 'onAppearStart', 'onAppearActive', 'onAppearEnd', 'onEnterStart', 'onEnterActive', 'onEnterEnd', 'onLeaveStart', 'onLeaveActive', 'onLeaveEnd'];
function genCSSMotionList(transitionSupport) {
  var CSSMotion = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : es_CSSMotion;

  var CSSMotionList = /*#__PURE__*/function (_React$Component) {
    Object(esm_inherits["a" /* default */])(CSSMotionList, _React$Component);

    var _super = _createSuper(CSSMotionList);

    function CSSMotionList() {
      var _this;

      Object(esm_classCallCheck["a" /* default */])(this, CSSMotionList);

      _this = _super.apply(this, arguments);
      _this.state = {
        keyEntities: []
      };

      _this.removeKey = function (removeKey) {
        _this.setState(function (_ref) {
          var keyEntities = _ref.keyEntities;
          return {
            keyEntities: keyEntities.map(function (entity) {
              if (entity.key !== removeKey) return entity;
              return _objectSpread2(_objectSpread2({}, entity), {}, {
                status: STATUS_REMOVED
              });
            })
          };
        });
      };

      return _this;
    }

    Object(esm_createClass["a" /* default */])(CSSMotionList, [{
      key: "render",
      value: function render() {
        var _this2 = this;

        var keyEntities = this.state.keyEntities;

        var _this$props = this.props,
            component = _this$props.component,
            children = _this$props.children,
            restProps = Object(objectWithoutProperties["a" /* default */])(_this$props, ["component", "children"]);

        var Component = component || external_React_default.a.Fragment;
        var motionProps = {};
        MOTION_PROP_NAMES.forEach(function (prop) {
          motionProps[prop] = restProps[prop];
          delete restProps[prop];
        });
        delete restProps.keys;
        return /*#__PURE__*/external_React_default.a.createElement(Component, Object.assign({}, restProps), keyEntities.map(function (_ref2) {
          var status = _ref2.status,
              eventProps = Object(objectWithoutProperties["a" /* default */])(_ref2, ["status"]);

          var visible = status === STATUS_ADD || status === STATUS_KEEP;
          return /*#__PURE__*/external_React_default.a.createElement(CSSMotion, Object.assign({}, motionProps, {
            key: eventProps.key,
            visible: visible,
            eventProps: eventProps,
            onLeaveEnd: function onLeaveEnd() {
              if (motionProps.onLeaveEnd) {
                motionProps.onLeaveEnd.apply(motionProps, arguments);
              }

              _this2.removeKey(eventProps.key);
            }
          }), children);
        }));
      }
    }], [{
      key: "getDerivedStateFromProps",
      value: function getDerivedStateFromProps(_ref3, _ref4) {
        var keys = _ref3.keys;
        var keyEntities = _ref4.keyEntities;
        var parsedKeyObjects = parseKeys(keys); // Always as keep when motion not support

        if (!transitionSupport) {
          return {
            keyEntities: parsedKeyObjects.map(function (obj) {
              return _objectSpread2(_objectSpread2({}, obj), {}, {
                status: STATUS_KEEP
              });
            })
          };
        }

        var mixedKeyEntities = diffKeys(keyEntities, parsedKeyObjects);
        var keyEntitiesLen = keyEntities.length;
        return {
          keyEntities: mixedKeyEntities.filter(function (entity) {
            // IE 9 not support Array.prototype.find
            var prevEntity = null;

            for (var i = 0; i < keyEntitiesLen; i += 1) {
              var currentEntity = keyEntities[i];

              if (currentEntity.key === entity.key) {
                prevEntity = currentEntity;
                break;
              }
            } // Remove if already mark as removed


            if (prevEntity && prevEntity.status === STATUS_REMOVED && entity.status === STATUS_REMOVE) {
              return false;
            }

            return true;
          })
        };
      }
    }]);

    return CSSMotionList;
  }(external_React_default.a.Component);

  CSSMotionList.defaultProps = {
    component: 'div'
  };
  return CSSMotionList;
}
/* harmony default export */ var es_CSSMotionList = (genCSSMotionList(supportTransition));
// CONCATENATED MODULE: ./node_modules/rc-motion/es/index.js



/* harmony default export */ var rc_motion_es = (es_CSSMotion);
// CONCATENATED MODULE: ./node_modules/rc-trigger/es/PopupInner.js


var PopupInner_PopupInner = function PopupInner(props, ref) {
  var prefixCls = props.prefixCls,
      className = props.className,
      style = props.style,
      children = props.children,
      onMouseEnter = props.onMouseEnter,
      onMouseLeave = props.onMouseLeave,
      onMouseDown = props.onMouseDown,
      onTouchStart = props.onTouchStart;
  var childNode = children;

  if (external_React_default.a.Children.count(children) > 1) {
    childNode = /*#__PURE__*/external_React_default.a.createElement("div", {
      className: "".concat(prefixCls, "-content")
    }, children);
  }

  return /*#__PURE__*/external_React_default.a.createElement("div", {
    ref: ref,
    className: className,
    onMouseEnter: onMouseEnter,
    onMouseLeave: onMouseLeave,
    onMouseDown: onMouseDown,
    onTouchStart: onTouchStart,
    style: style
  }, childNode);
};

var RefPopupInner = /*#__PURE__*/external_React_default.a.forwardRef(PopupInner_PopupInner);
RefPopupInner.displayName = 'PopupInner';
/* harmony default export */ var es_PopupInner = (RefPopupInner);
// CONCATENATED MODULE: ./node_modules/rc-trigger/es/utils/legacyUtil.js
function getMotion(_ref) {
  var prefixCls = _ref.prefixCls,
      motion = _ref.motion,
      animation = _ref.animation,
      transitionName = _ref.transitionName;

  if (motion) {
    return motion;
  }

  if (animation) {
    return {
      motionName: "".concat(prefixCls, "-").concat(animation)
    };
  }

  if (transitionName) {
    return {
      motionName: transitionName
    };
  }

  return null;
}
// CONCATENATED MODULE: ./node_modules/rc-trigger/es/Popup.js






/* eslint-disable no-param-reassign */










function supportMotion(motion) {
  return motion && motion.motionName;
}

var Popup_Popup = /*#__PURE__*/function (_Component) {
  Object(esm_inherits["a" /* default */])(Popup, _Component);

  var _super = _createSuper(Popup);

  function Popup() {
    var _this;

    Object(esm_classCallCheck["a" /* default */])(this, Popup);

    _this = _super.apply(this, arguments);
    _this.state = {
      targetWidth: undefined,
      targetHeight: undefined,
      status: null,
      prevVisible: null,
      alignClassName: null,
      inMotion: false
    };
    _this.popupRef = /*#__PURE__*/external_React_default.a.createRef();
    _this.alignRef = /*#__PURE__*/external_React_default.a.createRef();
    _this.nextFrameState = null;
    _this.nextFrameId = null;

    _this.onAlign = function (popupDomNode, align) {
      var status = _this.state.status;
      var _this$props = _this.props,
          getClassNameFromAlign = _this$props.getClassNameFromAlign,
          onAlign = _this$props.onAlign;
      var alignClassName = getClassNameFromAlign(align);

      if (status === 'align') {
        _this.setState({
          alignClassName: alignClassName,
          status: 'aligned'
        }, function () {
          _this.alignRef.current.forceAlign();
        });
      } else if (status === 'aligned') {
        _this.setState({
          alignClassName: alignClassName,
          status: 'afterAlign'
        });

        onAlign(popupDomNode, align);
      } else {
        _this.setState({
          alignClassName: alignClassName
        });
      }
    };

    _this.onMotionEnd = function () {
      var visible = _this.props.visible;

      _this.setState({
        status: visible ? 'AfterMotion' : 'stable',
        inMotion: false
      });
    };

    _this.setStateOnNextFrame = function (state) {
      _this.cancelFrameState();

      _this.nextFrameState = _objectSpread2(_objectSpread2({}, _this.nextFrameState), state);
      _this.nextFrameId = raf_default()(function () {
        var submitState = _objectSpread2({}, _this.nextFrameState);

        _this.nextFrameState = null;

        _this.setState(submitState);
      });
    };

    _this.getMotion = function () {
      return _objectSpread2({}, getMotion(_this.props));
    }; // `target` on `rc-align` can accept as a function to get the bind element or a point.
    // ref: https://www.npmjs.com/package/rc-align


    _this.getAlignTarget = function () {
      var _this$props2 = _this.props,
          point = _this$props2.point,
          getRootDomNode = _this$props2.getRootDomNode;

      if (point) {
        return point;
      }

      return getRootDomNode;
    };

    _this.cancelFrameState = function () {
      raf_default.a.cancel(_this.nextFrameId);
    };

    _this.renderPopupElement = function () {
      var _this$state = _this.state,
          status = _this$state.status,
          targetHeight = _this$state.targetHeight,
          targetWidth = _this$state.targetWidth,
          alignClassName = _this$state.alignClassName;
      var _this$props3 = _this.props,
          prefixCls = _this$props3.prefixCls,
          className = _this$props3.className,
          style = _this$props3.style,
          stretch = _this$props3.stretch,
          visible = _this$props3.visible,
          align = _this$props3.align,
          destroyPopupOnHide = _this$props3.destroyPopupOnHide,
          onMouseEnter = _this$props3.onMouseEnter,
          onMouseLeave = _this$props3.onMouseLeave,
          onMouseDown = _this$props3.onMouseDown,
          onTouchStart = _this$props3.onTouchStart,
          children = _this$props3.children;
      var mergedClassName = classnames_default()(prefixCls, className, alignClassName);
      var hiddenClassName = "".concat(prefixCls, "-hidden"); // ================== Style ==================

      var sizeStyle = {};

      if (stretch) {
        // Stretch with target
        if (stretch.indexOf('height') !== -1) {
          sizeStyle.height = targetHeight;
        } else if (stretch.indexOf('minHeight') !== -1) {
          sizeStyle.minHeight = targetHeight;
        }

        if (stretch.indexOf('width') !== -1) {
          sizeStyle.width = targetWidth;
        } else if (stretch.indexOf('minWidth') !== -1) {
          sizeStyle.minWidth = targetWidth;
        }
      }

      var mergedStyle = _objectSpread2(_objectSpread2(_objectSpread2(_objectSpread2({}, sizeStyle), _this.getZIndexStyle()), style), {}, {
        opacity: status === 'stable' || !visible ? undefined : 0
      }); // ================= Motions =================


      var mergedMotion = _this.getMotion();

      var mergedMotionVisible = visible;

      if (visible && status !== 'beforeMotion' && status !== 'motion' && status !== 'stable') {
        mergedMotion.motionAppear = false;
        mergedMotion.motionEnter = false;
        mergedMotion.motionLeave = false;
      }

      if (status === 'afterAlign' || status === 'beforeMotion') {
        mergedMotionVisible = false;
      } // Update trigger to tell if is in motion


      ['onEnterStart', 'onAppearStart', 'onLeaveStart'].forEach(function (event) {
        var originFunc = mergedMotion === null || mergedMotion === void 0 ? void 0 : mergedMotion[event];

        mergedMotion[event] = function () {
          for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
            args[_key] = arguments[_key];
          }

          originFunc === null || originFunc === void 0 ? void 0 : originFunc.apply(void 0, args);

          _this.setState({
            inMotion: true
          });
        };
      }); // ================== Align ==================

      var mergedAlignDisabled = !visible || status !== 'align' && status !== 'aligned' && status !== 'stable'; // ================== Popup ==================

      var mergedPopupVisible = true;

      if (status === 'stable') {
        mergedPopupVisible = visible;
      } // Only remove popup since mask may still need animation


      if (destroyPopupOnHide && !mergedPopupVisible) {
        return null;
      }

      return /*#__PURE__*/external_React_default.a.createElement(rc_motion_es, Object.assign({
        visible: mergedMotionVisible
      }, mergedMotion, {
        removeOnLeave: false,
        onEnterEnd: _this.onMotionEnd,
        onLeaveEnd: _this.onMotionEnd,
        leavedClassName: hiddenClassName
      }), function (_ref, motionRef) {
        var motionStyle = _ref.style,
            motionClassName = _ref.className;
        return /*#__PURE__*/external_React_default.a.createElement(rc_align_es, {
          target: _this.getAlignTarget(),
          key: "popup",
          ref: _this.alignRef,
          monitorWindowResize: true,
          disabled: mergedAlignDisabled,
          align: align,
          onAlign: _this.onAlign
        }, /*#__PURE__*/external_React_default.a.createElement(es_PopupInner, {
          prefixCls: prefixCls,
          className: classnames_default()(mergedClassName, motionClassName),
          ref: composeRef(motionRef, _this.popupRef),
          onMouseEnter: onMouseEnter,
          onMouseLeave: onMouseLeave,
          onMouseDown: onMouseDown,
          onTouchStart: onTouchStart,
          style: _objectSpread2(_objectSpread2({}, mergedStyle), motionStyle)
        }, children));
      });
    };

    _this.renderMaskElement = function () {
      var _this$props4 = _this.props,
          mask = _this$props4.mask,
          maskMotion = _this$props4.maskMotion,
          maskTransitionName = _this$props4.maskTransitionName,
          maskAnimation = _this$props4.maskAnimation,
          prefixCls = _this$props4.prefixCls,
          visible = _this$props4.visible;

      if (!mask) {
        return null;
      }

      var motion = {};

      if (maskMotion && maskMotion.motionName) {
        motion = _objectSpread2({
          motionAppear: true
        }, getMotion({
          motion: maskMotion,
          prefixCls: prefixCls,
          transitionName: maskTransitionName,
          animation: maskAnimation
        }));
      }

      return /*#__PURE__*/external_React_default.a.createElement(rc_motion_es, Object.assign({}, motion, {
        visible: visible,
        removeOnLeave: true
      }), function (_ref2) {
        var className = _ref2.className;
        return /*#__PURE__*/external_React_default.a.createElement("div", {
          style: _this.getZIndexStyle(),
          key: "mask",
          className: classnames_default()("".concat(prefixCls, "-mask"), className)
        });
      });
    };

    return _this;
  }

  Object(esm_createClass["a" /* default */])(Popup, [{
    key: "componentDidMount",
    value: function componentDidMount() {
      this.componentDidUpdate();
    }
  }, {
    key: "componentDidUpdate",
    value: function componentDidUpdate() {
      var status = this.state.status;
      var _this$props5 = this.props,
          getRootDomNode = _this$props5.getRootDomNode,
          visible = _this$props5.visible,
          stretch = _this$props5.stretch; // If there is a pending state update, cancel it, a new one will be set if necessary

      this.cancelFrameState();

      if (visible && status !== 'stable') {
        switch (status) {
          case null:
            {
              this.setStateOnNextFrame({
                status: stretch ? 'measure' : 'align'
              });
              break;
            }

          case 'afterAlign':
            {
              this.setStateOnNextFrame({
                status: supportMotion(this.getMotion()) ? 'beforeMotion' : 'stable'
              });
              break;
            }

          case 'AfterMotion':
            {
              this.setStateOnNextFrame({
                status: 'stable'
              });
              break;
            }

          default:
            {
              // Go to next status
              var queue = ['measure', 'align', null, 'beforeMotion', 'motion'];
              var index = queue.indexOf(status);
              var nextStatus = queue[index + 1];

              if (index !== -1 && nextStatus) {
                this.setStateOnNextFrame({
                  status: nextStatus
                });
              }
            }
        }
      } // Measure stretch size


      if (status === 'measure') {
        var $ele = getRootDomNode();

        if ($ele) {
          this.setStateOnNextFrame({
            targetHeight: $ele.offsetHeight,
            targetWidth: $ele.offsetWidth
          });
        }
      }
    }
  }, {
    key: "componentWillUnmount",
    value: function componentWillUnmount() {
      this.cancelFrameState();
    }
  }, {
    key: "getZIndexStyle",
    value: function getZIndexStyle() {
      var zIndex = this.props.zIndex;
      return {
        zIndex: zIndex
      };
    }
  }, {
    key: "render",
    value: function render() {
      return /*#__PURE__*/external_React_default.a.createElement("div", null, this.renderMaskElement(), this.renderPopupElement());
    }
  }], [{
    key: "getDerivedStateFromProps",
    value: function getDerivedStateFromProps(_ref3, _ref4) {
      var visible = _ref3.visible,
          props = Object(objectWithoutProperties["a" /* default */])(_ref3, ["visible"]);

      var prevVisible = _ref4.prevVisible,
          status = _ref4.status,
          inMotion = _ref4.inMotion;
      var newState = {
        prevVisible: visible,
        status: status
      };
      var mergedMotion = getMotion(props);

      if (prevVisible === null && visible === false) {
        // Init render should always be stable
        newState.status = 'stable';
        newState.inMotion = false;
      } else if (visible !== prevVisible) {
        newState.inMotion = false;

        if (visible || supportMotion(mergedMotion) && inMotion) {
          newState.status = null;
        } else {
          newState.status = 'stable';
        }

        if (visible) {
          newState.alignClassName = null;
        }
      }

      return newState;
    }
  }]);

  return Popup;
}(external_React_["Component"]);

/* harmony default export */ var es_Popup = (Popup_Popup);
/* eslint-enable */
// CONCATENATED MODULE: ./node_modules/rc-trigger/es/context.js

var TriggerContext = /*#__PURE__*/external_React_default.a.createContext(null);
/* harmony default export */ var es_context = (TriggerContext);
// CONCATENATED MODULE: ./node_modules/rc-trigger/es/index.js


















function noop() {}

function returnEmptyString() {
  return '';
}

function returnDocument() {
  return window.document;
}

var ALL_HANDLERS = ['onClick', 'onMouseDown', 'onTouchStart', 'onMouseEnter', 'onMouseLeave', 'onFocus', 'onBlur', 'onContextMenu'];
/**
 * Internal usage. Do not use in your code since this will be removed.
 */

function generateTrigger(PortalComponent) {
  var Trigger = /*#__PURE__*/function (_React$Component) {
    Object(esm_inherits["a" /* default */])(Trigger, _React$Component);

    var _super = _createSuper(Trigger);

    function Trigger(props) {
      var _this;

      Object(esm_classCallCheck["a" /* default */])(this, Trigger);

      _this = _super.call(this, props);
      _this.popupRef = /*#__PURE__*/external_React_default.a.createRef();
      _this.triggerRef = /*#__PURE__*/external_React_default.a.createRef();

      _this.onMouseEnter = function (e) {
        var mouseEnterDelay = _this.props.mouseEnterDelay;

        _this.fireEvents('onMouseEnter', e);

        _this.delaySetPopupVisible(true, mouseEnterDelay, mouseEnterDelay ? null : e);
      };

      _this.onMouseMove = function (e) {
        _this.fireEvents('onMouseMove', e);

        _this.setPoint(e);
      };

      _this.onMouseLeave = function (e) {
        _this.fireEvents('onMouseLeave', e);

        _this.delaySetPopupVisible(false, _this.props.mouseLeaveDelay);
      };

      _this.onPopupMouseEnter = function () {
        _this.clearDelayTimer();
      };

      _this.onPopupMouseLeave = function (e) {
        // https://github.com/react-component/trigger/pull/13
        // react bug?
        if (e.relatedTarget && !e.relatedTarget.setTimeout && _this.popupRef.current && _this.popupRef.current.popupRef.current && contains(_this.popupRef.current.popupRef.current, e.relatedTarget)) {
          return;
        }

        _this.delaySetPopupVisible(false, _this.props.mouseLeaveDelay);
      };

      _this.onFocus = function (e) {
        _this.fireEvents('onFocus', e); // incase focusin and focusout


        _this.clearDelayTimer();

        if (_this.isFocusToShow()) {
          _this.focusTime = Date.now();

          _this.delaySetPopupVisible(true, _this.props.focusDelay);
        }
      };

      _this.onMouseDown = function (e) {
        _this.fireEvents('onMouseDown', e);

        _this.preClickTime = Date.now();
      };

      _this.onTouchStart = function (e) {
        _this.fireEvents('onTouchStart', e);

        _this.preTouchTime = Date.now();
      };

      _this.onBlur = function (e) {
        _this.fireEvents('onBlur', e);

        _this.clearDelayTimer();

        if (_this.isBlurToHide()) {
          _this.delaySetPopupVisible(false, _this.props.blurDelay);
        }
      };

      _this.onContextMenu = function (e) {
        e.preventDefault();

        _this.fireEvents('onContextMenu', e);

        _this.setPopupVisible(true, e);
      };

      _this.onContextMenuClose = function () {
        if (_this.isContextMenuToShow()) {
          _this.close();
        }
      };

      _this.onClick = function (event) {
        _this.fireEvents('onClick', event); // focus will trigger click


        if (_this.focusTime) {
          var preTime;

          if (_this.preClickTime && _this.preTouchTime) {
            preTime = Math.min(_this.preClickTime, _this.preTouchTime);
          } else if (_this.preClickTime) {
            preTime = _this.preClickTime;
          } else if (_this.preTouchTime) {
            preTime = _this.preTouchTime;
          }

          if (Math.abs(preTime - _this.focusTime) < 20) {
            return;
          }

          _this.focusTime = 0;
        }

        _this.preClickTime = 0;
        _this.preTouchTime = 0; // Only prevent default when all the action is click.
        // https://github.com/ant-design/ant-design/issues/17043
        // https://github.com/ant-design/ant-design/issues/17291

        if (_this.isClickToShow() && (_this.isClickToHide() || _this.isBlurToHide()) && event && event.preventDefault) {
          event.preventDefault();
        }

        var nextVisible = !_this.state.popupVisible;

        if (_this.isClickToHide() && !nextVisible || nextVisible && _this.isClickToShow()) {
          _this.setPopupVisible(!_this.state.popupVisible, event);
        }
      };

      _this.onPopupMouseDown = function () {
        _this.hasPopupMouseDown = true;
        clearTimeout(_this.mouseDownTimeout);
        _this.mouseDownTimeout = window.setTimeout(function () {
          _this.hasPopupMouseDown = false;
        }, 0);

        if (_this.context) {
          var _this$context;

          (_this$context = _this.context).onPopupMouseDown.apply(_this$context, arguments);
        }
      };

      _this.onDocumentClick = function (event) {
        if (_this.props.mask && !_this.props.maskClosable) {
          return;
        }

        var target = event.target;

        var root = _this.getRootDomNode();

        var popupNode = _this.getPopupDomNode();

        if (!contains(root, target) && !contains(popupNode, target) && !_this.hasPopupMouseDown) {
          _this.close();
        }
      };

      _this.getRootDomNode = function () {
        var getTriggerDOMNode = _this.props.getTriggerDOMNode;

        if (getTriggerDOMNode) {
          return getTriggerDOMNode(_this.triggerRef.current);
        }

        try {
          var domNode = findDOMNode(_this.triggerRef.current);

          if (domNode) {
            return domNode;
          }
        } catch (err) {// Do nothing
        }

        return external_ReactDOM_default.a.findDOMNode(Object(assertThisInitialized["a" /* default */])(_this));
      };

      _this.getPopupClassNameFromAlign = function (align) {
        var className = [];
        var _this$props = _this.props,
            popupPlacement = _this$props.popupPlacement,
            builtinPlacements = _this$props.builtinPlacements,
            prefixCls = _this$props.prefixCls,
            alignPoint = _this$props.alignPoint,
            getPopupClassNameFromAlign = _this$props.getPopupClassNameFromAlign;

        if (popupPlacement && builtinPlacements) {
          className.push(getAlignPopupClassName(builtinPlacements, prefixCls, align, alignPoint));
        }

        if (getPopupClassNameFromAlign) {
          className.push(getPopupClassNameFromAlign(align));
        }

        return className.join(' ');
      };

      _this.getComponent = function () {
        var _this$props2 = _this.props,
            prefixCls = _this$props2.prefixCls,
            destroyPopupOnHide = _this$props2.destroyPopupOnHide,
            popupClassName = _this$props2.popupClassName,
            onPopupAlign = _this$props2.onPopupAlign,
            popupMotion = _this$props2.popupMotion,
            popupAnimation = _this$props2.popupAnimation,
            popupTransitionName = _this$props2.popupTransitionName,
            popupStyle = _this$props2.popupStyle,
            mask = _this$props2.mask,
            maskAnimation = _this$props2.maskAnimation,
            maskTransitionName = _this$props2.maskTransitionName,
            maskMotion = _this$props2.maskMotion,
            zIndex = _this$props2.zIndex,
            popup = _this$props2.popup,
            stretch = _this$props2.stretch,
            alignPoint = _this$props2.alignPoint;
        var _this$state = _this.state,
            popupVisible = _this$state.popupVisible,
            point = _this$state.point;

        var align = _this.getPopupAlign();

        var mouseProps = {};

        if (_this.isMouseEnterToShow()) {
          mouseProps.onMouseEnter = _this.onPopupMouseEnter;
        }

        if (_this.isMouseLeaveToHide()) {
          mouseProps.onMouseLeave = _this.onPopupMouseLeave;
        }

        mouseProps.onMouseDown = _this.onPopupMouseDown;
        mouseProps.onTouchStart = _this.onPopupMouseDown;
        return /*#__PURE__*/external_React_default.a.createElement(es_Popup, Object.assign({
          prefixCls: prefixCls,
          destroyPopupOnHide: destroyPopupOnHide,
          visible: popupVisible,
          point: alignPoint && point,
          className: popupClassName,
          align: align,
          onAlign: onPopupAlign,
          animation: popupAnimation,
          getClassNameFromAlign: _this.getPopupClassNameFromAlign
        }, mouseProps, {
          stretch: stretch,
          getRootDomNode: _this.getRootDomNode,
          style: popupStyle,
          mask: mask,
          zIndex: zIndex,
          transitionName: popupTransitionName,
          maskAnimation: maskAnimation,
          maskTransitionName: maskTransitionName,
          maskMotion: maskMotion,
          ref: _this.popupRef,
          motion: popupMotion
        }), typeof popup === 'function' ? popup() : popup);
      };

      _this.getContainer = function () {
        var _assertThisInitialize = Object(assertThisInitialized["a" /* default */])(_this),
            props = _assertThisInitialize.props;

        var popupContainer = document.createElement('div'); // Make sure default popup container will never cause scrollbar appearing
        // https://github.com/react-component/trigger/issues/41

        popupContainer.style.position = 'absolute';
        popupContainer.style.top = '0';
        popupContainer.style.left = '0';
        popupContainer.style.width = '100%';
        var mountNode = props.getPopupContainer ? props.getPopupContainer(_this.getRootDomNode()) : props.getDocument().body;
        mountNode.appendChild(popupContainer);
        return popupContainer;
      };

      _this.setPoint = function (point) {
        var alignPoint = _this.props.alignPoint;
        if (!alignPoint || !point) return;

        _this.setState({
          point: {
            pageX: point.pageX,
            pageY: point.pageY
          }
        });
      };

      _this.handlePortalUpdate = function () {
        if (_this.state.prevPopupVisible !== _this.state.popupVisible) {
          _this.props.afterPopupVisibleChange(_this.state.popupVisible);
        }
      };

      var popupVisible;

      if ('popupVisible' in props) {
        popupVisible = !!props.popupVisible;
      } else {
        popupVisible = !!props.defaultPopupVisible;
      }

      _this.state = {
        prevPopupVisible: popupVisible,
        popupVisible: popupVisible
      };
      ALL_HANDLERS.forEach(function (h) {
        _this["fire".concat(h)] = function (e) {
          _this.fireEvents(h, e);
        };
      });
      return _this;
    }

    Object(esm_createClass["a" /* default */])(Trigger, [{
      key: "componentDidMount",
      value: function componentDidMount() {
        this.componentDidUpdate();
      }
    }, {
      key: "componentDidUpdate",
      value: function componentDidUpdate() {
        var props = this.props;
        var state = this.state; // We must listen to `mousedown` or `touchstart`, edge case:
        // https://github.com/ant-design/ant-design/issues/5804
        // https://github.com/react-component/calendar/issues/250
        // https://github.com/react-component/trigger/issues/50

        if (state.popupVisible) {
          var currentDocument;

          if (!this.clickOutsideHandler && (this.isClickToHide() || this.isContextMenuToShow())) {
            currentDocument = props.getDocument();
            this.clickOutsideHandler = addEventListenerWrap(currentDocument, 'mousedown', this.onDocumentClick);
          } // always hide on mobile


          if (!this.touchOutsideHandler) {
            currentDocument = currentDocument || props.getDocument();
            this.touchOutsideHandler = addEventListenerWrap(currentDocument, 'touchstart', this.onDocumentClick);
          } // close popup when trigger type contains 'onContextMenu' and document is scrolling.


          if (!this.contextMenuOutsideHandler1 && this.isContextMenuToShow()) {
            currentDocument = currentDocument || props.getDocument();
            this.contextMenuOutsideHandler1 = addEventListenerWrap(currentDocument, 'scroll', this.onContextMenuClose);
          } // close popup when trigger type contains 'onContextMenu' and window is blur.


          if (!this.contextMenuOutsideHandler2 && this.isContextMenuToShow()) {
            this.contextMenuOutsideHandler2 = addEventListenerWrap(window, 'blur', this.onContextMenuClose);
          }

          return;
        }

        this.clearOutsideHandler();
      }
    }, {
      key: "componentWillUnmount",
      value: function componentWillUnmount() {
        this.clearDelayTimer();
        this.clearOutsideHandler();
        clearTimeout(this.mouseDownTimeout);
      }
    }, {
      key: "getPopupDomNode",
      value: function getPopupDomNode() {
        // for test
        if (this.popupRef.current && this.popupRef.current.popupRef.current) {
          return this.popupRef.current.popupRef.current;
        }

        return null;
      }
    }, {
      key: "getPopupAlign",
      value: function getPopupAlign() {
        var props = this.props;
        var popupPlacement = props.popupPlacement,
            popupAlign = props.popupAlign,
            builtinPlacements = props.builtinPlacements;

        if (popupPlacement && builtinPlacements) {
          return getAlignFromPlacement(builtinPlacements, popupPlacement, popupAlign);
        }

        return popupAlign;
      }
      /**
       * @param popupVisible    Show or not the popup element
       * @param event           SyntheticEvent, used for `pointAlign`
       */

    }, {
      key: "setPopupVisible",
      value: function setPopupVisible(popupVisible, event) {
        var alignPoint = this.props.alignPoint;
        var prevPopupVisible = this.state.popupVisible;
        this.clearDelayTimer();

        if (prevPopupVisible !== popupVisible) {
          if (!('popupVisible' in this.props)) {
            this.setState({
              popupVisible: popupVisible,
              prevPopupVisible: prevPopupVisible
            });
          }

          this.props.onPopupVisibleChange(popupVisible);
        } // Always record the point position since mouseEnterDelay will delay the show


        if (alignPoint && event) {
          this.setPoint(event);
        }
      }
    }, {
      key: "delaySetPopupVisible",
      value: function delaySetPopupVisible(visible, delayS, event) {
        var _this2 = this;

        var delay = delayS * 1000;
        this.clearDelayTimer();

        if (delay) {
          var point = event ? {
            pageX: event.pageX,
            pageY: event.pageY
          } : null;
          this.delayTimer = window.setTimeout(function () {
            _this2.setPopupVisible(visible, point);

            _this2.clearDelayTimer();
          }, delay);
        } else {
          this.setPopupVisible(visible, event);
        }
      }
    }, {
      key: "clearDelayTimer",
      value: function clearDelayTimer() {
        if (this.delayTimer) {
          clearTimeout(this.delayTimer);
          this.delayTimer = null;
        }
      }
    }, {
      key: "clearOutsideHandler",
      value: function clearOutsideHandler() {
        if (this.clickOutsideHandler) {
          this.clickOutsideHandler.remove();
          this.clickOutsideHandler = null;
        }

        if (this.contextMenuOutsideHandler1) {
          this.contextMenuOutsideHandler1.remove();
          this.contextMenuOutsideHandler1 = null;
        }

        if (this.contextMenuOutsideHandler2) {
          this.contextMenuOutsideHandler2.remove();
          this.contextMenuOutsideHandler2 = null;
        }

        if (this.touchOutsideHandler) {
          this.touchOutsideHandler.remove();
          this.touchOutsideHandler = null;
        }
      }
    }, {
      key: "createTwoChains",
      value: function createTwoChains(event) {
        var childPros = this.props.children.props;
        var props = this.props;

        if (childPros[event] && props[event]) {
          return this["fire".concat(event)];
        }

        return childPros[event] || props[event];
      }
    }, {
      key: "isClickToShow",
      value: function isClickToShow() {
        var _this$props3 = this.props,
            action = _this$props3.action,
            showAction = _this$props3.showAction;
        return action.indexOf('click') !== -1 || showAction.indexOf('click') !== -1;
      }
    }, {
      key: "isContextMenuToShow",
      value: function isContextMenuToShow() {
        var _this$props4 = this.props,
            action = _this$props4.action,
            showAction = _this$props4.showAction;
        return action.indexOf('contextMenu') !== -1 || showAction.indexOf('contextMenu') !== -1;
      }
    }, {
      key: "isClickToHide",
      value: function isClickToHide() {
        var _this$props5 = this.props,
            action = _this$props5.action,
            hideAction = _this$props5.hideAction;
        return action.indexOf('click') !== -1 || hideAction.indexOf('click') !== -1;
      }
    }, {
      key: "isMouseEnterToShow",
      value: function isMouseEnterToShow() {
        var _this$props6 = this.props,
            action = _this$props6.action,
            showAction = _this$props6.showAction;
        return action.indexOf('hover') !== -1 || showAction.indexOf('mouseEnter') !== -1;
      }
    }, {
      key: "isMouseLeaveToHide",
      value: function isMouseLeaveToHide() {
        var _this$props7 = this.props,
            action = _this$props7.action,
            hideAction = _this$props7.hideAction;
        return action.indexOf('hover') !== -1 || hideAction.indexOf('mouseLeave') !== -1;
      }
    }, {
      key: "isFocusToShow",
      value: function isFocusToShow() {
        var _this$props8 = this.props,
            action = _this$props8.action,
            showAction = _this$props8.showAction;
        return action.indexOf('focus') !== -1 || showAction.indexOf('focus') !== -1;
      }
    }, {
      key: "isBlurToHide",
      value: function isBlurToHide() {
        var _this$props9 = this.props,
            action = _this$props9.action,
            hideAction = _this$props9.hideAction;
        return action.indexOf('focus') !== -1 || hideAction.indexOf('blur') !== -1;
      }
    }, {
      key: "forcePopupAlign",
      value: function forcePopupAlign() {
        if (this.state.popupVisible && this.popupRef.current && this.popupRef.current.alignRef.current) {
          this.popupRef.current.alignRef.current.forceAlign();
        }
      }
    }, {
      key: "fireEvents",
      value: function fireEvents(type, e) {
        var childCallback = this.props.children.props[type];

        if (childCallback) {
          childCallback(e);
        }

        var callback = this.props[type];

        if (callback) {
          callback(e);
        }
      }
    }, {
      key: "close",
      value: function close() {
        this.setPopupVisible(false);
      }
    }, {
      key: "render",
      value: function render() {
        var popupVisible = this.state.popupVisible;
        var _this$props10 = this.props,
            children = _this$props10.children,
            forceRender = _this$props10.forceRender,
            alignPoint = _this$props10.alignPoint,
            className = _this$props10.className,
            autoDestroy = _this$props10.autoDestroy;
        var child = external_React_default.a.Children.only(children);
        var newChildProps = {
          key: 'trigger'
        };

        if (this.isContextMenuToShow()) {
          newChildProps.onContextMenu = this.onContextMenu;
        } else {
          newChildProps.onContextMenu = this.createTwoChains('onContextMenu');
        }

        if (this.isClickToHide() || this.isClickToShow()) {
          newChildProps.onClick = this.onClick;
          newChildProps.onMouseDown = this.onMouseDown;
          newChildProps.onTouchStart = this.onTouchStart;
        } else {
          newChildProps.onClick = this.createTwoChains('onClick');
          newChildProps.onMouseDown = this.createTwoChains('onMouseDown');
          newChildProps.onTouchStart = this.createTwoChains('onTouchStart');
        }

        if (this.isMouseEnterToShow()) {
          newChildProps.onMouseEnter = this.onMouseEnter;

          if (alignPoint) {
            newChildProps.onMouseMove = this.onMouseMove;
          }
        } else {
          newChildProps.onMouseEnter = this.createTwoChains('onMouseEnter');
        }

        if (this.isMouseLeaveToHide()) {
          newChildProps.onMouseLeave = this.onMouseLeave;
        } else {
          newChildProps.onMouseLeave = this.createTwoChains('onMouseLeave');
        }

        if (this.isFocusToShow() || this.isBlurToHide()) {
          newChildProps.onFocus = this.onFocus;
          newChildProps.onBlur = this.onBlur;
        } else {
          newChildProps.onFocus = this.createTwoChains('onFocus');
          newChildProps.onBlur = this.createTwoChains('onBlur');
        }

        var childrenClassName = classnames_default()(child && child.props && child.props.className, className);

        if (childrenClassName) {
          newChildProps.className = childrenClassName;
        }

        var cloneProps = _objectSpread2({}, newChildProps);

        if (supportRef(child)) {
          cloneProps.ref = composeRef(this.triggerRef, child.ref);
        }

        var trigger = /*#__PURE__*/external_React_default.a.cloneElement(child, cloneProps);
        var portal; // prevent unmounting after it's rendered

        if (popupVisible || this.popupRef.current || forceRender) {
          portal = /*#__PURE__*/external_React_default.a.createElement(PortalComponent, {
            key: "portal",
            getContainer: this.getContainer,
            didUpdate: this.handlePortalUpdate
          }, this.getComponent());
        }

        if (!popupVisible && autoDestroy) {
          portal = null;
        }

        return /*#__PURE__*/external_React_default.a.createElement(es_context.Provider, {
          value: {
            onPopupMouseDown: this.onPopupMouseDown
          }
        }, trigger, portal);
      }
    }], [{
      key: "getDerivedStateFromProps",
      value: function getDerivedStateFromProps(_ref, prevState) {
        var popupVisible = _ref.popupVisible;
        var newState = {};

        if (popupVisible !== undefined && prevState.popupVisible !== popupVisible) {
          newState.popupVisible = popupVisible;
          newState.prevPopupVisible = prevState.popupVisible;
        }

        return newState;
      }
    }]);

    return Trigger;
  }(external_React_default.a.Component);

  Trigger.contextType = es_context;
  Trigger.defaultProps = {
    prefixCls: 'rc-trigger-popup',
    getPopupClassNameFromAlign: returnEmptyString,
    getDocument: returnDocument,
    onPopupVisibleChange: noop,
    afterPopupVisibleChange: noop,
    onPopupAlign: noop,
    popupClassName: '',
    mouseEnterDelay: 0,
    mouseLeaveDelay: 0.1,
    focusDelay: 0,
    blurDelay: 0.15,
    popupStyle: {},
    destroyPopupOnHide: false,
    popupAlign: {},
    defaultPopupVisible: false,
    mask: false,
    maskClosable: true,
    action: [],
    showAction: [],
    hideAction: [],
    autoDestroy: false
  };
  return Trigger;
}
/* harmony default export */ var rc_trigger_es = (generateTrigger(Portal_Portal));
// CONCATENATED MODULE: ./node_modules/rc-tooltip/es/placements.js
var placements_autoAdjustOverflow = {
  adjustX: 1,
  adjustY: 1
};
var targetOffset = [0, 0];
var placements = {
  left: {
    points: ['cr', 'cl'],
    overflow: placements_autoAdjustOverflow,
    offset: [-4, 0],
    targetOffset: targetOffset
  },
  right: {
    points: ['cl', 'cr'],
    overflow: placements_autoAdjustOverflow,
    offset: [4, 0],
    targetOffset: targetOffset
  },
  top: {
    points: ['bc', 'tc'],
    overflow: placements_autoAdjustOverflow,
    offset: [0, -4],
    targetOffset: targetOffset
  },
  bottom: {
    points: ['tc', 'bc'],
    overflow: placements_autoAdjustOverflow,
    offset: [0, 4],
    targetOffset: targetOffset
  },
  topLeft: {
    points: ['bl', 'tl'],
    overflow: placements_autoAdjustOverflow,
    offset: [0, -4],
    targetOffset: targetOffset
  },
  leftTop: {
    points: ['tr', 'tl'],
    overflow: placements_autoAdjustOverflow,
    offset: [-4, 0],
    targetOffset: targetOffset
  },
  topRight: {
    points: ['br', 'tr'],
    overflow: placements_autoAdjustOverflow,
    offset: [0, -4],
    targetOffset: targetOffset
  },
  rightTop: {
    points: ['tl', 'tr'],
    overflow: placements_autoAdjustOverflow,
    offset: [4, 0],
    targetOffset: targetOffset
  },
  bottomRight: {
    points: ['tr', 'br'],
    overflow: placements_autoAdjustOverflow,
    offset: [0, 4],
    targetOffset: targetOffset
  },
  rightBottom: {
    points: ['bl', 'br'],
    overflow: placements_autoAdjustOverflow,
    offset: [4, 0],
    targetOffset: targetOffset
  },
  bottomLeft: {
    points: ['tl', 'bl'],
    overflow: placements_autoAdjustOverflow,
    offset: [0, 4],
    targetOffset: targetOffset
  },
  leftBottom: {
    points: ['br', 'bl'],
    overflow: placements_autoAdjustOverflow,
    offset: [-4, 0],
    targetOffset: targetOffset
  }
};
/* harmony default export */ var es_placements = (placements);
// CONCATENATED MODULE: ./node_modules/rc-tooltip/es/Content.js


var Content_Content = function Content(props) {
  var overlay = props.overlay,
      prefixCls = props.prefixCls,
      id = props.id,
      overlayInnerStyle = props.overlayInnerStyle;
  return /*#__PURE__*/external_React_default.a.createElement("div", {
    className: "".concat(prefixCls, "-inner"),
    id: id,
    role: "tooltip",
    style: overlayInnerStyle
  }, typeof overlay === 'function' ? overlay() : overlay);
};

/* harmony default export */ var es_Content = (Content_Content);
// CONCATENATED MODULE: ./node_modules/rc-tooltip/es/Tooltip.js
function Tooltip_typeof(obj) {
  "@babel/helpers - typeof";

  if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") {
    Tooltip_typeof = function _typeof(obj) {
      return typeof obj;
    };
  } else {
    Tooltip_typeof = function _typeof(obj) {
      return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj;
    };
  }

  return Tooltip_typeof(obj);
}

function Tooltip_ownKeys(object, enumerableOnly) {
  var keys = Object.keys(object);

  if (Object.getOwnPropertySymbols) {
    var symbols = Object.getOwnPropertySymbols(object);
    if (enumerableOnly) symbols = symbols.filter(function (sym) {
      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
    });
    keys.push.apply(keys, symbols);
  }

  return keys;
}

function _objectSpread(target) {
  for (var i = 1; i < arguments.length; i++) {
    var source = arguments[i] != null ? arguments[i] : {};

    if (i % 2) {
      Tooltip_ownKeys(Object(source), true).forEach(function (key) {
        Tooltip_defineProperty(target, key, source[key]);
      });
    } else if (Object.getOwnPropertyDescriptors) {
      Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
    } else {
      Tooltip_ownKeys(Object(source)).forEach(function (key) {
        Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
      });
    }
  }

  return target;
}

function Tooltip_defineProperty(obj, key, value) {
  if (key in obj) {
    Object.defineProperty(obj, key, {
      value: value,
      enumerable: true,
      configurable: true,
      writable: true
    });
  } else {
    obj[key] = value;
  }

  return obj;
}

function _objectWithoutProperties(source, excluded) {
  if (source == null) return {};

  var target = _objectWithoutPropertiesLoose(source, excluded);

  var key, i;

  if (Object.getOwnPropertySymbols) {
    var sourceSymbolKeys = Object.getOwnPropertySymbols(source);

    for (i = 0; i < sourceSymbolKeys.length; i++) {
      key = sourceSymbolKeys[i];
      if (excluded.indexOf(key) >= 0) continue;
      if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue;
      target[key] = source[key];
    }
  }

  return target;
}

function _objectWithoutPropertiesLoose(source, excluded) {
  if (source == null) return {};
  var target = {};
  var sourceKeys = Object.keys(source);
  var key, i;

  for (i = 0; i < sourceKeys.length; i++) {
    key = sourceKeys[i];
    if (excluded.indexOf(key) >= 0) continue;
    target[key] = source[key];
  }

  return target;
}






var Tooltip_Tooltip = function Tooltip(props, ref) {
  var overlayClassName = props.overlayClassName,
      _props$trigger = props.trigger,
      trigger = _props$trigger === void 0 ? ['hover'] : _props$trigger,
      _props$mouseEnterDela = props.mouseEnterDelay,
      mouseEnterDelay = _props$mouseEnterDela === void 0 ? 0 : _props$mouseEnterDela,
      _props$mouseLeaveDela = props.mouseLeaveDelay,
      mouseLeaveDelay = _props$mouseLeaveDela === void 0 ? 0.1 : _props$mouseLeaveDela,
      overlayStyle = props.overlayStyle,
      _props$prefixCls = props.prefixCls,
      prefixCls = _props$prefixCls === void 0 ? 'rc-tooltip' : _props$prefixCls,
      children = props.children,
      onVisibleChange = props.onVisibleChange,
      afterVisibleChange = props.afterVisibleChange,
      transitionName = props.transitionName,
      animation = props.animation,
      _props$placement = props.placement,
      placement = _props$placement === void 0 ? 'right' : _props$placement,
      _props$align = props.align,
      align = _props$align === void 0 ? {} : _props$align,
      _props$destroyTooltip = props.destroyTooltipOnHide,
      destroyTooltipOnHide = _props$destroyTooltip === void 0 ? false : _props$destroyTooltip,
      defaultVisible = props.defaultVisible,
      getTooltipContainer = props.getTooltipContainer,
      overlayInnerStyle = props.overlayInnerStyle,
      restProps = _objectWithoutProperties(props, ["overlayClassName", "trigger", "mouseEnterDelay", "mouseLeaveDelay", "overlayStyle", "prefixCls", "children", "onVisibleChange", "afterVisibleChange", "transitionName", "animation", "placement", "align", "destroyTooltipOnHide", "defaultVisible", "getTooltipContainer", "overlayInnerStyle"]);

  var domRef = Object(external_React_["useRef"])(null);
  Object(external_React_["useImperativeHandle"])(ref, function () {
    return domRef.current;
  });

  var extraProps = _objectSpread({}, restProps);

  if ('visible' in props) {
    extraProps.popupVisible = props.visible;
  }

  var getPopupElement = function getPopupElement() {
    var _props$arrowContent = props.arrowContent,
        arrowContent = _props$arrowContent === void 0 ? null : _props$arrowContent,
        overlay = props.overlay,
        id = props.id;
    return [/*#__PURE__*/external_React_default.a.createElement("div", {
      className: "".concat(prefixCls, "-arrow"),
      key: "arrow"
    }, arrowContent), /*#__PURE__*/external_React_default.a.createElement(es_Content, {
      key: "content",
      prefixCls: prefixCls,
      id: id,
      overlay: overlay,
      overlayInnerStyle: overlayInnerStyle
    })];
  };

  var destroyTooltip = false;
  var autoDestroy = false;

  if (typeof destroyTooltipOnHide === 'boolean') {
    destroyTooltip = destroyTooltipOnHide;
  } else if (destroyTooltipOnHide && Tooltip_typeof(destroyTooltipOnHide) === 'object') {
    var keepParent = destroyTooltipOnHide.keepParent;
    destroyTooltip = keepParent === true;
    autoDestroy = keepParent === false;
  }

  return /*#__PURE__*/external_React_default.a.createElement(rc_trigger_es, Object.assign({
    popupClassName: overlayClassName,
    prefixCls: prefixCls,
    popup: getPopupElement,
    action: trigger,
    builtinPlacements: placements,
    popupPlacement: placement,
    ref: domRef,
    popupAlign: align,
    getPopupContainer: getTooltipContainer,
    onPopupVisibleChange: onVisibleChange,
    afterPopupVisibleChange: afterVisibleChange,
    popupTransitionName: transitionName,
    popupAnimation: animation,
    defaultPopupVisible: defaultVisible,
    destroyPopupOnHide: destroyTooltip,
    autoDestroy: autoDestroy,
    mouseLeaveDelay: mouseLeaveDelay,
    popupStyle: overlayStyle,
    mouseEnterDelay: mouseEnterDelay
  }, extraProps), children);
};

/* harmony default export */ var es_Tooltip = (/*#__PURE__*/Object(external_React_["forwardRef"])(Tooltip_Tooltip));
// CONCATENATED MODULE: ./node_modules/rc-tooltip/es/index.js

/* harmony default export */ var rc_tooltip_es = (es_Tooltip);
// CONCATENATED MODULE: ./node_modules/antd/es/tooltip/placements.js


var autoAdjustOverflowEnabled = {
  adjustX: 1,
  adjustY: 1
};
var autoAdjustOverflowDisabled = {
  adjustX: 0,
  adjustY: 0
};
var placements_targetOffset = [0, 0];
function getOverflowOptions(autoAdjustOverflow) {
  if (typeof autoAdjustOverflow === 'boolean') {
    return autoAdjustOverflow ? autoAdjustOverflowEnabled : autoAdjustOverflowDisabled;
  }

  return extends_default()(extends_default()({}, autoAdjustOverflowDisabled), autoAdjustOverflow);
}
function getPlacements(config) {
  var _config$arrowWidth = config.arrowWidth,
      arrowWidth = _config$arrowWidth === void 0 ? 5 : _config$arrowWidth,
      _config$horizontalArr = config.horizontalArrowShift,
      horizontalArrowShift = _config$horizontalArr === void 0 ? 16 : _config$horizontalArr,
      _config$verticalArrow = config.verticalArrowShift,
      verticalArrowShift = _config$verticalArrow === void 0 ? 8 : _config$verticalArrow,
      autoAdjustOverflow = config.autoAdjustOverflow;
  var placementMap = {
    left: {
      points: ['cr', 'cl'],
      offset: [-4, 0]
    },
    right: {
      points: ['cl', 'cr'],
      offset: [4, 0]
    },
    top: {
      points: ['bc', 'tc'],
      offset: [0, -4]
    },
    bottom: {
      points: ['tc', 'bc'],
      offset: [0, 4]
    },
    topLeft: {
      points: ['bl', 'tc'],
      offset: [-(horizontalArrowShift + arrowWidth), -4]
    },
    leftTop: {
      points: ['tr', 'cl'],
      offset: [-4, -(verticalArrowShift + arrowWidth)]
    },
    topRight: {
      points: ['br', 'tc'],
      offset: [horizontalArrowShift + arrowWidth, -4]
    },
    rightTop: {
      points: ['tl', 'cr'],
      offset: [4, -(verticalArrowShift + arrowWidth)]
    },
    bottomRight: {
      points: ['tr', 'bc'],
      offset: [horizontalArrowShift + arrowWidth, 4]
    },
    rightBottom: {
      points: ['bl', 'cr'],
      offset: [4, verticalArrowShift + arrowWidth]
    },
    bottomLeft: {
      points: ['tl', 'bc'],
      offset: [-(horizontalArrowShift + arrowWidth), 4]
    },
    leftBottom: {
      points: ['br', 'cl'],
      offset: [-4, verticalArrowShift + arrowWidth]
    }
  };
  Object.keys(placementMap).forEach(function (key) {
    placementMap[key] = config.arrowPointAtCenter ? extends_default()(extends_default()({}, placementMap[key]), {
      overflow: getOverflowOptions(autoAdjustOverflow),
      targetOffset: placements_targetOffset
    }) : extends_default()(extends_default()({}, placements[key]), {
      overflow: getOverflowOptions(autoAdjustOverflow)
    });
    placementMap[key].ignoreShake = true;
  });
  return placementMap;
}
// CONCATENATED MODULE: ./node_modules/antd/es/_util/reactNode.js

var isValidElement = external_React_["isValidElement"];

function replaceElement(element, replacement, props) {
  if (!isValidElement(element)) return replacement;
  return /*#__PURE__*/external_React_["cloneElement"](element, typeof props === 'function' ? props() : props);
}
function cloneElement(element, props) {
  return replaceElement(element, element, props);
}
// CONCATENATED MODULE: ./node_modules/antd/es/_util/type.js
// https://stackoverflow.com/questions/46176165/ways-to-get-string-literal-type-of-array-values-without-enum-overhead
var tuple = function tuple() {
  for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
    args[_key] = arguments[_key];
  }

  return args;
};
var tupleNum = function tupleNum() {
  for (var _len2 = arguments.length, args = new Array(_len2), _key2 = 0; _key2 < _len2; _key2++) {
    args[_key2] = arguments[_key2];
  }

  return args;
};
// CONCATENATED MODULE: ./node_modules/antd/es/_util/colors.js

var PresetStatusColorTypes = tuple('success', 'processing', 'error', 'default', 'warning'); // eslint-disable-next-line import/prefer-default-export

var PresetColorTypes = tuple('pink', 'red', 'yellow', 'orange', 'cyan', 'green', 'blue', 'purple', 'geekblue', 'magenta', 'volcano', 'gold', 'lime');
// CONCATENATED MODULE: ./node_modules/antd/es/tooltip/index.js











var tooltip_splitObject = function splitObject(obj, keys) {
  var picked = {};

  var omitted = extends_default()({}, obj);

  keys.forEach(function (key) {
    if (obj && key in obj) {
      picked[key] = obj[key];
      delete omitted[key];
    }
  });
  return {
    picked: picked,
    omitted: omitted
  };
};

var PresetColorRegex = new RegExp("^(".concat(PresetColorTypes.join('|'), ")(-inverse)?$")); // Fix Tooltip won't hide at disabled button
// mouse events don't trigger at disabled button in Chrome
// https://github.com/react-component/tooltip/issues/18

function getDisabledCompatibleChildren(element, prefixCls) {
  var elementType = element.type;

  if ((elementType.__ANT_BUTTON === true || elementType.__ANT_SWITCH === true || elementType.__ANT_CHECKBOX === true || element.type === 'button') && element.props.disabled) {
    // Pick some layout related style properties up to span
    // Prevent layout bugs like https://github.com/ant-design/ant-design/issues/5254
    var _splitObject = tooltip_splitObject(element.props.style, ['position', 'left', 'right', 'top', 'bottom', 'float', 'display', 'zIndex']),
        picked = _splitObject.picked,
        omitted = _splitObject.omitted;

    var spanStyle = extends_default()(extends_default()({
      display: 'inline-block'
    }, picked), {
      cursor: 'not-allowed',
      width: element.props.block ? '100%' : null
    });

    var buttonStyle = extends_default()(extends_default()({}, omitted), {
      pointerEvents: 'none'
    });

    var child = cloneElement(element, {
      style: buttonStyle,
      className: null
    });
    return /*#__PURE__*/external_React_["createElement"]("span", {
      style: spanStyle,
      className: classnames_default()(element.props.className, "".concat(prefixCls, "-disabled-compatible-wrapper"))
    }, child);
  }

  return element;
}

var tooltip_Tooltip = /*#__PURE__*/external_React_["forwardRef"](function (props, ref) {
  var _classNames2;

  var _React$useContext = external_React_["useContext"](ConfigContext),
      getContextPopupContainer = _React$useContext.getPopupContainer,
      getPrefixCls = _React$useContext.getPrefixCls,
      direction = _React$useContext.direction;

  var _React$useState = external_React_["useState"](!!props.visible || !!props.defaultVisible),
      _React$useState2 = slicedToArray_default()(_React$useState, 2),
      visible = _React$useState2[0],
      setVisible = _React$useState2[1];

  external_React_["useEffect"](function () {
    if ('visible' in props) {
      setVisible(props.visible);
    }
  }, [props.visible]);

  var isNoTitle = function isNoTitle() {
    var title = props.title,
        overlay = props.overlay;
    return !title && !overlay && title !== 0; // overlay for old version compatibility
  };

  var onVisibleChange = function onVisibleChange(vis) {
    if (!('visible' in props)) {
      setVisible(isNoTitle() ? false : vis);
    }

    if (props.onVisibleChange && !isNoTitle()) {
      props.onVisibleChange(vis);
    }
  };

  var getTooltipPlacements = function getTooltipPlacements() {
    var builtinPlacements = props.builtinPlacements,
        arrowPointAtCenter = props.arrowPointAtCenter,
        autoAdjustOverflow = props.autoAdjustOverflow;
    return builtinPlacements || getPlacements({
      arrowPointAtCenter: arrowPointAtCenter,
      autoAdjustOverflow: autoAdjustOverflow
    });
  }; // 动态设置动画点


  var onPopupAlign = function onPopupAlign(domNode, align) {
    var placements = getTooltipPlacements(); // 当前返回的位置

    var placement = Object.keys(placements).filter(function (key) {
      return placements[key].points[0] === align.points[0] && placements[key].points[1] === align.points[1];
    })[0];

    if (!placement) {
      return;
    } // 根据当前坐标设置动画点


    var rect = domNode.getBoundingClientRect();
    var transformOrigin = {
      top: '50%',
      left: '50%'
    };

    if (placement.indexOf('top') >= 0 || placement.indexOf('Bottom') >= 0) {
      transformOrigin.top = "".concat(rect.height - align.offset[1], "px");
    } else if (placement.indexOf('Top') >= 0 || placement.indexOf('bottom') >= 0) {
      transformOrigin.top = "".concat(-align.offset[1], "px");
    }

    if (placement.indexOf('left') >= 0 || placement.indexOf('Right') >= 0) {
      transformOrigin.left = "".concat(rect.width - align.offset[0], "px");
    } else if (placement.indexOf('right') >= 0 || placement.indexOf('Left') >= 0) {
      transformOrigin.left = "".concat(-align.offset[0], "px");
    }

    domNode.style.transformOrigin = "".concat(transformOrigin.left, " ").concat(transformOrigin.top);
  };

  var getOverlay = function getOverlay() {
    var title = props.title,
        overlay = props.overlay;

    if (title === 0) {
      return title;
    }

    return overlay || title || '';
  };

  var customizePrefixCls = props.prefixCls,
      openClassName = props.openClassName,
      getPopupContainer = props.getPopupContainer,
      getTooltipContainer = props.getTooltipContainer,
      overlayClassName = props.overlayClassName,
      color = props.color,
      overlayInnerStyle = props.overlayInnerStyle;
  var children = props.children;
  var prefixCls = getPrefixCls('tooltip', customizePrefixCls);
  var tempVisible = visible; // Hide tooltip when there is no title

  if (!('visible' in props) && isNoTitle()) {
    tempVisible = false;
  }

  var child = getDisabledCompatibleChildren(isValidElement(children) ? children : /*#__PURE__*/external_React_["createElement"]("span", null, children), prefixCls);
  var childProps = child.props;
  var childCls = classnames_default()(childProps.className, defineProperty_default()({}, openClassName || "".concat(prefixCls, "-open"), true));
  var customOverlayClassName = classnames_default()(overlayClassName, (_classNames2 = {}, defineProperty_default()(_classNames2, "".concat(prefixCls, "-rtl"), direction === 'rtl'), defineProperty_default()(_classNames2, "".concat(prefixCls, "-").concat(color), color && PresetColorRegex.test(color)), _classNames2));
  var formattedOverlayInnerStyle;
  var arrowContentStyle;

  if (color && !PresetColorRegex.test(color)) {
    formattedOverlayInnerStyle = extends_default()(extends_default()({}, overlayInnerStyle), {
      background: color
    });
    arrowContentStyle = {
      background: color
    };
  }

  return /*#__PURE__*/external_React_["createElement"](rc_tooltip_es, extends_default()({}, props, {
    prefixCls: prefixCls,
    overlayClassName: customOverlayClassName,
    getTooltipContainer: getPopupContainer || getTooltipContainer || getContextPopupContainer,
    ref: ref,
    builtinPlacements: getTooltipPlacements(),
    overlay: getOverlay(),
    visible: tempVisible,
    onVisibleChange: onVisibleChange,
    onPopupAlign: onPopupAlign,
    overlayInnerStyle: formattedOverlayInnerStyle,
    arrowContent: /*#__PURE__*/external_React_["createElement"]("span", {
      className: "".concat(prefixCls, "-arrow-content"),
      style: arrowContentStyle
    })
  }), tempVisible ? cloneElement(child, {
    className: childCls
  }) : child);
});
tooltip_Tooltip.displayName = 'Tooltip';
tooltip_Tooltip.defaultProps = {
  placement: 'top',
  transitionName: 'zoom-big-fast',
  mouseEnterDelay: 0.1,
  mouseLeaveDelay: 0.1,
  arrowPointAtCenter: false,
  autoAdjustOverflow: true
};
/* harmony default export */ var tooltip = (tooltip_Tooltip);
// CONCATENATED MODULE: ./node_modules/@ant-design/icons-svg/es/asn/InfoCircleOutlined.js
// This icon file is generated automatically.
var InfoCircleOutlined_InfoCircleOutlined = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "64 64 896 896",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M512 64C264.6 64 64 264.6 64 512s200.6 448 448 448 448-200.6 448-448S759.4 64 512 64zm0 820c-205.4 0-372-166.6-372-372s166.6-372 372-372 372 166.6 372 372-166.6 372-372 372z"
      }
    }, {
      "tag": "path",
      "attrs": {
        "d": "M464 336a48 48 0 1096 0 48 48 0 10-96 0zm72 112h-48c-4.4 0-8 3.6-8 8v272c0 4.4 3.6 8 8 8h48c4.4 0 8-3.6 8-8V456c0-4.4-3.6-8-8-8z"
      }
    }]
  },
  "name": "info-circle",
  "theme": "outlined"
};
/* harmony default export */ var asn_InfoCircleOutlined = (InfoCircleOutlined_InfoCircleOutlined);
// EXTERNAL MODULE: ./node_modules/@ant-design/colors/lib/index.js
var lib = __webpack_require__(52);

// EXTERNAL MODULE: ./node_modules/rc-util/es/warning.js
var es_warning = __webpack_require__(12);

// EXTERNAL MODULE: ./node_modules/insert-css/index.js
var insert_css = __webpack_require__(53);

// CONCATENATED MODULE: ./node_modules/@ant-design/icons/es/utils.js






function utils_warning(valid, message) {
  Object(es_warning["a" /* default */])(valid, "[@ant-design/icons] ".concat(message));
}
function isIconDefinition(target) {
  return Object(esm_typeof["a" /* default */])(target) === 'object' && typeof target.name === 'string' && typeof target.theme === 'string' && (Object(esm_typeof["a" /* default */])(target.icon) === 'object' || typeof target.icon === 'function');
}
function normalizeAttrs() {
  var attrs = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  return Object.keys(attrs).reduce(function (acc, key) {
    var val = attrs[key];

    switch (key) {
      case 'class':
        acc.className = val;
        delete acc.class;
        break;

      default:
        acc[key] = val;
    }

    return acc;
  }, {});
}
function generate(node, key, rootProps) {
  if (!rootProps) {
    return /*#__PURE__*/external_React_default.a.createElement(node.tag, _objectSpread2({
      key: key
    }, normalizeAttrs(node.attrs)), (node.children || []).map(function (child, index) {
      return generate(child, "".concat(key, "-").concat(node.tag, "-").concat(index));
    }));
  }

  return /*#__PURE__*/external_React_default.a.createElement(node.tag, _objectSpread2(_objectSpread2({
    key: key
  }, normalizeAttrs(node.attrs)), rootProps), (node.children || []).map(function (child, index) {
    return generate(child, "".concat(key, "-").concat(node.tag, "-").concat(index));
  }));
}
function getSecondaryColor(primaryColor) {
  // choose the second color
  return Object(lib["generate"])(primaryColor)[0];
}
function normalizeTwoToneColors(twoToneColor) {
  if (!twoToneColor) {
    return [];
  }

  return Array.isArray(twoToneColor) ? twoToneColor : [twoToneColor];
} // These props make sure that the SVG behaviours like general text.
// Reference: https://blog.prototypr.io/align-svg-icons-to-text-and-say-goodbye-to-font-icons-d44b3d7b26b4

var svgBaseProps = {
  width: '1em',
  height: '1em',
  fill: 'currentColor',
  'aria-hidden': 'true',
  focusable: 'false'
};
var iconStyles = "\n.anticon {\n  display: inline-block;\n  color: inherit;\n  font-style: normal;\n  line-height: 0;\n  text-align: center;\n  text-transform: none;\n  vertical-align: -0.125em;\n  text-rendering: optimizeLegibility;\n  -webkit-font-smoothing: antialiased;\n  -moz-osx-font-smoothing: grayscale;\n}\n\n.anticon > * {\n  line-height: 1;\n}\n\n.anticon svg {\n  display: inline-block;\n}\n\n.anticon::before {\n  display: none;\n}\n\n.anticon .anticon-icon {\n  display: block;\n}\n\n.anticon[tabindex] {\n  cursor: pointer;\n}\n\n.anticon-spin::before,\n.anticon-spin {\n  display: inline-block;\n  -webkit-animation: loadingCircle 1s infinite linear;\n  animation: loadingCircle 1s infinite linear;\n}\n\n@-webkit-keyframes loadingCircle {\n  100% {\n    -webkit-transform: rotate(360deg);\n    transform: rotate(360deg);\n  }\n}\n\n@keyframes loadingCircle {\n  100% {\n    -webkit-transform: rotate(360deg);\n    transform: rotate(360deg);\n  }\n}\n";
var cssInjectedFlag = false;
var utils_useInsertStyles = function useInsertStyles() {
  var styleStr = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : iconStyles;
  Object(external_React_["useEffect"])(function () {
    if (!cssInjectedFlag) {
      Object(insert_css["insertCss"])(styleStr, {
        prepend: true
      });
      cssInjectedFlag = true;
    }
  }, []);
};
// CONCATENATED MODULE: ./node_modules/@ant-design/icons/es/components/IconBase.js



var twoToneColorPalette = {
  primaryColor: '#333',
  secondaryColor: '#E6E6E6',
  calculated: false
};

function setTwoToneColors(_ref) {
  var primaryColor = _ref.primaryColor,
      secondaryColor = _ref.secondaryColor;
  twoToneColorPalette.primaryColor = primaryColor;
  twoToneColorPalette.secondaryColor = secondaryColor || getSecondaryColor(primaryColor);
  twoToneColorPalette.calculated = !!secondaryColor;
}

function getTwoToneColors() {
  return _objectSpread2({}, twoToneColorPalette);
}

var IconBase_IconBase = function IconBase(props) {
  var icon = props.icon,
      className = props.className,
      onClick = props.onClick,
      style = props.style,
      primaryColor = props.primaryColor,
      secondaryColor = props.secondaryColor,
      restProps = Object(objectWithoutProperties["a" /* default */])(props, ["icon", "className", "onClick", "style", "primaryColor", "secondaryColor"]);

  var colors = twoToneColorPalette;

  if (primaryColor) {
    colors = {
      primaryColor: primaryColor,
      secondaryColor: secondaryColor || getSecondaryColor(primaryColor)
    };
  }

  utils_useInsertStyles();
  utils_warning(isIconDefinition(icon), "icon should be icon definiton, but got ".concat(icon));

  if (!isIconDefinition(icon)) {
    return null;
  }

  var target = icon;

  if (target && typeof target.icon === 'function') {
    target = _objectSpread2(_objectSpread2({}, target), {}, {
      icon: target.icon(colors.primaryColor, colors.secondaryColor)
    });
  }

  return generate(target.icon, "svg-".concat(target.name), _objectSpread2({
    className: className,
    onClick: onClick,
    style: style,
    'data-icon': target.name,
    width: '1em',
    height: '1em',
    fill: 'currentColor',
    'aria-hidden': 'true'
  }, restProps));
};

IconBase_IconBase.displayName = 'IconReact';
IconBase_IconBase.getTwoToneColors = getTwoToneColors;
IconBase_IconBase.setTwoToneColors = setTwoToneColors;
/* harmony default export */ var components_IconBase = (IconBase_IconBase);
// CONCATENATED MODULE: ./node_modules/@ant-design/icons/es/components/twoTonePrimaryColor.js



function setTwoToneColor(twoToneColor) {
  var _normalizeTwoToneColo = normalizeTwoToneColors(twoToneColor),
      _normalizeTwoToneColo2 = Object(esm_slicedToArray["a" /* default */])(_normalizeTwoToneColo, 2),
      primaryColor = _normalizeTwoToneColo2[0],
      secondaryColor = _normalizeTwoToneColo2[1];

  return components_IconBase.setTwoToneColors({
    primaryColor: primaryColor,
    secondaryColor: secondaryColor
  });
}
function getTwoToneColor() {
  var colors = components_IconBase.getTwoToneColors();

  if (!colors.calculated) {
    return colors.primaryColor;
  }

  return [colors.primaryColor, colors.secondaryColor];
}
// CONCATENATED MODULE: ./node_modules/@ant-design/icons/es/components/AntdIcon.js







 // Initial setting
// should move it to antd main repo?

setTwoToneColor('#1890ff');
var Icon = /*#__PURE__*/external_React_["forwardRef"](function (props, ref) {
  var className = props.className,
      icon = props.icon,
      spin = props.spin,
      rotate = props.rotate,
      tabIndex = props.tabIndex,
      onClick = props.onClick,
      twoToneColor = props.twoToneColor,
      restProps = Object(objectWithoutProperties["a" /* default */])(props, ["className", "icon", "spin", "rotate", "tabIndex", "onClick", "twoToneColor"]);

  var classString = classnames_default()('anticon', Object(esm_defineProperty["a" /* default */])({}, "anticon-".concat(icon.name), Boolean(icon.name)), className);
  var svgClassString = classnames_default()({
    'anticon-spin': !!spin || icon.name === 'loading'
  });
  var iconTabIndex = tabIndex;

  if (iconTabIndex === undefined && onClick) {
    iconTabIndex = -1;
  }

  var svgStyle = rotate ? {
    msTransform: "rotate(".concat(rotate, "deg)"),
    transform: "rotate(".concat(rotate, "deg)")
  } : undefined;

  var _normalizeTwoToneColo = normalizeTwoToneColors(twoToneColor),
      _normalizeTwoToneColo2 = Object(esm_slicedToArray["a" /* default */])(_normalizeTwoToneColo, 2),
      primaryColor = _normalizeTwoToneColo2[0],
      secondaryColor = _normalizeTwoToneColo2[1];

  return /*#__PURE__*/external_React_["createElement"]("span", Object.assign({
    role: "img",
    "aria-label": icon.name
  }, restProps, {
    ref: ref,
    tabIndex: iconTabIndex,
    onClick: onClick,
    className: classString
  }), /*#__PURE__*/external_React_["createElement"](components_IconBase, {
    className: svgClassString,
    icon: icon,
    primaryColor: primaryColor,
    secondaryColor: secondaryColor,
    style: svgStyle
  }));
});
Icon.displayName = 'AntdIcon';
Icon.getTwoToneColor = getTwoToneColor;
Icon.setTwoToneColor = setTwoToneColor;
/* harmony default export */ var AntdIcon = (Icon);
// CONCATENATED MODULE: ./node_modules/@ant-design/icons/es/icons/InfoCircleOutlined.js
// GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY




var icons_InfoCircleOutlined_InfoCircleOutlined = function InfoCircleOutlined(props, ref) {
  return /*#__PURE__*/external_React_["createElement"](AntdIcon, Object.assign({}, props, {
    ref: ref,
    icon: asn_InfoCircleOutlined
  }));
};

icons_InfoCircleOutlined_InfoCircleOutlined.displayName = 'InfoCircleOutlined';
/* harmony default export */ var icons_InfoCircleOutlined = (/*#__PURE__*/external_React_["forwardRef"](icons_InfoCircleOutlined_InfoCircleOutlined));
// EXTERNAL MODULE: ./node_modules/antd/lib/config-provider/index.js
var config_provider = __webpack_require__(20);

// EXTERNAL MODULE: ./packages/utils/es/components/LabelIconTip/index.less
var components_LabelIconTip = __webpack_require__(87);

// CONCATENATED MODULE: ./packages/utils/es/components/LabelIconTip/index.js








/**
 * 在 form 的 label 后面增加一个 tips 来展示一些说明文案
 * @param props
 */

var LabelIconTip_LabelIconTip = function LabelIconTip(props) {
  var label = props.label,
      tip = props.tip;

  var _useContext = Object(external_React_["useContext"])(config_provider["ConfigContext"]),
      getPrefixCls = _useContext.getPrefixCls; // 如果 tip 不存在直接使用了 label


  if (!tip) {
    return /*#__PURE__*/external_React_default.a.createElement(external_React_default.a.Fragment, null, label);
  }

  var className = getPrefixCls('pro-core-label-tip');
  var tooltipProps = typeof tip === 'string' ? {
    title: tip
  } : tip;
  return /*#__PURE__*/external_React_default.a.createElement(es_space, {
    size: 4,
    className: className
  }, label, /*#__PURE__*/external_React_default.a.createElement(tooltip, tooltipProps, /*#__PURE__*/external_React_default.a.createElement(icons_InfoCircleOutlined, {
    className: "".concat(className, "-icon")
  })));
};

/* harmony default export */ var es_components_LabelIconTip = (LabelIconTip_LabelIconTip);
// EXTERNAL MODULE: ./packages/utils/es/isBrowser/index.js
var isBrowser = __webpack_require__(42);

// CONCATENATED MODULE: ./packages/utils/es/isImg/index.js
/** 判断是否是图片链接 */
function isImg(path) {
  return /\w.(png|jpg|jpeg|svg|webp|gif|bmp)$/i.test(path);
}

/* harmony default export */ var es_isImg = (isImg);
// CONCATENATED MODULE: ./packages/utils/es/isUrl/index.js
/* eslint no-useless-escape:0 import/prefer-default-export:0 */
var reg = /(((^https?:(?:\/\/)?)(?:[-;:&=\+\$,\w]+@)?[A-Za-z0-9.-]+(?::\d+)?|(?:www.|[-;:&=\+\$,\w]+@)[A-Za-z0-9.-]+)((?:\/[\+~%\/.\w-_]*)?\??(?:[-\+=&;%@.\w_]*)#?(?:[\w]*))?)$/;

var isUrl = function isUrl(path) {
  return reg.test(path);
};

/* harmony default export */ var es_isUrl = (isUrl);
// CONCATENATED MODULE: ./packages/utils/es/pickProProps/index.js
var proFieldProps = "valueType request mode plain renderFormItem render text formItemProps valueEnum";
var proFormProps = "fieldProps secondary colSize groupProps contentRender submitterProps submitter";
function pickProProps(props) {
  var propList = "".concat(proFieldProps, " ").concat(proFormProps).split(/[\s\n]+/);
  var attrs = {};
  Object.keys(props || {}).forEach(function (key) {
    if (propList.includes(key)) {
      return;
    }

    attrs[key] = props[key];
  });
  return attrs;
}
// CONCATENATED MODULE: ./packages/utils/es/pickUndefined/index.js
var pickUndefined = function pickUndefined(obj) {
  var newObj = {};
  Object.keys(obj).forEach(function (key) {
    if (obj[key] !== undefined) {
      newObj[key] = obj[key];
    }
  });
  return newObj;
};

/* harmony default export */ var es_pickUndefined = (pickUndefined);
// CONCATENATED MODULE: ./packages/utils/es/pickUndefinedAndArray/index.js
var pickUndefinedAndArray_pickUndefined = function pickUndefined(obj) {
  var newObj = {};
  Object.keys(obj).forEach(function (key) {
    var _obj$key;

    if (obj[key] !== undefined && ((_obj$key = obj[key]) === null || _obj$key === void 0 ? void 0 : _obj$key.length) !== 0) {
      newObj[key] = obj[key];
    }
  });
  return newObj;
};

/* harmony default export */ var pickUndefinedAndArray = (pickUndefinedAndArray_pickUndefined);
// CONCATENATED MODULE: ./packages/utils/es/hooks/useDebounceFn/index.js
function _toConsumableArray(arr) {
  return _arrayWithoutHoles(arr) || _iterableToArray(arr) || _unsupportedIterableToArray(arr) || _nonIterableSpread();
}

function _nonIterableSpread() {
  throw new TypeError("Invalid attempt to spread non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
}

function _unsupportedIterableToArray(o, minLen) {
  if (!o) return;
  if (typeof o === "string") return _arrayLikeToArray(o, minLen);
  var n = Object.prototype.toString.call(o).slice(8, -1);
  if (n === "Object" && o.constructor) n = o.constructor.name;
  if (n === "Map" || n === "Set") return Array.from(o);
  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen);
}

function _iterableToArray(iter) {
  if (typeof Symbol !== "undefined" && Symbol.iterator in Object(iter)) return Array.from(iter);
}

function _arrayWithoutHoles(arr) {
  if (Array.isArray(arr)) return _arrayLikeToArray(arr);
}

function _arrayLikeToArray(arr, len) {
  if (len == null || len > arr.length) len = arr.length;

  for (var i = 0, arr2 = new Array(len); i < len; i++) {
    arr2[i] = arr[i];
  }

  return arr2;
}



var useDebounceFn_useUpdateEffect = function useUpdateEffect(effect, deps) {
  var isMounted = Object(external_React_["useRef"])(false);
  Object(external_React_["useEffect"])(function () {
    if (!isMounted.current) {
      isMounted.current = true;
    } else {
      return effect();
    }

    return function () {
      return undefined;
    };
  }, deps);
};

function useDebounceFn(fn, deps, wait) {
  // eslint-disable-next-line no-underscore-dangle
  var hooksDeps = Array.isArray(deps) ? deps : []; // eslint-disable-next-line no-underscore-dangle

  var hookWait = typeof deps === 'number' ? deps : wait || 0;
  var timer = Object(external_React_["useRef"])();
  var fnRef = Object(external_React_["useRef"])(fn);
  fnRef.current = fn;
  var cancel = Object(external_React_["useCallback"])(function () {
    if (timer.current) {
      clearTimeout(timer.current);
    }
  }, []);
  var run = Object(external_React_["useCallback"])(function () {
    for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
      args[_key] = arguments[_key];
    }

    cancel();
    timer.current = setTimeout(function () {
      fnRef.current.apply(fnRef, args);
    }, hookWait);
  }, [hookWait, cancel]);
  useDebounceFn_useUpdateEffect(function () {
    run();
    return cancel;
  }, [].concat(_toConsumableArray(hooksDeps), [run]));
  Object(external_React_["useEffect"])(function () {
    return cancel;
  }, []);
  return {
    run: run,
    cancel: cancel
  };
}

/* harmony default export */ var hooks_useDebounceFn = (useDebounceFn);
// CONCATENATED MODULE: ./packages/utils/es/hooks/usePrevious/index.js


var usePrevious_usePrevious = function usePrevious(state) {
  var ref = Object(external_React_["useRef"])();
  Object(external_React_["useEffect"])(function () {
    ref.current = state;
  });
  return ref.current;
};

/* harmony default export */ var hooks_usePrevious = (usePrevious_usePrevious);
// EXTERNAL MODULE: external "moment"
var external_moment_ = __webpack_require__(54);
var external_moment_default = /*#__PURE__*/__webpack_require__.n(external_moment_);

// CONCATENATED MODULE: ./packages/utils/es/conversionSubmitValue/index.js

var dateFormatterMap = {
  time: 'HH:mm:ss',
  timeRange: 'HH:mm:ss',
  date: 'YYYY-MM-DD',
  dateRange: 'YYYY-MM-DD',
  dateTime: 'YYYY-MM-DD HH:mm:ss',
  dateTimeRange: 'YYYY-MM-DD HH:mm:ss'
};
/**
 * 根据不同的格式转化 moment
 * @param value
 * @param dateFormatter
 * @param valueType
 */

var conversionSubmitValue_conversionMoment = function conversionMoment(value, dateFormatter) {
  var valueType = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : 'dateTime';

  if (!dateFormatter) {
    return value;
  }

  if (external_moment_default.a.isMoment(value) && !Array.isArray(value)) {
    if (dateFormatter === 'number') {
      return value.valueOf();
    }

    return value.format(dateFormatterMap[valueType] || 'YYYY-MM-DD HH:mm:ss');
  }

  if (Array.isArray(value)) {
    return value.map(function (item) {
      if (external_moment_default.a.isMoment(item)) {
        if (dateFormatter === 'number') {
          return item.valueOf();
        }

        return item.format(dateFormatterMap[valueType] || 'YYYY-MM-DD HH:mm:ss');
      }

      return item;
    });
  }

  return value;
};
/**
 * 这里主要是来转化一下数据
 * 将 moment 转化为 string
 * 将 all 默认删除
 * @param value
 * @param dateFormatter
 * @param proColumnsMap
 */


var conversionSubmitValue = function conversionSubmitValue(value, dateFormatter, valueTypeMap) {
  var tmpValue = {};
  Object.keys(value).forEach(function (key) {
    var valueType = valueTypeMap[key] || 'text';
    var itemValue = value[key];

    if (!itemValue) {
      return;
    } // 都没命中，原样返回


    tmpValue[key] = conversionSubmitValue_conversionMoment(itemValue, dateFormatter, valueType);
  });
  return tmpValue;
};

/* harmony default export */ var es_conversionSubmitValue = (conversionSubmitValue);
// EXTERNAL MODULE: ./node_modules/lodash.isequal/index.js
var lodash_isequal = __webpack_require__(38);
var lodash_isequal_default = /*#__PURE__*/__webpack_require__.n(lodash_isequal);

// CONCATENATED MODULE: ./packages/utils/es/hooks/useDeepCompareEffect/index.js



function deepCompareEquals(a, b) {
  return lodash_isequal_default()(a, b);
}

function useDeepCompareMemoize(value) {
  var ref = Object(external_React_["useRef"])(); // it can be done by using useMemo as well
  // but useRef is rather cleaner and easier

  if (!deepCompareEquals(value, ref.current)) {
    ref.current = value;
  }

  return ref.current;
}

function useDeepCompareEffect(effect, dependencies) {
  Object(external_React_["useEffect"])(effect, useDeepCompareMemoize(dependencies));
}

/* harmony default export */ var hooks_useDeepCompareEffect = (useDeepCompareEffect);
// CONCATENATED MODULE: ./packages/utils/es/hooks/useDocumentTitle/index.js



function useDocumentTitle(titleInfo, appDefaultTitle) {
  var titleText = typeof titleInfo.pageName === 'string' ? titleInfo.title : appDefaultTitle;
  Object(external_React_["useEffect"])(function () {
    if (Object(isBrowser["a" /* default */])() && titleText) {
      document.title = titleText;
    }
  }, [titleInfo.title]);
}

/* harmony default export */ var hooks_useDocumentTitle = (useDocumentTitle);
// CONCATENATED MODULE: ./packages/utils/es/index.js







/**
 * hooks
 */







// CONCATENATED MODULE: ./node_modules/omit.js/es/index.js
function omit(obj, fields) {
  // eslint-disable-next-line prefer-object-spread
  var shallowCopy = Object.assign({}, obj);

  for (var i = 0; i < fields.length; i += 1) {
    var key = fields[i];
    delete shallowCopy[key];
  }

  return shallowCopy;
}

/* harmony default export */ var omit_js_es = (omit);
// EXTERNAL MODULE: ./packages/layout/src/Header.less
var Header = __webpack_require__(152);

// EXTERNAL MODULE: ./packages/layout/src/GlobalHeader/index.less
var src_GlobalHeader = __webpack_require__(153);

// CONCATENATED MODULE: ./node_modules/@ant-design/icons-svg/es/asn/MenuUnfoldOutlined.js
// This icon file is generated automatically.
var MenuUnfoldOutlined_MenuUnfoldOutlined = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "64 64 896 896",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M408 442h480c4.4 0 8-3.6 8-8v-56c0-4.4-3.6-8-8-8H408c-4.4 0-8 3.6-8 8v56c0 4.4 3.6 8 8 8zm-8 204c0 4.4 3.6 8 8 8h480c4.4 0 8-3.6 8-8v-56c0-4.4-3.6-8-8-8H408c-4.4 0-8 3.6-8 8v56zm504-486H120c-4.4 0-8 3.6-8 8v56c0 4.4 3.6 8 8 8h784c4.4 0 8-3.6 8-8v-56c0-4.4-3.6-8-8-8zm0 632H120c-4.4 0-8 3.6-8 8v56c0 4.4 3.6 8 8 8h784c4.4 0 8-3.6 8-8v-56c0-4.4-3.6-8-8-8zM142.4 642.1L298.7 519a8.84 8.84 0 000-13.9L142.4 381.9c-5.8-4.6-14.4-.5-14.4 6.9v246.3a8.9 8.9 0 0014.4 7z"
      }
    }]
  },
  "name": "menu-unfold",
  "theme": "outlined"
};
/* harmony default export */ var asn_MenuUnfoldOutlined = (MenuUnfoldOutlined_MenuUnfoldOutlined);
// CONCATENATED MODULE: ./node_modules/@ant-design/icons/es/icons/MenuUnfoldOutlined.js
// GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY




var icons_MenuUnfoldOutlined_MenuUnfoldOutlined = function MenuUnfoldOutlined(props, ref) {
  return /*#__PURE__*/external_React_["createElement"](AntdIcon, Object.assign({}, props, {
    ref: ref,
    icon: asn_MenuUnfoldOutlined
  }));
};

icons_MenuUnfoldOutlined_MenuUnfoldOutlined.displayName = 'MenuUnfoldOutlined';
/* harmony default export */ var icons_MenuUnfoldOutlined = (/*#__PURE__*/external_React_["forwardRef"](icons_MenuUnfoldOutlined_MenuUnfoldOutlined));
// CONCATENATED MODULE: ./node_modules/@ant-design/icons-svg/es/asn/MenuFoldOutlined.js
// This icon file is generated automatically.
var MenuFoldOutlined_MenuFoldOutlined = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "64 64 896 896",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M408 442h480c4.4 0 8-3.6 8-8v-56c0-4.4-3.6-8-8-8H408c-4.4 0-8 3.6-8 8v56c0 4.4 3.6 8 8 8zm-8 204c0 4.4 3.6 8 8 8h480c4.4 0 8-3.6 8-8v-56c0-4.4-3.6-8-8-8H408c-4.4 0-8 3.6-8 8v56zm504-486H120c-4.4 0-8 3.6-8 8v56c0 4.4 3.6 8 8 8h784c4.4 0 8-3.6 8-8v-56c0-4.4-3.6-8-8-8zm0 632H120c-4.4 0-8 3.6-8 8v56c0 4.4 3.6 8 8 8h784c4.4 0 8-3.6 8-8v-56c0-4.4-3.6-8-8-8zM115.4 518.9L271.7 642c5.8 4.6 14.4.5 14.4-6.9V388.9c0-7.4-8.5-11.5-14.4-6.9L115.4 505.1a8.74 8.74 0 000 13.8z"
      }
    }]
  },
  "name": "menu-fold",
  "theme": "outlined"
};
/* harmony default export */ var asn_MenuFoldOutlined = (MenuFoldOutlined_MenuFoldOutlined);
// CONCATENATED MODULE: ./node_modules/@ant-design/icons/es/icons/MenuFoldOutlined.js
// GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY




var icons_MenuFoldOutlined_MenuFoldOutlined = function MenuFoldOutlined(props, ref) {
  return /*#__PURE__*/external_React_["createElement"](AntdIcon, Object.assign({}, props, {
    ref: ref,
    icon: asn_MenuFoldOutlined
  }));
};

icons_MenuFoldOutlined_MenuFoldOutlined.displayName = 'MenuFoldOutlined';
/* harmony default export */ var icons_MenuFoldOutlined = (/*#__PURE__*/external_React_["forwardRef"](icons_MenuFoldOutlined_MenuFoldOutlined));
// EXTERNAL MODULE: ./packages/layout/src/SiderMenu/index.less
var src_SiderMenu = __webpack_require__(72);

// CONCATENATED MODULE: ./node_modules/@ant-design/icons/es/components/Icon.js





var Icon_Icon = /*#__PURE__*/external_React_["forwardRef"](function (props, ref) {
  var className = props.className,
      Component = props.component,
      viewBox = props.viewBox,
      spin = props.spin,
      rotate = props.rotate,
      tabIndex = props.tabIndex,
      onClick = props.onClick,
      children = props.children,
      restProps = Object(objectWithoutProperties["a" /* default */])(props, ["className", "component", "viewBox", "spin", "rotate", "tabIndex", "onClick", "children"]);

  utils_warning(Boolean(Component || children), 'Should have `component` prop or `children`.');
  utils_useInsertStyles();
  var classString = classnames_default()('anticon', className);
  var svgClassString = classnames_default()({
    'anticon-spin': !!spin
  });
  var svgStyle = rotate ? {
    msTransform: "rotate(".concat(rotate, "deg)"),
    transform: "rotate(".concat(rotate, "deg)")
  } : undefined;

  var innerSvgProps = _objectSpread2(_objectSpread2({}, svgBaseProps), {}, {
    className: svgClassString,
    style: svgStyle,
    viewBox: viewBox
  });

  if (!viewBox) {
    delete innerSvgProps.viewBox;
  } // component > children


  var renderInnerNode = function renderInnerNode() {
    if (Component) {
      return /*#__PURE__*/external_React_["createElement"](Component, Object.assign({}, innerSvgProps), children);
    }

    if (children) {
      utils_warning(Boolean(viewBox) || external_React_["Children"].count(children) === 1 && /*#__PURE__*/external_React_["isValidElement"](children) && external_React_["Children"].only(children).type === 'use', 'Make sure that you provide correct `viewBox`' + ' prop (default `0 0 1024 1024`) to the icon.');
      return /*#__PURE__*/external_React_["createElement"]("svg", Object.assign({}, innerSvgProps, {
        viewBox: viewBox
      }), children);
    }

    return null;
  };

  var iconTabIndex = tabIndex;

  if (iconTabIndex === undefined && onClick) {
    iconTabIndex = -1;
  }

  return /*#__PURE__*/external_React_["createElement"]("span", Object.assign({
    role: "img"
  }, restProps, {
    ref: ref,
    tabIndex: iconTabIndex,
    onClick: onClick,
    className: classString
  }), renderInnerNode());
});
Icon_Icon.displayName = 'AntdIcon';
/* harmony default export */ var components_Icon = (Icon_Icon);
// CONCATENATED MODULE: ./node_modules/@ant-design/icons/es/components/IconFont.js



var customCache = new Set();

function isValidCustomScriptUrl(scriptUrl) {
  return Boolean(typeof scriptUrl === 'string' && scriptUrl.length && !customCache.has(scriptUrl));
}

function createScriptUrlElements(scriptUrls) {
  var index = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 0;
  var currentScriptUrl = scriptUrls[index];

  if (isValidCustomScriptUrl(currentScriptUrl)) {
    var script = document.createElement('script');
    script.setAttribute('src', currentScriptUrl);
    script.setAttribute('data-namespace', currentScriptUrl);

    if (scriptUrls.length > index + 1) {
      script.onload = function () {
        createScriptUrlElements(scriptUrls, index + 1);
      };

      script.onerror = function () {
        createScriptUrlElements(scriptUrls, index + 1);
      };
    }

    customCache.add(currentScriptUrl);
    document.body.appendChild(script);
  }
}

function create() {
  var options = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
  var scriptUrl = options.scriptUrl,
      _options$extraCommonP = options.extraCommonProps,
      extraCommonProps = _options$extraCommonP === void 0 ? {} : _options$extraCommonP;
  /**
   * DOM API required.
   * Make sure in browser environment.
   * The Custom Icon will create a <script/>
   * that loads SVG symbols and insert the SVG Element into the document body.
   */

  if (scriptUrl && typeof document !== 'undefined' && typeof window !== 'undefined' && typeof document.createElement === 'function') {
    if (Array.isArray(scriptUrl)) {
      // 因为iconfont资源会把svg插入before，所以前加载相同type会覆盖后加载，为了数组覆盖顺序，倒叙插入
      createScriptUrlElements(scriptUrl.reverse());
    } else {
      createScriptUrlElements([scriptUrl]);
    }
  }

  var Iconfont = /*#__PURE__*/external_React_["forwardRef"](function (props, ref) {
    var type = props.type,
        children = props.children,
        restProps = Object(objectWithoutProperties["a" /* default */])(props, ["type", "children"]); // children > type


    var content = null;

    if (props.type) {
      content = /*#__PURE__*/external_React_["createElement"]("use", {
        xlinkHref: "#".concat(type)
      });
    }

    if (children) {
      content = children;
    }

    return /*#__PURE__*/external_React_["createElement"](components_Icon, Object.assign({}, extraCommonProps, restProps, {
      ref: ref
    }), content);
  });
  Iconfont.displayName = 'Iconfont';
  return Iconfont;
}
// CONCATENATED MODULE: ./packages/layout/src/defaultSettings.ts
var defaultSettings = {
  navTheme: 'dark',
  layout: 'side',
  contentWidth: 'Fluid',
  fixedHeader: false,
  fixSiderbar: false,
  menu: {
    locale: true
  },
  headerHeight: 48,
  title: 'Ant Design Pro',
  iconfontUrl: '',
  primaryColor: '#1890ff'
};
/* harmony default export */ var src_defaultSettings = (defaultSettings);
// CONCATENATED MODULE: ./node_modules/memoize-one/dist/memoize-one.esm.js
function areInputsEqual(newInputs, lastInputs) {
  if (newInputs.length !== lastInputs.length) {
    return false;
  }

  for (var i = 0; i < newInputs.length; i++) {
    if (newInputs[i] !== lastInputs[i]) {
      return false;
    }
  }

  return true;
}

function memoizeOne(resultFn, isEqual) {
  if (isEqual === void 0) {
    isEqual = areInputsEqual;
  }

  var lastThis;
  var lastArgs = [];
  var lastResult;
  var calledOnce = false;

  function memoized() {
    var newArgs = [];

    for (var _i = 0; _i < arguments.length; _i++) {
      newArgs[_i] = arguments[_i];
    }

    if (calledOnce && lastThis === this && isEqual(newArgs, lastArgs)) {
      return lastResult;
    }

    lastResult = resultFn.apply(this, newArgs);
    calledOnce = true;
    lastThis = this;
    lastArgs = newArgs;
    return lastResult;
  }

  return memoized;
}

/* harmony default export */ var memoize_one_esm = (memoizeOne);
// EXTERNAL MODULE: ./node_modules/hash.js/lib/hash.js
var hash = __webpack_require__(80);
var hash_default = /*#__PURE__*/__webpack_require__.n(hash);

// CONCATENATED MODULE: ./node_modules/@qixian.cs/path-to-regexp/dist.es2015/index.js
function dist_es2015_typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { dist_es2015_typeof = function _typeof(obj) { return typeof obj; }; } else { dist_es2015_typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return dist_es2015_typeof(obj); }

/**
 * Tokenize input string.
 */
function lexer(str) {
  var tokens = [];
  var i = 0;

  while (i < str.length) {
    var char = str[i];

    if (char === "*" || char === "+" || char === "?") {
      tokens.push({
        type: "MODIFIER",
        index: i,
        value: str[i++]
      });
      continue;
    }

    if (char === "\\") {
      tokens.push({
        type: "ESCAPED_CHAR",
        index: i++,
        value: str[i++]
      });
      continue;
    }

    if (char === "{") {
      tokens.push({
        type: "OPEN",
        index: i,
        value: str[i++]
      });
      continue;
    }

    if (char === "}") {
      tokens.push({
        type: "CLOSE",
        index: i,
        value: str[i++]
      });
      continue;
    }

    if (char === ":") {
      var name = "";
      var j = i + 1;

      while (j < str.length) {
        var code = str.charCodeAt(j);

        if ( // `0-9`
        code >= 48 && code <= 57 || // `A-Z`
        code >= 65 && code <= 90 || // `a-z`
        code >= 97 && code <= 122 || // `_`
        code === 95) {
          name += str[j++];
          continue;
        }

        break;
      }

      if (!name) throw new TypeError("Missing parameter name at " + i);
      tokens.push({
        type: "NAME",
        index: i,
        value: name
      });
      i = j;
      continue;
    }

    if (char === "(") {
      var count = 1;
      var pattern = "";
      var j = i + 1;

      if (str[j] === "?") {
        throw new TypeError("Pattern cannot start with \"?\" at " + j);
      }

      while (j < str.length) {
        if (str[j] === "\\") {
          pattern += str[j++] + str[j++];
          continue;
        }

        if (str[j] === ")") {
          count--;

          if (count === 0) {
            j++;
            break;
          }
        } else if (str[j] === "(") {
          count++;

          if (str[j + 1] !== "?") {
            throw new TypeError("Capturing groups are not allowed at " + j);
          }
        }

        pattern += str[j++];
      }

      if (count) throw new TypeError("Unbalanced pattern at " + i);
      if (!pattern) throw new TypeError("Missing pattern at " + i);
      tokens.push({
        type: "PATTERN",
        index: i,
        value: pattern
      });
      i = j;
      continue;
    }

    tokens.push({
      type: "CHAR",
      index: i,
      value: str[i++]
    });
  }

  tokens.push({
    type: "END",
    index: i,
    value: ""
  });
  return tokens;
}
/**
 * Parse a string for the raw tokens.
 */


function parse(str, options) {
  if (options === void 0) {
    options = {};
  }

  var tokens = lexer(str);
  var _a = options.prefixes,
      prefixes = _a === void 0 ? "./" : _a;
  var defaultPattern = "[^" + escapeString(options.delimiter || "/#?") + "]+?";
  var result = [];
  var key = 0;
  var i = 0;
  var path = "";

  var tryConsume = function tryConsume(type) {
    if (i < tokens.length && tokens[i].type === type) return tokens[i++].value;
  };

  var mustConsume = function mustConsume(type) {
    var value = tryConsume(type);
    if (value !== undefined) return value;
    var _a = tokens[i],
        nextType = _a.type,
        index = _a.index;
    throw new TypeError("Unexpected " + nextType + " at " + index + ", expected " + type);
  };

  var consumeText = function consumeText() {
    var result = "";
    var value; // tslint:disable-next-line

    while (value = tryConsume("CHAR") || tryConsume("ESCAPED_CHAR")) {
      result += value;
    }

    return result;
  };

  while (i < tokens.length) {
    var char = tryConsume("CHAR");
    var name = tryConsume("NAME");
    var pattern = tryConsume("PATTERN");

    if (name || pattern) {
      var prefix = char || "";

      if (prefixes.indexOf(prefix) === -1) {
        path += prefix;
        prefix = "";
      }

      if (path) {
        result.push(path);
        path = "";
      }

      result.push({
        name: name || key++,
        prefix: prefix,
        suffix: "",
        pattern: pattern || defaultPattern,
        modifier: tryConsume("MODIFIER") || ""
      });
      continue;
    }

    var value = char || tryConsume("ESCAPED_CHAR");

    if (value) {
      path += value;
      continue;
    }

    if (path) {
      result.push(path);
      path = "";
    }

    var open = tryConsume("OPEN");

    if (open) {
      var prefix = consumeText();
      var name_1 = tryConsume("NAME") || "";
      var pattern_1 = tryConsume("PATTERN") || "";
      var suffix = consumeText();
      mustConsume("CLOSE");
      result.push({
        name: name_1 || (pattern_1 ? key++ : ""),
        pattern: name_1 && !pattern_1 ? defaultPattern : pattern_1,
        prefix: prefix,
        suffix: suffix,
        modifier: tryConsume("MODIFIER") || ""
      });
      continue;
    }

    mustConsume("END");
  }

  return result;
}
/**
 * Compile a string to a template function for the path.
 */

function compile(str, options) {
  return tokensToFunction(parse(str, options), options);
}
/**
 * Expose a method for transforming tokens into the path function.
 */

function tokensToFunction(tokens, options) {
  if (options === void 0) {
    options = {};
  }

  var reFlags = flags(options);
  var _a = options.encode,
      encode = _a === void 0 ? function (x) {
    return x;
  } : _a,
      _b = options.validate,
      validate = _b === void 0 ? true : _b; // Compile all the tokens into regexps.

  var matches = tokens.map(function (token) {
    if (dist_es2015_typeof(token) === "object") {
      return new RegExp("^(?:" + token.pattern + ")$", reFlags);
    }
  });
  return function (data) {
    var path = "";

    for (var i = 0; i < tokens.length; i++) {
      var token = tokens[i];

      if (typeof token === "string") {
        path += token;
        continue;
      }

      var value = data ? data[token.name] : undefined;
      var optional = token.modifier === "?" || token.modifier === "*";
      var repeat = token.modifier === "*" || token.modifier === "+";

      if (Array.isArray(value)) {
        if (!repeat) {
          throw new TypeError("Expected \"" + token.name + "\" to not repeat, but got an array");
        }

        if (value.length === 0) {
          if (optional) continue;
          throw new TypeError("Expected \"" + token.name + "\" to not be empty");
        }

        for (var j = 0; j < value.length; j++) {
          var segment = encode(value[j], token);

          if (validate && !matches[i].test(segment)) {
            throw new TypeError("Expected all \"" + token.name + "\" to match \"" + token.pattern + "\", but got \"" + segment + "\"");
          }

          path += token.prefix + segment + token.suffix;
        }

        continue;
      }

      if (typeof value === "string" || typeof value === "number") {
        var segment = encode(String(value), token);

        if (validate && !matches[i].test(segment)) {
          throw new TypeError("Expected \"" + token.name + "\" to match \"" + token.pattern + "\", but got \"" + segment + "\"");
        }

        path += token.prefix + segment + token.suffix;
        continue;
      }

      if (optional) continue;
      var typeOfMessage = repeat ? "an array" : "a string";
      throw new TypeError("Expected \"" + token.name + "\" to be " + typeOfMessage);
    }

    return path;
  };
}
/**
 * Create path match function from `path-to-regexp` spec.
 */

function match(str, options) {
  var keys = [];
  var re = pathToRegexp(str, keys, options);
  return regexpToFunction(re, keys, options);
}
/**
 * Create a path match function from `path-to-regexp` output.
 */

function regexpToFunction(re, keys, options) {
  if (options === void 0) {
    options = {};
  }

  var _a = options.decode,
      decode = _a === void 0 ? function (x) {
    return x;
  } : _a;
  return function (pathname) {
    var m = re.exec(pathname);
    if (!m) return false;
    var path = m[0],
        index = m.index;
    var params = Object.create(null);

    var _loop_1 = function _loop_1(i) {
      // tslint:disable-next-line
      if (m[i] === undefined) return "continue";
      var key = keys[i - 1];

      if (key.modifier === "*" || key.modifier === "+") {
        params[key.name] = m[i].split(key.prefix + key.suffix).map(function (value) {
          return decode(value, key);
        });
      } else {
        params[key.name] = decode(m[i], key);
      }
    };

    for (var i = 1; i < m.length; i++) {
      _loop_1(i);
    }

    return {
      path: path,
      index: index,
      params: params
    };
  };
}
/**
 * Escape a regular expression string.
 */

function escapeString(str) {
  return str.replace(/([.+*?=^!:${}()[\]|/\\])/g, "\\$1");
}
/**
 * Get the flags for a regexp from the options.
 */


function flags(options) {
  return options && options.sensitive ? "" : "i";
}
/**
 * Pull out keys from a regexp.
 */


function regexpToRegexp(path, keys) {
  if (!keys) return path; // Use a negative lookahead to match only capturing groups.

  var groups = path.source.match(/\((?!\?)/g);

  if (groups) {
    for (var i = 0; i < groups.length; i++) {
      keys.push({
        name: i,
        prefix: "",
        suffix: "",
        modifier: "",
        pattern: ""
      });
    }
  }

  return path;
}
/**
 * Transform an array into a regexp.
 */


function arrayToRegexp(paths, keys, options) {
  var parts = paths.map(function (path) {
    return pathToRegexp(path, keys, options).source;
  });
  return new RegExp("(?:" + parts.join("|") + ")", flags(options));
}
/**
 * Create a path regexp from string input.
 */


function stringToRegexp(path, keys, options) {
  return tokensToRegexp(parse(path, options), keys, options);
}
/**
 * Expose a function for taking tokens and returning a RegExp.
 */


function tokensToRegexp(tokens, keys, options) {
  if (options === void 0) {
    options = {};
  }

  var _a = options.strict,
      strict = _a === void 0 ? false : _a,
      _b = options.start,
      start = _b === void 0 ? true : _b,
      _c = options.end,
      end = _c === void 0 ? true : _c,
      _d = options.encode,
      encode = _d === void 0 ? function (x) {
    return x;
  } : _d;
  var endsWith = "[" + escapeString(options.endsWith || "") + "]|$";
  var delimiter = "[" + escapeString(options.delimiter || "/#?") + "]";
  var route = start ? "^" : ""; // Iterate over the tokens and create our regexp string.

  for (var _i = 0, tokens_1 = tokens; _i < tokens_1.length; _i++) {
    var token = tokens_1[_i];

    if (typeof token === "string") {
      route += escapeString(encode(token));
    } else {
      var prefix = escapeString(encode(token.prefix));
      var suffix = escapeString(encode(token.suffix));

      if (token.pattern) {
        if (keys) keys.push(token);

        if (prefix || suffix) {
          if (token.modifier === "+" || token.modifier === "*") {
            var mod = token.modifier === "*" ? "?" : "";
            route += "(?:" + prefix + "((?:" + token.pattern + ")(?:" + suffix + prefix + "(?:" + token.pattern + "))*)" + suffix + ")" + mod;
          } else {
            route += "(?:" + prefix + "(" + token.pattern + ")" + suffix + ")" + token.modifier;
          }
        } else {
          route += "(" + token.pattern + ")" + token.modifier;
        }
      } else {
        route += "(?:" + prefix + suffix + ")" + token.modifier;
      }
    }
  }

  if (end) {
    if (!strict) route += delimiter + "?";
    route += !options.endsWith ? "$" : "(?=" + endsWith + ")";
  } else {
    var endToken = tokens[tokens.length - 1];
    var isEndDelimited = typeof endToken === "string" ? delimiter.indexOf(endToken[endToken.length - 1]) > -1 : // tslint:disable-next-line
    endToken === undefined;

    if (!strict) {
      route += "(?:" + delimiter + "(?=" + endsWith + "))?";
    }

    if (!isEndDelimited) {
      route += "(?=" + delimiter + "|" + endsWith + ")";
    }
  }

  return new RegExp(route, flags(options));
}
/**
 * Normalize the given path string, returning a regular expression.
 *
 * An empty array can be passed in for the keys, which will hold the
 * placeholder key descriptions. For example, using `/user/:id`, `keys` will
 * contain `[{ name: 'id', delimiter: '/', optional: false, repeat: false }]`.
 */

function pathToRegexp(path, keys, options) {
  if (path instanceof RegExp) return regexpToRegexp(path, keys);
  if (Array.isArray(path)) return arrayToRegexp(path, keys, options);
  return stringToRegexp(path, keys, options);
}
// CONCATENATED MODULE: ./node_modules/@umijs/route-utils/es/transformRoute/transformRoute.js
function transformRoute_typeof(obj) {
  "@babel/helpers - typeof";

  if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") {
    transformRoute_typeof = function _typeof(obj) {
      return typeof obj;
    };
  } else {
    transformRoute_typeof = function _typeof(obj) {
      return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj;
    };
  }

  return transformRoute_typeof(obj);
}

function transformRoute_slicedToArray(arr, i) {
  return transformRoute_arrayWithHoles(arr) || transformRoute_iterableToArrayLimit(arr, i) || transformRoute_unsupportedIterableToArray(arr, i) || transformRoute_nonIterableRest();
}

function transformRoute_nonIterableRest() {
  throw new TypeError("Invalid attempt to destructure non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
}

function transformRoute_iterableToArrayLimit(arr, i) {
  if (typeof Symbol === "undefined" || !(Symbol.iterator in Object(arr))) return;
  var _arr = [];
  var _n = true;
  var _d = false;
  var _e = undefined;

  try {
    for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) {
      _arr.push(_s.value);

      if (i && _arr.length === i) break;
    }
  } catch (err) {
    _d = true;
    _e = err;
  } finally {
    try {
      if (!_n && _i["return"] != null) _i["return"]();
    } finally {
      if (_d) throw _e;
    }
  }

  return _arr;
}

function transformRoute_arrayWithHoles(arr) {
  if (Array.isArray(arr)) return arr;
}

function _createForOfIteratorHelper(o, allowArrayLike) {
  var it;

  if (typeof Symbol === "undefined" || o[Symbol.iterator] == null) {
    if (Array.isArray(o) || (it = transformRoute_unsupportedIterableToArray(o)) || allowArrayLike && o && typeof o.length === "number") {
      if (it) o = it;
      var i = 0;

      var F = function F() {};

      return {
        s: F,
        n: function n() {
          if (i >= o.length) return {
            done: true
          };
          return {
            done: false,
            value: o[i++]
          };
        },
        e: function e(_e2) {
          throw _e2;
        },
        f: F
      };
    }

    throw new TypeError("Invalid attempt to iterate non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
  }

  var normalCompletion = true,
      didErr = false,
      err;
  return {
    s: function s() {
      it = o[Symbol.iterator]();
    },
    n: function n() {
      var step = it.next();
      normalCompletion = step.done;
      return step;
    },
    e: function e(_e3) {
      didErr = true;
      err = _e3;
    },
    f: function f() {
      try {
        if (!normalCompletion && it.return != null) it.return();
      } finally {
        if (didErr) throw err;
      }
    }
  };
}

function transformRoute_classCallCheck(instance, Constructor) {
  if (!(instance instanceof Constructor)) {
    throw new TypeError("Cannot call a class as a function");
  }
}

function transformRoute_defineProperties(target, props) {
  for (var i = 0; i < props.length; i++) {
    var descriptor = props[i];
    descriptor.enumerable = descriptor.enumerable || false;
    descriptor.configurable = true;
    if ("value" in descriptor) descriptor.writable = true;
    Object.defineProperty(target, descriptor.key, descriptor);
  }
}

function transformRoute_createClass(Constructor, protoProps, staticProps) {
  if (protoProps) transformRoute_defineProperties(Constructor.prototype, protoProps);
  if (staticProps) transformRoute_defineProperties(Constructor, staticProps);
  return Constructor;
}

function transformRoute_inherits(subClass, superClass) {
  if (typeof superClass !== "function" && superClass !== null) {
    throw new TypeError("Super expression must either be null or a function");
  }

  subClass.prototype = Object.create(superClass && superClass.prototype, {
    constructor: {
      value: subClass,
      writable: true,
      configurable: true
    }
  });
  if (superClass) transformRoute_setPrototypeOf(subClass, superClass);
}

function transformRoute_createSuper(Derived) {
  var hasNativeReflectConstruct = transformRoute_isNativeReflectConstruct();

  return function _createSuperInternal() {
    var Super = transformRoute_getPrototypeOf(Derived),
        result;

    if (hasNativeReflectConstruct) {
      var NewTarget = transformRoute_getPrototypeOf(this).constructor;

      result = Reflect.construct(Super, arguments, NewTarget);
    } else {
      result = Super.apply(this, arguments);
    }

    return transformRoute_possibleConstructorReturn(this, result);
  };
}

function transformRoute_possibleConstructorReturn(self, call) {
  if (call && (transformRoute_typeof(call) === "object" || typeof call === "function")) {
    return call;
  }

  return transformRoute_assertThisInitialized(self);
}

function transformRoute_assertThisInitialized(self) {
  if (self === void 0) {
    throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
  }

  return self;
}

function _wrapNativeSuper(Class) {
  var _cache = typeof Map === "function" ? new Map() : undefined;

  _wrapNativeSuper = function _wrapNativeSuper(Class) {
    if (Class === null || !_isNativeFunction(Class)) return Class;

    if (typeof Class !== "function") {
      throw new TypeError("Super expression must either be null or a function");
    }

    if (typeof _cache !== "undefined") {
      if (_cache.has(Class)) return _cache.get(Class);

      _cache.set(Class, Wrapper);
    }

    function Wrapper() {
      return _construct(Class, arguments, transformRoute_getPrototypeOf(this).constructor);
    }

    Wrapper.prototype = Object.create(Class.prototype, {
      constructor: {
        value: Wrapper,
        enumerable: false,
        writable: true,
        configurable: true
      }
    });
    return transformRoute_setPrototypeOf(Wrapper, Class);
  };

  return _wrapNativeSuper(Class);
}

function _construct(Parent, args, Class) {
  if (transformRoute_isNativeReflectConstruct()) {
    _construct = Reflect.construct;
  } else {
    _construct = function _construct(Parent, args, Class) {
      var a = [null];
      a.push.apply(a, args);
      var Constructor = Function.bind.apply(Parent, a);
      var instance = new Constructor();
      if (Class) transformRoute_setPrototypeOf(instance, Class.prototype);
      return instance;
    };
  }

  return _construct.apply(null, arguments);
}

function transformRoute_isNativeReflectConstruct() {
  if (typeof Reflect === "undefined" || !Reflect.construct) return false;
  if (Reflect.construct.sham) return false;
  if (typeof Proxy === "function") return true;

  try {
    Date.prototype.toString.call(Reflect.construct(Date, [], function () {}));
    return true;
  } catch (e) {
    return false;
  }
}

function _isNativeFunction(fn) {
  return Function.toString.call(fn).indexOf("[native code]") !== -1;
}

function transformRoute_setPrototypeOf(o, p) {
  transformRoute_setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) {
    o.__proto__ = p;
    return o;
  };

  return transformRoute_setPrototypeOf(o, p);
}

function transformRoute_getPrototypeOf(o) {
  transformRoute_getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) {
    return o.__proto__ || Object.getPrototypeOf(o);
  };
  return transformRoute_getPrototypeOf(o);
}

function transformRoute_toConsumableArray(arr) {
  return transformRoute_arrayWithoutHoles(arr) || transformRoute_iterableToArray(arr) || transformRoute_unsupportedIterableToArray(arr) || transformRoute_nonIterableSpread();
}

function transformRoute_nonIterableSpread() {
  throw new TypeError("Invalid attempt to spread non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
}

function transformRoute_unsupportedIterableToArray(o, minLen) {
  if (!o) return;
  if (typeof o === "string") return transformRoute_arrayLikeToArray(o, minLen);
  var n = Object.prototype.toString.call(o).slice(8, -1);
  if (n === "Object" && o.constructor) n = o.constructor.name;
  if (n === "Map" || n === "Set") return Array.from(o);
  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return transformRoute_arrayLikeToArray(o, minLen);
}

function transformRoute_iterableToArray(iter) {
  if (typeof Symbol !== "undefined" && Symbol.iterator in Object(iter)) return Array.from(iter);
}

function transformRoute_arrayWithoutHoles(arr) {
  if (Array.isArray(arr)) return transformRoute_arrayLikeToArray(arr);
}

function transformRoute_arrayLikeToArray(arr, len) {
  if (len == null || len > arr.length) len = arr.length;

  for (var i = 0, arr2 = new Array(len); i < len; i++) {
    arr2[i] = arr[i];
  }

  return arr2;
}

function transformRoute_objectWithoutProperties(source, excluded) {
  if (source == null) return {};

  var target = transformRoute_objectWithoutPropertiesLoose(source, excluded);

  var key, i;

  if (Object.getOwnPropertySymbols) {
    var sourceSymbolKeys = Object.getOwnPropertySymbols(source);

    for (i = 0; i < sourceSymbolKeys.length; i++) {
      key = sourceSymbolKeys[i];
      if (excluded.indexOf(key) >= 0) continue;
      if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue;
      target[key] = source[key];
    }
  }

  return target;
}

function transformRoute_objectWithoutPropertiesLoose(source, excluded) {
  if (source == null) return {};
  var target = {};
  var sourceKeys = Object.keys(source);
  var key, i;

  for (i = 0; i < sourceKeys.length; i++) {
    key = sourceKeys[i];
    if (excluded.indexOf(key) >= 0) continue;
    target[key] = source[key];
  }

  return target;
}

function transformRoute_ownKeys(object, enumerableOnly) {
  var keys = Object.keys(object);

  if (Object.getOwnPropertySymbols) {
    var symbols = Object.getOwnPropertySymbols(object);
    if (enumerableOnly) symbols = symbols.filter(function (sym) {
      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
    });
    keys.push.apply(keys, symbols);
  }

  return keys;
}

function transformRoute_objectSpread(target) {
  for (var i = 1; i < arguments.length; i++) {
    var source = arguments[i] != null ? arguments[i] : {};

    if (i % 2) {
      transformRoute_ownKeys(Object(source), true).forEach(function (key) {
        transformRoute_defineProperty(target, key, source[key]);
      });
    } else if (Object.getOwnPropertyDescriptors) {
      Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
    } else {
      transformRoute_ownKeys(Object(source)).forEach(function (key) {
        Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
      });
    }
  }

  return target;
}

function transformRoute_defineProperty(obj, key, value) {
  if (key in obj) {
    Object.defineProperty(obj, key, {
      value: value,
      enumerable: true,
      configurable: true,
      writable: true
    });
  } else {
    obj[key] = value;
  }

  return obj;
}





function stripQueryStringAndHashFromPath(url) {
  return url.split('?')[0].split('#')[0];
}
/* eslint no-useless-escape:0 import/prefer-default-export:0 */

var transformRoute_reg = /(((^https?:(?:\/\/)?)(?:[-;:&=\+\$,\w]+@)?[A-Za-z0-9.-]+(?::\d+)?|(?:www.|[-;:&=\+\$,\w]+@)[A-Za-z0-9.-]+)((?:\/[\+~%\/.\w-_]*)?\??(?:[-\+=&;%@.\w_]*)#?(?:[\w]*))?)$/;
var transformRoute_isUrl = function isUrl(path) {
  return transformRoute_reg.test(path);
};
var transformRoute_getKeyByPath = function getKeyByPath(item) {
  var path = item.path;

  if (!path || path === '/') {
    // 如果还是没有，用对象的hash 生成一个
    try {
      return "/".concat(hash_default.a.sha256().update(JSON.stringify(item)).digest('hex'));
    } catch (error) {// dom some thing
    }
  }

  return path ? stripQueryStringAndHashFromPath(path) : path;
};
/**
 * 获取locale，增加了一个功能，如果 locale = false，将不使用国际化
 * @param item
 * @param parentName
 */

var getItemLocaleName = function getItemLocaleName(item, parentName) {
  var name = item.name,
      locale = item.locale; // 如果配置了 locale 并且 locale 为 false或 ""

  if ('locale' in item && locale === false || !name) {
    return false;
  }

  return item.locale || "".concat(parentName, ".").concat(name);
};
/**
 * 如果不是 / 开头的和父节点做一下合并
 * 如果是 / 开头的不作任何处理
 * 如果是 url 也直接返回
 * @param path
 * @param parentPath
 */


var mergePath = function mergePath() {
  var path = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : '';
  var parentPath = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : '/';

  if ((path || parentPath).startsWith('/')) {
    return path;
  }

  if (transformRoute_isUrl(path)) {
    return path;
  }

  return "/".concat(parentPath, "/").concat(path).replace(/\/\//g, '/').replace(/\/\//g, '/');
}; // bigfish 的兼容准话


var bigfishCompatibleConversions = function bigfishCompatibleConversions(route, props) {
  var _route$menu = route.menu,
      menu = _route$menu === void 0 ? {} : _route$menu,
      indexRoute = route.indexRoute,
      _route$path = route.path,
      path = _route$path === void 0 ? '' : _route$path,
      children = route.children;
  var _menu$name = menu.name,
      name = _menu$name === void 0 ? route.name : _menu$name,
      _menu$icon = menu.icon,
      icon = _menu$icon === void 0 ? route.icon : _menu$icon,
      _menu$hideChildren = menu.hideChildren,
      hideChildren = _menu$hideChildren === void 0 ? route.hideChildren : _menu$hideChildren,
      _menu$flatMenu = menu.flatMenu,
      flatMenu = _menu$flatMenu === void 0 ? route.flatMenu : _menu$flatMenu; // 兼容平铺式写法
  // 拼接 childrenRoutes, 处理存在 indexRoute 时的逻辑

  var childrenRoutes = indexRoute && // 如果只有 redirect,不用处理的
  Object.keys(indexRoute).join(',') !== 'redirect' ? [transformRoute_objectSpread({
    path: path,
    menu: menu
  }, indexRoute)].concat(children || []) : children; // 拼接返回的 menu 数据

  var result = transformRoute_objectSpread({}, route);

  if (name) {
    result.name = name;
  }

  if (icon) {
    result.icon = icon;
  }

  if (childrenRoutes && childrenRoutes.length) {
    /** 在菜单中隐藏子项 */
    if (hideChildren) {
      delete result.children;
      return result;
    } // 需要重新进行一次


    var routers = formatter(transformRoute_objectSpread(transformRoute_objectSpread({}, props), {}, {
      data: childrenRoutes
    }), route);
    /** 在菜单中只隐藏此项，子项往上提，仍旧展示 */

    if (flatMenu) {
      return routers;
    }

    result.children = routers;
  }

  return result;
};
/**
 *
 * @param props
 * @param parent
 */


function formatter(props) {
  var parent = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {
    path: '/'
  };
  var data = props.data,
      formatMessage = props.formatMessage,
      parentName = props.parentName,
      menuLocale = props.locale;

  if (!data || !Array.isArray(data)) {
    return [];
  }

  return data.filter(function (item) {
    if (!item) return false;
    if (item.routes || item.children) return true;
    if (item.path) return true;
    if (item.layout) return true; // 重定向

    if (item.redirect) return false;
    return false;
  }).filter(function (item) {
    var _item$menu, _item$menu2; // 是否没有权限查看
    // 这样就不会显示，是一个兼容性的方式


    if (item.unaccessible) {
      // eslint-disable-next-line no-param-reassign
      delete item.name;
    }

    if ((item === null || item === void 0 ? void 0 : (_item$menu = item.menu) === null || _item$menu === void 0 ? void 0 : _item$menu.name) || (item === null || item === void 0 ? void 0 : item.flatMenu) || (item === null || item === void 0 ? void 0 : (_item$menu2 = item.menu) === null || _item$menu2 === void 0 ? void 0 : _item$menu2.flatMenu)) {
      return true;
    } // 显示指定在 menu 中隐藏该项
    // layout 插件的功能，其实不应该存在的


    if (item.menu === false) {
      return false;
    }

    return true;
  }).map(function () {
    var item = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {
      path: '/'
    };
    var path = mergePath(item.path, parent ? parent.path : '/');
    var name = item.name;
    var locale = getItemLocaleName(item, parentName || 'menu'); // if enableMenuLocale use item.name,
    // close menu international

    var localeName = locale !== false && menuLocale !== false && formatMessage && locale ? formatMessage({
      id: locale,
      defaultMessage: name
    }) : name;

    var _parent$pro_layout_pa = parent.pro_layout_parentKeys,
        pro_layout_parentKeys = _parent$pro_layout_pa === void 0 ? [] : _parent$pro_layout_pa,
        children = parent.children,
        icon = parent.icon,
        flatMenu = parent.flatMenu,
        indexRoute = parent.indexRoute,
        restParent = transformRoute_objectWithoutProperties(parent, ["pro_layout_parentKeys", "children", "icon", "flatMenu", "indexRoute"]);

    var finallyItem = transformRoute_objectSpread(transformRoute_objectSpread(transformRoute_objectSpread({}, restParent), item), {}, {
      path: path,
      locale: locale,
      key: item.key || transformRoute_getKeyByPath(transformRoute_objectSpread(transformRoute_objectSpread({}, item), {}, {
        path: path
      })),
      routes: null,
      pro_layout_parentKeys: Array.from(new Set([].concat(transformRoute_toConsumableArray(item.parentKeys || []), transformRoute_toConsumableArray(pro_layout_parentKeys), ["/".concat(parent.key || '').replace(/\/\//g, '/').replace(/\/\//g, '/')]))).filter(function (key) {
        return key && key !== '/';
      })
    });

    if (localeName) {
      finallyItem.name = localeName;
    } else {
      delete finallyItem.name;
    }

    if (item.routes || item.children) {
      var formatterChildren = formatter(transformRoute_objectSpread(transformRoute_objectSpread({}, props), {}, {
        data: item.routes || item.children,
        parentName: locale || ''
      }), finallyItem); // Reduce memory usage

      finallyItem.children = formatterChildren && formatterChildren.length > 0 ? formatterChildren : undefined;

      if (!finallyItem.children) {
        delete finallyItem.children;
      }
    }

    return bigfishCompatibleConversions(finallyItem, props);
  }).flat(1);
}

var memoizeOneFormatter = memoize_one_esm(formatter, lodash_isequal_default.a);
/**
 * 删除 hideInMenu 和 item.name 不存在的
 */

var defaultFilterMenuData = function defaultFilterMenuData() {
  var menuData = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : [];
  return menuData.filter(function (item) {
    return item && (item.name || item.children) && !item.hideInMenu && !item.redirect;
  }).map(function (item) {
    if (item.children && Array.isArray(item.children) && !item.hideChildrenInMenu && item.children.some(function (child) {
      return child && !!child.name;
    })) {
      var children = defaultFilterMenuData(item.children);
      if (children.length) return transformRoute_objectSpread(transformRoute_objectSpread({}, item), {}, {
        children: children
      });
    }

    return transformRoute_objectSpread(transformRoute_objectSpread({}, item), {}, {
      children: undefined
    });
  }).filter(function (item) {
    return item;
  });
};
/**
 * support pathToRegexp get string
 */


var transformRoute_RoutesMap = /*#__PURE__*/function (_Map) {
  transformRoute_inherits(RoutesMap, _Map);

  var _super = transformRoute_createSuper(RoutesMap);

  function RoutesMap() {
    transformRoute_classCallCheck(this, RoutesMap);

    return _super.apply(this, arguments);
  }

  transformRoute_createClass(RoutesMap, [{
    key: "get",
    value: function get(pathname) {
      var routeValue;

      try {
        // eslint-disable-next-line no-restricted-syntax
        var _iterator = _createForOfIteratorHelper(this.entries()),
            _step;

        try {
          for (_iterator.s(); !(_step = _iterator.n()).done;) {
            var _step$value = transformRoute_slicedToArray(_step.value, 2),
                key = _step$value[0],
                value = _step$value[1];

            var path = stripQueryStringAndHashFromPath(key);

            if (!transformRoute_isUrl(key) && pathToRegexp(path, []).test(pathname)) {
              routeValue = value;
              break;
            }
          }
        } catch (err) {
          _iterator.e(err);
        } finally {
          _iterator.f();
        }
      } catch (error) {
        routeValue = undefined;
      }

      return routeValue;
    }
  }]);

  return RoutesMap;
}( /*#__PURE__*/_wrapNativeSuper(Map));
/**
 * 获取面包屑映射
 * @param MenuDataItem[] menuData 菜单配置
 */


var getBreadcrumbNameMap = function getBreadcrumbNameMap(menuData) {
  // Map is used to ensure the order of keys
  var routerMap = new transformRoute_RoutesMap();

  var flattenMenuData = function flattenMenuData(data, parent) {
    data.forEach(function (menuItem) {
      if (menuItem && menuItem.children) {
        flattenMenuData(menuItem.children, menuItem);
      } // Reduce memory usage


      var path = mergePath(menuItem.path, parent ? parent.path : '/');
      routerMap.set(stripQueryStringAndHashFromPath(path), menuItem);
    });
  };

  flattenMenuData(menuData);
  return routerMap;
};

var memoizeOneGetBreadcrumbNameMap = memoize_one_esm(getBreadcrumbNameMap, lodash_isequal_default.a);

var clearChildren = function clearChildren() {
  var menuData = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : [];
  return menuData.map(function (item) {
    if (item.children && Array.isArray(item.children) && item.children.length > 0) {
      var children = clearChildren(item.children);
      if (children.length) return transformRoute_objectSpread(transformRoute_objectSpread({}, item), {}, {
        children: children
      });
    }

    var finallyItem = transformRoute_objectSpread({}, item);

    delete finallyItem.children;
    return finallyItem;
  }).filter(function (item) {
    return item;
  });
};
/**
 * @param routes 路由配置
 * @param locale 是否使用国际化
 * @param formatMessage 国际化的程序
 * @param ignoreFilter 是否筛选掉不展示的 menuItem 项，plugin-layout需要所有项目来计算布局样式
 * @returns { breadcrumb, menuData}
 */


var transformRoute = function transformRoute(routes, locale, formatMessage, ignoreFilter) {
  var originalMenuData = memoizeOneFormatter({
    data: routes,
    formatMessage: formatMessage,
    locale: locale
  });
  var menuData = ignoreFilter ? clearChildren(originalMenuData) : defaultFilterMenuData(originalMenuData); // Map type used for internal logic

  var breadcrumb = memoizeOneGetBreadcrumbNameMap(originalMenuData);
  return {
    breadcrumb: breadcrumb,
    menuData: menuData
  };
};

/* harmony default export */ var transformRoute_transformRoute = (transformRoute);
// CONCATENATED MODULE: ./node_modules/@umijs/route-utils/es/getFlatMenus/getFlatMenus.js
function getFlatMenus_ownKeys(object, enumerableOnly) {
  var keys = Object.keys(object);

  if (Object.getOwnPropertySymbols) {
    var symbols = Object.getOwnPropertySymbols(object);
    if (enumerableOnly) symbols = symbols.filter(function (sym) {
      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
    });
    keys.push.apply(keys, symbols);
  }

  return keys;
}

function getFlatMenus_objectSpread(target) {
  for (var i = 1; i < arguments.length; i++) {
    var source = arguments[i] != null ? arguments[i] : {};

    if (i % 2) {
      getFlatMenus_ownKeys(Object(source), true).forEach(function (key) {
        getFlatMenus_defineProperty(target, key, source[key]);
      });
    } else if (Object.getOwnPropertyDescriptors) {
      Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
    } else {
      getFlatMenus_ownKeys(Object(source)).forEach(function (key) {
        Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
      });
    }
  }

  return target;
}

function getFlatMenus_defineProperty(obj, key, value) {
  if (key in obj) {
    Object.defineProperty(obj, key, {
      value: value,
      enumerable: true,
      configurable: true,
      writable: true
    });
  } else {
    obj[key] = value;
  }

  return obj;
}


/**
 * 获取打平的 menuData
 * 已 path 为 key
 * @param menuData
 */

var getFlatMenus_getFlatMenus = function getFlatMenus() {
  var menuData = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : [];
  var menus = {};
  menuData.forEach(function (item) {
    if (!item || !item.key) {
      return;
    }

    menus[stripQueryStringAndHashFromPath(item.path || item.key || '/')] = getFlatMenus_objectSpread({}, item);
    menus[item.key || item.path || '/'] = getFlatMenus_objectSpread({}, item);

    if (item.children) {
      menus = getFlatMenus_objectSpread(getFlatMenus_objectSpread({}, menus), getFlatMenus(item.children));
    }
  });
  return menus;
};
/* harmony default export */ var es_getFlatMenus_getFlatMenus = (getFlatMenus_getFlatMenus);
// CONCATENATED MODULE: ./node_modules/@umijs/route-utils/es/getMatchMenu/getMatchMenu.js



var getMatchMenu_getMenuMatches = function getMenuMatches() {
  var flatMenuKeys = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : [];
  var path = arguments.length > 1 ? arguments[1] : undefined;
  return flatMenuKeys.filter(function (item) {
    if (item === '/' && path === '/') {
      return true;
    }

    if (item !== '/' && item !== '/*' && item && !transformRoute_isUrl(item)) {
      var pathKey = stripQueryStringAndHashFromPath(item);

      try {
        // /a
        if (pathToRegexp("".concat(pathKey), []).test(path)) {
          return true;
        } // /a/b/b


        if (pathToRegexp("".concat(pathKey, "(.*)")).test(path)) {
          return true;
        }
      } catch (error) {// console.log(error, path);
      }
    }

    return false;
  }).sort(function (a, b) {
    // 如果完全匹配放到最后面
    if (a === path) {
      return 10;
    }

    if (b === path) {
      return -10;
    }

    return a.substr(1).split('/').length - b.substr(1).split('/').length;
  }).pop();
};
/**
 * 获取当前的选中菜单列表
 * @param pathname
 * @param menuData
 * @returns MenuDataItem[]
 */

var getMatchMenu_getMatchMenu = function getMatchMenu(pathname, menuData) {
  var flatMenus = es_getFlatMenus_getFlatMenus(menuData);
  var flatMenuKeys = Object.keys(flatMenus);
  var menuPathKey = getMatchMenu_getMenuMatches(flatMenuKeys, pathname || '/');

  if (!menuPathKey) {
    return [];
  }

  var menuItem = flatMenus[menuPathKey] || {
    pro_layout_parentKeys: '',
    key: ''
  }; // 去重

  var map = new Map();
  var parentItems = (menuItem.pro_layout_parentKeys || []).map(function (key) {
    if (map.has(key)) {
      return null;
    }

    map.set(key, true);
    return flatMenus[key];
  }).filter(function (item) {
    return item;
  });

  if (menuItem.key) {
    parentItems.push(menuItem);
  }

  return parentItems;
};
/* harmony default export */ var es_getMatchMenu_getMatchMenu = (getMatchMenu_getMatchMenu);
// CONCATENATED MODULE: ./node_modules/@umijs/route-utils/es/index.js



// CONCATENATED MODULE: ./packages/layout/src/SiderMenu/SiderMenuUtils.ts
 // 获取当前的选中菜单

var SiderMenuUtils_getSelectedMenuKeys = function getSelectedMenuKeys(pathname, menuData) {
  var menus = es_getMatchMenu_getMatchMenu(pathname, menuData);
  return menus.map(function (item) {
    return item.key || item.path || '';
  });
};
// CONCATENATED MODULE: ./packages/layout/src/utils/utils.ts
var getOpenKeysFromMenuData = function getOpenKeysFromMenuData(menuData) {
  if (!menuData) {
    return undefined;
  }

  return menuData.reduce(function (pre, item) {
    if (item.key) {
      pre.push(item.key);
    }

    if (item.children) {
      var newArray = pre.concat(getOpenKeysFromMenuData(item.children) || []);
      return newArray;
    }

    return pre;
  }, []);
};
var themeConfig = {
  daybreak: 'daybreak',
  '#1890ff': 'daybreak',
  '#F5222D': 'dust',
  '#FA541C': 'volcano',
  '#FAAD14': 'sunset',
  '#13C2C2': 'cyan',
  '#52C41A': 'green',
  '#2F54EB': 'geekblue',
  '#722ED1': 'purple'
};

var invertKeyValues = function invertKeyValues(obj) {
  return Object.keys(obj).reduce(function (acc, key) {
    acc[obj[key]] = key;
    return acc;
  }, {});
};
/**
 * #1890ff -> daybreak
 * @param val
 */


function genThemeToString(val) {
  return val && themeConfig[val] ? themeConfig[val] : val;
}
/**
 * daybreak-> #1890ff
 * @param val
 */

function genStringToTheme(val) {
  var stringConfig = invertKeyValues(themeConfig);
  return val && stringConfig[val] ? stringConfig[val] : val;
}
// CONCATENATED MODULE: ./node_modules/unstated-next/dist/unstated-next.mjs


function createContainer(useHook) {
  var Context = external_React_.createContext(null);

  function Provider(props) {
    var value = useHook(props.initialState);
    return external_React_.createElement(Context.Provider, {
      value: value
    }, props.children);
  }

  function useContainer() {
    var value = external_React_.useContext(Context);

    if (value === null) {
      throw new Error("Component must be wrapped with <Container.Provider>");
    }

    return value;
  }

  return {
    Provider: Provider,
    useContainer: useContainer
  };
}
function unstated_next_useContainer(container) {
  return container.useContainer();
}


//# sourceMappingURL=unstated-next.mjs.map

// CONCATENATED MODULE: ./packages/layout/src/SiderMenu/Counter.ts



function useMenuCounter() {
  var _useState = Object(external_React_["useState"])([]),
      flatMenuKeys = _useState[0],
      setFlatMenuKeys = _useState[1];

  return {
    flatMenuKeys: flatMenuKeys,
    setFlatMenuKeys: setFlatMenuKeys
  };
}

var MenuCounter = createContainer(useMenuCounter);
/* harmony default export */ var Counter = (MenuCounter);
// CONCATENATED MODULE: ./packages/layout/src/SiderMenu/BaseMenu.tsx
function _extends() { _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return _extends.apply(this, arguments); }

function BaseMenu_ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }

function BaseMenu_objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { BaseMenu_ownKeys(Object(source), true).forEach(function (key) { BaseMenu_defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { BaseMenu_ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }

function BaseMenu_defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }












var SubMenu = external_antd_["Menu"].SubMenu;
var IconFont = create({
  scriptUrl: src_defaultSettings.iconfontUrl
}); // Allow menu.js config icon as string or ReactNode
//   icon: 'setting',
//   icon: 'icon-geren' #For Iconfont ,
//   icon: 'http://demo.com/icon.png',
//   icon: '/favicon.png',
//   icon: <Icon type="setting" />,

var BaseMenu_getIcon = function getIcon(icon) {
  if (typeof icon === 'string' && icon !== '') {
    if (es_isUrl(icon) || es_isImg(icon)) {
      return /*#__PURE__*/external_React_default.a.createElement(components_Icon, {
        component: function component() {
          return /*#__PURE__*/external_React_default.a.createElement("img", {
            src: icon,
            alt: "icon",
            className: "ant-pro-sider-menu-icon"
          });
        }
      });
    }

    if (icon.startsWith('icon-')) {
      return /*#__PURE__*/external_React_default.a.createElement(IconFont, {
        type: icon
      });
    }
  }

  return icon;
};

var BaseMenu_MenuUtil = function MenuUtil(props) {
  var _this = this;

  this.props = void 0;

  this.getNavMenuItems = function (menusData, isChildren) {
    if (menusData === void 0) {
      menusData = [];
    }

    return menusData.filter(function (item) {
      return item.name && !item.hideInMenu;
    }).map(function (item) {
      return _this.getSubMenuOrItem(item, isChildren);
    }).filter(function (item) {
      return item;
    });
  };

  this.hasChildren = function (item) {
    return item && !item.hideChildrenInMenu && (item == null ? void 0 : item.children) && item.children.some(function (child) {
      return child && !!child.name && !child.hideInMenu;
    });
  };

  this.getSubMenuOrItem = function (item, isChildren) {
    if (Array.isArray(item.children) && _this.hasChildren(item)) {
      var name = _this.getIntlName(item);

      var _this$props = _this.props,
          subMenuItemRender = _this$props.subMenuItemRender,
          prefixCls = _this$props.prefixCls; //  get defaultTitle by menuItemRender

      var defaultTitle = item.icon ? /*#__PURE__*/external_React_default.a.createElement("span", {
        className: prefixCls + "-menu-item"
      }, !isChildren && BaseMenu_getIcon(item.icon), /*#__PURE__*/external_React_default.a.createElement("span", null, name)) : /*#__PURE__*/external_React_default.a.createElement("span", {
        className: prefixCls + "-menu-item"
      }, name); // subMenu only title render

      var title = subMenuItemRender ? subMenuItemRender(BaseMenu_objectSpread(BaseMenu_objectSpread({}, item), {}, {
        isUrl: false
      }), defaultTitle) : defaultTitle;
      return /*#__PURE__*/external_React_default.a.createElement(SubMenu, {
        title: title,
        key: item.key || item.path,
        onTitleClick: item.onTitleClick
      }, _this.getNavMenuItems(item.children, true));
    }

    return /*#__PURE__*/external_React_default.a.createElement(external_antd_["Menu"].Item, {
      key: item.key || item.path
    }, _this.getMenuItemPath(item, isChildren));
  };

  this.getIntlName = function (item) {
    var name = item.name,
        locale = item.locale;
    var _this$props2 = _this.props,
        _this$props2$menu = _this$props2.menu,
        menu = _this$props2$menu === void 0 ? {
      locale: false
    } : _this$props2$menu,
        formatMessage = _this$props2.formatMessage;

    if (locale && menu.locale !== false && formatMessage) {
      return formatMessage({
        id: locale,
        defaultMessage: name
      });
    }

    return name;
  };

  this.getMenuItemPath = function (item, isChildren) {
    var itemPath = _this.conversionPath(item.path || '/');

    var _this$props3 = _this.props,
        _this$props3$location = _this$props3.location,
        location = _this$props3$location === void 0 ? {
      pathname: '/'
    } : _this$props3$location,
        isMobile = _this$props3.isMobile,
        onCollapse = _this$props3.onCollapse,
        menuItemRender = _this$props3.menuItemRender;
    var target = item.target; // if local is true formatMessage all name。

    var name = _this.getIntlName(item);

    var prefixCls = _this.props.prefixCls;
    var icon = isChildren ? null : BaseMenu_getIcon(item.icon);
    var defaultItem = /*#__PURE__*/external_React_default.a.createElement("span", {
      className: prefixCls + "-menu-item"
    }, icon, /*#__PURE__*/external_React_default.a.createElement("span", {
      className: prefixCls + "-menu-item-title"
    }, name));
    var isHttpUrl = es_isUrl(itemPath); // Is it a http link

    if (isHttpUrl) {
      defaultItem = /*#__PURE__*/external_React_default.a.createElement("a", {
        href: itemPath,
        target: target
      }, icon, /*#__PURE__*/external_React_default.a.createElement("span", null, name));
    }

    if (menuItemRender) {
      var renderItemProps = BaseMenu_objectSpread(BaseMenu_objectSpread({}, item), {}, {
        isUrl: isHttpUrl,
        itemPath: itemPath,
        isMobile: isMobile,
        replace: itemPath === location.pathname,
        onClick: function onClick() {
          return onCollapse && onCollapse(true);
        }
      }); // 如果 hideChildrenInMenu 删除掉无用的 children


      if (!_this.hasChildren(item)) {
        delete renderItemProps.children;
      }

      return menuItemRender(renderItemProps, defaultItem);
    }

    return defaultItem;
  };

  this.conversionPath = function (path) {
    if (path && path.indexOf('http') === 0) {
      return path;
    }

    return ("/" + (path || '')).replace(/\/+/g, '/');
  };

  this.props = props;
};
/**
 * 生成openKeys 的对象，因为设置了openKeys 就会变成受控，所以需要一个空对象
 * @param BaseMenuProps
 */


var getOpenKeysProps = function getOpenKeysProps(openKeys, _ref) {
  if (openKeys === void 0) {
    openKeys = [];
  }

  var layout = _ref.layout,
      collapsed = _ref.collapsed;
  var openKeysProps = {};

  if (openKeys && !collapsed && ['side', 'mix'].includes(layout || 'mix')) {
    openKeysProps = {
      openKeys: openKeys
    };
  }

  return openKeysProps;
};

var BaseMenu_BaseMenu = function BaseMenu(props) {
  var theme = props.theme,
      mode = props.mode,
      _props$location = props.location,
      location = _props$location === void 0 ? {
    pathname: '/'
  } : _props$location,
      className = props.className,
      handleOpenChange = props.handleOpenChange,
      style = props.style,
      menuData = props.menuData,
      _props$menu = props.menu,
      menu = _props$menu === void 0 ? {
    locale: true
  } : _props$menu,
      iconfontUrl = props.iconfontUrl,
      splitMenus = props.splitMenus,
      collapsed = props.collapsed,
      propsSelectedKeys = props.selectedKeys,
      onSelect = props.onSelect,
      propsOpenKeys = props.openKeys;
  var openKeysRef = Object(external_React_["useRef"])([]); // 用于减少 defaultOpenKeys 计算的组件

  var defaultOpenKeysRef = Object(external_React_["useRef"])([]);

  var _useState = Object(external_React_["useState"])(function () {
    return menuData;
  }),
      postMenuData = _useState[0],
      setPostMenuData = _useState[1];

  var postMenuDataRef = Object(external_React_["useRef"])(postMenuData);
  var pathname = location.pathname;

  var _MenuCounter$useConta = Counter.useContainer(),
      flatMenuKeys = _MenuCounter$useConta.flatMenuKeys;

  var _useState2 = Object(external_React_["useState"])(menu.defaultOpenAll),
      defaultOpenAll = _useState2[0],
      setDefaultOpenAll = _useState2[1];

  var _useMergedState = useMergedState_default()(function () {
    if (menu.defaultOpenAll) {
      return getOpenKeysFromMenuData(menuData) || [];
    }

    if (propsOpenKeys === false) {
      return false;
    }

    return [];
  }, {
    value: propsOpenKeys === false ? undefined : propsOpenKeys,
    onChange: handleOpenChange
  }),
      openKeys = _useMergedState[0],
      setOpenKeys = _useMergedState[1];

  var _useMergedState2 = useMergedState_default()([], {
    value: propsSelectedKeys,
    onChange: onSelect ? function (keys) {
      if (onSelect && keys) {
        onSelect(keys);
      }
    } : undefined
  }),
      selectedKeys = _useMergedState2[0],
      setSelectedKeys = _useMergedState2[1];

  Object(external_React_["useEffect"])(function () {
    if (menu.defaultOpenAll || propsOpenKeys === false || flatMenuKeys.length) {
      return;
    }

    var keys = SiderMenuUtils_getSelectedMenuKeys(location.pathname || '/', postMenuDataRef.current || []);

    if (keys) {
      openKeysRef.current = keys;
      setOpenKeys(keys);
      setSelectedKeys(keys);
    }
  }, [flatMenuKeys.join('-')]);
  Object(external_React_["useEffect"])(function () {
    // reset IconFont
    if (iconfontUrl) {
      IconFont = create({
        scriptUrl: iconfontUrl
      });
    }
  }, [iconfontUrl]);
  Object(external_React_["useEffect"])(function () {
    // if pathname can't match, use the nearest parent's key
    var keys = SiderMenuUtils_getSelectedMenuKeys(location.pathname || '/', postMenuDataRef.current || []);
    var animationFrameId = requestAnimationFrame(function () {
      if (keys.join('-') !== (selectedKeys || []).join('-')) {
        setSelectedKeys(keys);
      }

      if (!defaultOpenAll && propsOpenKeys !== false && keys.join('-') !== (openKeysRef.current || []).join('-')) {
        setOpenKeys(keys);
        openKeysRef.current = keys;
      } else if (flatMenuKeys.length > 0) {
        setDefaultOpenAll(false);
      }
    });
    return function () {
      return window.cancelAnimationFrame && window.cancelAnimationFrame(animationFrameId);
    };
  }, [pathname, collapsed]);
  var openKeysProps = Object(external_React_["useMemo"])(function () {
    return getOpenKeysProps(openKeys, props);
  }, [openKeys && openKeys.join(','), props.layout, props.collapsed]);
  var cls = classnames_default()(className, {
    'top-nav-menu': mode === 'horizontal'
  });

  var _useState3 = Object(external_React_["useState"])(function () {
    return new BaseMenu_MenuUtil(props);
  }),
      menuUtils = _useState3[0]; // sync props


  menuUtils.props = props;
  /**
   * 这里需要用 menuData
   * 为了计算 splitMenus 需要用最全的 menuData
   */

  Object(external_React_["useEffect"])(function () {
    if (splitMenus && openKeys) {
      var keys = SiderMenuUtils_getSelectedMenuKeys(location.pathname || '/', menuData || []);
      var key = keys[0];

      if (key) {
        var _menuData$find;

        var postData = (menuData == null ? void 0 : (_menuData$find = menuData.find(function (item) {
          return item.key === key;
        })) == null ? void 0 : _menuData$find.children) || [];
        setPostMenuData(postData);
        return;
      }
    }

    setPostMenuData(menuData);
  }, [pathname, splitMenus, flatMenuKeys.join('-')]); // 这次 openKeys === false 的时候的情况，这种情况下帮用户选中一次
  // 第二次以后不再关系，所以用了 defaultOpenKeys

  if (props.openKeys === false && !props.handleOpenChange) {
    var keys = SiderMenuUtils_getSelectedMenuKeys(location.pathname || '/', menuData || []);
    defaultOpenKeysRef.current = keys;

    if (keys.length < 1) {
      return null;
    }
  }

  var finallyData = props.postMenuData ? props.postMenuData(postMenuData) : postMenuData;
  /**
   * 记下最新的 menuData
   */

  postMenuDataRef.current = finallyData;
  return /*#__PURE__*/external_React_default.a.createElement(external_antd_["Menu"], _extends({}, openKeysProps, {
    key: "Menu",
    mode: mode,
    defaultOpenKeys: defaultOpenKeysRef.current,
    theme: theme,
    inlineIndent: 16,
    selectedKeys: selectedKeys,
    style: style,
    className: cls,
    onOpenChange: function onOpenChange(keys) {
      openKeysRef.current = keys;
      setOpenKeys(keys);
    }
  }, props.menuProps), menuUtils.getNavMenuItems(finallyData, false));
};

BaseMenu_BaseMenu.defaultProps = {
  postMenuData: function postMenuData(data) {
    return data || [];
  }
};
/* harmony default export */ var SiderMenu_BaseMenu = (BaseMenu_BaseMenu);
// CONCATENATED MODULE: ./packages/layout/src/SiderMenu/SiderMenu.tsx
function SiderMenu_ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }

function SiderMenu_objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { SiderMenu_ownKeys(Object(source), true).forEach(function (key) { SiderMenu_defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { SiderMenu_ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }

function SiderMenu_defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }

function SiderMenu_extends() { SiderMenu_extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return SiderMenu_extends.apply(this, arguments); }








var Sider = external_antd_["Layout"].Sider;
var SiderMenu_defaultRenderLogo = function defaultRenderLogo(logo) {
  if (typeof logo === 'string') {
    return /*#__PURE__*/external_React_default.a.createElement("img", {
      src: logo,
      alt: "logo"
    });
  }

  if (typeof logo === 'function') {
    return logo();
  }

  return logo;
};
var SiderMenu_defaultRenderLogoAndTitle = function defaultRenderLogoAndTitle(props, renderKey) {
  if (renderKey === void 0) {
    renderKey = 'menuHeaderRender';
  }

  var _props$logo = props.logo,
      logo = _props$logo === void 0 ? 'https://gw.alipayobjects.com/zos/antfincdn/PmY%24TNNDBI/logo.svg' : _props$logo,
      title = props.title,
      layout = props.layout;
  var renderFunction = props[renderKey || ''];

  if (renderFunction === false) {
    return null;
  }

  var logoDom = SiderMenu_defaultRenderLogo(logo);
  var titleDom = /*#__PURE__*/external_React_default.a.createElement("h1", null, title);

  if (renderFunction) {
    // when collapsed, no render title
    return renderFunction(logoDom, props.collapsed ? null : titleDom, props);
  }

  if (layout === 'mix' && renderKey === 'menuHeaderRender') {
    return null;
  }

  return /*#__PURE__*/external_React_default.a.createElement("a", null, logoDom, props.collapsed ? null : titleDom);
};
var SiderMenu_defaultRenderCollapsedButton = function defaultRenderCollapsedButton(collapsed) {
  return collapsed ? /*#__PURE__*/external_React_default.a.createElement(icons_MenuUnfoldOutlined, null) : /*#__PURE__*/external_React_default.a.createElement(icons_MenuFoldOutlined, null);
};

var SiderMenu_SiderMenu = function SiderMenu(props) {
  var _classNames;

  var collapsed = props.collapsed,
      fixSiderbar = props.fixSiderbar,
      _onCollapse = props.onCollapse,
      theme = props.theme,
      _props$siderWidth = props.siderWidth,
      siderWidth = _props$siderWidth === void 0 ? 208 : _props$siderWidth,
      isMobile = props.isMobile,
      onMenuHeaderClick = props.onMenuHeaderClick,
      _props$breakpoint = props.breakpoint,
      breakpoint = _props$breakpoint === void 0 ? 'lg' : _props$breakpoint,
      style = props.style,
      layout = props.layout,
      _props$menuExtraRende = props.menuExtraRender,
      menuExtraRender = _props$menuExtraRende === void 0 ? false : _props$menuExtraRende,
      _props$collapsedButto = props.collapsedButtonRender,
      collapsedButtonRender = _props$collapsedButto === void 0 ? SiderMenu_defaultRenderCollapsedButton : _props$collapsedButto,
      links = props.links,
      menuContentRender = props.menuContentRender,
      _props$prefixCls = props.prefixCls,
      prefixCls = _props$prefixCls === void 0 ? 'ant-pro' : _props$prefixCls,
      onOpenChange = props.onOpenChange,
      headerHeight = props.headerHeight;
  var baseClassName = prefixCls + "-sider";

  var _MenuCounter$useConta = Counter.useContainer(),
      flatMenuKeys = _MenuCounter$useConta.flatMenuKeys;

  var siderClassName = classnames_default()("" + baseClassName, (_classNames = {}, _classNames[baseClassName + "-fixed"] = fixSiderbar, _classNames[baseClassName + "-layout-" + layout] = layout && !isMobile, _classNames[baseClassName + "-light"] = theme === 'light', _classNames));
  var headerDom = SiderMenu_defaultRenderLogoAndTitle(props);
  var extraDom = menuExtraRender && menuExtraRender(props);
  var menuDom = menuContentRender !== false && flatMenuKeys && /*#__PURE__*/external_React_default.a.createElement(SiderMenu_BaseMenu, SiderMenu_extends({}, props, {
    mode: "inline",
    handleOpenChange: onOpenChange,
    style: {
      width: '100%'
    },
    className: baseClassName + "-menu"
  }));
  return /*#__PURE__*/external_React_default.a.createElement(external_React_default.a.Fragment, null, fixSiderbar && /*#__PURE__*/external_React_default.a.createElement("div", {
    style: SiderMenu_objectSpread({
      width: collapsed ? 48 : siderWidth,
      overflow: 'hidden',
      flex: "0 0 " + (collapsed ? 48 : siderWidth) + "px",
      maxWidth: collapsed ? 48 : siderWidth,
      minWidth: collapsed ? 48 : siderWidth
    }, style)
  }), /*#__PURE__*/external_React_default.a.createElement(Sider, {
    collapsible: true,
    trigger: null,
    collapsed: collapsed,
    breakpoint: breakpoint === false ? undefined : breakpoint,
    onCollapse: function onCollapse(collapse) {
      if (!isMobile) {
        if (_onCollapse) {
          _onCollapse(collapse);
        }
      }
    },
    collapsedWidth: 48,
    style: SiderMenu_objectSpread({
      overflow: 'hidden',
      paddingTop: layout === 'mix' ? headerHeight : undefined
    }, style),
    width: siderWidth,
    theme: theme,
    className: siderClassName
  }, headerDom && /*#__PURE__*/external_React_default.a.createElement("div", {
    className: baseClassName + "-logo",
    onClick: onMenuHeaderClick,
    id: "logo"
  }, headerDom), extraDom && /*#__PURE__*/external_React_default.a.createElement("div", {
    className: baseClassName + "-extra " + (!headerDom && baseClassName + "-extra-no-logo")
  }, extraDom), /*#__PURE__*/external_React_default.a.createElement("div", {
    style: {
      flex: 1,
      overflowY: 'auto',
      overflowX: 'hidden'
    }
  }, menuContentRender ? menuContentRender(props, menuDom) : menuDom), /*#__PURE__*/external_React_default.a.createElement("div", {
    className: baseClassName + "-links"
  }, /*#__PURE__*/external_React_default.a.createElement(external_antd_["Menu"], {
    theme: theme,
    inlineIndent: 16,
    className: baseClassName + "-link-menu",
    selectedKeys: [],
    openKeys: [],
    mode: "inline"
  }, (links || []).map(function (node, index) {
    return (
      /*#__PURE__*/
      // eslint-disable-next-line react/no-array-index-key
      external_React_default.a.createElement(external_antd_["Menu"].Item, {
        className: baseClassName + "-link",
        key: index
      }, node)
    );
  }), collapsedButtonRender && !isMobile && /*#__PURE__*/external_React_default.a.createElement(external_antd_["Menu"].Item, {
    className: baseClassName + "-collapsed-button",
    title: false,
    onClick: function onClick() {
      if (_onCollapse) {
        _onCollapse(!collapsed);
      }
    }
  }, collapsedButtonRender(collapsed))))));
};

/* harmony default export */ var src_SiderMenu_SiderMenu = (SiderMenu_SiderMenu);
// CONCATENATED MODULE: ./node_modules/rc-resize-observer/es/index.js







function es_ownKeys(object, enumerableOnly) {
  var keys = Object.keys(object);

  if (Object.getOwnPropertySymbols) {
    var symbols = Object.getOwnPropertySymbols(object);
    if (enumerableOnly) symbols = symbols.filter(function (sym) {
      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
    });
    keys.push.apply(keys, symbols);
  }

  return keys;
}

function es_objectSpread(target) {
  for (var i = 1; i < arguments.length; i++) {
    var source = arguments[i] != null ? arguments[i] : {};

    if (i % 2) {
      es_ownKeys(Object(source), true).forEach(function (key) {
        Object(esm_defineProperty["a" /* default */])(target, key, source[key]);
      });
    } else if (Object.getOwnPropertyDescriptors) {
      Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
    } else {
      es_ownKeys(Object(source)).forEach(function (key) {
        Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
      });
    }
  }

  return target;
}

function es_createSuper(Derived) {
  var hasNativeReflectConstruct = es_isNativeReflectConstruct();

  return function _createSuperInternal() {
    var Super = Object(getPrototypeOf["a" /* default */])(Derived),
        result;

    if (hasNativeReflectConstruct) {
      var NewTarget = Object(getPrototypeOf["a" /* default */])(this).constructor;

      result = Reflect.construct(Super, arguments, NewTarget);
    } else {
      result = Super.apply(this, arguments);
    }

    return Object(possibleConstructorReturn["a" /* default */])(this, result);
  };
}

function es_isNativeReflectConstruct() {
  if (typeof Reflect === "undefined" || !Reflect.construct) return false;
  if (Reflect.construct.sham) return false;
  if (typeof Proxy === "function") return true;

  try {
    Date.prototype.toString.call(Reflect.construct(Date, [], function () {}));
    return true;
  } catch (e) {
    return false;
  }
}







var INTERNAL_PREFIX_KEY = 'rc-observer-key'; // Still need to be compatible with React 15, we use class component here

var es_ReactResizeObserver =
/** @class */
function () {
  var ReactResizeObserver = /*#__PURE__*/function (_React$Component) {
    Object(esm_inherits["a" /* default */])(ReactResizeObserver, _React$Component);

    var _super = es_createSuper(ReactResizeObserver);

    function ReactResizeObserver() {
      var _this;

      Object(esm_classCallCheck["a" /* default */])(this, ReactResizeObserver);

      _this = _super.apply(this, arguments);
      _this.resizeObserver = null;
      _this.childNode = null;
      _this.currentElement = null;
      _this.state = {
        width: 0,
        height: 0
      };

      _this.onResize = function (entries) {
        var onResize = _this.props.onResize;
        var target = entries[0].target;

        var _target$getBoundingCl = target.getBoundingClientRect(),
            width = _target$getBoundingCl.width,
            height = _target$getBoundingCl.height;

        var offsetWidth = target.offsetWidth,
            offsetHeight = target.offsetHeight;
        /**
         * Resize observer trigger when content size changed.
         * In most case we just care about element size,
         * let's use `boundary` instead of `contentRect` here to avoid shaking.
         */

        var fixedWidth = Math.floor(width);
        var fixedHeight = Math.floor(height);

        if (_this.state.width !== fixedWidth || _this.state.height !== fixedHeight) {
          var size = {
            width: fixedWidth,
            height: fixedHeight
          };

          _this.setState(size);

          if (onResize) {
            onResize(es_objectSpread(es_objectSpread({}, size), {}, {
              offsetWidth: offsetWidth,
              offsetHeight: offsetHeight
            }));
          }
        }
      };

      _this.setChildNode = function (node) {
        _this.childNode = node;
      };

      return _this;
    }

    Object(esm_createClass["a" /* default */])(ReactResizeObserver, [{
      key: "componentDidMount",
      value: function componentDidMount() {
        this.onComponentUpdated();
      }
    }, {
      key: "componentDidUpdate",
      value: function componentDidUpdate() {
        this.onComponentUpdated();
      }
    }, {
      key: "componentWillUnmount",
      value: function componentWillUnmount() {
        this.destroyObserver();
      }
    }, {
      key: "onComponentUpdated",
      value: function onComponentUpdated() {
        var disabled = this.props.disabled; // Unregister if disabled

        if (disabled) {
          this.destroyObserver();
          return;
        } // Unregister if element changed


        var element = findDOMNode(this.childNode || this);
        var elementChanged = element !== this.currentElement;

        if (elementChanged) {
          this.destroyObserver();
          this.currentElement = element;
        }

        if (!this.resizeObserver && element) {
          this.resizeObserver = new ResizeObserver_es["a" /* default */](this.onResize);
          this.resizeObserver.observe(element);
        }
      }
    }, {
      key: "destroyObserver",
      value: function destroyObserver() {
        if (this.resizeObserver) {
          this.resizeObserver.disconnect();
          this.resizeObserver = null;
        }
      }
    }, {
      key: "render",
      value: function render() {
        var children = this.props.children;
        var childNodes = Object(toArray["a" /* default */])(children);

        if (childNodes.length > 1) {
          Object(es_warning["a" /* default */])(false, 'Find more than one child node with `children` in ResizeObserver. Will only observe first one.');
        } else if (childNodes.length === 0) {
          Object(es_warning["a" /* default */])(false, '`children` of ResizeObserver is empty. Nothing is in observe.');
          return null;
        }

        var childNode = childNodes[0];

        if ( /*#__PURE__*/external_React_["isValidElement"](childNode) && supportRef(childNode)) {
          var ref = childNode.ref;
          childNodes[0] = /*#__PURE__*/external_React_["cloneElement"](childNode, {
            ref: composeRef(ref, this.setChildNode)
          });
        }

        return childNodes.length === 1 ? childNodes[0] : childNodes.map(function (node, index) {
          if (! /*#__PURE__*/external_React_["isValidElement"](node) || 'key' in node && node.key !== null) {
            return node;
          }

          return /*#__PURE__*/external_React_["cloneElement"](node, {
            key: "".concat(INTERNAL_PREFIX_KEY, "-").concat(index)
          });
        });
      }
    }]);

    return ReactResizeObserver;
  }(external_React_["Component"]);

  ReactResizeObserver.displayName = 'ResizeObserver';
  return ReactResizeObserver;
}();

/* harmony default export */ var rc_resize_observer_es = (es_ReactResizeObserver);
// EXTERNAL MODULE: ./packages/layout/src/TopNavHeader/index.less
var src_TopNavHeader = __webpack_require__(161);

// CONCATENATED MODULE: ./packages/layout/src/TopNavHeader/index.tsx
function TopNavHeader_extends() { TopNavHeader_extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return TopNavHeader_extends.apply(this, arguments); }

function TopNavHeader_ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }

function TopNavHeader_objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { TopNavHeader_ownKeys(Object(source), true).forEach(function (key) { TopNavHeader_defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { TopNavHeader_ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }

function TopNavHeader_defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }

function TopNavHeader_objectWithoutPropertiesLoose(source, excluded) { if (source == null) return {}; var target = {}; var sourceKeys = Object.keys(source); var key, i; for (i = 0; i < sourceKeys.length; i++) { key = sourceKeys[i]; if (excluded.indexOf(key) >= 0) continue; target[key] = source[key]; } return target; }








/**
 * 抽离出来是为了防止 rightSize 经常改变导致菜单 render
 * @param param0
 */
var TopNavHeader_RightContent = function RightContent(_ref) {
  var rightContentRender = _ref.rightContentRender,
      props = TopNavHeader_objectWithoutPropertiesLoose(_ref, ["rightContentRender"]);

  var _useState = Object(external_React_["useState"])('auto'),
      rightSize = _useState[0],
      setRightSize = _useState[1];

  return /*#__PURE__*/external_React_default.a.createElement("div", {
    style: {
      minWidth: rightSize
    }
  }, /*#__PURE__*/external_React_default.a.createElement("div", {
    style: {
      paddingRight: 8
    }
  }, /*#__PURE__*/external_React_default.a.createElement(rc_resize_observer_es, {
    onResize: function onResize(_ref2) {
      var width = _ref2.width;

      if (!width) {
        return;
      }

      setRightSize(width);
    }
  }, rightContentRender && /*#__PURE__*/external_React_default.a.createElement("div", null, rightContentRender(TopNavHeader_objectSpread({}, props))))));
};

var TopNavHeader_TopNavHeader = function TopNavHeader(props) {
  var ref = Object(external_React_["useRef"])(null);
  var theme = props.theme,
      onMenuHeaderClick = props.onMenuHeaderClick,
      contentWidth = props.contentWidth,
      rightContentRender = props.rightContentRender,
      propsClassName = props.className,
      style = props.style,
      layout = props.layout;
  var baseClassName = 'ant-pro-top-nav-header';
  var headerDom = SiderMenu_defaultRenderLogoAndTitle(TopNavHeader_objectSpread(TopNavHeader_objectSpread({}, props), {}, {
    collapsed: false
  }), layout === 'mix' ? 'headerTitleRender' : undefined);
  var className = classnames_default()(baseClassName, propsClassName, {
    light: theme === 'light'
  });
  return /*#__PURE__*/external_React_default.a.createElement("div", {
    className: className,
    style: style
  }, /*#__PURE__*/external_React_default.a.createElement("div", {
    ref: ref,
    className: baseClassName + "-main " + (contentWidth === 'Fixed' ? 'wide' : '')
  }, headerDom && /*#__PURE__*/external_React_default.a.createElement("div", {
    className: baseClassName + "-main-left",
    onClick: onMenuHeaderClick
  }, /*#__PURE__*/external_React_default.a.createElement("div", {
    className: baseClassName + "-logo",
    key: "logo",
    id: "logo"
  }, headerDom)), /*#__PURE__*/external_React_default.a.createElement("div", {
    style: {
      flex: 1
    },
    className: baseClassName + "-menu"
  }, /*#__PURE__*/external_React_default.a.createElement(SiderMenu_BaseMenu, TopNavHeader_extends({}, props, props.menuProps))), rightContentRender && /*#__PURE__*/external_React_default.a.createElement(TopNavHeader_RightContent, TopNavHeader_extends({
    rightContentRender: rightContentRender
  }, props))));
};

/* harmony default export */ var layout_src_TopNavHeader = (TopNavHeader_TopNavHeader);
// CONCATENATED MODULE: ./packages/layout/src/GlobalHeader/index.tsx
function GlobalHeader_extends() { GlobalHeader_extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return GlobalHeader_extends.apply(this, arguments); }

function GlobalHeader_ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }

function GlobalHeader_objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { GlobalHeader_ownKeys(Object(source), true).forEach(function (key) { GlobalHeader_defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { GlobalHeader_ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }

function GlobalHeader_defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }







var renderLogo = function renderLogo(menuHeaderRender, logoDom) {
  if (menuHeaderRender === false) {
    return null;
  }

  if (menuHeaderRender) {
    return menuHeaderRender(logoDom, null);
  }

  return logoDom;
};

var GlobalHeader_GlobalHeader = function GlobalHeader(props) {
  var _classNames;

  var isMobile = props.isMobile,
      logo = props.logo,
      collapsed = props.collapsed,
      onCollapse = props.onCollapse,
      _props$collapsedButto = props.collapsedButtonRender,
      collapsedButtonRender = _props$collapsedButto === void 0 ? SiderMenu_defaultRenderCollapsedButton : _props$collapsedButto,
      rightContentRender = props.rightContentRender,
      menuHeaderRender = props.menuHeaderRender,
      propClassName = props.className,
      style = props.style,
      layout = props.layout,
      children = props.children,
      splitMenus = props.splitMenus,
      menuData = props.menuData,
      prefixCls = props.prefixCls;
  var baseClassName = prefixCls + "-global-header";
  var className = classnames_default()(propClassName, baseClassName, (_classNames = {}, _classNames[baseClassName + "-layout-" + layout] = layout, _classNames));

  if (layout === 'mix' && !isMobile && splitMenus) {
    var noChildrenMenuData = (menuData || []).map(function (item) {
      return GlobalHeader_objectSpread(GlobalHeader_objectSpread({}, item), {}, {
        children: undefined
      });
    });
    return /*#__PURE__*/external_React_default.a.createElement(layout_src_TopNavHeader, GlobalHeader_extends({
      mode: "horizontal"
    }, props, {
      splitMenus: false,
      menuData: noChildrenMenuData,
      navTheme: "dark",
      theme: "dark"
    }));
  }

  var logoDom = /*#__PURE__*/external_React_default.a.createElement("span", {
    className: baseClassName + "-logo",
    key: "logo"
  }, /*#__PURE__*/external_React_default.a.createElement("a", null, SiderMenu_defaultRenderLogo(logo)));
  return /*#__PURE__*/external_React_default.a.createElement("div", {
    className: className,
    style: GlobalHeader_objectSpread({}, style)
  }, isMobile && renderLogo(menuHeaderRender, logoDom), isMobile && collapsedButtonRender && /*#__PURE__*/external_React_default.a.createElement("span", {
    className: baseClassName + "-collapsed-button",
    onClick: function onClick() {
      if (onCollapse) {
        onCollapse(!collapsed);
      }
    }
  }, collapsedButtonRender(collapsed)), layout === 'mix' && !isMobile && /*#__PURE__*/external_React_default.a.createElement(external_React_default.a.Fragment, null, /*#__PURE__*/external_React_default.a.createElement("div", {
    className: baseClassName + "-logo"
  }, SiderMenu_defaultRenderLogoAndTitle(GlobalHeader_objectSpread(GlobalHeader_objectSpread({}, props), {}, {
    collapsed: false
  }), 'headerTitleRender'))), /*#__PURE__*/external_React_default.a.createElement("div", {
    style: {
      flex: 1
    }
  }, children), rightContentRender && rightContentRender(props));
};

/* harmony default export */ var layout_src_GlobalHeader = (GlobalHeader_GlobalHeader);
// CONCATENATED MODULE: ./packages/layout/src/Header.tsx
function Header_ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }

function Header_objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { Header_ownKeys(Object(source), true).forEach(function (key) { Header_defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { Header_ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }

function Header_defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }

function Header_extends() { Header_extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return Header_extends.apply(this, arguments); }

function _inheritsLoose(subClass, superClass) { subClass.prototype = Object.create(superClass.prototype); subClass.prototype.constructor = subClass; subClass.__proto__ = superClass; }







var Header_Header = external_antd_["Layout"].Header;

var Header_HeaderView = /*#__PURE__*/function (_Component) {
  _inheritsLoose(HeaderView, _Component);

  function HeaderView() {
    var _this;

    for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
      args[_key] = arguments[_key];
    }

    _this = _Component.call.apply(_Component, [this].concat(args)) || this;

    _this.renderContent = function () {
      var _this$props = _this.props,
          isMobile = _this$props.isMobile,
          onCollapse = _this$props.onCollapse,
          navTheme = _this$props.navTheme,
          layout = _this$props.layout,
          headerRender = _this$props.headerRender,
          headerContentRender = _this$props.headerContentRender;
      var isTop = layout === 'top';
      var defaultDom = /*#__PURE__*/external_React_default.a.createElement(layout_src_GlobalHeader, Header_extends({
        onCollapse: onCollapse
      }, _this.props), headerContentRender && headerContentRender(_this.props));

      if (isTop && !isMobile) {
        defaultDom = /*#__PURE__*/external_React_default.a.createElement(layout_src_TopNavHeader, Header_extends({
          theme: navTheme,
          mode: "horizontal",
          onCollapse: onCollapse
        }, _this.props));
      }

      if (headerRender && typeof headerRender === 'function') {
        return headerRender(_this.props, defaultDom);
      }

      return defaultDom;
    };

    return _this;
  }

  var _proto = HeaderView.prototype;

  _proto.render = function render() {
    var _classNames;

    var _this$props2 = this.props,
        fixedHeader = _this$props2.fixedHeader,
        layout = _this$props2.layout,
        propsClassName = _this$props2.className,
        style = _this$props2.style,
        collapsed = _this$props2.collapsed,
        _this$props2$siderWid = _this$props2.siderWidth,
        siderWidth = _this$props2$siderWid === void 0 ? 208 : _this$props2$siderWid,
        hasSiderMenu = _this$props2.hasSiderMenu,
        headerRender = _this$props2.headerRender,
        isMobile = _this$props2.isMobile,
        prefixCls = _this$props2.prefixCls,
        headerHeight = _this$props2.headerHeight;
    var needFixedHeader = fixedHeader || layout === 'mix';
    var isTop = layout === 'top';
    var needSettingWidth = needFixedHeader && hasSiderMenu && !isTop && !isMobile;
    var className = classnames_default()(propsClassName, (_classNames = {}, _classNames[prefixCls + "-fixed-header"] = needFixedHeader, _classNames[prefixCls + "-top-menu"] = isTop, _classNames));

    if (headerRender === false) {
      return null;
    }

    var width = layout !== 'mix' && needSettingWidth ? "calc(100% - " + (collapsed ? 48 : siderWidth) + "px)" : '100%';
    var right = needFixedHeader ? 0 : undefined;
    return /*#__PURE__*/external_React_default.a.createElement(external_React_default.a.Fragment, null, needFixedHeader && /*#__PURE__*/external_React_default.a.createElement(Header_Header, {
      style: {
        height: headerHeight,
        lineHeight: headerHeight + "px",
        background: 'transparent'
      }
    }), /*#__PURE__*/external_React_default.a.createElement(Header_Header, {
      style: Header_objectSpread({
        padding: 0,
        height: headerHeight,
        lineHeight: headerHeight + "px",
        width: width,
        zIndex: layout === 'mix' ? 100 : 9,
        right: right
      }, style),
      className: className
    }, this.renderContent()));
  };

  return HeaderView;
}(external_React_["Component"]);

/* harmony default export */ var src_Header = (Header_HeaderView);
// EXTERNAL MODULE: ./packages/layout/node_modules/path-to-regexp/index.js
var path_to_regexp = __webpack_require__(39);
var path_to_regexp_default = /*#__PURE__*/__webpack_require__.n(path_to_regexp);

// CONCATENATED MODULE: ./packages/layout/src/getPageTitle.ts

var getPageTitle_matchParamsPath = function matchParamsPath(pathname, breadcrumb, breadcrumbMap) {
  // Internal logic use breadcrumbMap to ensure the order
  // 内部逻辑使用 breadcrumbMap 来确保查询顺序
  if (breadcrumbMap) {
    var pathKey = [].concat(breadcrumbMap.keys()).find(function (key) {
      return path_to_regexp_default()(key).test(pathname);
    });

    if (pathKey) {
      return breadcrumbMap.get(pathKey);
    }
  } // External uses use breadcrumb
  // 外部用户使用 breadcrumb 参数


  if (breadcrumb) {
    var _pathKey = Object.keys(breadcrumb).find(function (key) {
      return path_to_regexp_default()(key).test(pathname);
    });

    if (_pathKey) {
      return breadcrumb[_pathKey];
    }
  }

  return {
    path: ''
  };
};

var getPageTitle = function getPageTitle(props, ignoreTile) {
  var _props$pathname = props.pathname,
      pathname = _props$pathname === void 0 ? '/' : _props$pathname,
      breadcrumb = props.breadcrumb,
      breadcrumbMap = props.breadcrumbMap,
      formatMessage = props.formatMessage,
      _props$title = props.title,
      title = _props$title === void 0 ? 'Ant Design Pro' : _props$title,
      _props$menu = props.menu,
      menu = _props$menu === void 0 ? {
    locale: false
  } : _props$menu;
  var pageTitle = ignoreTile ? '' : title;

  if (!pathname) {
    return pageTitle;
  }

  var currRouterData = getPageTitle_matchParamsPath(pathname, breadcrumb, breadcrumbMap);

  if (!currRouterData) {
    return pageTitle;
  }

  var pageName = currRouterData.name;

  if (menu.locale !== false && currRouterData.locale && formatMessage) {
    pageName = formatMessage({
      id: currRouterData.locale || '',
      defaultMessage: currRouterData.name
    });
  }

  if (!pageName) {
    return pageTitle;
  }

  if (ignoreTile) {
    return pageName;
  }

  return pageName + " - " + title;
};
/**
 * 获取关于 pageTile 的所有信息方便包装
 * @param props
 * @param ignoreTile
 */


var getPageTitleInfo = function getPageTitleInfo(props, ignoreTile) {
  var _props$pathname2 = props.pathname,
      pathname = _props$pathname2 === void 0 ? '/' : _props$pathname2,
      breadcrumb = props.breadcrumb,
      breadcrumbMap = props.breadcrumbMap,
      formatMessage = props.formatMessage,
      _props$title2 = props.title,
      title = _props$title2 === void 0 ? 'Ant Design Pro' : _props$title2,
      _props$menu2 = props.menu,
      menu = _props$menu2 === void 0 ? {
    locale: false
  } : _props$menu2;
  var pageTitle = ignoreTile ? '' : title;

  if (!pathname) {
    return {
      title: pageTitle,
      id: '',
      pageName: pageTitle
    };
  }

  var currRouterData = getPageTitle_matchParamsPath(pathname, breadcrumb, breadcrumbMap);

  if (!currRouterData) {
    return {
      title: pageTitle,
      id: '',
      pageName: pageTitle
    };
  }

  var pageName = currRouterData.name;

  if (menu.locale !== false && currRouterData.locale && formatMessage) {
    pageName = formatMessage({
      id: currRouterData.locale || '',
      defaultMessage: currRouterData.name
    });
  }

  if (!pageName) {
    return {
      title: pageTitle,
      id: currRouterData.locale || '',
      pageName: pageTitle
    };
  }

  if (ignoreTile) {
    return {
      title: pageName,
      id: currRouterData.locale || '',
      pageName: pageName
    };
  }

  return {
    title: pageName + " - " + title,
    id: currRouterData.locale || '',
    pageName: pageName
  };
};


/* harmony default export */ var src_getPageTitle = (getPageTitle);
// CONCATENATED MODULE: ./packages/layout/src/locales/zh-CN/settingDrawer.ts
/* harmony default export */ var settingDrawer = ({
  'app.setting.pagestyle': '整体风格设置',
  'app.setting.pagestyle.dark': '暗色菜单风格',
  'app.setting.pagestyle.light': '亮色菜单风格',
  'app.setting.content-width': '内容区域宽度',
  'app.setting.content-width.fixed': '定宽',
  'app.setting.content-width.fluid': '流式',
  'app.setting.themecolor': '主题色',
  'app.setting.themecolor.dust': '薄暮',
  'app.setting.themecolor.volcano': '火山',
  'app.setting.themecolor.sunset': '日暮',
  'app.setting.themecolor.cyan': '明青',
  'app.setting.themecolor.green': '极光绿',
  'app.setting.themecolor.daybreak': '拂晓蓝（默认）',
  'app.setting.themecolor.geekblue': '极客蓝',
  'app.setting.themecolor.purple': '酱紫',
  'app.setting.navigationmode': '导航模式',
  'app.setting.regionalsettings': '内容区域',
  'app.setting.regionalsettings.header': '顶栏',
  'app.setting.regionalsettings.menu': '菜单',
  'app.setting.regionalsettings.footer': '页脚',
  'app.setting.regionalsettings.menuHeader': '菜单头',
  'app.setting.sidemenu': '侧边菜单布局',
  'app.setting.topmenu': '顶部菜单布局',
  'app.setting.mixmenu': '混合菜单布局',
  'app.setting.splitMenus': '自动分割菜单',
  'app.setting.fixedheader': '固定 Header',
  'app.setting.fixedsidebar': '固定侧边菜单',
  'app.setting.fixedsidebar.hint': '侧边菜单布局时可配置',
  'app.setting.hideheader': '下滑时隐藏 Header',
  'app.setting.hideheader.hint': '固定 Header 时可配置',
  'app.setting.othersettings': '其他设置',
  'app.setting.weakmode': '色弱模式',
  'app.setting.copy': '拷贝设置',
  'app.setting.loading': '正在加载主题',
  'app.setting.copyinfo': '拷贝成功，请到 src/defaultSettings.js 中替换默认配置',
  'app.setting.production.hint': '配置栏只在开发环境用于预览，生产环境不会展现，请拷贝后手动修改配置文件'
});
// CONCATENATED MODULE: ./packages/layout/src/locales/zh-CN.ts
function zh_CN_ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }

function zh_CN_objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { zh_CN_ownKeys(Object(source), true).forEach(function (key) { zh_CN_defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { zh_CN_ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }

function zh_CN_defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }


/* harmony default export */ var zh_CN = (zh_CN_objectSpread({}, settingDrawer));
// CONCATENATED MODULE: ./packages/layout/src/locales/zh-TW/settingDrawer.ts
/* harmony default export */ var zh_TW_settingDrawer = ({
  'app.setting.pagestyle': '整體風格設置',
  'app.setting.pagestyle.dark': '暗色菜單風格',
  'app.setting.pagestyle.light': '亮色菜單風格',
  'app.setting.content-width': '內容區域寬度',
  'app.setting.content-width.fixed': '定寬',
  'app.setting.content-width.fluid': '流式',
  'app.setting.themecolor': '主題色',
  'app.setting.themecolor.dust': '薄暮',
  'app.setting.themecolor.volcano': '火山',
  'app.setting.themecolor.sunset': '日暮',
  'app.setting.themecolor.cyan': '明青',
  'app.setting.themecolor.green': '極光綠',
  'app.setting.themecolor.daybreak': '拂曉藍（默認）',
  'app.setting.themecolor.geekblue': '極客藍',
  'app.setting.themecolor.purple': '醬紫',
  'app.setting.navigationmode': '導航模式',
  'app.setting.sidemenu': '側邊菜單布局',
  'app.setting.topmenu': '頂部菜單布局',
  'app.setting.mixmenu': '混合菜單布局',
  'app.setting.splitMenus': '自动分割菜单',
  'app.setting.fixedheader': '固定 Header',
  'app.setting.fixedsidebar': '固定側邊菜單',
  'app.setting.fixedsidebar.hint': '側邊菜單布局時可配置',
  'app.setting.hideheader': '下滑時隱藏 Header',
  'app.setting.hideheader.hint': '固定 Header 時可配置',
  'app.setting.othersettings': '其他設置',
  'app.setting.weakmode': '色弱模式',
  'app.setting.copy': '拷貝設置',
  'app.setting.loading': '正在加載主題',
  'app.setting.copyinfo': '拷貝成功，請到 src/defaultSettings.js 中替換默認配置',
  'app.setting.production.hint': '配置欄只在開發環境用於預覽，生產環境不會展現，請拷貝後手動修改配置文件'
});
// CONCATENATED MODULE: ./packages/layout/src/locales/zh-TW.ts
function zh_TW_ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }

function zh_TW_objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { zh_TW_ownKeys(Object(source), true).forEach(function (key) { zh_TW_defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { zh_TW_ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }

function zh_TW_defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }


/* harmony default export */ var zh_TW = (zh_TW_objectSpread({}, zh_TW_settingDrawer));
// CONCATENATED MODULE: ./packages/layout/src/locales/en-US/settingDrawer.ts
/* harmony default export */ var en_US_settingDrawer = ({
  'app.setting.pagestyle': 'Page style setting',
  'app.setting.pagestyle.dark': 'Dark style',
  'app.setting.pagestyle.light': 'Light style',
  'app.setting.content-width': 'Content Width',
  'app.setting.content-width.fixed': 'Fixed',
  'app.setting.content-width.fluid': 'Fluid',
  'app.setting.themecolor': 'Theme Color',
  'app.setting.themecolor.dust': 'Dust Red',
  'app.setting.themecolor.volcano': 'Volcano',
  'app.setting.themecolor.sunset': 'Sunset Orange',
  'app.setting.themecolor.cyan': 'Cyan',
  'app.setting.themecolor.green': 'Polar Green',
  'app.setting.themecolor.daybreak': 'Daybreak Blue (default)',
  'app.setting.themecolor.geekblue': 'Geek Blue',
  'app.setting.themecolor.purple': 'Golden Purple',
  'app.setting.navigationmode': 'Navigation Mode',
  'app.setting.regionalsettings': 'Regional Settings',
  'app.setting.regionalsettings.header': 'Header',
  'app.setting.regionalsettings.menu': 'Menu',
  'app.setting.regionalsettings.footer': 'Footer',
  'app.setting.regionalsettings.menuHeader': 'Menu Header',
  'app.setting.sidemenu': 'Side Menu Layout',
  'app.setting.topmenu': 'Top Menu Layout',
  'app.setting.mixmenu': 'Mix Menu Layout',
  'app.setting.splitMenus': 'Split Menus',
  'app.setting.fixedheader': 'Fixed Header',
  'app.setting.fixedsidebar': 'Fixed Sidebar',
  'app.setting.fixedsidebar.hint': 'Works on Side Menu Layout',
  'app.setting.hideheader': 'Hidden Header when scrolling',
  'app.setting.hideheader.hint': 'Works when Hidden Header is enabled',
  'app.setting.othersettings': 'Other Settings',
  'app.setting.weakmode': 'Weak Mode',
  'app.setting.copy': 'Copy Setting',
  'app.setting.loading': 'Loading theme',
  'app.setting.copyinfo': 'copy success，please replace defaultSettings in src/models/setting.js',
  'app.setting.production.hint': 'Setting panel shows in development environment only, please manually modify'
});
// CONCATENATED MODULE: ./packages/layout/src/locales/en-US.ts
function en_US_ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }

function en_US_objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { en_US_ownKeys(Object(source), true).forEach(function (key) { en_US_defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { en_US_ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }

function en_US_defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }


/* harmony default export */ var locales_en_US = (en_US_objectSpread({}, en_US_settingDrawer));
// CONCATENATED MODULE: ./packages/layout/src/locales/it-IT/settingDrawer.ts
/* harmony default export */ var it_IT_settingDrawer = ({
  'app.setting.pagestyle': 'Impostazioni di stile',
  'app.setting.pagestyle.dark': 'Tema scuro',
  'app.setting.pagestyle.light': 'Tema chiaro',
  'app.setting.content-width': 'Largezza contenuto',
  'app.setting.content-width.fixed': 'Fissa',
  'app.setting.content-width.fluid': 'Fluida',
  'app.setting.themecolor': 'Colore del tema',
  'app.setting.themecolor.dust': 'Rosso polvere',
  'app.setting.themecolor.volcano': 'Vulcano',
  'app.setting.themecolor.sunset': 'Arancione tramonto',
  'app.setting.themecolor.cyan': 'Ciano',
  'app.setting.themecolor.green': 'Verde polare',
  'app.setting.themecolor.daybreak': 'Blu cielo mattutino (default)',
  'app.setting.themecolor.geekblue': 'Blu geek',
  'app.setting.themecolor.purple': 'Viola dorato',
  'app.setting.navigationmode': 'Modalità di navigazione',
  'app.setting.sidemenu': 'Menu laterale',
  'app.setting.topmenu': 'Menu in testata',
  'app.setting.mixmenu': 'Menu misto',
  'app.setting.splitMenus': 'Menu divisi',
  'app.setting.fixedheader': 'Testata fissa',
  'app.setting.fixedsidebar': 'Menu laterale fisso',
  'app.setting.fixedsidebar.hint': 'Solo se selezionato Menu laterale',
  'app.setting.hideheader': 'Nascondi testata durante lo scorrimento',
  'app.setting.hideheader.hint': 'Solo se abilitato Nascondi testata durante lo scorrimento',
  'app.setting.othersettings': 'Altre impostazioni',
  'app.setting.weakmode': 'Inverti colori',
  'app.setting.copy': 'Copia impostazioni',
  'app.setting.loading': 'Carico tema...',
  'app.setting.copyinfo': 'Impostazioni copiate con successo! Incolla il contenuto in config/defaultSettings.js',
  'app.setting.production.hint': 'Questo pannello è visibile solo durante lo sviluppo. Le impostazioni devono poi essere modificate manulamente'
});
// CONCATENATED MODULE: ./packages/layout/src/locales/it-IT.ts
function it_IT_ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }

function it_IT_objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { it_IT_ownKeys(Object(source), true).forEach(function (key) { it_IT_defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { it_IT_ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }

function it_IT_defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }


/* harmony default export */ var it_IT = (it_IT_objectSpread({}, it_IT_settingDrawer));
// CONCATENATED MODULE: ./packages/layout/src/locales/index.ts





var locales_locales = {
  'zh-CN': zh_CN,
  'zh-TW': zh_TW,
  'en-US': locales_en_US,
  'it-IT': it_IT
};

var locales_getLanguage = function getLanguage() {
  var lang; // support ssr

  if (!Object(isBrowser["a" /* default */])()) {
    return lang || '';
  }

  lang = window.localStorage.getItem('umi_locale');
  return lang || window.g_locale || navigator.language;
};


/* harmony default export */ var src_locales = (function (locale) {
  if (locale) {
    return locales_locales[locale];
  }

  var gLocale = locales_getLanguage();

  if (locales_locales[gLocale]) {
    return locales_locales[gLocale];
  }

  return locales_locales['zh-CN'];
});
// CONCATENATED MODULE: ./node_modules/@ant-design/icons-svg/es/asn/GithubOutlined.js
// This icon file is generated automatically.
var GithubOutlined_GithubOutlined = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "64 64 896 896",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M511.6 76.3C264.3 76.2 64 276.4 64 523.5 64 718.9 189.3 885 363.8 946c23.5 5.9 19.9-10.8 19.9-22.2v-77.5c-135.7 15.9-141.2-73.9-150.3-88.9C215 726 171.5 718 184.5 703c30.9-15.9 62.4 4 98.9 57.9 26.4 39.1 77.9 32.5 104 26 5.7-23.5 17.9-44.5 34.7-60.8-140.6-25.2-199.2-111-199.2-213 0-49.5 16.3-95 48.3-131.7-20.4-60.5 1.9-112.3 4.9-120 58.1-5.2 118.5 41.6 123.2 45.3 33-8.9 70.7-13.6 112.9-13.6 42.4 0 80.2 4.9 113.5 13.9 11.3-8.6 67.3-48.8 121.3-43.9 2.9 7.7 24.7 58.3 5.5 118 32.4 36.8 48.9 82.7 48.9 132.3 0 102.2-59 188.1-200 212.9a127.5 127.5 0 0138.1 91v112.5c.8 9 0 17.9 15 17.9 177.1-59.7 304.6-227 304.6-424.1 0-247.2-200.4-447.3-447.5-447.3z"
      }
    }]
  },
  "name": "github",
  "theme": "outlined"
};
/* harmony default export */ var asn_GithubOutlined = (GithubOutlined_GithubOutlined);
// CONCATENATED MODULE: ./node_modules/@ant-design/icons/es/icons/GithubOutlined.js
// GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY




var icons_GithubOutlined_GithubOutlined = function GithubOutlined(props, ref) {
  return /*#__PURE__*/external_React_["createElement"](AntdIcon, Object.assign({}, props, {
    ref: ref,
    icon: asn_GithubOutlined
  }));
};

icons_GithubOutlined_GithubOutlined.displayName = 'GithubOutlined';
/* harmony default export */ var icons_GithubOutlined = (/*#__PURE__*/external_React_["forwardRef"](icons_GithubOutlined_GithubOutlined));
// CONCATENATED MODULE: ./node_modules/@ant-design/icons-svg/es/asn/CopyrightOutlined.js
// This icon file is generated automatically.
var CopyrightOutlined_CopyrightOutlined = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "64 64 896 896",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M512 64C264.6 64 64 264.6 64 512s200.6 448 448 448 448-200.6 448-448S759.4 64 512 64zm0 820c-205.4 0-372-166.6-372-372s166.6-372 372-372 372 166.6 372 372-166.6 372-372 372zm5.6-532.7c53 0 89 33.8 93 83.4.3 4.2 3.8 7.4 8 7.4h56.7c2.6 0 4.7-2.1 4.7-4.7 0-86.7-68.4-147.4-162.7-147.4C407.4 290 344 364.2 344 486.8v52.3C344 660.8 407.4 734 517.3 734c94 0 162.7-58.8 162.7-141.4 0-2.6-2.1-4.7-4.7-4.7h-56.8c-4.2 0-7.6 3.2-8 7.3-4.2 46.1-40.1 77.8-93 77.8-65.3 0-102.1-47.9-102.1-133.6v-52.6c.1-87 37-135.5 102.2-135.5z"
      }
    }]
  },
  "name": "copyright",
  "theme": "outlined"
};
/* harmony default export */ var asn_CopyrightOutlined = (CopyrightOutlined_CopyrightOutlined);
// CONCATENATED MODULE: ./node_modules/@ant-design/icons/es/icons/CopyrightOutlined.js
// GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY




var icons_CopyrightOutlined_CopyrightOutlined = function CopyrightOutlined(props, ref) {
  return /*#__PURE__*/external_React_["createElement"](AntdIcon, Object.assign({}, props, {
    ref: ref,
    icon: asn_CopyrightOutlined
  }));
};

icons_CopyrightOutlined_CopyrightOutlined.displayName = 'CopyrightOutlined';
/* harmony default export */ var icons_CopyrightOutlined = (/*#__PURE__*/external_React_["forwardRef"](icons_CopyrightOutlined_CopyrightOutlined));
// EXTERNAL MODULE: ./packages/layout/src/GlobalFooter/index.less
var GlobalFooter = __webpack_require__(162);

// CONCATENATED MODULE: ./packages/layout/src/GlobalFooter/index.tsx



/* harmony default export */ var src_GlobalFooter = (function (_ref) {
  var className = _ref.className,
      _ref$prefixCls = _ref.prefixCls,
      prefixCls = _ref$prefixCls === void 0 ? 'ant-pro' : _ref$prefixCls,
      links = _ref.links,
      copyright = _ref.copyright,
      style = _ref.style;

  if ((links == null || links === false || Array.isArray(links) && links.length === 0) && (copyright == null || copyright === false)) {
    return null;
  }

  var baseClassName = prefixCls + "-global-footer";
  var clsString = classnames_default()(baseClassName, className);
  return /*#__PURE__*/external_React_default.a.createElement("footer", {
    className: clsString,
    style: style
  }, links && /*#__PURE__*/external_React_default.a.createElement("div", {
    className: baseClassName + "-links"
  }, links.map(function (link) {
    return /*#__PURE__*/external_React_default.a.createElement("a", {
      key: link.key,
      title: link.key,
      target: link.blankTarget ? '_blank' : '_self',
      href: link.href
    }, link.title);
  })), copyright && /*#__PURE__*/external_React_default.a.createElement("div", {
    className: baseClassName + "-copyright"
  }, copyright));
});
// CONCATENATED MODULE: ./packages/layout/src/Footer.tsx
function Footer_ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }

function Footer_objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { Footer_ownKeys(Object(source), true).forEach(function (key) { Footer_defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { Footer_ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }

function Footer_defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }





var Footer = external_antd_["Layout"].Footer;
var defaultLinks = [{
  key: 'Ant Design Pro',
  title: 'Ant Design Pro',
  href: 'https://pro.ant.design',
  blankTarget: true
}, {
  key: 'github',
  title: /*#__PURE__*/external_React_default.a.createElement(icons_GithubOutlined, null),
  href: 'https://github.com/ant-design/ant-design-pro',
  blankTarget: true
}, {
  key: 'Ant Design',
  title: 'Ant Design',
  href: 'https://ant.design',
  blankTarget: true
}];
var defaultCopyright = '2019 蚂蚁金服体验技术部出品';

var Footer_FooterView = function FooterView(_ref) {
  var links = _ref.links,
      copyright = _ref.copyright,
      style = _ref.style,
      className = _ref.className;
  return /*#__PURE__*/external_React_default.a.createElement(Footer, {
    className: className,
    style: Footer_objectSpread({
      padding: 0
    }, style)
  }, /*#__PURE__*/external_React_default.a.createElement(src_GlobalFooter, {
    links: links !== undefined ? links : defaultLinks,
    copyright: copyright === false ? null : /*#__PURE__*/external_React_default.a.createElement(external_React_["Fragment"], null, "Copyright ", /*#__PURE__*/external_React_default.a.createElement(icons_CopyrightOutlined, null), " ", copyright || defaultCopyright)
  }));
};

/* harmony default export */ var src_Footer = (Footer_FooterView);
// CONCATENATED MODULE: ./packages/layout/src/RouteContext.tsx

var routeContext = /*#__PURE__*/Object(external_React_["createContext"])({});
/* harmony default export */ var RouteContext = (routeContext);
// CONCATENATED MODULE: ./packages/layout/src/SiderMenu/index.tsx
function src_SiderMenu_extends() { src_SiderMenu_extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return src_SiderMenu_extends.apply(this, arguments); }

function src_SiderMenu_ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }

function src_SiderMenu_objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { src_SiderMenu_ownKeys(Object(source), true).forEach(function (key) { src_SiderMenu_defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { src_SiderMenu_ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }

function src_SiderMenu_defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }










var SiderMenu_SiderMenuWrapper = function SiderMenuWrapper(props) {
  var isMobile = props.isMobile,
      menuData = props.menuData,
      siderWidth = props.siderWidth,
      collapsed = props.collapsed,
      onCollapse = props.onCollapse,
      style = props.style,
      className = props.className,
      hide = props.hide,
      prefixCls = props.prefixCls;

  var _MenuCounter$useConta = Counter.useContainer(),
      setFlatMenuKeys = _MenuCounter$useConta.setFlatMenuKeys;

  hooks_useDeepCompareEffect(function () {
    if (!menuData || menuData.length < 1) {
      return function () {
        return null;
      };
    } // // 当 menu data 改变的时候重新计算这两个参数


    var newFlatMenus = es_getFlatMenus_getFlatMenus(menuData);
    var animationFrameId = requestAnimationFrame(function () {
      setFlatMenuKeys(Object.keys(newFlatMenus));
    });
    return function () {
      return window.cancelAnimationFrame && window.cancelAnimationFrame(animationFrameId);
    };
  }, [menuData]);
  Object(external_React_["useEffect"])(function () {
    if (isMobile === true) {
      if (onCollapse) {
        onCollapse(true);
      }
    }
  }, [isMobile]);
  var omitProps = omit_js_es(props, ['className', 'style']);

  if (hide) {
    return null;
  }

  return isMobile ? /*#__PURE__*/external_React_default.a.createElement(external_antd_["Drawer"], {
    visible: !collapsed,
    placement: "left",
    className: classnames_default()(prefixCls + "-drawer-sider", className),
    onClose: function onClose() {
      return onCollapse && onCollapse(true);
    },
    style: src_SiderMenu_objectSpread({
      padding: 0,
      height: '100vh'
    }, style),
    width: siderWidth,
    bodyStyle: {
      height: '100vh',
      padding: 0
    }
  }, /*#__PURE__*/external_React_default.a.createElement(src_SiderMenu_SiderMenu, src_SiderMenu_extends({}, omitProps, {
    className: classnames_default()(prefixCls + "-sider", className),
    collapsed: isMobile ? false : collapsed
  }))) : /*#__PURE__*/external_React_default.a.createElement(src_SiderMenu_SiderMenu, src_SiderMenu_extends({
    className: classnames_default()(prefixCls + "-sider", className)
  }, omitProps, {
    style: style
  }));
};

SiderMenu_SiderMenuWrapper.defaultProps = {
  onCollapse: function onCollapse() {
    return undefined;
  }
};
/* harmony default export */ var layout_src_SiderMenu = (SiderMenu_SiderMenuWrapper);
// CONCATENATED MODULE: ./packages/layout/src/utils/pathTools.ts
// /userInfo/2144/id => ['/userInfo','/userInfo/2144,'/userInfo/2144/id']
// eslint-disable-next-line import/prefer-default-export
function urlToList(url) {
  if (!url || url === '/') {
    return ['/'];
  }

  var urlList = url.split('/').filter(function (i) {
    return i;
  });
  return urlList.map(function (urlItem, index) {
    return "/" + urlList.slice(0, index + 1).join('/');
  });
}
// CONCATENATED MODULE: ./packages/layout/src/utils/getBreadcrumbProps.tsx





// 渲染Breadcrumb 子节点
// Render the Breadcrumb child node
var getBreadcrumbProps_defaultItemRender = function defaultItemRender(_ref) {
  var breadcrumbName = _ref.breadcrumbName,
      path = _ref.path;
  return /*#__PURE__*/external_React_default.a.createElement("a", {
    href: path
  }, breadcrumbName);
};

var renderItemLocal = function renderItemLocal(item, props) {
  var formatMessage = props.formatMessage,
      _props$menu = props.menu,
      menu = _props$menu === void 0 ? {
    locale: false
  } : _props$menu;

  if (item.locale && formatMessage && menu.locale !== false) {
    return formatMessage({
      id: item.locale,
      defaultMessage: item.name
    });
  }

  return item.name;
};

var getBreadcrumbProps_getBreadcrumb = function getBreadcrumb(breadcrumbMap, url) {
  if (!breadcrumbMap) {
    return {
      path: ''
    };
  }

  var breadcrumbItem = breadcrumbMap.get(url);

  if (!breadcrumbItem) {
    // Find the first matching path in the order defined by route config
    // 按照 route config 定义的顺序找到第一个匹配的路径
    var targetPath = [].concat(breadcrumbMap.keys()).find(function (path) {
      return (// remove ? ,不然会重复
        path_to_regexp_default()(path.replace('?', '')).test(url)
      );
    });

    if (targetPath) {
      breadcrumbItem = breadcrumbMap.get(targetPath);
    }
  }

  return breadcrumbItem || {
    path: ''
  };
};
var getBreadcrumbFromProps = function getBreadcrumbFromProps(props) {
  var location = props.location,
      breadcrumbMap = props.breadcrumbMap;
  return {
    location: location,
    breadcrumbMap: breadcrumbMap
  };
}; // Generated according to props

var getBreadcrumbProps_conversionFromProps = function conversionFromProps(props) {
  var _props$breadcrumbList = props.breadcrumbList,
      breadcrumbList = _props$breadcrumbList === void 0 ? [] : _props$breadcrumbList;
  return breadcrumbList.map(function (item) {
    var title = item.title,
        href = item.href; // For application that has configured router base
    // @ts-ignore

    var _ref2 = Object(isBrowser["a" /* default */])() ? window : {},
        _ref2$routerBase = _ref2.routerBase,
        routerBase = _ref2$routerBase === void 0 ? '/' : _ref2$routerBase;

    var realPath = routerBase === '/' ? href : "" + routerBase + href;
    return {
      path: realPath,
      breadcrumbName: title
    };
  }).filter(function (item) {
    return item.path;
  });
};

var getBreadcrumbProps_conversionFromLocation = function conversionFromLocation(routerLocation, breadcrumbMap, props) {
  if (routerLocation === void 0) {
    routerLocation = {
      pathname: '/'
    };
  }

  if (!routerLocation) {
    return [];
  } // Convertor the url to an array


  var pathSnippets = urlToList(routerLocation.pathname); // Loop data mosaic routing

  var extraBreadcrumbItems = pathSnippets.map(function (url) {
    // For application that has configured router base
    // @ts-ignore
    var _ref3 = Object(isBrowser["a" /* default */])() ? window : {},
        _ref3$routerBase = _ref3.routerBase,
        routerBase = _ref3$routerBase === void 0 ? '/' : _ref3$routerBase;

    var realPath = routerBase === '/' ? url : "" + routerBase + url;
    var currentBreadcrumb = getBreadcrumbProps_getBreadcrumb(breadcrumbMap, url);

    if (currentBreadcrumb.inherited) {
      return {
        path: '',
        breadcrumbName: ''
      };
    }

    var name = renderItemLocal(currentBreadcrumb, props);
    var hideInBreadcrumb = currentBreadcrumb.hideInBreadcrumb;
    return name && !hideInBreadcrumb ? {
      path: realPath,
      breadcrumbName: name,
      component: currentBreadcrumb.component
    } : {
      path: '',
      breadcrumbName: ''
    };
  }).filter(function (item) {
    return item && item.path;
  });
  return extraBreadcrumbItems;
};

/**
 * 将参数转化为面包屑
 * Convert parameters into breadcrumbs
 */
var genBreadcrumbProps = function genBreadcrumbProps(props) {
  var breadcrumbList = props.breadcrumbList;

  var _getBreadcrumbFromPro = getBreadcrumbFromProps(props),
      location = _getBreadcrumbFromPro.location,
      breadcrumbMap = _getBreadcrumbFromPro.breadcrumbMap;

  if (breadcrumbList && breadcrumbList.length) {
    return getBreadcrumbProps_conversionFromProps(props);
  } // 根据 location 生成 面包屑
  // Generate breadcrumbs based on location


  if (location && location.pathname && breadcrumbMap) {
    return getBreadcrumbProps_conversionFromLocation(location, breadcrumbMap, props);
  }

  return [];
}; // use breadcrumbRender to change routes

var getBreadcrumbProps = function getBreadcrumbProps(props) {
  var breadcrumbRender = props.breadcrumbRender,
      propsItemRender = props.itemRender;
  var routesArray = genBreadcrumbProps(props);
  var itemRender = propsItemRender || getBreadcrumbProps_defaultItemRender;
  var routes = routesArray; // if routes.length =1, don't show it

  if (breadcrumbRender) {
    routes = breadcrumbRender(routes) || [];
  }

  if (routes && routes.length < 2) {
    routes = undefined;
  }

  return {
    routes: routes,
    itemRender: itemRender
  };
};
// CONCATENATED MODULE: ./packages/layout/src/utils/getMenuData.ts


function fromEntries(iterable) {
  return [].concat(iterable).reduce(function (obj, _ref) {
    var key = _ref[0],
        val = _ref[1];
    // eslint-disable-next-line no-param-reassign
    obj[key] = val;
    return obj;
  }, {});
}

/* harmony default export */ var getMenuData = (function (routes, menu, formatMessage, menuDataRender) {
  var _transformRoute = transformRoute_transformRoute(routes, (menu == null ? void 0 : menu.locale) || false, formatMessage, true),
      menuData = _transformRoute.menuData,
      breadcrumb = _transformRoute.breadcrumb;

  if (!menuDataRender) {
    return {
      breadcrumb: fromEntries(breadcrumb),
      breadcrumbMap: breadcrumb,
      menuData: menuData
    };
  }

  var renderData = transformRoute_transformRoute(menuDataRender(menuData), (menu == null ? void 0 : menu.locale) || false, formatMessage, true);
  return {
    breadcrumb: fromEntries(renderData.breadcrumb),
    breadcrumbMap: renderData.breadcrumb,
    menuData: renderData.menuData
  };
});
// CONCATENATED MODULE: ./packages/layout/src/PageLoading/index.tsx



var PageLoading_PageLoading = function PageLoading(_ref) {
  var tip = _ref.tip;
  return /*#__PURE__*/external_React_default.a.createElement("div", {
    style: {
      paddingTop: 100,
      textAlign: 'center'
    }
  }, /*#__PURE__*/external_React_default.a.createElement(external_antd_["Spin"], {
    size: "large",
    tip: tip
  }));
};

/* harmony default export */ var src_PageLoading = (PageLoading_PageLoading);
// EXTERNAL MODULE: ./node_modules/rc-util/lib/warning.js
var lib_warning = __webpack_require__(36);

// CONCATENATED MODULE: ./packages/provider/es/locale/zh_CN.js
/* harmony default export */ var locale_zh_CN = ({
  moneySymbol: '￥',
  tableForm: {
    search: '查询',
    reset: '重置',
    submit: '提交',
    collapsed: '展开',
    expand: '收起',
    inputPlaceholder: '请输入',
    selectPlaceholder: '请选择'
  },
  alert: {
    clear: '清空',
    selected: '已选择',
    item: '项'
  },
  pagination: {
    total: {
      range: '第',
      total: '条/总共',
      item: '条'
    }
  },
  tableToolBar: {
    leftPin: '固定在列首',
    rightPin: '固定在列尾',
    noPin: '不固定',
    leftFixedTitle: '固定在左侧',
    rightFixedTitle: '固定在右侧',
    noFixedTitle: '不固定',
    reset: '重置',
    columnDisplay: '列展示',
    columnSetting: '列设置',
    fullScreen: '全屏',
    exitFullScreen: '退出全屏',
    reload: '刷新',
    density: '密度',
    densityDefault: '正常',
    densityLarger: '默认',
    densityMiddle: '中等',
    densitySmall: '紧凑'
  }
});
// CONCATENATED MODULE: ./packages/provider/es/locale/en_US.js
/* harmony default export */ var es_locale_en_US = ({
  moneySymbol: '$',
  tableForm: {
    search: 'Query',
    reset: 'Reset',
    submit: 'Submit',
    collapsed: 'Expand',
    expand: 'Collapse',
    inputPlaceholder: 'Please enter',
    selectPlaceholder: 'Please select'
  },
  alert: {
    clear: 'Clear',
    selected: 'Selected',
    item: 'Item'
  },
  pagination: {
    total: {
      range: ' ',
      total: 'of',
      item: 'items'
    }
  },
  tableToolBar: {
    leftPin: 'Pin to left',
    rightPin: 'Pin to right',
    noPin: 'Unpinned',
    leftFixedTitle: 'Fixed the left',
    rightFixedTitle: 'Fixed the right',
    noFixedTitle: 'Not Fixed',
    reset: 'Reset',
    columnDisplay: 'Column Display',
    columnSetting: 'Settings',
    fullScreen: 'Full Screen',
    exitFullScreen: 'Exit Full Screen',
    reload: 'Refresh',
    density: 'Density',
    densityDefault: 'Default',
    densityLarger: 'Larger',
    densityMiddle: 'Middle',
    densitySmall: 'Compact'
  }
});
// CONCATENATED MODULE: ./packages/provider/es/locale/vi_VN.js
/* harmony default export */ var vi_VN = ({
  moneySymbol: '₫',
  tableForm: {
    search: 'Tìm kiếm',
    reset: 'Làm lại',
    submit: 'Gửi đi',
    collapsed: 'Mở rộng',
    expand: 'Thu gọn',
    inputPlaceholder: 'nhập dữ liệu',
    selectPlaceholder: 'Vui lòng chọn'
  },
  alert: {
    clear: 'Xóa',
    selected: 'đã chọn',
    item: 'mục'
  },
  pagination: {
    total: {
      range: ' ',
      total: 'trên',
      item: 'mặt hàng'
    }
  },
  tableToolBar: {
    leftPin: 'Ghim trái',
    rightPin: 'Ghim phải',
    noPin: 'Bỏ ghim',
    leftFixedTitle: 'Cố định trái',
    rightFixedTitle: 'Cố định phải',
    noFixedTitle: 'Chưa cố định',
    reset: 'Làm lại',
    columnDisplay: 'Cột hiển thị',
    columnSetting: 'Cấu hình',
    fullScreen: 'Chế độ toàn màn hình',
    exitFullScreen: 'Thoát chế độ toàn màn hình',
    reload: 'Làm mới',
    density: 'Mật độ hiển thị',
    densityDefault: 'Mặc định',
    densityLarger: 'Mặc định',
    densityMiddle: 'Trung bình',
    densitySmall: 'Chật'
  }
});
// CONCATENATED MODULE: ./packages/provider/es/locale/it_IT.js
/* harmony default export */ var locale_it_IT = ({
  moneySymbol: '€',
  tableForm: {
    search: 'Filtra',
    reset: 'Pulisci',
    submit: 'Invia',
    collapsed: 'Espandi',
    expand: 'Contrai',
    inputPlaceholder: 'Digita',
    selectPlaceholder: 'Seleziona'
  },
  alert: {
    clear: 'Rimuovi',
    selected: 'Selezionati',
    item: 'elementi'
  },
  pagination: {
    total: {
      range: ' ',
      total: 'di',
      item: 'elementi'
    }
  },
  tableToolBar: {
    leftPin: 'Fissa a sinistra',
    rightPin: 'Fissa a destra',
    noPin: 'Ripristina posizione',
    leftFixedTitle: 'Fissato a sinistra',
    rightFixedTitle: 'Fissato a destra',
    noFixedTitle: 'Non fissato',
    reset: 'Ripristina',
    columnDisplay: 'Disposizione colonne',
    columnSetting: 'Impostazioni',
    fullScreen: 'Modalità schermo intero',
    exitFullScreen: 'Esci da modalità schermo intero',
    reload: 'Ricarica',
    density: 'Grandezza tabella',
    densityLarger: 'Grande',
    densityMiddle: 'Media',
    densitySmall: 'Compatta'
  }
});
// CONCATENATED MODULE: ./packages/provider/es/locale/es_ES.js
/* harmony default export */ var es_ES = ({
  moneySymbol: '€',
  tableForm: {
    search: 'Buscar',
    reset: 'Limpiar',
    submit: 'Submit',
    collapsed: 'Expandir',
    expand: 'Colapsar',
    inputPlaceholder: 'Ingrese valor',
    selectPlaceholder: 'Seleccione valor'
  },
  alert: {
    clear: 'Limpiar',
    selected: 'Seleccionado',
    item: 'Articulo'
  },
  pagination: {
    total: {
      range: ' ',
      total: 'de',
      item: 'artículos'
    }
  },
  tableToolBar: {
    leftPin: 'Pin a la izquierda',
    rightPin: 'Pin a la derecha',
    noPin: 'Sin Pin',
    leftFixedTitle: 'Fijado a la izquierda',
    rightFixedTitle: 'Fijado a la derecha',
    noFixedTitle: 'Sin Fijar',
    reset: 'Reiniciar',
    columnDisplay: 'Mostrar Columna',
    columnSetting: 'Configuración',
    fullScreen: 'Pantalla Completa',
    exitFullScreen: 'Salir Pantalla Completa',
    reload: 'Refrescar',
    density: 'Densidad',
    densityDefault: 'Por Defecto',
    densityLarger: 'Largo',
    densityMiddle: 'Medio',
    densitySmall: 'Compacto'
  }
});
// CONCATENATED MODULE: ./packages/provider/es/locale/ja_JP.js
/* harmony default export */ var ja_JP = ({
  moneySymbol: '¥',
  tableForm: {
    search: '検索',
    reset: 'リセット',
    submit: '提交',
    collapsed: '展開',
    expand: '収納',
    inputPlaceholder: '入力してください',
    selectPlaceholder: '選択してください'
  },
  alert: {
    clear: 'クリア',
    selected: '選択した',
    item: '項目'
  },
  pagination: {
    total: {
      range: '記事',
      total: '/合計',
      item: ' '
    }
  },
  tableToolBar: {
    leftPin: '左に固定',
    rightPin: '右に固定',
    noPin: 'キャンセル',
    leftFixedTitle: '左に固定された項目',
    rightFixedTitle: '右に固定された項目',
    noFixedTitle: '固定されてない項目',
    reset: 'リセット',
    columnDisplay: '表示列',
    columnSetting: '列表示設定',
    fullScreen: 'フルスクリーン',
    exitFullScreen: '終了',
    reload: '更新',
    density: '行高',
    densityLarger: '默认',
    densityMiddle: '中',
    densitySmall: '小'
  }
});
// CONCATENATED MODULE: ./packages/provider/es/locale/ru_RU.js
/* harmony default export */ var ru_RU = ({
  moneySymbol: '₽',
  tableForm: {
    search: 'Найти',
    reset: 'Сброс',
    submit: 'Отправить',
    collapsed: 'Развернуть',
    expand: 'Свернуть',
    inputPlaceholder: 'Введите значение',
    selectPlaceholder: 'Выберите значение'
  },
  alert: {
    clear: 'Очистить',
    selected: 'выбранный',
    item: 'предмет'
  },
  pagination: {
    total: {
      range: ' ',
      total: 'из',
      item: 'предметов'
    }
  },
  tableToolBar: {
    leftPin: 'Закрепить слева',
    rightPin: 'Закрепить справа',
    noPin: 'Открепить',
    leftFixedTitle: 'Закреплено слева',
    rightFixedTitle: 'Закреплено справа',
    noFixedTitle: 'Не закреплено',
    reset: 'Сброс',
    columnDisplay: 'Отображение столбца',
    columnSetting: 'Настройки',
    fullScreen: 'Полный экран',
    exitFullScreen: 'Выйти из полноэкранного режима',
    reload: 'Обновить',
    density: 'Размер',
    densityDefault: 'По умолчанию',
    densityLarger: 'Большой',
    densityMiddle: 'Средний',
    densitySmall: 'Сжатый'
  }
});
// CONCATENATED MODULE: ./packages/provider/es/locale/ms_MY.js
/* harmony default export */ var ms_MY = ({
  moneySymbol: 'RM',
  tableForm: {
    search: 'Cari',
    reset: 'Menetapkan semula',
    submit: 'Hantar',
    collapsed: 'Kembang',
    expand: 'Kuncup',
    inputPlaceholder: 'Sila masuk',
    selectPlaceholder: 'Sila pilih'
  },
  alert: {
    clear: 'Padam',
    selected: 'Dipilih',
    item: 'Item'
  },
  pagination: {
    total: {
      range: ' ',
      total: 'daripada',
      item: 'item'
    }
  },
  tableToolBar: {
    leftPin: 'Pin ke kiri',
    rightPin: 'Pin ke kanan',
    noPin: 'Tidak pin',
    leftFixedTitle: 'Tetap ke kiri',
    rightFixedTitle: 'Tetap ke kanan',
    noFixedTitle: 'Tidak Tetap',
    reset: 'Menetapkan semula',
    columnDisplay: 'Lajur',
    columnSetting: 'Settings',
    fullScreen: 'Full Screen',
    exitFullScreen: 'Keluar Full Screen',
    reload: 'Muat Semula',
    density: 'Densiti',
    densityDefault: 'Biasa',
    densityLarger: 'Besar',
    densityMiddle: 'Tengah',
    densitySmall: 'Kecil'
  }
});
// CONCATENATED MODULE: ./packages/provider/es/locale/zh_TW.js
/* harmony default export */ var locale_zh_TW = ({
  moneySymbol: '￥',
  tableForm: {
    search: '查詢',
    reset: '重置',
    submit: '提交',
    collapsed: '展開',
    expand: '收起',
    inputPlaceholder: '請輸入',
    selectPlaceholder: '請選擇'
  },
  alert: {
    clear: '清空',
    selected: '已選擇',
    item: '項'
  },
  pagination: {
    total: {
      range: '第',
      total: '條/總共',
      item: '條'
    }
  },
  tableToolBar: {
    leftPin: '固定到左邊',
    rightPin: '固定到右邊',
    noPin: '不固定',
    leftFixedTitle: '固定在左側',
    rightFixedTitle: '固定在右側',
    noFixedTitle: '不固定',
    reset: '重置',
    columnDisplay: '列展示',
    columnSetting: '列設置',
    fullScreen: '全屏',
    exitFullScreen: '退出全屏',
    reload: '刷新',
    density: '密度',
    densityDefault: '正常',
    densityLarger: '默認',
    densityMiddle: '中等',
    densitySmall: '緊湊'
  }
});
// CONCATENATED MODULE: ./packages/provider/es/locale/fr_FR.js
/* harmony default export */ var fr_FR = ({
  moneySymbol: '€',
  tableForm: {
    search: 'Rechercher',
    reset: 'Réinitialiser',
    submit: 'Envoyer',
    collapsed: 'Agrandir',
    expand: 'Réduire',
    inputPlaceholder: 'Entrer une valeur',
    selectPlaceholder: 'Sélectionner une valeur'
  },
  alert: {
    clear: 'Réinitialiser',
    selected: 'Sélectionné',
    item: 'Item'
  },
  pagination: {
    total: {
      range: ' ',
      total: 'sur',
      item: 'éléments'
    }
  },
  tableToolBar: {
    leftPin: 'Épingler à gauche',
    rightPin: 'Épingler à gauche',
    noPin: 'Sans épingle',
    leftFixedTitle: 'Fixer à gauche',
    rightFixedTitle: 'Fixer à droite',
    noFixedTitle: 'Non fixé',
    reset: 'Réinitialiser',
    columnDisplay: 'Affichage colonne',
    columnSetting: 'Réglages',
    fullScreen: 'Plein écran',
    exitFullScreen: 'Quitter Plein écran',
    reload: 'Rafraichir',
    density: 'Densité',
    densityDefault: 'Par défaut',
    densityLarger: 'Larger',
    densityMiddle: 'Moyenne',
    densitySmall: 'Compacte'
  }
});
// CONCATENATED MODULE: ./packages/provider/es/locale/pt_BR.js
/* harmony default export */ var pt_BR = ({
  moneySymbol: 'R$',
  tableForm: {
    search: 'Filtrar',
    reset: 'Limpar',
    submit: 'Confirmar',
    collapsed: 'Expandir',
    expand: 'Colapsar',
    inputPlaceholder: 'Por favor insira',
    selectPlaceholder: 'Por favor selecione'
  },
  alert: {
    clear: 'Limpar',
    selected: 'Selecionado(s)',
    item: 'Item(s)'
  },
  pagination: {
    total: {
      range: ' ',
      total: 'de',
      item: 'items'
    }
  },
  tableToolBar: {
    leftPin: 'Fixar à esquerda',
    rightPin: 'Fixar à direita',
    noPin: 'Desfixado',
    leftFixedTitle: 'Fixado à esquerda',
    rightFixedTitle: 'Fixado à direita',
    noFixedTitle: 'Não fixado',
    reset: 'Limpar',
    columnDisplay: 'Mostrar Coluna',
    columnSetting: 'Configurações',
    fullScreen: 'Tela Cheia',
    exitFullScreen: 'Sair da Tela Cheia',
    reload: 'Atualizar',
    density: 'Densidade',
    densityDefault: 'Padrão',
    densityLarger: 'Largo',
    densityMiddle: 'Médio',
    densitySmall: 'Compacto'
  }
});
// CONCATENATED MODULE: ./packages/provider/es/index.js
function provider_es_ownKeys(object, enumerableOnly) {
  var keys = Object.keys(object);

  if (Object.getOwnPropertySymbols) {
    var symbols = Object.getOwnPropertySymbols(object);
    if (enumerableOnly) symbols = symbols.filter(function (sym) {
      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
    });
    keys.push.apply(keys, symbols);
  }

  return keys;
}

function provider_es_objectSpread(target) {
  for (var i = 1; i < arguments.length; i++) {
    var source = arguments[i] != null ? arguments[i] : {};

    if (i % 2) {
      provider_es_ownKeys(Object(source), true).forEach(function (key) {
        es_defineProperty(target, key, source[key]);
      });
    } else if (Object.getOwnPropertyDescriptors) {
      Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
    } else {
      provider_es_ownKeys(Object(source)).forEach(function (key) {
        Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
      });
    }
  }

  return target;
}

function es_defineProperty(obj, key, value) {
  if (key in obj) {
    Object.defineProperty(obj, key, {
      value: value,
      enumerable: true,
      configurable: true,
      writable: true
    });
  } else {
    obj[key] = value;
  }

  return obj;
}

function es_createForOfIteratorHelper(o, allowArrayLike) {
  var it;

  if (typeof Symbol === "undefined" || o[Symbol.iterator] == null) {
    if (Array.isArray(o) || (it = es_unsupportedIterableToArray(o)) || allowArrayLike && o && typeof o.length === "number") {
      if (it) o = it;
      var i = 0;

      var F = function F() {};

      return {
        s: F,
        n: function n() {
          if (i >= o.length) return {
            done: true
          };
          return {
            done: false,
            value: o[i++]
          };
        },
        e: function e(_e) {
          throw _e;
        },
        f: F
      };
    }

    throw new TypeError("Invalid attempt to iterate non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
  }

  var normalCompletion = true,
      didErr = false,
      err;
  return {
    s: function s() {
      it = o[Symbol.iterator]();
    },
    n: function n() {
      var step = it.next();
      normalCompletion = step.done;
      return step;
    },
    e: function e(_e2) {
      didErr = true;
      err = _e2;
    },
    f: function f() {
      try {
        if (!normalCompletion && it.return != null) it.return();
      } finally {
        if (didErr) throw err;
      }
    }
  };
}

function es_unsupportedIterableToArray(o, minLen) {
  if (!o) return;
  if (typeof o === "string") return es_arrayLikeToArray(o, minLen);
  var n = Object.prototype.toString.call(o).slice(8, -1);
  if (n === "Object" && o.constructor) n = o.constructor.name;
  if (n === "Map" || n === "Set") return Array.from(o);
  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return es_arrayLikeToArray(o, minLen);
}

function es_arrayLikeToArray(arr, len) {
  if (len == null || len > arr.length) len = arr.length;

  for (var i = 0, arr2 = new Array(len); i < len; i++) {
    arr2[i] = arr[i];
  }

  return arr2;
}















var getLang = function getLang() {
  var isNavigatorLanguageValid = typeof navigator !== 'undefined' && typeof navigator.language === 'string';
  var browserLang = isNavigatorLanguageValid ? navigator.language.split('-').join('{{BaseSeparator}}') : '';
  var lang = typeof localStorage !== 'undefined' ? window.localStorage.getItem('umi_locale') : '';
  return lang || browserLang || '';
};

function es_get(source, path, defaultValue) {
  // a[3].b -> a.3.b
  var paths = path.replace(/\[(\d+)\]/g, '.$1').split('.');
  var result = source;
  var message = defaultValue; // eslint-disable-next-line no-restricted-syntax

  var _iterator = es_createForOfIteratorHelper(paths),
      _step;

  try {
    for (_iterator.s(); !(_step = _iterator.n()).done;) {
      var p = _step.value;
      message = Object(result)[p];
      result = Object(result)[p];

      if (message === undefined) {
        return defaultValue;
      }
    }
  } catch (err) {
    _iterator.e(err);
  } finally {
    _iterator.f();
  }

  return message;
}
/**
 * 创建一个操作函数
 * @param locale
 * @param localeMap
 */


var createIntl = function createIntl(locale, localeMap) {
  return {
    getMessage: function getMessage(id, defaultMessage) {
      return es_get(localeMap, id, defaultMessage) || defaultMessage;
    },
    locale: locale
  };
};

var zhCNIntl = createIntl('zh_CN', locale_zh_CN);
var enUSIntl = createIntl('en_US', es_locale_en_US);
var viVNIntl = createIntl('vi_VN', vi_VN);
var itITIntl = createIntl('it_IT', locale_it_IT);
var jaJPIntl = createIntl('ja_JP', ja_JP);
var esESIntl = createIntl('es_ES', es_ES);
var ruRUIntl = createIntl('ru_RU', ru_RU);
var msMYIntl = createIntl('ms_MY', ms_MY);
var zhTWIntl = createIntl('zh_TW', locale_zh_TW);
var frFRIntl = createIntl('fr_FR', fr_FR);
var ptBRIntl = createIntl('pt_BR', pt_BR);
var intlMap = {
  'zh-CN': zhCNIntl,
  'en-US': enUSIntl,
  'vi-VN': viVNIntl,
  'it-IT': itITIntl,
  'js-JP': jaJPIntl,
  'es-ES': esESIntl,
  'ru-RU': ruRUIntl,
  'ms-MY': msMYIntl,
  'zh-TW': zhTWIntl,
  'fr-FR': frFRIntl,
  'pt-BR': ptBRIntl
};
var intlMapKeys = Object.keys(intlMap);

var es_ConfigContext = /*#__PURE__*/external_React_default.a.createContext({
  intl: provider_es_objectSpread(provider_es_objectSpread({}, zhCNIntl), {}, {
    locale: 'default'
  })
});
var es_ConfigConsumer = es_ConfigContext.Consumer,
    ConfigProvider = es_ConfigContext.Provider;
/**
 * 根据 antd 的 key 来找到的 locale 插件的 key
 * @param localeKey
 */

var findIntlKeyByAntdLocaleKey = function findIntlKeyByAntdLocaleKey(localeKey) {
  if (!localeKey) {
    return 'zh-CN';
  }

  var localeName = localeKey.toLocaleLowerCase();
  return intlMapKeys.find(function (intlKey) {
    var LowerCaseKey = intlKey.toLocaleLowerCase();
    return LowerCaseKey.includes(localeName);
  }) || 'zh-CN';
};
/**
 *  如果没有配置 locale，这里组件会根据 antd 的 key 来自动选择
 * @param param0
 */


var es_ConfigProviderWarp = function ConfigProviderWarp(_ref) {
  var children = _ref.children;

  var _useContext = Object(external_React_["useContext"])(config_provider["ConfigContext"]),
      locale = _useContext.locale;

  return /*#__PURE__*/external_React_default.a.createElement(es_ConfigConsumer, null, function (value) {
    var localeName = locale === null || locale === void 0 ? void 0 : locale.locale;
    var key = findIntlKeyByAntdLocaleKey(localeName); // antd 的 key 存在的时候以 antd 的为主

    var intl = localeName && value.intl.locale === 'default' ? intlMap[key] : value || intlMap[key];
    return /*#__PURE__*/external_React_default.a.createElement(ConfigProvider, {
      value: intl || zhCNIntl
    }, children);
  });
};


function useIntl() {
  var context = Object(external_React_["useContext"])(es_ConfigContext);
  Object(lib_warning["noteOnce"])(!!context.intl, "\n\u4E3A\u4E86\u63D0\u5347\u517C\u5BB9\u6027  \n<IntlProvider value={zhCNIntl}/>\n\u9700\u8981\u4FEE\u6539\u4E3A:\n<ConfigProvider\n  value={{\n    intl: zhCNIntl,\n  }}\n/>\n\u6211\u4EEC\u5C06\u4F1A\u5728\u4E0B\u4E2A\u7248\u672C\u4E2D\u5220\u9664\u5B83\n    ");
  Object(lib_warning["noteOnce"])(!!context.intl, "\nTo improve compatibility\n  <IntlProvider value={zhCNIntl}/>\nNeed to be modified to:\n  <ConfigProvider\n    value={{\n      intl: zhCNIntl,\n    }}\n  />\nWe will remove it in the next version\n    ");

  if (!context.intl) {
    return context || zhCNIntl;
  }

  return context.intl || zhCNIntl;
}
/* harmony default export */ var provider_es = (es_ConfigContext);
// CONCATENATED MODULE: ./packages/layout/src/WrapContent.tsx




var WrapContent_WrapContent = function WrapContent(props) {
  var style = props.style,
      className = props.className,
      children = props.children;
  return /*#__PURE__*/external_React_default.a.createElement(es_ConfigProviderWarp, null, /*#__PURE__*/external_React_default.a.createElement(external_antd_["Layout"].Content, {
    className: className,
    style: style
  }, children));
};

/* harmony default export */ var src_WrapContent = (WrapContent_WrapContent);
// CONCATENATED MODULE: ./packages/layout/src/utils/compatibleLayout.ts
var compatibleLayout = function compatibleLayout(layout) {
  if (!layout) {
    return layout;
  }

  var layoutEnum = ['sidemenu', 'topmenu'];

  if (layoutEnum.includes(layout)) {
    return layout.replace('menu', '');
  }

  return layout;
};

/* harmony default export */ var utils_compatibleLayout = (compatibleLayout);
// CONCATENATED MODULE: ./packages/layout/src/BasicLayout.tsx
function BasicLayout_objectWithoutPropertiesLoose(source, excluded) { if (source == null) return {}; var target = {}; var sourceKeys = Object.keys(source); var key, i; for (i = 0; i < sourceKeys.length; i++) { key = sourceKeys[i]; if (excluded.indexOf(key) >= 0) continue; target[key] = source[key]; } return target; }

function BasicLayout_extends() { BasicLayout_extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return BasicLayout_extends.apply(this, arguments); }

function BasicLayout_ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }

function BasicLayout_objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { BasicLayout_ownKeys(Object(source), true).forEach(function (key) { BasicLayout_defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { BasicLayout_ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }

function BasicLayout_defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }

























var BasicLayout_headerRender = function headerRender(props) {
  if (props.headerRender === false || props.pure) {
    return null;
  }

  return /*#__PURE__*/external_React_default.a.createElement(src_Header, props);
};

var BasicLayout_footerRender = function footerRender(props) {
  if (props.footerRender === false || props.pure) {
    return null;
  }

  if (props.footerRender) {
    return props.footerRender(BasicLayout_objectSpread({}, props), /*#__PURE__*/external_React_default.a.createElement(src_Footer, null));
  }

  return null;
};

var BasicLayout_renderSiderMenu = function renderSiderMenu(props) {
  var layout = props.layout,
      isMobile = props.isMobile,
      menuRender = props.menuRender;

  if (props.menuRender === false || props.pure) {
    return null;
  }

  if (layout === 'top' && !isMobile) {
    return /*#__PURE__*/external_React_default.a.createElement(layout_src_SiderMenu, BasicLayout_extends({}, props, {
      hide: true
    }));
  }

  if (menuRender) {
    return menuRender(props, /*#__PURE__*/external_React_default.a.createElement(layout_src_SiderMenu, props));
  }

  return /*#__PURE__*/external_React_default.a.createElement(layout_src_SiderMenu, props);
};

var BasicLayout_defaultPageTitleRender = function defaultPageTitleRender(pageProps, props) {
  var pageTitleRender = props.pageTitleRender;
  var pageTitleInfo = getPageTitleInfo(pageProps);

  if (pageTitleRender === false) {
    return {
      title: props.title || '',
      id: '',
      pageName: ''
    };
  }

  if (pageTitleRender) {
    var title = pageTitleRender(pageProps, pageTitleInfo.title, pageTitleInfo);

    if (typeof title === 'string') {
      return BasicLayout_objectSpread(BasicLayout_objectSpread({}, pageTitleInfo), {}, {
        title: title
      });
    }

    warning_default()(typeof title === 'string', 'pro-layout: renderPageTitle return value should be a string');
  }

  return pageTitleInfo;
};

var getPaddingLeft = function getPaddingLeft(hasLeftPadding, collapsed, siderWidth) {
  if (hasLeftPadding) {
    return collapsed ? 48 : siderWidth;
  }

  return 0;
};
/**
 * 🌃 Powerful and easy to use beautiful layout
 * 🏄‍ Support multiple topics and layout types
 * @param props
 */


var BasicLayout_BasicLayout = function BasicLayout(props) {
  var _classNames, _classNames2;

  var children = props.children,
      propsOnCollapse = props.onCollapse,
      _props$location = props.location,
      location = _props$location === void 0 ? {
    pathname: '/'
  } : _props$location,
      fixSiderbar = props.fixSiderbar,
      navTheme = props.navTheme,
      contentStyle = props.contentStyle,
      _props$route = props.route,
      route = _props$route === void 0 ? {
    routes: []
  } : _props$route,
      defaultPropsLayout = props.layout,
      style = props.style,
      disableContentMargin = props.disableContentMargin,
      _props$siderWidth = props.siderWidth,
      siderWidth = _props$siderWidth === void 0 ? 208 : _props$siderWidth,
      menu = props.menu,
      propsIsChildrenLayout = props.isChildrenLayout,
      menuDataRender = props.menuDataRender,
      loading = props.loading,
      rest = BasicLayout_objectWithoutPropertiesLoose(props, ["children", "onCollapse", "location", "fixSiderbar", "navTheme", "contentStyle", "route", "layout", "style", "disableContentMargin", "siderWidth", "menu", "isChildrenLayout", "menuDataRender", "loading"]);

  var propsLayout = utils_compatibleLayout(defaultPropsLayout);
  var prefixCls = rest.prefixCls;

  var formatMessage = function formatMessage(_ref) {
    var id = _ref.id,
        defaultMessage = _ref.defaultMessage,
        restParams = BasicLayout_objectWithoutPropertiesLoose(_ref, ["id", "defaultMessage"]);

    if (props.formatMessage) {
      return props.formatMessage(BasicLayout_objectSpread({
        id: id,
        defaultMessage: defaultMessage
      }, restParams));
    }

    var locales = src_locales();

    if (locales[id]) {
      return locales[id];
    }

    if (defaultMessage) {
      return defaultMessage;
    }

    return id;
  };

  var colSize = es();
  var _route$routes = route.routes,
      routes = _route$routes === void 0 ? [] : _route$routes;

  var _useMergedState = useMergedState_default()(function () {
    return getMenuData(routes, menu, formatMessage, menuDataRender);
  }),
      menuInfoData = _useMergedState[0],
      setMenuInfoData = _useMergedState[1];

  var renderMenuInfoData = {}; // 如果menuDataRender 存在，就应该每次都render一下，不然无法保证数据的同步

  if (menuDataRender) {
    renderMenuInfoData = getMenuData(routes, menu, formatMessage, menuDataRender);
  }

  var isMobile = (colSize === 'sm' || colSize === 'xs') && !props.disableMobile;

  var _ref2 = !menuDataRender ? menuInfoData : renderMenuInfoData,
      _ref2$breadcrumb = _ref2.breadcrumb,
      breadcrumb = _ref2$breadcrumb === void 0 ? {} : _ref2$breadcrumb,
      breadcrumbMap = _ref2.breadcrumbMap,
      _ref2$menuData = _ref2.menuData,
      menuData = _ref2$menuData === void 0 ? [] : _ref2$menuData;
  /**
   *  如果 menuRender 不存在，可以做一下性能优化
   *  只要 routers 没有更新就不需要重新计算
   */


  hooks_useDeepCompareEffect(function () {
    if (!menuDataRender) {
      var infoData = getMenuData(routes, menu, formatMessage, menuDataRender); // 稍微慢一点 render，不然会造成性能问题，看起来像是菜单的卡顿

      var animationFrameId = requestAnimationFrame(function () {
        setMenuInfoData(infoData);
      });
      return function () {
        return window.cancelAnimationFrame && window.cancelAnimationFrame(animationFrameId);
      };
    }

    return function () {
      return null;
    };
  }, [props.route, stringify(menu)]); // If it is a fix menu, calculate padding
  // don't need padding in phone mode

  var hasLeftPadding = propsLayout !== 'top' && !isMobile;

  var _useMergedState2 = useMergedState_default()(false, {
    value: props.collapsed,
    onChange: propsOnCollapse
  }),
      collapsed = _useMergedState2[0],
      onCollapse = _useMergedState2[1]; // Splicing parameters, adding menuData and formatMessage in props


  var defaultProps = omit_js_es(BasicLayout_objectSpread(BasicLayout_objectSpread({}, props), {}, {
    formatMessage: formatMessage,
    breadcrumb: breadcrumb,
    layout: utils_compatibleLayout(props.layout)
  }), ['className', 'style']); // gen page title

  var pageTitleInfo = BasicLayout_defaultPageTitleRender(BasicLayout_objectSpread(BasicLayout_objectSpread({
    pathname: location.pathname
  }, defaultProps), {}, {
    breadcrumbMap: breadcrumbMap
  }), props); // gen breadcrumbProps, parameter for pageHeader

  var breadcrumbProps = getBreadcrumbProps(BasicLayout_objectSpread(BasicLayout_objectSpread({}, defaultProps), {}, {
    breadcrumbMap: breadcrumbMap
  })); // render sider dom

  var siderMenuDom = BasicLayout_renderSiderMenu(BasicLayout_objectSpread(BasicLayout_objectSpread({}, defaultProps), {}, {
    menuData: menuData,
    onCollapse: onCollapse,
    isMobile: isMobile,
    theme: (navTheme || 'dark').toLocaleLowerCase().includes('dark') ? 'dark' : 'light',
    collapsed: collapsed
  })); // render header dom

  var headerDom = BasicLayout_headerRender(BasicLayout_objectSpread(BasicLayout_objectSpread({}, defaultProps), {}, {
    hasSiderMenu: !!siderMenuDom,
    menuData: menuData,
    isMobile: isMobile,
    collapsed: collapsed,
    onCollapse: onCollapse,
    theme: (navTheme || 'dark').toLocaleLowerCase().includes('dark') ? 'dark' : 'light'
  })); // render footer dom

  var footerDom = BasicLayout_footerRender(BasicLayout_objectSpread({
    isMobile: isMobile,
    collapsed: collapsed
  }, defaultProps));

  var _useContext = Object(external_React_["useContext"])(RouteContext),
      contextIsChildrenLayout = _useContext.isChildrenLayout; // 如果 props 中定义，以 props 为准


  var isChildrenLayout = propsIsChildrenLayout !== undefined ? propsIsChildrenLayout : contextIsChildrenLayout;
  var baseClassName = prefixCls + "-basicLayout"; // gen className

  var className = classnames_default()(props.className, 'ant-design-pro', baseClassName, (_classNames = {}, _classNames["screen-" + colSize] = colSize, _classNames[baseClassName + "-top-menu"] = propsLayout === 'top', _classNames[baseClassName + "-is-children"] = isChildrenLayout, _classNames[baseClassName + "-fix-siderbar"] = fixSiderbar, _classNames[baseClassName + "-mobile"] = isMobile, _classNames));
  /**
   * 计算 slider 的宽度
   */

  var leftSiderWidth = getPaddingLeft(!!hasLeftPadding, collapsed, siderWidth); // siderMenuDom 为空的时候，不需要 padding

  var genLayoutStyle = {
    position: 'relative'
  }; // if is some layout children, don't need min height

  if (isChildrenLayout || contentStyle && contentStyle.minHeight) {
    genLayoutStyle.minHeight = 0;
  }

  var contentClassName = classnames_default()(baseClassName + "-content", (_classNames2 = {}, _classNames2[baseClassName + "-has-header"] = headerDom, _classNames2[baseClassName + "-content-disable-margin"] = disableContentMargin, _classNames2));
  /**
   * 页面切换的时候触发
   */

  Object(external_React_["useEffect"])(function () {
    var onPageChange = props.onPageChange;

    if (onPageChange) {
      onPageChange(props.location);
    }
  }, [stringify(props.location)]);

  var _useState = Object(external_React_["useState"])(false),
      hasFooterToolbar = _useState[0],
      setHasFooterToolbar = _useState[1];

  hooks_useDocumentTitle(pageTitleInfo, props.title || src_defaultSettings.title);
  return /*#__PURE__*/external_React_default.a.createElement(Counter.Provider, null, /*#__PURE__*/external_React_default.a.createElement(RouteContext.Provider, {
    value: BasicLayout_objectSpread(BasicLayout_objectSpread({}, defaultProps), {}, {
      breadcrumb: breadcrumbProps,
      menuData: menuData,
      isMobile: isMobile,
      collapsed: collapsed,
      isChildrenLayout: true,
      title: pageTitleInfo.pageName,
      hasSiderMenu: !!siderMenuDom,
      hasHeader: !!headerDom,
      siderWidth: leftSiderWidth,
      hasFooter: !!footerDom,
      hasFooterToolbar: hasFooterToolbar,
      setHasFooterToolbar: setHasFooterToolbar,
      pageTitleInfo: pageTitleInfo
    })
  }, /*#__PURE__*/external_React_default.a.createElement("div", {
    className: className
  }, /*#__PURE__*/external_React_default.a.createElement(external_antd_["Layout"], {
    style: BasicLayout_objectSpread({
      minHeight: '100%'
    }, style),
    hasSider: true
  }, siderMenuDom, /*#__PURE__*/external_React_default.a.createElement(external_antd_["Layout"], {
    style: genLayoutStyle
  }, headerDom, /*#__PURE__*/external_React_default.a.createElement(src_WrapContent, BasicLayout_extends({
    isChildrenLayout: isChildrenLayout
  }, rest, {
    className: contentClassName,
    style: contentStyle
  }), loading ? /*#__PURE__*/external_React_default.a.createElement(src_PageLoading, null) : children), footerDom)))));
};

BasicLayout_BasicLayout.defaultProps = BasicLayout_objectSpread(BasicLayout_objectSpread({
  logo: 'https://gw.alipayobjects.com/zos/antfincdn/PmY%24TNNDBI/logo.svg'
}, src_defaultSettings), {}, {
  prefixCls: 'ant-pro',
  siderWidth: 208,
  location: Object(isBrowser["a" /* default */])() ? window.location : undefined
});
/* harmony default export */ var layout_src_BasicLayout = (BasicLayout_BasicLayout);
// EXTERNAL MODULE: ./packages/layout/src/SettingDrawer/index.less
var src_SettingDrawer = __webpack_require__(163);

// CONCATENATED MODULE: ./node_modules/@ant-design/icons-svg/es/asn/CloseOutlined.js
// This icon file is generated automatically.
var CloseOutlined_CloseOutlined = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "64 64 896 896",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M563.8 512l262.5-312.9c4.4-5.2.7-13.1-6.1-13.1h-79.8c-4.7 0-9.2 2.1-12.3 5.7L511.6 449.8 295.1 191.7c-3-3.6-7.5-5.7-12.3-5.7H203c-6.8 0-10.5 7.9-6.1 13.1L459.4 512 196.9 824.9A7.95 7.95 0 00203 838h79.8c4.7 0 9.2-2.1 12.3-5.7l216.5-258.1 216.5 258.1c3 3.6 7.5 5.7 12.3 5.7h79.8c6.8 0 10.5-7.9 6.1-13.1L563.8 512z"
      }
    }]
  },
  "name": "close",
  "theme": "outlined"
};
/* harmony default export */ var asn_CloseOutlined = (CloseOutlined_CloseOutlined);
// CONCATENATED MODULE: ./node_modules/@ant-design/icons/es/icons/CloseOutlined.js
// GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY




var icons_CloseOutlined_CloseOutlined = function CloseOutlined(props, ref) {
  return /*#__PURE__*/external_React_["createElement"](AntdIcon, Object.assign({}, props, {
    ref: ref,
    icon: asn_CloseOutlined
  }));
};

icons_CloseOutlined_CloseOutlined.displayName = 'CloseOutlined';
/* harmony default export */ var icons_CloseOutlined = (/*#__PURE__*/external_React_["forwardRef"](icons_CloseOutlined_CloseOutlined));
// CONCATENATED MODULE: ./node_modules/@ant-design/icons-svg/es/asn/SettingOutlined.js
// This icon file is generated automatically.
var SettingOutlined_SettingOutlined = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "64 64 896 896",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M924.8 625.7l-65.5-56c3.1-19 4.7-38.4 4.7-57.8s-1.6-38.8-4.7-57.8l65.5-56a32.03 32.03 0 009.3-35.2l-.9-2.6a443.74 443.74 0 00-79.7-137.9l-1.8-2.1a32.12 32.12 0 00-35.1-9.5l-81.3 28.9c-30-24.6-63.5-44-99.7-57.6l-15.7-85a32.05 32.05 0 00-25.8-25.7l-2.7-.5c-52.1-9.4-106.9-9.4-159 0l-2.7.5a32.05 32.05 0 00-25.8 25.7l-15.8 85.4a351.86 351.86 0 00-99 57.4l-81.9-29.1a32 32 0 00-35.1 9.5l-1.8 2.1a446.02 446.02 0 00-79.7 137.9l-.9 2.6c-4.5 12.5-.8 26.5 9.3 35.2l66.3 56.6c-3.1 18.8-4.6 38-4.6 57.1 0 19.2 1.5 38.4 4.6 57.1L99 625.5a32.03 32.03 0 00-9.3 35.2l.9 2.6c18.1 50.4 44.9 96.9 79.7 137.9l1.8 2.1a32.12 32.12 0 0035.1 9.5l81.9-29.1c29.8 24.5 63.1 43.9 99 57.4l15.8 85.4a32.05 32.05 0 0025.8 25.7l2.7.5a449.4 449.4 0 00159 0l2.7-.5a32.05 32.05 0 0025.8-25.7l15.7-85a350 350 0 0099.7-57.6l81.3 28.9a32 32 0 0035.1-9.5l1.8-2.1c34.8-41.1 61.6-87.5 79.7-137.9l.9-2.6c4.5-12.3.8-26.3-9.3-35zM788.3 465.9c2.5 15.1 3.8 30.6 3.8 46.1s-1.3 31-3.8 46.1l-6.6 40.1 74.7 63.9a370.03 370.03 0 01-42.6 73.6L721 702.8l-31.4 25.8c-23.9 19.6-50.5 35-79.3 45.8l-38.1 14.3-17.9 97a377.5 377.5 0 01-85 0l-17.9-97.2-37.8-14.5c-28.5-10.8-55-26.2-78.7-45.7l-31.4-25.9-93.4 33.2c-17-22.9-31.2-47.6-42.6-73.6l75.5-64.5-6.5-40c-2.4-14.9-3.7-30.3-3.7-45.5 0-15.3 1.2-30.6 3.7-45.5l6.5-40-75.5-64.5c11.3-26.1 25.6-50.7 42.6-73.6l93.4 33.2 31.4-25.9c23.7-19.5 50.2-34.9 78.7-45.7l37.9-14.3 17.9-97.2c28.1-3.2 56.8-3.2 85 0l17.9 97 38.1 14.3c28.7 10.8 55.4 26.2 79.3 45.8l31.4 25.8 92.8-32.9c17 22.9 31.2 47.6 42.6 73.6L781.8 426l6.5 39.9zM512 326c-97.2 0-176 78.8-176 176s78.8 176 176 176 176-78.8 176-176-78.8-176-176-176zm79.2 255.2A111.6 111.6 0 01512 614c-29.9 0-58-11.7-79.2-32.8A111.6 111.6 0 01400 502c0-29.9 11.7-58 32.8-79.2C454 401.6 482.1 390 512 390c29.9 0 58 11.6 79.2 32.8A111.6 111.6 0 01624 502c0 29.9-11.7 58-32.8 79.2z"
      }
    }]
  },
  "name": "setting",
  "theme": "outlined"
};
/* harmony default export */ var asn_SettingOutlined = (SettingOutlined_SettingOutlined);
// CONCATENATED MODULE: ./node_modules/@ant-design/icons/es/icons/SettingOutlined.js
// GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY




var icons_SettingOutlined_SettingOutlined = function SettingOutlined(props, ref) {
  return /*#__PURE__*/external_React_["createElement"](AntdIcon, Object.assign({}, props, {
    ref: ref,
    icon: asn_SettingOutlined
  }));
};

icons_SettingOutlined_SettingOutlined.displayName = 'SettingOutlined';
/* harmony default export */ var icons_SettingOutlined = (/*#__PURE__*/external_React_["forwardRef"](icons_SettingOutlined_SettingOutlined));
// CONCATENATED MODULE: ./node_modules/@ant-design/icons-svg/es/asn/NotificationOutlined.js
// This icon file is generated automatically.
var NotificationOutlined_NotificationOutlined = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "64 64 896 896",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M880 112c-3.8 0-7.7.7-11.6 2.3L292 345.9H128c-8.8 0-16 7.4-16 16.6v299c0 9.2 7.2 16.6 16 16.6h101.7c-3.7 11.6-5.7 23.9-5.7 36.4 0 65.9 53.8 119.5 120 119.5 55.4 0 102.1-37.6 115.9-88.4l408.6 164.2c3.9 1.5 7.8 2.3 11.6 2.3 16.9 0 32-14.2 32-33.2V145.2C912 126.2 897 112 880 112zM344 762.3c-26.5 0-48-21.4-48-47.8 0-11.2 3.9-21.9 11-30.4l84.9 34.1c-2 24.6-22.7 44.1-47.9 44.1zm496 58.4L318.8 611.3l-12.9-5.2H184V417.9h121.9l12.9-5.2L840 203.3v617.4z"
      }
    }]
  },
  "name": "notification",
  "theme": "outlined"
};
/* harmony default export */ var asn_NotificationOutlined = (NotificationOutlined_NotificationOutlined);
// CONCATENATED MODULE: ./node_modules/@ant-design/icons/es/icons/NotificationOutlined.js
// GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY




var icons_NotificationOutlined_NotificationOutlined = function NotificationOutlined(props, ref) {
  return /*#__PURE__*/external_React_["createElement"](AntdIcon, Object.assign({}, props, {
    ref: ref,
    icon: asn_NotificationOutlined
  }));
};

icons_NotificationOutlined_NotificationOutlined.displayName = 'NotificationOutlined';
/* harmony default export */ var icons_NotificationOutlined = (/*#__PURE__*/external_React_["forwardRef"](icons_NotificationOutlined_NotificationOutlined));
// CONCATENATED MODULE: ./node_modules/@ant-design/icons-svg/es/asn/CopyOutlined.js
// This icon file is generated automatically.
var CopyOutlined_CopyOutlined = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "64 64 896 896",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M832 64H296c-4.4 0-8 3.6-8 8v56c0 4.4 3.6 8 8 8h496v688c0 4.4 3.6 8 8 8h56c4.4 0 8-3.6 8-8V96c0-17.7-14.3-32-32-32zM704 192H192c-17.7 0-32 14.3-32 32v530.7c0 8.5 3.4 16.6 9.4 22.6l173.3 173.3c2.2 2.2 4.7 4 7.4 5.5v1.9h4.2c3.5 1.3 7.2 2 11 2H704c17.7 0 32-14.3 32-32V224c0-17.7-14.3-32-32-32zM350 856.2L263.9 770H350v86.2zM664 888H414V746c0-22.1-17.9-40-40-40H232V264h432v624z"
      }
    }]
  },
  "name": "copy",
  "theme": "outlined"
};
/* harmony default export */ var asn_CopyOutlined = (CopyOutlined_CopyOutlined);
// CONCATENATED MODULE: ./node_modules/@ant-design/icons/es/icons/CopyOutlined.js
// GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY




var icons_CopyOutlined_CopyOutlined = function CopyOutlined(props, ref) {
  return /*#__PURE__*/external_React_["createElement"](AntdIcon, Object.assign({}, props, {
    ref: ref,
    icon: asn_CopyOutlined
  }));
};

icons_CopyOutlined_CopyOutlined.displayName = 'CopyOutlined';
/* harmony default export */ var icons_CopyOutlined = (/*#__PURE__*/external_React_["forwardRef"](icons_CopyOutlined_CopyOutlined));
// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/extends.js
function extends_extends() {
  extends_extends = Object.assign || function (target) {
    for (var i = 1; i < arguments.length; i++) {
      var source = arguments[i];

      for (var key in source) {
        if (Object.prototype.hasOwnProperty.call(source, key)) {
          target[key] = source[key];
        }
      }
    }

    return target;
  };

  return extends_extends.apply(this, arguments);
}
// CONCATENATED MODULE: ./node_modules/resolve-pathname/esm/resolve-pathname.js
function isAbsolute(pathname) {
  return pathname.charAt(0) === '/';
} // About 1.5x faster than the two-arg version of Array#splice()


function spliceOne(list, index) {
  for (var i = index, k = i + 1, n = list.length; k < n; i += 1, k += 1) {
    list[i] = list[k];
  }

  list.pop();
} // This implementation is based heavily on node's url.parse


function resolvePathname(to, from) {
  if (from === undefined) from = '';
  var toParts = to && to.split('/') || [];
  var fromParts = from && from.split('/') || [];
  var isToAbs = to && isAbsolute(to);
  var isFromAbs = from && isAbsolute(from);
  var mustEndAbs = isToAbs || isFromAbs;

  if (to && isAbsolute(to)) {
    // to is absolute
    fromParts = toParts;
  } else if (toParts.length) {
    // to is relative, drop the filename
    fromParts.pop();
    fromParts = fromParts.concat(toParts);
  }

  if (!fromParts.length) return '/';
  var hasTrailingSlash;

  if (fromParts.length) {
    var last = fromParts[fromParts.length - 1];
    hasTrailingSlash = last === '.' || last === '..' || last === '';
  } else {
    hasTrailingSlash = false;
  }

  var up = 0;

  for (var i = fromParts.length; i >= 0; i--) {
    var part = fromParts[i];

    if (part === '.') {
      spliceOne(fromParts, i);
    } else if (part === '..') {
      spliceOne(fromParts, i);
      up++;
    } else if (up) {
      spliceOne(fromParts, i);
      up--;
    }
  }

  if (!mustEndAbs) for (; up--; up) {
    fromParts.unshift('..');
  }
  if (mustEndAbs && fromParts[0] !== '' && (!fromParts[0] || !isAbsolute(fromParts[0]))) fromParts.unshift('');
  var result = fromParts.join('/');
  if (hasTrailingSlash && result.substr(-1) !== '/') result += '/';
  return result;
}

/* harmony default export */ var resolve_pathname = (resolvePathname);
// CONCATENATED MODULE: ./node_modules/value-equal/esm/value-equal.js
function value_equal_typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { value_equal_typeof = function _typeof(obj) { return typeof obj; }; } else { value_equal_typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return value_equal_typeof(obj); }

function value_equal_valueOf(obj) {
  return obj.valueOf ? obj.valueOf() : Object.prototype.valueOf.call(obj);
}

function valueEqual(a, b) {
  // Test for strict equality first.
  if (a === b) return true; // Otherwise, if either of them == null they are not equal.

  if (a == null || b == null) return false;

  if (Array.isArray(a)) {
    return Array.isArray(b) && a.length === b.length && a.every(function (item, index) {
      return valueEqual(item, b[index]);
    });
  }

  if (value_equal_typeof(a) === 'object' || value_equal_typeof(b) === 'object') {
    var aValue = value_equal_valueOf(a);
    var bValue = value_equal_valueOf(b);
    if (aValue !== a || bValue !== b) return valueEqual(aValue, bValue);
    return Object.keys(Object.assign({}, a, b)).every(function (key) {
      return valueEqual(a[key], b[key]);
    });
  }

  return false;
}

/* harmony default export */ var value_equal = (valueEqual);
// CONCATENATED MODULE: ./node_modules/tiny-invariant/dist/tiny-invariant.esm.js
var isProduction = "production" === 'production';
var tiny_invariant_esm_prefix = 'Invariant failed';

function invariant(condition, message) {
  if (condition) {
    return;
  }

  if (isProduction) {
    throw new Error(tiny_invariant_esm_prefix);
  }

  throw new Error(tiny_invariant_esm_prefix + ": " + (message || ''));
}

/* harmony default export */ var tiny_invariant_esm = (invariant);
// CONCATENATED MODULE: ./node_modules/history/esm/history.js
function history_typeof(obj) { "@babel/helpers - typeof"; if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { history_typeof = function _typeof(obj) { return typeof obj; }; } else { history_typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return history_typeof(obj); }







function addLeadingSlash(path) {
  return path.charAt(0) === '/' ? path : '/' + path;
}

function stripLeadingSlash(path) {
  return path.charAt(0) === '/' ? path.substr(1) : path;
}

function hasBasename(path, prefix) {
  return path.toLowerCase().indexOf(prefix.toLowerCase()) === 0 && '/?#'.indexOf(path.charAt(prefix.length)) !== -1;
}

function stripBasename(path, prefix) {
  return hasBasename(path, prefix) ? path.substr(prefix.length) : path;
}

function stripTrailingSlash(path) {
  return path.charAt(path.length - 1) === '/' ? path.slice(0, -1) : path;
}

function parsePath(path) {
  var pathname = path || '/';
  var search = '';
  var hash = '';
  var hashIndex = pathname.indexOf('#');

  if (hashIndex !== -1) {
    hash = pathname.substr(hashIndex);
    pathname = pathname.substr(0, hashIndex);
  }

  var searchIndex = pathname.indexOf('?');

  if (searchIndex !== -1) {
    search = pathname.substr(searchIndex);
    pathname = pathname.substr(0, searchIndex);
  }

  return {
    pathname: pathname,
    search: search === '?' ? '' : search,
    hash: hash === '#' ? '' : hash
  };
}

function createPath(location) {
  var pathname = location.pathname,
      search = location.search,
      hash = location.hash;
  var path = pathname || '/';
  if (search && search !== '?') path += search.charAt(0) === '?' ? search : "?" + search;
  if (hash && hash !== '#') path += hash.charAt(0) === '#' ? hash : "#" + hash;
  return path;
}

function createLocation(path, state, key, currentLocation) {
  var location;

  if (typeof path === 'string') {
    // Two-arg form: push(path, state)
    location = parsePath(path);
    location.state = state;
  } else {
    // One-arg form: push(location)
    location = extends_extends({}, path);
    if (location.pathname === undefined) location.pathname = '';

    if (location.search) {
      if (location.search.charAt(0) !== '?') location.search = '?' + location.search;
    } else {
      location.search = '';
    }

    if (location.hash) {
      if (location.hash.charAt(0) !== '#') location.hash = '#' + location.hash;
    } else {
      location.hash = '';
    }

    if (state !== undefined && location.state === undefined) location.state = state;
  }

  try {
    location.pathname = decodeURI(location.pathname);
  } catch (e) {
    if (e instanceof URIError) {
      throw new URIError('Pathname "' + location.pathname + '" could not be decoded. ' + 'This is likely caused by an invalid percent-encoding.');
    } else {
      throw e;
    }
  }

  if (key) location.key = key;

  if (currentLocation) {
    // Resolve incomplete/relative pathname relative to current location.
    if (!location.pathname) {
      location.pathname = currentLocation.pathname;
    } else if (location.pathname.charAt(0) !== '/') {
      location.pathname = resolve_pathname(location.pathname, currentLocation.pathname);
    }
  } else {
    // When there is no prior location and pathname is empty, set it to /
    if (!location.pathname) {
      location.pathname = '/';
    }
  }

  return location;
}

function locationsAreEqual(a, b) {
  return a.pathname === b.pathname && a.search === b.search && a.hash === b.hash && a.key === b.key && value_equal(a.state, b.state);
}

function createTransitionManager() {
  var prompt = null;

  function setPrompt(nextPrompt) {
     false ? undefined : void 0;
    prompt = nextPrompt;
    return function () {
      if (prompt === nextPrompt) prompt = null;
    };
  }

  function confirmTransitionTo(location, action, getUserConfirmation, callback) {
    // TODO: If another transition starts while we're still confirming
    // the previous one, we may end up in a weird state. Figure out the
    // best way to handle this.
    if (prompt != null) {
      var result = typeof prompt === 'function' ? prompt(location, action) : prompt;

      if (typeof result === 'string') {
        if (typeof getUserConfirmation === 'function') {
          getUserConfirmation(result, callback);
        } else {
           false ? undefined : void 0;
          callback(true);
        }
      } else {
        // Return false from a transition hook to cancel the transition.
        callback(result !== false);
      }
    } else {
      callback(true);
    }
  }

  var listeners = [];

  function appendListener(fn) {
    var isActive = true;

    function listener() {
      if (isActive) fn.apply(void 0, arguments);
    }

    listeners.push(listener);
    return function () {
      isActive = false;
      listeners = listeners.filter(function (item) {
        return item !== listener;
      });
    };
  }

  function notifyListeners() {
    for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
      args[_key] = arguments[_key];
    }

    listeners.forEach(function (listener) {
      return listener.apply(void 0, args);
    });
  }

  return {
    setPrompt: setPrompt,
    confirmTransitionTo: confirmTransitionTo,
    appendListener: appendListener,
    notifyListeners: notifyListeners
  };
}

var history_canUseDOM = !!(typeof window !== 'undefined' && window.document && window.document.createElement);

function getConfirmation(message, callback) {
  callback(window.confirm(message)); // eslint-disable-line no-alert
}
/**
 * Returns true if the HTML5 history API is supported. Taken from Modernizr.
 *
 * https://github.com/Modernizr/Modernizr/blob/master/LICENSE
 * https://github.com/Modernizr/Modernizr/blob/master/feature-detects/history.js
 * changed to avoid false negatives for Windows Phones: https://github.com/reactjs/react-router/issues/586
 */


function supportsHistory() {
  var ua = window.navigator.userAgent;
  if ((ua.indexOf('Android 2.') !== -1 || ua.indexOf('Android 4.0') !== -1) && ua.indexOf('Mobile Safari') !== -1 && ua.indexOf('Chrome') === -1 && ua.indexOf('Windows Phone') === -1) return false;
  return window.history && 'pushState' in window.history;
}
/**
 * Returns true if browser fires popstate on hash change.
 * IE10 and IE11 do not.
 */


function supportsPopStateOnHashChange() {
  return window.navigator.userAgent.indexOf('Trident') === -1;
}
/**
 * Returns false if using go(n) with hash history causes a full page reload.
 */


function supportsGoWithoutReloadUsingHash() {
  return window.navigator.userAgent.indexOf('Firefox') === -1;
}
/**
 * Returns true if a given popstate event is an extraneous WebKit event.
 * Accounts for the fact that Chrome on iOS fires real popstate events
 * containing undefined state when pressing the back button.
 */


function isExtraneousPopstateEvent(event) {
  return event.state === undefined && navigator.userAgent.indexOf('CriOS') === -1;
}

var PopStateEvent = 'popstate';
var HashChangeEvent = 'hashchange';

function getHistoryState() {
  try {
    return window.history.state || {};
  } catch (e) {
    // IE 11 sometimes throws when accessing window.history.state
    // See https://github.com/ReactTraining/history/pull/289
    return {};
  }
}
/**
 * Creates a history object that uses the HTML5 history API including
 * pushState, replaceState, and the popstate event.
 */


function createBrowserHistory(props) {
  if (props === void 0) {
    props = {};
  }

  !history_canUseDOM ?  false ? undefined : tiny_invariant_esm(false) : void 0;
  var globalHistory = window.history;
  var canUseHistory = supportsHistory();
  var needsHashChangeListener = !supportsPopStateOnHashChange();
  var _props = props,
      _props$forceRefresh = _props.forceRefresh,
      forceRefresh = _props$forceRefresh === void 0 ? false : _props$forceRefresh,
      _props$getUserConfirm = _props.getUserConfirmation,
      getUserConfirmation = _props$getUserConfirm === void 0 ? getConfirmation : _props$getUserConfirm,
      _props$keyLength = _props.keyLength,
      keyLength = _props$keyLength === void 0 ? 6 : _props$keyLength;
  var basename = props.basename ? stripTrailingSlash(addLeadingSlash(props.basename)) : '';

  function getDOMLocation(historyState) {
    var _ref = historyState || {},
        key = _ref.key,
        state = _ref.state;

    var _window$location = window.location,
        pathname = _window$location.pathname,
        search = _window$location.search,
        hash = _window$location.hash;
    var path = pathname + search + hash;
     false ? undefined : void 0;
    if (basename) path = stripBasename(path, basename);
    return createLocation(path, state, key);
  }

  function createKey() {
    return Math.random().toString(36).substr(2, keyLength);
  }

  var transitionManager = createTransitionManager();

  function setState(nextState) {
    extends_extends(history, nextState);

    history.length = globalHistory.length;
    transitionManager.notifyListeners(history.location, history.action);
  }

  function handlePopState(event) {
    // Ignore extraneous popstate events in WebKit.
    if (isExtraneousPopstateEvent(event)) return;
    handlePop(getDOMLocation(event.state));
  }

  function handleHashChange() {
    handlePop(getDOMLocation(getHistoryState()));
  }

  var forceNextPop = false;

  function handlePop(location) {
    if (forceNextPop) {
      forceNextPop = false;
      setState();
    } else {
      var action = 'POP';
      transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {
        if (ok) {
          setState({
            action: action,
            location: location
          });
        } else {
          revertPop(location);
        }
      });
    }
  }

  function revertPop(fromLocation) {
    var toLocation = history.location; // TODO: We could probably make this more reliable by
    // keeping a list of keys we've seen in sessionStorage.
    // Instead, we just default to 0 for keys we don't know.

    var toIndex = allKeys.indexOf(toLocation.key);
    if (toIndex === -1) toIndex = 0;
    var fromIndex = allKeys.indexOf(fromLocation.key);
    if (fromIndex === -1) fromIndex = 0;
    var delta = toIndex - fromIndex;

    if (delta) {
      forceNextPop = true;
      go(delta);
    }
  }

  var initialLocation = getDOMLocation(getHistoryState());
  var allKeys = [initialLocation.key]; // Public interface

  function createHref(location) {
    return basename + createPath(location);
  }

  function push(path, state) {
     false ? undefined : void 0;
    var action = 'PUSH';
    var location = createLocation(path, state, createKey(), history.location);
    transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {
      if (!ok) return;
      var href = createHref(location);
      var key = location.key,
          state = location.state;

      if (canUseHistory) {
        globalHistory.pushState({
          key: key,
          state: state
        }, null, href);

        if (forceRefresh) {
          window.location.href = href;
        } else {
          var prevIndex = allKeys.indexOf(history.location.key);
          var nextKeys = allKeys.slice(0, prevIndex + 1);
          nextKeys.push(location.key);
          allKeys = nextKeys;
          setState({
            action: action,
            location: location
          });
        }
      } else {
         false ? undefined : void 0;
        window.location.href = href;
      }
    });
  }

  function replace(path, state) {
     false ? undefined : void 0;
    var action = 'REPLACE';
    var location = createLocation(path, state, createKey(), history.location);
    transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {
      if (!ok) return;
      var href = createHref(location);
      var key = location.key,
          state = location.state;

      if (canUseHistory) {
        globalHistory.replaceState({
          key: key,
          state: state
        }, null, href);

        if (forceRefresh) {
          window.location.replace(href);
        } else {
          var prevIndex = allKeys.indexOf(history.location.key);
          if (prevIndex !== -1) allKeys[prevIndex] = location.key;
          setState({
            action: action,
            location: location
          });
        }
      } else {
         false ? undefined : void 0;
        window.location.replace(href);
      }
    });
  }

  function go(n) {
    globalHistory.go(n);
  }

  function goBack() {
    go(-1);
  }

  function goForward() {
    go(1);
  }

  var listenerCount = 0;

  function checkDOMListeners(delta) {
    listenerCount += delta;

    if (listenerCount === 1 && delta === 1) {
      window.addEventListener(PopStateEvent, handlePopState);
      if (needsHashChangeListener) window.addEventListener(HashChangeEvent, handleHashChange);
    } else if (listenerCount === 0) {
      window.removeEventListener(PopStateEvent, handlePopState);
      if (needsHashChangeListener) window.removeEventListener(HashChangeEvent, handleHashChange);
    }
  }

  var isBlocked = false;

  function block(prompt) {
    if (prompt === void 0) {
      prompt = false;
    }

    var unblock = transitionManager.setPrompt(prompt);

    if (!isBlocked) {
      checkDOMListeners(1);
      isBlocked = true;
    }

    return function () {
      if (isBlocked) {
        isBlocked = false;
        checkDOMListeners(-1);
      }

      return unblock();
    };
  }

  function listen(listener) {
    var unlisten = transitionManager.appendListener(listener);
    checkDOMListeners(1);
    return function () {
      checkDOMListeners(-1);
      unlisten();
    };
  }

  var history = {
    length: globalHistory.length,
    action: 'POP',
    location: initialLocation,
    createHref: createHref,
    push: push,
    replace: replace,
    go: go,
    goBack: goBack,
    goForward: goForward,
    block: block,
    listen: listen
  };
  return history;
}

var HashChangeEvent$1 = 'hashchange';
var HashPathCoders = {
  hashbang: {
    encodePath: function encodePath(path) {
      return path.charAt(0) === '!' ? path : '!/' + stripLeadingSlash(path);
    },
    decodePath: function decodePath(path) {
      return path.charAt(0) === '!' ? path.substr(1) : path;
    }
  },
  noslash: {
    encodePath: stripLeadingSlash,
    decodePath: addLeadingSlash
  },
  slash: {
    encodePath: addLeadingSlash,
    decodePath: addLeadingSlash
  }
};

function stripHash(url) {
  var hashIndex = url.indexOf('#');
  return hashIndex === -1 ? url : url.slice(0, hashIndex);
}

function getHashPath() {
  // We can't use window.location.hash here because it's not
  // consistent across browsers - Firefox will pre-decode it!
  var href = window.location.href;
  var hashIndex = href.indexOf('#');
  return hashIndex === -1 ? '' : href.substring(hashIndex + 1);
}

function pushHashPath(path) {
  window.location.hash = path;
}

function replaceHashPath(path) {
  window.location.replace(stripHash(window.location.href) + '#' + path);
}

function createHashHistory(props) {
  if (props === void 0) {
    props = {};
  }

  !history_canUseDOM ?  false ? undefined : tiny_invariant_esm(false) : void 0;
  var globalHistory = window.history;
  var canGoWithoutReload = supportsGoWithoutReloadUsingHash();
  var _props = props,
      _props$getUserConfirm = _props.getUserConfirmation,
      getUserConfirmation = _props$getUserConfirm === void 0 ? getConfirmation : _props$getUserConfirm,
      _props$hashType = _props.hashType,
      hashType = _props$hashType === void 0 ? 'slash' : _props$hashType;
  var basename = props.basename ? stripTrailingSlash(addLeadingSlash(props.basename)) : '';
  var _HashPathCoders$hashT = HashPathCoders[hashType],
      encodePath = _HashPathCoders$hashT.encodePath,
      decodePath = _HashPathCoders$hashT.decodePath;

  function getDOMLocation() {
    var path = decodePath(getHashPath());
     false ? undefined : void 0;
    if (basename) path = stripBasename(path, basename);
    return createLocation(path);
  }

  var transitionManager = createTransitionManager();

  function setState(nextState) {
    extends_extends(history, nextState);

    history.length = globalHistory.length;
    transitionManager.notifyListeners(history.location, history.action);
  }

  var forceNextPop = false;
  var ignorePath = null;

  function locationsAreEqual$$1(a, b) {
    return a.pathname === b.pathname && a.search === b.search && a.hash === b.hash;
  }

  function handleHashChange() {
    var path = getHashPath();
    var encodedPath = encodePath(path);

    if (path !== encodedPath) {
      // Ensure we always have a properly-encoded hash.
      replaceHashPath(encodedPath);
    } else {
      var location = getDOMLocation();
      var prevLocation = history.location;
      if (!forceNextPop && locationsAreEqual$$1(prevLocation, location)) return; // A hashchange doesn't always == location change.

      if (ignorePath === createPath(location)) return; // Ignore this change; we already setState in push/replace.

      ignorePath = null;
      handlePop(location);
    }
  }

  function handlePop(location) {
    if (forceNextPop) {
      forceNextPop = false;
      setState();
    } else {
      var action = 'POP';
      transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {
        if (ok) {
          setState({
            action: action,
            location: location
          });
        } else {
          revertPop(location);
        }
      });
    }
  }

  function revertPop(fromLocation) {
    var toLocation = history.location; // TODO: We could probably make this more reliable by
    // keeping a list of paths we've seen in sessionStorage.
    // Instead, we just default to 0 for paths we don't know.

    var toIndex = allPaths.lastIndexOf(createPath(toLocation));
    if (toIndex === -1) toIndex = 0;
    var fromIndex = allPaths.lastIndexOf(createPath(fromLocation));
    if (fromIndex === -1) fromIndex = 0;
    var delta = toIndex - fromIndex;

    if (delta) {
      forceNextPop = true;
      go(delta);
    }
  } // Ensure the hash is encoded properly before doing anything else.


  var path = getHashPath();
  var encodedPath = encodePath(path);
  if (path !== encodedPath) replaceHashPath(encodedPath);
  var initialLocation = getDOMLocation();
  var allPaths = [createPath(initialLocation)]; // Public interface

  function createHref(location) {
    var baseTag = document.querySelector('base');
    var href = '';

    if (baseTag && baseTag.getAttribute('href')) {
      href = stripHash(window.location.href);
    }

    return href + '#' + encodePath(basename + createPath(location));
  }

  function push(path, state) {
     false ? undefined : void 0;
    var action = 'PUSH';
    var location = createLocation(path, undefined, undefined, history.location);
    transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {
      if (!ok) return;
      var path = createPath(location);
      var encodedPath = encodePath(basename + path);
      var hashChanged = getHashPath() !== encodedPath;

      if (hashChanged) {
        // We cannot tell if a hashchange was caused by a PUSH, so we'd
        // rather setState here and ignore the hashchange. The caveat here
        // is that other hash histories in the page will consider it a POP.
        ignorePath = path;
        pushHashPath(encodedPath);
        var prevIndex = allPaths.lastIndexOf(createPath(history.location));
        var nextPaths = allPaths.slice(0, prevIndex + 1);
        nextPaths.push(path);
        allPaths = nextPaths;
        setState({
          action: action,
          location: location
        });
      } else {
         false ? undefined : void 0;
        setState();
      }
    });
  }

  function replace(path, state) {
     false ? undefined : void 0;
    var action = 'REPLACE';
    var location = createLocation(path, undefined, undefined, history.location);
    transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {
      if (!ok) return;
      var path = createPath(location);
      var encodedPath = encodePath(basename + path);
      var hashChanged = getHashPath() !== encodedPath;

      if (hashChanged) {
        // We cannot tell if a hashchange was caused by a REPLACE, so we'd
        // rather setState here and ignore the hashchange. The caveat here
        // is that other hash histories in the page will consider it a POP.
        ignorePath = path;
        replaceHashPath(encodedPath);
      }

      var prevIndex = allPaths.indexOf(createPath(history.location));
      if (prevIndex !== -1) allPaths[prevIndex] = path;
      setState({
        action: action,
        location: location
      });
    });
  }

  function go(n) {
     false ? undefined : void 0;
    globalHistory.go(n);
  }

  function goBack() {
    go(-1);
  }

  function goForward() {
    go(1);
  }

  var listenerCount = 0;

  function checkDOMListeners(delta) {
    listenerCount += delta;

    if (listenerCount === 1 && delta === 1) {
      window.addEventListener(HashChangeEvent$1, handleHashChange);
    } else if (listenerCount === 0) {
      window.removeEventListener(HashChangeEvent$1, handleHashChange);
    }
  }

  var isBlocked = false;

  function block(prompt) {
    if (prompt === void 0) {
      prompt = false;
    }

    var unblock = transitionManager.setPrompt(prompt);

    if (!isBlocked) {
      checkDOMListeners(1);
      isBlocked = true;
    }

    return function () {
      if (isBlocked) {
        isBlocked = false;
        checkDOMListeners(-1);
      }

      return unblock();
    };
  }

  function listen(listener) {
    var unlisten = transitionManager.appendListener(listener);
    checkDOMListeners(1);
    return function () {
      checkDOMListeners(-1);
      unlisten();
    };
  }

  var history = {
    length: globalHistory.length,
    action: 'POP',
    location: initialLocation,
    createHref: createHref,
    push: push,
    replace: replace,
    go: go,
    goBack: goBack,
    goForward: goForward,
    block: block,
    listen: listen
  };
  return history;
}

function clamp(n, lowerBound, upperBound) {
  return Math.min(Math.max(n, lowerBound), upperBound);
}
/**
 * Creates a history object that stores locations in memory.
 */


function createMemoryHistory(props) {
  if (props === void 0) {
    props = {};
  }

  var _props = props,
      getUserConfirmation = _props.getUserConfirmation,
      _props$initialEntries = _props.initialEntries,
      initialEntries = _props$initialEntries === void 0 ? ['/'] : _props$initialEntries,
      _props$initialIndex = _props.initialIndex,
      initialIndex = _props$initialIndex === void 0 ? 0 : _props$initialIndex,
      _props$keyLength = _props.keyLength,
      keyLength = _props$keyLength === void 0 ? 6 : _props$keyLength;
  var transitionManager = createTransitionManager();

  function setState(nextState) {
    extends_extends(history, nextState);

    history.length = history.entries.length;
    transitionManager.notifyListeners(history.location, history.action);
  }

  function createKey() {
    return Math.random().toString(36).substr(2, keyLength);
  }

  var index = clamp(initialIndex, 0, initialEntries.length - 1);
  var entries = initialEntries.map(function (entry) {
    return typeof entry === 'string' ? createLocation(entry, undefined, createKey()) : createLocation(entry, undefined, entry.key || createKey());
  }); // Public interface

  var createHref = createPath;

  function push(path, state) {
     false ? undefined : void 0;
    var action = 'PUSH';
    var location = createLocation(path, state, createKey(), history.location);
    transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {
      if (!ok) return;
      var prevIndex = history.index;
      var nextIndex = prevIndex + 1;
      var nextEntries = history.entries.slice(0);

      if (nextEntries.length > nextIndex) {
        nextEntries.splice(nextIndex, nextEntries.length - nextIndex, location);
      } else {
        nextEntries.push(location);
      }

      setState({
        action: action,
        location: location,
        index: nextIndex,
        entries: nextEntries
      });
    });
  }

  function replace(path, state) {
     false ? undefined : void 0;
    var action = 'REPLACE';
    var location = createLocation(path, state, createKey(), history.location);
    transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {
      if (!ok) return;
      history.entries[history.index] = location;
      setState({
        action: action,
        location: location
      });
    });
  }

  function go(n) {
    var nextIndex = clamp(history.index + n, 0, history.entries.length - 1);
    var action = 'POP';
    var location = history.entries[nextIndex];
    transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) {
      if (ok) {
        setState({
          action: action,
          location: location,
          index: nextIndex
        });
      } else {
        // Mimic the behavior of DOM histories by
        // causing a render after a cancelled POP.
        setState();
      }
    });
  }

  function goBack() {
    go(-1);
  }

  function goForward() {
    go(1);
  }

  function canGo(n) {
    var nextIndex = history.index + n;
    return nextIndex >= 0 && nextIndex < history.entries.length;
  }

  function block(prompt) {
    if (prompt === void 0) {
      prompt = false;
    }

    return transitionManager.setPrompt(prompt);
  }

  function listen(listener) {
    return transitionManager.appendListener(listener);
  }

  var history = {
    length: entries.length,
    action: 'POP',
    location: entries[index],
    index: index,
    entries: entries,
    createHref: createHref,
    push: push,
    replace: replace,
    go: go,
    goBack: goBack,
    goForward: goForward,
    canGo: canGo,
    block: block,
    listen: listen
  };
  return history;
}


// EXTERNAL MODULE: ./packages/layout/node_modules/qs/lib/index.js
var qs_lib = __webpack_require__(40);

// EXTERNAL MODULE: ./node_modules/react-copy-to-clipboard/lib/index.js
var react_copy_to_clipboard_lib = __webpack_require__(81);
var react_copy_to_clipboard_lib_default = /*#__PURE__*/__webpack_require__.n(react_copy_to_clipboard_lib);

// CONCATENATED MODULE: ./node_modules/@ant-design/icons-svg/es/asn/CheckOutlined.js
// This icon file is generated automatically.
var CheckOutlined_CheckOutlined = {
  "icon": {
    "tag": "svg",
    "attrs": {
      "viewBox": "64 64 896 896",
      "focusable": "false"
    },
    "children": [{
      "tag": "path",
      "attrs": {
        "d": "M912 190h-69.9c-9.8 0-19.1 4.5-25.1 12.2L404.7 724.5 207 474a32 32 0 00-25.1-12.2H112c-6.7 0-10.4 7.7-6.3 12.9l273.9 347c12.8 16.2 37.4 16.2 50.3 0l488.4-618.9c4.1-5.1.4-12.8-6.3-12.8z"
      }
    }]
  },
  "name": "check",
  "theme": "outlined"
};
/* harmony default export */ var asn_CheckOutlined = (CheckOutlined_CheckOutlined);
// CONCATENATED MODULE: ./node_modules/@ant-design/icons/es/icons/CheckOutlined.js
// GENERATE BY ./scripts/generate.ts
// DON NOT EDIT IT MANUALLY




var icons_CheckOutlined_CheckOutlined = function CheckOutlined(props, ref) {
  return /*#__PURE__*/external_React_["createElement"](AntdIcon, Object.assign({}, props, {
    ref: ref,
    icon: asn_CheckOutlined
  }));
};

icons_CheckOutlined_CheckOutlined.displayName = 'CheckOutlined';
/* harmony default export */ var icons_CheckOutlined = (/*#__PURE__*/external_React_["forwardRef"](icons_CheckOutlined_CheckOutlined));
// CONCATENATED MODULE: ./packages/layout/src/SettingDrawer/BlockCheckbox.tsx




var BlockCheckbox_BlockCheckbox = function BlockCheckbox(_ref) {
  var value = _ref.value,
      onChange = _ref.onChange,
      list = _ref.list,
      prefixCls = _ref.prefixCls;
  var baseClassName = prefixCls + "-drawer-block-checkbox";

  var _useState = Object(external_React_["useState"])([]),
      dom = _useState[0],
      setDom = _useState[1];

  Object(external_React_["useEffect"])(function () {
    var domList = (list || []).map(function (item) {
      return /*#__PURE__*/external_React_default.a.createElement("div", {
        key: item.key,
        className: baseClassName + "-item",
        onClick: function onClick() {
          return onChange(item.key);
        }
      }, /*#__PURE__*/external_React_default.a.createElement(external_antd_["Tooltip"], {
        title: item.title,
        key: item.key
      }, /*#__PURE__*/external_React_default.a.createElement("img", {
        src: item.url,
        alt: item.key
      })), /*#__PURE__*/external_React_default.a.createElement("div", {
        className: baseClassName + "-selectIcon",
        style: {
          display: value === item.key ? 'block' : 'none'
        }
      }, /*#__PURE__*/external_React_default.a.createElement(icons_CheckOutlined, null)));
    });
    setDom(domList);
  }, [value, list == null ? void 0 : list.length]);
  return /*#__PURE__*/external_React_default.a.createElement("div", {
    className: baseClassName,
    style: {
      minHeight: 42
    }
  }, dom);
};

/* harmony default export */ var SettingDrawer_BlockCheckbox = (BlockCheckbox_BlockCheckbox);
// EXTERNAL MODULE: ./packages/layout/src/SettingDrawer/ThemeColor.less
var SettingDrawer_ThemeColor = __webpack_require__(169);

// CONCATENATED MODULE: ./packages/layout/src/SettingDrawer/ThemeColor.tsx
function ThemeColor_extends() { ThemeColor_extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return ThemeColor_extends.apply(this, arguments); }

function ThemeColor_objectWithoutPropertiesLoose(source, excluded) { if (source == null) return {}; var target = {}; var sourceKeys = Object.keys(source); var key, i; for (i = 0; i < sourceKeys.length; i++) { key = sourceKeys[i]; if (excluded.indexOf(key) >= 0) continue; target[key] = source[key]; } return target; }






var Tag = /*#__PURE__*/external_React_default.a.forwardRef(function (_ref, ref) {
  var color = _ref.color,
      check = _ref.check,
      rest = ThemeColor_objectWithoutPropertiesLoose(_ref, ["color", "check"]);

  return /*#__PURE__*/external_React_default.a.createElement("div", ThemeColor_extends({}, rest, {
    style: {
      backgroundColor: color
    },
    ref: ref
  }), check ? /*#__PURE__*/external_React_default.a.createElement(icons_CheckOutlined, null) : '');
});

var ThemeColor_ThemeColor = function ThemeColor(_ref2, ref) {
  var colors = _ref2.colors,
      value = _ref2.value,
      onChange = _ref2.onChange,
      formatMessage = _ref2.formatMessage;
  var colorList = colors || [];

  if (colorList.length < 1) {
    return null;
  }

  return /*#__PURE__*/external_React_default.a.createElement("div", {
    className: "theme-color",
    ref: ref
  }, /*#__PURE__*/external_React_default.a.createElement("div", {
    className: "theme-color-content"
  }, colorList.map(function (_ref3) {
    var key = _ref3.key,
        color = _ref3.color;
    var themeKey = genThemeToString(key);
    return /*#__PURE__*/external_React_default.a.createElement(external_antd_["Tooltip"], {
      key: color,
      title: themeKey ? formatMessage({
        id: "app.setting.themecolor." + themeKey
      }) : key
    }, /*#__PURE__*/external_React_default.a.createElement(Tag, {
      className: "theme-color-block",
      color: color,
      check: value === key || genThemeToString(value) === key,
      onClick: function onClick() {
        return onChange && onChange(key);
      }
    }));
  })));
};

/* harmony default export */ var src_SettingDrawer_ThemeColor = (/*#__PURE__*/external_React_default.a.forwardRef(ThemeColor_ThemeColor));
// CONCATENATED MODULE: ./packages/layout/src/SettingDrawer/LayoutChange.tsx




var LayoutChange_renderLayoutSettingItem = function renderLayoutSettingItem(item) {
  var action = /*#__PURE__*/external_React_default.a.cloneElement(item.action, {
    disabled: item.disabled
  });
  return /*#__PURE__*/external_React_default.a.createElement(external_antd_["Tooltip"], {
    title: item.disabled ? item.disabledReason : '',
    placement: "left"
  }, /*#__PURE__*/external_React_default.a.createElement(external_antd_["List"].Item, {
    actions: [action]
  }, /*#__PURE__*/external_React_default.a.createElement("span", {
    style: {
      opacity: item.disabled ? 0.5 : 1
    }
  }, item.title)));
};

var LayoutChange_LayoutSetting = function LayoutSetting(_ref) {
  var _ref$settings = _ref.settings,
      settings = _ref$settings === void 0 ? {} : _ref$settings,
      changeSetting = _ref.changeSetting;
  var formatMessage = SettingDrawer_getFormatMessage();

  var _ref2 = settings || src_defaultSettings,
      contentWidth = _ref2.contentWidth,
      splitMenus = _ref2.splitMenus,
      fixedHeader = _ref2.fixedHeader,
      layout = _ref2.layout,
      fixSiderbar = _ref2.fixSiderbar;

  return /*#__PURE__*/external_React_default.a.createElement(external_antd_["List"], {
    split: false,
    dataSource: [{
      title: formatMessage({
        id: 'app.setting.content-width',
        defaultMessage: 'Content Width'
      }),
      action: /*#__PURE__*/external_React_default.a.createElement(external_antd_["Select"], {
        value: contentWidth || 'Fixed',
        size: "small",
        onSelect: function onSelect(value) {
          return changeSetting('contentWidth', value);
        },
        style: {
          width: 80
        }
      }, layout === 'side' ? null : /*#__PURE__*/external_React_default.a.createElement(external_antd_["Select"].Option, {
        value: "Fixed"
      }, formatMessage({
        id: 'app.setting.content-width.fixed',
        defaultMessage: 'Fixed'
      })), /*#__PURE__*/external_React_default.a.createElement(external_antd_["Select"].Option, {
        value: "Fluid"
      }, formatMessage({
        id: 'app.setting.content-width.fluid',
        defaultMessage: 'Fluid'
      })))
    }, {
      title: formatMessage({
        id: 'app.setting.fixedheader',
        defaultMessage: 'Fixed Header'
      }),
      action: /*#__PURE__*/external_React_default.a.createElement(external_antd_["Switch"], {
        size: "small",
        checked: !!fixedHeader,
        onChange: function onChange(checked) {
          return changeSetting('fixedHeader', checked);
        }
      })
    }, {
      title: formatMessage({
        id: 'app.setting.fixedsidebar',
        defaultMessage: 'Fixed Sidebar'
      }),
      disabled: layout === 'top',
      disabledReason: formatMessage({
        id: 'app.setting.fixedsidebar.hint',
        defaultMessage: 'Works on Side Menu Layout'
      }),
      action: /*#__PURE__*/external_React_default.a.createElement(external_antd_["Switch"], {
        size: "small",
        checked: !!fixSiderbar,
        onChange: function onChange(checked) {
          return changeSetting('fixSiderbar', checked);
        }
      })
    }, {
      title: formatMessage({
        id: 'app.setting.splitMenus'
      }),
      disabled: layout !== 'mix',
      action: /*#__PURE__*/external_React_default.a.createElement(external_antd_["Switch"], {
        size: "small",
        checked: !!splitMenus,
        onChange: function onChange(checked) {
          return changeSetting('splitMenus', checked);
        }
      })
    }],
    renderItem: LayoutChange_renderLayoutSettingItem
  });
};

/* harmony default export */ var LayoutChange = (LayoutChange_LayoutSetting);
// CONCATENATED MODULE: ./packages/layout/src/SettingDrawer/RegionalChange.tsx





var RegionalChange_RegionalSetting = function RegionalSetting(_ref) {
  var _ref$settings = _ref.settings,
      settings = _ref$settings === void 0 ? {} : _ref$settings,
      changeSetting = _ref.changeSetting;
  var formatMessage = SettingDrawer_getFormatMessage();
  var regionalSetting = ['header', 'footer', 'menu', 'menuHeader'];
  return /*#__PURE__*/external_React_default.a.createElement(external_antd_["List"], {
    split: false,
    renderItem: LayoutChange_renderLayoutSettingItem,
    dataSource: regionalSetting.map(function (key) {
      return {
        title: formatMessage({
          id: "app.setting.regionalsettings." + key
        }),
        action: /*#__PURE__*/external_React_default.a.createElement(external_antd_["Switch"], {
          size: "small",
          checked: settings[key + "Render"] || settings[key + "Render"] === undefined,
          onChange: function onChange(checked) {
            return changeSetting(key + "Render", checked === true ? undefined : false);
          }
        })
      };
    })
  });
};

/* harmony default export */ var RegionalChange = (RegionalChange_RegionalSetting);
// CONCATENATED MODULE: ./packages/layout/src/SettingDrawer/index.tsx
function SettingDrawer_ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }

function SettingDrawer_objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { SettingDrawer_ownKeys(Object(source), true).forEach(function (key) { SettingDrawer_defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { SettingDrawer_ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }

function SettingDrawer_defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }



















var SettingDrawer_Body = function Body(_ref) {
  var children = _ref.children,
      prefixCls = _ref.prefixCls,
      title = _ref.title;
  return /*#__PURE__*/external_React_default.a.createElement("div", {
    style: {
      marginBottom: 24
    }
  }, /*#__PURE__*/external_React_default.a.createElement("h3", {
    className: prefixCls + "-drawer-title"
  }, title), children);
};

var oldSetting = {};

var getDifferentSetting = function getDifferentSetting(state) {
  var stateObj = {};
  Object.keys(state).forEach(function (key) {
    if (state[key] !== oldSetting[key] && key !== 'collapse') {
      stateObj[key] = state[key];
    }

    if (key.includes('Render')) {
      stateObj[key] = state[key] === 'false' || state[key] === false ? false : undefined;
    }
  });
  delete stateObj.menu;
  return stateObj;
};

var SettingDrawer_getFormatMessage = function getFormatMessage() {
  var formatMessage = function formatMessage(_ref2) {
    var id = _ref2.id,
        defaultMessage = _ref2.defaultMessage;
    var locales = src_locales();

    if (locales[id]) {
      return locales[id];
    }

    if (defaultMessage) {
      return defaultMessage;
    }

    return id;
  };

  return formatMessage;
};

var SettingDrawer_updateTheme = function updateTheme(dark, color, hideMessageLoading, publicPath) {
  if (hideMessageLoading === void 0) {
    hideMessageLoading = false;
  }

  if (publicPath === void 0) {
    publicPath = '/theme';
  }

  // ssr
  if (typeof window === 'undefined' || !window.umi_plugin_ant_themeVar) {
    return;
  }

  var formatMessage = SettingDrawer_getFormatMessage();

  var hide = function hide() {
    return null;
  };

  if (!hideMessageLoading) {
    hide = external_antd_["message"].loading(formatMessage({
      id: 'app.setting.loading',
      defaultMessage: '正在加载主题'
    }));
  }

  var href = dark ? publicPath + "/dark" : publicPath + "/"; // 如果是 dark，并且是 color=daybreak，无需进行拼接

  var colorFileName = dark && color ? "-" + encodeURIComponent(color) : encodeURIComponent(color || '');

  if (color === 'daybreak' && dark) {
    colorFileName = '';
  }

  var dom = document.getElementById('theme-style'); // 如果这两个都是空

  if (!href && !colorFileName) {
    if (dom) {
      dom.remove();
      localStorage.removeItem('site-theme');
    }

    return;
  }

  var url = "" + href + (colorFileName || '') + ".css";

  if (dom) {
    dom.onload = function () {
      window.setTimeout(function () {
        hide();
      });
    };

    dom.href = url;
  } else {
    var style = document.createElement('link');
    style.type = 'text/css';
    style.rel = 'stylesheet';
    style.id = 'theme-style';

    style.onload = function () {
      window.setTimeout(function () {
        hide();
      });
    };

    style.href = url;

    if (document.body.append) {
      document.body.append(style);
    } else {
      document.body.appendChild(style);
    }
  }

  localStorage.setItem('site-theme', dark ? 'dark' : 'light');
};

var getThemeList = function getThemeList(settings) {
  var formatMessage = SettingDrawer_getFormatMessage();
  var list = window.umi_plugin_ant_themeVar || [];
  var themeList = [{
    key: 'light',
    url: 'https://gw.alipayobjects.com/zos/antfincdn/NQ%24zoisaD2/jpRkZQMyYRryryPNtyIC.svg',
    title: formatMessage({
      id: 'app.setting.pagestyle.light'
    })
  }];
  var darkColorList = [{
    key: 'daybreak',
    color: '#1890ff',
    theme: 'dark'
  }];
  var lightColorList = [{
    key: 'daybreak',
    color: '#1890ff',
    theme: 'dark'
  }];

  if (settings.layout !== 'mix') {
    themeList.push({
      key: 'dark',
      url: 'https://gw.alipayobjects.com/zos/antfincdn/XwFOFbLkSM/LCkqqYNmvBEbokSDscrm.svg',
      title: formatMessage({
        id: 'app.setting.pagestyle.dark',
        defaultMessage: ''
      })
    });
  }

  if (list.find(function (item) {
    return item.theme === 'dark';
  })) {
    themeList.push({
      key: 'realDark',
      url: 'https://gw.alipayobjects.com/zos/antfincdn/hmKaLQvmY2/LCkqqYNmvBEbokSDscrm.svg',
      title: formatMessage({
        id: 'app.setting.pagestyle.dark',
        defaultMessage: ''
      })
    });
  } // insert  theme color List


  list.forEach(function (item) {
    var color = (item.modifyVars || {})['@primary-color'];

    if (item.theme === 'dark' && color) {
      darkColorList.push(SettingDrawer_objectSpread({
        color: color
      }, item));
    }

    if (!item.theme || item.theme === 'light') {
      lightColorList.push(SettingDrawer_objectSpread({
        color: color
      }, item));
    }
  });
  return {
    colorList: {
      dark: darkColorList,
      light: lightColorList
    },
    themeList: themeList
  };
};
/**
 * 初始化的时候需要做的工作
 * @param param0
 */


var SettingDrawer_initState = function initState(settings, onSettingChange, publicPath) {
  if (!Object(isBrowser["a" /* default */])()) {
    return;
  }

  var loadedStyle = false;

  if (window.location.search) {
    var params = Object(qs_lib["parse"])(window.location.search.replace('?', ''));
    var replaceSetting = {};
    Object.keys(params).forEach(function (key) {
      if (src_defaultSettings[key] || src_defaultSettings[key] === undefined) {
        replaceSetting[key] = params[key];

        if (key.includes('Render')) {
          replaceSetting[key] = params[key] === 'false' ? false : undefined;
        }
      }
    });

    if (onSettingChange) {
      onSettingChange(SettingDrawer_objectSpread(SettingDrawer_objectSpread({}, settings), replaceSetting));
    } // 如果 url 中设置主题，进行一次加载。


    if (oldSetting.navTheme !== params.navTheme && params.navTheme) {
      SettingDrawer_updateTheme(settings.navTheme === 'realDark', params.primaryColor, true, publicPath);
      loadedStyle = true;
    }
  }

  if (loadedStyle) {
    return;
  } // 如果 url 中没有设置主题，并且 url 中的没有加载，进行一次加载。


  if (src_defaultSettings.navTheme !== settings.navTheme && settings.navTheme) {
    SettingDrawer_updateTheme(settings.navTheme === 'realDark', settings.primaryColor, true, publicPath);
  }
};

var SettingDrawer_getParamsFromUrl = function getParamsFromUrl(settings) {
  if (!Object(isBrowser["a" /* default */])()) {
    return src_defaultSettings;
  } // 第一次进入与 浏览器参数同步一下


  var params = {};

  if (window.location.search) {
    params = Object(qs_lib["parse"])(window.location.search.replace('?', ''));
  }

  return SettingDrawer_objectSpread(SettingDrawer_objectSpread(SettingDrawer_objectSpread({}, src_defaultSettings), settings || {}), params);
};

var SettingDrawer_genCopySettingJson = function genCopySettingJson(settingState) {
  return JSON.stringify(omit_js_es(SettingDrawer_objectSpread(SettingDrawer_objectSpread({}, settingState), {}, {
    primaryColor: genStringToTheme(settingState.primaryColor)
  }), ['colorWeak']), null, 2);
};
/**
 * 可视化配置组件
 * @param props
 */


var SettingDrawer_SettingDrawer = function SettingDrawer(props) {
  var _props$settings = props.settings,
      propsSettings = _props$settings === void 0 ? undefined : _props$settings,
      _props$hideLoading = props.hideLoading,
      hideLoading = _props$hideLoading === void 0 ? false : _props$hideLoading,
      hideColors = props.hideColors,
      hideHintAlert = props.hideHintAlert,
      hideCopyButton = props.hideCopyButton,
      getContainer = props.getContainer,
      onSettingChange = props.onSettingChange,
      _props$prefixCls = props.prefixCls,
      prefixCls = _props$prefixCls === void 0 ? 'ant-pro' : _props$prefixCls;
  var firstRender = Object(external_React_["useRef"])(true);

  var _useMergedState = useMergedState_default()(false, {
    value: props.collapse,
    onChange: props.onCollapseChange
  }),
      show = _useMergedState[0],
      setShow = _useMergedState[1];

  var _useState = Object(external_React_["useState"])(locales_getLanguage()),
      language = _useState[0],
      setLanguage = _useState[1];

  var _useMergedState2 = useMergedState_default()(function () {
    return SettingDrawer_getParamsFromUrl(propsSettings);
  }, {
    value: propsSettings,
    onChange: onSettingChange
  }),
      settingState = _useMergedState2[0],
      setSettingState = _useMergedState2[1];

  var preStateRef = Object(external_React_["useRef"])(settingState);

  var _ref3 = settingState || {},
      _ref3$navTheme = _ref3.navTheme,
      navTheme = _ref3$navTheme === void 0 ? 'dark' : _ref3$navTheme,
      _ref3$primaryColor = _ref3.primaryColor,
      primaryColor = _ref3$primaryColor === void 0 ? 'daybreak' : _ref3$primaryColor,
      _ref3$layout = _ref3.layout,
      layout = _ref3$layout === void 0 ? 'sidemenu' : _ref3$layout,
      colorWeak = _ref3.colorWeak;

  Object(external_React_["useEffect"])(function () {
    // 语言修改，这个是和 locale 是配置起来的
    var onLanguageChange = function onLanguageChange() {
      if (language !== locales_getLanguage()) {
        setLanguage(locales_getLanguage());
      }
    }; // 记住默认的选择，方便做 diff，然后保存到 url 参数中


    oldSetting = SettingDrawer_objectSpread(SettingDrawer_objectSpread({}, src_defaultSettings), propsSettings);
    /**
     * 如果不是浏览器 都没有必要做了
     */

    if (!Object(isBrowser["a" /* default */])()) {
      return function () {
        return null;
      };
    }

    SettingDrawer_initState(settingState, setSettingState, props.publicPath);
    window.addEventListener('languagechange', onLanguageChange, {
      passive: true
    });
    return function () {
      return window.removeEventListener('languagechange', onLanguageChange);
    };
  }, []);
  /**
   * 修改设置
   * @param key
   * @param value
   * @param hideMessageLoading
   */

  var changeSetting = function changeSetting(key, value, hideMessageLoading) {
    var nextState = SettingDrawer_objectSpread({}, preStateRef.current);

    nextState[key] = value;

    if (key === 'navTheme') {
      SettingDrawer_updateTheme(value === 'realDark', undefined, hideMessageLoading, props.publicPath);
      nextState.primaryColor = 'daybreak';
    }

    if (key === 'primaryColor') {
      SettingDrawer_updateTheme(nextState.navTheme === 'realDark', value === 'daybreak' ? '' : value, hideMessageLoading, props.publicPath);
    }

    if (key === 'layout') {
      nextState.contentWidth = value === 'top' ? 'Fixed' : 'Fluid';
    }

    if (key === 'layout' && value !== 'mix') {
      nextState.splitMenus = false;
    }

    if (key === 'layout' && value === 'mix') {
      nextState.navTheme = 'light';
    }

    if (key === 'colorWeak' && value === true) {
      var dom = document.querySelector('body div');

      if (!dom) {
        return;
      }

      dom.dataset.prosettingdrawer = dom.style.filter;
      dom.style.filter = 'invert(80%)';
    }

    if (key === 'colorWeak' && value === false) {
      var _dom = document.querySelector('body div');

      if (!_dom) {
        return;
      }

      _dom.style.filter = _dom.dataset.prosettingdrawer || 'none';
      delete _dom.dataset.prosettingdrawer;
    }

    preStateRef.current = nextState;
    setSettingState(nextState);
  };

  var formatMessage = SettingDrawer_getFormatMessage();
  var themeList = getThemeList(settingState);
  Object(external_React_["useEffect"])(function () {
    /**
     * 如果不是浏览器 都没有必要做了
     */
    if (!Object(isBrowser["a" /* default */])()) {
      return;
    }

    if (firstRender.current) {
      firstRender.current = false;
      return;
    }

    var browserHistory = createBrowserHistory();
    var params = {};

    if (window.location.search) {
      params = Object(qs_lib["parse"])(window.location.search.replace('?', ''));
    }

    var diffParams = getDifferentSetting(SettingDrawer_objectSpread(SettingDrawer_objectSpread({}, params), settingState));

    if (Object.keys(settingState).length < 1) {
      return;
    }

    browserHistory.replace({
      search: Object(qs_lib["stringify"])(diffParams)
    });
  }, [JSON.stringify(settingState)]);
  var baseClassName = prefixCls + "-setting";
  return /*#__PURE__*/external_React_default.a.createElement(external_antd_["Drawer"], {
    visible: show,
    width: 300,
    onClose: function onClose() {
      return setShow(false);
    },
    placement: "right",
    getContainer: getContainer,
    handler: /*#__PURE__*/external_React_default.a.createElement("div", {
      className: baseClassName + "-drawer-handle",
      onClick: function onClick() {
        return setShow(!show);
      }
    }, show ? /*#__PURE__*/external_React_default.a.createElement(icons_CloseOutlined, {
      style: {
        color: '#fff',
        fontSize: 20
      }
    }) : /*#__PURE__*/external_React_default.a.createElement(icons_SettingOutlined, {
      style: {
        color: '#fff',
        fontSize: 20
      }
    })),
    style: {
      zIndex: 999
    }
  }, /*#__PURE__*/external_React_default.a.createElement("div", {
    className: baseClassName + "-drawer-content"
  }, /*#__PURE__*/external_React_default.a.createElement(SettingDrawer_Body, {
    title: formatMessage({
      id: 'app.setting.pagestyle',
      defaultMessage: 'Page style setting'
    }),
    prefixCls: baseClassName
  }, /*#__PURE__*/external_React_default.a.createElement(SettingDrawer_BlockCheckbox, {
    prefixCls: baseClassName,
    list: themeList.themeList,
    value: navTheme,
    key: "navTheme",
    onChange: function onChange(value) {
      return changeSetting('navTheme', value, hideLoading);
    }
  })), /*#__PURE__*/external_React_default.a.createElement(SettingDrawer_Body, {
    title: formatMessage({
      id: 'app.setting.themecolor',
      defaultMessage: 'Theme color'
    }),
    prefixCls: baseClassName
  }, /*#__PURE__*/external_React_default.a.createElement(src_SettingDrawer_ThemeColor, {
    value: primaryColor,
    colors: hideColors ? [] : themeList.colorList[navTheme === 'realDark' ? 'dark' : 'light'],
    formatMessage: formatMessage,
    onChange: function onChange(color) {
      return changeSetting('primaryColor', color, hideLoading);
    }
  })), /*#__PURE__*/external_React_default.a.createElement(external_antd_["Divider"], null), /*#__PURE__*/external_React_default.a.createElement(SettingDrawer_Body, {
    prefixCls: baseClassName,
    title: formatMessage({
      id: 'app.setting.navigationmode'
    })
  }, /*#__PURE__*/external_React_default.a.createElement(SettingDrawer_BlockCheckbox, {
    prefixCls: baseClassName,
    value: layout,
    key: "layout",
    list: [{
      key: 'side',
      url: 'https://gw.alipayobjects.com/zos/antfincdn/XwFOFbLkSM/LCkqqYNmvBEbokSDscrm.svg',
      title: formatMessage({
        id: 'app.setting.sidemenu'
      })
    }, {
      key: 'top',
      url: 'https://gw.alipayobjects.com/zos/antfincdn/URETY8%24STp/KDNDBbriJhLwuqMoxcAr.svg',
      title: formatMessage({
        id: 'app.setting.topmenu'
      })
    }, {
      key: 'mix',
      url: 'https://gw.alipayobjects.com/zos/antfincdn/x8Ob%26B8cy8/LCkqqYNmvBEbokSDscrm.svg',
      title: formatMessage({
        id: 'app.setting.mixmenu'
      })
    }],
    onChange: function onChange(value) {
      return changeSetting('layout', value, hideLoading);
    }
  })), /*#__PURE__*/external_React_default.a.createElement(LayoutChange, {
    settings: settingState,
    changeSetting: changeSetting
  }), /*#__PURE__*/external_React_default.a.createElement(external_antd_["Divider"], null), /*#__PURE__*/external_React_default.a.createElement(SettingDrawer_Body, {
    prefixCls: baseClassName,
    title: formatMessage({
      id: 'app.setting.regionalsettings'
    })
  }, /*#__PURE__*/external_React_default.a.createElement(RegionalChange, {
    settings: settingState,
    changeSetting: changeSetting
  })), /*#__PURE__*/external_React_default.a.createElement(external_antd_["Divider"], null), /*#__PURE__*/external_React_default.a.createElement(SettingDrawer_Body, {
    prefixCls: baseClassName,
    title: formatMessage({
      id: 'app.setting.othersettings'
    })
  }, /*#__PURE__*/external_React_default.a.createElement(external_antd_["List"], {
    split: false,
    renderItem: LayoutChange_renderLayoutSettingItem,
    dataSource: [{
      title: formatMessage({
        id: 'app.setting.weakmode'
      }),
      action: /*#__PURE__*/external_React_default.a.createElement(external_antd_["Switch"], {
        size: "small",
        checked: !!colorWeak,
        onChange: function onChange(checked) {
          return changeSetting('colorWeak', checked);
        }
      })
    }]
  })), hideHintAlert && hideCopyButton ? null : /*#__PURE__*/external_React_default.a.createElement(external_antd_["Divider"], null), hideHintAlert ? null : /*#__PURE__*/external_React_default.a.createElement(external_antd_["Alert"], {
    type: "warning",
    message: formatMessage({
      id: 'app.setting.production.hint'
    }),
    icon: /*#__PURE__*/external_React_default.a.createElement(icons_NotificationOutlined, null),
    showIcon: true,
    style: {
      marginBottom: 16
    }
  }), hideCopyButton ? null : /*#__PURE__*/external_React_default.a.createElement(react_copy_to_clipboard_lib_default.a, {
    text: SettingDrawer_genCopySettingJson(settingState),
    onCopy: function onCopy() {
      return external_antd_["message"].success(formatMessage({
        id: 'app.setting.copyinfo'
      }));
    }
  }, /*#__PURE__*/external_React_default.a.createElement(external_antd_["Button"], {
    block: true
  }, /*#__PURE__*/external_React_default.a.createElement(icons_CopyOutlined, null), " ", formatMessage({
    id: 'app.setting.copy'
  })))));
};

/* harmony default export */ var layout_src_SettingDrawer = (SettingDrawer_SettingDrawer);
// EXTERNAL MODULE: ./packages/layout/src/GridContent/GridContent.less
var GridContent_GridContent = __webpack_require__(170);

// CONCATENATED MODULE: ./packages/layout/src/GridContent/index.tsx





/**
 * This component can support contentWidth so you don't need to calculate the width
 * contentWidth=Fixed, width will is 1200
 * @param props
 */
var src_GridContent_GridContent = function GridContent(props) {
  var value = Object(external_React_["useContext"])(RouteContext);
  var children = props.children,
      propsContentWidth = props.contentWidth,
      propsClassName = props.className,
      style = props.style,
      _props$prefixCls = props.prefixCls,
      prefixCls = _props$prefixCls === void 0 ? 'ant-pro' : _props$prefixCls;
  var contentWidth = propsContentWidth || value.contentWidth;
  var className = prefixCls + "-grid-content";

  if (contentWidth === 'Fixed') {
    className = prefixCls + "-grid-content wide";
  }

  return /*#__PURE__*/external_React_default.a.createElement("div", {
    className: classnames_default()(className, propsClassName),
    style: style
  }, /*#__PURE__*/external_React_default.a.createElement("div", {
    className: prefixCls + "-grid-content-children"
  }, children));
};

/* harmony default export */ var src_GridContent = (src_GridContent_GridContent);
// EXTERNAL MODULE: ./packages/layout/src/PageContainer/index.less
var src_PageContainer = __webpack_require__(171);

// EXTERNAL MODULE: ./packages/layout/src/FooterToolbar/index.less
var src_FooterToolbar = __webpack_require__(172);

// CONCATENATED MODULE: ./packages/layout/src/FooterToolbar/index.tsx
function FooterToolbar_extends() { FooterToolbar_extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return FooterToolbar_extends.apply(this, arguments); }

function FooterToolbar_ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }

function FooterToolbar_objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { FooterToolbar_ownKeys(Object(source), true).forEach(function (key) { FooterToolbar_defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { FooterToolbar_ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }

function FooterToolbar_defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }

function FooterToolbar_objectWithoutPropertiesLoose(source, excluded) { if (source == null) return {}; var target = {}; var sourceKeys = Object.keys(source); var key, i; for (i = 0; i < sourceKeys.length; i++) { key = sourceKeys[i]; if (excluded.indexOf(key) >= 0) continue; target[key] = source[key]; } return target; }







var FooterToolbar_FooterToolbar = function FooterToolbar(props) {
  var children = props.children,
      _props$prefixCls = props.prefixCls,
      prefixCls = _props$prefixCls === void 0 ? 'ant-pro' : _props$prefixCls,
      className = props.className,
      extra = props.extra,
      renderContent = props.renderContent,
      restProps = FooterToolbar_objectWithoutPropertiesLoose(props, ["children", "prefixCls", "className", "extra", "renderContent"]);

  var baseClassName = prefixCls + "-footer-bar";
  var value = Object(external_React_["useContext"])(RouteContext);
  var width = Object(external_React_["useMemo"])(function () {
    var hasSiderMenu = value.hasSiderMenu,
        isMobile = value.isMobile,
        siderWidth = value.siderWidth;

    if (!hasSiderMenu) {
      return undefined;
    } // 0 or undefined


    if (!siderWidth) {
      return '100%';
    }

    return isMobile ? '100%' : "calc(100% - " + siderWidth + "px)";
  }, [value.collapsed, value.hasSiderMenu, value.isMobile, value.siderWidth]);
  var dom = /*#__PURE__*/external_React_default.a.createElement(external_React_default.a.Fragment, null, /*#__PURE__*/external_React_default.a.createElement("div", {
    className: baseClassName + "-left"
  }, extra), /*#__PURE__*/external_React_default.a.createElement("div", {
    className: baseClassName + "-right"
  }, /*#__PURE__*/external_React_default.a.createElement(external_antd_["Space"], null, children)));
  /**
   * 告诉 props 是否存在 footerBar
   */

  Object(external_React_["useEffect"])(function () {
    if (!value || !(value == null ? void 0 : value.setHasFooterToolbar)) {
      return function () {};
    }

    value == null ? void 0 : value.setHasFooterToolbar(true);
    return function () {
      if (!value || !(value == null ? void 0 : value.setHasFooterToolbar)) {
        return;
      }

      value == null ? void 0 : value.setHasFooterToolbar(false);
    };
  }, []);
  return /*#__PURE__*/external_React_default.a.createElement("div", FooterToolbar_extends({
    className: classnames_default()(className, "" + baseClassName),
    style: {
      width: width
    }
  }, restProps), renderContent ? renderContent(FooterToolbar_objectSpread(FooterToolbar_objectSpread(FooterToolbar_objectSpread({}, props), value), {}, {
    leftWidth: width
  }), dom) : dom);
};

/* harmony default export */ var layout_src_FooterToolbar = (FooterToolbar_FooterToolbar);
// CONCATENATED MODULE: ./packages/layout/src/PageContainer/index.tsx
function PageContainer_ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; }

function PageContainer_objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { PageContainer_ownKeys(Object(source), true).forEach(function (key) { PageContainer_defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { PageContainer_ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; }

function PageContainer_defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }

function PageContainer_objectWithoutPropertiesLoose(source, excluded) { if (source == null) return {}; var target = {}; var sourceKeys = Object.keys(source); var key, i; for (i = 0; i < sourceKeys.length; i++) { key = sourceKeys[i]; if (excluded.indexOf(key) >= 0) continue; target[key] = source[key]; } return target; }

function PageContainer_extends() { PageContainer_extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; return PageContainer_extends.apply(this, arguments); }









/**
 * render Footer tabList
 * In order to be compatible with the old version of the PageHeader
 * basically all the functions are implemented.
 */
var PageContainer_renderFooter = function renderFooter(_ref) {
  var tabList = _ref.tabList,
      tabActiveKey = _ref.tabActiveKey,
      onTabChange = _ref.onTabChange,
      tabBarExtraContent = _ref.tabBarExtraContent,
      tabProps = _ref.tabProps,
      prefixedClassName = _ref.prefixedClassName;

  if (tabList && tabList.length) {
    return /*#__PURE__*/external_React_default.a.createElement(external_antd_["Tabs"], PageContainer_extends({
      className: prefixedClassName + "-tabs",
      activeKey: tabActiveKey,
      onChange: function onChange(key) {
        if (onTabChange) {
          onTabChange(key);
        }
      },
      tabBarExtraContent: tabBarExtraContent
    }, tabProps), tabList.map(function (item, index) {
      return (
        /*#__PURE__*/
        // eslint-disable-next-line react/no-array-index-key
        external_React_default.a.createElement(external_antd_["Tabs"].TabPane, PageContainer_extends({}, item, {
          tab: item.tab,
          key: item.key || index
        }))
      );
    }));
  }

  return null;
};

var PageContainer_renderPageHeader = function renderPageHeader(content, extraContent, prefixedClassName) {
  if (!content && !extraContent) {
    return null;
  }

  return /*#__PURE__*/external_React_default.a.createElement("div", {
    className: prefixedClassName + "-detail"
  }, /*#__PURE__*/external_React_default.a.createElement("div", {
    className: prefixedClassName + "-main"
  }, /*#__PURE__*/external_React_default.a.createElement("div", {
    className: prefixedClassName + "-row"
  }, content && /*#__PURE__*/external_React_default.a.createElement("div", {
    className: prefixedClassName + "-content"
  }, content), extraContent && /*#__PURE__*/external_React_default.a.createElement("div", {
    className: prefixedClassName + "-extraContent"
  }, extraContent))));
};

var PageContainer_defaultPageHeaderRender = function defaultPageHeaderRender(props, value) {
  var title = props.title,
      content = props.content,
      pageHeaderRender = props.pageHeaderRender,
      extraContent = props.extraContent,
      style = props.style,
      prefixCls = props.prefixCls,
      restProps = PageContainer_objectWithoutPropertiesLoose(props, ["title", "content", "pageHeaderRender", "extraContent", "style", "prefixCls"]);

  if (pageHeaderRender) {
    return pageHeaderRender(PageContainer_objectSpread(PageContainer_objectSpread({}, props), value));
  }

  var pageHeaderTitle = title;

  if (!title && title !== false) {
    pageHeaderTitle = value.title;
  }

  return /*#__PURE__*/external_React_default.a.createElement(external_antd_["PageHeader"], PageContainer_extends({}, value, {
    title: pageHeaderTitle
  }, restProps, {
    footer: PageContainer_renderFooter(PageContainer_objectSpread(PageContainer_objectSpread({}, restProps), {}, {
      prefixedClassName: value.prefixedClassName
    })),
    prefixCls: prefixCls
  }), PageContainer_renderPageHeader(content, extraContent, value.prefixedClassName));
};

var PageContainer_PageContainer = function PageContainer(props) {
  var _classNames;

  var children = props.children,
      style = props.style,
      footer = props.footer,
      ghost = props.ghost,
      _props$prefixCls = props.prefixCls,
      prefixCls = _props$prefixCls === void 0 ? 'ant-pro' : _props$prefixCls;
  var value = Object(external_React_["useContext"])(RouteContext);
  var prefixedClassName = prefixCls + "-page-container";
  var className = classnames_default()(prefixedClassName, props.className, (_classNames = {}, _classNames[prefixCls + "-page-container-ghost"] = ghost, _classNames));
  return /*#__PURE__*/external_React_default.a.createElement("div", {
    style: style,
    className: className
  }, /*#__PURE__*/external_React_default.a.createElement("div", {
    className: prefixedClassName + "-warp"
  }, PageContainer_defaultPageHeaderRender(props, PageContainer_objectSpread(PageContainer_objectSpread({}, value), {}, {
    prefixCls: undefined,
    prefixedClassName: prefixedClassName
  }))), /*#__PURE__*/external_React_default.a.createElement(src_GridContent, null, children ? /*#__PURE__*/external_React_default.a.createElement("div", null, /*#__PURE__*/external_React_default.a.createElement("div", {
    className: prefixedClassName + "-children-content"
  }, children), value.hasFooterToolbar && /*#__PURE__*/external_React_default.a.createElement("div", {
    style: {
      height: 48,
      marginTop: 24
    }
  })) : null), footer && /*#__PURE__*/external_React_default.a.createElement(layout_src_FooterToolbar, null, footer));
};

/* harmony default export */ var layout_src_PageContainer = (PageContainer_PageContainer);
// CONCATENATED MODULE: ./packages/layout/src/index.tsx












var PageHeaderWrapper = layout_src_PageContainer;

/* harmony default export */ var src = __webpack_exports__["default"] = (layout_src_BasicLayout);

/***/ }),
/* 174 */
/***/ (function(module, __webpack_exports__, __webpack_require__) {

"use strict";
// ESM COMPAT FLAG
__webpack_require__.r(__webpack_exports__);

// EXPORTS
__webpack_require__.d(__webpack_exports__, "Field", function() { return /* reexport */ es_Field; });
__webpack_require__.d(__webpack_exports__, "List", function() { return /* reexport */ es_List; });
__webpack_require__.d(__webpack_exports__, "useForm", function() { return /* reexport */ es_useForm; });
__webpack_require__.d(__webpack_exports__, "FormProvider", function() { return /* reexport */ FormContext_FormProvider; });

// EXTERNAL MODULE: external "React"
var external_React_ = __webpack_require__(0);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/objectWithoutProperties.js + 1 modules
var objectWithoutProperties = __webpack_require__(8);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/defineProperty.js
var defineProperty = __webpack_require__(5);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/toConsumableArray.js + 3 modules
var toConsumableArray = __webpack_require__(6);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/classCallCheck.js
var classCallCheck = __webpack_require__(9);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/createClass.js
var createClass = __webpack_require__(11);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/inherits.js + 1 modules
var inherits = __webpack_require__(15);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/possibleConstructorReturn.js
var possibleConstructorReturn = __webpack_require__(21);

// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/getPrototypeOf.js
var getPrototypeOf = __webpack_require__(16);

// EXTERNAL MODULE: ./node_modules/rc-util/es/Children/toArray.js
var toArray = __webpack_require__(28);

// EXTERNAL MODULE: ./node_modules/rc-util/es/warning.js
var warning = __webpack_require__(12);

// CONCATENATED MODULE: ./node_modules/rc-field-form/es/FieldContext.js


var HOOK_MARK = 'RC_FORM_INTERNAL_HOOKS'; // eslint-disable-next-line @typescript-eslint/no-explicit-any

var FieldContext_warningFunc = function warningFunc() {
  Object(warning["a" /* default */])(false, 'Can not find FormContext. Please make sure you wrap Field under Form.');
};

var Context = /*#__PURE__*/external_React_["createContext"]({
  getFieldValue: FieldContext_warningFunc,
  getFieldsValue: FieldContext_warningFunc,
  getFieldError: FieldContext_warningFunc,
  getFieldsError: FieldContext_warningFunc,
  isFieldsTouched: FieldContext_warningFunc,
  isFieldTouched: FieldContext_warningFunc,
  isFieldValidating: FieldContext_warningFunc,
  isFieldsValidating: FieldContext_warningFunc,
  resetFields: FieldContext_warningFunc,
  setFields: FieldContext_warningFunc,
  setFieldsValue: FieldContext_warningFunc,
  validateFields: FieldContext_warningFunc,
  submit: FieldContext_warningFunc,
  getInternalHooks: function getInternalHooks() {
    FieldContext_warningFunc();
    return {
      dispatch: FieldContext_warningFunc,
      registerField: FieldContext_warningFunc,
      useSubscribe: FieldContext_warningFunc,
      setInitialValues: FieldContext_warningFunc,
      setCallbacks: FieldContext_warningFunc,
      getFields: FieldContext_warningFunc,
      setValidateMessages: FieldContext_warningFunc,
      setPreserve: FieldContext_warningFunc
    };
  }
});
/* harmony default export */ var FieldContext = (Context);
// CONCATENATED MODULE: ./node_modules/rc-field-form/es/utils/typeUtil.js
function typeUtil_toArray(value) {
  if (value === undefined || value === null) {
    return [];
  }

  return Array.isArray(value) ? value : [value];
}
// EXTERNAL MODULE: ./node_modules/@babel/runtime/regenerator/index.js
var regenerator = __webpack_require__(23);
var regenerator_default = /*#__PURE__*/__webpack_require__.n(regenerator);

// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/asyncToGenerator.js
function asyncGeneratorStep(gen, resolve, reject, _next, _throw, key, arg) {
  try {
    var info = gen[key](arg);
    var value = info.value;
  } catch (error) {
    reject(error);
    return;
  }

  if (info.done) {
    resolve(value);
  } else {
    Promise.resolve(value).then(_next, _throw);
  }
}

function _asyncToGenerator(fn) {
  return function () {
    var self = this,
        args = arguments;
    return new Promise(function (resolve, reject) {
      var gen = fn.apply(self, args);

      function _next(value) {
        asyncGeneratorStep(gen, resolve, reject, _next, _throw, "next", value);
      }

      function _throw(err) {
        asyncGeneratorStep(gen, resolve, reject, _next, _throw, "throw", err);
      }

      _next(undefined);
    });
  };
}
// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/typeof.js
var esm_typeof = __webpack_require__(10);

// EXTERNAL MODULE: ./node_modules/async-validator/dist-web/index.js
var dist_web = __webpack_require__(79);

// CONCATENATED MODULE: ./node_modules/rc-util/es/utils/get.js
function get_get(entity, path) {
  var current = entity;

  for (var i = 0; i < path.length; i += 1) {
    if (current === null || current === undefined) {
      return undefined;
    }

    current = current[path[i]];
  }

  return current;
}
// CONCATENATED MODULE: ./node_modules/rc-util/es/utils/set.js
function ownKeys(object, enumerableOnly) {
  var keys = Object.keys(object);

  if (Object.getOwnPropertySymbols) {
    var symbols = Object.getOwnPropertySymbols(object);
    if (enumerableOnly) symbols = symbols.filter(function (sym) {
      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
    });
    keys.push.apply(keys, symbols);
  }

  return keys;
}

function _objectSpread(target) {
  for (var i = 1; i < arguments.length; i++) {
    var source = arguments[i] != null ? arguments[i] : {};

    if (i % 2) {
      ownKeys(Object(source), true).forEach(function (key) {
        _defineProperty(target, key, source[key]);
      });
    } else if (Object.getOwnPropertyDescriptors) {
      Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
    } else {
      ownKeys(Object(source)).forEach(function (key) {
        Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
      });
    }
  }

  return target;
}

function _defineProperty(obj, key, value) {
  if (key in obj) {
    Object.defineProperty(obj, key, {
      value: value,
      enumerable: true,
      configurable: true,
      writable: true
    });
  } else {
    obj[key] = value;
  }

  return obj;
}

function _toConsumableArray(arr) {
  return _arrayWithoutHoles(arr) || _iterableToArray(arr) || _unsupportedIterableToArray(arr) || _nonIterableSpread();
}

function _nonIterableSpread() {
  throw new TypeError("Invalid attempt to spread non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
}

function _arrayWithoutHoles(arr) {
  if (Array.isArray(arr)) return _arrayLikeToArray(arr);
}

function _toArray(arr) {
  return _arrayWithHoles(arr) || _iterableToArray(arr) || _unsupportedIterableToArray(arr) || _nonIterableRest();
}

function _nonIterableRest() {
  throw new TypeError("Invalid attempt to destructure non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
}

function _unsupportedIterableToArray(o, minLen) {
  if (!o) return;
  if (typeof o === "string") return _arrayLikeToArray(o, minLen);
  var n = Object.prototype.toString.call(o).slice(8, -1);
  if (n === "Object" && o.constructor) n = o.constructor.name;
  if (n === "Map" || n === "Set") return Array.from(o);
  if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen);
}

function _arrayLikeToArray(arr, len) {
  if (len == null || len > arr.length) len = arr.length;

  for (var i = 0, arr2 = new Array(len); i < len; i++) {
    arr2[i] = arr[i];
  }

  return arr2;
}

function _iterableToArray(iter) {
  if (typeof Symbol !== "undefined" && Symbol.iterator in Object(iter)) return Array.from(iter);
}

function _arrayWithHoles(arr) {
  if (Array.isArray(arr)) return arr;
}

function set_set(entity, paths, value) {
  if (!paths.length) {
    return value;
  }

  var _paths = _toArray(paths),
      path = _paths[0],
      restPath = _paths.slice(1);

  var clone;

  if (!entity && typeof path === 'number') {
    clone = [];
  } else if (Array.isArray(entity)) {
    clone = _toConsumableArray(entity);
  } else {
    clone = _objectSpread({}, entity);
  }

  clone[path] = set_set(clone[path], restPath, value);
  return clone;
}
// CONCATENATED MODULE: ./node_modules/rc-field-form/es/utils/valueUtil.js




function valueUtil_ownKeys(object, enumerableOnly) {
  var keys = Object.keys(object);

  if (Object.getOwnPropertySymbols) {
    var symbols = Object.getOwnPropertySymbols(object);
    if (enumerableOnly) symbols = symbols.filter(function (sym) {
      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
    });
    keys.push.apply(keys, symbols);
  }

  return keys;
}

function valueUtil_objectSpread(target) {
  for (var i = 1; i < arguments.length; i++) {
    var source = arguments[i] != null ? arguments[i] : {};

    if (i % 2) {
      valueUtil_ownKeys(Object(source), true).forEach(function (key) {
        Object(defineProperty["a" /* default */])(target, key, source[key]);
      });
    } else if (Object.getOwnPropertyDescriptors) {
      Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
    } else {
      valueUtil_ownKeys(Object(source)).forEach(function (key) {
        Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
      });
    }
  }

  return target;
}




/**
 * Convert name to internal supported format.
 * This function should keep since we still thinking if need support like `a.b.c` format.
 * 'a' => ['a']
 * 123 => [123]
 * ['a', 123] => ['a', 123]
 */

function getNamePath(path) {
  return typeUtil_toArray(path);
}
function getValue(store, namePath) {
  var value = get_get(store, namePath);
  return value;
}
function setValue(store, namePath, value) {
  var newStore = set_set(store, namePath, value);
  return newStore;
}
function cloneByNamePathList(store, namePathList) {
  var newStore = {};
  namePathList.forEach(function (namePath) {
    var value = getValue(store, namePath);
    newStore = setValue(newStore, namePath, value);
  });
  return newStore;
}
function containsNamePath(namePathList, namePath) {
  return namePathList && namePathList.some(function (path) {
    return matchNamePath(path, namePath);
  });
}

function isObject(obj) {
  return Object(esm_typeof["a" /* default */])(obj) === 'object' && obj !== null && Object.getPrototypeOf(obj) === Object.prototype;
}
/**
 * Copy values into store and return a new values object
 * ({ a: 1, b: { c: 2 } }, { a: 4, b: { d: 5 } }) => { a: 4, b: { c: 2, d: 5 } }
 */


function internalSetValues(store, values) {
  var newStore = Array.isArray(store) ? Object(toConsumableArray["a" /* default */])(store) : valueUtil_objectSpread({}, store);

  if (!values) {
    return newStore;
  }

  Object.keys(values).forEach(function (key) {
    var prevValue = newStore[key];
    var value = values[key]; // If both are object (but target is not array), we use recursion to set deep value

    var recursive = isObject(prevValue) && isObject(value);
    newStore[key] = recursive ? internalSetValues(prevValue, value || {}) : value;
  });
  return newStore;
}

function setValues(store) {
  for (var _len = arguments.length, restValues = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
    restValues[_key - 1] = arguments[_key];
  }

  return restValues.reduce(function (current, newStore) {
    return internalSetValues(current, newStore);
  }, store);
}
function matchNamePath(namePath, changedNamePath) {
  if (!namePath || !changedNamePath || namePath.length !== changedNamePath.length) {
    return false;
  }

  return namePath.every(function (nameUnit, i) {
    return changedNamePath[i] === nameUnit;
  });
}
function isSimilar(source, target) {
  if (source === target) {
    return true;
  }

  if (!source && target || source && !target) {
    return false;
  }

  if (!source || !target || Object(esm_typeof["a" /* default */])(source) !== 'object' || Object(esm_typeof["a" /* default */])(target) !== 'object') {
    return false;
  }

  var sourceKeys = Object.keys(source);
  var targetKeys = Object.keys(target);
  var keys = new Set([].concat(Object(toConsumableArray["a" /* default */])(sourceKeys), Object(toConsumableArray["a" /* default */])(targetKeys)));
  return Object(toConsumableArray["a" /* default */])(keys).every(function (key) {
    var sourceValue = source[key];
    var targetValue = target[key];

    if (typeof sourceValue === 'function' && typeof targetValue === 'function') {
      return true;
    }

    return sourceValue === targetValue;
  });
}
function defaultGetValueFromEvent(valuePropName) {
  var event = arguments.length <= 1 ? undefined : arguments[1];

  if (event && event.target && valuePropName in event.target) {
    return event.target[valuePropName];
  }

  return event;
}
/**
 * Moves an array item from one position in an array to another.
 *
 * Note: This is a pure function so a new array will be returned, instead
 * of altering the array argument.
 *
 * @param array         Array in which to move an item.         (required)
 * @param moveIndex     The index of the item to move.          (required)
 * @param toIndex       The index to move item at moveIndex to. (required)
 */

function valueUtil_move(array, moveIndex, toIndex) {
  var length = array.length;

  if (moveIndex < 0 || moveIndex >= length || toIndex < 0 || toIndex >= length) {
    return array;
  }

  var item = array[moveIndex];
  var diff = moveIndex - toIndex;

  if (diff > 0) {
    // move left
    return [].concat(Object(toConsumableArray["a" /* default */])(array.slice(0, toIndex)), [item], Object(toConsumableArray["a" /* default */])(array.slice(toIndex, moveIndex)), Object(toConsumableArray["a" /* default */])(array.slice(moveIndex + 1, length)));
  }

  if (diff < 0) {
    // move right
    return [].concat(Object(toConsumableArray["a" /* default */])(array.slice(0, moveIndex)), Object(toConsumableArray["a" /* default */])(array.slice(moveIndex + 1, toIndex + 1)), [item], Object(toConsumableArray["a" /* default */])(array.slice(toIndex + 1, length)));
  }

  return array;
}
// CONCATENATED MODULE: ./node_modules/rc-field-form/es/utils/messages.js
var typeTemplate = "'${name}' is not a valid ${type}";
var defaultValidateMessages = {
  default: "Validation error on field '${name}'",
  required: "'${name}' is required",
  enum: "'${name}' must be one of [${enum}]",
  whitespace: "'${name}' cannot be empty",
  date: {
    format: "'${name}' is invalid for format date",
    parse: "'${name}' could not be parsed as date",
    invalid: "'${name}' is invalid date"
  },
  types: {
    string: typeTemplate,
    method: typeTemplate,
    array: typeTemplate,
    object: typeTemplate,
    number: typeTemplate,
    date: typeTemplate,
    boolean: typeTemplate,
    integer: typeTemplate,
    float: typeTemplate,
    regexp: typeTemplate,
    email: typeTemplate,
    url: typeTemplate,
    hex: typeTemplate
  },
  string: {
    len: "'${name}' must be exactly ${len} characters",
    min: "'${name}' must be at least ${min} characters",
    max: "'${name}' cannot be longer than ${max} characters",
    range: "'${name}' must be between ${min} and ${max} characters"
  },
  number: {
    len: "'${name}' must equal ${len}",
    min: "'${name}' cannot be less than ${min}",
    max: "'${name}' cannot be greater than ${max}",
    range: "'${name}' must be between ${min} and ${max}"
  },
  array: {
    len: "'${name}' must be exactly ${len} in length",
    min: "'${name}' cannot be less than ${min} in length",
    max: "'${name}' cannot be greater than ${max} in length",
    range: "'${name}' must be between ${min} and ${max} in length"
  },
  pattern: {
    mismatch: "'${name}' does not match pattern ${pattern}"
  }
};
// CONCATENATED MODULE: ./node_modules/rc-field-form/es/utils/validateUtil.js






function validateUtil_ownKeys(object, enumerableOnly) {
  var keys = Object.keys(object);

  if (Object.getOwnPropertySymbols) {
    var symbols = Object.getOwnPropertySymbols(object);
    if (enumerableOnly) symbols = symbols.filter(function (sym) {
      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
    });
    keys.push.apply(keys, symbols);
  }

  return keys;
}

function validateUtil_objectSpread(target) {
  for (var i = 1; i < arguments.length; i++) {
    var source = arguments[i] != null ? arguments[i] : {};

    if (i % 2) {
      validateUtil_ownKeys(Object(source), true).forEach(function (key) {
        Object(defineProperty["a" /* default */])(target, key, source[key]);
      });
    } else if (Object.getOwnPropertyDescriptors) {
      Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
    } else {
      validateUtil_ownKeys(Object(source)).forEach(function (key) {
        Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
      });
    }
  }

  return target;
}





 // Remove incorrect original ts define

var AsyncValidator = dist_web["a" /* default */];
/**
 * Replace with template.
 *   `I'm ${name}` + { name: 'bamboo' } = I'm bamboo
 */

function replaceMessage(template, kv) {
  return template.replace(/\$\{\w+\}/g, function (str) {
    var key = str.slice(2, -1);
    return kv[key];
  });
}
/**
 * We use `async-validator` to validate rules. So have to hot replace the message with validator.
 * { required: '${name} is required' } => { required: () => 'field is required' }
 */


function convertMessages(messages, name, rule, messageVariables) {
  var kv = validateUtil_objectSpread({}, rule, {
    name: name,
    enum: (rule.enum || []).join(', ')
  });

  var replaceFunc = function replaceFunc(template, additionalKV) {
    return function () {
      return replaceMessage(template, validateUtil_objectSpread({}, kv, {}, additionalKV));
    };
  };
  /* eslint-disable no-param-reassign */


  function fillTemplate(source) {
    var target = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
    Object.keys(source).forEach(function (ruleName) {
      var value = source[ruleName];

      if (typeof value === 'string') {
        target[ruleName] = replaceFunc(value, messageVariables);
      } else if (value && Object(esm_typeof["a" /* default */])(value) === 'object') {
        target[ruleName] = {};
        fillTemplate(value, target[ruleName]);
      } else {
        target[ruleName] = value;
      }
    });
    return target;
  }
  /* eslint-enable */


  return fillTemplate(setValues({}, defaultValidateMessages, messages));
}

function validateRule(_x, _x2, _x3, _x4, _x5) {
  return _validateRule.apply(this, arguments);
}
/**
 * We use `async-validator` to validate the value.
 * But only check one value in a time to avoid namePath validate issue.
 */


function _validateRule() {
  _validateRule = _asyncToGenerator( /*#__PURE__*/regenerator_default.a.mark(function _callee2(name, value, rule, options, messageVariables) {
    var cloneRule, subRuleField, validator, messages, result, subResults;
    return regenerator_default.a.wrap(function _callee2$(_context2) {
      while (1) {
        switch (_context2.prev = _context2.next) {
          case 0:
            cloneRule = validateUtil_objectSpread({}, rule); // We should special handle array validate

            subRuleField = null;

            if (cloneRule && cloneRule.type === 'array' && cloneRule.defaultField) {
              subRuleField = cloneRule.defaultField;
              delete cloneRule.defaultField;
            }

            validator = new AsyncValidator(Object(defineProperty["a" /* default */])({}, name, [cloneRule]));
            messages = convertMessages(options.validateMessages, name, cloneRule, messageVariables);
            validator.messages(messages);
            result = [];
            _context2.prev = 7;
            _context2.next = 10;
            return Promise.resolve(validator.validate(Object(defineProperty["a" /* default */])({}, name, value), validateUtil_objectSpread({}, options)));

          case 10:
            _context2.next = 15;
            break;

          case 12:
            _context2.prev = 12;
            _context2.t0 = _context2["catch"](7);

            if (_context2.t0.errors) {
              result = _context2.t0.errors.map(function (_ref2, index) {
                var message = _ref2.message;
                return (// Wrap ReactNode with `key`

                  /*#__PURE__*/
                  external_React_["isValidElement"](message) ? /*#__PURE__*/external_React_["cloneElement"](message, {
                    key: "error_".concat(index)
                  }) : message
                );
              });
            } else {
              console.error(_context2.t0);
              result = [messages.default()];
            }

          case 15:
            if (!(!result.length && subRuleField)) {
              _context2.next = 20;
              break;
            }

            _context2.next = 18;
            return Promise.all(value.map(function (subValue, i) {
              return validateRule("".concat(name, ".").concat(i), subValue, subRuleField, options, messageVariables);
            }));

          case 18:
            subResults = _context2.sent;
            return _context2.abrupt("return", subResults.reduce(function (prev, errors) {
              return [].concat(Object(toConsumableArray["a" /* default */])(prev), Object(toConsumableArray["a" /* default */])(errors));
            }, []));

          case 20:
            return _context2.abrupt("return", result);

          case 21:
          case "end":
            return _context2.stop();
        }
      }
    }, _callee2, null, [[7, 12]]);
  }));
  return _validateRule.apply(this, arguments);
}

function validateRules(namePath, value, rules, options, validateFirst, messageVariables) {
  var name = namePath.join('.'); // Fill rule with context

  var filledRules = rules.map(function (currentRule) {
    var originValidatorFunc = currentRule.validator;

    if (!originValidatorFunc) {
      return currentRule;
    }

    return validateUtil_objectSpread({}, currentRule, {
      validator: function validator(rule, val, callback) {
        var hasPromise = false; // Wrap callback only accept when promise not provided

        var wrappedCallback = function wrappedCallback() {
          for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
            args[_key] = arguments[_key];
          } // Wait a tick to make sure return type is a promise


          Promise.resolve().then(function () {
            Object(warning["a" /* default */])(!hasPromise, 'Your validator function has already return a promise. `callback` will be ignored.');

            if (!hasPromise) {
              callback.apply(void 0, args);
            }
          });
        }; // Get promise


        var promise = originValidatorFunc(rule, val, wrappedCallback);
        hasPromise = promise && typeof promise.then === 'function' && typeof promise.catch === 'function';
        /**
         * 1. Use promise as the first priority.
         * 2. If promise not exist, use callback with warning instead
         */

        Object(warning["a" /* default */])(hasPromise, '`callback` is deprecated. Please return a promise instead.');

        if (hasPromise) {
          promise.then(function () {
            callback();
          }).catch(function (err) {
            callback(err);
          });
        }
      }
    });
  });
  var summaryPromise;

  if (validateFirst === true) {
    // >>>>> Validate by serialization
    summaryPromise = new Promise( /*#__PURE__*/function () {
      var _ref = _asyncToGenerator( /*#__PURE__*/regenerator_default.a.mark(function _callee(resolve) {
        var i, errors;
        return regenerator_default.a.wrap(function _callee$(_context) {
          while (1) {
            switch (_context.prev = _context.next) {
              case 0:
                i = 0;

              case 1:
                if (!(i < filledRules.length)) {
                  _context.next = 11;
                  break;
                }

                _context.next = 4;
                return validateRule(name, value, filledRules[i], options, messageVariables);

              case 4:
                errors = _context.sent;

                if (!errors.length) {
                  _context.next = 8;
                  break;
                }

                resolve(errors);
                return _context.abrupt("return");

              case 8:
                i += 1;
                _context.next = 1;
                break;

              case 11:
                /* eslint-enable */
                resolve([]);

              case 12:
              case "end":
                return _context.stop();
            }
          }
        }, _callee);
      }));

      return function (_x6) {
        return _ref.apply(this, arguments);
      };
    }());
  } else {
    // >>>>> Validate by parallel
    var rulePromises = filledRules.map(function (rule) {
      return validateRule(name, value, rule, options, messageVariables);
    });
    summaryPromise = (validateFirst ? finishOnFirstFailed(rulePromises) : finishOnAllFailed(rulePromises)).then(function (errors) {
      if (!errors.length) {
        return [];
      }

      return Promise.reject(errors);
    });
  } // Internal catch error to avoid console error log.


  summaryPromise.catch(function (e) {
    return e;
  });
  return summaryPromise;
}

function finishOnAllFailed(_x7) {
  return _finishOnAllFailed.apply(this, arguments);
}

function _finishOnAllFailed() {
  _finishOnAllFailed = _asyncToGenerator( /*#__PURE__*/regenerator_default.a.mark(function _callee3(rulePromises) {
    return regenerator_default.a.wrap(function _callee3$(_context3) {
      while (1) {
        switch (_context3.prev = _context3.next) {
          case 0:
            return _context3.abrupt("return", Promise.all(rulePromises).then(function (errorsList) {
              var _ref3;

              var errors = (_ref3 = []).concat.apply(_ref3, Object(toConsumableArray["a" /* default */])(errorsList));

              return errors;
            }));

          case 1:
          case "end":
            return _context3.stop();
        }
      }
    }, _callee3);
  }));
  return _finishOnAllFailed.apply(this, arguments);
}

function finishOnFirstFailed(_x8) {
  return _finishOnFirstFailed.apply(this, arguments);
}

function _finishOnFirstFailed() {
  _finishOnFirstFailed = _asyncToGenerator( /*#__PURE__*/regenerator_default.a.mark(function _callee4(rulePromises) {
    var count;
    return regenerator_default.a.wrap(function _callee4$(_context4) {
      while (1) {
        switch (_context4.prev = _context4.next) {
          case 0:
            count = 0;
            return _context4.abrupt("return", new Promise(function (resolve) {
              rulePromises.forEach(function (promise) {
                promise.then(function (errors) {
                  if (errors.length) {
                    resolve(errors);
                  }

                  count += 1;

                  if (count === rulePromises.length) {
                    resolve([]);
                  }
                });
              });
            }));

          case 2:
          case "end":
            return _context4.stop();
        }
      }
    }, _callee4);
  }));
  return _finishOnFirstFailed.apply(this, arguments);
}
// CONCATENATED MODULE: ./node_modules/rc-field-form/es/Field.js









function Field_ownKeys(object, enumerableOnly) {
  var keys = Object.keys(object);

  if (Object.getOwnPropertySymbols) {
    var symbols = Object.getOwnPropertySymbols(object);
    if (enumerableOnly) symbols = symbols.filter(function (sym) {
      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
    });
    keys.push.apply(keys, symbols);
  }

  return keys;
}

function Field_objectSpread(target) {
  for (var i = 1; i < arguments.length; i++) {
    var source = arguments[i] != null ? arguments[i] : {};

    if (i % 2) {
      Field_ownKeys(Object(source), true).forEach(function (key) {
        Object(defineProperty["a" /* default */])(target, key, source[key]);
      });
    } else if (Object.getOwnPropertyDescriptors) {
      Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
    } else {
      Field_ownKeys(Object(source)).forEach(function (key) {
        Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
      });
    }
  }

  return target;
}

function _createSuper(Derived) {
  return function () {
    var Super = Object(getPrototypeOf["a" /* default */])(Derived),
        result;

    if (_isNativeReflectConstruct()) {
      var NewTarget = Object(getPrototypeOf["a" /* default */])(this).constructor;

      result = Reflect.construct(Super, arguments, NewTarget);
    } else {
      result = Super.apply(this, arguments);
    }

    return Object(possibleConstructorReturn["a" /* default */])(this, result);
  };
}

function _isNativeReflectConstruct() {
  if (typeof Reflect === "undefined" || !Reflect.construct) return false;
  if (Reflect.construct.sham) return false;
  if (typeof Proxy === "function") return true;

  try {
    Date.prototype.toString.call(Reflect.construct(Date, [], function () {}));
    return true;
  } catch (e) {
    return false;
  }
}









function requireUpdate(shouldUpdate, prev, next, prevValue, nextValue, info) {
  if (typeof shouldUpdate === 'function') {
    return shouldUpdate(prev, next, 'source' in info ? {
      source: info.source
    } : {});
  }

  return prevValue !== nextValue;
} // We use Class instead of Hooks here since it will cost much code by using Hooks.


var Field_Field = /*#__PURE__*/function (_React$Component) {
  Object(inherits["a" /* default */])(Field, _React$Component);

  var _super = _createSuper(Field);

  function Field() {
    var _this;

    Object(classCallCheck["a" /* default */])(this, Field);

    _this = _super.apply(this, arguments);
    _this.state = {
      resetCount: 0
    };
    _this.cancelRegisterFunc = null;
    _this.destroy = false;
    /**
     * Follow state should not management in State since it will async update by React.
     * This makes first render of form can not get correct state value.
     */

    _this.touched = false;
    /** Mark when touched & validated. Currently only used for `dependencies` */

    _this.dirty = false;
    _this.validatePromise = null;
    _this.errors = [];

    _this.cancelRegister = function () {
      var preserve = _this.props.preserve;

      if (_this.cancelRegisterFunc) {
        _this.cancelRegisterFunc(preserve);
      }

      _this.cancelRegisterFunc = null;
    }; // ================================== Utils ==================================


    _this.getNamePath = function () {
      var name = _this.props.name;
      var _this$context$prefixN = _this.context.prefixName,
          prefixName = _this$context$prefixN === void 0 ? [] : _this$context$prefixN;
      return name !== undefined ? [].concat(Object(toConsumableArray["a" /* default */])(prefixName), Object(toConsumableArray["a" /* default */])(name)) : [];
    };

    _this.getRules = function () {
      var _this$props$rules = _this.props.rules,
          rules = _this$props$rules === void 0 ? [] : _this$props$rules;
      return rules.map(function (rule) {
        if (typeof rule === 'function') {
          return rule(_this.context);
        }

        return rule;
      });
    };

    _this.refresh = function () {
      if (_this.destroy) return;
      /**
       * Clean up current node.
       */

      _this.setState(function (_ref) {
        var resetCount = _ref.resetCount;
        return {
          resetCount: resetCount + 1
        };
      });
    }; // ========================= Field Entity Interfaces =========================
    // Trigger by store update. Check if need update the component


    _this.onStoreChange = function (prevStore, namePathList, info) {
      var _this$props = _this.props,
          shouldUpdate = _this$props.shouldUpdate,
          _this$props$dependenc = _this$props.dependencies,
          dependencies = _this$props$dependenc === void 0 ? [] : _this$props$dependenc,
          onReset = _this$props.onReset;
      var store = info.store;

      var namePath = _this.getNamePath();

      var prevValue = _this.getValue(prevStore);

      var curValue = _this.getValue(store);

      var namePathMatch = namePathList && containsNamePath(namePathList, namePath); // `setFieldsValue` is a quick access to update related status

      if (info.type === 'valueUpdate' && info.source === 'external' && prevValue !== curValue) {
        _this.touched = true;
        _this.dirty = true;
        _this.validatePromise = null;
        _this.errors = [];
      }

      switch (info.type) {
        case 'reset':
          if (!namePathList || namePathMatch) {
            // Clean up state
            _this.touched = false;
            _this.dirty = false;
            _this.validatePromise = null;
            _this.errors = [];

            if (onReset) {
              onReset();
            }

            _this.refresh();

            return;
          }

          break;

        case 'setField':
          {
            if (namePathMatch) {
              var data = info.data;

              if ('touched' in data) {
                _this.touched = data.touched;
              }

              if ('validating' in data && !('originRCField' in data)) {
                _this.validatePromise = data.validating ? Promise.resolve([]) : null;
              }

              if ('errors' in data) {
                _this.errors = data.errors || [];
              }

              _this.dirty = true;

              _this.reRender();

              return;
            } // Handle update by `setField` with `shouldUpdate`


            if (shouldUpdate && !namePath.length && requireUpdate(shouldUpdate, prevStore, store, prevValue, curValue, info)) {
              _this.reRender();

              return;
            }

            break;
          }

        case 'dependenciesUpdate':
          {
            /**
             * Trigger when marked `dependencies` updated. Related fields will all update
             */
            var dependencyList = dependencies.map(getNamePath); // No need for `namePathMath` check and `shouldUpdate` check, since `valueUpdate` will be
            // emitted earlier and they will work there
            // If set it may cause unnecessary twice rerendering

            if (dependencyList.some(function (dependency) {
              return containsNamePath(info.relatedFields, dependency);
            })) {
              _this.reRender();

              return;
            }

            break;
          }

        default:
          // 1. If `namePath` exists in `namePathList`, means it's related value and should update
          //      For example <List name="list"><Field name={['list', 0]}></List>
          //      If `namePathList` is [['list']] (List value update), Field should be updated
          //      If `namePathList` is [['list', 0]] (Field value update), List shouldn't be updated
          // 2.
          //   2.1 If `dependencies` is set, `name` is not set and `shouldUpdate` is not set,
          //       don't use `shouldUpdate`. `dependencies` is view as a shortcut if `shouldUpdate`
          //       is not provided
          //   2.2 If `shouldUpdate` provided, use customize logic to update the field
          //       else to check if value changed
          if (namePathMatch || (!dependencies.length || namePath.length || shouldUpdate) && requireUpdate(shouldUpdate, prevStore, store, prevValue, curValue, info)) {
            _this.reRender();

            return;
          }

          break;
      }

      if (shouldUpdate === true) {
        _this.reRender();
      }
    };

    _this.validateRules = function (options) {
      var _this$props2 = _this.props,
          _this$props2$validate = _this$props2.validateFirst,
          validateFirst = _this$props2$validate === void 0 ? false : _this$props2$validate,
          messageVariables = _this$props2.messageVariables;

      var _ref2 = options || {},
          triggerName = _ref2.triggerName;

      var namePath = _this.getNamePath();

      var filteredRules = _this.getRules();

      if (triggerName) {
        filteredRules = filteredRules.filter(function (rule) {
          var validateTrigger = rule.validateTrigger;

          if (!validateTrigger) {
            return true;
          }

          var triggerList = typeUtil_toArray(validateTrigger);
          return triggerList.includes(triggerName);
        });
      }

      var promise = validateRules(namePath, _this.getValue(), filteredRules, options, validateFirst, messageVariables);
      _this.dirty = true;
      _this.validatePromise = promise;
      _this.errors = [];
      promise.catch(function (e) {
        return e;
      }).then(function () {
        var errors = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : [];

        if (_this.validatePromise === promise) {
          _this.validatePromise = null;
          _this.errors = errors;

          _this.reRender();
        }
      });
      return promise;
    };

    _this.isFieldValidating = function () {
      return !!_this.validatePromise;
    };

    _this.isFieldTouched = function () {
      return _this.touched;
    };

    _this.isFieldDirty = function () {
      return _this.dirty;
    };

    _this.getErrors = function () {
      return _this.errors;
    }; // ============================= Child Component =============================


    _this.getMeta = function () {
      // Make error & validating in cache to save perf
      _this.prevValidating = _this.isFieldValidating();
      var meta = {
        touched: _this.isFieldTouched(),
        validating: _this.prevValidating,
        errors: _this.errors,
        name: _this.getNamePath()
      };
      return meta;
    }; // Only return validate child node. If invalidate, will do nothing about field.


    _this.getOnlyChild = function (children) {
      // Support render props
      if (typeof children === 'function') {
        var meta = _this.getMeta();

        return Field_objectSpread({}, _this.getOnlyChild(children(_this.getControlled(), meta, _this.context)), {
          isFunction: true
        });
      } // Filed element only


      var childList = Object(toArray["a" /* default */])(children);

      if (childList.length !== 1 || ! /*#__PURE__*/external_React_["isValidElement"](childList[0])) {
        return {
          child: childList,
          isFunction: false
        };
      }

      return {
        child: childList[0],
        isFunction: false
      };
    }; // ============================== Field Control ==============================


    _this.getValue = function (store) {
      var getFieldsValue = _this.context.getFieldsValue;

      var namePath = _this.getNamePath();

      return getValue(store || getFieldsValue(true), namePath);
    };

    _this.getControlled = function () {
      var childProps = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
      var _this$props3 = _this.props,
          trigger = _this$props3.trigger,
          validateTrigger = _this$props3.validateTrigger,
          getValueFromEvent = _this$props3.getValueFromEvent,
          normalize = _this$props3.normalize,
          valuePropName = _this$props3.valuePropName,
          getValueProps = _this$props3.getValueProps;
      var mergedValidateTrigger = validateTrigger !== undefined ? validateTrigger : _this.context.validateTrigger;

      var namePath = _this.getNamePath();

      var _this$context = _this.context,
          getInternalHooks = _this$context.getInternalHooks,
          getFieldsValue = _this$context.getFieldsValue;

      var _getInternalHooks = getInternalHooks(HOOK_MARK),
          dispatch = _getInternalHooks.dispatch;

      var value = _this.getValue();

      var mergedGetValueProps = getValueProps || function (val) {
        return Object(defineProperty["a" /* default */])({}, valuePropName, val);
      }; // eslint-disable-next-line @typescript-eslint/no-explicit-any


      var originTriggerFunc = childProps[trigger];

      var control = Field_objectSpread({}, childProps, {}, mergedGetValueProps(value)); // Add trigger


      control[trigger] = function () {
        // Mark as touched
        _this.touched = true;
        _this.dirty = true;
        var newValue;

        for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
          args[_key] = arguments[_key];
        }

        if (getValueFromEvent) {
          newValue = getValueFromEvent.apply(void 0, args);
        } else {
          newValue = defaultGetValueFromEvent.apply(void 0, [valuePropName].concat(args));
        }

        if (normalize) {
          newValue = normalize(newValue, value, getFieldsValue(true));
        }

        dispatch({
          type: 'updateValue',
          namePath: namePath,
          value: newValue
        });

        if (originTriggerFunc) {
          originTriggerFunc.apply(void 0, args);
        }
      }; // Add validateTrigger


      var validateTriggerList = typeUtil_toArray(mergedValidateTrigger || []);
      validateTriggerList.forEach(function (triggerName) {
        // Wrap additional function of component, so that we can get latest value from store
        var originTrigger = control[triggerName];

        control[triggerName] = function () {
          if (originTrigger) {
            originTrigger.apply(void 0, arguments);
          } // Always use latest rules


          var rules = _this.props.rules;

          if (rules && rules.length) {
            // We dispatch validate to root,
            // since it will update related data with other field with same name
            dispatch({
              type: 'validateField',
              namePath: namePath,
              triggerName: triggerName
            });
          }
        };
      });
      return control;
    };

    return _this;
  } // ============================== Subscriptions ==============================


  Object(createClass["a" /* default */])(Field, [{
    key: "componentDidMount",
    value: function componentDidMount() {
      var shouldUpdate = this.props.shouldUpdate;
      var getInternalHooks = this.context.getInternalHooks;

      var _getInternalHooks2 = getInternalHooks(HOOK_MARK),
          registerField = _getInternalHooks2.registerField;

      this.cancelRegisterFunc = registerField(this); // One more render for component in case fields not ready

      if (shouldUpdate === true) {
        this.reRender();
      }
    }
  }, {
    key: "componentWillUnmount",
    value: function componentWillUnmount() {
      this.cancelRegister();
      this.destroy = true;
    }
  }, {
    key: "reRender",
    value: function reRender() {
      if (this.destroy) return;
      this.forceUpdate();
    }
  }, {
    key: "render",
    value: function render() {
      var resetCount = this.state.resetCount;
      var children = this.props.children;

      var _this$getOnlyChild = this.getOnlyChild(children),
          child = _this$getOnlyChild.child,
          isFunction = _this$getOnlyChild.isFunction; // Not need to `cloneElement` since user can handle this in render function self


      var returnChildNode;

      if (isFunction) {
        returnChildNode = child;
      } else if ( /*#__PURE__*/external_React_["isValidElement"](child)) {
        returnChildNode = /*#__PURE__*/external_React_["cloneElement"](child, this.getControlled(child.props));
      } else {
        Object(warning["a" /* default */])(!child, '`children` of Field is not validate ReactElement.');
        returnChildNode = child;
      }

      return /*#__PURE__*/external_React_["createElement"](external_React_["Fragment"], {
        key: resetCount
      }, returnChildNode);
    }
  }]);

  return Field;
}(external_React_["Component"]);

Field_Field.contextType = FieldContext;
Field_Field.defaultProps = {
  trigger: 'onChange',
  valuePropName: 'value'
};

var Field_WrapperField = function WrapperField(_ref4) {
  var name = _ref4.name,
      isListField = _ref4.isListField,
      restProps = Object(objectWithoutProperties["a" /* default */])(_ref4, ["name", "isListField"]);

  var namePath = name !== undefined ? getNamePath(name) : undefined;
  var key = 'keep';

  if (!isListField) {
    key = "_".concat((namePath || []).join('_'));
  }

  return /*#__PURE__*/external_React_["createElement"](Field_Field, Object.assign({
    key: key,
    name: namePath
  }, restProps));
};

/* harmony default export */ var es_Field = (Field_WrapperField);
// CONCATENATED MODULE: ./node_modules/rc-field-form/es/List.js



function List_ownKeys(object, enumerableOnly) {
  var keys = Object.keys(object);

  if (Object.getOwnPropertySymbols) {
    var symbols = Object.getOwnPropertySymbols(object);
    if (enumerableOnly) symbols = symbols.filter(function (sym) {
      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
    });
    keys.push.apply(keys, symbols);
  }

  return keys;
}

function List_objectSpread(target) {
  for (var i = 1; i < arguments.length; i++) {
    var source = arguments[i] != null ? arguments[i] : {};

    if (i % 2) {
      List_ownKeys(Object(source), true).forEach(function (key) {
        Object(defineProperty["a" /* default */])(target, key, source[key]);
      });
    } else if (Object.getOwnPropertyDescriptors) {
      Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
    } else {
      List_ownKeys(Object(source)).forEach(function (key) {
        Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
      });
    }
  }

  return target;
}







var List_List = function List(_ref) {
  var name = _ref.name,
      children = _ref.children;
  var context = external_React_["useContext"](FieldContext);
  var keyRef = external_React_["useRef"]({
    keys: [],
    id: 0
  });
  var keyManager = keyRef.current; // User should not pass `children` as other type.

  if (typeof children !== 'function') {
    Object(warning["a" /* default */])(false, 'Form.List only accepts function as children.');
    return null;
  }

  var parentPrefixName = getNamePath(context.prefixName) || [];
  var prefixName = [].concat(Object(toConsumableArray["a" /* default */])(parentPrefixName), Object(toConsumableArray["a" /* default */])(getNamePath(name)));

  var shouldUpdate = function shouldUpdate(prevValue, nextValue, _ref2) {
    var source = _ref2.source;

    if (source === 'internal') {
      return false;
    }

    return prevValue !== nextValue;
  };

  return /*#__PURE__*/external_React_["createElement"](FieldContext.Provider, {
    value: List_objectSpread({}, context, {
      prefixName: prefixName
    })
  }, /*#__PURE__*/external_React_["createElement"](es_Field, {
    name: [],
    shouldUpdate: shouldUpdate
  }, function (_ref3) {
    var _ref3$value = _ref3.value,
        value = _ref3$value === void 0 ? [] : _ref3$value,
        onChange = _ref3.onChange;
    var getFieldValue = context.getFieldValue;

    var getNewValue = function getNewValue() {
      var values = getFieldValue(prefixName || []);
      return values || [];
    };
    /**
     * Always get latest value in case user update fields by `form` api.
     */


    var operations = {
      add: function add(defaultValue) {
        // Mapping keys
        keyManager.keys = [].concat(Object(toConsumableArray["a" /* default */])(keyManager.keys), [keyManager.id]);
        keyManager.id += 1;
        var newValue = getNewValue();
        onChange([].concat(Object(toConsumableArray["a" /* default */])(newValue), [defaultValue]));
      },
      remove: function remove(index) {
        var newValue = getNewValue();
        var indexSet = new Set(Array.isArray(index) ? index : [index]);

        if (indexSet.size <= 0) {
          return;
        }

        keyManager.keys = keyManager.keys.filter(function (_, keysIndex) {
          return !indexSet.has(keysIndex);
        }); // Trigger store change

        onChange(newValue.filter(function (_, valueIndex) {
          return !indexSet.has(valueIndex);
        }));
      },
      move: function move(from, to) {
        if (from === to) {
          return;
        }

        var newValue = getNewValue(); // Do not handle out of range

        if (from < 0 || from >= newValue.length || to < 0 || to >= newValue.length) {
          return;
        }

        keyManager.keys = valueUtil_move(keyManager.keys, from, to); // Trigger store change

        onChange(valueUtil_move(newValue, from, to));
      }
    };
    return children(value.map(function (__, index) {
      var key = keyManager.keys[index];

      if (key === undefined) {
        keyManager.keys[index] = keyManager.id;
        key = keyManager.keys[index];
        keyManager.id += 1;
      }

      return {
        name: index,
        key: key,
        isListField: true
      };
    }), operations);
  }));
};

/* harmony default export */ var es_List = (List_List);
// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/slicedToArray.js + 3 modules
var slicedToArray = __webpack_require__(17);

// CONCATENATED MODULE: ./node_modules/rc-field-form/es/utils/asyncUtil.js
function allPromiseFinish(promiseList) {
  var hasError = false;
  var count = promiseList.length;
  var results = [];

  if (!promiseList.length) {
    return Promise.resolve([]);
  }

  return new Promise(function (resolve, reject) {
    promiseList.forEach(function (promise, index) {
      promise.catch(function (e) {
        hasError = true;
        return e;
      }).then(function (result) {
        count -= 1;
        results[index] = result;

        if (count > 0) {
          return;
        }

        if (hasError) {
          reject(results);
        }

        resolve(results);
      });
    });
  });
}
// CONCATENATED MODULE: ./node_modules/rc-field-form/es/utils/NameMap.js



/**
 * NameMap like a `Map` but accepts `string[]` as key.
 */

var NameMap_NameMap = /*#__PURE__*/function () {
  function NameMap() {
    Object(classCallCheck["a" /* default */])(this, NameMap);

    this.list = [];
  }

  Object(createClass["a" /* default */])(NameMap, [{
    key: "set",
    value: function set(key, value) {
      var index = this.list.findIndex(function (item) {
        return matchNamePath(item.key, key);
      });

      if (index !== -1) {
        this.list[index].value = value;
      } else {
        this.list.push({
          key: key,
          value: value
        });
      }
    }
  }, {
    key: "get",
    value: function get(key) {
      var result = this.list.find(function (item) {
        return matchNamePath(item.key, key);
      });
      return result && result.value;
    }
  }, {
    key: "update",
    value: function update(key, updater) {
      var origin = this.get(key);
      var next = updater(origin);

      if (!next) {
        this.delete(key);
      } else {
        this.set(key, next);
      }
    }
  }, {
    key: "delete",
    value: function _delete(key) {
      this.list = this.list.filter(function (item) {
        return !matchNamePath(item.key, key);
      });
    }
  }, {
    key: "map",
    value: function map(callback) {
      return this.list.map(callback);
    }
  }, {
    key: "toJSON",
    value: function toJSON() {
      var json = {};
      this.map(function (_ref) {
        var key = _ref.key,
            value = _ref.value;
        json[key.join('.')] = value;
        return null;
      });
      return json;
    }
  }]);

  return NameMap;
}();

/* harmony default export */ var utils_NameMap = (NameMap_NameMap);
// CONCATENATED MODULE: ./node_modules/rc-field-form/es/useForm.js






function useForm_ownKeys(object, enumerableOnly) {
  var keys = Object.keys(object);

  if (Object.getOwnPropertySymbols) {
    var symbols = Object.getOwnPropertySymbols(object);
    if (enumerableOnly) symbols = symbols.filter(function (sym) {
      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
    });
    keys.push.apply(keys, symbols);
  }

  return keys;
}

function useForm_objectSpread(target) {
  for (var i = 1; i < arguments.length; i++) {
    var source = arguments[i] != null ? arguments[i] : {};

    if (i % 2) {
      useForm_ownKeys(Object(source), true).forEach(function (key) {
        Object(defineProperty["a" /* default */])(target, key, source[key]);
      });
    } else if (Object.getOwnPropertyDescriptors) {
      Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
    } else {
      useForm_ownKeys(Object(source)).forEach(function (key) {
        Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
      });
    }
  }

  return target;
}








var useForm_FormStore = function FormStore(forceRootUpdate) {
  var _this = this;

  Object(classCallCheck["a" /* default */])(this, FormStore);

  this.formHooked = false;
  this.subscribable = true;
  this.store = {};
  this.fieldEntities = [];
  this.initialValues = {};
  this.callbacks = {};
  this.validateMessages = null;
  this.preserve = null;
  this.lastValidatePromise = null;

  this.getForm = function () {
    return {
      getFieldValue: _this.getFieldValue,
      getFieldsValue: _this.getFieldsValue,
      getFieldError: _this.getFieldError,
      getFieldsError: _this.getFieldsError,
      isFieldsTouched: _this.isFieldsTouched,
      isFieldTouched: _this.isFieldTouched,
      isFieldValidating: _this.isFieldValidating,
      isFieldsValidating: _this.isFieldsValidating,
      resetFields: _this.resetFields,
      setFields: _this.setFields,
      setFieldsValue: _this.setFieldsValue,
      validateFields: _this.validateFields,
      submit: _this.submit,
      getInternalHooks: _this.getInternalHooks
    };
  }; // ======================== Internal Hooks ========================


  this.getInternalHooks = function (key) {
    if (key === HOOK_MARK) {
      _this.formHooked = true;
      return {
        dispatch: _this.dispatch,
        registerField: _this.registerField,
        useSubscribe: _this.useSubscribe,
        setInitialValues: _this.setInitialValues,
        setCallbacks: _this.setCallbacks,
        setValidateMessages: _this.setValidateMessages,
        getFields: _this.getFields,
        setPreserve: _this.setPreserve
      };
    }

    Object(warning["a" /* default */])(false, '`getInternalHooks` is internal usage. Should not call directly.');
    return null;
  };

  this.useSubscribe = function (subscribable) {
    _this.subscribable = subscribable;
  };
  /**
   * First time `setInitialValues` should update store with initial value
   */


  this.setInitialValues = function (initialValues, init) {
    _this.initialValues = initialValues || {};

    if (init) {
      _this.store = setValues({}, initialValues, _this.store);
    }
  };

  this.getInitialValue = function (namePath) {
    return getValue(_this.initialValues, namePath);
  };

  this.setCallbacks = function (callbacks) {
    _this.callbacks = callbacks;
  };

  this.setValidateMessages = function (validateMessages) {
    _this.validateMessages = validateMessages;
  };

  this.setPreserve = function (preserve) {
    _this.preserve = preserve;
  }; // ========================== Dev Warning =========================


  this.timeoutId = null;

  this.warningUnhooked = function () {
    if (false) {}
  }; // ============================ Fields ============================

  /**
   * Get registered field entities.
   * @param pure Only return field which has a `name`. Default: false
   */


  this.getFieldEntities = function () {
    var pure = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;

    if (!pure) {
      return _this.fieldEntities;
    }

    return _this.fieldEntities.filter(function (field) {
      return field.getNamePath().length;
    });
  };

  this.getFieldsMap = function () {
    var pure = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;
    var cache = new utils_NameMap();

    _this.getFieldEntities(pure).forEach(function (field) {
      var namePath = field.getNamePath();
      cache.set(namePath, field);
    });

    return cache;
  };

  this.getFieldEntitiesForNamePathList = function (nameList) {
    if (!nameList) {
      return _this.getFieldEntities(true);
    }

    var cache = _this.getFieldsMap(true);

    return nameList.map(function (name) {
      var namePath = getNamePath(name);
      return cache.get(namePath) || {
        INVALIDATE_NAME_PATH: getNamePath(name)
      };
    });
  };

  this.getFieldsValue = function (nameList, filterFunc) {
    _this.warningUnhooked();

    if (nameList === true && !filterFunc) {
      return _this.store;
    }

    var fieldEntities = _this.getFieldEntitiesForNamePathList(Array.isArray(nameList) ? nameList : null);

    var filteredNameList = [];
    fieldEntities.forEach(function (entity) {
      var namePath = 'INVALIDATE_NAME_PATH' in entity ? entity.INVALIDATE_NAME_PATH : entity.getNamePath();

      if (!filterFunc) {
        filteredNameList.push(namePath);
      } else {
        var meta = 'getMeta' in entity ? entity.getMeta() : null;

        if (filterFunc(meta)) {
          filteredNameList.push(namePath);
        }
      }
    });
    return cloneByNamePathList(_this.store, filteredNameList.map(getNamePath));
  };

  this.getFieldValue = function (name) {
    _this.warningUnhooked();

    var namePath = getNamePath(name);
    return getValue(_this.store, namePath);
  };

  this.getFieldsError = function (nameList) {
    _this.warningUnhooked();

    var fieldEntities = _this.getFieldEntitiesForNamePathList(nameList);

    return fieldEntities.map(function (entity, index) {
      if (entity && !('INVALIDATE_NAME_PATH' in entity)) {
        return {
          name: entity.getNamePath(),
          errors: entity.getErrors()
        };
      }

      return {
        name: getNamePath(nameList[index]),
        errors: []
      };
    });
  };

  this.getFieldError = function (name) {
    _this.warningUnhooked();

    var namePath = getNamePath(name);

    var fieldError = _this.getFieldsError([namePath])[0];

    return fieldError.errors;
  };

  this.isFieldsTouched = function () {
    _this.warningUnhooked();

    for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
      args[_key] = arguments[_key];
    }

    var arg0 = args[0],
        arg1 = args[1];
    var namePathList;
    var isAllFieldsTouched = false;

    if (args.length === 0) {
      namePathList = null;
    } else if (args.length === 1) {
      if (Array.isArray(arg0)) {
        namePathList = arg0.map(getNamePath);
        isAllFieldsTouched = false;
      } else {
        namePathList = null;
        isAllFieldsTouched = arg0;
      }
    } else {
      namePathList = arg0.map(getNamePath);
      isAllFieldsTouched = arg1;
    }

    var testTouched = function testTouched(field) {
      // Not provide `nameList` will check all the fields
      if (!namePathList) {
        return field.isFieldTouched();
      }

      var fieldNamePath = field.getNamePath();

      if (containsNamePath(namePathList, fieldNamePath)) {
        return field.isFieldTouched();
      }

      return isAllFieldsTouched;
    };

    return isAllFieldsTouched ? _this.getFieldEntities(true).every(testTouched) : _this.getFieldEntities(true).some(testTouched);
  };

  this.isFieldTouched = function (name) {
    _this.warningUnhooked();

    return _this.isFieldsTouched([name]);
  };

  this.isFieldsValidating = function (nameList) {
    _this.warningUnhooked();

    var fieldEntities = _this.getFieldEntities();

    if (!nameList) {
      return fieldEntities.some(function (testField) {
        return testField.isFieldValidating();
      });
    }

    var namePathList = nameList.map(getNamePath);
    return fieldEntities.some(function (testField) {
      var fieldNamePath = testField.getNamePath();
      return containsNamePath(namePathList, fieldNamePath) && testField.isFieldValidating();
    });
  };

  this.isFieldValidating = function (name) {
    _this.warningUnhooked();

    return _this.isFieldsValidating([name]);
  };
  /**
   * Reset Field with field `initialValue` prop.
   * Can pass `entities` or `namePathList` or just nothing.
   */


  this.resetWithFieldInitialValue = function () {
    var info = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {}; // Create cache

    var cache = new utils_NameMap();

    var fieldEntities = _this.getFieldEntities(true);

    fieldEntities.forEach(function (field) {
      var initialValue = field.props.initialValue;
      var namePath = field.getNamePath(); // Record only if has `initialValue`

      if (initialValue !== undefined) {
        var records = cache.get(namePath) || new Set();
        records.add({
          entity: field,
          value: initialValue
        });
        cache.set(namePath, records);
      }
    }); // Reset

    var resetWithFields = function resetWithFields(entities) {
      entities.forEach(function (field) {
        var initialValue = field.props.initialValue;

        if (initialValue !== undefined) {
          var namePath = field.getNamePath();

          var formInitialValue = _this.getInitialValue(namePath);

          if (formInitialValue !== undefined) {
            // Warning if conflict with form initialValues and do not modify value
            Object(warning["a" /* default */])(false, "Form already set 'initialValues' with path '".concat(namePath.join('.'), "'. Field can not overwrite it."));
          } else {
            var records = cache.get(namePath);

            if (records && records.size > 1) {
              // Warning if multiple field set `initialValue`and do not modify value
              Object(warning["a" /* default */])(false, "Multiple Field with path '".concat(namePath.join('.'), "' set 'initialValue'. Can not decide which one to pick."));
            } else if (records) {
              var originValue = _this.getFieldValue(namePath); // Set `initialValue`


              if (!info.skipExist || originValue === undefined) {
                _this.store = setValue(_this.store, namePath, Object(toConsumableArray["a" /* default */])(records)[0].value);
              }
            }
          }
        }
      });
    };

    var requiredFieldEntities;

    if (info.entities) {
      requiredFieldEntities = info.entities;
    } else if (info.namePathList) {
      requiredFieldEntities = [];
      info.namePathList.forEach(function (namePath) {
        var records = cache.get(namePath);

        if (records) {
          var _requiredFieldEntitie;

          (_requiredFieldEntitie = requiredFieldEntities).push.apply(_requiredFieldEntitie, Object(toConsumableArray["a" /* default */])(Object(toConsumableArray["a" /* default */])(records).map(function (r) {
            return r.entity;
          })));
        }
      });
    } else {
      requiredFieldEntities = fieldEntities;
    }

    resetWithFields(requiredFieldEntities);
  };

  this.resetFields = function (nameList) {
    _this.warningUnhooked();

    var prevStore = _this.store;

    if (!nameList) {
      _this.store = setValues({}, _this.initialValues);

      _this.resetWithFieldInitialValue();

      _this.notifyObservers(prevStore, null, {
        type: 'reset'
      });

      return;
    } // Reset by `nameList`


    var namePathList = nameList.map(getNamePath);
    namePathList.forEach(function (namePath) {
      var initialValue = _this.getInitialValue(namePath);

      _this.store = setValue(_this.store, namePath, initialValue);
    });

    _this.resetWithFieldInitialValue({
      namePathList: namePathList
    });

    _this.notifyObservers(prevStore, namePathList, {
      type: 'reset'
    });
  };

  this.setFields = function (fields) {
    _this.warningUnhooked();

    var prevStore = _this.store;
    fields.forEach(function (fieldData) {
      var name = fieldData.name,
          errors = fieldData.errors,
          data = Object(objectWithoutProperties["a" /* default */])(fieldData, ["name", "errors"]);

      var namePath = getNamePath(name); // Value

      if ('value' in data) {
        _this.store = setValue(_this.store, namePath, data.value);
      }

      _this.notifyObservers(prevStore, [namePath], {
        type: 'setField',
        data: fieldData
      });
    });
  };

  this.getFields = function () {
    var entities = _this.getFieldEntities(true);

    var fields = entities.map(function (field) {
      var namePath = field.getNamePath();
      var meta = field.getMeta();

      var fieldData = useForm_objectSpread({}, meta, {
        name: namePath,
        value: _this.getFieldValue(namePath)
      });

      Object.defineProperty(fieldData, 'originRCField', {
        value: true
      });
      return fieldData;
    });
    return fields;
  }; // =========================== Observer ===========================


  this.registerField = function (entity) {
    _this.fieldEntities.push(entity); // Set initial values


    if (entity.props.initialValue !== undefined) {
      var prevStore = _this.store;

      _this.resetWithFieldInitialValue({
        entities: [entity],
        skipExist: true
      });

      _this.notifyObservers(prevStore, [entity.getNamePath()], {
        type: 'valueUpdate',
        source: 'internal'
      });
    } // un-register field callback


    return function (preserve) {
      _this.fieldEntities = _this.fieldEntities.filter(function (item) {
        return item !== entity;
      }); // Clean up store value if preserve

      var mergedPreserve = preserve !== undefined ? preserve : _this.preserve;

      if (mergedPreserve === false) {
        var namePath = entity.getNamePath();

        if (_this.getFieldValue(namePath) !== undefined) {
          _this.store = setValue(_this.store, namePath, undefined);
        }
      }
    };
  };

  this.dispatch = function (action) {
    switch (action.type) {
      case 'updateValue':
        {
          var namePath = action.namePath,
              value = action.value;

          _this.updateValue(namePath, value);

          break;
        }

      case 'validateField':
        {
          var _namePath = action.namePath,
              triggerName = action.triggerName;

          _this.validateFields([_namePath], {
            triggerName: triggerName
          });

          break;
        }

      default: // Currently we don't have other action. Do nothing.

    }
  };

  this.notifyObservers = function (prevStore, namePathList, info) {
    if (_this.subscribable) {
      var mergedInfo = useForm_objectSpread({}, info, {
        store: _this.getFieldsValue(true)
      });

      _this.getFieldEntities().forEach(function (_ref) {
        var onStoreChange = _ref.onStoreChange;
        onStoreChange(prevStore, namePathList, mergedInfo);
      });
    } else {
      _this.forceRootUpdate();
    }
  };

  this.updateValue = function (name, value) {
    var namePath = getNamePath(name);
    var prevStore = _this.store;
    _this.store = setValue(_this.store, namePath, value);

    _this.notifyObservers(prevStore, [namePath], {
      type: 'valueUpdate',
      source: 'internal'
    }); // Notify dependencies children with parent update


    var childrenFields = _this.getDependencyChildrenFields(namePath);

    _this.validateFields(childrenFields);

    _this.notifyObservers(prevStore, childrenFields, {
      type: 'dependenciesUpdate',
      relatedFields: [namePath].concat(Object(toConsumableArray["a" /* default */])(childrenFields))
    }); // trigger callback function


    var onValuesChange = _this.callbacks.onValuesChange;

    if (onValuesChange) {
      var changedValues = cloneByNamePathList(_this.store, [namePath]);
      onValuesChange(changedValues, _this.store);
    }

    _this.triggerOnFieldsChange([namePath].concat(Object(toConsumableArray["a" /* default */])(childrenFields)));
  }; // Let all child Field get update.


  this.setFieldsValue = function (store) {
    _this.warningUnhooked();

    var prevStore = _this.store;

    if (store) {
      _this.store = setValues(_this.store, store);
    }

    _this.notifyObservers(prevStore, null, {
      type: 'valueUpdate',
      source: 'external'
    });
  };

  this.getDependencyChildrenFields = function (rootNamePath) {
    var children = new Set();
    var childrenFields = [];
    var dependencies2fields = new utils_NameMap();
    /**
     * Generate maps
     * Can use cache to save perf if user report performance issue with this
     */

    _this.getFieldEntities().forEach(function (field) {
      var dependencies = field.props.dependencies;
      (dependencies || []).forEach(function (dependency) {
        var dependencyNamePath = getNamePath(dependency);
        dependencies2fields.update(dependencyNamePath, function () {
          var fields = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : new Set();
          fields.add(field);
          return fields;
        });
      });
    });

    var fillChildren = function fillChildren(namePath) {
      var fields = dependencies2fields.get(namePath) || new Set();
      fields.forEach(function (field) {
        if (!children.has(field)) {
          children.add(field);
          var fieldNamePath = field.getNamePath();

          if (field.isFieldDirty() && fieldNamePath.length) {
            childrenFields.push(fieldNamePath);
            fillChildren(fieldNamePath);
          }
        }
      });
    };

    fillChildren(rootNamePath);
    return childrenFields;
  };

  this.triggerOnFieldsChange = function (namePathList, filedErrors) {
    var onFieldsChange = _this.callbacks.onFieldsChange;

    if (onFieldsChange) {
      var fields = _this.getFields();
      /**
       * Fill errors since `fields` may be replaced by controlled fields
       */


      if (filedErrors) {
        var cache = new utils_NameMap();
        filedErrors.forEach(function (_ref2) {
          var name = _ref2.name,
              errors = _ref2.errors;
          cache.set(name, errors);
        });
        fields.forEach(function (field) {
          // eslint-disable-next-line no-param-reassign
          field.errors = cache.get(field.name) || field.errors;
        });
      }

      var changedFields = fields.filter(function (_ref3) {
        var fieldName = _ref3.name;
        return containsNamePath(namePathList, fieldName);
      });
      onFieldsChange(changedFields, fields);
    }
  }; // =========================== Validate ===========================


  this.validateFields = function (nameList, options) {
    _this.warningUnhooked();

    var provideNameList = !!nameList;
    var namePathList = provideNameList ? nameList.map(getNamePath) : []; // Collect result in promise list

    var promiseList = [];

    _this.getFieldEntities(true).forEach(function (field) {
      // Add field if not provide `nameList`
      if (!provideNameList) {
        namePathList.push(field.getNamePath());
      } // Skip if without rule


      if (!field.props.rules || !field.props.rules.length) {
        return;
      }

      var fieldNamePath = field.getNamePath(); // Add field validate rule in to promise list

      if (!provideNameList || containsNamePath(namePathList, fieldNamePath)) {
        var promise = field.validateRules(useForm_objectSpread({
          validateMessages: useForm_objectSpread({}, defaultValidateMessages, {}, _this.validateMessages)
        }, options)); // Wrap promise with field

        promiseList.push(promise.then(function () {
          return {
            name: fieldNamePath,
            errors: []
          };
        }).catch(function (errors) {
          return Promise.reject({
            name: fieldNamePath,
            errors: errors
          });
        }));
      }
    });

    var summaryPromise = allPromiseFinish(promiseList);
    _this.lastValidatePromise = summaryPromise; // Notify fields with rule that validate has finished and need update

    summaryPromise.catch(function (results) {
      return results;
    }).then(function (results) {
      var resultNamePathList = results.map(function (_ref4) {
        var name = _ref4.name;
        return name;
      });

      _this.notifyObservers(_this.store, resultNamePathList, {
        type: 'validateFinish'
      });

      _this.triggerOnFieldsChange(resultNamePathList, results);
    });
    var returnPromise = summaryPromise.then(function () {
      if (_this.lastValidatePromise === summaryPromise) {
        return Promise.resolve(_this.getFieldsValue(namePathList));
      }

      return Promise.reject([]);
    }).catch(function (results) {
      var errorList = results.filter(function (result) {
        return result && result.errors.length;
      });
      return Promise.reject({
        values: _this.getFieldsValue(namePathList),
        errorFields: errorList,
        outOfDate: _this.lastValidatePromise !== summaryPromise
      });
    }); // Do not throw in console

    returnPromise.catch(function (e) {
      return e;
    });
    return returnPromise;
  }; // ============================ Submit ============================


  this.submit = function () {
    _this.warningUnhooked();

    _this.validateFields().then(function (values) {
      var onFinish = _this.callbacks.onFinish;

      if (onFinish) {
        try {
          onFinish(values);
        } catch (err) {
          // Should print error if user `onFinish` callback failed
          console.error(err);
        }
      }
    }).catch(function (e) {
      var onFinishFailed = _this.callbacks.onFinishFailed;

      if (onFinishFailed) {
        onFinishFailed(e);
      }
    });
  };

  this.forceRootUpdate = forceRootUpdate;
};

function useForm(form) {
  var formRef = external_React_["useRef"]();

  var _React$useState = external_React_["useState"](),
      _React$useState2 = Object(slicedToArray["a" /* default */])(_React$useState, 2),
      forceUpdate = _React$useState2[1];

  if (!formRef.current) {
    if (form) {
      formRef.current = form;
    } else {
      // Create a new FormStore if not provided
      var forceReRender = function forceReRender() {
        forceUpdate({});
      };

      var formStore = new useForm_FormStore(forceReRender);
      formRef.current = formStore.getForm();
    }
  }

  return [formRef.current];
}

/* harmony default export */ var es_useForm = (useForm);
// CONCATENATED MODULE: ./node_modules/rc-field-form/es/FormContext.js


function FormContext_ownKeys(object, enumerableOnly) {
  var keys = Object.keys(object);

  if (Object.getOwnPropertySymbols) {
    var symbols = Object.getOwnPropertySymbols(object);
    if (enumerableOnly) symbols = symbols.filter(function (sym) {
      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
    });
    keys.push.apply(keys, symbols);
  }

  return keys;
}

function FormContext_objectSpread(target) {
  for (var i = 1; i < arguments.length; i++) {
    var source = arguments[i] != null ? arguments[i] : {};

    if (i % 2) {
      FormContext_ownKeys(Object(source), true).forEach(function (key) {
        Object(defineProperty["a" /* default */])(target, key, source[key]);
      });
    } else if (Object.getOwnPropertyDescriptors) {
      Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
    } else {
      FormContext_ownKeys(Object(source)).forEach(function (key) {
        Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
      });
    }
  }

  return target;
}


var FormContext = /*#__PURE__*/external_React_["createContext"]({
  triggerFormChange: function triggerFormChange() {},
  triggerFormFinish: function triggerFormFinish() {},
  registerForm: function registerForm() {},
  unregisterForm: function unregisterForm() {}
});

var FormContext_FormProvider = function FormProvider(_ref) {
  var validateMessages = _ref.validateMessages,
      onFormChange = _ref.onFormChange,
      onFormFinish = _ref.onFormFinish,
      children = _ref.children;
  var formContext = external_React_["useContext"](FormContext);
  var formsRef = external_React_["useRef"]({});
  return /*#__PURE__*/external_React_["createElement"](FormContext.Provider, {
    value: FormContext_objectSpread({}, formContext, {
      validateMessages: FormContext_objectSpread({}, formContext.validateMessages, {}, validateMessages),
      // =========================================================
      // =                  Global Form Control                  =
      // =========================================================
      triggerFormChange: function triggerFormChange(name, changedFields) {
        if (onFormChange) {
          onFormChange(name, {
            changedFields: changedFields,
            forms: formsRef.current
          });
        }

        formContext.triggerFormChange(name, changedFields);
      },
      triggerFormFinish: function triggerFormFinish(name, values) {
        if (onFormFinish) {
          onFormFinish(name, {
            values: values,
            forms: formsRef.current
          });
        }

        formContext.triggerFormFinish(name, values);
      },
      registerForm: function registerForm(name, form) {
        if (name) {
          formsRef.current = FormContext_objectSpread({}, formsRef.current, Object(defineProperty["a" /* default */])({}, name, form));
        }

        formContext.registerForm(name, form);
      },
      unregisterForm: function unregisterForm(name) {
        var newForms = FormContext_objectSpread({}, formsRef.current);

        delete newForms[name];
        formsRef.current = newForms;
        formContext.unregisterForm(name);
      }
    })
  }, children);
};


/* harmony default export */ var es_FormContext = (FormContext);
// CONCATENATED MODULE: ./node_modules/rc-field-form/es/Form.js




function Form_ownKeys(object, enumerableOnly) {
  var keys = Object.keys(object);

  if (Object.getOwnPropertySymbols) {
    var symbols = Object.getOwnPropertySymbols(object);
    if (enumerableOnly) symbols = symbols.filter(function (sym) {
      return Object.getOwnPropertyDescriptor(object, sym).enumerable;
    });
    keys.push.apply(keys, symbols);
  }

  return keys;
}

function Form_objectSpread(target) {
  for (var i = 1; i < arguments.length; i++) {
    var source = arguments[i] != null ? arguments[i] : {};

    if (i % 2) {
      Form_ownKeys(Object(source), true).forEach(function (key) {
        Object(defineProperty["a" /* default */])(target, key, source[key]);
      });
    } else if (Object.getOwnPropertyDescriptors) {
      Object.defineProperties(target, Object.getOwnPropertyDescriptors(source));
    } else {
      Form_ownKeys(Object(source)).forEach(function (key) {
        Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key));
      });
    }
  }

  return target;
}







var Form_Form = function Form(_ref, ref) {
  var name = _ref.name,
      initialValues = _ref.initialValues,
      fields = _ref.fields,
      form = _ref.form,
      preserve = _ref.preserve,
      children = _ref.children,
      _ref$component = _ref.component,
      Component = _ref$component === void 0 ? 'form' : _ref$component,
      validateMessages = _ref.validateMessages,
      _ref$validateTrigger = _ref.validateTrigger,
      validateTrigger = _ref$validateTrigger === void 0 ? 'onChange' : _ref$validateTrigger,
      onValuesChange = _ref.onValuesChange,
      _onFieldsChange = _ref.onFieldsChange,
      _onFinish = _ref.onFinish,
      onFinishFailed = _ref.onFinishFailed,
      restProps = Object(objectWithoutProperties["a" /* default */])(_ref, ["name", "initialValues", "fields", "form", "preserve", "children", "component", "validateMessages", "validateTrigger", "onValuesChange", "onFieldsChange", "onFinish", "onFinishFailed"]);

  var formContext = external_React_["useContext"](es_FormContext); // We customize handle event since Context will makes all the consumer re-render:
  // https://reactjs.org/docs/context.html#contextprovider

  var _useForm = es_useForm(form),
      _useForm2 = Object(slicedToArray["a" /* default */])(_useForm, 1),
      formInstance = _useForm2[0];

  var _formInstance$getInte = formInstance.getInternalHooks(HOOK_MARK),
      useSubscribe = _formInstance$getInte.useSubscribe,
      setInitialValues = _formInstance$getInte.setInitialValues,
      setCallbacks = _formInstance$getInte.setCallbacks,
      setValidateMessages = _formInstance$getInte.setValidateMessages,
      setPreserve = _formInstance$getInte.setPreserve; // Pass ref with form instance


  external_React_["useImperativeHandle"](ref, function () {
    return formInstance;
  }); // Register form into Context

  external_React_["useEffect"](function () {
    formContext.registerForm(name, formInstance);
    return function () {
      formContext.unregisterForm(name);
    };
  }, [formContext, formInstance, name]); // Pass props to store

  setValidateMessages(Form_objectSpread({}, formContext.validateMessages, {}, validateMessages));
  setCallbacks({
    onValuesChange: onValuesChange,
    onFieldsChange: function onFieldsChange(changedFields) {
      formContext.triggerFormChange(name, changedFields);

      if (_onFieldsChange) {
        for (var _len = arguments.length, rest = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
          rest[_key - 1] = arguments[_key];
        }

        _onFieldsChange.apply(void 0, [changedFields].concat(rest));
      }
    },
    onFinish: function onFinish(values) {
      formContext.triggerFormFinish(name, values);

      if (_onFinish) {
        _onFinish(values);
      }
    },
    onFinishFailed: onFinishFailed
  });
  setPreserve(preserve); // Set initial value, init store value when first mount

  var mountRef = external_React_["useRef"](null);
  setInitialValues(initialValues, !mountRef.current);

  if (!mountRef.current) {
    mountRef.current = true;
  } // Prepare children by `children` type


  var childrenNode = children;
  var childrenRenderProps = typeof children === 'function';

  if (childrenRenderProps) {
    var values = formInstance.getFieldsValue(true);
    childrenNode = children(values, formInstance);
  } // Not use subscribe when using render props


  useSubscribe(!childrenRenderProps); // Listen if fields provided. We use ref to save prev data here to avoid additional render

  var prevFieldsRef = external_React_["useRef"]();
  external_React_["useEffect"](function () {
    if (!isSimilar(prevFieldsRef.current || [], fields || [])) {
      formInstance.setFields(fields || []);
    }

    prevFieldsRef.current = fields;
  }, [fields, formInstance]);
  var formContextValue = external_React_["useMemo"](function () {
    return Form_objectSpread({}, formInstance, {
      validateTrigger: validateTrigger
    });
  }, [formInstance, validateTrigger]);
  var wrapperNode = /*#__PURE__*/external_React_["createElement"](FieldContext.Provider, {
    value: formContextValue
  }, childrenNode);

  if (Component === false) {
    return wrapperNode;
  }

  return /*#__PURE__*/external_React_["createElement"](Component, Object.assign({}, restProps, {
    onSubmit: function onSubmit(event) {
      event.preventDefault();
      event.stopPropagation();
      formInstance.submit();
    }
  }), wrapperNode);
};

/* harmony default export */ var es_Form = (Form_Form);
// CONCATENATED MODULE: ./node_modules/rc-field-form/es/index.js






var InternalForm = /*#__PURE__*/external_React_["forwardRef"](es_Form);
var RefForm = InternalForm;
RefForm.FormProvider = FormContext_FormProvider;
RefForm.Field = es_Field;
RefForm.List = es_List;
RefForm.useForm = es_useForm;

/* harmony default export */ var es = __webpack_exports__["default"] = (RefForm);

/***/ })
/******/ ])["default"];