|
|
// ==========================================================
|
|
|
// FreeImage 3 .NET wrapper
|
|
|
// Original FreeImage 3 functions and .NET compatible derived functions
|
|
|
//
|
|
|
// Design and implementation by
|
|
|
// - Jean-Philippe Goerke (jpgoerke@users.sourceforge.net)
|
|
|
// - Carsten Klein (cklein05@users.sourceforge.net)
|
|
|
//
|
|
|
// Contributors:
|
|
|
// - David Boland (davidboland@vodafone.ie)
|
|
|
//
|
|
|
// Main reference : MSDN Knowlede Base
|
|
|
//
|
|
|
// This file is part of FreeImage 3
|
|
|
//
|
|
|
// COVERED CODE IS PROVIDED UNDER THIS LICENSE ON AN "AS IS" BASIS, WITHOUT WARRANTY
|
|
|
// OF ANY KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, WITHOUT LIMITATION, WARRANTIES
|
|
|
// THAT THE COVERED CODE IS FREE OF DEFECTS, MERCHANTABLE, FIT FOR A PARTICULAR PURPOSE
|
|
|
// OR NON-INFRINGING. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE COVERED
|
|
|
// CODE IS WITH YOU. SHOULD ANY COVERED CODE PROVE DEFECTIVE IN ANY RESPECT, YOU (NOT
|
|
|
// THE INITIAL DEVELOPER OR ANY OTHER CONTRIBUTOR) ASSUME THE COST OF ANY NECESSARY
|
|
|
// SERVICING, REPAIR OR CORRECTION. THIS DISCLAIMER OF WARRANTY CONSTITUTES AN ESSENTIAL
|
|
|
// PART OF THIS LICENSE. NO USE OF ANY COVERED CODE IS AUTHORIZED HEREUNDER EXCEPT UNDER
|
|
|
// THIS DISCLAIMER.
|
|
|
//
|
|
|
// Use at your own risk!
|
|
|
// ==========================================================
|
|
|
|
|
|
// ==========================================================
|
|
|
// To build the project without VS use the following commandline:
|
|
|
// "csc.exe /out:FreeImageNET.dll /target:library /doc:FreeImageNET.XML /debug- /o /unsafe+ /filealign:512 FreeImage.cs"
|
|
|
// ==========================================================
|
|
|
|
|
|
using System;
|
|
|
using System.Collections;
|
|
|
using System.Collections.Generic;
|
|
|
using System.Collections.ObjectModel;
|
|
|
using System.Diagnostics;
|
|
|
using System.Drawing;
|
|
|
using System.Drawing.Imaging;
|
|
|
using System.IO;
|
|
|
using System.Reflection;
|
|
|
using System.Resources;
|
|
|
using System.Runtime.CompilerServices;
|
|
|
using System.Runtime.InteropServices;
|
|
|
using System.Runtime.Serialization;
|
|
|
using System.Text;
|
|
|
using System.Text.RegularExpressions;
|
|
|
using System.Xml;
|
|
|
using FreeImageAPI;
|
|
|
using FreeImageAPI.IO;
|
|
|
using FreeImageAPI.Metadata;
|
|
|
using FreeImageAPI.Plugins;
|
|
|
|
|
|
/////////////////////////////////////////////////////
|
|
|
// //
|
|
|
// FreeImage.h import //
|
|
|
// //
|
|
|
/////////////////////////////////////////////////////
|
|
|
|
|
|
#region Structs
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>BITMAP</b> structure defines the type, width, height, color format, and bit values of a bitmap.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The bitmap formats currently used are monochrome and color. The monochrome bitmap uses a one-bit,
|
|
|
/// one-plane format. Each scan is a multiple of 32 bits.
|
|
|
/// <para/>
|
|
|
/// Scans are organized as follows for a monochrome bitmap of height n:
|
|
|
/// <para/>
|
|
|
/// <code>
|
|
|
/// Scan 0
|
|
|
/// Scan 1
|
|
|
/// .
|
|
|
/// .
|
|
|
/// .
|
|
|
/// Scan n-2
|
|
|
/// Scan n-1
|
|
|
/// </code>
|
|
|
/// <para/>
|
|
|
/// The pixels on a monochrome device are either black or white. If the corresponding bit in the
|
|
|
/// bitmap is 1, the pixel is set to the foreground color; if the corresponding bit in the bitmap
|
|
|
/// is zero, the pixel is set to the background color.
|
|
|
/// <para/>
|
|
|
/// All devices that have the RC_BITBLT device capability support bitmaps. For more information,
|
|
|
/// see <b>GetDeviceCaps</b>.
|
|
|
/// <para/>
|
|
|
/// Each device has a unique color format. To transfer a bitmap from one device to another,
|
|
|
/// use the <b>GetDIBits</b> and <b>SetDIBits</b> functions.
|
|
|
/// </remarks>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential)]
|
|
|
public struct BITMAP
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Specifies the bitmap type. This member must be zero.
|
|
|
/// </summary>
|
|
|
public int bmType;
|
|
|
/// <summary>
|
|
|
/// Specifies the width, in pixels, of the bitmap. The width must be greater than zero.
|
|
|
/// </summary>
|
|
|
public int bmWidth;
|
|
|
/// <summary>
|
|
|
/// Specifies the height, in pixels, of the bitmap. The height must be greater than zero.
|
|
|
/// </summary>
|
|
|
public int bmHeight;
|
|
|
/// <summary>
|
|
|
/// Specifies the number of bytes in each scan line. This value must be divisible by 2,
|
|
|
/// because the system assumes that the bit values of a bitmap form an array that is word aligned.
|
|
|
/// </summary>
|
|
|
public int bmWidthBytes;
|
|
|
/// <summary>
|
|
|
/// Specifies the count of color planes.
|
|
|
/// </summary>
|
|
|
public ushort bmPlanes;
|
|
|
/// <summary>
|
|
|
/// Specifies the number of bits required to indicate the color of a pixel.
|
|
|
/// </summary>
|
|
|
public ushort bmBitsPixel;
|
|
|
/// <summary>
|
|
|
/// Pointer to the location of the bit values for the bitmap.
|
|
|
/// The <b>bmBits</b> member must be a long pointer to an array of character (1-byte) values.
|
|
|
/// </summary>
|
|
|
public IntPtr bmBits;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// This structure contains information about the dimensions and color format
|
|
|
/// of a device-independent bitmap (DIB).
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The <see cref="FreeImageAPI.BITMAPINFO"/> structure combines the
|
|
|
/// <b>BITMAPINFOHEADER</b> structure and a color table to provide a complete
|
|
|
/// definition of the dimensions and colors of a DIB.
|
|
|
/// </remarks>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential)]
|
|
|
public struct BITMAPINFOHEADER : IEquatable<BITMAPINFOHEADER>
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Specifies the size of the structure, in bytes.
|
|
|
/// </summary>
|
|
|
public uint biSize;
|
|
|
/// <summary>
|
|
|
/// Specifies the width of the bitmap, in pixels.
|
|
|
/// <para/>
|
|
|
/// <b>Windows 98/Me, Windows 2000/XP:</b> If <b>biCompression</b> is BI_JPEG or BI_PNG,
|
|
|
/// the <b>biWidth</b> member specifies the width of the decompressed JPEG or PNG image file,
|
|
|
/// respectively.
|
|
|
/// </summary>
|
|
|
public int biWidth;
|
|
|
/// <summary>
|
|
|
/// Specifies the height of the bitmap, in pixels. If <b>biHeight</b> is positive, the bitmap
|
|
|
/// is a bottom-up DIB and its origin is the lower-left corner. If <b>biHeight</b> is negative,
|
|
|
/// the bitmap is a top-down DIB and its origin is the upper-left corner.
|
|
|
/// <para/>
|
|
|
/// If <b>biHeight</b> is negative, indicating a top-down DIB, <b>biCompression</b> must be
|
|
|
/// either BI_RGB or BI_BITFIELDS. Top-down DIBs cannot be compressed.
|
|
|
/// <para/>
|
|
|
/// <b>Windows 98/Me, Windows 2000/XP:</b> If <b>biCompression</b> is BI_JPEG or BI_PNG,
|
|
|
/// the <b>biHeight</b> member specifies the height of the decompressed JPEG or PNG image file,
|
|
|
/// respectively.
|
|
|
/// </summary>
|
|
|
public int biHeight;
|
|
|
/// <summary>
|
|
|
/// Specifies the number of planes for the target device. This value must be set to 1.
|
|
|
/// </summary>
|
|
|
public ushort biPlanes;
|
|
|
/// <summary>
|
|
|
/// Specifies the number of bits per pixel.The biBitCount member of the <b>BITMAPINFOHEADER</b>
|
|
|
/// structure determines the number of bits that define each pixel and the maximum number of
|
|
|
/// colors in the bitmap. This member must be one of the following values.
|
|
|
/// <para/>
|
|
|
///
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>Value</term>
|
|
|
/// <description>Meaning</description>
|
|
|
/// </listheader>
|
|
|
///
|
|
|
/// <item>
|
|
|
/// <term>0</term>
|
|
|
/// <description>
|
|
|
/// <b>Windows 98/Me, Windows 2000/XP:</b> The number of bits-per-pixel is specified
|
|
|
/// or is implied by the JPEG or PNG format.
|
|
|
/// </description>
|
|
|
/// </item>
|
|
|
///
|
|
|
/// <item>
|
|
|
/// <term>1</term>
|
|
|
/// <description>
|
|
|
/// The bitmap is monochrome, and the bmiColors member of <see cref="FreeImageAPI.BITMAPINFO"/>
|
|
|
/// contains two entries. Each bit in the bitmap array represents a pixel. If the bit is clear,
|
|
|
/// the pixel is displayed with the color of the first entry in the bmiColors table; if the bit
|
|
|
/// is set, the pixel has the color of the second entry in the table.
|
|
|
/// </description>
|
|
|
/// </item>
|
|
|
///
|
|
|
/// <item>
|
|
|
/// <term>4</term>
|
|
|
/// <description>
|
|
|
/// The bitmap has a maximum of 16 colors, and the <b>bmiColors</b> member of <b>BITMAPINFO</b>
|
|
|
/// contains up to 16 entries. Each pixel in the bitmap is represented by a 4-bit index into the
|
|
|
/// color table. For example, if the first byte in the bitmap is 0x1F, the byte represents two
|
|
|
/// pixels. The first pixel contains the color in the second table entry, and the second pixel
|
|
|
/// contains the color in the sixteenth table entry.</description>
|
|
|
/// </item>
|
|
|
///
|
|
|
/// <item>
|
|
|
/// <term>8</term>
|
|
|
/// <description>
|
|
|
/// The bitmap has a maximum of 256 colors, and the <b>bmiColors</b> member of <b>BITMAPINFO</b>
|
|
|
/// contains up to 256 entries. In this case, each byte in the array represents a single pixel.
|
|
|
/// </description>
|
|
|
/// </item>
|
|
|
///
|
|
|
/// <item>
|
|
|
/// <term>16</term>
|
|
|
/// <description>
|
|
|
/// The bitmap has a maximum of 2^16 colors. If the <b>biCompression</b> member of the
|
|
|
/// <b>BITMAPINFOHEADER</b> is BI_RGB, the <b>bmiColors</b> member of <b>BITMAPINFO</b> is NULL.
|
|
|
/// Each <b>WORD</b> in the bitmap array represents a single pixel. The relative intensities
|
|
|
/// of red, green, and blue are represented with five bits for each color component.
|
|
|
/// The value for blue is in the least significant five bits, followed by five bits each for
|
|
|
/// green and red. The most significant bit is not used. The <b>bmiColors</b> color table is used
|
|
|
/// for optimizing colors used on palette-based devices, and must contain the number of entries
|
|
|
/// specified by the <b>biClrUsed</b> member of the <b>BITMAPINFOHEADER</b>.
|
|
|
/// <para/>
|
|
|
/// If the <b>biCompression</b> member of the <b>BITMAPINFOHEADER</b> is BI_BITFIELDS, the
|
|
|
/// <b>bmiColors</b> member contains three <b>DWORD</b> color masks that specify the red, green,
|
|
|
/// and blue components, respectively, of each pixel. Each <b>WORD</b> in the bitmap array represents
|
|
|
/// a single pixel.
|
|
|
/// <para/>
|
|
|
/// <b>Windows NT/Windows 2000/XP:</b> When the <b>biCompression</b> member is BI_BITFIELDS,
|
|
|
/// bits set in each <b>DWORD</b> mask must be contiguous and should not overlap the bits
|
|
|
/// of another mask. All the bits in the pixel do not have to be used.
|
|
|
/// <para/>
|
|
|
/// <b>Windows 95/98/Me:</b> When the <b>biCompression</b> member is BI_BITFIELDS, the system
|
|
|
/// supports only the following 16bpp color masks: A 5-5-5 16-bit image, where the blue mask is
|
|
|
/// 0x001F, the green mask is 0x03E0, and the red mask is 0x7C00; and a 5-6-5 16-bit image,
|
|
|
/// where the blue mask is 0x001F, the green mask is 0x07E0, and the red mask is 0xF800.
|
|
|
/// </description>
|
|
|
/// </item>
|
|
|
///
|
|
|
/// <item>
|
|
|
/// <term>24</term>
|
|
|
/// <description>
|
|
|
/// The bitmap has a maximum of 2^24 colors, and the <b>bmiColors</b> member of <b>BITMAPINFO</b>
|
|
|
/// is NULL. Each 3-byte triplet in the bitmap array represents the relative intensities of blue,
|
|
|
/// green, and red, respectively, for a pixel. The <b>bmiColors</b> color table is used for
|
|
|
/// optimizing colors used on palette-based devices, and must contain the number of entries
|
|
|
/// specified by the <b>biClrUsed</b> member of the <b>BITMAPINFOHEADER</b>.
|
|
|
/// </description>
|
|
|
/// </item>
|
|
|
///
|
|
|
/// <item>
|
|
|
/// <term>32</term>
|
|
|
/// <description>
|
|
|
/// The bitmap has a maximum of 2^32 colors. If the <b>biCompression</b> member of the
|
|
|
/// <b>BITMAPINFOHEADER</b> is BI_RGB, the <b>bmiColors</b> member of <b>BITMAPINFO</b> is NULL.
|
|
|
/// Each <b>DWORD</b> in the bitmap array represents the relative intensities of blue, green, and red,
|
|
|
/// respectively, for a pixel. The high byte in each <b>DWORD</b> is not used. The <b>bmiColors</b>
|
|
|
/// color table is used for optimizing colors used on palette-based devices, and must contain the
|
|
|
/// number of entries specified by the <b>biClrUsed</b> member of the <b>BITMAPINFOHEADER</b>.
|
|
|
/// <para/>
|
|
|
/// If the <b>biCompression</b> member of the <b>BITMAPINFOHEADER</b> is BI_BITFIELDS,
|
|
|
/// the <b>bmiColors</b> member contains three <b>DWORD</b> color masks that specify the red, green,
|
|
|
/// and blue components, respectively, of each pixel. Each <b>DWORD</b> in the bitmap array represents
|
|
|
/// a single pixel.
|
|
|
/// <para/>
|
|
|
/// <b>Windows NT/ 2000:</b> When the <b>biCompression</b> member is BI_BITFIELDS, bits set in each
|
|
|
/// <b>DWORD</b> mask must be contiguous and should not overlap the bits of another mask. All the
|
|
|
/// bits in the pixel do not need to be used.
|
|
|
/// <para/>
|
|
|
/// <b>Windows 95/98/Me:</b> When the <b>biCompression</b> member is BI_BITFIELDS, the system
|
|
|
/// supports only the following 32-bpp color mask: The blue mask is 0x000000FF, the green mask is
|
|
|
/// 0x0000FF00, and the red mask is 0x00FF0000.
|
|
|
/// </description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// </summary>
|
|
|
public ushort biBitCount;
|
|
|
/// <summary>
|
|
|
/// Specifies the type of compression for a compressed bottom-up bitmap (top-down DIBs cannot be
|
|
|
/// compressed).
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>Value</term>
|
|
|
/// <description>Meaning</description>
|
|
|
/// </listheader>
|
|
|
///
|
|
|
/// <item>
|
|
|
/// <term>BI_RGB</term>
|
|
|
/// <description>An uncompressed format.</description>
|
|
|
/// </item>
|
|
|
///
|
|
|
/// <item>
|
|
|
/// <term>BI_RLE8</term>
|
|
|
/// <description>A run-length encoded (RLE) format for bitmaps with 8 bpp. The compression format
|
|
|
/// is a 2-byte format consisting of a count byte followed by a byte containing a color index.
|
|
|
/// </description>
|
|
|
/// </item>
|
|
|
///
|
|
|
/// <item>
|
|
|
/// <term>BI_RLE4</term>
|
|
|
/// <description>An RLE format for bitmaps with 4 bpp. The compression format is a 2-byte format
|
|
|
/// consisting of a count byte followed by two word-length color indexes.</description>
|
|
|
/// </item>
|
|
|
///
|
|
|
/// <item>
|
|
|
/// <term>BI_BITFIELDS</term>
|
|
|
/// <description>Specifies that the bitmap is not compressed and that the color table consists
|
|
|
/// of three <b>DWORD</b> color masks that specify the red, green, and blue components, respectively,
|
|
|
/// of each pixel. This is valid when used with 16- and 32-bpp bitmaps.</description>
|
|
|
/// </item>
|
|
|
///
|
|
|
/// <item>
|
|
|
/// <term>BI_JPEG</term>
|
|
|
/// <description><b>Windows 98/Me, Windows 2000/XP:</b> Indicates that the image is a JPEG image.
|
|
|
/// </description>
|
|
|
/// </item>
|
|
|
///
|
|
|
/// <item>
|
|
|
/// <term>BI_PNG</term>
|
|
|
/// <description><b>Windows 98/Me, Windows 2000/XP:</b> Indicates that the image is a PNG image.
|
|
|
/// </description>
|
|
|
/// </item>
|
|
|
///
|
|
|
/// </list>
|
|
|
/// </summary>
|
|
|
public uint biCompression;
|
|
|
/// <summary>
|
|
|
/// Specifies the size, in bytes, of the image. This may be set to zero for BI_RGB bitmaps.
|
|
|
/// <para/>
|
|
|
/// <b>Windows 98/Me, Windows 2000/XP:</b> If <b>biCompression</b> is BI_JPEG or BI_PNG,
|
|
|
/// <b>biSizeImage</b> indicates the size of the JPEG or PNG image buffer, respectively.
|
|
|
/// </summary>
|
|
|
public uint biSizeImage;
|
|
|
/// <summary>
|
|
|
/// Specifies the horizontal resolution, in pixels-per-meter, of the target device for the bitmap.
|
|
|
/// An application can use this value to select a bitmap from a resource group that best matches
|
|
|
/// the characteristics of the current device.
|
|
|
/// </summary>
|
|
|
public int biXPelsPerMeter;
|
|
|
/// <summary>
|
|
|
/// Specifies the vertical resolution, in pixels-per-meter, of the target device for the bitmap.
|
|
|
/// </summary>
|
|
|
public int biYPelsPerMeter;
|
|
|
/// <summary>
|
|
|
/// Specifies the number of color indexes in the color table that are actually used by the bitmap.
|
|
|
/// If this value is zero, the bitmap uses the maximum number of colors corresponding to the value
|
|
|
/// of the biBitCount member for the compression mode specified by <b>biCompression</b>.
|
|
|
/// <para/>
|
|
|
/// If <b>iClrUsed</b> is nonzero and the <b>biBitCount</b> member is less than 16, the <b>biClrUsed</b>
|
|
|
/// member specifies the actual number of colors the graphics engine or device driver accesses.
|
|
|
/// If <b>biBitCount</b> is 16 or greater, the <b>biClrUsed</b> member specifies the size of the color
|
|
|
/// table used to optimize performance of the system color palettes. If <b>biBitCount</b> equals 16 or 32,
|
|
|
/// the optimal color palette starts immediately following the three <b>DWORD</b> masks.
|
|
|
/// <para/>
|
|
|
/// When the bitmap array immediately follows the <see cref="BITMAPINFO"/> structure, it is a packed bitmap.
|
|
|
/// Packed bitmaps are referenced by a single pointer. Packed bitmaps require that the
|
|
|
/// <b>biClrUsed</b> member must be either zero or the actual size of the color table.
|
|
|
/// </summary>
|
|
|
public uint biClrUsed;
|
|
|
/// <summary>
|
|
|
/// Specifies the number of color indexes that are required for displaying the bitmap. If this value
|
|
|
/// is zero, all colors are required.
|
|
|
/// </summary>
|
|
|
public uint biClrImportant;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="BITMAPINFOHEADER"/> structures are equivalent.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="BITMAPINFOHEADER"/> that is to the left of the equality operator.</param>
|
|
|
/// <param name="right">The <see cref="BITMAPINFOHEADER"/> that is to the right of the equality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="BITMAPINFOHEADER"/> structures are equal; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(BITMAPINFOHEADER left, BITMAPINFOHEADER right)
|
|
|
{
|
|
|
return ((left.biSize == right.biSize) &&
|
|
|
(left.biWidth == right.biWidth) &&
|
|
|
(left.biHeight == right.biHeight) &&
|
|
|
(left.biPlanes == right.biPlanes) &&
|
|
|
(left.biBitCount == right.biBitCount) &&
|
|
|
(left.biCompression == right.biCompression) &&
|
|
|
(left.biSizeImage == right.biSizeImage) &&
|
|
|
(left.biXPelsPerMeter == right.biXPelsPerMeter) &&
|
|
|
(left.biYPelsPerMeter == right.biYPelsPerMeter) &&
|
|
|
(left.biClrUsed == right.biClrUsed) &&
|
|
|
(left.biClrImportant == right.biClrImportant));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="BITMAPINFOHEADER"/> structures are different.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="BITMAPINFOHEADER"/> that is to the left of the inequality operator.</param>
|
|
|
/// <param name="right">The <see cref="BITMAPINFOHEADER"/> that is to the right of the inequality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="BITMAPINFOHEADER"/> structures are different; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(BITMAPINFOHEADER left, BITMAPINFOHEADER right)
|
|
|
{
|
|
|
return !(left == right);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified <see cref="BITMAPINFOHEADER"/> structure is equivalent to this <see cref="BITMAPINFOHEADER"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="BITMAPINFOHEADER"/> structure to compare to this instance.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="BITMAPINFOHEADER"/> structure
|
|
|
/// equivalent to this <see cref="BITMAPINFOHEADER"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(BITMAPINFOHEADER other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified object is a <see cref="BITMAPINFOHEADER"/> structure
|
|
|
/// and is equivalent to this <see cref="BITMAPINFOHEADER"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The object to test.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="BITMAPINFOHEADER"/> structure
|
|
|
/// equivalent to this <see cref="BITMAPINFOHEADER"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return ((obj is BITMAPINFOHEADER) && (this == (BITMAPINFOHEADER)obj));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="BITMAPINFOHEADER"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="BITMAPINFOHEADER"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return base.GetHashCode();
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>BITMAPINFO</b> structure defines the dimensions and color information for a DIB.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// A DIB consists of two distinct parts: a <b>BITMAPINFO</b> structure describing the dimensions
|
|
|
/// and colors of the bitmap, and an array of bytes defining the pixels of the bitmap. The bits in
|
|
|
/// the array are packed together, but each scan line must be padded with zeroes to end on a
|
|
|
/// <b>LONG</b> data-type boundary. If the height of the bitmap is positive, the bitmap is a
|
|
|
/// bottom-up DIB and its origin is the lower-left corner. If the height is negative, the bitmap is
|
|
|
/// a top-down DIB and its origin is the upper left corner.
|
|
|
/// <para/>
|
|
|
/// A bitmap is packed when the bitmap array immediately follows the <b>BITMAPINFO</b> header.
|
|
|
/// Packed bitmaps are referenced by a single pointer. For packed bitmaps, the <b>biClrUsed</b>
|
|
|
/// member must be set to an even number when using the DIB_PAL_COLORS mode so that the DIB bitmap
|
|
|
/// array starts on a <b>DWORD</b> boundary.
|
|
|
/// <para/>
|
|
|
/// <b>Note</b> The <b>bmiColors</b> member should not contain palette indexes if the bitmap is to
|
|
|
/// be stored in a file or transferred to another application.
|
|
|
/// <para/>
|
|
|
/// Unless the application has exclusive use and control of the bitmap, the bitmap color table
|
|
|
/// should contain explicit RGB values.
|
|
|
/// </remarks>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential)]
|
|
|
public struct BITMAPINFO : IEquatable<BITMAPINFO>
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Specifies a <see cref="FreeImageAPI.BITMAPINFOHEADER"/> structure that contains information
|
|
|
/// about the dimensions of color format.
|
|
|
/// </summary>
|
|
|
public BITMAPINFOHEADER bmiHeader;
|
|
|
/// <summary>
|
|
|
/// The <b>bmiColors</b> member contains one of the following:
|
|
|
/// <list type="bullets">
|
|
|
///
|
|
|
/// <item>
|
|
|
/// <term>
|
|
|
/// An array of <see cref="FreeImageAPI.RGBQUAD"/>. The elements of the array that make up the
|
|
|
/// color table.
|
|
|
/// </term>
|
|
|
/// </item>
|
|
|
///
|
|
|
/// <item>
|
|
|
/// <term>
|
|
|
/// An array of 16-bit unsigned integers that specifies indexes into the currently realized
|
|
|
/// logical palette. This use of <b>bmiColors</b> is allowed for functions that use DIBs.
|
|
|
/// When <b>bmiColors</b> elements contain indexes to a realized logical palette, they must
|
|
|
/// also call the following bitmap functions:
|
|
|
/// </term>
|
|
|
/// </item>
|
|
|
///
|
|
|
/// </list>
|
|
|
/// <b>CreateDIBitmap</b>
|
|
|
/// <para/>
|
|
|
/// <b>CreateDIBPatternBrush</b>
|
|
|
/// <para/>
|
|
|
/// <b>CreateDIBSection</b>
|
|
|
/// <para/>
|
|
|
/// The <i>iUsage</i> parameter of CreateDIBSection must be set to DIB_PAL_COLORS.
|
|
|
/// <para/>
|
|
|
/// The number of entries in the array depends on the values of the <b>biBitCount</b> and
|
|
|
/// <b>biClrUsed</b> members of the <see cref="FreeImageAPI.BITMAPINFOHEADER"/> structure.
|
|
|
/// <para/>
|
|
|
/// The colors in the <b>bmiColors</b> table appear in order of importance. For more information,
|
|
|
/// see the Remarks section.
|
|
|
/// </summary>
|
|
|
public RGBQUAD[] bmiColors;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="BITMAPINFO"/> structures are equivalent.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="BITMAPINFO"/> that is to the left of the equality operator.</param>
|
|
|
/// <param name="right">The <see cref="BITMAPINFO"/> that is to the right of the equality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="BITMAPINFO"/> structures are equal; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(BITMAPINFO left, BITMAPINFO right)
|
|
|
{
|
|
|
if (left.bmiHeader != right.bmiHeader)
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
if ((left.bmiColors == null) && (right.bmiColors == null))
|
|
|
{
|
|
|
return true;
|
|
|
}
|
|
|
if ((left.bmiColors == null) || (right.bmiColors == null))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
if (left.bmiColors.Length != right.bmiColors.Length)
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
for (int i = 0; i < left.bmiColors.Length; i++)
|
|
|
{
|
|
|
if (left.bmiColors[i] != right.bmiColors[i])
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
}
|
|
|
return true;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="BITMAPINFO"/> structures are different.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="BITMAPINFO"/> that is to the left of the inequality operator.</param>
|
|
|
/// <param name="right">The <see cref="BITMAPINFO"/> that is to the right of the inequality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="BITMAPINFO"/> structures are different; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(BITMAPINFO left, BITMAPINFO right)
|
|
|
{
|
|
|
return !(left == right);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified <see cref="BITMAPINFO"/> structure is equivalent to this <see cref="BITMAPINFO"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="BITMAPINFO"/> structure to compare to this instance.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="BITMAPINFO"/> structure
|
|
|
/// equivalent to this <see cref="BITMAPINFO"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(BITMAPINFO other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified object is a <see cref="BITMAPINFO"/> structure
|
|
|
/// and is equivalent to this <see cref="BITMAPINFO"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The object to test.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="BITMAPINFO"/> structure
|
|
|
/// equivalent to this <see cref="BITMAPINFO"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return ((obj is BITMAPINFO) && (this == ((BITMAPINFO)obj)));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="BITMAPINFO"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="BITMAPINFO"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
int hash = bmiHeader.GetHashCode();
|
|
|
if (bmiColors != null)
|
|
|
{
|
|
|
for (int c = 0; c < bmiColors.Length; c++)
|
|
|
{
|
|
|
hash ^= bmiColors[c].GetHashCode();
|
|
|
hash <<= 1;
|
|
|
}
|
|
|
hash <<= 1;
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
hash >>= 1;
|
|
|
}
|
|
|
return hash;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>FIBITMAP</b> structure is a handle to a FreeImage bimtap.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The handle represented by a <b>FIBITBAP</b> structure provides
|
|
|
/// access to either a singlepage bitmap or exactly one page of
|
|
|
/// a multipage bitmap.
|
|
|
/// </remarks>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential)]
|
|
|
public struct FIBITMAP : IComparable, IComparable<FIBITMAP>, IEquatable<FIBITMAP>
|
|
|
{
|
|
|
private IntPtr data;
|
|
|
|
|
|
/// <summary>
|
|
|
/// A read-only field that represents a handle that has been initialized to zero.
|
|
|
/// </summary>
|
|
|
public static readonly FIBITMAP Zero;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FIBITMAP"/> structures are equivalent.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FIBITMAP"/> that is to the left of the equality operator.</param>
|
|
|
/// <param name="right">The <see cref="FIBITMAP"/> that is to the right of the equality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FIBITMAP"/> structures are equal; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(FIBITMAP left, FIBITMAP right)
|
|
|
{
|
|
|
return (left.data == right.data);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FIBITMAP"/> structures are different.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FIBITMAP"/> that is to the left of the inequality operator.</param>
|
|
|
/// <param name="right">The <see cref="FIBITMAP"/> that is to the right of the inequality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FIBITMAP"/> structures are different; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(FIBITMAP left, FIBITMAP right)
|
|
|
{
|
|
|
return (left.data != right.data);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets whether the handle is a null or not.
|
|
|
/// </summary>
|
|
|
/// <value><b>true</b> if this <see cref="FIBITMAP"/> handle is a null;
|
|
|
/// otherwise, <b>false</b>.</value>
|
|
|
public bool IsNull
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return (data == IntPtr.Zero);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the handle to <i>null</i>.
|
|
|
/// </summary>
|
|
|
public void SetNull()
|
|
|
{
|
|
|
data = IntPtr.Zero;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the numeric value of the <see cref="FIBITMAP"/> object
|
|
|
/// to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return data.ToString();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="FIBITMAP"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="FIBITMAP"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return data.GetHashCode();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Determines whether the specified <see cref="Object"/> is equal to the current <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The <see cref="Object"/> to compare with the current <see cref="Object"/>.</param>
|
|
|
/// <returns><b>true</b> if the specified <see cref="Object"/> is equal to the current <see cref="Object"/>; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return ((obj is FIBITMAP) && (this == ((FIBITMAP)obj)));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Indicates whether the current object is equal to another object of the same type.
|
|
|
/// </summary>
|
|
|
/// <param name="other">An object to compare with this object.</param>
|
|
|
/// <returns><b>true</b> if the current object is equal to the other parameter; otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(FIBITMAP other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer indicating the lexical relationship between the two comparands.</returns>
|
|
|
/// <exception cref="ArgumentException"><paramref name="obj"/> is not a <see cref="FIBITMAP"/>.</exception>
|
|
|
public int CompareTo(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
if (!(obj is FIBITMAP))
|
|
|
{
|
|
|
throw new ArgumentException("obj");
|
|
|
}
|
|
|
return CompareTo((FIBITMAP)obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="FIBITMAP"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FIBITMAP"/> to compare.</param>
|
|
|
/// <returns>A signed number indicating the relative values of this instance
|
|
|
/// and <paramref name="other"/>.</returns>
|
|
|
public int CompareTo(FIBITMAP other)
|
|
|
{
|
|
|
return this.data.ToInt64().CompareTo(other.data.ToInt64());
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>FIMULTIBITMAP</b> structure is a handle to a FreeImage multipaged bimtap.
|
|
|
/// </summary>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential)]
|
|
|
public struct FIMULTIBITMAP : IComparable, IComparable<FIMULTIBITMAP>, IEquatable<FIMULTIBITMAP>
|
|
|
{
|
|
|
private IntPtr data;
|
|
|
|
|
|
/// <summary>
|
|
|
/// A read-only field that represents a handle that has been initialized to zero.
|
|
|
/// </summary>
|
|
|
public static readonly FIMULTIBITMAP Zero;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FIMULTIBITMAP"/> structures are equivalent.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FIMULTIBITMAP"/> that is to the left of the equality operator.</param>
|
|
|
/// <param name="right">The <see cref="FIMULTIBITMAP"/> that is to the right of the equality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FIMULTIBITMAP"/> structures are equal; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(FIMULTIBITMAP left, FIMULTIBITMAP right)
|
|
|
{
|
|
|
return (left.data == right.data);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FIMULTIBITMAP"/> structures are different.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FIMULTIBITMAP"/> that is to the left of the inequality operator.</param>
|
|
|
/// <param name="right">The <see cref="FIMULTIBITMAP"/> that is to the right of the inequality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FIMULTIBITMAP"/> structures are different; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(FIMULTIBITMAP left, FIMULTIBITMAP right)
|
|
|
{
|
|
|
return (left.data != right.data);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets whether the handle is a null or not.
|
|
|
/// </summary>
|
|
|
/// <value><b>true</b> if this <see cref="FIMULTIBITMAP"/> handle is a null;
|
|
|
/// otherwise, <b>false</b>.</value>
|
|
|
public bool IsNull
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return (data == IntPtr.Zero);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the handle to <i>null</i>.
|
|
|
/// </summary>
|
|
|
public void SetNull()
|
|
|
{
|
|
|
data = IntPtr.Zero;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the numeric value of the <see cref="FIMULTIBITMAP"/> object
|
|
|
/// to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return data.ToString();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="FIMULTIBITMAP"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="FIMULTIBITMAP"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return data.GetHashCode();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Determines whether the specified <see cref="Object"/> is equal to the current <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The <see cref="Object"/> to compare with the current <see cref="Object"/>.</param>
|
|
|
/// <returns><b>true</b> if the specified <see cref="Object"/> is equal to the current <see cref="Object"/>; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return ((obj is FIMULTIBITMAP) && (this == ((FIMULTIBITMAP)obj)));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Indicates whether the current object is equal to another object of the same type.
|
|
|
/// </summary>
|
|
|
/// <param name="other">An object to compare with this object.</param>
|
|
|
/// <returns><b>true</b> if the current object is equal to the other parameter; otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(FIMULTIBITMAP other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer indicating the lexical relationship between the two comparands.</returns>
|
|
|
/// <exception cref="ArgumentException"><paramref name="obj"/> is not a <see cref="FIMULTIBITMAP"/>.</exception>
|
|
|
public int CompareTo(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
if (!(obj is FIMULTIBITMAP))
|
|
|
{
|
|
|
throw new ArgumentException("obj");
|
|
|
}
|
|
|
return CompareTo((FIMULTIBITMAP)obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="FIMULTIBITMAP"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FIMULTIBITMAP"/> to compare.</param>
|
|
|
/// <returns>A signed number indicating the relative values of this instance
|
|
|
/// and <paramref name="other"/>.</returns>
|
|
|
public int CompareTo(FIMULTIBITMAP other)
|
|
|
{
|
|
|
return this.data.ToInt64().CompareTo(other.data.ToInt64());
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>FIMEMORY</b> structure is a handle to an opened memory stream.
|
|
|
/// </summary>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential)]
|
|
|
public struct FIMEMORY : IComparable, IComparable<FIMEMORY>, IEquatable<FIMEMORY>
|
|
|
{
|
|
|
private IntPtr data;
|
|
|
|
|
|
/// <summary>
|
|
|
/// A read-only field that represents a handle that has been initialized to zero.
|
|
|
/// </summary>
|
|
|
public static readonly FIMEMORY Zero;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FIMEMORY"/> structures are equivalent.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FIMEMORY"/> that is to the left of the equality operator.</param>
|
|
|
/// <param name="right">The <see cref="FIMEMORY"/> that is to the right of the equality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FIMEMORY"/> structures are equal; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(FIMEMORY left, FIMEMORY right)
|
|
|
{
|
|
|
return (left.data == right.data);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FIMEMORY"/> structures are different.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FIMEMORY"/> that is to the left of the inequality operator.</param>
|
|
|
/// <param name="right">The <see cref="FIMEMORY"/> that is to the right of the inequality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FIMEMORY"/> structures are different; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(FIMEMORY left, FIMEMORY right)
|
|
|
{
|
|
|
return (left.data != right.data);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets whether the pointer is a null pointer or not.
|
|
|
/// </summary>
|
|
|
/// <value><b>true</b> if this <see cref="FIMEMORY"/> is a null pointer;
|
|
|
/// otherwise, <b>false</b>.</value>
|
|
|
public bool IsNull
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return (data == IntPtr.Zero);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the handle to <i>null</i>.
|
|
|
/// </summary>
|
|
|
public void SetNull()
|
|
|
{
|
|
|
data = IntPtr.Zero;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the numeric value of the <see cref="FIMEMORY"/> object
|
|
|
/// to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return data.ToString();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="FIMEMORY"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="FIMEMORY"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return data.GetHashCode();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Determines whether the specified <see cref="Object"/> is equal to the current <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The <see cref="Object"/> to compare with the current <see cref="Object"/>.</param>
|
|
|
/// <returns><b>true</b> if the specified <see cref="Object"/> is equal to the current <see cref="Object"/>; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return ((obj is FIMEMORY) && (this == ((FIMEMORY)obj)));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Indicates whether the current object is equal to another object of the same type.
|
|
|
/// </summary>
|
|
|
/// <param name="other">An object to compare with this object.</param>
|
|
|
/// <returns><b>true</b> if the current object is equal to the other parameter; otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(FIMEMORY other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer indicating the lexical relationship between the two comparands.</returns>
|
|
|
/// <exception cref="ArgumentException"><paramref name="obj"/> is not a <see cref="FIMEMORY"/>.</exception>
|
|
|
public int CompareTo(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
if (!(obj is FIMEMORY))
|
|
|
{
|
|
|
throw new ArgumentException("obj");
|
|
|
}
|
|
|
return CompareTo((FIMEMORY)obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="FIMEMORY"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FIMEMORY"/> to compare.</param>
|
|
|
/// <returns>A signed number indicating the relative values of this instance
|
|
|
/// and <paramref name="other"/>.</returns>
|
|
|
public int CompareTo(FIMEMORY other)
|
|
|
{
|
|
|
return this.data.ToInt64().CompareTo(other.data.ToInt64());
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>FIMETADATA</b> structure is an unique search handle for metadata search operations.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The <b>FIMETADATA</b> structure is usually returned by the
|
|
|
/// <see cref="FreeImageAPI.FreeImage.FindFirstMetadata(FREE_IMAGE_MDMODEL, FIBITMAP, out FITAG)"/>
|
|
|
/// function and then used on subsequent calls to
|
|
|
/// <see cref="FreeImageAPI.FreeImage.FindNextMetadata(FIMETADATA, out FITAG)"/>.
|
|
|
/// When the <b>FIMETADATA</b> handle is no longer used, it needs to be freed by the
|
|
|
/// <see cref="FreeImageAPI.FreeImage.FindCloseMetadata(FIMETADATA)"/> function.
|
|
|
/// </remarks>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential)]
|
|
|
public struct FIMETADATA : IComparable, IComparable<FIMETADATA>, IEquatable<FIMETADATA>
|
|
|
{
|
|
|
private IntPtr data;
|
|
|
|
|
|
/// <summary>
|
|
|
/// A read-only field that represents a handle that has been initialized to zero.
|
|
|
/// </summary>
|
|
|
public static readonly FIMETADATA Zero;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FIMETADATA"/> structures are equivalent.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FIMETADATA"/> that is to the left of the equality operator.</param>
|
|
|
/// <param name="right">The <see cref="FIMETADATA"/> that is to the right of the equality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FIMETADATA"/> structures are equal; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(FIMETADATA left, FIMETADATA right)
|
|
|
{
|
|
|
return (left.data == right.data);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FIMETADATA"/> structures are different.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FIMETADATA"/> that is to the left of the inequality operator.</param>
|
|
|
/// <param name="right">The <see cref="FIMETADATA"/> that is to the right of the inequality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FIMETADATA"/> structures are different; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(FIMETADATA left, FIMETADATA right)
|
|
|
{
|
|
|
return (left.data != right.data);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets whether the pointer is a null pointer or not.
|
|
|
/// </summary>
|
|
|
/// <value><b>true</b> if this <see cref="FIMETADATA"/> is a null pointer;
|
|
|
/// otherwise, <b>false</b>.</value>
|
|
|
public bool IsNull
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return (data == IntPtr.Zero);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the handle to <i>null</i>.
|
|
|
/// </summary>
|
|
|
public void SetNull()
|
|
|
{
|
|
|
data = IntPtr.Zero;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the numeric value of the <see cref="FIMETADATA"/> object
|
|
|
/// to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return data.ToString();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="FIMETADATA"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="FIMETADATA"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return data.GetHashCode();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Determines whether the specified <see cref="Object"/> is equal to the current <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The <see cref="Object"/> to compare with the current <see cref="Object"/>.</param>
|
|
|
/// <returns><b>true</b> if the specified <see cref="Object"/> is equal to the current <see cref="Object"/>; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return ((obj is FIMETADATA) && (this == ((FIMETADATA)obj)));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Indicates whether the current object is equal to another object of the same type.
|
|
|
/// </summary>
|
|
|
/// <param name="other">An object to compare with this object.</param>
|
|
|
/// <returns><b>true</b> if the current object is equal to the other parameter; otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(FIMETADATA other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer indicating the lexical relationship between the two comparands.</returns>
|
|
|
/// <exception cref="ArgumentException"><paramref name="obj"/> is not a <see cref="FIMETADATA"/>.</exception>
|
|
|
public int CompareTo(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
if (!(obj is FIMETADATA))
|
|
|
{
|
|
|
throw new ArgumentException("obj");
|
|
|
}
|
|
|
return CompareTo((FIMETADATA)obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="FIMETADATA"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FIMETADATA"/> to compare.</param>
|
|
|
/// <returns>A signed number indicating the relative values of this instance
|
|
|
/// and <paramref name="other"/>.</returns>
|
|
|
public int CompareTo(FIMETADATA other)
|
|
|
{
|
|
|
return this.data.ToInt64().CompareTo(other.data.ToInt64());
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>FITAG</b> structure is a handle to a FreeImage metadata tag.
|
|
|
/// </summary>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential)]
|
|
|
public struct FITAG : IComparable, IComparable<FITAG>, IEquatable<FITAG>
|
|
|
{
|
|
|
private IntPtr data;
|
|
|
|
|
|
/// <summary>
|
|
|
/// A read-only field that represents a handle that has been initialized to zero.
|
|
|
/// </summary>
|
|
|
public static readonly FITAG Zero;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FITAG"/> structures are equivalent.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FITAG"/> that is to the left of the equality operator.</param>
|
|
|
/// <param name="right">The <see cref="FITAG"/> that is to the right of the equality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FITAG"/> structures are equal; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(FITAG left, FITAG right)
|
|
|
{
|
|
|
return (left.data == right.data);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FITAG"/> structures are different.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FITAG"/> that is to the left of the inequality operator.</param>
|
|
|
/// <param name="right">The <see cref="FITAG"/> that is to the right of the inequality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FITAG"/> structures are different; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(FITAG left, FITAG right)
|
|
|
{
|
|
|
return (left.data != right.data);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets whether the pointer is a null pointer or not.
|
|
|
/// </summary>
|
|
|
/// <value><b>true</b> if this <see cref="FITAG"/> is a null pointer;
|
|
|
/// otherwise, <b>false</b>.</value>
|
|
|
public bool IsNull
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return (data == IntPtr.Zero);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the handle to <i>null</i>.
|
|
|
/// </summary>
|
|
|
public void SetNull()
|
|
|
{
|
|
|
data = IntPtr.Zero;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the numeric value of the <see cref="FITAG"/> object
|
|
|
/// to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return data.ToString();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="FITAG"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="FITAG"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return data.GetHashCode();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Determines whether the specified <see cref="Object"/> is equal to the current <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The <see cref="Object"/> to compare with the current <see cref="Object"/>.</param>
|
|
|
/// <returns><b>true</b> if the specified <see cref="Object"/> is equal to the current <see cref="Object"/>; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return ((obj is FITAG) && (this == ((FITAG)obj)));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Indicates whether the current object is equal to another object of the same type.
|
|
|
/// </summary>
|
|
|
/// <param name="other">An object to compare with this object.</param>
|
|
|
/// <returns><b>true</b> if the current object is equal to the other parameter; otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(FITAG other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer indicating the lexical relationship between the two comparands.</returns>
|
|
|
/// <exception cref="ArgumentException"><paramref name="obj"/> is not a <see cref="FITAG"/>.</exception>
|
|
|
public int CompareTo(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
if (!(obj is FITAG))
|
|
|
{
|
|
|
throw new ArgumentException("obj");
|
|
|
}
|
|
|
return CompareTo((FITAG)obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="FITAG"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FITAG"/> to compare.</param>
|
|
|
/// <returns>A signed number indicating the relative values of this instance
|
|
|
/// and <paramref name="other"/>.</returns>
|
|
|
public int CompareTo(FITAG other)
|
|
|
{
|
|
|
return this.data.ToInt64().CompareTo(other.data.ToInt64());
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI.IO
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Structure for implementing access to custom handles.
|
|
|
/// </summary>
|
|
|
[StructLayout(LayoutKind.Sequential)]
|
|
|
public struct FreeImageIO
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Delegate to the C++ function <b>fread</b>.
|
|
|
/// </summary>
|
|
|
public ReadProc readProc;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to the C++ function <b>fwrite</b>.
|
|
|
/// </summary>
|
|
|
public WriteProc writeProc;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to the C++ function <b>fseek</b>.
|
|
|
/// </summary>
|
|
|
public SeekProc seekProc;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to the C++ function <b>ftell</b>.
|
|
|
/// </summary>
|
|
|
public TellProc tellProc;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>RGBQUAD</b> structure describes a color consisting of relative
|
|
|
/// intensities of red, green, blue and alpha value. Each single color
|
|
|
/// component consumes 8 bits and so, takes values in the range from 0 to 255.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <para>
|
|
|
/// The <b>RGBQUAD</b> structure provides access to an underlying Win32 <b>RGBQUAD</b>
|
|
|
/// structure. To determine the alpha, red, green or blue component of a color,
|
|
|
/// use the rgbReserved, rgbRed, rgbGreen or rgbBlue fields, respectively.
|
|
|
/// </para>
|
|
|
/// <para>For easy integration of the underlying structure into the .NET framework,
|
|
|
/// the <b>RGBQUAD</b> structure implements implicit conversion operators to
|
|
|
/// convert the represented color to and from the <see cref="System.Drawing.Color"/>
|
|
|
/// type. This makes the <see cref="System.Drawing.Color"/> type a real replacement
|
|
|
/// for the <b>RGBQUAD</b> structure and my be used in all situations which require
|
|
|
/// an <b>RGBQUAD</b> type.
|
|
|
/// </para>
|
|
|
/// <para>
|
|
|
/// Each color component rgbReserved, rgbRed, rgbGreen or rgbBlue of <b>RGBQUAD</b>
|
|
|
/// is translated into it's corresponding color component A, R, G or B of
|
|
|
/// <see cref="System.Drawing.Color"/> by an one-to-one manner and vice versa.
|
|
|
/// </para>
|
|
|
/// <para>
|
|
|
/// <b>Conversion from System.Drawing.Color to RGBQUAD</b>
|
|
|
/// </para>
|
|
|
/// <c>RGBQUAD.component = Color.component</c>
|
|
|
/// <para>
|
|
|
/// <b>Conversion from RGBQUAD to System.Drawing.Color</b>
|
|
|
/// </para>
|
|
|
/// <c>Color.component = RGBQUAD.component</c>
|
|
|
/// <para>
|
|
|
/// The same conversion is also applied when the <see cref="FreeImageAPI.RGBQUAD.Color"/>
|
|
|
/// property or the <see cref="FreeImageAPI.RGBQUAD(System.Drawing.Color)"/> constructor
|
|
|
/// is invoked.
|
|
|
/// </para>
|
|
|
/// </remarks>
|
|
|
/// <example>
|
|
|
/// The following code example demonstrates the various conversions between the
|
|
|
/// <b>RGBQUAD</b> structure and the <see cref="System.Drawing.Color"/> structure.
|
|
|
/// <code>
|
|
|
/// RGBQUAD rgbq;
|
|
|
/// // Initialize the structure using a native .NET Color structure.
|
|
|
/// rgbq = new RGBQUAD(Color.Indigo);
|
|
|
/// // Initialize the structure using the implicit operator.
|
|
|
/// rgbq = Color.DarkSeaGreen;
|
|
|
/// // Convert the RGBQUAD instance into a native .NET Color
|
|
|
/// // using its implicit operator.
|
|
|
/// Color color = rgbq;
|
|
|
/// // Using the structure's Color property for converting it
|
|
|
/// // into a native .NET Color.
|
|
|
/// Color another = rgbq.Color;
|
|
|
/// </code>
|
|
|
/// </example>
|
|
|
[Serializable, StructLayout(LayoutKind.Explicit)]
|
|
|
public struct RGBQUAD : IComparable, IComparable<RGBQUAD>, IEquatable<RGBQUAD>
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The blue color component.
|
|
|
/// </summary>
|
|
|
[FieldOffset(0)]
|
|
|
public byte rgbBlue;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The green color component.
|
|
|
/// </summary>
|
|
|
[FieldOffset(1)]
|
|
|
public byte rgbGreen;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The red color component.
|
|
|
/// </summary>
|
|
|
[FieldOffset(2)]
|
|
|
public byte rgbRed;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The alpha color component.
|
|
|
/// </summary>
|
|
|
[FieldOffset(3)]
|
|
|
public byte rgbReserved;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The color's value.
|
|
|
/// </summary>
|
|
|
[FieldOffset(0)]
|
|
|
public uint uintValue;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified <see cref="System.Drawing.Color"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="color"><see cref="System.Drawing.Color"/> to initialize with.</param>
|
|
|
public RGBQUAD(Color color)
|
|
|
{
|
|
|
uintValue = 0u;
|
|
|
rgbBlue = color.B;
|
|
|
rgbGreen = color.G;
|
|
|
rgbRed = color.R;
|
|
|
rgbReserved = color.A;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="RGBQUAD"/> structures are equivalent.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="RGBQUAD"/> that is to the left of the equality operator.</param>
|
|
|
/// <param name="right">The <see cref="RGBQUAD"/> that is to the right of the equality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="RGBQUAD"/> structures are equal; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(RGBQUAD left, RGBQUAD right)
|
|
|
{
|
|
|
return (left.uintValue == right.uintValue);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="RGBQUAD"/> structures are different.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="RGBQUAD"/> that is to the left of the inequality operator.</param>
|
|
|
/// <param name="right">The <see cref="RGBQUAD"/> that is to the right of the inequality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="RGBQUAD"/> structures are different; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(RGBQUAD left, RGBQUAD right)
|
|
|
{
|
|
|
return (left.uintValue != right.uintValue);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="System.Drawing.Color"/> structure to a <see cref="RGBQUAD"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="System.Drawing.Color"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="RGBQUAD"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator RGBQUAD(Color value)
|
|
|
{
|
|
|
return new RGBQUAD(value);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="RGBQUAD"/> structure to a Color structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="RGBQUAD"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="System.Drawing.Color"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator Color(RGBQUAD value)
|
|
|
{
|
|
|
return value.Color;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of an <see cref="UInt32"/> structure to a <see cref="RGBQUAD"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">An <see cref="UInt32"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="RGBQUAD"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator RGBQUAD(uint value)
|
|
|
{
|
|
|
RGBQUAD result = new RGBQUAD();
|
|
|
result.uintValue = value;
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="RGBQUAD"/> structure to an <see cref="UInt32"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="RGBQUAD"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="RGBQUAD"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator uint(RGBQUAD value)
|
|
|
{
|
|
|
return value.uintValue;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the <see cref="System.Drawing.Color"/> of the structure.
|
|
|
/// </summary>
|
|
|
public Color Color
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return Color.FromArgb(
|
|
|
rgbReserved,
|
|
|
rgbRed,
|
|
|
rgbGreen,
|
|
|
rgbBlue);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
rgbRed = value.R;
|
|
|
rgbGreen = value.G;
|
|
|
rgbBlue = value.B;
|
|
|
rgbReserved = value.A;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts an array of <see cref="Color"/> into an array of
|
|
|
/// <see cref="RGBQUAD"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="array">The array to convert.</param>
|
|
|
/// <returns>An array of <see cref="RGBQUAD"/>.</returns>
|
|
|
public static RGBQUAD[] ToRGBQUAD(Color[] array)
|
|
|
{
|
|
|
if (array == null)
|
|
|
return null;
|
|
|
|
|
|
RGBQUAD[] result = new RGBQUAD[array.Length];
|
|
|
for (int i = 0; i < array.Length; i++)
|
|
|
{
|
|
|
result[i] = array[i];
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts an array of <see cref="RGBQUAD"/> into an array of
|
|
|
/// <see cref="Color"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="array">The array to convert.</param>
|
|
|
/// <returns>An array of <see cref="RGBQUAD"/>.</returns>
|
|
|
public static Color[] ToColor(RGBQUAD[] array)
|
|
|
{
|
|
|
if (array == null)
|
|
|
return null;
|
|
|
|
|
|
Color[] result = new Color[array.Length];
|
|
|
for (int i = 0; i < array.Length; i++)
|
|
|
{
|
|
|
result[i] = array[i].Color;
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer indicating the lexical relationship between the two comparands.</returns>
|
|
|
/// <exception cref="ArgumentException"><paramref name="obj"/> is not a <see cref="RGBQUAD"/>.</exception>
|
|
|
public int CompareTo(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
if (!(obj is RGBQUAD))
|
|
|
{
|
|
|
throw new ArgumentException("obj");
|
|
|
}
|
|
|
return CompareTo((RGBQUAD)obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="RGBQUAD"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="RGBQUAD"/> to compare.</param>
|
|
|
/// <returns>A signed number indicating the relative values of this instance
|
|
|
/// and <paramref name="other"/>.</returns>
|
|
|
public int CompareTo(RGBQUAD other)
|
|
|
{
|
|
|
return this.Color.ToArgb().CompareTo(other.Color.ToArgb());
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified object is a <see cref="RGBQUAD"/> structure
|
|
|
/// and is equivalent to this <see cref="RGBQUAD"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The object to test.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="RGBQUAD"/> structure
|
|
|
/// equivalent to this <see cref="RGBQUAD"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return ((obj is RGBQUAD) && (this == ((RGBQUAD)obj)));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified <see cref="RGBQUAD"/> structure is equivalent to this <see cref="RGBQUAD"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="RGBQUAD"/> structure to compare to this instance.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="RGBQUAD"/> structure
|
|
|
/// equivalent to this <see cref="RGBQUAD"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(RGBQUAD other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="RGBQUAD"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="RGBQUAD"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return base.GetHashCode();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the numeric value of the <see cref="RGBQUAD"/> object
|
|
|
/// to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return FreeImage.ColorToString(Color);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>RGBTRIPLE</b> structure describes a color consisting of relative
|
|
|
/// intensities of red, green and blue value. Each single color component
|
|
|
/// consumes 8 bits and so, takes values in the range from 0 to 255.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <para>
|
|
|
/// The <b>RGBTRIPLE</b> structure provides access to an underlying Win32 <b>RGBTRIPLE</b>
|
|
|
/// structure. To determine the red, green or blue component of a color, use the
|
|
|
/// rgbtRed, rgbtGreen or rgbtBlue fields, respectively.
|
|
|
/// </para>
|
|
|
/// <para>For easy integration of the underlying structure into the .NET framework,
|
|
|
/// the <b>RGBTRIPLE</b> structure implements implicit conversion operators to
|
|
|
/// convert the represented color to and from the <see cref="System.Drawing.Color"/>
|
|
|
/// type. This makes the <see cref="System.Drawing.Color"/> type a real replacement
|
|
|
/// for the <b>RGBTRIPLE</b> structure and my be used in all situations which require
|
|
|
/// an <b>RGBTRIPLE</b> type.
|
|
|
/// </para>
|
|
|
/// <para>
|
|
|
/// Each of the color components rgbtRed, rgbtGreen or rgbtBlue of <b>RGBTRIPLE</b> is
|
|
|
/// translated into it's corresponding color component R, G or B of
|
|
|
/// <see cref="System.Drawing.Color"/> by an one-to-one manner and vice versa.
|
|
|
/// When converting from <see cref="System.Drawing.Color"/> into <b>RGBTRIPLE</b>, the
|
|
|
/// color's alpha value is ignored and assumed to be 255 when converting from
|
|
|
/// <b>RGBTRIPLE</b> into <see cref="System.Drawing.Color"/>, creating a fully
|
|
|
/// opaque color.
|
|
|
/// </para>
|
|
|
/// <para>
|
|
|
/// <b>Conversion from System.Drawing.Color to RGBTRIPLE</b>
|
|
|
/// </para>
|
|
|
/// <c>RGBTRIPLE.component = Color.component</c>
|
|
|
/// <para>
|
|
|
/// <b>Conversion from RGBTRIPLE to System.Drawing.Color</b>
|
|
|
/// </para>
|
|
|
/// <c>Color.component = RGBTRIPLE.component</c>
|
|
|
/// <para>
|
|
|
/// The same conversion is also applied when the <see cref="FreeImageAPI.RGBTRIPLE.Color"/>
|
|
|
/// property or the <see cref="FreeImageAPI.RGBTRIPLE(System.Drawing.Color)"/> constructor
|
|
|
/// is invoked.
|
|
|
/// </para>
|
|
|
/// </remarks>
|
|
|
/// <example>
|
|
|
/// The following code example demonstrates the various conversions between the
|
|
|
/// <b>RGBTRIPLE</b> structure and the <see cref="System.Drawing.Color"/> structure.
|
|
|
/// <code>
|
|
|
/// RGBTRIPLE rgbt;
|
|
|
/// // Initialize the structure using a native .NET Color structure.
|
|
|
/// rgbt = new RGBTRIPLE(Color.Indigo);
|
|
|
/// // Initialize the structure using the implicit operator.
|
|
|
/// rgbt = Color.DarkSeaGreen;
|
|
|
/// // Convert the RGBTRIPLE instance into a native .NET Color
|
|
|
/// // using its implicit operator.
|
|
|
/// Color color = rgbt;
|
|
|
/// // Using the structure's Color property for converting it
|
|
|
/// // into a native .NET Color.
|
|
|
/// Color another = rgbt.Color;
|
|
|
/// </code>
|
|
|
/// </example>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential)]
|
|
|
public struct RGBTRIPLE : IComparable, IComparable<RGBTRIPLE>, IEquatable<RGBTRIPLE>
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The blue color component.
|
|
|
/// </summary>
|
|
|
public byte rgbtBlue;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The green color component.
|
|
|
/// </summary>
|
|
|
public byte rgbtGreen;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The red color component.
|
|
|
/// </summary>
|
|
|
public byte rgbtRed;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified <see cref="System.Drawing.Color"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="color"><see cref="System.Drawing.Color"/> to initialize with.</param>
|
|
|
public RGBTRIPLE(Color color)
|
|
|
{
|
|
|
rgbtBlue = color.B;
|
|
|
rgbtGreen = color.G;
|
|
|
rgbtRed = color.R;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="RGBTRIPLE"/> structures are equivalent.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="RGBTRIPLE"/> that is to the left of the equality operator.</param>
|
|
|
/// <param name="right">The <see cref="RGBTRIPLE"/> that is to the right of the equality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="RGBTRIPLE"/> structures are equal; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(RGBTRIPLE left, RGBTRIPLE right)
|
|
|
{
|
|
|
return
|
|
|
left.rgbtBlue == right.rgbtBlue &&
|
|
|
left.rgbtGreen == right.rgbtGreen &&
|
|
|
left.rgbtRed == right.rgbtRed;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="RGBTRIPLE"/> structures are different.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="RGBTRIPLE"/> that is to the left of the inequality operator.</param>
|
|
|
/// <param name="right">The <see cref="RGBTRIPLE"/> that is to the right of the inequality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="RGBTRIPLE"/> structures are different; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(RGBTRIPLE left, RGBTRIPLE right)
|
|
|
{
|
|
|
return !(left == right);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="System.Drawing.Color"/> structure to a <see cref="RGBTRIPLE"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="System.Drawing.Color"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="RGBTRIPLE"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator RGBTRIPLE(Color value)
|
|
|
{
|
|
|
return new RGBTRIPLE(value);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="RGBTRIPLE"/> structure to a <see cref="System.Drawing.Color"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="RGBTRIPLE"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="System.Drawing.Color"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator Color(RGBTRIPLE value)
|
|
|
{
|
|
|
return value.Color;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of an <see cref="UInt32"/> structure to a <see cref="RGBTRIPLE"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">An <see cref="UInt32"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="RGBTRIPLE"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator RGBTRIPLE(uint value)
|
|
|
{
|
|
|
RGBTRIPLE result = new RGBTRIPLE();
|
|
|
result.rgbtBlue = (byte)(value & 0xFF);
|
|
|
result.rgbtGreen = (byte)((value >> 8) & 0xFF);
|
|
|
result.rgbtRed = (byte)((value >> 16) & 0xFF);
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="RGBTRIPLE"/> structure to an <see cref="UInt32"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="RGBTRIPLE"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="RGBTRIPLE"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator uint(RGBTRIPLE value)
|
|
|
{
|
|
|
return (uint)((value.rgbtRed << 16) | (value.rgbtGreen << 8) | (value.rgbtBlue));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the <see cref="System.Drawing.Color"/> of the structure.
|
|
|
/// </summary>
|
|
|
public Color Color
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return Color.FromArgb(
|
|
|
rgbtRed,
|
|
|
rgbtGreen,
|
|
|
rgbtBlue);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
rgbtBlue = value.B;
|
|
|
rgbtGreen = value.G;
|
|
|
rgbtRed = value.R;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer indicating the lexical relationship between the two comparands.</returns>
|
|
|
/// <exception cref="ArgumentException"><paramref name="obj"/> is not a <see cref="RGBTRIPLE"/>.</exception>
|
|
|
public int CompareTo(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
if (!(obj is RGBTRIPLE))
|
|
|
{
|
|
|
throw new ArgumentException("obj");
|
|
|
}
|
|
|
return CompareTo((RGBTRIPLE)obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="RGBTRIPLE"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="RGBTRIPLE"/> to compare.</param>
|
|
|
/// <returns>A signed number indicating the relative values of this instance
|
|
|
/// and <paramref name="other"/>.</returns>
|
|
|
public int CompareTo(RGBTRIPLE other)
|
|
|
{
|
|
|
return this.Color.ToArgb().CompareTo(other.Color.ToArgb());
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified object is a <see cref="RGBTRIPLE"/> structure
|
|
|
/// and is equivalent to this <see cref="RGBTRIPLE"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The object to test.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="RGBTRIPLE"/> structure
|
|
|
/// equivalent to this <see cref="RGBTRIPLE"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return ((obj is RGBTRIPLE) && (this == ((RGBTRIPLE)obj)));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified <see cref="RGBTRIPLE"/> structure is equivalent to this
|
|
|
/// <see cref="RGBTRIPLE"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="RGBTRIPLE"/> structure to compare to this instance.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="RGBTRIPLE"/> structure
|
|
|
/// equivalent to this <see cref="RGBTRIPLE"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(RGBTRIPLE other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="RGBTRIPLE"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="RGBTRIPLE"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return base.GetHashCode();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the numeric value of the <see cref="RGBTRIPLE"/> object
|
|
|
/// to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return FreeImage.ColorToString(Color);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>FIRGBA16</b> structure describes a color consisting of relative
|
|
|
/// intensities of red, green, blue and alpha value. Each single color
|
|
|
/// component consumes 16 bits and so, takes values in the range from 0 to 65535.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <para>
|
|
|
/// The <b>FIRGBA16</b> structure provides access to an underlying FreeImage <b>FIRGBA16</b>
|
|
|
/// structure. To determine the alpha, red, green or blue component of a color,
|
|
|
/// use the alpha, red, green or blue fields, respectively.
|
|
|
/// </para>
|
|
|
/// <para>For easy integration of the underlying structure into the .NET framework,
|
|
|
/// the <b>FIRGBA16</b> structure implements implicit conversion operators to
|
|
|
/// convert the represented color to and from the <see cref="System.Drawing.Color"/>
|
|
|
/// type. This makes the <see cref="System.Drawing.Color"/> type a real replacement
|
|
|
/// for the <b>FIRGBA16</b> structure and my be used in all situations which require
|
|
|
/// an <b>FIRGBA16</b> type.
|
|
|
/// </para>
|
|
|
/// <para>
|
|
|
/// Each color component alpha, red, green or blue of <b>FIRGBA16</b>
|
|
|
/// is translated into it's corresponding color component A, R, G or B of
|
|
|
/// <see cref="System.Drawing.Color"/> by an 8 bit right shift and vice versa.
|
|
|
/// </para>
|
|
|
/// <para>
|
|
|
/// <b>Conversion from System.Drawing.Color to FIRGBA16</b>
|
|
|
/// </para>
|
|
|
/// <c>FIRGBA16.component = Color.component << 8</c>
|
|
|
/// <para>
|
|
|
/// <b>Conversion from FIRGBA16 to System.Drawing.Color</b>
|
|
|
/// </para>
|
|
|
/// <c>Color.component = FIRGBA16.component >> 8</c>
|
|
|
/// <para>
|
|
|
/// The same conversion is also applied when the <see cref="FreeImageAPI.FIRGBA16.Color"/>
|
|
|
/// property or the <see cref="FreeImageAPI.FIRGBA16(System.Drawing.Color)"/> constructor
|
|
|
/// is invoked.
|
|
|
/// </para>
|
|
|
/// </remarks>
|
|
|
/// <example>
|
|
|
/// The following code example demonstrates the various conversions between the
|
|
|
/// <b>FIRGBA16</b> structure and the <see cref="System.Drawing.Color"/> structure.
|
|
|
/// <code>
|
|
|
/// FIRGBA16 firgba16;
|
|
|
/// // Initialize the structure using a native .NET Color structure.
|
|
|
/// firgba16 = new FIRGBA16(Color.Indigo);
|
|
|
/// // Initialize the structure using the implicit operator.
|
|
|
/// firgba16 = Color.DarkSeaGreen;
|
|
|
/// // Convert the FIRGBA16 instance into a native .NET Color
|
|
|
/// // using its implicit operator.
|
|
|
/// Color color = firgba16;
|
|
|
/// // Using the structure's Color property for converting it
|
|
|
/// // into a native .NET Color.
|
|
|
/// Color another = firgba16.Color;
|
|
|
/// </code>
|
|
|
/// </example>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential)]
|
|
|
public struct FIRGBA16 : IComparable, IComparable<FIRGBA16>, IEquatable<FIRGBA16>
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The red color component.
|
|
|
/// </summary>
|
|
|
public ushort red;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The green color component.
|
|
|
/// </summary>
|
|
|
public ushort green;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The blue color component.
|
|
|
/// </summary>
|
|
|
public ushort blue;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The alpha color component.
|
|
|
/// </summary>
|
|
|
public ushort alpha;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified <see cref="System.Drawing.Color"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="color"><see cref="System.Drawing.Color"/> to initialize with.</param>
|
|
|
public FIRGBA16(Color color)
|
|
|
{
|
|
|
red = (ushort)(color.R << 8);
|
|
|
green = (ushort)(color.G << 8);
|
|
|
blue = (ushort)(color.B << 8);
|
|
|
alpha = (ushort)(color.A << 8);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FIRGBA16"/> structures are equivalent.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FIRGBA16"/> that is to the left of the equality operator.</param>
|
|
|
/// <param name="right">The <see cref="FIRGBA16"/> that is to the right of the equality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FIRGBA16"/> structures are equal; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(FIRGBA16 left, FIRGBA16 right)
|
|
|
{
|
|
|
return
|
|
|
((left.alpha == right.alpha) &&
|
|
|
(left.blue == right.blue) &&
|
|
|
(left.green == right.green) &&
|
|
|
(left.red == right.red));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FIRGBA16"/> structures are different.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FIRGBA16"/> that is to the left of the inequality operator.</param>
|
|
|
/// <param name="right">The <see cref="FIRGBA16"/> that is to the right of the inequality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FIRGBA16"/> structures are different; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(FIRGBA16 left, FIRGBA16 right)
|
|
|
{
|
|
|
return !(left == right);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="System.Drawing.Color"/> structure to a <see cref="FIRGBA16"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="System.Drawing.Color"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIRGBA16"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FIRGBA16(Color value)
|
|
|
{
|
|
|
return new FIRGBA16(value);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIRGBA16"/> structure to a <see cref="System.Drawing.Color"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIRGBA16"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="System.Drawing.Color"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator Color(FIRGBA16 value)
|
|
|
{
|
|
|
return value.Color;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the <see cref="System.Drawing.Color"/> of the structure.
|
|
|
/// </summary>
|
|
|
public Color Color
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return Color.FromArgb((alpha >> 8), (red >> 8), (green >> 8), (blue >> 8));
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
red = (ushort)(value.R << 8);
|
|
|
green = (ushort)(value.G << 8);
|
|
|
blue = (ushort)(value.B << 8);
|
|
|
alpha = (ushort)(value.A << 8);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer indicating the lexical relationship between the two comparands.</returns>
|
|
|
/// <exception cref="ArgumentException"><paramref name="obj"/> is not a <see cref="FIRGBA16"/>.</exception>
|
|
|
public int CompareTo(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
if (!(obj is FIRGBA16))
|
|
|
{
|
|
|
throw new ArgumentException("obj");
|
|
|
}
|
|
|
return CompareTo((FIRGBA16)obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="FIRGBA16"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FIRGBA16"/> to compare.</param>
|
|
|
/// <returns>A signed number indicating the relative values of this instance
|
|
|
/// and <paramref name="other"/>.</returns>
|
|
|
public int CompareTo(FIRGBA16 other)
|
|
|
{
|
|
|
return this.Color.ToArgb().CompareTo(other.Color.ToArgb());
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified object is a <see cref="FIRGBA16"/> structure
|
|
|
/// and is equivalent to this <see cref="FIRGBA16"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The object to test.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="FIRGBA16"/> structure
|
|
|
/// equivalent to this <see cref="FIRGBA16"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return ((obj is FIRGBA16) && (this == ((FIRGBA16)obj)));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified <see cref="FIRGBA16"/> structure is equivalent to this <see cref="FIRGBA16"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FIRGBA16"/> structure to compare to this instance.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="FIRGBA16"/> structure
|
|
|
/// equivalent to this <see cref="FIRGBA16"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(FIRGBA16 other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="FIRGBA16"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="FIRGBA16"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return base.GetHashCode();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the numeric value of the <see cref="FIRGBA16"/> object
|
|
|
/// to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return FreeImage.ColorToString(Color);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>FIRGB16</b> structure describes a color consisting of relative
|
|
|
/// intensities of red, green, blue and alpha value. Each single color
|
|
|
/// component consumes 16 bits and so, takes values in the range from 0 to 65535.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <para>
|
|
|
/// The <b>FIRGB16</b> structure provides access to an underlying FreeImage <b>FIRGB16</b>
|
|
|
/// structure. To determine the red, green or blue component of a color,
|
|
|
/// use the red, green or blue fields, respectively.
|
|
|
/// </para>
|
|
|
/// <para>For easy integration of the underlying structure into the .NET framework,
|
|
|
/// the <b>FIRGB16</b> structure implements implicit conversion operators to
|
|
|
/// convert the represented color to and from the <see cref="System.Drawing.Color"/>
|
|
|
/// type. This makes the <see cref="System.Drawing.Color"/> type a real replacement
|
|
|
/// for the <b>FIRGB16</b> structure and my be used in all situations which require
|
|
|
/// an <b>FIRGB16</b> type.
|
|
|
/// </para>
|
|
|
/// <para>
|
|
|
/// Each color component red, green or blue of <b>FIRGB16</b> is translated into
|
|
|
/// it's corresponding color component R, G or B of
|
|
|
/// <see cref="System.Drawing.Color"/> by right shifting 8 bits and shifting left 8 bits for the reverse conversion.
|
|
|
/// When converting from <see cref="System.Drawing.Color"/> into <b>FIRGB16</b>, the
|
|
|
/// color's alpha value is ignored and assumed to be 255 when converting from
|
|
|
/// <b>FIRGB16</b> into <see cref="System.Drawing.Color"/>, creating a fully
|
|
|
/// opaque color.
|
|
|
/// </para>
|
|
|
/// <para>
|
|
|
/// <b>Conversion from System.Drawing.Color to FIRGB16</b>
|
|
|
/// </para>
|
|
|
/// <c>FIRGB16.component = Color.component << 8</c>
|
|
|
/// <para>
|
|
|
/// <b>Conversion from FIRGB16 to System.Drawing.Color</b>
|
|
|
/// </para>
|
|
|
/// <c>Color.component = FIRGB16.component >> 8</c>
|
|
|
/// <para>
|
|
|
/// The same conversion is also applied when the <see cref="FreeImageAPI.FIRGB16.Color"/>
|
|
|
/// property or the <see cref="FreeImageAPI.FIRGB16(System.Drawing.Color)"/> constructor
|
|
|
/// is invoked.
|
|
|
/// </para>
|
|
|
/// </remarks>
|
|
|
/// <example>
|
|
|
/// The following code example demonstrates the various conversions between the
|
|
|
/// <b>FIRGB16</b> structure and the <see cref="System.Drawing.Color"/> structure.
|
|
|
/// <code>
|
|
|
/// FIRGB16 firgb16;
|
|
|
/// // Initialize the structure using a native .NET Color structure.
|
|
|
/// firgb16 = new FIRGBA16(Color.Indigo);
|
|
|
/// // Initialize the structure using the implicit operator.
|
|
|
/// firgb16 = Color.DarkSeaGreen;
|
|
|
/// // Convert the FIRGB16 instance into a native .NET Color
|
|
|
/// // using its implicit operator.
|
|
|
/// Color color = firgb16;
|
|
|
/// // Using the structure's Color property for converting it
|
|
|
/// // into a native .NET Color.
|
|
|
/// Color another = firgb16.Color;
|
|
|
/// </code>
|
|
|
/// </example>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential)]
|
|
|
public struct FIRGB16 : IComparable, IComparable<FIRGB16>, IEquatable<FIRGB16>
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The red color component.
|
|
|
/// </summary>
|
|
|
public ushort red;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The green color component.
|
|
|
/// </summary>
|
|
|
public ushort green;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The blue color component.
|
|
|
/// </summary>
|
|
|
public ushort blue;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified <see cref="System.Drawing.Color"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="color"><see cref="System.Drawing.Color"/> to initialize with.</param>
|
|
|
public FIRGB16(Color color)
|
|
|
{
|
|
|
red = (ushort)(color.R << 8);
|
|
|
green = (ushort)(color.G << 8);
|
|
|
blue = (ushort)(color.B << 8);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FIRGB16"/> structures are equivalent.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FIRGB16"/> that is to the left of the equality operator.</param>
|
|
|
/// <param name="right">The <see cref="FIRGB16"/> that is to the right of the equality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FIRGB16"/> structures are equal; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(FIRGB16 left, FIRGB16 right)
|
|
|
{
|
|
|
return
|
|
|
((left.blue == right.blue) &&
|
|
|
(left.green == right.green) &&
|
|
|
(left.red == right.red));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FIRGB16"/> structures are different.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FIRGB16"/> that is to the left of the inequality operator.</param>
|
|
|
/// <param name="right">The <see cref="FIRGB16"/> that is to the right of the inequality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FIRGB16"/> structures are different; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(FIRGB16 left, FIRGB16 right)
|
|
|
{
|
|
|
return !(left == right);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="System.Drawing.Color"/> structure to a <see cref="FIRGB16"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="System.Drawing.Color"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIRGB16"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FIRGB16(Color value)
|
|
|
{
|
|
|
return new FIRGB16(value);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIRGB16"/> structure to a <see cref="System.Drawing.Color"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIRGB16"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="System.Drawing.Color"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator Color(FIRGB16 value)
|
|
|
{
|
|
|
return value.Color;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the <see cref="System.Drawing.Color"/> of the structure.
|
|
|
/// </summary>
|
|
|
public Color Color
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return Color.FromArgb((red >> 8), (green >> 8), (blue >> 8));
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
red = (ushort)(value.R << 8);
|
|
|
green = (ushort)(value.G << 8);
|
|
|
blue = (ushort)(value.B << 8);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer indicating the lexical relationship between the two comparands.</returns>
|
|
|
/// <exception cref="ArgumentException"><paramref name="obj"/> is not a <see cref="FIRGB16"/>.</exception>
|
|
|
public int CompareTo(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
if (!(obj is FIRGB16))
|
|
|
{
|
|
|
throw new ArgumentException("obj");
|
|
|
}
|
|
|
return CompareTo((FIRGB16)obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="FIRGB16"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FIRGB16"/> to compare.</param>
|
|
|
/// <returns>A signed number indicating the relative values of this instance
|
|
|
/// and <paramref name="other"/>.</returns>
|
|
|
public int CompareTo(FIRGB16 other)
|
|
|
{
|
|
|
return this.Color.ToArgb().CompareTo(other.Color.ToArgb());
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified object is a <see cref="FIRGB16"/> structure
|
|
|
/// and is equivalent to this <see cref="FIRGB16"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The object to test.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="FIRGB16"/> structure
|
|
|
/// equivalent to this <see cref="FIRGB16"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return ((obj is FIRGB16) && (this == ((FIRGB16)obj)));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified <see cref="FIRGB16"/> structure is equivalent to this <see cref="FIRGB16"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FIRGB16"/> structure to compare to this instance.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="FIRGB16"/> structure
|
|
|
/// equivalent to this <see cref="FIRGB16"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(FIRGB16 other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="FIRGB16"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="FIRGB16"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return base.GetHashCode();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the numeric value of the <see cref="FIRGB16"/> object
|
|
|
/// to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return FreeImage.ColorToString(Color);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>FIRGBAF</b> structure describes a color consisting of relative
|
|
|
/// intensities of red, green, blue and alpha value. Each single color
|
|
|
/// component consumes 32 bits and takes values in the range from 0 to 1.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <para>
|
|
|
/// The <b>FIRGBAF</b> structure provides access to an underlying FreeImage <b>FIRGBAF</b>
|
|
|
/// structure. To determine the alpha, red, green or blue component of a color,
|
|
|
/// use the alpha, red, green or blue fields, respectively.
|
|
|
/// </para>
|
|
|
/// <para>For easy integration of the underlying structure into the .NET framework,
|
|
|
/// the <b>FIRGBAF</b> structure implements implicit conversion operators to
|
|
|
/// convert the represented color to and from the <see cref="System.Drawing.Color"/>
|
|
|
/// type. This makes the <see cref="System.Drawing.Color"/> type a real replacement
|
|
|
/// for the <b>FIRGBAF</b> structure and my be used in all situations which require
|
|
|
/// an <b>FIRGBAF</b> type.
|
|
|
/// </para>
|
|
|
/// <para>
|
|
|
/// Each color component alpha, red, green or blue of <b>FIRGBAF</b> is translated
|
|
|
/// into it's corresponding color component A, R, G or B of
|
|
|
/// <see cref="System.Drawing.Color"/> by linearly mapping the values of one range
|
|
|
/// into the other range and vice versa.
|
|
|
/// </para>
|
|
|
/// <para>
|
|
|
/// <b>Conversion from System.Drawing.Color to FIRGBAF</b>
|
|
|
/// </para>
|
|
|
/// <c>FIRGBAF.component = (float)Color.component / 255f</c>
|
|
|
/// <para>
|
|
|
/// <b>Conversion from FIRGBAF to System.Drawing.Color</b>
|
|
|
/// </para>
|
|
|
/// <c>Color.component = (int)(FIRGBAF.component * 255f)</c>
|
|
|
/// <para>
|
|
|
/// The same conversion is also applied when the <see cref="FreeImageAPI.FIRGBAF.Color"/>
|
|
|
/// property or the <see cref="FreeImageAPI.FIRGBAF(System.Drawing.Color)"/> constructor
|
|
|
/// is invoked.
|
|
|
/// </para>
|
|
|
/// </remarks>
|
|
|
/// <example>
|
|
|
/// The following code example demonstrates the various conversions between the
|
|
|
/// <b>FIRGBAF</b> structure and the <see cref="System.Drawing.Color"/> structure.
|
|
|
/// <code>
|
|
|
/// FIRGBAF firgbaf;
|
|
|
/// // Initialize the structure using a native .NET Color structure.
|
|
|
/// firgbaf = new FIRGBAF(Color.Indigo);
|
|
|
/// // Initialize the structure using the implicit operator.
|
|
|
/// firgbaf = Color.DarkSeaGreen;
|
|
|
/// // Convert the FIRGBAF instance into a native .NET Color
|
|
|
/// // using its implicit operator.
|
|
|
/// Color color = firgbaf;
|
|
|
/// // Using the structure's Color property for converting it
|
|
|
/// // into a native .NET Color.
|
|
|
/// Color another = firgbaf.Color;
|
|
|
/// </code>
|
|
|
/// </example>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential)]
|
|
|
public struct FIRGBAF : IComparable, IComparable<FIRGBAF>, IEquatable<FIRGBAF>
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The red color component.
|
|
|
/// </summary>
|
|
|
public float red;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The green color component.
|
|
|
/// </summary>
|
|
|
public float green;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The blue color component.
|
|
|
/// </summary>
|
|
|
public float blue;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The alpha color component.
|
|
|
/// </summary>
|
|
|
public float alpha;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified <see cref="System.Drawing.Color"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="color"><see cref="System.Drawing.Color"/> to initialize with.</param>
|
|
|
public FIRGBAF(Color color)
|
|
|
{
|
|
|
red = (float)color.R / 255f;
|
|
|
green = (float)color.G / 255f;
|
|
|
blue = (float)color.B / 255f;
|
|
|
alpha = (float)color.A / 255f;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FIRGBAF"/> structures are equivalent.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FIRGBAF"/> that is to the left of the equality operator.</param>
|
|
|
/// <param name="right">The <see cref="FIRGBAF"/> that is to the right of the equality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FIRGBAF"/> structures are equal; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(FIRGBAF left, FIRGBAF right)
|
|
|
{
|
|
|
return
|
|
|
((left.alpha == right.alpha) &&
|
|
|
(left.blue == right.blue) &&
|
|
|
(left.green == right.green) &&
|
|
|
(left.red == right.red));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FIRGBAF"/> structures are different.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FIRGBAF"/> that is to the left of the inequality operator.</param>
|
|
|
/// <param name="right">The <see cref="FIRGBAF"/> that is to the right of the inequality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FIRGBAF"/> structures are different; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(FIRGBAF left, FIRGBAF right)
|
|
|
{
|
|
|
return !(left == right);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="System.Drawing.Color"/> structure to a <see cref="FIRGBAF"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="System.Drawing.Color"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIRGBAF"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FIRGBAF(Color value)
|
|
|
{
|
|
|
return new FIRGBAF(value);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIRGBAF"/> structure to a <see cref="System.Drawing.Color"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIRGBAF"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="System.Drawing.Color"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator Color(FIRGBAF value)
|
|
|
{
|
|
|
return value.Color;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the <see cref="System.Drawing.Color"/> of the structure.
|
|
|
/// </summary>
|
|
|
public Color Color
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return Color.FromArgb(
|
|
|
(int)(alpha * 255f),
|
|
|
(int)(red * 255f),
|
|
|
(int)(green * 255f),
|
|
|
(int)(blue * 255f));
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
red = (float)value.R / 255f;
|
|
|
green = (float)value.G / 255f;
|
|
|
blue = (float)value.B / 255f;
|
|
|
alpha = (float)value.A / 255f;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer indicating the lexical relationship between the two comparands.</returns>
|
|
|
/// <exception cref="ArgumentException"><paramref name="obj"/> is not a <see cref="FIRGBAF"/>.</exception>
|
|
|
public int CompareTo(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
if (!(obj is FIRGBAF))
|
|
|
{
|
|
|
throw new ArgumentException("obj");
|
|
|
}
|
|
|
return CompareTo((FIRGBAF)obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="FIRGBAF"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FIRGBAF"/> to compare.</param>
|
|
|
/// <returns>A signed number indicating the relative values of this instance
|
|
|
/// and <paramref name="other"/>.</returns>
|
|
|
public int CompareTo(FIRGBAF other)
|
|
|
{
|
|
|
return this.Color.ToArgb().CompareTo(other.Color.ToArgb());
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified object is a <see cref="FIRGBAF"/> structure
|
|
|
/// and is equivalent to this <see cref="FIRGBAF"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The object to test.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="FIRGBAF"/> structure
|
|
|
/// equivalent to this <see cref="FIRGBAF"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return ((obj is FIRGBAF) && (this == ((FIRGBAF)obj)));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified <see cref="FIRGBAF"/> structure is equivalent to this <see cref="FIRGBAF"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FIRGBAF"/> structure to compare to this instance.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="FIRGBAF"/> structure
|
|
|
/// equivalent to this <see cref="FIRGBAF"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(FIRGBAF other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="FIRGBAF"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="FIRGBAF"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return base.GetHashCode();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the numeric value of the <see cref="FIRGBAF"/> object
|
|
|
/// to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return FreeImage.ColorToString(Color);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>FIRGBF</b> structure describes a color consisting of relative
|
|
|
/// intensities of red, green, blue and alpha value. Each single color
|
|
|
/// component consumes 32 bits and takes values in the range from 0 to 1.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <para>
|
|
|
/// The <b>FIRGBF</b> structure provides access to an underlying FreeImage <b>FIRGBF</b>
|
|
|
/// structure. To determine the red, green or blue component of a color, use the
|
|
|
/// red, green or blue fields, respectively.
|
|
|
/// </para>
|
|
|
/// <para>For easy integration of the underlying structure into the .NET framework,
|
|
|
/// the <b>FIRGBF</b> structure implements implicit conversion operators to
|
|
|
/// convert the represented color to and from the <see cref="System.Drawing.Color"/>
|
|
|
/// type. This makes the <see cref="System.Drawing.Color"/> type a real replacement
|
|
|
/// for the <b>FIRGBF</b> structure and my be used in all situations which require
|
|
|
/// an <b>FIRGBF</b> type.
|
|
|
/// </para>
|
|
|
/// <para>
|
|
|
/// Each color component alpha, red, green or blue of <b>FIRGBF</b> is translated
|
|
|
/// into it's corresponding color component A, R, G or B of
|
|
|
/// <see cref="System.Drawing.Color"/> by linearly mapping the values of one range
|
|
|
/// into the other range and vice versa.
|
|
|
/// When converting from <see cref="System.Drawing.Color"/> into <b>FIRGBF</b>, the
|
|
|
/// color's alpha value is ignored and assumed to be 255 when converting from
|
|
|
/// <b>FIRGBF</b> into <see cref="System.Drawing.Color"/>, creating a fully
|
|
|
/// opaque color.
|
|
|
/// </para>
|
|
|
/// <para>
|
|
|
/// <b>Conversion from System.Drawing.Color to FIRGBF</b>
|
|
|
/// </para>
|
|
|
/// <c>FIRGBF.component = (float)Color.component / 255f</c>
|
|
|
/// <para>
|
|
|
/// <b>Conversion from FIRGBF to System.Drawing.Color</b>
|
|
|
/// </para>
|
|
|
/// <c>Color.component = (int)(FIRGBF.component * 255f)</c>
|
|
|
/// <para>
|
|
|
/// The same conversion is also applied when the <see cref="FreeImageAPI.FIRGBF.Color"/>
|
|
|
/// property or the <see cref="FreeImageAPI.FIRGBF(System.Drawing.Color)"/> constructor
|
|
|
/// is invoked.
|
|
|
/// </para>
|
|
|
/// </remarks>
|
|
|
/// <example>
|
|
|
/// The following code example demonstrates the various conversions between the
|
|
|
/// <b>FIRGBF</b> structure and the <see cref="System.Drawing.Color"/> structure.
|
|
|
/// <code>
|
|
|
/// FIRGBF firgbf;
|
|
|
/// // Initialize the structure using a native .NET Color structure.
|
|
|
/// firgbf = new FIRGBF(Color.Indigo);
|
|
|
/// // Initialize the structure using the implicit operator.
|
|
|
/// firgbf = Color.DarkSeaGreen;
|
|
|
/// // Convert the FIRGBF instance into a native .NET Color
|
|
|
/// // using its implicit operator.
|
|
|
/// Color color = firgbf;
|
|
|
/// // Using the structure's Color property for converting it
|
|
|
/// // into a native .NET Color.
|
|
|
/// Color another = firgbf.Color;
|
|
|
/// </code>
|
|
|
/// </example>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential)]
|
|
|
public struct FIRGBF : IComparable, IComparable<FIRGBF>, IEquatable<FIRGBF>
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The red color component.
|
|
|
/// </summary>
|
|
|
public float red;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The green color component.
|
|
|
/// </summary>
|
|
|
public float green;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The blue color component.
|
|
|
/// </summary>
|
|
|
public float blue;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified <see cref="System.Drawing.Color"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="color"><see cref="System.Drawing.Color"/> to initialize with.</param>
|
|
|
public FIRGBF(Color color)
|
|
|
{
|
|
|
red = (float)color.R / 255f;
|
|
|
green = (float)color.G / 255f;
|
|
|
blue = (float)color.B / 255f;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FIRGBF"/> structures are equivalent.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FIRGBF"/> that is to the left of the equality operator.</param>
|
|
|
/// <param name="right">The <see cref="FIRGBF"/> that is to the right of the equality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FIRGBF"/> structures are equal; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(FIRGBF left, FIRGBF right)
|
|
|
{
|
|
|
return
|
|
|
((left.blue == right.blue) &&
|
|
|
(left.green == right.green) &&
|
|
|
(left.red == right.red));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FIRGBF"/> structures are different.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FIRGBF"/> that is to the left of the inequality operator.</param>
|
|
|
/// <param name="right">The <see cref="FIRGBF"/> that is to the right of the inequality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FIRGBF"/> structures are different; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(FIRGBF left, FIRGBF right)
|
|
|
{
|
|
|
return !(left == right);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="System.Drawing.Color"/> structure to a <see cref="FIRGBF"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="System.Drawing.Color"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIRGBF"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FIRGBF(Color value)
|
|
|
{
|
|
|
return new FIRGBF(value);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIRGBF"/> structure to a <see cref="System.Drawing.Color"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIRGBF"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="System.Drawing.Color"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator Color(FIRGBF value)
|
|
|
{
|
|
|
return value.Color;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the <see cref="System.Drawing.Color"/> of the structure.
|
|
|
/// </summary>
|
|
|
public Color Color
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return Color.FromArgb(
|
|
|
(int)(red * 255f),
|
|
|
(int)(green * 255f),
|
|
|
(int)(blue * 255f));
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
red = (float)value.R / 255f;
|
|
|
green = (float)value.G / 255f;
|
|
|
blue = (float)value.B / 255f;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer indicating the lexical relationship between the two comparands.</returns>
|
|
|
/// <exception cref="ArgumentException"><paramref name="obj"/> is not a <see cref="FIRGBF"/>.</exception>
|
|
|
public int CompareTo(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
if (!(obj is FIRGBF))
|
|
|
{
|
|
|
throw new ArgumentException("obj");
|
|
|
}
|
|
|
return CompareTo((FIRGBF)obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="FIRGBF"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FIRGBF"/> to compare.</param>
|
|
|
/// <returns>A signed number indicating the relative values of this instance
|
|
|
/// and <paramref name="other"/>.</returns>
|
|
|
public int CompareTo(FIRGBF other)
|
|
|
{
|
|
|
return this.Color.ToArgb().CompareTo(other.Color.ToArgb());
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified object is a <see cref="FIRGBF"/> structure
|
|
|
/// and is equivalent to this <see cref="FIRGBF"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The object to test.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="FIRGBF"/> structure
|
|
|
/// equivalent to this <see cref="FIRGBF"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return ((obj is FIRGBF) && (this == ((FIRGBF)obj)));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified <see cref="FIRGBF"/> structure is equivalent to this <see cref="FIRGBF"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FIRGBF"/> structure to compare to this instance.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="FIRGBF"/> structure
|
|
|
/// equivalent to this <see cref="FIRGBF"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(FIRGBF other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="FIRGBF"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="FIRGBF"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return base.GetHashCode();
|
|
|
}
|
|
|
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the numeric value of the <see cref="FIRGBF"/> object
|
|
|
/// to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return FreeImage.ColorToString(Color);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>FICOMPLEX</b> structure describes a color consisting of a real and an imaginary part.
|
|
|
/// Each part is using 4 bytes of data.
|
|
|
/// </summary>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential)]
|
|
|
public struct FICOMPLEX : IComparable, IComparable<FICOMPLEX>, IEquatable<FICOMPLEX>
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Real part of the color.
|
|
|
/// </summary>
|
|
|
public double real;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Imaginary part of the color.
|
|
|
/// </summary>
|
|
|
public double imag;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FICOMPLEX"/> structures are equivalent.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FICOMPLEX"/> that is to the left of the equality operator.</param>
|
|
|
/// <param name="right">The <see cref="FICOMPLEX"/> that is to the right of the equality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FICOMPLEX"/> structures are equal; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(FICOMPLEX left, FICOMPLEX right)
|
|
|
{
|
|
|
return ((left.real == right.real) && (left.imag == right.imag));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FICOMPLEX"/> structures are different.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FICOMPLEX"/> that is to the left of the inequality operator.</param>
|
|
|
/// <param name="right">The <see cref="FICOMPLEX"/> that is to the right of the inequality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FICOMPLEX"/> structures are different; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(FICOMPLEX left, FICOMPLEX right)
|
|
|
{
|
|
|
return ((left.real != right.real) || (left.imag == right.imag));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer indicating the lexical relationship between the two comparands.</returns>
|
|
|
/// <exception cref="ArgumentException"><paramref name="obj"/> is not a <see cref="FICOMPLEX"/>.</exception>
|
|
|
public int CompareTo(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
if (!(obj is FICOMPLEX))
|
|
|
{
|
|
|
throw new ArgumentException("obj");
|
|
|
}
|
|
|
return CompareTo((FICOMPLEX)obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="FICOMPLEX"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FICOMPLEX"/> to compare.</param>
|
|
|
/// <returns>A signed number indicating the relative values of this instance
|
|
|
/// and <paramref name="other"/>.</returns>
|
|
|
public int CompareTo(FICOMPLEX other)
|
|
|
{
|
|
|
return base.GetHashCode();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified object is a <see cref="FICOMPLEX"/> structure
|
|
|
/// and is equivalent to this <see cref="FICOMPLEX"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The object to test.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="FICOMPLEX"/> structure
|
|
|
/// equivalent to this <see cref="FICOMPLEX"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return ((obj is FICOMPLEX) && (this == ((FICOMPLEX)obj)));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified <see cref="FICOMPLEX"/> structure is equivalent to this <see cref="FICOMPLEX"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FICOMPLEX"/> structure to compare to this instance.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="FICOMPLEX"/> structure
|
|
|
/// equivalent to this <see cref="FICOMPLEX"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(FICOMPLEX other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="FICOMPLEX"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="FICOMPLEX"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return base.GetHashCode();
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// This Structure contains ICC-Profile data.
|
|
|
/// </summary>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential)]
|
|
|
public struct FIICCPROFILE
|
|
|
{
|
|
|
private ICC_FLAGS flags;
|
|
|
private uint size;
|
|
|
private IntPtr data;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a new ICC-Profile for <paramref name="dib"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="data">The ICC-Profile data.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public FIICCPROFILE(FIBITMAP dib, byte[] data)
|
|
|
: this(dib, data, (int)data.Length)
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a new ICC-Profile for <paramref name="dib"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="data">The ICC-Profile data.</param>
|
|
|
/// <param name="size">Number of bytes to use from data.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public unsafe FIICCPROFILE(FIBITMAP dib, byte[] data, int size)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
FIICCPROFILE prof;
|
|
|
size = Math.Min(size, (int)data.Length);
|
|
|
prof = *(FIICCPROFILE*)FreeImage.CreateICCProfile(dib, data, size);
|
|
|
this.flags = prof.flags;
|
|
|
this.size = prof.size;
|
|
|
this.data = prof.data;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Info flag of the profile.
|
|
|
/// </summary>
|
|
|
public ICC_FLAGS Flags
|
|
|
{
|
|
|
get { return flags; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Profile's size measured in bytes.
|
|
|
/// </summary>
|
|
|
public uint Size
|
|
|
{
|
|
|
get { return size; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Points to a block of contiguous memory containing the profile.
|
|
|
/// </summary>
|
|
|
public IntPtr DataPointer
|
|
|
{
|
|
|
get { return data; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copy of the ICC-Profiles data.
|
|
|
/// </summary>
|
|
|
public unsafe byte[] Data
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
byte[] result;
|
|
|
FreeImage.CopyMemory(result = new byte[size], data.ToPointer(), size);
|
|
|
return result;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Indicates whether the profile is CMYK.
|
|
|
/// </summary>
|
|
|
public bool IsCMYK
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return ((flags & ICC_FLAGS.FIICC_COLOR_IS_CMYK) != 0);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI.Plugins
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The structure contains functionpointers that make up a FreeImage plugin.
|
|
|
/// </summary>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential)]
|
|
|
public struct Plugin
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that returns a string which describes
|
|
|
/// the plugins format.
|
|
|
/// </summary>
|
|
|
public FormatProc formatProc;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that returns a string which contains
|
|
|
/// a more detailed description.
|
|
|
/// </summary>
|
|
|
public DescriptionProc descriptionProc;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that returns a comma seperated list
|
|
|
/// of file extensions the plugin can read or write.
|
|
|
/// </summary>
|
|
|
public ExtensionListProc extensionListProc;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that returns a regular expression that
|
|
|
/// can be used to idientify whether a file can be handled by the plugin.
|
|
|
/// </summary>
|
|
|
public RegExprProc regExprProc;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that opens a file.
|
|
|
/// </summary>
|
|
|
public OpenProc openProc;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that closes a previosly opened file.
|
|
|
/// </summary>
|
|
|
public CloseProc closeProc;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that returns the number of pages of a multipage
|
|
|
/// bitmap if the plugin is capable of handling multipage bitmaps.
|
|
|
/// </summary>
|
|
|
public PageCountProc pageCountProc;
|
|
|
|
|
|
/// <summary>
|
|
|
/// UNKNOWN
|
|
|
/// </summary>
|
|
|
public PageCapabilityProc pageCapabilityProc;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that loads and decodes a bitmap into memory.
|
|
|
/// </summary>
|
|
|
public LoadProc loadProc;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that saves a bitmap.
|
|
|
/// </summary>
|
|
|
public SaveProc saveProc;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that determines whether the source is a valid image.
|
|
|
/// </summary>
|
|
|
public ValidateProc validateProc;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that returns a string which contains
|
|
|
/// the plugin's mime type.
|
|
|
/// </summary>
|
|
|
public MimeProc mimeProc;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that returns whether the plugin can handle the
|
|
|
/// specified color depth.
|
|
|
/// </summary>
|
|
|
public SupportsExportBPPProc supportsExportBPPProc;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that returns whether the plugin can handle the
|
|
|
/// specified image type.
|
|
|
/// </summary>
|
|
|
public SupportsExportTypeProc supportsExportTypeProc;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that returns whether the plugin can handle
|
|
|
/// ICC-Profiles.
|
|
|
/// </summary>
|
|
|
public SupportsICCProfilesProc supportsICCProfilesProc;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Enums
|
|
|
|
|
|
namespace FreeImageAPI.Metadata
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Specifies how a single frame will be handled after being displayed.
|
|
|
/// </summary>
|
|
|
public enum DisposalMethodType : byte
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Same behavior as <see cref="DisposalMethodType.Leave"/> but should not be used.
|
|
|
/// </summary>
|
|
|
Unspecified,
|
|
|
|
|
|
/// <summary>
|
|
|
/// The image is left in place and will be overdrawn by the next image.
|
|
|
/// </summary>
|
|
|
Leave,
|
|
|
|
|
|
/// <summary>
|
|
|
/// The area of the image will be blanked out by its background.
|
|
|
/// </summary>
|
|
|
Background,
|
|
|
|
|
|
/// <summary>
|
|
|
/// Restores the the area of the image to the state it was before it
|
|
|
/// has been dawn.
|
|
|
/// </summary>
|
|
|
Previous,
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// I/O image format identifiers.
|
|
|
/// </summary>
|
|
|
public enum FREE_IMAGE_FORMAT
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Unknown format (returned value only, never use it as input value)
|
|
|
/// </summary>
|
|
|
FIF_UNKNOWN = -1,
|
|
|
/// <summary>
|
|
|
/// Windows or OS/2 Bitmap File (*.BMP)
|
|
|
/// </summary>
|
|
|
FIF_BMP = 0,
|
|
|
/// <summary>
|
|
|
/// Windows Icon (*.ICO)
|
|
|
/// </summary>
|
|
|
FIF_ICO = 1,
|
|
|
/// <summary>
|
|
|
/// Independent JPEG Group (*.JPG, *.JIF, *.JPEG, *.JPE)
|
|
|
/// </summary>
|
|
|
FIF_JPEG = 2,
|
|
|
/// <summary>
|
|
|
/// JPEG Network Graphics (*.JNG)
|
|
|
/// </summary>
|
|
|
FIF_JNG = 3,
|
|
|
/// <summary>
|
|
|
/// Commodore 64 Koala format (*.KOA)
|
|
|
/// </summary>
|
|
|
FIF_KOALA = 4,
|
|
|
/// <summary>
|
|
|
/// Amiga IFF (*.IFF, *.LBM)
|
|
|
/// </summary>
|
|
|
FIF_LBM = 5,
|
|
|
/// <summary>
|
|
|
/// Amiga IFF (*.IFF, *.LBM)
|
|
|
/// </summary>
|
|
|
FIF_IFF = 5,
|
|
|
/// <summary>
|
|
|
/// Multiple Network Graphics (*.MNG)
|
|
|
/// </summary>
|
|
|
FIF_MNG = 6,
|
|
|
/// <summary>
|
|
|
/// Portable Bitmap (ASCII) (*.PBM)
|
|
|
/// </summary>
|
|
|
FIF_PBM = 7,
|
|
|
/// <summary>
|
|
|
/// Portable Bitmap (BINARY) (*.PBM)
|
|
|
/// </summary>
|
|
|
FIF_PBMRAW = 8,
|
|
|
/// <summary>
|
|
|
/// Kodak PhotoCD (*.PCD)
|
|
|
/// </summary>
|
|
|
FIF_PCD = 9,
|
|
|
/// <summary>
|
|
|
/// Zsoft Paintbrush PCX bitmap format (*.PCX)
|
|
|
/// </summary>
|
|
|
FIF_PCX = 10,
|
|
|
/// <summary>
|
|
|
/// Portable Graymap (ASCII) (*.PGM)
|
|
|
/// </summary>
|
|
|
FIF_PGM = 11,
|
|
|
/// <summary>
|
|
|
/// Portable Graymap (BINARY) (*.PGM)
|
|
|
/// </summary>
|
|
|
FIF_PGMRAW = 12,
|
|
|
/// <summary>
|
|
|
/// Portable Network Graphics (*.PNG)
|
|
|
/// </summary>
|
|
|
FIF_PNG = 13,
|
|
|
/// <summary>
|
|
|
/// Portable Pixelmap (ASCII) (*.PPM)
|
|
|
/// </summary>
|
|
|
FIF_PPM = 14,
|
|
|
/// <summary>
|
|
|
/// Portable Pixelmap (BINARY) (*.PPM)
|
|
|
/// </summary>
|
|
|
FIF_PPMRAW = 15,
|
|
|
/// <summary>
|
|
|
/// Sun Rasterfile (*.RAS)
|
|
|
/// </summary>
|
|
|
FIF_RAS = 16,
|
|
|
/// <summary>
|
|
|
/// truevision Targa files (*.TGA, *.TARGA)
|
|
|
/// </summary>
|
|
|
FIF_TARGA = 17,
|
|
|
/// <summary>
|
|
|
/// Tagged Image File Format (*.TIF, *.TIFF)
|
|
|
/// </summary>
|
|
|
FIF_TIFF = 18,
|
|
|
/// <summary>
|
|
|
/// Wireless Bitmap (*.WBMP)
|
|
|
/// </summary>
|
|
|
FIF_WBMP = 19,
|
|
|
/// <summary>
|
|
|
/// Adobe Photoshop (*.PSD)
|
|
|
/// </summary>
|
|
|
FIF_PSD = 20,
|
|
|
/// <summary>
|
|
|
/// Dr. Halo (*.CUT)
|
|
|
/// </summary>
|
|
|
FIF_CUT = 21,
|
|
|
/// <summary>
|
|
|
/// X11 Bitmap Format (*.XBM)
|
|
|
/// </summary>
|
|
|
FIF_XBM = 22,
|
|
|
/// <summary>
|
|
|
/// X11 Pixmap Format (*.XPM)
|
|
|
/// </summary>
|
|
|
FIF_XPM = 23,
|
|
|
/// <summary>
|
|
|
/// DirectDraw Surface (*.DDS)
|
|
|
/// </summary>
|
|
|
FIF_DDS = 24,
|
|
|
/// <summary>
|
|
|
/// Graphics Interchange Format (*.GIF)
|
|
|
/// </summary>
|
|
|
FIF_GIF = 25,
|
|
|
/// <summary>
|
|
|
/// High Dynamic Range (*.HDR)
|
|
|
/// </summary>
|
|
|
FIF_HDR = 26,
|
|
|
/// <summary>
|
|
|
/// Raw Fax format CCITT G3 (*.G3)
|
|
|
/// </summary>
|
|
|
FIF_FAXG3 = 27,
|
|
|
/// <summary>
|
|
|
/// Silicon Graphics SGI image format (*.SGI)
|
|
|
/// </summary>
|
|
|
FIF_SGI = 28,
|
|
|
/// <summary>
|
|
|
/// OpenEXR format (*.EXR)
|
|
|
/// </summary>
|
|
|
FIF_EXR = 29,
|
|
|
/// <summary>
|
|
|
/// JPEG-2000 format (*.J2K, *.J2C)
|
|
|
/// </summary>
|
|
|
FIF_J2K = 30,
|
|
|
/// <summary>
|
|
|
/// JPEG-2000 format (*.JP2)
|
|
|
/// </summary>
|
|
|
FIF_JP2 = 31,
|
|
|
/// <summary>
|
|
|
/// Portable FloatMap (*.PFM)
|
|
|
/// </summary>
|
|
|
FIF_PFM = 32,
|
|
|
/// <summary>
|
|
|
/// Macintosh PICT (*.PICT)
|
|
|
/// </summary>
|
|
|
FIF_PICT = 33,
|
|
|
/// <summary>
|
|
|
/// RAW camera image (*.*)
|
|
|
/// </summary>
|
|
|
FIF_RAW = 34,
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Image types used in FreeImage.
|
|
|
/// </summary>
|
|
|
public enum FREE_IMAGE_TYPE
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// unknown type
|
|
|
/// </summary>
|
|
|
FIT_UNKNOWN = 0,
|
|
|
/// <summary>
|
|
|
/// standard image : 1-, 4-, 8-, 16-, 24-, 32-bit
|
|
|
/// </summary>
|
|
|
FIT_BITMAP = 1,
|
|
|
/// <summary>
|
|
|
/// array of unsigned short : unsigned 16-bit
|
|
|
/// </summary>
|
|
|
FIT_UINT16 = 2,
|
|
|
/// <summary>
|
|
|
/// array of short : signed 16-bit
|
|
|
/// </summary>
|
|
|
FIT_INT16 = 3,
|
|
|
/// <summary>
|
|
|
/// array of unsigned long : unsigned 32-bit
|
|
|
/// </summary>
|
|
|
FIT_UINT32 = 4,
|
|
|
/// <summary>
|
|
|
/// array of long : signed 32-bit
|
|
|
/// </summary>
|
|
|
FIT_INT32 = 5,
|
|
|
/// <summary>
|
|
|
/// array of float : 32-bit IEEE floating point
|
|
|
/// </summary>
|
|
|
FIT_FLOAT = 6,
|
|
|
/// <summary>
|
|
|
/// array of double : 64-bit IEEE floating point
|
|
|
/// </summary>
|
|
|
FIT_DOUBLE = 7,
|
|
|
/// <summary>
|
|
|
/// array of FICOMPLEX : 2 x 64-bit IEEE floating point
|
|
|
/// </summary>
|
|
|
FIT_COMPLEX = 8,
|
|
|
/// <summary>
|
|
|
/// 48-bit RGB image : 3 x 16-bit
|
|
|
/// </summary>
|
|
|
FIT_RGB16 = 9,
|
|
|
/// <summary>
|
|
|
/// 64-bit RGBA image : 4 x 16-bit
|
|
|
/// </summary>
|
|
|
FIT_RGBA16 = 10,
|
|
|
/// <summary>
|
|
|
/// 96-bit RGB float image : 3 x 32-bit IEEE floating point
|
|
|
/// </summary>
|
|
|
FIT_RGBF = 11,
|
|
|
/// <summary>
|
|
|
/// 128-bit RGBA float image : 4 x 32-bit IEEE floating point
|
|
|
/// </summary>
|
|
|
FIT_RGBAF = 12
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Constants used in color filling routines.
|
|
|
/// </summary>
|
|
|
public enum FREE_IMAGE_COLOR_OPTIONS
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Default value.
|
|
|
/// </summary>
|
|
|
FICO_DEFAULT = 0x0,
|
|
|
/// <summary>
|
|
|
/// <see cref="RGBQUAD"/> color is RGB color (contains no valid alpha channel).
|
|
|
/// </summary>
|
|
|
FICO_RGB = 0x0,
|
|
|
/// <summary>
|
|
|
/// <see cref="RGBQUAD"/> color is RGBA color (contains a valid alpha channel).
|
|
|
/// </summary>
|
|
|
FICO_RGBA = 0x1,
|
|
|
/// <summary>
|
|
|
/// Lookup nearest RGB color from palette.
|
|
|
/// </summary>
|
|
|
FICO_NEAREST_COLOR = 0x0,
|
|
|
/// <summary>
|
|
|
/// Lookup equal RGB color from palette.
|
|
|
/// </summary>
|
|
|
FICO_EQUAL_COLOR = 0x2,
|
|
|
/// <summary>
|
|
|
/// <see cref="RGBQUAD.rgbReserved"/> contains the palette index to be used.
|
|
|
/// </summary>
|
|
|
FICO_ALPHA_IS_INDEX = 0x4,
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Image color types used in FreeImage.
|
|
|
/// </summary>
|
|
|
public enum FREE_IMAGE_COLOR_TYPE
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// min value is white
|
|
|
/// </summary>
|
|
|
FIC_MINISWHITE = 0,
|
|
|
/// <summary>
|
|
|
/// min value is black
|
|
|
/// </summary>
|
|
|
FIC_MINISBLACK = 1,
|
|
|
/// <summary>
|
|
|
/// RGB color model
|
|
|
/// </summary>
|
|
|
FIC_RGB = 2,
|
|
|
/// <summary>
|
|
|
/// color map indexed
|
|
|
/// </summary>
|
|
|
FIC_PALETTE = 3,
|
|
|
/// <summary>
|
|
|
/// RGB color model with alpha channel
|
|
|
/// </summary>
|
|
|
FIC_RGBALPHA = 4,
|
|
|
/// <summary>
|
|
|
/// CMYK color model
|
|
|
/// </summary>
|
|
|
FIC_CMYK = 5
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Color quantization algorithms.
|
|
|
/// Constants used in FreeImage_ColorQuantize.
|
|
|
/// </summary>
|
|
|
public enum FREE_IMAGE_QUANTIZE
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Xiaolin Wu color quantization algorithm
|
|
|
/// </summary>
|
|
|
FIQ_WUQUANT = 0,
|
|
|
/// <summary>
|
|
|
/// NeuQuant neural-net quantization algorithm by Anthony Dekker
|
|
|
/// </summary>
|
|
|
FIQ_NNQUANT = 1
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Dithering algorithms.
|
|
|
/// Constants used in FreeImage_Dither.
|
|
|
/// </summary>
|
|
|
public enum FREE_IMAGE_DITHER
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Floyd and Steinberg error diffusion
|
|
|
/// </summary>
|
|
|
FID_FS = 0,
|
|
|
/// <summary>
|
|
|
/// Bayer ordered dispersed dot dithering (order 2 dithering matrix)
|
|
|
/// </summary>
|
|
|
FID_BAYER4x4 = 1,
|
|
|
/// <summary>
|
|
|
/// Bayer ordered dispersed dot dithering (order 3 dithering matrix)
|
|
|
/// </summary>
|
|
|
FID_BAYER8x8 = 2,
|
|
|
/// <summary>
|
|
|
/// Ordered clustered dot dithering (order 3 - 6x6 matrix)
|
|
|
/// </summary>
|
|
|
FID_CLUSTER6x6 = 3,
|
|
|
/// <summary>
|
|
|
/// Ordered clustered dot dithering (order 4 - 8x8 matrix)
|
|
|
/// </summary>
|
|
|
FID_CLUSTER8x8 = 4,
|
|
|
/// <summary>
|
|
|
/// Ordered clustered dot dithering (order 8 - 16x16 matrix)
|
|
|
/// </summary>
|
|
|
FID_CLUSTER16x16 = 5,
|
|
|
/// <summary>
|
|
|
/// Bayer ordered dispersed dot dithering (order 4 dithering matrix)
|
|
|
/// </summary>
|
|
|
FID_BAYER16x16 = 6
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Lossless JPEG transformations constants used in FreeImage_JPEGTransform.
|
|
|
/// </summary>
|
|
|
public enum FREE_IMAGE_JPEG_OPERATION
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// no transformation
|
|
|
/// </summary>
|
|
|
FIJPEG_OP_NONE = 0,
|
|
|
/// <summary>
|
|
|
/// horizontal flip
|
|
|
/// </summary>
|
|
|
FIJPEG_OP_FLIP_H = 1,
|
|
|
/// <summary>
|
|
|
/// vertical flip
|
|
|
/// </summary>
|
|
|
FIJPEG_OP_FLIP_V = 2,
|
|
|
/// <summary>
|
|
|
/// transpose across UL-to-LR axis
|
|
|
/// </summary>
|
|
|
FIJPEG_OP_TRANSPOSE = 3,
|
|
|
/// <summary>
|
|
|
/// transpose across UR-to-LL axis
|
|
|
/// </summary>
|
|
|
FIJPEG_OP_TRANSVERSE = 4,
|
|
|
/// <summary>
|
|
|
/// 90-degree clockwise rotation
|
|
|
/// </summary>
|
|
|
FIJPEG_OP_ROTATE_90 = 5,
|
|
|
/// <summary>
|
|
|
/// 180-degree rotation
|
|
|
/// </summary>
|
|
|
FIJPEG_OP_ROTATE_180 = 6,
|
|
|
/// <summary>
|
|
|
/// 270-degree clockwise (or 90 ccw)
|
|
|
/// </summary>
|
|
|
FIJPEG_OP_ROTATE_270 = 7
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Tone mapping operators. Constants used in FreeImage_ToneMapping.
|
|
|
/// </summary>
|
|
|
public enum FREE_IMAGE_TMO
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Adaptive logarithmic mapping (F. Drago, 2003)
|
|
|
/// </summary>
|
|
|
FITMO_DRAGO03 = 0,
|
|
|
/// <summary>
|
|
|
/// Dynamic range reduction inspired by photoreceptor physiology (E. Reinhard, 2005)
|
|
|
/// </summary>
|
|
|
FITMO_REINHARD05 = 1,
|
|
|
/// <summary>
|
|
|
/// Gradient domain high dynamic range compression (R. Fattal, 2002)
|
|
|
/// </summary>
|
|
|
FITMO_FATTAL02
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Upsampling / downsampling filters. Constants used in FreeImage_Rescale.
|
|
|
/// </summary>
|
|
|
public enum FREE_IMAGE_FILTER
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Box, pulse, Fourier window, 1st order (constant) b-spline
|
|
|
/// </summary>
|
|
|
FILTER_BOX = 0,
|
|
|
/// <summary>
|
|
|
/// Mitchell and Netravali's two-param cubic filter
|
|
|
/// </summary>
|
|
|
FILTER_BICUBIC = 1,
|
|
|
/// <summary>
|
|
|
/// Bilinear filter
|
|
|
/// </summary>
|
|
|
FILTER_BILINEAR = 2,
|
|
|
/// <summary>
|
|
|
/// 4th order (cubic) b-spline
|
|
|
/// </summary>
|
|
|
FILTER_BSPLINE = 3,
|
|
|
/// <summary>
|
|
|
/// Catmull-Rom spline, Overhauser spline
|
|
|
/// </summary>
|
|
|
FILTER_CATMULLROM = 4,
|
|
|
/// <summary>
|
|
|
/// Lanczos3 filter
|
|
|
/// </summary>
|
|
|
FILTER_LANCZOS3 = 5
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Color channels. Constants used in color manipulation routines.
|
|
|
/// </summary>
|
|
|
public enum FREE_IMAGE_COLOR_CHANNEL
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Use red, green and blue channels
|
|
|
/// </summary>
|
|
|
FICC_RGB = 0,
|
|
|
/// <summary>
|
|
|
/// Use red channel
|
|
|
/// </summary>
|
|
|
FICC_RED = 1,
|
|
|
/// <summary>
|
|
|
/// Use green channel
|
|
|
/// </summary>
|
|
|
FICC_GREEN = 2,
|
|
|
/// <summary>
|
|
|
/// Use blue channel
|
|
|
/// </summary>
|
|
|
FICC_BLUE = 3,
|
|
|
/// <summary>
|
|
|
/// Use alpha channel
|
|
|
/// </summary>
|
|
|
FICC_ALPHA = 4,
|
|
|
/// <summary>
|
|
|
/// Use black channel
|
|
|
/// </summary>
|
|
|
FICC_BLACK = 5,
|
|
|
/// <summary>
|
|
|
/// Complex images: use real part
|
|
|
/// </summary>
|
|
|
FICC_REAL = 6,
|
|
|
/// <summary>
|
|
|
/// Complex images: use imaginary part
|
|
|
/// </summary>
|
|
|
FICC_IMAG = 7,
|
|
|
/// <summary>
|
|
|
/// Complex images: use magnitude
|
|
|
/// </summary>
|
|
|
FICC_MAG = 8,
|
|
|
/// <summary>
|
|
|
/// Complex images: use phase
|
|
|
/// </summary>
|
|
|
FICC_PHASE = 9
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Tag data type information (based on TIFF specifications)
|
|
|
/// Note: RATIONALs are the ratio of two 32-bit integer values.
|
|
|
/// </summary>
|
|
|
public enum FREE_IMAGE_MDTYPE
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// placeholder
|
|
|
/// </summary>
|
|
|
FIDT_NOTYPE = 0,
|
|
|
/// <summary>
|
|
|
/// 8-bit unsigned integer
|
|
|
/// </summary>
|
|
|
FIDT_BYTE = 1,
|
|
|
/// <summary>
|
|
|
/// 8-bit bytes w/ last byte null
|
|
|
/// </summary>
|
|
|
FIDT_ASCII = 2,
|
|
|
/// <summary>
|
|
|
/// 16-bit unsigned integer
|
|
|
/// </summary>
|
|
|
FIDT_SHORT = 3,
|
|
|
/// <summary>
|
|
|
/// 32-bit unsigned integer
|
|
|
/// </summary>
|
|
|
FIDT_LONG = 4,
|
|
|
/// <summary>
|
|
|
/// 64-bit unsigned fraction
|
|
|
/// </summary>
|
|
|
FIDT_RATIONAL = 5,
|
|
|
/// <summary>
|
|
|
/// 8-bit signed integer
|
|
|
/// </summary>
|
|
|
FIDT_SBYTE = 6,
|
|
|
/// <summary>
|
|
|
/// 8-bit untyped data
|
|
|
/// </summary>
|
|
|
FIDT_UNDEFINED = 7,
|
|
|
/// <summary>
|
|
|
/// 16-bit signed integer
|
|
|
/// </summary>
|
|
|
FIDT_SSHORT = 8,
|
|
|
/// <summary>
|
|
|
/// 32-bit signed integer
|
|
|
/// </summary>
|
|
|
FIDT_SLONG = 9,
|
|
|
/// <summary>
|
|
|
/// 64-bit signed fraction
|
|
|
/// </summary>
|
|
|
FIDT_SRATIONAL = 10,
|
|
|
/// <summary>
|
|
|
/// 32-bit IEEE floating point
|
|
|
/// </summary>
|
|
|
FIDT_FLOAT = 11,
|
|
|
/// <summary>
|
|
|
/// 64-bit IEEE floating point
|
|
|
/// </summary>
|
|
|
FIDT_DOUBLE = 12,
|
|
|
/// <summary>
|
|
|
/// 32-bit unsigned integer (offset)
|
|
|
/// </summary>
|
|
|
FIDT_IFD = 13,
|
|
|
/// <summary>
|
|
|
/// 32-bit RGBQUAD
|
|
|
/// </summary>
|
|
|
FIDT_PALETTE = 14
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Metadata models supported by FreeImage.
|
|
|
/// </summary>
|
|
|
public enum FREE_IMAGE_MDMODEL
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// No data
|
|
|
/// </summary>
|
|
|
FIMD_NODATA = -1,
|
|
|
/// <summary>
|
|
|
/// single comment or keywords
|
|
|
/// </summary>
|
|
|
FIMD_COMMENTS = 0,
|
|
|
/// <summary>
|
|
|
/// Exif-TIFF metadata
|
|
|
/// </summary>
|
|
|
FIMD_EXIF_MAIN = 1,
|
|
|
/// <summary>
|
|
|
/// Exif-specific metadata
|
|
|
/// </summary>
|
|
|
FIMD_EXIF_EXIF = 2,
|
|
|
/// <summary>
|
|
|
/// Exif GPS metadata
|
|
|
/// </summary>
|
|
|
FIMD_EXIF_GPS = 3,
|
|
|
/// <summary>
|
|
|
/// Exif maker note metadata
|
|
|
/// </summary>
|
|
|
FIMD_EXIF_MAKERNOTE = 4,
|
|
|
/// <summary>
|
|
|
/// Exif interoperability metadata
|
|
|
/// </summary>
|
|
|
FIMD_EXIF_INTEROP = 5,
|
|
|
/// <summary>
|
|
|
/// IPTC/NAA metadata
|
|
|
/// </summary>
|
|
|
FIMD_IPTC = 6,
|
|
|
/// <summary>
|
|
|
/// Abobe XMP metadata
|
|
|
/// </summary>
|
|
|
FIMD_XMP = 7,
|
|
|
/// <summary>
|
|
|
/// GeoTIFF metadata
|
|
|
/// </summary>
|
|
|
FIMD_GEOTIFF = 8,
|
|
|
/// <summary>
|
|
|
/// Animation metadata
|
|
|
/// </summary>
|
|
|
FIMD_ANIMATION = 9,
|
|
|
/// <summary>
|
|
|
/// Used to attach other metadata types to a dib
|
|
|
/// </summary>
|
|
|
FIMD_CUSTOM = 10
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Flags used in load functions.
|
|
|
/// </summary>
|
|
|
[System.Flags]
|
|
|
public enum FREE_IMAGE_LOAD_FLAGS
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Default option for all types.
|
|
|
/// </summary>
|
|
|
DEFAULT = 0,
|
|
|
/// <summary>
|
|
|
/// Load the image as a 256 color image with ununsed palette entries, if it's 16 or 2 color.
|
|
|
/// </summary>
|
|
|
GIF_LOAD256 = 1,
|
|
|
/// <summary>
|
|
|
/// 'Play' the GIF to generate each frame (as 32bpp) instead of returning raw frame data when loading.
|
|
|
/// </summary>
|
|
|
GIF_PLAYBACK = 2,
|
|
|
/// <summary>
|
|
|
/// Convert to 32bpp and create an alpha channel from the AND-mask when loading.
|
|
|
/// </summary>
|
|
|
ICO_MAKEALPHA = 1,
|
|
|
/// <summary>
|
|
|
/// Load the file as fast as possible, sacrificing some quality.
|
|
|
/// </summary>
|
|
|
JPEG_FAST = 0x0001,
|
|
|
/// <summary>
|
|
|
/// Load the file with the best quality, sacrificing some speed.
|
|
|
/// </summary>
|
|
|
JPEG_ACCURATE = 0x0002,
|
|
|
/// <summary>
|
|
|
/// Load separated CMYK "as is" (use | to combine with other load flags).
|
|
|
/// </summary>
|
|
|
JPEG_CMYK = 0x0004,
|
|
|
/// <summary>
|
|
|
/// Load and rotate according to Exif 'Orientation' tag if available.
|
|
|
/// </summary>
|
|
|
JPEG_EXIFROTATE = 0x0008,
|
|
|
/// <summary>
|
|
|
/// Load the bitmap sized 768 x 512.
|
|
|
/// </summary>
|
|
|
PCD_BASE = 1,
|
|
|
/// <summary>
|
|
|
/// Load the bitmap sized 384 x 256.
|
|
|
/// </summary>
|
|
|
PCD_BASEDIV4 = 2,
|
|
|
/// <summary>
|
|
|
/// Load the bitmap sized 192 x 128.
|
|
|
/// </summary>
|
|
|
PCD_BASEDIV16 = 3,
|
|
|
/// <summary>
|
|
|
/// Avoid gamma correction.
|
|
|
/// </summary>
|
|
|
PNG_IGNOREGAMMA = 1,
|
|
|
/// <summary>
|
|
|
/// If set the loader converts RGB555 and ARGB8888 -> RGB888.
|
|
|
/// </summary>
|
|
|
TARGA_LOAD_RGB888 = 1,
|
|
|
/// <summary>
|
|
|
/// Reads tags for separated CMYK.
|
|
|
/// </summary>
|
|
|
TIFF_CMYK = 0x0001,
|
|
|
/// <summary>
|
|
|
/// Tries to load the JPEG preview image, embedded in
|
|
|
/// Exif Metadata or load the image as RGB 24-bit if no
|
|
|
/// preview image is available.
|
|
|
/// </summary>
|
|
|
RAW_PREVIEW = 0x1,
|
|
|
/// <summary>
|
|
|
/// Loads the image as RGB 24-bit.
|
|
|
/// </summary>
|
|
|
RAW_DISPLAY = 0x2,
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Flags used in save functions.
|
|
|
/// </summary>
|
|
|
[System.Flags]
|
|
|
public enum FREE_IMAGE_SAVE_FLAGS
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Default option for all types.
|
|
|
/// </summary>
|
|
|
DEFAULT = 0,
|
|
|
/// <summary>
|
|
|
/// Save with run length encoding.
|
|
|
/// </summary>
|
|
|
BMP_SAVE_RLE = 1,
|
|
|
/// <summary>
|
|
|
/// Save data as float instead of as half (not recommended).
|
|
|
/// </summary>
|
|
|
EXR_FLOAT = 0x0001,
|
|
|
/// <summary>
|
|
|
/// Save with no compression.
|
|
|
/// </summary>
|
|
|
EXR_NONE = 0x0002,
|
|
|
/// <summary>
|
|
|
/// Save with zlib compression, in blocks of 16 scan lines.
|
|
|
/// </summary>
|
|
|
EXR_ZIP = 0x0004,
|
|
|
/// <summary>
|
|
|
/// Save with piz-based wavelet compression.
|
|
|
/// </summary>
|
|
|
EXR_PIZ = 0x0008,
|
|
|
/// <summary>
|
|
|
/// Save with lossy 24-bit float compression.
|
|
|
/// </summary>
|
|
|
EXR_PXR24 = 0x0010,
|
|
|
/// <summary>
|
|
|
/// Save with lossy 44% float compression - goes to 22% when combined with EXR_LC.
|
|
|
/// </summary>
|
|
|
EXR_B44 = 0x0020,
|
|
|
/// <summary>
|
|
|
/// Save images with one luminance and two chroma channels, rather than as RGB (lossy compression).
|
|
|
/// </summary>
|
|
|
EXR_LC = 0x0040,
|
|
|
/// <summary>
|
|
|
/// Save with superb quality (100:1).
|
|
|
/// </summary>
|
|
|
JPEG_QUALITYSUPERB = 0x80,
|
|
|
/// <summary>
|
|
|
/// Save with good quality (75:1).
|
|
|
/// </summary>
|
|
|
JPEG_QUALITYGOOD = 0x0100,
|
|
|
/// <summary>
|
|
|
/// Save with normal quality (50:1).
|
|
|
/// </summary>
|
|
|
JPEG_QUALITYNORMAL = 0x0200,
|
|
|
/// <summary>
|
|
|
/// Save with average quality (25:1).
|
|
|
/// </summary>
|
|
|
JPEG_QUALITYAVERAGE = 0x0400,
|
|
|
/// <summary>
|
|
|
/// Save with bad quality (10:1).
|
|
|
/// </summary>
|
|
|
JPEG_QUALITYBAD = 0x0800,
|
|
|
/// <summary>
|
|
|
/// Save as a progressive-JPEG (use | to combine with other save flags).
|
|
|
/// </summary>
|
|
|
JPEG_PROGRESSIVE = 0x2000,
|
|
|
/// <summary>
|
|
|
/// Save with high 4x1 chroma subsampling (4:1:1).
|
|
|
/// </summary>
|
|
|
JPEG_SUBSAMPLING_411 = 0x1000,
|
|
|
/// <summary>
|
|
|
/// Save with medium 2x2 medium chroma (4:2:0).
|
|
|
/// </summary>
|
|
|
JPEG_SUBSAMPLING_420 = 0x4000,
|
|
|
/// <summary>
|
|
|
/// Save with low 2x1 chroma subsampling (4:2:2).
|
|
|
/// </summary>
|
|
|
JPEG_SUBSAMPLING_422 = 0x8000,
|
|
|
/// <summary>
|
|
|
/// Save with no chroma subsampling (4:4:4).
|
|
|
/// </summary>
|
|
|
JPEG_SUBSAMPLING_444 = 0x10000,
|
|
|
/// <summary>
|
|
|
/// Save using ZLib level 1 compression flag
|
|
|
/// (default value is <see cref="PNG_Z_DEFAULT_COMPRESSION"/>).
|
|
|
/// </summary>
|
|
|
PNG_Z_BEST_SPEED = 0x0001,
|
|
|
/// <summary>
|
|
|
/// Save using ZLib level 6 compression flag (default recommended value).
|
|
|
/// </summary>
|
|
|
PNG_Z_DEFAULT_COMPRESSION = 0x0006,
|
|
|
/// <summary>
|
|
|
/// save using ZLib level 9 compression flag
|
|
|
/// (default value is <see cref="PNG_Z_DEFAULT_COMPRESSION"/>).
|
|
|
/// </summary>
|
|
|
PNG_Z_BEST_COMPRESSION = 0x0009,
|
|
|
/// <summary>
|
|
|
/// Save without ZLib compression.
|
|
|
/// </summary>
|
|
|
PNG_Z_NO_COMPRESSION = 0x0100,
|
|
|
/// <summary>
|
|
|
/// Save using Adam7 interlacing (use | to combine with other save flags).
|
|
|
/// </summary>
|
|
|
PNG_INTERLACED = 0x0200,
|
|
|
/// <summary>
|
|
|
/// If set the writer saves in ASCII format (i.e. P1, P2 or P3).
|
|
|
/// </summary>
|
|
|
PNM_SAVE_ASCII = 1,
|
|
|
/// <summary>
|
|
|
/// Stores tags for separated CMYK (use | to combine with compression flags).
|
|
|
/// </summary>
|
|
|
TIFF_CMYK = 0x0001,
|
|
|
/// <summary>
|
|
|
/// Save using PACKBITS compression.
|
|
|
/// </summary>
|
|
|
TIFF_PACKBITS = 0x0100,
|
|
|
/// <summary>
|
|
|
/// Save using DEFLATE compression (a.k.a. ZLIB compression).
|
|
|
/// </summary>
|
|
|
TIFF_DEFLATE = 0x0200,
|
|
|
/// <summary>
|
|
|
/// Save using ADOBE DEFLATE compression.
|
|
|
/// </summary>
|
|
|
TIFF_ADOBE_DEFLATE = 0x0400,
|
|
|
/// <summary>
|
|
|
/// Save without any compression.
|
|
|
/// </summary>
|
|
|
TIFF_NONE = 0x0800,
|
|
|
/// <summary>
|
|
|
/// Save using CCITT Group 3 fax encoding.
|
|
|
/// </summary>
|
|
|
TIFF_CCITTFAX3 = 0x1000,
|
|
|
/// <summary>
|
|
|
/// Save using CCITT Group 4 fax encoding.
|
|
|
/// </summary>
|
|
|
TIFF_CCITTFAX4 = 0x2000,
|
|
|
/// <summary>
|
|
|
/// Save using LZW compression.
|
|
|
/// </summary>
|
|
|
TIFF_LZW = 0x4000,
|
|
|
/// <summary>
|
|
|
/// Save using JPEG compression.
|
|
|
/// </summary>
|
|
|
TIFF_JPEG = 0x8000
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Flags for ICC profiles.
|
|
|
/// </summary>
|
|
|
[System.Flags]
|
|
|
public enum ICC_FLAGS : ushort
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Default value.
|
|
|
/// </summary>
|
|
|
FIICC_DEFAULT = 0x00,
|
|
|
/// <summary>
|
|
|
/// The color is CMYK.
|
|
|
/// </summary>
|
|
|
FIICC_COLOR_IS_CMYK = 0x01
|
|
|
}
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Delegates
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
// Delegates used by the FreeImageIO structure
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate for capturing FreeImage error messages.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">The format of the image.</param>
|
|
|
/// <param name="message">The errormessage.</param>
|
|
|
// DLL_API is missing in the definition of the callbackfuntion.
|
|
|
[UnmanagedFunctionPointer(CallingConvention.Cdecl, CharSet = CharSet.Ansi, ThrowOnUnmappableChar = false)]
|
|
|
public delegate void OutputMessageFunction(FREE_IMAGE_FORMAT fif, string message);
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI.IO
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Delegate to the C++ function <b>fread</b>.
|
|
|
/// </summary>
|
|
|
/// <param name="buffer">Pointer to read from.</param>
|
|
|
/// <param name="size">Item size in bytes.</param>
|
|
|
/// <param name="count">Maximum number of items to be read.</param>
|
|
|
/// <param name="handle">Handle/stream to read from.</param>
|
|
|
/// <returns>Number of full items actually read,
|
|
|
/// which may be less than count if an error occurs or
|
|
|
/// if the end of the file is encountered before reaching count.</returns>
|
|
|
public delegate uint ReadProc(IntPtr buffer, uint size, uint count, fi_handle handle);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to the C++ function <b>fwrite</b>.
|
|
|
/// </summary>
|
|
|
/// <param name="buffer">Pointer to data to be written.</param>
|
|
|
/// <param name="size">Item size in bytes.</param>
|
|
|
/// <param name="count">Maximum number of items to be written.</param>
|
|
|
/// <param name="handle">Handle/stream to write to.</param>
|
|
|
/// <returns>Number of full items actually written,
|
|
|
/// which may be less than count if an error occurs.
|
|
|
/// Also, if an error occurs, the file-position indicator cannot be determined.</returns>
|
|
|
public delegate uint WriteProc(IntPtr buffer, uint size, uint count, fi_handle handle);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to the C++ function <b>fseek</b>.
|
|
|
/// </summary>
|
|
|
/// <param name="handle">Handle/stream to seek in.</param>
|
|
|
/// <param name="offset">Number of bytes from origin.</param>
|
|
|
/// <param name="origin">Initial position.</param>
|
|
|
/// <returns>If successful 0 is returned; otherwise a nonzero value. </returns>
|
|
|
public delegate int SeekProc(fi_handle handle, int offset, SeekOrigin origin);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to the C++ function <b>ftell</b>.
|
|
|
/// </summary>
|
|
|
/// <param name="handle">Handle/stream to retrieve its currents position from.</param>
|
|
|
/// <returns>The current position.</returns>
|
|
|
public delegate int TellProc(fi_handle handle);
|
|
|
|
|
|
// Delegates used by 'Plugin' structure
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI.Plugins
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that returns a string which describes
|
|
|
/// the plugins format.
|
|
|
/// </summary>
|
|
|
public delegate string FormatProc();
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that returns a string which contains
|
|
|
/// a more detailed description.
|
|
|
/// </summary>
|
|
|
public delegate string DescriptionProc();
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that returns a comma seperated list
|
|
|
/// of file extensions the plugin can read or write.
|
|
|
/// </summary>
|
|
|
public delegate string ExtensionListProc();
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that returns a regular expression that
|
|
|
/// can be used to idientify whether a file can be handled by the plugin.
|
|
|
/// </summary>
|
|
|
public delegate string RegExprProc();
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that opens a file.
|
|
|
/// </summary>
|
|
|
public delegate IntPtr OpenProc(ref FreeImageIO io, fi_handle handle, bool read);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that closes a previosly opened file.
|
|
|
/// </summary>
|
|
|
public delegate void CloseProc(ref FreeImageIO io, fi_handle handle, IntPtr data);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that returns the number of pages of a multipage
|
|
|
/// bitmap if the plugin is capable of handling multipage bitmaps.
|
|
|
/// </summary>
|
|
|
public delegate int PageCountProc(ref FreeImageIO io, fi_handle handle, IntPtr data);
|
|
|
|
|
|
/// <summary>
|
|
|
/// UNKNOWN
|
|
|
/// </summary>
|
|
|
public delegate int PageCapabilityProc(ref FreeImageIO io, fi_handle handle, IntPtr data);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that loads and decodes a bitmap into memory.
|
|
|
/// </summary>
|
|
|
public delegate FIBITMAP LoadProc(ref FreeImageIO io, fi_handle handle, int page, int flags, IntPtr data);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that saves a bitmap.
|
|
|
/// </summary>
|
|
|
public delegate bool SaveProc(ref FreeImageIO io, FIBITMAP dib, fi_handle handle, int page, int flags, IntPtr data);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that determines whether the source defined
|
|
|
/// by <param name="io"/> and <param name="handle"/> is a valid image.
|
|
|
/// </summary>
|
|
|
public delegate bool ValidateProc(ref FreeImageIO io, fi_handle handle);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that returns a string which contains
|
|
|
/// the plugin's mime type.
|
|
|
/// </summary>
|
|
|
public delegate string MimeProc();
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that returns whether the plugin can handle the
|
|
|
/// specified color depth.
|
|
|
/// </summary>
|
|
|
public delegate bool SupportsExportBPPProc(int bpp);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that returns whether the plugin can handle the
|
|
|
/// specified image type.
|
|
|
/// </summary>
|
|
|
public delegate bool SupportsExportTypeProc(FREE_IMAGE_TYPE type);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate to a function that returns whether the plugin can handle
|
|
|
/// ICC-Profiles.
|
|
|
/// </summary>
|
|
|
public delegate bool SupportsICCProfilesProc();
|
|
|
|
|
|
/// <summary>
|
|
|
/// Callback function used by FreeImage to register plugins.
|
|
|
/// </summary>
|
|
|
public delegate void InitProc(ref Plugin plugin, int format_id);
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
public static partial class FreeImage
|
|
|
{
|
|
|
#region Constants
|
|
|
|
|
|
/// <summary>
|
|
|
/// Filename of the FreeImage library.
|
|
|
/// </summary>
|
|
|
private const string FreeImageLibrary = "FreeImage";
|
|
|
|
|
|
/// <summary>
|
|
|
/// Number of bytes to shift left within a 4 byte block.
|
|
|
/// </summary>
|
|
|
public const int FI_RGBA_RED = 2;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Number of bytes to shift left within a 4 byte block.
|
|
|
/// </summary>
|
|
|
public const int FI_RGBA_GREEN = 1;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Number of bytes to shift left within a 4 byte block.
|
|
|
/// </summary>
|
|
|
public const int FI_RGBA_BLUE = 0;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Number of bytes to shift left within a 4 byte block.
|
|
|
/// </summary>
|
|
|
public const int FI_RGBA_ALPHA = 3;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Mask indicating the position of the given color.
|
|
|
/// </summary>
|
|
|
public const uint FI_RGBA_RED_MASK = 0x00FF0000;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Mask indicating the position of the given color.
|
|
|
/// </summary>
|
|
|
public const uint FI_RGBA_GREEN_MASK = 0x0000FF00;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Mask indicating the position of the given color.
|
|
|
/// </summary>
|
|
|
public const uint FI_RGBA_BLUE_MASK = 0x000000FF;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Mask indicating the position of the given color.
|
|
|
/// </summary>
|
|
|
public const uint FI_RGBA_ALPHA_MASK = 0xFF000000;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Number of bits to shift left within a 32 bit block.
|
|
|
/// </summary>
|
|
|
public const int FI_RGBA_RED_SHIFT = 16;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Number of bits to shift left within a 32 bit block.
|
|
|
/// </summary>
|
|
|
public const int FI_RGBA_GREEN_SHIFT = 8;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Number of bits to shift left within a 32 bit block.
|
|
|
/// </summary>
|
|
|
public const int FI_RGBA_BLUE_SHIFT = 0;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Number of bits to shift left within a 32 bit block.
|
|
|
/// </summary>
|
|
|
public const int FI_RGBA_ALPHA_SHIFT = 24;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Mask indicating the position of color components of a 32 bit color.
|
|
|
/// </summary>
|
|
|
public const uint FI_RGBA_RGB_MASK = (FI_RGBA_RED_MASK | FI_RGBA_GREEN_MASK | FI_RGBA_BLUE_MASK);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Mask indicating the position of the given color.
|
|
|
/// </summary>
|
|
|
public const int FI16_555_RED_MASK = 0x7C00;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Mask indicating the position of the given color.
|
|
|
/// </summary>
|
|
|
public const int FI16_555_GREEN_MASK = 0x03E0;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Mask indicating the position of the given color.
|
|
|
/// </summary>
|
|
|
public const int FI16_555_BLUE_MASK = 0x001F;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Number of bits to shift left within a 16 bit block.
|
|
|
/// </summary>
|
|
|
public const int FI16_555_RED_SHIFT = 10;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Number of bits to shift left within a 16 bit block.
|
|
|
/// </summary>
|
|
|
public const int FI16_555_GREEN_SHIFT = 5;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Number of bits to shift left within a 16 bit block.
|
|
|
/// </summary>
|
|
|
public const int FI16_555_BLUE_SHIFT = 0;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Mask indicating the position of the given color.
|
|
|
/// </summary>
|
|
|
public const int FI16_565_RED_MASK = 0xF800;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Mask indicating the position of the given color.
|
|
|
/// </summary>
|
|
|
public const int FI16_565_GREEN_MASK = 0x07E0;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Mask indicating the position of the given color.
|
|
|
/// </summary>
|
|
|
public const int FI16_565_BLUE_MASK = 0x001F;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Number of bits to shift left within a 16 bit block.
|
|
|
/// </summary>
|
|
|
public const int FI16_565_RED_SHIFT = 11;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Number of bits to shift left within a 16 bit block.
|
|
|
/// </summary>
|
|
|
public const int FI16_565_GREEN_SHIFT = 5;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Number of bits to shift left within a 16 bit block.
|
|
|
/// </summary>
|
|
|
public const int FI16_565_BLUE_SHIFT = 0;
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region General functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initialises the library.
|
|
|
/// </summary>
|
|
|
/// <param name="load_local_plugins_only">
|
|
|
/// When the <paramref name="load_local_plugins_only"/> is true, FreeImage won't make use of external plugins.
|
|
|
/// </param>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_Initialise")]
|
|
|
private static extern void Initialise(bool load_local_plugins_only);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Deinitialises the library.
|
|
|
/// </summary>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_DeInitialise")]
|
|
|
private static extern void DeInitialise();
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a string containing the current version of the library.
|
|
|
/// </summary>
|
|
|
/// <returns>The current version of the library.</returns>
|
|
|
public static unsafe string GetVersion() { return PtrToStr(GetVersion_()); }
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Ansi, EntryPoint = "FreeImage_GetVersion")]
|
|
|
private static unsafe extern byte* GetVersion_();
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a string containing a standard copyright message.
|
|
|
/// </summary>
|
|
|
/// <returns>A standard copyright message.</returns>
|
|
|
public static unsafe string GetCopyrightMessage() { return PtrToStr(GetCopyrightMessage_()); }
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Ansi, EntryPoint = "FreeImage_GetCopyrightMessage")]
|
|
|
private static unsafe extern byte* GetCopyrightMessage_();
|
|
|
|
|
|
/// <summary>
|
|
|
/// Calls the set error message function in FreeImage.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">Format of the bitmaps.</param>
|
|
|
/// <param name="message">The error message.</param>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Ansi, EntryPoint = "FreeImage_OutputMessageProc")]
|
|
|
public static extern void OutputMessageProc(FREE_IMAGE_FORMAT fif, string message);
|
|
|
|
|
|
/// <summary>
|
|
|
/// You use the function FreeImage_SetOutputMessage to capture the log string
|
|
|
/// so that you can show it to the user of the program.
|
|
|
/// The callback is implemented in the <see cref="FreeImageEngine.Message"/> event of this class.
|
|
|
/// </summary>
|
|
|
/// <remarks>The function is private because FreeImage can only have a single
|
|
|
/// callback function. To use the callback use the <see cref="FreeImageEngine.Message"/>
|
|
|
/// event of this class.</remarks>
|
|
|
/// <param name="omf">Handler to the callback function.</param>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SetOutputMessage")]
|
|
|
internal static extern void SetOutputMessage(OutputMessageFunction omf);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Bitmap management functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a new bitmap in memory.
|
|
|
/// </summary>
|
|
|
/// <param name="width">Width of the new bitmap.</param>
|
|
|
/// <param name="height">Height of the new bitmap.</param>
|
|
|
/// <param name="bpp">Bit depth of the new Bitmap.
|
|
|
/// Supported pixel depth: 1-, 4-, 8-, 16-, 24-, 32-bit per pixel for standard bitmap</param>
|
|
|
/// <param name="red_mask">Red part of the color layout.
|
|
|
/// eg: 0xFF0000</param>
|
|
|
/// <param name="green_mask">Green part of the color layout.
|
|
|
/// eg: 0x00FF00</param>
|
|
|
/// <param name="blue_mask">Blue part of the color layout.
|
|
|
/// eg: 0x0000FF</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_Allocate")]
|
|
|
public static extern FIBITMAP Allocate(int width, int height, int bpp,
|
|
|
uint red_mask, uint green_mask, uint blue_mask);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a new bitmap in memory.
|
|
|
/// </summary>
|
|
|
/// <param name="type">Type of the image.</param>
|
|
|
/// <param name="width">Width of the new bitmap.</param>
|
|
|
/// <param name="height">Height of the new bitmap.</param>
|
|
|
/// <param name="bpp">Bit depth of the new Bitmap.
|
|
|
/// Supported pixel depth: 1-, 4-, 8-, 16-, 24-, 32-bit per pixel for standard bitmap</param>
|
|
|
/// <param name="red_mask">Red part of the color layout.
|
|
|
/// eg: 0xFF0000</param>
|
|
|
/// <param name="green_mask">Green part of the color layout.
|
|
|
/// eg: 0x00FF00</param>
|
|
|
/// <param name="blue_mask">Blue part of the color layout.
|
|
|
/// eg: 0x0000FF</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_AllocateT")]
|
|
|
public static extern FIBITMAP AllocateT(FREE_IMAGE_TYPE type, int width, int height, int bpp,
|
|
|
uint red_mask, uint green_mask, uint blue_mask);
|
|
|
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_AllocateEx")]
|
|
|
internal static extern FIBITMAP AllocateEx(int width, int height, int bpp,
|
|
|
IntPtr color, FREE_IMAGE_COLOR_OPTIONS options, RGBQUAD[] palette,
|
|
|
uint red_mask, uint green_mask, uint blue_mask);
|
|
|
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_AllocateExT")]
|
|
|
internal static extern FIBITMAP AllocateExT(FREE_IMAGE_TYPE type, int width, int height, int bpp,
|
|
|
IntPtr color, FREE_IMAGE_COLOR_OPTIONS options, RGBQUAD[] palette,
|
|
|
uint red_mask, uint green_mask, uint blue_mask);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Makes an exact reproduction of an existing bitmap, including metadata and attached profile if any.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_Clone")]
|
|
|
public static extern FIBITMAP Clone(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Deletes a previously loaded FIBITMAP from memory.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_Unload")]
|
|
|
public static extern void Unload(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Decodes a bitmap, allocates memory for it and returns it as a FIBITMAP.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">Type of the bitmap.</param>
|
|
|
/// <param name="filename">Name of the file to decode.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Unicode, EntryPoint = "FreeImage_LoadU")]
|
|
|
public static extern FIBITMAP Load(FREE_IMAGE_FORMAT fif, string filename, FREE_IMAGE_LOAD_FLAGS flags);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Decodes a bitmap, allocates memory for it and returns it as a FIBITMAP.
|
|
|
/// The filename supports UNICODE.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">Type of the bitmap.</param>
|
|
|
/// <param name="filename">Name of the file to decode.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Unicode, EntryPoint = "FreeImage_LoadU")]
|
|
|
private static extern FIBITMAP LoadU(FREE_IMAGE_FORMAT fif, string filename, FREE_IMAGE_LOAD_FLAGS flags);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a bitmap from an arbitrary source.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">Type of the bitmap.</param>
|
|
|
/// <param name="io">A FreeImageIO structure with functionpointers to handle the source.</param>
|
|
|
/// <param name="handle">A handle to the source.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_LoadFromHandle")]
|
|
|
public static extern FIBITMAP LoadFromHandle(FREE_IMAGE_FORMAT fif, ref FreeImageIO io, fi_handle handle, FREE_IMAGE_LOAD_FLAGS flags);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a previosly loaded FIBITMAP to a file.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">Type of the bitmap.</param>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="filename">Name of the file to save to.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Unicode, EntryPoint = "FreeImage_SaveU")]
|
|
|
public static extern bool Save(FREE_IMAGE_FORMAT fif, FIBITMAP dib, string filename, FREE_IMAGE_SAVE_FLAGS flags);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a previosly loaded FIBITMAP to a file.
|
|
|
/// The filename supports UNICODE.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">Type of the bitmap.</param>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="filename">Name of the file to save to.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Unicode, EntryPoint = "FreeImage_SaveU")]
|
|
|
private static extern bool SaveU(FREE_IMAGE_FORMAT fif, FIBITMAP dib, string filename, FREE_IMAGE_SAVE_FLAGS flags);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a bitmap to an arbitrary source.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">Type of the bitmap.</param>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="io">A FreeImageIO structure with functionpointers to handle the source.</param>
|
|
|
/// <param name="handle">A handle to the source.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SaveToHandle")]
|
|
|
public static extern bool SaveToHandle(FREE_IMAGE_FORMAT fif, FIBITMAP dib, ref FreeImageIO io, fi_handle handle,
|
|
|
FREE_IMAGE_SAVE_FLAGS flags);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Memory I/O streams
|
|
|
|
|
|
/// <summary>
|
|
|
/// Open a memory stream.
|
|
|
/// </summary>
|
|
|
/// <param name="data">Pointer to the data in memory.</param>
|
|
|
/// <param name="size_in_bytes">Length of the data in byte.</param>
|
|
|
/// <returns>Handle to a memory stream.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_OpenMemory")]
|
|
|
public static extern FIMEMORY OpenMemory(IntPtr data, uint size_in_bytes);
|
|
|
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_OpenMemory")]
|
|
|
internal static extern FIMEMORY OpenMemoryEx(byte[] data, uint size_in_bytes);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Close and free a memory stream.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">Handle to a memory stream.</param>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_CloseMemory")]
|
|
|
public static extern void CloseMemory(FIMEMORY stream);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Decodes a bitmap from a stream, allocates memory for it and returns it as a FIBITMAP.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">Type of the bitmap.</param>
|
|
|
/// <param name="stream">Handle to a memory stream.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_LoadFromMemory")]
|
|
|
public static extern FIBITMAP LoadFromMemory(FREE_IMAGE_FORMAT fif, FIMEMORY stream, FREE_IMAGE_LOAD_FLAGS flags);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a previosly loaded FIBITMAP to a stream.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">Type of the bitmap.</param>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="stream">Handle to a memory stream.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SaveToMemory")]
|
|
|
public static extern bool SaveToMemory(FREE_IMAGE_FORMAT fif, FIBITMAP dib, FIMEMORY stream, FREE_IMAGE_SAVE_FLAGS flags);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the current position of a memory handle.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">Handle to a memory stream.</param>
|
|
|
/// <returns>The current file position if successful, -1 otherwise.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_TellMemory")]
|
|
|
public static extern int TellMemory(FIMEMORY stream);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Moves the memory handle to a specified location.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">Handle to a memory stream.</param>
|
|
|
/// <param name="offset">Number of bytes from origin.</param>
|
|
|
/// <param name="origin">Initial position.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SeekMemory")]
|
|
|
public static extern bool SeekMemory(FIMEMORY stream, int offset, System.IO.SeekOrigin origin);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Provides a direct buffer access to a memory stream.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">The target memory stream.</param>
|
|
|
/// <param name="data">Pointer to the data in memory.</param>
|
|
|
/// <param name="size_in_bytes">Size of the data in bytes.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_AcquireMemory")]
|
|
|
public static extern bool AcquireMemory(FIMEMORY stream, ref IntPtr data, ref uint size_in_bytes);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Reads data from a memory stream.
|
|
|
/// </summary>
|
|
|
/// <param name="buffer">The buffer to store the data in.</param>
|
|
|
/// <param name="size">Size in bytes of the items.</param>
|
|
|
/// <param name="count">Number of items to read.</param>
|
|
|
/// <param name="stream">The stream to read from.
|
|
|
/// The memory pointer associated with stream is increased by the number of bytes actually read.</param>
|
|
|
/// <returns>The number of full items actually read.
|
|
|
/// May be less than count on error or stream-end.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ReadMemory")]
|
|
|
public static extern uint ReadMemory(byte[] buffer, uint size, uint count, FIMEMORY stream);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Writes data to a memory stream.
|
|
|
/// </summary>
|
|
|
/// <param name="buffer">The buffer to read the data from.</param>
|
|
|
/// <param name="size">Size in bytes of the items.</param>
|
|
|
/// <param name="count">Number of items to write.</param>
|
|
|
/// <param name="stream">The stream to write to.
|
|
|
/// The memory pointer associated with stream is increased by the number of bytes actually written.</param>
|
|
|
/// <returns>The number of full items actually written.
|
|
|
/// May be less than count on error or stream-end.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_WriteMemory")]
|
|
|
public static extern uint WriteMemory(byte[] buffer, uint size, uint count, FIMEMORY stream);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Open a multi-page bitmap from a memory stream.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">Type of the bitmap.</param>
|
|
|
/// <param name="stream">The stream to decode.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Handle to a FreeImage multi-paged bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_LoadMultiBitmapFromMemory")]
|
|
|
public static extern FIMULTIBITMAP LoadMultiBitmapFromMemory(FREE_IMAGE_FORMAT fif, FIMEMORY stream, FREE_IMAGE_LOAD_FLAGS flags);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Plugin functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Registers a new plugin to be used in FreeImage.
|
|
|
/// </summary>
|
|
|
/// <param name="proc_address">Pointer to the function that initialises the plugin.</param>
|
|
|
/// <param name="format">A string describing the format of the plugin.</param>
|
|
|
/// <param name="description">A string describing the plugin.</param>
|
|
|
/// <param name="extension">A string witha comma sperated list of extensions. f.e: "pl,pl2,pl4"</param>
|
|
|
/// <param name="regexpr">A regular expression used to identify the bitmap.</param>
|
|
|
/// <returns>The format idientifier assigned by FreeImage.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Ansi, EntryPoint = "FreeImage_RegisterLocalPlugin")]
|
|
|
public static extern FREE_IMAGE_FORMAT RegisterLocalPlugin(InitProc proc_address,
|
|
|
string format, string description, string extension, string regexpr);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Registers a new plugin to be used in FreeImage. The plugin is residing in a DLL.
|
|
|
/// The Init function must be called <20>Init<69> and must use the stdcall calling convention.
|
|
|
/// </summary>
|
|
|
/// <param name="path">Complete path to the dll file hosting the plugin.</param>
|
|
|
/// <param name="format">A string describing the format of the plugin.</param>
|
|
|
/// <param name="description">A string describing the plugin.</param>
|
|
|
/// <param name="extension">A string witha comma sperated list of extensions. f.e: "pl,pl2,pl4"</param>
|
|
|
/// <param name="regexpr">A regular expression used to identify the bitmap.</param>
|
|
|
/// <returns>The format idientifier assigned by FreeImage.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Ansi, EntryPoint = "FreeImage_RegisterExternalPlugin")]
|
|
|
public static extern FREE_IMAGE_FORMAT RegisterExternalPlugin(string path,
|
|
|
string format, string description, string extension, string regexpr);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the number of FREE_IMAGE_FORMAT identifiers being currently registered.
|
|
|
/// </summary>
|
|
|
/// <returns>The number of registered formats.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetFIFCount")]
|
|
|
public static extern int GetFIFCount();
|
|
|
|
|
|
/// <summary>
|
|
|
/// Enables or disables a plugin.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">The plugin to enable or disable.</param>
|
|
|
/// <param name="enable">True: enable the plugin. false: disable the plugin.</param>
|
|
|
/// <returns>The previous state of the plugin.
|
|
|
/// 1 - enabled. 0 - disables. -1 plugin does not exist.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SetPluginEnabled")]
|
|
|
public static extern int SetPluginEnabled(FREE_IMAGE_FORMAT fif, bool enable);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the state of a plugin.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">The plugin to check.</param>
|
|
|
/// <returns>1 - enabled. 0 - disables. -1 plugin does not exist.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_IsPluginEnabled")]
|
|
|
public static extern int IsPluginEnabled(FREE_IMAGE_FORMAT fif);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a <see cref="FREE_IMAGE_FORMAT"/> identifier from the format string that was used to register the FIF.
|
|
|
/// </summary>
|
|
|
/// <param name="format">The string that was used to register the plugin.</param>
|
|
|
/// <returns>A <see cref="FREE_IMAGE_FORMAT"/> identifier from the format.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Ansi, EntryPoint = "FreeImage_GetFIFFromFormat")]
|
|
|
public static extern FREE_IMAGE_FORMAT GetFIFFromFormat(string format);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a <see cref="FREE_IMAGE_FORMAT"/> identifier from a MIME content type string
|
|
|
/// (MIME stands for Multipurpose Internet Mail Extension).
|
|
|
/// </summary>
|
|
|
/// <param name="mime">A MIME content type.</param>
|
|
|
/// <returns>A <see cref="FREE_IMAGE_FORMAT"/> identifier from the MIME.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Ansi, EntryPoint = "FreeImage_GetFIFFromMime")]
|
|
|
public static extern FREE_IMAGE_FORMAT GetFIFFromMime(string mime);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the string that was used to register a plugin from the system assigned <see cref="FREE_IMAGE_FORMAT"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">The assigned <see cref="FREE_IMAGE_FORMAT"/>.</param>
|
|
|
/// <returns>The string that was used to register the plugin.</returns>
|
|
|
public static unsafe string GetFormatFromFIF(FREE_IMAGE_FORMAT fif) { return PtrToStr(GetFormatFromFIF_(fif)); }
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetFormatFromFIF")]
|
|
|
private static unsafe extern byte* GetFormatFromFIF_(FREE_IMAGE_FORMAT fif);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a comma-delimited file extension list describing the bitmap formats the given plugin can read and/or write.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">The desired <see cref="FREE_IMAGE_FORMAT"/>.</param>
|
|
|
/// <returns>A comma-delimited file extension list.</returns>
|
|
|
public static unsafe string GetFIFExtensionList(FREE_IMAGE_FORMAT fif) { return PtrToStr(GetFIFExtensionList_(fif)); }
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetFIFExtensionList")]
|
|
|
private static unsafe extern byte* GetFIFExtensionList_(FREE_IMAGE_FORMAT fif);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a descriptive string that describes the bitmap formats the given plugin can read and/or write.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">The desired <see cref="FREE_IMAGE_FORMAT"/>.</param>
|
|
|
/// <returns>A descriptive string that describes the bitmap formats.</returns>
|
|
|
public static unsafe string GetFIFDescription(FREE_IMAGE_FORMAT fif) { return PtrToStr(GetFIFDescription_(fif)); }
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetFIFDescription")]
|
|
|
private static unsafe extern byte* GetFIFDescription_(FREE_IMAGE_FORMAT fif);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a regular expression string that can be used by a regular expression engine to identify the bitmap.
|
|
|
/// FreeImageQt makes use of this function.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">The desired <see cref="FREE_IMAGE_FORMAT"/>.</param>
|
|
|
/// <returns>A regular expression string.</returns>
|
|
|
public static unsafe string GetFIFRegExpr(FREE_IMAGE_FORMAT fif) { return PtrToStr(GetFIFRegExpr_(fif)); }
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetFIFRegExpr")]
|
|
|
private static unsafe extern byte* GetFIFRegExpr_(FREE_IMAGE_FORMAT fif);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Given a <see cref="FREE_IMAGE_FORMAT"/> identifier, returns a MIME content type string (MIME stands for Multipurpose Internet Mail Extension).
|
|
|
/// </summary>
|
|
|
/// <param name="fif">The desired <see cref="FREE_IMAGE_FORMAT"/>.</param>
|
|
|
/// <returns>A MIME content type string.</returns>
|
|
|
public static unsafe string GetFIFMimeType(FREE_IMAGE_FORMAT fif) { return PtrToStr(GetFIFMimeType_(fif)); }
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetFIFMimeType")]
|
|
|
private static unsafe extern byte* GetFIFMimeType_(FREE_IMAGE_FORMAT fif);
|
|
|
|
|
|
/// <summary>
|
|
|
/// This function takes a filename or a file-extension and returns the plugin that can
|
|
|
/// read/write files with that extension in the form of a <see cref="FREE_IMAGE_FORMAT"/> identifier.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The filename or -extension.</param>
|
|
|
/// <returns>The <see cref="FREE_IMAGE_FORMAT"/> of the plugin.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Unicode, EntryPoint = "FreeImage_GetFIFFromFilenameU")]
|
|
|
public static extern FREE_IMAGE_FORMAT GetFIFFromFilename(string filename);
|
|
|
|
|
|
/// <summary>
|
|
|
/// This function takes a filename or a file-extension and returns the plugin that can
|
|
|
/// read/write files with that extension in the form of a <see cref="FREE_IMAGE_FORMAT"/> identifier.
|
|
|
/// Supports UNICODE filenames.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The filename or -extension.</param>
|
|
|
/// <returns>The <see cref="FREE_IMAGE_FORMAT"/> of the plugin.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Unicode, EntryPoint = "FreeImage_GetFIFFromFilenameU")]
|
|
|
private static extern FREE_IMAGE_FORMAT GetFIFFromFilenameU(string filename);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Checks if a plugin can load bitmaps.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">The <see cref="FREE_IMAGE_FORMAT"/> of the plugin.</param>
|
|
|
/// <returns>True if the plugin can load bitmaps, else false.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_FIFSupportsReading")]
|
|
|
public static extern bool FIFSupportsReading(FREE_IMAGE_FORMAT fif);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Checks if a plugin can save bitmaps.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">The <see cref="FREE_IMAGE_FORMAT"/> of the plugin.</param>
|
|
|
/// <returns>True if the plugin can save bitmaps, else false.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_FIFSupportsWriting")]
|
|
|
public static extern bool FIFSupportsWriting(FREE_IMAGE_FORMAT fif);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Checks if a plugin can save bitmaps in the desired bit depth.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">The <see cref="FREE_IMAGE_FORMAT"/> of the plugin.</param>
|
|
|
/// <param name="bpp">The desired bit depth.</param>
|
|
|
/// <returns>True if the plugin can save bitmaps in the desired bit depth, else false.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_FIFSupportsExportBPP")]
|
|
|
public static extern bool FIFSupportsExportBPP(FREE_IMAGE_FORMAT fif, int bpp);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Checks if a plugin can save a bitmap in the desired data type.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">The <see cref="FREE_IMAGE_FORMAT"/> of the plugin.</param>
|
|
|
/// <param name="type">The desired image type.</param>
|
|
|
/// <returns>True if the plugin can save bitmaps as the desired type, else false.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_FIFSupportsExportType")]
|
|
|
public static extern bool FIFSupportsExportType(FREE_IMAGE_FORMAT fif, FREE_IMAGE_TYPE type);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Checks if a plugin can load or save an ICC profile.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">The <see cref="FREE_IMAGE_FORMAT"/> of the plugin.</param>
|
|
|
/// <returns>True if the plugin can load or save an ICC profile, else false.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_FIFSupportsICCProfiles")]
|
|
|
public static extern bool FIFSupportsICCProfiles(FREE_IMAGE_FORMAT fif);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Multipage functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a FreeImage multi-paged bitmap.
|
|
|
/// Load flags can be provided by the flags parameter.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">Format of the image.</param>
|
|
|
/// <param name="filename">The complete name of the file to load.</param>
|
|
|
/// <param name="create_new">When true a new bitmap is created.</param>
|
|
|
/// <param name="read_only">When true the bitmap will be loaded read only.</param>
|
|
|
/// <param name="keep_cache_in_memory">When true performance is increased at the cost of memory.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Handle to a FreeImage multi-paged bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_OpenMultiBitmap")]
|
|
|
public static extern FIMULTIBITMAP OpenMultiBitmap(FREE_IMAGE_FORMAT fif, string filename, bool create_new,
|
|
|
bool read_only, bool keep_cache_in_memory, FREE_IMAGE_LOAD_FLAGS flags);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a FreeImage multi-pages bitmap from the specified handle
|
|
|
/// using the specified functions.
|
|
|
/// Load flags can be provided by the flags parameter.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">Format of the image.</param>
|
|
|
/// <param name="io">IO functions used to read from the specified handle.</param>
|
|
|
/// <param name="handle">The handle to load the bitmap from.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Handle to a FreeImage multi-paged bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_OpenMultiBitmapFromHandle")]
|
|
|
public static extern FIMULTIBITMAP OpenMultiBitmapFromHandle(FREE_IMAGE_FORMAT fif, ref FreeImageIO io,
|
|
|
fi_handle handle, FREE_IMAGE_LOAD_FLAGS flags);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Closes a previously opened multi-page bitmap and, when the bitmap was not opened read-only, applies any changes made to it.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">Handle to a FreeImage multi-paged bitmap.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_CloseMultiBitmap")]
|
|
|
private static extern bool CloseMultiBitmap_(FIMULTIBITMAP bitmap, FREE_IMAGE_SAVE_FLAGS flags);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the number of pages currently available in the multi-paged bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">Handle to a FreeImage multi-paged bitmap.</param>
|
|
|
/// <returns>Number of pages.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetPageCount")]
|
|
|
public static extern int GetPageCount(FIMULTIBITMAP bitmap);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Appends a new page to the end of the bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">Handle to a FreeImage multi-paged bitmap.</param>
|
|
|
/// <param name="data">Handle to a FreeImage bitmap.</param>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_AppendPage")]
|
|
|
public static extern void AppendPage(FIMULTIBITMAP bitmap, FIBITMAP data);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Inserts a new page before the given position in the bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">Handle to a FreeImage multi-paged bitmap.</param>
|
|
|
/// <param name="page">Page has to be a number smaller than the current number of pages available in the bitmap.</param>
|
|
|
/// <param name="data">Handle to a FreeImage bitmap.</param>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_InsertPage")]
|
|
|
public static extern void InsertPage(FIMULTIBITMAP bitmap, int page, FIBITMAP data);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Deletes the page on the given position.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">Handle to a FreeImage multi-paged bitmap.</param>
|
|
|
/// <param name="page">Number of the page to delete.</param>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_DeletePage")]
|
|
|
public static extern void DeletePage(FIMULTIBITMAP bitmap, int page);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Locks a page in memory for editing.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">Handle to a FreeImage multi-paged bitmap.</param>
|
|
|
/// <param name="page">Number of the page to lock.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_LockPage")]
|
|
|
public static extern FIBITMAP LockPage(FIMULTIBITMAP bitmap, int page);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Unlocks a previously locked page and gives it back to the multi-page engine.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">Handle to a FreeImage multi-paged bitmap.</param>
|
|
|
/// <param name="data">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="changed">If true, the page is applied to the multi-page bitmap.</param>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_UnlockPage")]
|
|
|
public static extern void UnlockPage(FIMULTIBITMAP bitmap, FIBITMAP data, bool changed);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Moves the source page to the position of the target page.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">Handle to a FreeImage multi-paged bitmap.</param>
|
|
|
/// <param name="target">New position of the page.</param>
|
|
|
/// <param name="source">Old position of the page.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_MovePage")]
|
|
|
public static extern bool MovePage(FIMULTIBITMAP bitmap, int target, int source);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns an array of page-numbers that are currently locked in memory.
|
|
|
/// When the pages parameter is null, the size of the array is returned in the count variable.
|
|
|
/// </summary>
|
|
|
/// <example>
|
|
|
/// <code>
|
|
|
/// int[] lockedPages = null;
|
|
|
/// int count = 0;
|
|
|
/// GetLockedPageNumbers(dib, lockedPages, ref count);
|
|
|
/// lockedPages = new int[count];
|
|
|
/// GetLockedPageNumbers(dib, lockedPages, ref count);
|
|
|
/// </code>
|
|
|
/// </example>
|
|
|
/// <param name="bitmap">Handle to a FreeImage multi-paged bitmap.</param>
|
|
|
/// <param name="pages">The list of locked pages in the multi-pages bitmap.
|
|
|
/// If set to null, count will contain the number of pages.</param>
|
|
|
/// <param name="count">If <paramref name="pages"/> is set to null count will contain the number of locked pages.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetLockedPageNumbers")]
|
|
|
public static extern bool GetLockedPageNumbers(FIMULTIBITMAP bitmap, int[] pages, ref int count);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Filetype functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Orders FreeImage to analyze the bitmap signature.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">Name of the file to analyze.</param>
|
|
|
/// <param name="size">Reserved parameter - use 0.</param>
|
|
|
/// <returns>Type of the bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Unicode, EntryPoint = "FreeImage_GetFileTypeU")]
|
|
|
public static extern FREE_IMAGE_FORMAT GetFileType(string filename, int size);
|
|
|
|
|
|
|
|
|
/// <summary>
|
|
|
/// Orders FreeImage to analyze the bitmap signature.
|
|
|
/// Supports UNICODE filenames.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">Name of the file to analyze.</param>
|
|
|
/// <param name="size">Reserved parameter - use 0.</param>
|
|
|
/// <returns>Type of the bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Unicode, EntryPoint = "FreeImage_GetFileTypeU")]
|
|
|
private static extern FREE_IMAGE_FORMAT GetFileTypeU(string filename, int size);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Uses the <see cref="FreeImageIO"/> structure as described in the topic bitmap management functions
|
|
|
/// to identify a bitmap type.
|
|
|
/// </summary>
|
|
|
/// <param name="io">A <see cref="FreeImageIO"/> structure with functionpointers to handle the source.</param>
|
|
|
/// <param name="handle">A handle to the source.</param>
|
|
|
/// <param name="size">Size in bytes of the source.</param>
|
|
|
/// <returns>Type of the bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetFileTypeFromHandle")]
|
|
|
public static extern FREE_IMAGE_FORMAT GetFileTypeFromHandle(ref FreeImageIO io, fi_handle handle, int size);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Uses a memory handle to identify a bitmap type.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">Pointer to the stream.</param>
|
|
|
/// <param name="size">Size in bytes of the source.</param>
|
|
|
/// <returns>Type of the bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetFileTypeFromMemory")]
|
|
|
public static extern FREE_IMAGE_FORMAT GetFileTypeFromMemory(FIMEMORY stream, int size);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Helper functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns whether the platform is using Little Endian.
|
|
|
/// </summary>
|
|
|
/// <returns>Returns true if the platform is using Litte Endian, else false.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_IsLittleEndian")]
|
|
|
public static extern bool IsLittleEndian();
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a X11 color name into a corresponding RGB value.
|
|
|
/// </summary>
|
|
|
/// <param name="szColor">Name of the color to convert.</param>
|
|
|
/// <param name="nRed">Red component.</param>
|
|
|
/// <param name="nGreen">Green component.</param>
|
|
|
/// <param name="nBlue">Blue component.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Ansi, EntryPoint = "FreeImage_LookupX11Color")]
|
|
|
public static extern bool LookupX11Color(string szColor, out byte nRed, out byte nGreen, out byte nBlue);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a SVG color name into a corresponding RGB value.
|
|
|
/// </summary>
|
|
|
/// <param name="szColor">Name of the color to convert.</param>
|
|
|
/// <param name="nRed">Red component.</param>
|
|
|
/// <param name="nGreen">Green component.</param>
|
|
|
/// <param name="nBlue">Blue component.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Ansi, EntryPoint = "FreeImage_LookupSVGColor")]
|
|
|
public static extern bool LookupSVGColor(string szColor, out byte nRed, out byte nGreen, out byte nBlue);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Pixel access functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a pointer to the data-bits of the bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Pointer to the data-bits.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetBits")]
|
|
|
public static extern IntPtr GetBits(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a pointer to the start of the given scanline in the bitmap's data-bits.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="scanline">Number of the scanline.</param>
|
|
|
/// <returns>Pointer to the scanline.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetScanLine")]
|
|
|
public static extern IntPtr GetScanLine(FIBITMAP dib, int scanline);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Get the pixel index of a palettized image at position (x, y), including range check (slow access).
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="x">Pixel position in horizontal direction.</param>
|
|
|
/// <param name="y">Pixel position in vertical direction.</param>
|
|
|
/// <param name="value">The pixel index.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetPixelIndex")]
|
|
|
public static extern bool GetPixelIndex(FIBITMAP dib, uint x, uint y, out byte value);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Get the pixel color of a 16-, 24- or 32-bit image at position (x, y), including range check (slow access).
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="x">Pixel position in horizontal direction.</param>
|
|
|
/// <param name="y">Pixel position in vertical direction.</param>
|
|
|
/// <param name="value">The pixel color.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetPixelColor")]
|
|
|
public static extern bool GetPixelColor(FIBITMAP dib, uint x, uint y, out RGBQUAD value);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Set the pixel index of a palettized image at position (x, y), including range check (slow access).
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="x">Pixel position in horizontal direction.</param>
|
|
|
/// <param name="y">Pixel position in vertical direction.</param>
|
|
|
/// <param name="value">The new pixel index.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SetPixelIndex")]
|
|
|
public static extern bool SetPixelIndex(FIBITMAP dib, uint x, uint y, ref byte value);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Set the pixel color of a 16-, 24- or 32-bit image at position (x, y), including range check (slow access).
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="x">Pixel position in horizontal direction.</param>
|
|
|
/// <param name="y">Pixel position in vertical direction.</param>
|
|
|
/// <param name="value">The new pixel color.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SetPixelColor")]
|
|
|
public static extern bool SetPixelColor(FIBITMAP dib, uint x, uint y, ref RGBQUAD value);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Bitmap information functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the type of the bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Type of the bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetImageType")]
|
|
|
public static extern FREE_IMAGE_TYPE GetImageType(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the number of colors used in a bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Palette-size for palletised bitmaps, and 0 for high-colour bitmaps.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetColorsUsed")]
|
|
|
public static extern uint GetColorsUsed(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the size of one pixel in the bitmap in bits.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Size of one pixel in the bitmap in bits.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetBPP")]
|
|
|
public static extern uint GetBPP(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the width of the bitmap in pixel units.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>With of the bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetWidth")]
|
|
|
public static extern uint GetWidth(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the height of the bitmap in pixel units.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Height of the bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetHeight")]
|
|
|
public static extern uint GetHeight(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the width of the bitmap in bytes.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>With of the bitmap in bytes.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetLine")]
|
|
|
public static extern uint GetLine(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the width of the bitmap in bytes, rounded to the next 32-bit boundary,
|
|
|
/// also known as pitch or stride or scan width.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>With of the bitmap in bytes.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetPitch")]
|
|
|
public static extern uint GetPitch(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the size of the DIB-element of a FIBITMAP in memory.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Size of the DIB-element</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetDIBSize")]
|
|
|
public static extern uint GetDIBSize(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a pointer to the bitmap's palette.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Pointer to the bitmap's palette.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetPalette")]
|
|
|
public static extern IntPtr GetPalette(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the horizontal resolution, in pixels-per-meter, of the target device for the bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>The horizontal resolution, in pixels-per-meter.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetDotsPerMeterX")]
|
|
|
public static extern uint GetDotsPerMeterX(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the vertical resolution, in pixels-per-meter, of the target device for the bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>The vertical resolution, in pixels-per-meter.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetDotsPerMeterY")]
|
|
|
public static extern uint GetDotsPerMeterY(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Set the horizontal resolution, in pixels-per-meter, of the target device for the bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="res">The new horizontal resolution.</param>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SetDotsPerMeterX")]
|
|
|
public static extern void SetDotsPerMeterX(FIBITMAP dib, uint res);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Set the vertical resolution, in pixels-per-meter, of the target device for the bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="res">The new vertical resolution.</param>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SetDotsPerMeterY")]
|
|
|
public static extern void SetDotsPerMeterY(FIBITMAP dib, uint res);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a pointer to the <see cref="BITMAPINFOHEADER"/> of the DIB-element in a FIBITMAP.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Poiter to the header of the bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetInfoHeader")]
|
|
|
public static extern IntPtr GetInfoHeader(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Alias for FreeImage_GetInfoHeader that returns a pointer to a <see cref="BITMAPINFO"/>
|
|
|
/// rather than to a <see cref="BITMAPINFOHEADER"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Pointer to the <see cref="BITMAPINFO"/> structure for the bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetInfo")]
|
|
|
public static extern IntPtr GetInfo(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Investigates the color type of the bitmap by reading the bitmap's pixel bits and analysing them.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>The color type of the bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetColorType")]
|
|
|
public static extern FREE_IMAGE_COLOR_TYPE GetColorType(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a bit pattern describing the red color component of a pixel in a FreeImage bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>The bit pattern for RED.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetRedMask")]
|
|
|
public static extern uint GetRedMask(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a bit pattern describing the green color component of a pixel in a FreeImage bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>The bit pattern for green.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetGreenMask")]
|
|
|
public static extern uint GetGreenMask(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a bit pattern describing the blue color component of a pixel in a FreeImage bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>The bit pattern for blue.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetBlueMask")]
|
|
|
public static extern uint GetBlueMask(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the number of transparent colors in a palletised bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>The number of transparent colors in a palletised bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetTransparencyCount")]
|
|
|
public static extern uint GetTransparencyCount(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a pointer to the bitmap's transparency table.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Pointer to the bitmap's transparency table.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetTransparencyTable")]
|
|
|
public static extern IntPtr GetTransparencyTable(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tells FreeImage if it should make use of the transparency table
|
|
|
/// or the alpha channel that may accompany a bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="enabled">True to enable the transparency, false to disable.</param>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SetTransparent")]
|
|
|
public static extern void SetTransparent(FIBITMAP dib, bool enabled);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Set the bitmap's transparency table. Only affects palletised bitmaps.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="table">Pointer to the bitmap's new transparency table.</param>
|
|
|
/// <param name="count">The number of transparent colors in the new transparency table.</param>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SetTransparencyTable")]
|
|
|
internal static extern void SetTransparencyTable(FIBITMAP dib, byte[] table, int count);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns whether the transparency table is enabled.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Returns true when the transparency table is enabled (1-, 4- or 8-bit images)
|
|
|
/// or when the input dib contains alpha values (32-bit images). Returns false otherwise.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_IsTransparent")]
|
|
|
public static extern bool IsTransparent(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns whether the bitmap has a file background color.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Returns true when the image has a file background color, false otherwise.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_HasBackgroundColor")]
|
|
|
public static extern bool HasBackgroundColor(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the file background color of an image.
|
|
|
/// For 8-bit images, the color index in the palette is returned in the
|
|
|
/// rgbReserved member of the bkcolor parameter.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="bkcolor">The background color.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetBackgroundColor")]
|
|
|
public static extern bool GetBackgroundColor(FIBITMAP dib, out RGBQUAD bkcolor);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Set the file background color of an image.
|
|
|
/// When saving an image to PNG, this background color is transparently saved to the PNG file.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="bkcolor">The new background color.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SetBackgroundColor")]
|
|
|
public static unsafe extern bool SetBackgroundColor(FIBITMAP dib, ref RGBQUAD bkcolor);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Set the file background color of an image.
|
|
|
/// When saving an image to PNG, this background color is transparently saved to the PNG file.
|
|
|
/// When the bkcolor parameter is null, the background color is removed from the image.
|
|
|
/// <para>
|
|
|
/// This overloaded version of the function with an array parameter is provided to allow
|
|
|
/// passing <c>null</c> in the <paramref name="bkcolor"/> parameter. This is similar to the
|
|
|
/// original C/C++ function. Passing <c>null</c> as <paramref name="bkcolor"/> parameter will
|
|
|
/// unset the dib's previously set background color.
|
|
|
/// </para>
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="bkcolor">The new background color.
|
|
|
/// The first entry in the array is used.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <example>
|
|
|
/// <code>
|
|
|
/// // create a RGBQUAD color
|
|
|
/// RGBQUAD color = new RGBQUAD(Color.Green);
|
|
|
///
|
|
|
/// // set the dib's background color (using the other version of the function)
|
|
|
/// FreeImage.SetBackgroundColor(dib, ref color);
|
|
|
///
|
|
|
/// // remove it again (this only works due to the array parameter RGBQUAD[])
|
|
|
/// FreeImage.SetBackgroundColor(dib, null);
|
|
|
/// </code>
|
|
|
/// </example>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SetBackgroundColor")]
|
|
|
public static unsafe extern bool SetBackgroundColor(FIBITMAP dib, RGBQUAD[] bkcolor);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the index of the palette entry to be used as transparent color
|
|
|
/// for the image specified. Does nothing on high color images.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="index">The index of the palette entry to be set as transparent color.</param>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SetTransparentIndex")]
|
|
|
public static extern void SetTransparentIndex(FIBITMAP dib, int index);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the palette entry used as transparent color for the image specified.
|
|
|
/// Works for palletised images only and returns -1 for high color
|
|
|
/// images or if the image has no color set to be transparent.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>the index of the palette entry used as transparent color for
|
|
|
/// the image specified or -1 if there is no transparent color found
|
|
|
/// (e.g. the image is a high color image).</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetTransparentIndex")]
|
|
|
public static extern int GetTransparentIndex(FIBITMAP dib);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region ICC profile functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the <see cref="FIICCPROFILE"/> data of the bitmap.
|
|
|
/// This function can also be called safely, when the original format does not support profiles.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>The <see cref="FIICCPROFILE"/> data of the bitmap.</returns>
|
|
|
public static FIICCPROFILE GetICCProfileEx(FIBITMAP dib) { unsafe { return *(FIICCPROFILE*)FreeImage.GetICCProfile(dib); } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves a pointer to the <see cref="FIICCPROFILE"/> data of the bitmap.
|
|
|
/// This function can also be called safely, when the original format does not support profiles.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Pointer to the <see cref="FIICCPROFILE"/> data of the bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetICCProfile")]
|
|
|
public static extern IntPtr GetICCProfile(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a new <see cref="FIICCPROFILE"/> block from ICC profile data previously read from a file
|
|
|
/// or built by a color management system. The profile data is attached to the bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="data">Pointer to the new <see cref="FIICCPROFILE"/> data.</param>
|
|
|
/// <param name="size">Size of the <see cref="FIICCPROFILE"/> data.</param>
|
|
|
/// <returns>Pointer to the created <see cref="FIICCPROFILE"/> structure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_CreateICCProfile")]
|
|
|
public static extern IntPtr CreateICCProfile(FIBITMAP dib, byte[] data, int size);
|
|
|
|
|
|
/// <summary>
|
|
|
/// This function destroys an <see cref="FIICCPROFILE"/> previously created by <see cref="CreateICCProfile(FIBITMAP,byte[],int)"/>.
|
|
|
/// After this call the bitmap will contain no profile information.
|
|
|
/// This function should be called to ensure that a stored bitmap will not contain any profile information.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_DestroyICCProfile")]
|
|
|
public static extern void DestroyICCProfile(FIBITMAP dib);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Conversion functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a bitmap to 4 bits.
|
|
|
/// If the bitmap was a high-color bitmap (16, 24 or 32-bit) or if it was a
|
|
|
/// monochrome or greyscale bitmap (1 or 8-bit), the end result will be a
|
|
|
/// greyscale bitmap, otherwise (1-bit palletised bitmaps) it will be a palletised bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ConvertTo4Bits")]
|
|
|
public static extern FIBITMAP ConvertTo4Bits(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a bitmap to 8 bits. If the bitmap was a high-color bitmap (16, 24 or 32-bit)
|
|
|
/// or if it was a monochrome or greyscale bitmap (1 or 4-bit), the end result will be a
|
|
|
/// greyscale bitmap, otherwise (1 or 4-bit palletised bitmaps) it will be a palletised bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ConvertTo8Bits")]
|
|
|
public static extern FIBITMAP ConvertTo8Bits(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a bitmap to a 8-bit greyscale image with a linear ramp.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ConvertToGreyscale")]
|
|
|
public static extern FIBITMAP ConvertToGreyscale(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a bitmap to 16 bits, where each pixel has a color pattern of
|
|
|
/// 5 bits red, 5 bits green and 5 bits blue. One bit in each pixel is unused.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ConvertTo16Bits555")]
|
|
|
public static extern FIBITMAP ConvertTo16Bits555(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a bitmap to 16 bits, where each pixel has a color pattern of
|
|
|
/// 5 bits red, 6 bits green and 5 bits blue.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ConvertTo16Bits565")]
|
|
|
public static extern FIBITMAP ConvertTo16Bits565(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a bitmap to 24 bits. A clone of the input bitmap is returned for 24-bit bitmaps.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ConvertTo24Bits")]
|
|
|
public static extern FIBITMAP ConvertTo24Bits(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a bitmap to 32 bits. A clone of the input bitmap is returned for 32-bit bitmaps.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ConvertTo32Bits")]
|
|
|
public static extern FIBITMAP ConvertTo32Bits(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Quantizes a high-color 24-bit bitmap to an 8-bit palette color bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="quantize">Specifies the color reduction algorithm to be used.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ColorQuantize")]
|
|
|
public static extern FIBITMAP ColorQuantize(FIBITMAP dib, FREE_IMAGE_QUANTIZE quantize);
|
|
|
|
|
|
/// <summary>
|
|
|
/// ColorQuantizeEx is an extension to the <see cref="ColorQuantize(FIBITMAP, FREE_IMAGE_QUANTIZE)"/> method that
|
|
|
/// provides additional options used to quantize a 24-bit image to any
|
|
|
/// number of colors (up to 256), as well as quantize a 24-bit image using a
|
|
|
/// partial or full provided palette.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="quantize">Specifies the color reduction algorithm to be used.</param>
|
|
|
/// <param name="PaletteSize">Size of the desired output palette.</param>
|
|
|
/// <param name="ReserveSize">Size of the provided palette of ReservePalette.</param>
|
|
|
/// <param name="ReservePalette">The provided palette.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ColorQuantizeEx")]
|
|
|
public static extern FIBITMAP ColorQuantizeEx(FIBITMAP dib, FREE_IMAGE_QUANTIZE quantize, int PaletteSize, int ReserveSize, RGBQUAD[] ReservePalette);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a bitmap to 1-bit monochrome bitmap using a threshold T between [0..255].
|
|
|
/// The function first converts the bitmap to a 8-bit greyscale bitmap.
|
|
|
/// Then, any brightness level that is less than T is set to zero, otherwise to 1.
|
|
|
/// For 1-bit input bitmaps, the function clones the input bitmap and builds a monochrome palette.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="t">The threshold.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_Threshold")]
|
|
|
public static extern FIBITMAP Threshold(FIBITMAP dib, byte t);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a bitmap to 1-bit monochrome bitmap using a dithering algorithm.
|
|
|
/// For 1-bit input bitmaps, the function clones the input bitmap and builds a monochrome palette.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="algorithm">The dithering algorithm to use.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_Dither")]
|
|
|
public static extern FIBITMAP Dither(FIBITMAP dib, FREE_IMAGE_DITHER algorithm);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a raw bitmap to a FreeImage bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="bits">Pointer to the memory block containing the raw bitmap.</param>
|
|
|
/// <param name="width">The width in pixels of the raw bitmap.</param>
|
|
|
/// <param name="height">The height in pixels of the raw bitmap.</param>
|
|
|
/// <param name="pitch">Defines the total width of a scanline in the raw bitmap,
|
|
|
/// including padding bytes.</param>
|
|
|
/// <param name="bpp">The bit depth (bits per pixel) of the raw bitmap.</param>
|
|
|
/// <param name="red_mask">The bit mask describing the bits used to store a single
|
|
|
/// pixel's red component in the raw bitmap. This is only applied to 16-bpp raw bitmaps.</param>
|
|
|
/// <param name="green_mask">The bit mask describing the bits used to store a single
|
|
|
/// pixel's green component in the raw bitmap. This is only applied to 16-bpp raw bitmaps.</param>
|
|
|
/// <param name="blue_mask">The bit mask describing the bits used to store a single
|
|
|
/// pixel's blue component in the raw bitmap. This is only applied to 16-bpp raw bitmaps.</param>
|
|
|
/// <param name="topdown">If true, the raw bitmap is stored in top-down order (top-left pixel first)
|
|
|
/// and in bottom-up order (bottom-left pixel first) otherwise.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ConvertFromRawBits")]
|
|
|
public static extern FIBITMAP ConvertFromRawBits(IntPtr bits, int width, int height, int pitch,
|
|
|
uint bpp, uint red_mask, uint green_mask, uint blue_mask, bool topdown);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a raw bitmap to a FreeImage bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="bits">Array of bytes containing the raw bitmap.</param>
|
|
|
/// <param name="width">The width in pixels of the raw bitmap.</param>
|
|
|
/// <param name="height">The height in pixels of the raw bitmap.</param>
|
|
|
/// <param name="pitch">Defines the total width of a scanline in the raw bitmap,
|
|
|
/// including padding bytes.</param>
|
|
|
/// <param name="bpp">The bit depth (bits per pixel) of the raw bitmap.</param>
|
|
|
/// <param name="red_mask">The bit mask describing the bits used to store a single
|
|
|
/// pixel's red component in the raw bitmap. This is only applied to 16-bpp raw bitmaps.</param>
|
|
|
/// <param name="green_mask">The bit mask describing the bits used to store a single
|
|
|
/// pixel's green component in the raw bitmap. This is only applied to 16-bpp raw bitmaps.</param>
|
|
|
/// <param name="blue_mask">The bit mask describing the bits used to store a single
|
|
|
/// pixel's blue component in the raw bitmap. This is only applied to 16-bpp raw bitmaps.</param>
|
|
|
/// <param name="topdown">If true, the raw bitmap is stored in top-down order (top-left pixel first)
|
|
|
/// and in bottom-up order (bottom-left pixel first) otherwise.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ConvertFromRawBits")]
|
|
|
public static extern FIBITMAP ConvertFromRawBits(byte[] bits, int width, int height, int pitch,
|
|
|
uint bpp, uint red_mask, uint green_mask, uint blue_mask, bool topdown);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a FreeImage bitmap to a raw bitmap, that is a raw piece of memory.
|
|
|
/// </summary>
|
|
|
/// <param name="bits">Pointer to the memory block receiving the raw bitmap.</param>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="pitch">The desired total width in bytes of a scanline in the raw bitmap,
|
|
|
/// including any padding bytes.</param>
|
|
|
/// <param name="bpp">The desired bit depth (bits per pixel) of the raw bitmap.</param>
|
|
|
/// <param name="red_mask">The desired bit mask describing the bits used to store a single
|
|
|
/// pixel's red component in the raw bitmap. This is only applied to 16-bpp raw bitmaps.</param>
|
|
|
/// <param name="green_mask">The desired bit mask describing the bits used to store a single
|
|
|
/// pixel's green component in the raw bitmap. This is only applied to 16-bpp raw bitmaps.</param>
|
|
|
/// <param name="blue_mask">The desired bit mask describing the bits used to store a single
|
|
|
/// pixel's blue component in the raw bitmap. This is only applied to 16-bpp raw bitmaps.</param>
|
|
|
/// <param name="topdown">If true, the raw bitmap will be stored in top-down order (top-left pixel first)
|
|
|
/// and in bottom-up order (bottom-left pixel first) otherwise.</param>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ConvertToRawBits")]
|
|
|
public static extern void ConvertToRawBits(IntPtr bits, FIBITMAP dib, int pitch, uint bpp,
|
|
|
uint red_mask, uint green_mask, uint blue_mask, bool topdown);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a FreeImage bitmap to a raw bitmap, that is a raw piece of memory.
|
|
|
/// </summary>
|
|
|
/// <param name="bits">Array of bytes receiving the raw bitmap.</param>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="pitch">The desired total width in bytes of a scanline in the raw bitmap,
|
|
|
/// including any padding bytes.</param>
|
|
|
/// <param name="bpp">The desired bit depth (bits per pixel) of the raw bitmap.</param>
|
|
|
/// <param name="red_mask">The desired bit mask describing the bits used to store a single
|
|
|
/// pixel's red component in the raw bitmap. This is only applied to 16-bpp raw bitmaps.</param>
|
|
|
/// <param name="green_mask">The desired bit mask describing the bits used to store a single
|
|
|
/// pixel's green component in the raw bitmap. This is only applied to 16-bpp raw bitmaps.</param>
|
|
|
/// <param name="blue_mask">The desired bit mask describing the bits used to store a single
|
|
|
/// pixel's blue component in the raw bitmap. This is only applied to 16-bpp raw bitmaps.</param>
|
|
|
/// <param name="topdown">If true, the raw bitmap will be stored in top-down order (top-left pixel first)
|
|
|
/// and in bottom-up order (bottom-left pixel first) otherwise.</param>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ConvertToRawBits")]
|
|
|
public static extern void ConvertToRawBits(byte[] bits, FIBITMAP dib, int pitch, uint bpp,
|
|
|
uint red_mask, uint green_mask, uint blue_mask, bool topdown);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a 24- or 32-bit RGB(A) standard image or a 48-bit RGB image to a FIT_RGBF type image.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ConvertToRGBF")]
|
|
|
public static extern FIBITMAP ConvertToRGBF(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a non standard image whose color type is FIC_MINISBLACK
|
|
|
/// to a standard 8-bit greyscale image.
|
|
|
/// </summary>
|
|
|
/// <param name="src">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="scale_linear">When true the conversion is done by scaling linearly
|
|
|
/// each pixel value from [min, max] to an integer value between [0..255],
|
|
|
/// where min and max are the minimum and maximum pixel values in the image.
|
|
|
/// When false the conversion is done by rounding each pixel value to an integer between [0..255].
|
|
|
///
|
|
|
/// Rounding is done using the following formula:
|
|
|
///
|
|
|
/// dst_pixel = (BYTE) MIN(255, MAX(0, q)) where int q = int(src_pixel + 0.5);</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ConvertToStandardType")]
|
|
|
public static extern FIBITMAP ConvertToStandardType(FIBITMAP src, bool scale_linear);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts an image of any type to type dst_type.
|
|
|
/// </summary>
|
|
|
/// <param name="src">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="dst_type">Destination type.</param>
|
|
|
/// <param name="scale_linear">True to scale linear, else false.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ConvertToType")]
|
|
|
public static extern FIBITMAP ConvertToType(FIBITMAP src, FREE_IMAGE_TYPE dst_type, bool scale_linear);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Tone mapping operators
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a High Dynamic Range image (48-bit RGB or 96-bit RGBF) to a 24-bit RGB image, suitable for display.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="tmo">The tone mapping operator to be used.</param>
|
|
|
/// <param name="first_param">Parmeter depending on the used algorithm</param>
|
|
|
/// <param name="second_param">Parmeter depending on the used algorithm</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ToneMapping")]
|
|
|
public static extern FIBITMAP ToneMapping(FIBITMAP dib, FREE_IMAGE_TMO tmo, double first_param, double second_param);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a High Dynamic Range image to a 24-bit RGB image using a global
|
|
|
/// operator based on logarithmic compression of luminance values, imitating the human response to light.
|
|
|
/// </summary>
|
|
|
/// <param name="src">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="gamma">A gamma correction that is applied after the tone mapping.
|
|
|
/// A value of 1 means no correction.</param>
|
|
|
/// <param name="exposure">Scale factor allowing to adjust the brightness of the output image.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_TmoDrago03")]
|
|
|
public static extern FIBITMAP TmoDrago03(FIBITMAP src, double gamma, double exposure);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a High Dynamic Range image to a 24-bit RGB image using a global operator inspired
|
|
|
/// by photoreceptor physiology of the human visual system.
|
|
|
/// </summary>
|
|
|
/// <param name="src">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="intensity">Controls the overall image intensity in the range [-8, 8].</param>
|
|
|
/// <param name="contrast">Controls the overall image contrast in the range [0.3, 1.0[.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_TmoReinhard05")]
|
|
|
public static extern FIBITMAP TmoReinhard05(FIBITMAP src, double intensity, double contrast);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Apply the Gradient Domain High Dynamic Range Compression to a RGBF image and convert to 24-bit RGB.
|
|
|
/// </summary>
|
|
|
/// <param name="src">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="color_saturation">Color saturation (s parameter in the paper) in [0.4..0.6]</param>
|
|
|
/// <param name="attenuation">Atenuation factor (beta parameter in the paper) in [0.8..0.9]</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_TmoFattal02")]
|
|
|
public static extern FIBITMAP TmoFattal02(FIBITMAP src, double color_saturation, double attenuation);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Compression functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compresses a source buffer into a target buffer, using the ZLib library.
|
|
|
/// </summary>
|
|
|
/// <param name="target">Pointer to the target buffer.</param>
|
|
|
/// <param name="target_size">Size of the target buffer.
|
|
|
/// Must be at least 0.1% larger than source_size plus 12 bytes.</param>
|
|
|
/// <param name="source">Pointer to the source buffer.</param>
|
|
|
/// <param name="source_size">Size of the source buffer.</param>
|
|
|
/// <returns>The actual size of the compressed buffer, or 0 if an error occurred.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ZLibCompress")]
|
|
|
public static extern uint ZLibCompress(byte[] target, uint target_size, byte[] source, uint source_size);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Decompresses a source buffer into a target buffer, using the ZLib library.
|
|
|
/// </summary>
|
|
|
/// <param name="target">Pointer to the target buffer.</param>
|
|
|
/// <param name="target_size">Size of the target buffer.
|
|
|
/// Must have been saved outlide of zlib.</param>
|
|
|
/// <param name="source">Pointer to the source buffer.</param>
|
|
|
/// <param name="source_size">Size of the source buffer.</param>
|
|
|
/// <returns>The actual size of the uncompressed buffer, or 0 if an error occurred.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ZLibUncompress")]
|
|
|
public static extern uint ZLibUncompress(byte[] target, uint target_size, byte[] source, uint source_size);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compresses a source buffer into a target buffer, using the ZLib library.
|
|
|
/// </summary>
|
|
|
/// <param name="target">Pointer to the target buffer.</param>
|
|
|
/// <param name="target_size">Size of the target buffer.
|
|
|
/// Must be at least 0.1% larger than source_size plus 24 bytes.</param>
|
|
|
/// <param name="source">Pointer to the source buffer.</param>
|
|
|
/// <param name="source_size">Size of the source buffer.</param>
|
|
|
/// <returns>The actual size of the compressed buffer, or 0 if an error occurred.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ZLibGZip")]
|
|
|
public static extern uint ZLibGZip(byte[] target, uint target_size, byte[] source, uint source_size);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Decompresses a source buffer into a target buffer, using the ZLib library.
|
|
|
/// </summary>
|
|
|
/// <param name="target">Pointer to the target buffer.</param>
|
|
|
/// <param name="target_size">Size of the target buffer.
|
|
|
/// Must have been saved outlide of zlib.</param>
|
|
|
/// <param name="source">Pointer to the source buffer.</param>
|
|
|
/// <param name="source_size">Size of the source buffer.</param>
|
|
|
/// <returns>The actual size of the uncompressed buffer, or 0 if an error occurred.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ZLibGUnzip")]
|
|
|
public static extern uint ZLibGUnzip(byte[] target, uint target_size, byte[] source, uint source_size);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Generates a CRC32 checksum.
|
|
|
/// </summary>
|
|
|
/// <param name="crc">The CRC32 checksum to begin with.</param>
|
|
|
/// <param name="source">Pointer to the source buffer.
|
|
|
/// If the value is 0, the function returns the required initial value for the crc.</param>
|
|
|
/// <param name="source_size">Size of the source buffer.</param>
|
|
|
/// <returns></returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ZLibCRC32")]
|
|
|
public static extern uint ZLibCRC32(uint crc, byte[] source, uint source_size);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Tag creation and destruction
|
|
|
|
|
|
/// <summary>
|
|
|
/// Allocates a new <see cref="FITAG"/> object.
|
|
|
/// This object must be destroyed with a call to
|
|
|
/// <see cref="FreeImageAPI.FreeImage.DeleteTag(FITAG)"/> when no longer in use.
|
|
|
/// </summary>
|
|
|
/// <returns>The new <see cref="FITAG"/>.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_CreateTag")]
|
|
|
public static extern FITAG CreateTag();
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delete a previously allocated <see cref="FITAG"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The <see cref="FITAG"/> to destroy.</param>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_DeleteTag")]
|
|
|
public static extern void DeleteTag(FITAG tag);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates and returns a copy of a <see cref="FITAG"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The <see cref="FITAG"/> to clone.</param>
|
|
|
/// <returns>The new <see cref="FITAG"/>.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_CloneTag")]
|
|
|
public static extern FITAG CloneTag(FITAG tag);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Tag accessors
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the tag field name (unique inside a metadata model).
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag field.</param>
|
|
|
/// <returns>The field name.</returns>
|
|
|
public static unsafe string GetTagKey(FITAG tag) { return PtrToStr(GetTagKey_(tag)); }
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Ansi, EntryPoint = "FreeImage_GetTagKey")]
|
|
|
private static unsafe extern byte* GetTagKey_(FITAG tag);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the tag description.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag field.</param>
|
|
|
/// <returns>The description or NULL if unavailable.</returns>
|
|
|
public static unsafe string GetTagDescription(FITAG tag) { return PtrToStr(GetTagDescription_(tag)); }
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Ansi, EntryPoint = "FreeImage_GetTagDescription")]
|
|
|
private static unsafe extern byte* GetTagDescription_(FITAG tag);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the tag ID.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag field.</param>
|
|
|
/// <returns>The ID or 0 if unavailable.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetTagID")]
|
|
|
public static extern ushort GetTagID(FITAG tag);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the tag data type.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag field.</param>
|
|
|
/// <returns>The tag type.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetTagType")]
|
|
|
public static extern FREE_IMAGE_MDTYPE GetTagType(FITAG tag);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the number of components in the tag (in tag type units).
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag field.</param>
|
|
|
/// <returns>The number of components.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetTagCount")]
|
|
|
public static extern uint GetTagCount(FITAG tag);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the length of the tag value in bytes.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag field.</param>
|
|
|
/// <returns>The length of the tag value.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetTagLength")]
|
|
|
public static extern uint GetTagLength(FITAG tag);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the tag value.
|
|
|
/// It is up to the programmer to interpret the returned pointer correctly,
|
|
|
/// according to the results of GetTagType and GetTagCount.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag field.</param>
|
|
|
/// <returns>Pointer to the value.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetTagValue")]
|
|
|
public static extern IntPtr GetTagValue(FITAG tag);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the tag field name.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag field.</param>
|
|
|
/// <param name="key">The new name.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Ansi, EntryPoint = "FreeImage_SetTagKey")]
|
|
|
public static extern bool SetTagKey(FITAG tag, string key);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the tag description.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag field.</param>
|
|
|
/// <param name="description">The new description.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Ansi, EntryPoint = "FreeImage_SetTagDescription")]
|
|
|
public static extern bool SetTagDescription(FITAG tag, string description);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the tag ID.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag field.</param>
|
|
|
/// <param name="id">The new ID.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SetTagID")]
|
|
|
public static extern bool SetTagID(FITAG tag, ushort id);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the tag data type.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag field.</param>
|
|
|
/// <param name="type">The new type.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SetTagType")]
|
|
|
public static extern bool SetTagType(FITAG tag, FREE_IMAGE_MDTYPE type);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the number of data in the tag.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag field.</param>
|
|
|
/// <param name="count">New number of data.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SetTagCount")]
|
|
|
public static extern bool SetTagCount(FITAG tag, uint count);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the length of the tag value in bytes.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag field.</param>
|
|
|
/// <param name="length">The new length.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SetTagLength")]
|
|
|
public static extern bool SetTagLength(FITAG tag, uint length);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the tag value.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag field.</param>
|
|
|
/// <param name="value">Pointer to the new value.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SetTagValue")]
|
|
|
public static extern bool SetTagValue(FITAG tag, byte[] value);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Metadata iterator
|
|
|
|
|
|
/// <summary>
|
|
|
/// Provides information about the first instance of a tag that matches the metadata model.
|
|
|
/// </summary>
|
|
|
/// <param name="model">The model to match.</param>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="tag">Tag that matches the metadata model.</param>
|
|
|
/// <returns>Unique search handle that can be used to call FindNextMetadata or FindCloseMetadata.
|
|
|
/// Null if the metadata model does not exist.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_FindFirstMetadata")]
|
|
|
public static extern FIMETADATA FindFirstMetadata(FREE_IMAGE_MDMODEL model, FIBITMAP dib, out FITAG tag);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Find the next tag, if any, that matches the metadata model argument in a previous call
|
|
|
/// to FindFirstMetadata, and then alters the tag object contents accordingly.
|
|
|
/// </summary>
|
|
|
/// <param name="mdhandle">Unique search handle provided by FindFirstMetadata.</param>
|
|
|
/// <param name="tag">Tag that matches the metadata model.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_FindNextMetadata")]
|
|
|
public static extern bool FindNextMetadata(FIMETADATA mdhandle, out FITAG tag);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Closes the specified metadata search handle and releases associated resources.
|
|
|
/// </summary>
|
|
|
/// <param name="mdhandle">The handle to close.</param>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_FindCloseMetadata")]
|
|
|
private static extern void FindCloseMetadata_(FIMETADATA mdhandle);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Metadata setter and getter
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieve a metadata attached to a dib.
|
|
|
/// </summary>
|
|
|
/// <param name="model">The metadata model to look for.</param>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="key">The metadata field name.</param>
|
|
|
/// <param name="tag">A FITAG structure returned by the function.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Ansi, EntryPoint = "FreeImage_GetMetadata")]
|
|
|
public static extern bool GetMetadata(FREE_IMAGE_MDMODEL model, FIBITMAP dib, string key, out FITAG tag);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Attach a new FreeImage tag to a dib.
|
|
|
/// </summary>
|
|
|
/// <param name="model">The metadata model used to store the tag.</param>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="key">The tag field name.</param>
|
|
|
/// <param name="tag">The FreeImage tag to be attached.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Ansi, EntryPoint = "FreeImage_SetMetadata")]
|
|
|
public static extern bool SetMetadata(FREE_IMAGE_MDMODEL model, FIBITMAP dib, string key, FITAG tag);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Metadata helper functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the number of tags contained in the model metadata model attached to the input dib.
|
|
|
/// </summary>
|
|
|
/// <param name="model">The metadata model.</param>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Number of tags contained in the metadata model.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetMetadataCount")]
|
|
|
public static extern uint GetMetadataCount(FREE_IMAGE_MDMODEL model, FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies the metadata of FreeImage bitmap to another.
|
|
|
/// </summary>
|
|
|
/// <param name="dst">The FreeImage bitmap to copy the metadata to.</param>
|
|
|
/// <param name="src">The FreeImage bitmap to copy the metadata from.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_CloneMetadata")]
|
|
|
public static extern bool CloneMetadata(FIBITMAP dst, FIBITMAP src);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a FreeImage tag structure to a string that represents the interpreted tag value.
|
|
|
/// The function is not thread safe.
|
|
|
/// </summary>
|
|
|
/// <param name="model">The metadata model.</param>
|
|
|
/// <param name="tag">The interpreted tag value.</param>
|
|
|
/// <param name="Make">Reserved.</param>
|
|
|
/// <returns>The representing string.</returns>
|
|
|
public static unsafe string TagToString(FREE_IMAGE_MDMODEL model, FITAG tag, uint Make) { return PtrToStr(TagToString_(model, tag, Make)); }
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Ansi, EntryPoint = "FreeImage_TagToString")]
|
|
|
private static unsafe extern byte* TagToString_(FREE_IMAGE_MDMODEL model, FITAG tag, uint Make);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Rotation and flipping
|
|
|
|
|
|
/// <summary>
|
|
|
/// This function rotates a 1-, 8-bit greyscale or a 24-, 32-bit color image by means of 3 shears.
|
|
|
/// 1-bit images rotation is limited to integer multiple of 90<39>.
|
|
|
/// <c>null</c> is returned for other values.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="angle">The angle of rotation.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_RotateClassic")]
|
|
|
[Obsolete("RotateClassic is deprecated (use Rotate instead).")]
|
|
|
public static extern FIBITMAP RotateClassic(FIBITMAP dib, double angle);
|
|
|
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_Rotate")]
|
|
|
internal static extern FIBITMAP Rotate(FIBITMAP dib, double angle, IntPtr backgroundColor);
|
|
|
|
|
|
/// <summary>
|
|
|
/// This function performs a rotation and / or translation of an 8-bit greyscale,
|
|
|
/// 24- or 32-bit image, using a 3rd order (cubic) B-Spline.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="angle">The angle of rotation.</param>
|
|
|
/// <param name="x_shift">Horizontal image translation.</param>
|
|
|
/// <param name="y_shift">Vertical image translation.</param>
|
|
|
/// <param name="x_origin">Rotation center x-coordinate.</param>
|
|
|
/// <param name="y_origin">Rotation center y-coordinate.</param>
|
|
|
/// <param name="use_mask">When true the irrelevant part of the image is set to a black color,
|
|
|
/// otherwise, a mirroring technique is used to fill irrelevant pixels.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_RotateEx")]
|
|
|
public static extern FIBITMAP RotateEx(FIBITMAP dib, double angle,
|
|
|
double x_shift, double y_shift, double x_origin, double y_origin, bool use_mask);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Flip the input dib horizontally along the vertical axis.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_FlipHorizontal")]
|
|
|
public static extern bool FlipHorizontal(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Flip the input dib vertically along the horizontal axis.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_FlipVertical")]
|
|
|
public static extern bool FlipVertical(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Performs a lossless rotation or flipping on a JPEG file.
|
|
|
/// </summary>
|
|
|
/// <param name="src_file">Source file.</param>
|
|
|
/// <param name="dst_file">Destination file; can be the source file; will be overwritten.</param>
|
|
|
/// <param name="operation">The operation to apply.</param>
|
|
|
/// <param name="perfect">To avoid lossy transformation, you can set the perfect parameter to true.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Unicode, EntryPoint = "FreeImage_JPEGTransformU")]
|
|
|
public static extern bool JPEGTransform(string src_file, string dst_file,
|
|
|
FREE_IMAGE_JPEG_OPERATION operation, bool perfect);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Upsampling / downsampling
|
|
|
|
|
|
/// <summary>
|
|
|
/// Performs resampling (or scaling, zooming) of a greyscale or RGB(A) image
|
|
|
/// to the desired destination width and height.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="dst_width">Destination width.</param>
|
|
|
/// <param name="dst_height">Destination height.</param>
|
|
|
/// <param name="filter">The filter to apply.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_Rescale")]
|
|
|
public static extern FIBITMAP Rescale(FIBITMAP dib, int dst_width, int dst_height, FREE_IMAGE_FILTER filter);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a thumbnail from a greyscale or RGB(A) image, keeping aspect ratio.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="max_pixel_size">Thumbnail square size.</param>
|
|
|
/// <param name="convert">When true HDR images are transperantly converted to standard images.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_MakeThumbnail")]
|
|
|
public static extern FIBITMAP MakeThumbnail(FIBITMAP dib, int max_pixel_size, bool convert);
|
|
|
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_EnlargeCanvas")]
|
|
|
internal static extern FIBITMAP EnlargeCanvas(FIBITMAP dib,
|
|
|
int left, int top, int right, int bottom, IntPtr color, FREE_IMAGE_COLOR_OPTIONS options);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Color manipulation
|
|
|
|
|
|
/// <summary>
|
|
|
/// Perfoms an histogram transformation on a 8-, 24- or 32-bit image.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="lookUpTable">The lookup table.
|
|
|
/// It's size is assumed to be 256 in length.</param>
|
|
|
/// <param name="channel">The color channel to be transformed.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_AdjustCurve")]
|
|
|
public static extern bool AdjustCurve(FIBITMAP dib, byte[] lookUpTable, FREE_IMAGE_COLOR_CHANNEL channel);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Performs gamma correction on a 8-, 24- or 32-bit image.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="gamma">The parameter represents the gamma value to use (gamma > 0).
|
|
|
/// A value of 1.0 leaves the image alone, less than one darkens it, and greater than one lightens it.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_AdjustGamma")]
|
|
|
public static extern bool AdjustGamma(FIBITMAP dib, double gamma);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adjusts the brightness of a 8-, 24- or 32-bit image by a certain amount.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="percentage">A value 0 means no change,
|
|
|
/// less than 0 will make the image darker and greater than 0 will make the image brighter.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_AdjustBrightness")]
|
|
|
public static extern bool AdjustBrightness(FIBITMAP dib, double percentage);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adjusts the contrast of a 8-, 24- or 32-bit image by a certain amount.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="percentage">A value 0 means no change,
|
|
|
/// less than 0 will decrease the contrast and greater than 0 will increase the contrast of the image.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_AdjustContrast")]
|
|
|
public static extern bool AdjustContrast(FIBITMAP dib, double percentage);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Inverts each pixel data.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_Invert")]
|
|
|
public static extern bool Invert(FIBITMAP dib);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Computes the image histogram.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="histo">Array of integers with a size of 256.</param>
|
|
|
/// <param name="channel">Channel to compute from.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetHistogram")]
|
|
|
public static extern bool GetHistogram(FIBITMAP dib, int[] histo, FREE_IMAGE_COLOR_CHANNEL channel);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Channel processing
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the red, green, blue or alpha channel of a 24- or 32-bit image.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="channel">The color channel to extract.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetChannel")]
|
|
|
public static extern FIBITMAP GetChannel(FIBITMAP dib, FREE_IMAGE_COLOR_CHANNEL channel);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Insert a 8-bit dib into a 24- or 32-bit image.
|
|
|
/// Both images must have to same width and height.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="dib8">Handle to the bitmap to insert.</param>
|
|
|
/// <param name="channel">The color channel to replace.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SetChannel")]
|
|
|
public static extern bool SetChannel(FIBITMAP dib, FIBITMAP dib8, FREE_IMAGE_COLOR_CHANNEL channel);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the real part, imaginary part, magnitude or phase of a complex image.
|
|
|
/// </summary>
|
|
|
/// <param name="src">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="channel">The color channel to extract.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetComplexChannel")]
|
|
|
public static extern FIBITMAP GetComplexChannel(FIBITMAP src, FREE_IMAGE_COLOR_CHANNEL channel);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Set the real or imaginary part of a complex image.
|
|
|
/// Both images must have to same width and height.
|
|
|
/// </summary>
|
|
|
/// <param name="dst">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="src">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="channel">The color channel to replace.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SetComplexChannel")]
|
|
|
public static extern bool SetComplexChannel(FIBITMAP dst, FIBITMAP src, FREE_IMAGE_COLOR_CHANNEL channel);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Copy / Paste / Composite routines
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copy a sub part of the current dib image.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="left">Specifies the left position of the cropped rectangle.</param>
|
|
|
/// <param name="top">Specifies the top position of the cropped rectangle.</param>
|
|
|
/// <param name="right">Specifies the right position of the cropped rectangle.</param>
|
|
|
/// <param name="bottom">Specifies the bottom position of the cropped rectangle.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_Copy")]
|
|
|
public static extern FIBITMAP Copy(FIBITMAP dib, int left, int top, int right, int bottom);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Alpha blend or combine a sub part image with the current dib image.
|
|
|
/// The bit depth of the dst bitmap must be greater than or equal to the bit depth of the src.
|
|
|
/// </summary>
|
|
|
/// <param name="dst">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="src">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="left">Specifies the left position of the sub image.</param>
|
|
|
/// <param name="top">Specifies the top position of the sub image.</param>
|
|
|
/// <param name="alpha">alpha blend factor.
|
|
|
/// The source and destination images are alpha blended if alpha=0..255.
|
|
|
/// If alpha > 255, then the source image is combined to the destination image.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_Paste")]
|
|
|
public static extern bool Paste(FIBITMAP dst, FIBITMAP src, int left, int top, int alpha);
|
|
|
|
|
|
/// <summary>
|
|
|
/// This function composite a transparent foreground image against a single background color or
|
|
|
/// against a background image.
|
|
|
/// </summary>
|
|
|
/// <param name="fg">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="useFileBkg">When true the background of fg is used if it contains one.</param>
|
|
|
/// <param name="appBkColor">The application background is used if useFileBkg is false.</param>
|
|
|
/// <param name="bg">Image used as background when useFileBkg is false or fg has no background
|
|
|
/// and appBkColor is null.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_Composite")]
|
|
|
public static extern FIBITMAP Composite(FIBITMAP fg, bool useFileBkg, ref RGBQUAD appBkColor, FIBITMAP bg);
|
|
|
|
|
|
/// <summary>
|
|
|
/// This function composite a transparent foreground image against a single background color or
|
|
|
/// against a background image.
|
|
|
/// </summary>
|
|
|
/// <param name="fg">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="useFileBkg">When true the background of fg is used if it contains one.</param>
|
|
|
/// <param name="appBkColor">The application background is used if useFileBkg is false
|
|
|
/// and 'appBkColor' is not null.</param>
|
|
|
/// <param name="bg">Image used as background when useFileBkg is false or fg has no background
|
|
|
/// and appBkColor is null.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_Composite")]
|
|
|
public static extern FIBITMAP Composite(FIBITMAP fg, bool useFileBkg, RGBQUAD[] appBkColor, FIBITMAP bg);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Performs a lossless crop on a JPEG file.
|
|
|
/// </summary>
|
|
|
/// <param name="src_file">Source filename.</param>
|
|
|
/// <param name="dst_file">Destination filename.</param>
|
|
|
/// <param name="left">Specifies the left position of the cropped rectangle.</param>
|
|
|
/// <param name="top">Specifies the top position of the cropped rectangle.</param>
|
|
|
/// <param name="right">Specifies the right position of the cropped rectangle.</param>
|
|
|
/// <param name="bottom">Specifies the bottom position of the cropped rectangle.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, CharSet = CharSet.Unicode, EntryPoint = "FreeImage_JPEGCropU")]
|
|
|
public static extern bool JPEGCrop(string src_file, string dst_file, int left, int top, int right, int bottom);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Applies the alpha value of each pixel to its color components.
|
|
|
/// The aplha value stays unchanged.
|
|
|
/// Only works with 32-bits color depth.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_PreMultiplyWithAlpha")]
|
|
|
public static extern bool PreMultiplyWithAlpha(FIBITMAP dib);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Miscellaneous algorithms
|
|
|
|
|
|
/// <summary>
|
|
|
/// Solves a Poisson equation, remap result pixels to [0..1] and returns the solution.
|
|
|
/// </summary>
|
|
|
/// <param name="Laplacian">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="ncycle">Number of cycles in the multigrid algorithm (usually 2 or 3)</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_MultigridPoissonSolver")]
|
|
|
public static extern FIBITMAP MultigridPoissonSolver(FIBITMAP Laplacian, int ncycle);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Colors
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a lookup table to be used with <see cref="AdjustCurve"/> which may adjusts brightness and
|
|
|
/// contrast, correct gamma and invert the image with a single call to <see cref="AdjustCurve"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="lookUpTable">Output lookup table to be used with <see cref="AdjustCurve"/>.
|
|
|
/// The size of 'lookUpTable' is assumed to be 256.</param>
|
|
|
/// <param name="brightness">Percentage brightness value where -100 <= brightness <= 100.
|
|
|
/// <para>A value of 0 means no change, less than 0 will make the image darker and greater
|
|
|
/// than 0 will make the image brighter.</para></param>
|
|
|
/// <param name="contrast">Percentage contrast value where -100 <= contrast <= 100.
|
|
|
/// <para>A value of 0 means no change, less than 0 will decrease the contrast
|
|
|
/// and greater than 0 will increase the contrast of the image.</para></param>
|
|
|
/// <param name="gamma">Gamma value to be used for gamma correction.
|
|
|
/// <para>A value of 1.0 leaves the image alone, less than one darkens it,
|
|
|
/// and greater than one lightens it.</para></param>
|
|
|
/// <param name="invert">If set to true, the image will be inverted.</param>
|
|
|
/// <returns>The number of adjustments applied to the resulting lookup table
|
|
|
/// compared to a blind lookup table.</returns>
|
|
|
/// <remarks>
|
|
|
/// This function creates a lookup table to be used with <see cref="AdjustCurve"/> which may adjust
|
|
|
/// brightness and contrast, correct gamma and invert the image with a single call to
|
|
|
/// <see cref="AdjustCurve"/>. If more than one of these image display properties need to be adjusted,
|
|
|
/// using a combined lookup table should be preferred over calling each adjustment function
|
|
|
/// separately. That's particularly true for huge images or if performance is an issue. Then,
|
|
|
/// the expensive process of iterating over all pixels of an image is performed only once and
|
|
|
/// not up to four times.
|
|
|
/// <para/>
|
|
|
/// Furthermore, the lookup table created does not depend on the order, in which each single
|
|
|
/// adjustment operation is performed. Due to rounding and byte casting issues, it actually
|
|
|
/// matters in which order individual adjustment operations are performed. Both of the following
|
|
|
/// snippets most likely produce different results:
|
|
|
/// <para/>
|
|
|
/// <code>
|
|
|
/// // snippet 1: contrast, brightness
|
|
|
/// AdjustContrast(dib, 15.0);
|
|
|
/// AdjustBrightness(dib, 50.0);
|
|
|
/// </code>
|
|
|
/// <para/>
|
|
|
/// <code>
|
|
|
/// // snippet 2: brightness, contrast
|
|
|
/// AdjustBrightness(dib, 50.0);
|
|
|
/// AdjustContrast(dib, 15.0);
|
|
|
/// </code>
|
|
|
/// <para/>
|
|
|
/// Better and even faster would be snippet 3:
|
|
|
/// <para/>
|
|
|
/// <code>
|
|
|
/// // snippet 3:
|
|
|
/// byte[] lut = new byte[256];
|
|
|
/// GetAdjustColorsLookupTable(lut, 50.0, 15.0, 1.0, false);
|
|
|
/// AdjustCurve(dib, lut, FREE_IMAGE_COLOR_CHANNEL.FICC_RGB);
|
|
|
/// </code>
|
|
|
/// <para/>
|
|
|
/// This function is also used internally by <see cref="AdjustColors"/>, which does not return the
|
|
|
/// lookup table, but uses it to call <see cref="AdjustCurve"/> on the passed image.
|
|
|
/// </remarks>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_GetAdjustColorsLookupTable")]
|
|
|
public static extern int GetAdjustColorsLookupTable(byte[] lookUpTable, double brightness, double contrast, double gamma, bool invert);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adjusts an image's brightness, contrast and gamma as well as it may
|
|
|
/// optionally invert the image within a single operation.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="brightness">Percentage brightness value where -100 <= brightness <= 100.
|
|
|
/// <para>A value of 0 means no change, less than 0 will make the image darker and greater
|
|
|
/// than 0 will make the image brighter.</para></param>
|
|
|
/// <param name="contrast">Percentage contrast value where -100 <= contrast <= 100.
|
|
|
/// <para>A value of 0 means no change, less than 0 will decrease the contrast
|
|
|
/// and greater than 0 will increase the contrast of the image.</para></param>
|
|
|
/// <param name="gamma">Gamma value to be used for gamma correction.
|
|
|
/// <para>A value of 1.0 leaves the image alone, less than one darkens it,
|
|
|
/// and greater than one lightens it.</para>
|
|
|
/// This parameter must not be zero or smaller than zero.
|
|
|
/// If so, it will be ignored and no gamma correction will be performed on the image.</param>
|
|
|
/// <param name="invert">If set to true, the image will be inverted.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <remarks>
|
|
|
/// This function adjusts an image's brightness, contrast and gamma as well as it
|
|
|
/// may optionally invert the image within a single operation. If more than one of
|
|
|
/// these image display properties need to be adjusted, using this function should
|
|
|
/// be preferred over calling each adjustment function separately. That's particularly
|
|
|
/// true for huge images or if performance is an issue.
|
|
|
/// <para/>
|
|
|
/// This function relies on <see cref="GetAdjustColorsLookupTable"/>,
|
|
|
/// which creates a single lookup table, that combines all adjustment operations requested.
|
|
|
/// <para/>
|
|
|
/// Furthermore, the lookup table created by <see cref="GetAdjustColorsLookupTable"/> does
|
|
|
/// not depend on the order, in which each single adjustment operation is performed.
|
|
|
/// Due to rounding and byte casting issues, it actually matters in which order individual
|
|
|
/// adjustment operations are performed. Both of the following snippets most likely produce
|
|
|
/// different results:
|
|
|
/// <para/>
|
|
|
/// <code>
|
|
|
/// // snippet 1: contrast, brightness
|
|
|
/// AdjustContrast(dib, 15.0);
|
|
|
/// AdjustBrightness(dib, 50.0);
|
|
|
/// </code>
|
|
|
/// <para/>
|
|
|
/// <code>
|
|
|
/// // snippet 2: brightness, contrast
|
|
|
/// AdjustBrightness(dib, 50.0);
|
|
|
/// AdjustContrast(dib, 15.0);
|
|
|
/// </code>
|
|
|
/// <para/>
|
|
|
/// Better and even faster would be snippet 3:
|
|
|
/// <para/>
|
|
|
/// <code>
|
|
|
/// // snippet 3:
|
|
|
/// AdjustColors(dib, 50.0, 15.0, 1.0, false);
|
|
|
/// </code>
|
|
|
/// </remarks>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_AdjustColors")]
|
|
|
public static extern bool AdjustColors(FIBITMAP dib, double brightness, double contrast, double gamma, bool invert);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Applies color mapping for one or several colors on a 1-, 4- or 8-bit
|
|
|
/// palletized or a 16-, 24- or 32-bit high color image.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="srccolors">Array of colors to be used as the mapping source.</param>
|
|
|
/// <param name="dstcolors">Array of colors to be used as the mapping destination.</param>
|
|
|
/// <param name="count">The number of colors to be mapped. This is the size of both
|
|
|
/// srccolors and dstcolors.</param>
|
|
|
/// <param name="ignore_alpha">If true, 32-bit images and colors are treated as 24-bit.</param>
|
|
|
/// <param name="swap">If true, source and destination colors are swapped, that is,
|
|
|
/// each destination color is also mapped to the corresponding source color.</param>
|
|
|
/// <returns>The total number of pixels changed.</returns>
|
|
|
/// <remarks>
|
|
|
/// This function maps up to <paramref name="count"/> colors specified in
|
|
|
/// <paramref name="srccolors"/> to these specified in <paramref name="dstcolors"/>.
|
|
|
/// Thereby, color <i>srccolors[N]</i>, if found in the image, will be replaced by color
|
|
|
/// <i>dstcolors[N]</i>. If <paramref name="swap"/> is <b>true</b>, additionally all colors
|
|
|
/// specified in <paramref name="dstcolors"/> are also mapped to these specified
|
|
|
/// in <paramref name="srccolors"/>. For high color images, the actual image data will be
|
|
|
/// modified whereas, for palletized images only the palette will be changed.
|
|
|
/// <para/>
|
|
|
/// The function returns the number of pixels changed or zero, if no pixels were changed.
|
|
|
/// <para/>
|
|
|
/// Both arrays <paramref name="srccolors"/> and <paramref name="dstcolors"/> are assumed
|
|
|
/// not to hold less than <paramref name="count"/> colors.
|
|
|
/// <para/>
|
|
|
/// For 16-bit images, all colors specified are transparently converted to their
|
|
|
/// proper 16-bit representation (either in RGB555 or RGB565 format, which is determined
|
|
|
/// by the image's red- green- and blue-mask).
|
|
|
/// <para/>
|
|
|
/// <b>Note, that this behaviour is different from what <see cref="ApplyPaletteIndexMapping"/> does,
|
|
|
/// which modifies the actual image data on palletized images.</b>
|
|
|
/// </remarks>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ApplyColorMapping")]
|
|
|
public static extern uint ApplyColorMapping(FIBITMAP dib, RGBQUAD[] srccolors, RGBQUAD[] dstcolors, uint count, bool ignore_alpha, bool swap);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Swaps two specified colors on a 1-, 4- or 8-bit palletized
|
|
|
/// or a 16-, 24- or 32-bit high color image.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="color_a">One of the two colors to be swapped.</param>
|
|
|
/// <param name="color_b">The other of the two colors to be swapped.</param>
|
|
|
/// <param name="ignore_alpha">If true, 32-bit images and colors are treated as 24-bit.</param>
|
|
|
/// <returns>The total number of pixels changed.</returns>
|
|
|
/// <remarks>
|
|
|
/// This function swaps the two specified colors <paramref name="color_a"/> and
|
|
|
/// <paramref name="color_b"/> on a palletized or high color image.
|
|
|
/// For high color images, the actual image data will be modified whereas, for palletized
|
|
|
/// images only the palette will be changed.
|
|
|
/// <para/>
|
|
|
/// <b>Note, that this behaviour is different from what <see cref="SwapPaletteIndices"/> does,
|
|
|
/// which modifies the actual image data on palletized images.</b>
|
|
|
/// <para/>
|
|
|
/// This is just a thin wrapper for <see cref="ApplyColorMapping"/> and resolves to:
|
|
|
/// <para/>
|
|
|
/// <code>
|
|
|
/// return ApplyColorMapping(dib, color_a, color_b, 1, ignore_alpha, true);
|
|
|
/// </code>
|
|
|
/// </remarks>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SwapColors")]
|
|
|
public static extern uint SwapColors(FIBITMAP dib, ref RGBQUAD color_a, ref RGBQUAD color_b, bool ignore_alpha);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Applies palette index mapping for one or several indices
|
|
|
/// on a 1-, 4- or 8-bit palletized image.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="srcindices">Array of palette indices to be used as the mapping source.</param>
|
|
|
/// <param name="dstindices">Array of palette indices to be used as the mapping destination.</param>
|
|
|
/// <param name="count">The number of palette indices to be mapped. This is the size of both
|
|
|
/// srcindices and dstindices</param>
|
|
|
/// <param name="swap">If true, source and destination palette indices are swapped, that is,
|
|
|
/// each destination index is also mapped to the corresponding source index.</param>
|
|
|
/// <returns>The total number of pixels changed.</returns>
|
|
|
/// <remarks>
|
|
|
/// This function maps up to <paramref name="count"/> palette indices specified in
|
|
|
/// <paramref name="srcindices"/> to these specified in <paramref name="dstindices"/>.
|
|
|
/// Thereby, index <i>srcindices[N]</i>, if present in the image, will be replaced by index
|
|
|
/// <i>dstindices[N]</i>. If <paramref name="swap"/> is <b>true</b>, additionally all indices
|
|
|
/// specified in <paramref name="dstindices"/> are also mapped to these specified in
|
|
|
/// <paramref name="srcindices"/>.
|
|
|
/// <para/>
|
|
|
/// The function returns the number of pixels changed or zero, if no pixels were changed.
|
|
|
/// Both arrays <paramref name="srcindices"/> and <paramref name="dstindices"/> are assumed not to
|
|
|
/// hold less than <paramref name="count"/> indices.
|
|
|
/// <para/>
|
|
|
/// <b>Note, that this behaviour is different from what <see cref="ApplyColorMapping"/> does, which
|
|
|
/// modifies the actual image data on palletized images.</b>
|
|
|
/// </remarks>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_ApplyPaletteIndexMapping")]
|
|
|
public static extern uint ApplyPaletteIndexMapping(FIBITMAP dib, byte[] srcindices, byte[] dstindices, uint count, bool swap);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Swaps two specified palette indices on a 1-, 4- or 8-bit palletized image.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="index_a">One of the two palette indices to be swapped.</param>
|
|
|
/// <param name="index_b">The other of the two palette indices to be swapped.</param>
|
|
|
/// <returns>The total number of pixels changed.</returns>
|
|
|
/// <remarks>
|
|
|
/// This function swaps the two specified palette indices <i>index_a</i> and
|
|
|
/// <i>index_b</i> on a palletized image. Therefore, not the palette, but the
|
|
|
/// actual image data will be modified.
|
|
|
/// <para/>
|
|
|
/// <b>Note, that this behaviour is different from what <see cref="SwapColors"/> does on palletized images,
|
|
|
/// which only swaps the colors in the palette.</b>
|
|
|
/// <para/>
|
|
|
/// This is just a thin wrapper for <see cref="ApplyColorMapping"/> and resolves to:
|
|
|
/// <para/>
|
|
|
/// <code>
|
|
|
/// return ApplyPaletteIndexMapping(dib, index_a, index_b, 1, true);
|
|
|
/// </code>
|
|
|
/// </remarks>
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_SwapPaletteIndices")]
|
|
|
public static extern uint SwapPaletteIndices(FIBITMAP dib, ref byte index_a, ref byte index_b);
|
|
|
|
|
|
[DllImport(FreeImageLibrary, EntryPoint = "FreeImage_FillBackground")]
|
|
|
internal static extern bool FillBackground(FIBITMAP dib, IntPtr color, FREE_IMAGE_COLOR_OPTIONS options);
|
|
|
|
|
|
#endregion
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/////////////////////////////////////////////////////
|
|
|
// //
|
|
|
// Wrapper functions //
|
|
|
// //
|
|
|
/////////////////////////////////////////////////////
|
|
|
|
|
|
#region Structs
|
|
|
|
|
|
namespace FreeImageAPI.IO
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Wrapper for a custom handle.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The <b>fi_handle</b> of FreeImage in C++ is a simple pointer, but in .NET
|
|
|
/// it's not that simple. This wrapper uses fi_handle in two different ways.
|
|
|
///
|
|
|
/// We implement a new plugin and FreeImage gives us a handle (pointer) that
|
|
|
/// we can simply pass through to the given functions in a 'FreeImageIO'
|
|
|
/// structure.
|
|
|
/// But when we want to use LoadFromhandle or SaveToHandle we need
|
|
|
/// a fi_handle (that we receive again in our own functions).
|
|
|
/// This handle is for example a stream (see LoadFromStream / SaveToStream)
|
|
|
/// that we want to work with. To know which stream a read/write is meant for
|
|
|
/// we could use a hash value that the wrapper itself handles or we can
|
|
|
/// go the unmanaged way of using a handle.
|
|
|
/// Therefor we use a <see cref="GCHandle"/> to receive a unique pointer that we can
|
|
|
/// convert back into a .NET object.
|
|
|
/// When the <b>fi_handle</b> instance is no longer needed the instance must be disposed
|
|
|
/// by the creater manually! It is recommended to use the <c>using</c> statement to
|
|
|
/// be sure the instance is always disposed:
|
|
|
///
|
|
|
/// <code>
|
|
|
/// using (fi_handle handle = new fi_handle(object))
|
|
|
/// {
|
|
|
/// callSomeFunctions(handle);
|
|
|
/// }
|
|
|
/// </code>
|
|
|
///
|
|
|
/// What does that mean?
|
|
|
/// If we get a <b>fi_handle</b> from unmanaged code we get a pointer to unmanaged
|
|
|
/// memory that we do not have to care about, and just pass ist back to FreeImage.
|
|
|
/// If we have to create a handle our own we use the standard constructur
|
|
|
/// that fills the <see cref="IntPtr"/> with an pointer that represents the given object.
|
|
|
/// With calling <see cref="GetObject"/> the <see cref="IntPtr"/> is used to retrieve the original
|
|
|
/// object we passed through the constructor.
|
|
|
///
|
|
|
/// This way we can implement a <b>fi_handle</b> that works with managed an unmanaged
|
|
|
/// code.
|
|
|
/// </remarks>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential)]
|
|
|
public struct fi_handle : IComparable, IComparable<fi_handle>, IEquatable<fi_handle>, IDisposable
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The handle to wrap.
|
|
|
/// </summary>
|
|
|
public IntPtr handle;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance wrapping a managed object.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The object to wrap.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="obj"/> is null.</exception>
|
|
|
public fi_handle(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("obj");
|
|
|
}
|
|
|
GCHandle gch = GCHandle.Alloc(obj, GCHandleType.Normal);
|
|
|
handle = GCHandle.ToIntPtr(gch);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="fi_handle"/> structures are equivalent.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="fi_handle"/> that is to the left of the equality operator.</param>
|
|
|
/// <param name="right">The <see cref="fi_handle"/> that is to the right of the equality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="fi_handle"/> structures are equal; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(fi_handle left, fi_handle right)
|
|
|
{
|
|
|
return (left.handle == right.handle);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="fi_handle"/> structures are different.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="fi_handle"/> that is to the left of the inequality operator.</param>
|
|
|
/// <param name="right">The <see cref="fi_handle"/> that is to the right of the inequality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="fi_handle"/> structures are different; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(fi_handle left, fi_handle right)
|
|
|
{
|
|
|
return (left.handle != right.handle);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets whether the pointer is a null pointer.
|
|
|
/// </summary>
|
|
|
public bool IsNull
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return (handle == IntPtr.Zero);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the object assigned to the handle in case this instance
|
|
|
/// was created by managed code.
|
|
|
/// </summary>
|
|
|
/// <returns><see cref="Object"/> assigned to this handle or null on failure.</returns>
|
|
|
internal object GetObject()
|
|
|
{
|
|
|
object result = null;
|
|
|
if (handle != IntPtr.Zero)
|
|
|
{
|
|
|
try
|
|
|
{
|
|
|
result = GCHandle.FromIntPtr(handle).Target;
|
|
|
}
|
|
|
catch
|
|
|
{
|
|
|
}
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the numeric value of the <see cref="fi_handle"/> object
|
|
|
/// to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return handle.ToString();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="fi_handle"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="fi_handle"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return handle.GetHashCode();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified object is a <see cref="fi_handle"/> structure
|
|
|
/// and is equivalent to this <see cref="fi_handle"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The object to test.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="fi_handle"/> structure
|
|
|
/// equivalent to this <see cref="fi_handle"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return ((obj is fi_handle) && (this == ((fi_handle)obj)));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Indicates whether the current object is equal to another object of the same type.
|
|
|
/// </summary>
|
|
|
/// <param name="other">An object to compare with this object.</param>
|
|
|
/// <returns>True if the current object is equal to the other parameter; otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(fi_handle other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer indicating the lexical relationship between the two comparands.</returns>
|
|
|
/// <exception cref="ArgumentException"><paramref name="obj"/> is not a <see cref="fi_handle"/>.</exception>
|
|
|
public int CompareTo(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
if (!(obj is fi_handle))
|
|
|
{
|
|
|
throw new ArgumentException("obj");
|
|
|
}
|
|
|
return CompareTo((fi_handle)obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="fi_handle"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="fi_handle"/> to compare.</param>
|
|
|
/// <returns>A signed number indicating the relative values of this instance
|
|
|
/// and <paramref name="other"/>.</returns>
|
|
|
public int CompareTo(fi_handle other)
|
|
|
{
|
|
|
return handle.ToInt64().CompareTo(other.handle.ToInt64());
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Releases all resources used by the instance.
|
|
|
/// </summary>
|
|
|
public void Dispose()
|
|
|
{
|
|
|
if (this.handle != IntPtr.Zero)
|
|
|
{
|
|
|
try
|
|
|
{
|
|
|
GCHandle.FromIntPtr(handle).Free();
|
|
|
}
|
|
|
catch
|
|
|
{
|
|
|
}
|
|
|
finally
|
|
|
{
|
|
|
this.handle = IntPtr.Zero;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>FI1BIT</b> structure represents a single bit.
|
|
|
/// It's value can be <i>0</i> or <i>1</i>.
|
|
|
/// </summary>
|
|
|
[DebuggerDisplay("{value}"),
|
|
|
Serializable]
|
|
|
public struct FI1BIT
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Represents the largest possible value of <see cref="FI1BIT"/>. This field is constant.
|
|
|
/// </summary>
|
|
|
public const byte MaxValue = 0x01;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents the smallest possible value of <see cref="FI1BIT"/>. This field is constant.
|
|
|
/// </summary>
|
|
|
public const byte MinValue = 0x00;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The value of the structure.
|
|
|
/// </summary>
|
|
|
private byte value;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified value.
|
|
|
/// </summary>
|
|
|
/// <param name="value">The value to initialize with.</param>
|
|
|
private FI1BIT(byte value)
|
|
|
{
|
|
|
this.value = (byte)(value & MaxValue);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FI1BIT"/> structure to a <see cref="Byte"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FI1BIT"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FI1BIT"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator byte(FI1BIT value)
|
|
|
{
|
|
|
return value.value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="Byte"/> structure to a <see cref="FI1BIT"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="Byte"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FI1BIT"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FI1BIT(byte value)
|
|
|
{
|
|
|
return new FI1BIT(value);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the numeric value of the <see cref="FI1BIT"/> object
|
|
|
/// to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return value.ToString();
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>FI4BIT</b> structure represents the half of a <see cref="Byte"/>.
|
|
|
/// It's valuerange is between <i>0</i> and <i>15</i>.
|
|
|
/// </summary>
|
|
|
[DebuggerDisplay("{value}"),
|
|
|
Serializable]
|
|
|
public struct FI4BIT
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Represents the largest possible value of <see cref="FI4BIT"/>. This field is constant.
|
|
|
/// </summary>
|
|
|
public const byte MaxValue = 0x0F;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents the smallest possible value of <see cref="FI4BIT"/>. This field is constant.
|
|
|
/// </summary>
|
|
|
public const byte MinValue = 0x00;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The value of the structure.
|
|
|
/// </summary>
|
|
|
private byte value;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified value.
|
|
|
/// </summary>
|
|
|
/// <param name="value">The value to initialize with.</param>
|
|
|
private FI4BIT(byte value)
|
|
|
{
|
|
|
this.value = (byte)(value & MaxValue);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FI4BIT"/> structure to a <see cref="Byte"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FI4BIT"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FI4BIT"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator byte(FI4BIT value)
|
|
|
{
|
|
|
return value.value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="Byte"/> structure to a <see cref="FI4BIT"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="Byte"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FI4BIT"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FI4BIT(byte value)
|
|
|
{
|
|
|
return new FI4BIT(value);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the numeric value of the <see cref="FI4BIT"/> object
|
|
|
/// to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return value.ToString();
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>FI16RGB555</b> structure describes a color consisting of relative
|
|
|
/// intensities of red, green, blue and alpha value. Each single color
|
|
|
/// component consumes 5 bits and so, takes values in the range from 0 to 31.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <para>For easy integration of the underlying structure into the .NET framework,
|
|
|
/// the <b>FI16RGB555</b> structure implements implicit conversion operators to
|
|
|
/// convert the represented color to and from the <see cref="System.Drawing.Color"/>
|
|
|
/// type. This makes the <see cref="System.Drawing.Color"/> type a real replacement
|
|
|
/// for the <b>FI16RGB555</b> structure and my be used in all situations which require
|
|
|
/// an <b>FI16RGB555</b> type.
|
|
|
/// </para>
|
|
|
/// </remarks>
|
|
|
/// <example>
|
|
|
/// The following code example demonstrates the various conversions between the
|
|
|
/// <b>FI16RGB555</b> structure and the <see cref="System.Drawing.Color"/> structure.
|
|
|
/// <code>
|
|
|
/// FI16RGB555 fi16rgb;
|
|
|
/// // Initialize the structure using a native .NET Color structure.
|
|
|
/// fi16rgb = new FI16RGB555(Color.Indigo);
|
|
|
/// // Initialize the structure using the implicit operator.
|
|
|
/// fi16rgb = Color.DarkSeaGreen;
|
|
|
/// // Convert the FI16RGB555 instance into a native .NET Color
|
|
|
/// // using its implicit operator.
|
|
|
/// Color color = fi16rgb;
|
|
|
/// // Using the structure's Color property for converting it
|
|
|
/// // into a native .NET Color.
|
|
|
/// Color another = fi16rgb.Color;
|
|
|
/// </code>
|
|
|
/// </example>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential)]
|
|
|
public struct FI16RGB555 : IComparable, IComparable<FI16RGB555>, IEquatable<FI16RGB555>
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The value of the color.
|
|
|
/// </summary>
|
|
|
private ushort value;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified <see cref="System.Drawing.Color"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="color"><see cref="System.Drawing.Color"/> to initialize with.</param>
|
|
|
public FI16RGB555(Color color)
|
|
|
{
|
|
|
value = (ushort)(
|
|
|
(((color.R * 31) / 255) << FreeImage.FI16_555_RED_SHIFT) +
|
|
|
(((color.G * 31) / 255) << FreeImage.FI16_555_GREEN_SHIFT) +
|
|
|
(((color.B * 31) / 255) << FreeImage.FI16_555_BLUE_SHIFT));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FI16RGB555"/> structures are equivalent.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FI16RGB555"/> that is to the left of the equality operator.</param>
|
|
|
/// <param name="right">The <see cref="FI16RGB555"/> that is to the right of the equality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FI16RGB555"/> structures are equal; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(FI16RGB555 left, FI16RGB555 right)
|
|
|
{
|
|
|
return (left.value == right.value);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FI16RGB555"/> structures are different.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FI16RGB555"/> that is to the left of the inequality operator.</param>
|
|
|
/// <param name="right">The <see cref="FI16RGB555"/> that is to the right of the inequality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FI16RGB555"/> structures are different; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(FI16RGB555 left, FI16RGB555 right)
|
|
|
{
|
|
|
return (!(left == right));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="System.Drawing.Color"/> structure to a <see cref="FI16RGB555"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="System.Drawing.Color"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FI16RGB555"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FI16RGB555(Color value)
|
|
|
{
|
|
|
return new FI16RGB555(value);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FI16RGB555"/> structure to a <see cref="System.Drawing.Color"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FI16RGB555"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="System.Drawing.Color"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator Color(FI16RGB555 value)
|
|
|
{
|
|
|
return value.Color;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the <see cref="System.Drawing.Color"/> of the structure.
|
|
|
/// </summary>
|
|
|
public Color Color
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return Color.FromArgb(
|
|
|
((value & FreeImage.FI16_555_RED_MASK) >> FreeImage.FI16_555_RED_SHIFT) * 255 / 31,
|
|
|
((value & FreeImage.FI16_555_GREEN_MASK) >> FreeImage.FI16_555_GREEN_SHIFT) * 255 / 31,
|
|
|
((value & FreeImage.FI16_555_BLUE_MASK) >> FreeImage.FI16_555_BLUE_SHIFT) * 255 / 31);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
this.value = (ushort)(
|
|
|
(((value.R * 31) / 255) << FreeImage.FI16_555_RED_SHIFT) +
|
|
|
(((value.G * 31) / 255) << FreeImage.FI16_555_GREEN_SHIFT) +
|
|
|
(((value.B * 31) / 255) << FreeImage.FI16_555_BLUE_SHIFT));
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the red color component.
|
|
|
/// </summary>
|
|
|
public byte Red
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return (byte)(((value & FreeImage.FI16_555_RED_MASK) >> FreeImage.FI16_555_RED_SHIFT) * 255 / 31);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
this.value = (ushort)((this.value & (~FreeImage.FI16_555_RED_MASK)) | (((value * 31) / 255) << FreeImage.FI16_555_RED_SHIFT));
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the green color component.
|
|
|
/// </summary>
|
|
|
public byte Green
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return (byte)(((value & FreeImage.FI16_555_GREEN_MASK) >> FreeImage.FI16_555_GREEN_SHIFT) * 255 / 31);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
this.value = (ushort)((this.value & (~FreeImage.FI16_555_GREEN_MASK)) | (((value * 31) / 255) << FreeImage.FI16_555_GREEN_SHIFT));
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the blue color component.
|
|
|
/// </summary>
|
|
|
public byte Blue
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return (byte)(((value & FreeImage.FI16_555_BLUE_MASK) >> FreeImage.FI16_555_BLUE_SHIFT) * 255 / 31);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
this.value = (ushort)((this.value & (~FreeImage.FI16_555_BLUE_MASK)) | (((value * 31) / 255) << FreeImage.FI16_555_BLUE_SHIFT));
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer indicating the lexical relationship between the two comparands.</returns>
|
|
|
/// <exception cref="ArgumentException"><paramref name="obj"/> is not a <see cref="FI16RGB555"/>.</exception>
|
|
|
public int CompareTo(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
if (!(obj is FI16RGB555))
|
|
|
{
|
|
|
throw new ArgumentException("obj");
|
|
|
}
|
|
|
return CompareTo((FI16RGB555)obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="FI16RGB555"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FI16RGB555"/> to compare.</param>
|
|
|
/// <returns>A signed number indicating the relative values of this instance
|
|
|
/// and <paramref name="other"/>.</returns>
|
|
|
public int CompareTo(FI16RGB555 other)
|
|
|
{
|
|
|
return this.Color.ToArgb().CompareTo(other.Color.ToArgb());
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified object is a <see cref="FI16RGB555"/> structure
|
|
|
/// and is equivalent to this <see cref="FI16RGB555"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The object to test.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="FI16RGB555"/> structure
|
|
|
/// equivalent to this <see cref="FI16RGB555"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return base.Equals(obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified <see cref="FI16RGB555"/> structure is equivalent to this <see cref="FI16RGB555"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FI16RGB555"/> structure to compare to this instance.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="FI16RGB555"/> structure
|
|
|
/// equivalent to this <see cref="FI16RGB555"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(FI16RGB555 other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="FI16RGB555"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="FI16RGB555"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return base.GetHashCode();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the numeric value of the <see cref="FI16RGB555"/> object
|
|
|
/// to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return FreeImage.ColorToString(Color);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>FI16RGB565</b> structure describes a color consisting of relative
|
|
|
/// intensities of red, green, blue and alpha value. Each single color
|
|
|
/// component consumes 5 bits and so, takes values in the range from 0 to 31.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <para>For easy integration of the underlying structure into the .NET framework,
|
|
|
/// the <b>FI16RGB565</b> structure implements implicit conversion operators to
|
|
|
/// convert the represented color to and from the <see cref="System.Drawing.Color"/>
|
|
|
/// type. This makes the <see cref="System.Drawing.Color"/> type a real replacement
|
|
|
/// for the <b>FI16RGB565</b> structure and my be used in all situations which require
|
|
|
/// an <b>FI16RGB565</b> type.
|
|
|
/// </para>
|
|
|
/// </remarks>
|
|
|
/// <example>
|
|
|
/// The following code example demonstrates the various conversions between the
|
|
|
/// <b>FI16RGB565</b> structure and the <see cref="System.Drawing.Color"/> structure.
|
|
|
/// <code>
|
|
|
/// FI16RGB565 fi16rgb;
|
|
|
/// // Initialize the structure using a native .NET Color structure.
|
|
|
/// fi16rgb = new FI16RGB565(Color.Indigo);
|
|
|
/// // Initialize the structure using the implicit operator.
|
|
|
/// fi16rgb = Color.DarkSeaGreen;
|
|
|
/// // Convert the FI16RGB565 instance into a native .NET Color
|
|
|
/// // using its implicit operator.
|
|
|
/// Color color = fi16rgb;
|
|
|
/// // Using the structure's Color property for converting it
|
|
|
/// // into a native .NET Color.
|
|
|
/// Color another = fi16rgb.Color;
|
|
|
/// </code>
|
|
|
/// </example>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential)]
|
|
|
public struct FI16RGB565 : IComparable, IComparable<FI16RGB565>, IEquatable<FI16RGB565>
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The value of the color.
|
|
|
/// </summary>
|
|
|
private ushort value;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified <see cref="System.Drawing.Color"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="color"><see cref="System.Drawing.Color"/> to initialize with.</param>
|
|
|
public FI16RGB565(Color color)
|
|
|
{
|
|
|
value = (ushort)(
|
|
|
(((color.R * 31) / 255) << FreeImage.FI16_565_RED_SHIFT) +
|
|
|
(((color.G * 63) / 255) << FreeImage.FI16_565_GREEN_SHIFT) +
|
|
|
(((color.B * 31) / 255) << FreeImage.FI16_565_BLUE_SHIFT));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FI16RGB565"/> structures are equivalent.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FI16RGB565"/> that is to the left of the equality operator.</param>
|
|
|
/// <param name="right">The <see cref="FI16RGB565"/> that is to the right of the equality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FI16RGB565"/> structures are equal; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(FI16RGB565 left, FI16RGB565 right)
|
|
|
{
|
|
|
return (left.value == right.value);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="FI16RGB565"/> structures are different.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="FI16RGB565"/> that is to the left of the inequality operator.</param>
|
|
|
/// <param name="right">The <see cref="FI16RGB565"/> that is to the right of the inequality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="FI16RGB565"/> structures are different; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(FI16RGB565 left, FI16RGB565 right)
|
|
|
{
|
|
|
return (!(left == right));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="System.Drawing.Color"/> structure to a <see cref="FI16RGB565"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="System.Drawing.Color"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FI16RGB565"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FI16RGB565(Color value)
|
|
|
{
|
|
|
return new FI16RGB565(value);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FI16RGB565"/> structure to a <see cref="System.Drawing.Color"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FI16RGB565"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="System.Drawing.Color"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator Color(FI16RGB565 value)
|
|
|
{
|
|
|
return value.Color;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the <see cref="System.Drawing.Color"/> of the structure.
|
|
|
/// </summary>
|
|
|
public Color Color
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return Color.FromArgb(
|
|
|
((value & FreeImage.FI16_565_RED_MASK) >> FreeImage.FI16_565_RED_SHIFT) * 255 / 31,
|
|
|
((value & FreeImage.FI16_565_GREEN_MASK) >> FreeImage.FI16_565_GREEN_SHIFT) * 255 / 63,
|
|
|
((value & FreeImage.FI16_565_BLUE_MASK) >> FreeImage.FI16_565_BLUE_SHIFT) * 255 / 31);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
this.value = (ushort)(
|
|
|
(((value.R * 31) / 255) << FreeImage.FI16_565_RED_SHIFT) +
|
|
|
(((value.G * 63) / 255) << FreeImage.FI16_565_GREEN_SHIFT) +
|
|
|
(((value.B * 31) / 255) << FreeImage.FI16_565_BLUE_SHIFT));
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the red color component.
|
|
|
/// </summary>
|
|
|
public byte Red
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return (byte)(((value & FreeImage.FI16_565_RED_MASK) >> FreeImage.FI16_565_RED_SHIFT) * 255 / 31);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
this.value = (ushort)((this.value & (~FreeImage.FI16_565_RED_MASK)) | (((value * 31) / 255) << FreeImage.FI16_565_RED_SHIFT));
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the green color component.
|
|
|
/// </summary>
|
|
|
public byte Green
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return (byte)(((value & FreeImage.FI16_565_GREEN_MASK) >> FreeImage.FI16_565_GREEN_SHIFT) * 255 / 63);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
this.value = (ushort)((this.value & (~FreeImage.FI16_565_GREEN_MASK)) | (((value * 63) / 255) << FreeImage.FI16_565_GREEN_SHIFT));
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the blue color component.
|
|
|
/// </summary>
|
|
|
public byte Blue
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return (byte)(((value & FreeImage.FI16_565_BLUE_MASK) >> FreeImage.FI16_565_BLUE_SHIFT) * 255 / 31);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
this.value = (ushort)((this.value & (~FreeImage.FI16_565_BLUE_MASK)) | (((value * 31) / 255) << FreeImage.FI16_565_BLUE_SHIFT));
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer indicating the lexical relationship between the two comparands.</returns>
|
|
|
/// <exception cref="ArgumentException"><paramref name="obj"/> is not a <see cref="FI16RGB565"/>.</exception>
|
|
|
public int CompareTo(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
if (!(obj is FI16RGB565))
|
|
|
{
|
|
|
throw new ArgumentException("obj");
|
|
|
}
|
|
|
return CompareTo((FI16RGB565)obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="FI16RGB565"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FI16RGB565"/> to compare.</param>
|
|
|
/// <returns>A signed number indicating the relative values of this instance
|
|
|
/// and <paramref name="other"/>.</returns>
|
|
|
public int CompareTo(FI16RGB565 other)
|
|
|
{
|
|
|
return this.Color.ToArgb().CompareTo(other.Color.ToArgb());
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified object is a <see cref="FI16RGB565"/> structure
|
|
|
/// and is equivalent to this <see cref="FI16RGB565"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The object to test.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="FI16RGB565"/> structure
|
|
|
/// equivalent to this <see cref="FI16RGB565"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return base.Equals(obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified <see cref="FI16RGB565"/> structure is equivalent to this <see cref="FI16RGB565"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FI16RGB565"/> structure to compare to this instance.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="FI16RGB565"/> structure
|
|
|
/// equivalent to this <see cref="FI16RGB565"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(FI16RGB565 other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="FI16RGB565"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="FI16RGB565"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return base.GetHashCode();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the numeric value of the <see cref="FI16RGB565"/> object
|
|
|
/// to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return FreeImage.ColorToString(Color);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>FIRational</b> structure represents a fraction via two <see cref="Int32"/>
|
|
|
/// instances which are interpreted as numerator and denominator.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The structure tries to approximate the value of <see cref="FreeImageAPI.FIRational(decimal)"/>
|
|
|
/// when creating a new instance by using a better algorithm than FreeImage does.
|
|
|
/// <para/>
|
|
|
/// The structure implements the following operators:
|
|
|
/// +, -, ++, --, ==, != , >, >==, <, <== and ~ (which switches nominator and denomiator).
|
|
|
/// <para/>
|
|
|
/// The structure can be converted into all .NET standard types either implicit or
|
|
|
/// explicit.
|
|
|
/// </remarks>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential), ComVisible(true)]
|
|
|
public struct FIRational : IConvertible, IComparable, IFormattable, IComparable<FIRational>, IEquatable<FIRational>
|
|
|
{
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private int numerator;
|
|
|
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private int denominator;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents the largest possible value of <see cref="FIRational"/>. This field is constant.
|
|
|
/// </summary>
|
|
|
public static readonly FIRational MaxValue = new FIRational(Int32.MaxValue, 1);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents the smallest possible value of <see cref="FIRational"/>. This field is constant.
|
|
|
/// </summary>
|
|
|
public static readonly FIRational MinValue = new FIRational(Int32.MinValue, 1);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents the smallest positive <see cref="FIRational"/> value greater than zero. This field is constant.
|
|
|
/// </summary>
|
|
|
public static readonly FIRational Epsilon = new FIRational(1, Int32.MaxValue);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified parameters.
|
|
|
/// </summary>
|
|
|
/// <param name="n">The numerator.</param>
|
|
|
/// <param name="d">The denominator.</param>
|
|
|
public FIRational(int n, int d)
|
|
|
{
|
|
|
numerator = n;
|
|
|
denominator = d;
|
|
|
Normalize();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified parameters.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag to read the data from.</param>
|
|
|
public unsafe FIRational(FITAG tag)
|
|
|
{
|
|
|
switch (FreeImage.GetTagType(tag))
|
|
|
{
|
|
|
case FREE_IMAGE_MDTYPE.FIDT_SRATIONAL:
|
|
|
int* value = (int*)FreeImage.GetTagValue(tag);
|
|
|
numerator = (int)value[0];
|
|
|
denominator = (int)value[1];
|
|
|
Normalize();
|
|
|
return;
|
|
|
default:
|
|
|
throw new ArgumentException("tag");
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified parameters.
|
|
|
/// </summary>
|
|
|
/// <param name="value">The value to convert into a fraction.</param>
|
|
|
/// <exception cref="OverflowException">
|
|
|
/// <paramref name="value"/> cannot be converted into a fraction
|
|
|
/// represented by two integer values.</exception>
|
|
|
public FIRational(decimal value)
|
|
|
{
|
|
|
try
|
|
|
{
|
|
|
int sign = value < 0 ? -1 : 1;
|
|
|
value = Math.Abs(value);
|
|
|
try
|
|
|
{
|
|
|
int[] contFract = CreateContinuedFraction(value);
|
|
|
CreateFraction(contFract, out numerator, out denominator);
|
|
|
Normalize();
|
|
|
}
|
|
|
catch
|
|
|
{
|
|
|
numerator = 0;
|
|
|
denominator = 1;
|
|
|
}
|
|
|
if (Math.Abs(((decimal)numerator / (decimal)denominator) - value) > 0.0001m)
|
|
|
{
|
|
|
int maxDen = (Int32.MaxValue / (int)value) - 2;
|
|
|
maxDen = maxDen < 10000 ? maxDen : 10000;
|
|
|
ApproximateFraction(value, maxDen, out numerator, out denominator);
|
|
|
Normalize();
|
|
|
if (Math.Abs(((decimal)numerator / (decimal)denominator) - value) > 0.0001m)
|
|
|
{
|
|
|
throw new OverflowException("Unable to convert value into a fraction");
|
|
|
}
|
|
|
}
|
|
|
numerator *= sign;
|
|
|
Normalize();
|
|
|
}
|
|
|
catch (Exception ex)
|
|
|
{
|
|
|
throw new OverflowException("Unable to calculate fraction.", ex);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// The numerator of the fraction.
|
|
|
/// </summary>
|
|
|
public int Numerator
|
|
|
{
|
|
|
get { return numerator; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// The denominator of the fraction.
|
|
|
/// </summary>
|
|
|
public int Denominator
|
|
|
{
|
|
|
get { return denominator; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the truncated value of the fraction.
|
|
|
/// </summary>
|
|
|
/// <returns></returns>
|
|
|
public int Truncate()
|
|
|
{
|
|
|
return denominator > 0 ? (int)(numerator / denominator) : 0;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns whether the fraction is representing an integer value.
|
|
|
/// </summary>
|
|
|
public bool IsInteger
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return (denominator == 1 ||
|
|
|
(denominator != 0 && (numerator % denominator == 0)) ||
|
|
|
(denominator == 0 && numerator == 0));
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Calculated the greatest common divisor of 'a' and 'b'.
|
|
|
/// </summary>
|
|
|
private static long Gcd(long a, long b)
|
|
|
{
|
|
|
a = Math.Abs(a);
|
|
|
b = Math.Abs(b);
|
|
|
long r;
|
|
|
while (b > 0)
|
|
|
{
|
|
|
r = a % b;
|
|
|
a = b;
|
|
|
b = r;
|
|
|
}
|
|
|
return a;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Calculated the smallest common multiple of 'a' and 'b'.
|
|
|
/// </summary>
|
|
|
private static long Scm(int n, int m)
|
|
|
{
|
|
|
return Math.Abs((long)n * (long)m) / Gcd(n, m);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Normalizes the fraction.
|
|
|
/// </summary>
|
|
|
private void Normalize()
|
|
|
{
|
|
|
if (denominator == 0)
|
|
|
{
|
|
|
numerator = 0;
|
|
|
denominator = 1;
|
|
|
return;
|
|
|
}
|
|
|
|
|
|
if (numerator != 1 && denominator != 1)
|
|
|
{
|
|
|
int common = (int)Gcd(numerator, denominator);
|
|
|
if (common != 1 && common != 0)
|
|
|
{
|
|
|
numerator /= common;
|
|
|
denominator /= common;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
if (denominator < 0)
|
|
|
{
|
|
|
numerator *= -1;
|
|
|
denominator *= -1;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Normalizes a fraction.
|
|
|
/// </summary>
|
|
|
private static void Normalize(ref long numerator, ref long denominator)
|
|
|
{
|
|
|
if (denominator == 0)
|
|
|
{
|
|
|
numerator = 0;
|
|
|
denominator = 1;
|
|
|
}
|
|
|
else if (numerator != 1 && denominator != 1)
|
|
|
{
|
|
|
long common = Gcd(numerator, denominator);
|
|
|
if (common != 1)
|
|
|
{
|
|
|
numerator /= common;
|
|
|
denominator /= common;
|
|
|
}
|
|
|
}
|
|
|
if (denominator < 0)
|
|
|
{
|
|
|
numerator *= -1;
|
|
|
denominator *= -1;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the digits after the point.
|
|
|
/// </summary>
|
|
|
private static int GetDigits(decimal value)
|
|
|
{
|
|
|
int result = 0;
|
|
|
value -= decimal.Truncate(value);
|
|
|
while (value != 0)
|
|
|
{
|
|
|
value *= 10;
|
|
|
value -= decimal.Truncate(value);
|
|
|
result++;
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a continued fraction of a decimal value.
|
|
|
/// </summary>
|
|
|
private static int[] CreateContinuedFraction(decimal value)
|
|
|
{
|
|
|
int precision = GetDigits(value);
|
|
|
decimal epsilon = 0.0000001m;
|
|
|
List<int> list = new List<int>();
|
|
|
value = Math.Abs(value);
|
|
|
|
|
|
byte b = 0;
|
|
|
|
|
|
list.Add((int)value);
|
|
|
value -= ((int)value);
|
|
|
|
|
|
while (value != 0m)
|
|
|
{
|
|
|
if (++b == byte.MaxValue || value < epsilon)
|
|
|
{
|
|
|
break;
|
|
|
}
|
|
|
value = 1m / value;
|
|
|
if (Math.Abs((Math.Round(value, precision - 1) - value)) < epsilon)
|
|
|
{
|
|
|
value = Math.Round(value, precision - 1);
|
|
|
}
|
|
|
list.Add((int)value);
|
|
|
value -= ((int)value);
|
|
|
}
|
|
|
return list.ToArray();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a fraction from a continued fraction.
|
|
|
/// </summary>
|
|
|
private static void CreateFraction(int[] continuedFraction, out int numerator, out int denominator)
|
|
|
{
|
|
|
numerator = 1;
|
|
|
denominator = 0;
|
|
|
int temp;
|
|
|
|
|
|
for (int i = continuedFraction.Length - 1; i > -1; i--)
|
|
|
{
|
|
|
temp = numerator;
|
|
|
numerator = continuedFraction[i] * numerator + denominator;
|
|
|
denominator = temp;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tries 'brute force' to approximate <paramref name="value"/> with a fraction.
|
|
|
/// </summary>
|
|
|
private static void ApproximateFraction(decimal value, int maxDen, out int num, out int den)
|
|
|
{
|
|
|
num = 0;
|
|
|
den = 0;
|
|
|
decimal bestDifference = 1m;
|
|
|
decimal currentDifference = -1m;
|
|
|
int digits = GetDigits(value);
|
|
|
|
|
|
if (digits <= 9)
|
|
|
{
|
|
|
int mul = 1;
|
|
|
for (int i = 1; i <= digits; i++)
|
|
|
{
|
|
|
mul *= 10;
|
|
|
}
|
|
|
if (mul <= maxDen)
|
|
|
{
|
|
|
num = (int)(value * mul);
|
|
|
den = mul;
|
|
|
return;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
for (int i = 1; i <= maxDen; i++)
|
|
|
{
|
|
|
int numerator = (int)Math.Floor(value * (decimal)i + 0.5m);
|
|
|
currentDifference = Math.Abs(value - (decimal)numerator / (decimal)i);
|
|
|
if (currentDifference < bestDifference)
|
|
|
{
|
|
|
num = numerator;
|
|
|
den = i;
|
|
|
bestDifference = currentDifference;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the numeric value of the <see cref="FIRational"/> object
|
|
|
/// to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return ((IConvertible)this).ToDouble(null).ToString();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified object is a <see cref="FIRational"/> structure
|
|
|
/// and is equivalent to this <see cref="FIRational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The object to test.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="FIRational"/> structure
|
|
|
/// equivalent to this <see cref="FIRational"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return ((obj is FIRational) && (this == ((FIRational)obj)));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="FIRational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="FIRational"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return base.GetHashCode();
|
|
|
}
|
|
|
|
|
|
#region Operators
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static FIRational operator +(FIRational r1)
|
|
|
{
|
|
|
return r1;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static FIRational operator -(FIRational r1)
|
|
|
{
|
|
|
r1.numerator *= -1;
|
|
|
return r1;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the reciprocal value of this instance.
|
|
|
/// </summary>
|
|
|
public static FIRational operator ~(FIRational r1)
|
|
|
{
|
|
|
int temp = r1.denominator;
|
|
|
r1.denominator = r1.numerator;
|
|
|
r1.numerator = temp;
|
|
|
r1.Normalize();
|
|
|
return r1;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static FIRational operator ++(FIRational r1)
|
|
|
{
|
|
|
checked
|
|
|
{
|
|
|
r1.numerator += r1.denominator;
|
|
|
}
|
|
|
return r1;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static FIRational operator --(FIRational r1)
|
|
|
{
|
|
|
checked
|
|
|
{
|
|
|
r1.numerator -= r1.denominator;
|
|
|
}
|
|
|
return r1;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static FIRational operator +(FIRational r1, FIRational r2)
|
|
|
{
|
|
|
long numerator = 0;
|
|
|
long denominator = Scm(r1.denominator, r2.denominator);
|
|
|
numerator = (r1.numerator * (denominator / r1.denominator)) + (r2.numerator * (denominator / r2.denominator));
|
|
|
Normalize(ref numerator, ref denominator);
|
|
|
checked
|
|
|
{
|
|
|
return new FIRational((int)numerator, (int)denominator);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static FIRational operator -(FIRational r1, FIRational r2)
|
|
|
{
|
|
|
return r1 + (-r2);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static FIRational operator *(FIRational r1, FIRational r2)
|
|
|
{
|
|
|
long numerator = r1.numerator * r2.numerator;
|
|
|
long denominator = r1.denominator * r2.denominator;
|
|
|
Normalize(ref numerator, ref denominator);
|
|
|
checked
|
|
|
{
|
|
|
return new FIRational((int)numerator, (int)denominator);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static FIRational operator /(FIRational r1, FIRational r2)
|
|
|
{
|
|
|
int temp = r2.denominator;
|
|
|
r2.denominator = r2.numerator;
|
|
|
r2.numerator = temp;
|
|
|
return r1 * r2;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static FIRational operator %(FIRational r1, FIRational r2)
|
|
|
{
|
|
|
r2.Normalize();
|
|
|
if (Math.Abs(r2.numerator) < r2.denominator)
|
|
|
return new FIRational(0, 0);
|
|
|
int div = (int)(r1 / r2);
|
|
|
return r1 - (r2 * div);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static bool operator ==(FIRational r1, FIRational r2)
|
|
|
{
|
|
|
r1.Normalize();
|
|
|
r2.Normalize();
|
|
|
return (r1.numerator == r2.numerator) && (r1.denominator == r2.denominator);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static bool operator !=(FIRational r1, FIRational r2)
|
|
|
{
|
|
|
return !(r1 == r2);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static bool operator >(FIRational r1, FIRational r2)
|
|
|
{
|
|
|
long denominator = Scm(r1.denominator, r2.denominator);
|
|
|
return (r1.numerator * (denominator / r1.denominator)) > (r2.numerator * (denominator / r2.denominator));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static bool operator <(FIRational r1, FIRational r2)
|
|
|
{
|
|
|
long denominator = Scm(r1.denominator, r2.denominator);
|
|
|
return (r1.numerator * (denominator / r1.denominator)) < (r2.numerator * (denominator / r2.denominator));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static bool operator >=(FIRational r1, FIRational r2)
|
|
|
{
|
|
|
long denominator = Scm(r1.denominator, r2.denominator);
|
|
|
return (r1.numerator * (denominator / r1.denominator)) >= (r2.numerator * (denominator / r2.denominator));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static bool operator <=(FIRational r1, FIRational r2)
|
|
|
{
|
|
|
long denominator = Scm(r1.denominator, r2.denominator);
|
|
|
return (r1.numerator * (denominator / r1.denominator)) <= (r2.numerator * (denominator / r2.denominator));
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Conversions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIRational"/> structure to a <see cref="Boolean"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIRational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="Boolean"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator bool(FIRational value)
|
|
|
{
|
|
|
return (value.numerator != 0);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIRational"/> structure to a <see cref="Byte"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIRational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="Byte"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator byte(FIRational value)
|
|
|
{
|
|
|
return (byte)(double)value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIRational"/> structure to a <see cref="Char"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIRational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="Char"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator char(FIRational value)
|
|
|
{
|
|
|
return (char)(double)value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIRational"/> structure to a <see cref="Decimal"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIRational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="Decimal"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator decimal(FIRational value)
|
|
|
{
|
|
|
return value.denominator == 0 ? 0m : (decimal)value.numerator / (decimal)value.denominator;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIRational"/> structure to a <see cref="Double"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIRational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="Double"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator double(FIRational value)
|
|
|
{
|
|
|
return value.denominator == 0 ? 0d : (double)value.numerator / (double)value.denominator;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIRational"/> structure to an <see cref="Int16"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIRational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="Int16"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator short(FIRational value)
|
|
|
{
|
|
|
return (short)(double)value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIRational"/> structure to an <see cref="Int32"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIRational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="Int32"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator int(FIRational value)
|
|
|
{
|
|
|
return (int)(double)value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIRational"/> structure to an <see cref="Int64"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIRational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="Int64"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator long(FIRational value)
|
|
|
{
|
|
|
return (byte)(double)value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIRational"/> structure to a <see cref="Single"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIRational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="Single"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator float(FIRational value)
|
|
|
{
|
|
|
return value.denominator == 0 ? 0f : (float)value.numerator / (float)value.denominator;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIRational"/> structure to a <see cref="SByte"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIRational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="SByte"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator sbyte(FIRational value)
|
|
|
{
|
|
|
return (sbyte)(double)value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIRational"/> structure to an <see cref="UInt16"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIRational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="UInt16"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator ushort(FIRational value)
|
|
|
{
|
|
|
return (ushort)(double)value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIRational"/> structure to an <see cref="UInt32"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIRational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="UInt32"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator uint(FIRational value)
|
|
|
{
|
|
|
return (uint)(double)value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIRational"/> structure to an <see cref="UInt64"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIRational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="UInt64"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator ulong(FIRational value)
|
|
|
{
|
|
|
return (ulong)(double)value;
|
|
|
}
|
|
|
|
|
|
//
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="Boolean"/> structure to a <see cref="FIRational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="Boolean"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIRational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator FIRational(bool value)
|
|
|
{
|
|
|
return new FIRational(value ? 1 : 0, 1);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="Byte"/> structure to a <see cref="FIRational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="Byte"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIRational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FIRational(byte value)
|
|
|
{
|
|
|
return new FIRational(value, 1);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="Char"/> structure to a <see cref="FIRational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="Char"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIRational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FIRational(char value)
|
|
|
{
|
|
|
return new FIRational(value, 1);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="Decimal"/> structure to a <see cref="FIRational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="Decimal"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIRational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator FIRational(decimal value)
|
|
|
{
|
|
|
return new FIRational(value);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="Double"/> structure to a <see cref="FIRational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="Double"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIRational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator FIRational(double value)
|
|
|
{
|
|
|
return new FIRational((decimal)value);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of an <see cref="Int16"/> structure to a <see cref="FIRational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">An <see cref="Int16"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIRational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FIRational(short value)
|
|
|
{
|
|
|
return new FIRational(value, 1);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of an <see cref="Int32"/> structure to a <see cref="FIRational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">An <see cref="Int32"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIRational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FIRational(int value)
|
|
|
{
|
|
|
return new FIRational(value, 1);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of an <see cref="Int64"/> structure to a <see cref="FIRational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">An <see cref="Int64"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIRational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator FIRational(long value)
|
|
|
{
|
|
|
return new FIRational((int)value, 1);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="SByte"/> structure to a <see cref="FIRational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="SByte"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIRational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FIRational(sbyte value)
|
|
|
{
|
|
|
return new FIRational(value, 1);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="Single"/> structure to a <see cref="FIRational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="Single"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIRational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator FIRational(float value)
|
|
|
{
|
|
|
return new FIRational((decimal)value);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of an <see cref="UInt16"/> structure to a <see cref="FIRational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">An <see cref="UInt16"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIRational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FIRational(ushort value)
|
|
|
{
|
|
|
return new FIRational(value, 1);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of an <see cref="UInt32"/> structure to a <see cref="FIRational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">An <see cref="UInt32"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIRational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator FIRational(uint value)
|
|
|
{
|
|
|
return new FIRational((int)value, 1);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of an <see cref="UInt64"/> structure to a <see cref="FIRational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">An <see cref="UInt64"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIRational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator FIRational(ulong value)
|
|
|
{
|
|
|
return new FIRational((int)value, 1);
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region IConvertible Member
|
|
|
|
|
|
TypeCode IConvertible.GetTypeCode()
|
|
|
{
|
|
|
return TypeCode.Double;
|
|
|
}
|
|
|
|
|
|
bool IConvertible.ToBoolean(IFormatProvider provider)
|
|
|
{
|
|
|
return (bool)this;
|
|
|
}
|
|
|
|
|
|
byte IConvertible.ToByte(IFormatProvider provider)
|
|
|
{
|
|
|
return (byte)this;
|
|
|
}
|
|
|
|
|
|
char IConvertible.ToChar(IFormatProvider provider)
|
|
|
{
|
|
|
return (char)this;
|
|
|
}
|
|
|
|
|
|
DateTime IConvertible.ToDateTime(IFormatProvider provider)
|
|
|
{
|
|
|
return Convert.ToDateTime(((IConvertible)this).ToDouble(provider));
|
|
|
}
|
|
|
|
|
|
decimal IConvertible.ToDecimal(IFormatProvider provider)
|
|
|
{
|
|
|
return this;
|
|
|
}
|
|
|
|
|
|
double IConvertible.ToDouble(IFormatProvider provider)
|
|
|
{
|
|
|
return this;
|
|
|
}
|
|
|
|
|
|
short IConvertible.ToInt16(IFormatProvider provider)
|
|
|
{
|
|
|
return (short)this;
|
|
|
}
|
|
|
|
|
|
int IConvertible.ToInt32(IFormatProvider provider)
|
|
|
{
|
|
|
return (int)this;
|
|
|
}
|
|
|
|
|
|
long IConvertible.ToInt64(IFormatProvider provider)
|
|
|
{
|
|
|
return (long)this;
|
|
|
}
|
|
|
|
|
|
sbyte IConvertible.ToSByte(IFormatProvider provider)
|
|
|
{
|
|
|
return (sbyte)this;
|
|
|
}
|
|
|
|
|
|
float IConvertible.ToSingle(IFormatProvider provider)
|
|
|
{
|
|
|
return this;
|
|
|
}
|
|
|
|
|
|
string IConvertible.ToString(IFormatProvider provider)
|
|
|
{
|
|
|
return ToString(((double)this).ToString(), provider);
|
|
|
}
|
|
|
|
|
|
object IConvertible.ToType(Type conversionType, IFormatProvider provider)
|
|
|
{
|
|
|
return Convert.ChangeType(((IConvertible)this).ToDouble(provider), conversionType, provider);
|
|
|
}
|
|
|
|
|
|
ushort IConvertible.ToUInt16(IFormatProvider provider)
|
|
|
{
|
|
|
return (ushort)this;
|
|
|
}
|
|
|
|
|
|
uint IConvertible.ToUInt32(IFormatProvider provider)
|
|
|
{
|
|
|
return (uint)this;
|
|
|
}
|
|
|
|
|
|
ulong IConvertible.ToUInt64(IFormatProvider provider)
|
|
|
{
|
|
|
return (ulong)this;
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region IComparable Member
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer indicating the lexical relationship between the two comparands.</returns>
|
|
|
/// <exception cref="ArgumentException"><paramref name="obj"/> is not a <see cref="FIRational"/>.</exception>
|
|
|
public int CompareTo(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
if (!(obj is FIRational))
|
|
|
{
|
|
|
throw new ArgumentException();
|
|
|
}
|
|
|
return CompareTo((FIRational)obj);
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region IFormattable Member
|
|
|
|
|
|
/// <summary>
|
|
|
/// Formats the value of the current instance using the specified format.
|
|
|
/// </summary>
|
|
|
/// <param name="format">The String specifying the format to use.</param>
|
|
|
/// <param name="formatProvider">The IFormatProvider to use to format the value.</param>
|
|
|
/// <returns>A String containing the value of the current instance in the specified format.</returns>
|
|
|
public string ToString(string format, IFormatProvider formatProvider)
|
|
|
{
|
|
|
if (format == null)
|
|
|
{
|
|
|
format = "";
|
|
|
}
|
|
|
return String.Format(formatProvider, format, ((IConvertible)this).ToDouble(formatProvider));
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region IEquatable<FIRational> Member
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified <see cref="FIRational"/> structure is equivalent to this <see cref="FIRational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FIRational"/> structure to compare to this instance.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="FIRational"/> structure
|
|
|
/// equivalent to this <see cref="FIRational"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(FIRational other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region IComparable<FIRational> Member
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="FIRational"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FIRational"/> to compare.</param>
|
|
|
/// <returns>A signed number indicating the relative values of this instance
|
|
|
/// and <paramref name="other"/>.</returns>
|
|
|
public int CompareTo(FIRational other)
|
|
|
{
|
|
|
FIRational difference = this - other;
|
|
|
difference.Normalize();
|
|
|
if (difference.numerator > 0) return 1;
|
|
|
if (difference.numerator < 0) return -1;
|
|
|
else return 0;
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The <b>FIURational</b> structure represents a fraction via two <see cref="UInt32"/>
|
|
|
/// instances which are interpreted as numerator and denominator.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The structure tries to approximate the value of <see cref="FreeImageAPI.FIURational(decimal)"/>
|
|
|
/// when creating a new instance by using a better algorithm than FreeImage does.
|
|
|
/// <para/>
|
|
|
/// The structure implements the following operators:
|
|
|
/// +, ++, --, ==, != , >, >==, <, <== and ~ (which switches nominator and denomiator).
|
|
|
/// <para/>
|
|
|
/// The structure can be converted into all .NET standard types either implicit or
|
|
|
/// explicit.
|
|
|
/// </remarks>
|
|
|
[Serializable, StructLayout(LayoutKind.Sequential), ComVisible(true)]
|
|
|
public struct FIURational : IConvertible, IComparable, IFormattable, IComparable<FIURational>, IEquatable<FIURational>
|
|
|
{
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private uint numerator;
|
|
|
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private uint denominator;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents the largest possible value of <see cref="FIURational"/>. This field is constant.
|
|
|
/// </summary>
|
|
|
public static readonly FIURational MaxValue = new FIURational(UInt32.MaxValue, 1u);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents the smallest possible value of <see cref="FIURational"/>. This field is constant.
|
|
|
/// </summary>
|
|
|
public static readonly FIURational MinValue = new FIURational(0u, 1u);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents the smallest positive <see cref="FIURational"/> value greater than zero. This field is constant.
|
|
|
/// </summary>
|
|
|
public static readonly FIURational Epsilon = new FIURational(1u, UInt32.MaxValue);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified parameters.
|
|
|
/// </summary>
|
|
|
/// <param name="n">The numerator.</param>
|
|
|
/// <param name="d">The denominator.</param>
|
|
|
public FIURational(uint n, uint d)
|
|
|
{
|
|
|
numerator = n;
|
|
|
denominator = d;
|
|
|
Normalize();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified parameters.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag to read the data from.</param>
|
|
|
public unsafe FIURational(FITAG tag)
|
|
|
{
|
|
|
switch (FreeImage.GetTagType(tag))
|
|
|
{
|
|
|
case FREE_IMAGE_MDTYPE.FIDT_RATIONAL:
|
|
|
uint* pvalue = (uint*)FreeImage.GetTagValue(tag);
|
|
|
numerator = pvalue[0];
|
|
|
denominator = pvalue[1];
|
|
|
Normalize();
|
|
|
return;
|
|
|
default:
|
|
|
throw new ArgumentException("tag");
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
///Initializes a new instance based on the specified parameters.
|
|
|
/// </summary>
|
|
|
/// <param name="value">The value to convert into a fraction.</param>
|
|
|
/// <exception cref="OverflowException">
|
|
|
/// <paramref name="value"/> cannot be converted into a fraction
|
|
|
/// represented by two unsigned integer values.</exception>
|
|
|
public FIURational(decimal value)
|
|
|
{
|
|
|
try
|
|
|
{
|
|
|
if (value < 0)
|
|
|
{
|
|
|
throw new OverflowException("value");
|
|
|
}
|
|
|
try
|
|
|
{
|
|
|
int[] contFract = CreateContinuedFraction(value);
|
|
|
CreateFraction(contFract, out numerator, out denominator);
|
|
|
Normalize();
|
|
|
}
|
|
|
catch
|
|
|
{
|
|
|
numerator = 0;
|
|
|
denominator = 1;
|
|
|
}
|
|
|
if (Math.Abs(((decimal)numerator / (decimal)denominator) - value) > 0.0001m)
|
|
|
{
|
|
|
int maxDen = (Int32.MaxValue / (int)value) - 2;
|
|
|
maxDen = maxDen < 10000 ? maxDen : 10000;
|
|
|
ApproximateFraction(value, maxDen, out numerator, out denominator);
|
|
|
Normalize();
|
|
|
if (Math.Abs(((decimal)numerator / (decimal)denominator) - value) > 0.0001m)
|
|
|
{
|
|
|
throw new OverflowException("Unable to convert value into a fraction");
|
|
|
}
|
|
|
}
|
|
|
Normalize();
|
|
|
}
|
|
|
catch (Exception ex)
|
|
|
{
|
|
|
throw new OverflowException("Unable to calculate fraction.", ex);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// The numerator of the fraction.
|
|
|
/// </summary>
|
|
|
public uint Numerator
|
|
|
{
|
|
|
get { return numerator; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// The denominator of the fraction.
|
|
|
/// </summary>
|
|
|
public uint Denominator
|
|
|
{
|
|
|
get { return denominator; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the truncated value of the fraction.
|
|
|
/// </summary>
|
|
|
/// <returns></returns>
|
|
|
public int Truncate()
|
|
|
{
|
|
|
return denominator > 0 ? (int)(numerator / denominator) : 0;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns whether the fraction is representing an integer value.
|
|
|
/// </summary>
|
|
|
public bool IsInteger
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return (denominator == 1 ||
|
|
|
(denominator != 0 && (numerator % denominator == 0)) ||
|
|
|
(denominator == 0 && numerator == 0));
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Calculated the greatest common divisor of 'a' and 'b'.
|
|
|
/// </summary>
|
|
|
private static ulong Gcd(ulong a, ulong b)
|
|
|
{
|
|
|
ulong r;
|
|
|
while (b > 0)
|
|
|
{
|
|
|
r = a % b;
|
|
|
a = b;
|
|
|
b = r;
|
|
|
}
|
|
|
return a;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Calculated the smallest common multiple of 'a' and 'b'.
|
|
|
/// </summary>
|
|
|
private static ulong Scm(uint n, uint m)
|
|
|
{
|
|
|
return (ulong)n * (ulong)m / Gcd(n, m);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Normalizes the fraction.
|
|
|
/// </summary>
|
|
|
private void Normalize()
|
|
|
{
|
|
|
if (denominator == 0)
|
|
|
{
|
|
|
numerator = 0;
|
|
|
denominator = 1;
|
|
|
return;
|
|
|
}
|
|
|
|
|
|
if (numerator != 1 && denominator != 1)
|
|
|
{
|
|
|
uint common = (uint)Gcd(numerator, denominator);
|
|
|
if (common != 1 && common != 0)
|
|
|
{
|
|
|
numerator /= common;
|
|
|
denominator /= common;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Normalizes a fraction.
|
|
|
/// </summary>
|
|
|
private static void Normalize(ref ulong numerator, ref ulong denominator)
|
|
|
{
|
|
|
if (denominator == 0)
|
|
|
{
|
|
|
numerator = 0;
|
|
|
denominator = 1;
|
|
|
}
|
|
|
else if (numerator != 1 && denominator != 1)
|
|
|
{
|
|
|
ulong common = Gcd(numerator, denominator);
|
|
|
if (common != 1)
|
|
|
{
|
|
|
numerator /= common;
|
|
|
denominator /= common;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the digits after the point.
|
|
|
/// </summary>
|
|
|
private static int GetDigits(decimal value)
|
|
|
{
|
|
|
int result = 0;
|
|
|
value -= decimal.Truncate(value);
|
|
|
while (value != 0)
|
|
|
{
|
|
|
value *= 10;
|
|
|
value -= decimal.Truncate(value);
|
|
|
result++;
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a continued fraction of a decimal value.
|
|
|
/// </summary>
|
|
|
private static int[] CreateContinuedFraction(decimal value)
|
|
|
{
|
|
|
int precision = GetDigits(value);
|
|
|
decimal epsilon = 0.0000001m;
|
|
|
List<int> list = new List<int>();
|
|
|
value = Math.Abs(value);
|
|
|
|
|
|
byte b = 0;
|
|
|
|
|
|
list.Add((int)value);
|
|
|
value -= ((int)value);
|
|
|
|
|
|
while (value != 0m)
|
|
|
{
|
|
|
if (++b == byte.MaxValue || value < epsilon)
|
|
|
{
|
|
|
break;
|
|
|
}
|
|
|
value = 1m / value;
|
|
|
if (Math.Abs((Math.Round(value, precision - 1) - value)) < epsilon)
|
|
|
{
|
|
|
value = Math.Round(value, precision - 1);
|
|
|
}
|
|
|
list.Add((int)value);
|
|
|
value -= ((int)value);
|
|
|
}
|
|
|
return list.ToArray();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a fraction from a continued fraction.
|
|
|
/// </summary>
|
|
|
private static void CreateFraction(int[] continuedFraction, out uint numerator, out uint denominator)
|
|
|
{
|
|
|
numerator = 1;
|
|
|
denominator = 0;
|
|
|
uint temp;
|
|
|
|
|
|
for (int i = continuedFraction.Length - 1; i > -1; i--)
|
|
|
{
|
|
|
temp = numerator;
|
|
|
numerator = (uint)(continuedFraction[i] * numerator + denominator);
|
|
|
denominator = temp;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tries 'brute force' to approximate <paramref name="value"/> with a fraction.
|
|
|
/// </summary>
|
|
|
private static void ApproximateFraction(decimal value, int maxDen, out uint num, out uint den)
|
|
|
{
|
|
|
num = 0;
|
|
|
den = 0;
|
|
|
decimal bestDifference = 1m;
|
|
|
decimal currentDifference = -1m;
|
|
|
int digits = GetDigits(value);
|
|
|
|
|
|
if (digits <= 9)
|
|
|
{
|
|
|
uint mul = 1;
|
|
|
for (int i = 1; i <= digits; i++)
|
|
|
{
|
|
|
mul *= 10;
|
|
|
}
|
|
|
if (mul <= maxDen)
|
|
|
{
|
|
|
num = (uint)(value * mul);
|
|
|
den = mul;
|
|
|
return;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
for (uint u = 1; u <= maxDen; u++)
|
|
|
{
|
|
|
uint numerator = (uint)Math.Floor(value * (decimal)u + 0.5m);
|
|
|
currentDifference = Math.Abs(value - (decimal)numerator / (decimal)u);
|
|
|
if (currentDifference < bestDifference)
|
|
|
{
|
|
|
num = numerator;
|
|
|
den = u;
|
|
|
bestDifference = currentDifference;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the numeric value of the <see cref="FIURational"/> object
|
|
|
/// to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return ((IConvertible)this).ToDouble(null).ToString();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified object is a <see cref="FIURational"/> structure
|
|
|
/// and is equivalent to this <see cref="FIURational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The object to test.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="FIURational"/> structure
|
|
|
/// equivalent to this <see cref="FIURational"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return ((obj is FIURational) && (this == ((FIURational)obj)));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="FIURational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="FIURational"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return base.GetHashCode();
|
|
|
}
|
|
|
|
|
|
#region Operators
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static FIURational operator +(FIURational value)
|
|
|
{
|
|
|
return value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the reciprocal value of this instance.
|
|
|
/// </summary>
|
|
|
public static FIURational operator ~(FIURational value)
|
|
|
{
|
|
|
uint temp = value.denominator;
|
|
|
value.denominator = value.numerator;
|
|
|
value.numerator = temp;
|
|
|
value.Normalize();
|
|
|
return value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static FIURational operator ++(FIURational value)
|
|
|
{
|
|
|
checked
|
|
|
{
|
|
|
value.numerator += value.denominator;
|
|
|
}
|
|
|
return value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static FIURational operator --(FIURational value)
|
|
|
{
|
|
|
checked
|
|
|
{
|
|
|
value.numerator -= value.denominator;
|
|
|
}
|
|
|
return value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static FIURational operator +(FIURational left, FIURational right)
|
|
|
{
|
|
|
ulong numerator = 0;
|
|
|
ulong denominator = Scm(left.denominator, right.denominator);
|
|
|
numerator = (left.numerator * (denominator / left.denominator)) +
|
|
|
(right.numerator * (denominator / right.denominator));
|
|
|
Normalize(ref numerator, ref denominator);
|
|
|
checked
|
|
|
{
|
|
|
return new FIURational((uint)numerator, (uint)denominator);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static FIURational operator -(FIURational left, FIURational right)
|
|
|
{
|
|
|
checked
|
|
|
{
|
|
|
if (left.denominator != right.denominator)
|
|
|
{
|
|
|
uint denom = left.denominator;
|
|
|
left.numerator *= right.denominator;
|
|
|
left.denominator *= right.denominator;
|
|
|
right.numerator *= denom;
|
|
|
right.denominator *= denom;
|
|
|
}
|
|
|
left.numerator -= right.numerator;
|
|
|
left.Normalize();
|
|
|
return left;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static FIURational operator *(FIURational left, FIURational r2)
|
|
|
{
|
|
|
ulong numerator = left.numerator * r2.numerator;
|
|
|
ulong denominator = left.denominator * r2.denominator;
|
|
|
Normalize(ref numerator, ref denominator);
|
|
|
checked
|
|
|
{
|
|
|
return new FIURational((uint)numerator, (uint)denominator);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static FIURational operator /(FIURational left, FIURational right)
|
|
|
{
|
|
|
uint temp = right.denominator;
|
|
|
right.denominator = right.numerator;
|
|
|
right.numerator = temp;
|
|
|
return left * right;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static FIURational operator %(FIURational left, FIURational right)
|
|
|
{
|
|
|
right.Normalize();
|
|
|
if (Math.Abs(right.numerator) < right.denominator)
|
|
|
return new FIURational(0, 0);
|
|
|
int div = (int)(left / right);
|
|
|
return left - (right * div);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static bool operator ==(FIURational left, FIURational right)
|
|
|
{
|
|
|
left.Normalize();
|
|
|
right.Normalize();
|
|
|
return (left.numerator == right.numerator) && (left.denominator == right.denominator);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static bool operator !=(FIURational left, FIURational right)
|
|
|
{
|
|
|
left.Normalize();
|
|
|
right.Normalize();
|
|
|
return (left.numerator != right.numerator) || (left.denominator != right.denominator);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static bool operator >(FIURational left, FIURational right)
|
|
|
{
|
|
|
ulong denominator = Scm(left.denominator, right.denominator);
|
|
|
return (left.numerator * (denominator / left.denominator)) >
|
|
|
(right.numerator * (denominator / right.denominator));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static bool operator <(FIURational left, FIURational right)
|
|
|
{
|
|
|
ulong denominator = Scm(left.denominator, right.denominator);
|
|
|
return (left.numerator * (denominator / left.denominator)) <
|
|
|
(right.numerator * (denominator / right.denominator));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static bool operator >=(FIURational left, FIURational right)
|
|
|
{
|
|
|
ulong denominator = Scm(left.denominator, right.denominator);
|
|
|
return (left.numerator * (denominator / left.denominator)) >=
|
|
|
(right.numerator * (denominator / right.denominator));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Standard implementation of the operator.
|
|
|
/// </summary>
|
|
|
public static bool operator <=(FIURational left, FIURational right)
|
|
|
{
|
|
|
ulong denominator = Scm(left.denominator, right.denominator);
|
|
|
return (left.numerator * (denominator / left.denominator)) <=
|
|
|
(right.numerator * (denominator / right.denominator));
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Conversions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIURational"/> structure to a <see cref="Boolean"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIURational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="Boolean"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator bool(FIURational value)
|
|
|
{
|
|
|
return (value.numerator != 0);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIURational"/> structure to a <see cref="Byte"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIURational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="Byte"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator byte(FIURational value)
|
|
|
{
|
|
|
return (byte)(double)value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIURational"/> structure to a <see cref="Char"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIURational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="Char"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator char(FIURational value)
|
|
|
{
|
|
|
return (char)(double)value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIURational"/> structure to a <see cref="Decimal"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIURational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="Decimal"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator decimal(FIURational value)
|
|
|
{
|
|
|
return value.denominator == 0 ? 0m : (decimal)value.numerator / (decimal)value.denominator;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIURational"/> structure to a <see cref="Double"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIURational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="Double"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator double(FIURational value)
|
|
|
{
|
|
|
return value.denominator == 0 ? 0d : (double)value.numerator / (double)value.denominator;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIURational"/> structure to an <see cref="Int16"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIURational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="Int16"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator short(FIURational value)
|
|
|
{
|
|
|
return (short)(double)value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIURational"/> structure to an <see cref="Int32"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIURational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="Int32"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator int(FIURational value)
|
|
|
{
|
|
|
return (int)(double)value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIURational"/> structure to an <see cref="Int64"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIURational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="Int64"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator long(FIURational value)
|
|
|
{
|
|
|
return (byte)(double)value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIURational"/> structure to a <see cref="Single"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIURational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="Single"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator float(FIURational value)
|
|
|
{
|
|
|
return value.denominator == 0 ? 0f : (float)value.numerator / (float)value.denominator;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIURational"/> structure to a <see cref="SByte"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIURational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="SByte"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator sbyte(FIURational value)
|
|
|
{
|
|
|
return (sbyte)(double)value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIURational"/> structure to an <see cref="UInt16"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIURational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="UInt16"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator ushort(FIURational value)
|
|
|
{
|
|
|
return (ushort)(double)value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIURational"/> structure to an <see cref="UInt32"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIURational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="UInt32"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator uint(FIURational value)
|
|
|
{
|
|
|
return (uint)(double)value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="FIURational"/> structure to an <see cref="UInt32"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FIURational"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="UInt32"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator ulong(FIURational value)
|
|
|
{
|
|
|
return (ulong)(double)value;
|
|
|
}
|
|
|
|
|
|
//
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="Boolean"/> structure to a <see cref="FIURational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="Boolean"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIURational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator FIURational(bool value)
|
|
|
{
|
|
|
return new FIURational(value ? 1u : 0u, 1u);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="Byte"/> structure to a <see cref="FIURational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="Byte"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIURational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FIURational(byte value)
|
|
|
{
|
|
|
return new FIURational(value, 1);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="Char"/> structure to a <see cref="FIURational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="Char"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIURational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FIURational(char value)
|
|
|
{
|
|
|
return new FIURational(value, 1);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="Decimal"/> structure to a <see cref="FIURational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="Decimal"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIURational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator FIURational(decimal value)
|
|
|
{
|
|
|
return new FIURational(value);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="Double"/> structure to a <see cref="FIURational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="Double"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIURational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator FIURational(double value)
|
|
|
{
|
|
|
return new FIURational((decimal)value);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of an <see cref="Int16"/> structure to a <see cref="FIURational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">An <see cref="Int16"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIURational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FIURational(short value)
|
|
|
{
|
|
|
return new FIURational((uint)value, 1u);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of an <see cref="Int32"/> structure to a <see cref="FIURational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">An <see cref="Int32"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIURational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FIURational(int value)
|
|
|
{
|
|
|
return new FIURational((uint)value, 1u);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of an <see cref="Int64"/> structure to a <see cref="FIURational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">An <see cref="Int64"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIURational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator FIURational(long value)
|
|
|
{
|
|
|
return new FIURational((uint)value, 1u);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="SByte"/> structure to a <see cref="FIURational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="SByte"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIURational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FIURational(sbyte value)
|
|
|
{
|
|
|
return new FIURational((uint)value, 1u);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of a <see cref="Single"/> structure to a <see cref="FIURational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="Single"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIURational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator FIURational(float value)
|
|
|
{
|
|
|
return new FIURational((decimal)value);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of an <see cref="UInt16"/> structure to a <see cref="FIURational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">An <see cref="UInt16"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIURational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FIURational(ushort value)
|
|
|
{
|
|
|
return new FIURational(value, 1);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of an <see cref="UInt32"/> structure to a <see cref="FIURational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">An <see cref="UInt32"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIURational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator FIURational(uint value)
|
|
|
{
|
|
|
return new FIURational(value, 1u);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of an <see cref="UInt64"/> structure to a <see cref="FIURational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="value">An <see cref="UInt64"/> structure.</param>
|
|
|
/// <returns>A new instance of <see cref="FIURational"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static explicit operator FIURational(ulong value)
|
|
|
{
|
|
|
return new FIURational((uint)value, 1u);
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region IConvertible Member
|
|
|
|
|
|
TypeCode IConvertible.GetTypeCode()
|
|
|
{
|
|
|
return TypeCode.Double;
|
|
|
}
|
|
|
|
|
|
bool IConvertible.ToBoolean(IFormatProvider provider)
|
|
|
{
|
|
|
return (bool)this;
|
|
|
}
|
|
|
|
|
|
byte IConvertible.ToByte(IFormatProvider provider)
|
|
|
{
|
|
|
return (byte)this;
|
|
|
}
|
|
|
|
|
|
char IConvertible.ToChar(IFormatProvider provider)
|
|
|
{
|
|
|
return (char)this;
|
|
|
}
|
|
|
|
|
|
DateTime IConvertible.ToDateTime(IFormatProvider provider)
|
|
|
{
|
|
|
return Convert.ToDateTime(((IConvertible)this).ToDouble(provider));
|
|
|
}
|
|
|
|
|
|
decimal IConvertible.ToDecimal(IFormatProvider provider)
|
|
|
{
|
|
|
return this;
|
|
|
}
|
|
|
|
|
|
double IConvertible.ToDouble(IFormatProvider provider)
|
|
|
{
|
|
|
return this;
|
|
|
}
|
|
|
|
|
|
short IConvertible.ToInt16(IFormatProvider provider)
|
|
|
{
|
|
|
return (short)this;
|
|
|
}
|
|
|
|
|
|
int IConvertible.ToInt32(IFormatProvider provider)
|
|
|
{
|
|
|
return (int)this;
|
|
|
}
|
|
|
|
|
|
long IConvertible.ToInt64(IFormatProvider provider)
|
|
|
{
|
|
|
return (long)this;
|
|
|
}
|
|
|
|
|
|
sbyte IConvertible.ToSByte(IFormatProvider provider)
|
|
|
{
|
|
|
return (sbyte)this;
|
|
|
}
|
|
|
|
|
|
float IConvertible.ToSingle(IFormatProvider provider)
|
|
|
{
|
|
|
return this;
|
|
|
}
|
|
|
|
|
|
string IConvertible.ToString(IFormatProvider provider)
|
|
|
{
|
|
|
return ToString(((double)this).ToString(), provider);
|
|
|
}
|
|
|
|
|
|
object IConvertible.ToType(Type conversionType, IFormatProvider provider)
|
|
|
{
|
|
|
return Convert.ChangeType(((IConvertible)this).ToDouble(provider), conversionType, provider);
|
|
|
}
|
|
|
|
|
|
ushort IConvertible.ToUInt16(IFormatProvider provider)
|
|
|
{
|
|
|
return (ushort)this;
|
|
|
}
|
|
|
|
|
|
uint IConvertible.ToUInt32(IFormatProvider provider)
|
|
|
{
|
|
|
return (uint)this;
|
|
|
}
|
|
|
|
|
|
ulong IConvertible.ToUInt64(IFormatProvider provider)
|
|
|
{
|
|
|
return (ulong)this;
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region IComparable Member
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer indicating the lexical relationship between the two comparands.</returns>
|
|
|
/// <exception cref="ArgumentException"><paramref name="obj"/> is not a <see cref="FIURational"/>.</exception>
|
|
|
public int CompareTo(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
if (!(obj is FIURational))
|
|
|
{
|
|
|
throw new ArgumentException();
|
|
|
}
|
|
|
return CompareTo((FIURational)obj);
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region IFormattable Member
|
|
|
|
|
|
/// <summary>
|
|
|
/// Formats the value of the current instance using the specified format.
|
|
|
/// </summary>
|
|
|
/// <param name="format">The String specifying the format to use.</param>
|
|
|
/// <param name="formatProvider">The IFormatProvider to use to format the value.</param>
|
|
|
/// <returns>A String containing the value of the current instance in the specified format.</returns>
|
|
|
public string ToString(string format, IFormatProvider formatProvider)
|
|
|
{
|
|
|
if (format == null)
|
|
|
{
|
|
|
format = "";
|
|
|
}
|
|
|
return String.Format(formatProvider, format, ((IConvertible)this).ToDouble(formatProvider));
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region IEquatable<FIURational> Member
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified <see cref="FIURational"/> structure is equivalent to this <see cref="FIURational"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FIURational"/> structure to compare to this instance.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="FIURational"/> structure
|
|
|
/// equivalent to this <see cref="FIURational"/> structure; otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(FIURational other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region IComparable<FIURational> Member
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="FIURational"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="FIURational"/> to compare.</param>
|
|
|
/// <returns>A signed number indicating the relative values of this instance
|
|
|
/// and <paramref name="other"/>.</returns>
|
|
|
public int CompareTo(FIURational other)
|
|
|
{
|
|
|
FIURational difference = this - other;
|
|
|
difference.Normalize();
|
|
|
if (difference.numerator > 0) return 1;
|
|
|
if (difference.numerator < 0) return -1;
|
|
|
else return 0;
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
}
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Classes
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Encapsulates a FreeImage-bitmap.
|
|
|
/// </summary>
|
|
|
[Serializable, Guid("64a4c935-b757-499c-ab8c-6110316a9e51")]
|
|
|
public class FreeImageBitmap : MarshalByRefObject, ICloneable, IDisposable, IEnumerable, ISerializable
|
|
|
{
|
|
|
#region Fields
|
|
|
|
|
|
/// <summary>
|
|
|
/// Indicates whether this instance is disposed.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private bool disposed;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tab object.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private object tag;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Object used to syncronize lock methods.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private object lockObject = new object();
|
|
|
|
|
|
/// <summary>
|
|
|
/// Holds information used by SaveAdd() methods.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private SaveInformation saveInformation = new SaveInformation();
|
|
|
|
|
|
/// <summary>
|
|
|
/// The stream that this instance was loaded from or
|
|
|
/// null if it has been cloned or deserialized.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private Stream stream;
|
|
|
|
|
|
/// <summary>
|
|
|
/// True if the stream must be disposed with this
|
|
|
/// instance.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private bool disposeStream;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The number of frames contained by a mutlipage bitmap.
|
|
|
/// Default value is 1 and only changed if needed.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private int frameCount = 1;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The index of the loaded frame.
|
|
|
/// Default value is 0 and only changed if needed.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private int frameIndex = 0;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Format of the sourceimage.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private FREE_IMAGE_FORMAT originalFormat = FREE_IMAGE_FORMAT.FIF_UNKNOWN;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Handle to the encapsulated FreeImage-bitmap.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private FIBITMAP dib;
|
|
|
|
|
|
private const string ErrorLoadingBitmap = "Unable to load bitmap.";
|
|
|
private const string ErrorLoadingFrame = "Unable to load frame.";
|
|
|
private const string ErrorCreatingBitmap = "Unable to create bitmap.";
|
|
|
private const string ErrorUnloadBitmap = "Unable to unload bitmap.";
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Constructors and Destructor
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class.
|
|
|
/// </summary>
|
|
|
protected FreeImageBitmap()
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class.
|
|
|
/// For internal use only.
|
|
|
/// </summary>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
internal protected FreeImageBitmap(FIBITMAP dib)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new Exception(ErrorLoadingBitmap);
|
|
|
}
|
|
|
this.dib = dib;
|
|
|
AddMemoryPressure();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class
|
|
|
/// bases on the specified image.
|
|
|
/// </summary>
|
|
|
/// <param name="original">The original to clone from.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="original"/> is a null reference.</exception>
|
|
|
public FreeImageBitmap(FreeImageBitmap original)
|
|
|
{
|
|
|
if (original == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("original");
|
|
|
}
|
|
|
original.EnsureNotDisposed();
|
|
|
dib = FreeImage.Clone(original.dib);
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new Exception(ErrorLoadingBitmap);
|
|
|
}
|
|
|
originalFormat = original.originalFormat;
|
|
|
AddMemoryPressure();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class
|
|
|
/// bases on the specified image with the specified size.
|
|
|
/// </summary>
|
|
|
/// <param name="original">The original to clone from.</param>
|
|
|
/// <param name="newSize">The Size structure that represent the
|
|
|
/// size of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="original"/> is a null reference.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="newSize.Width"/> or <paramref name="newSize.Height"/> are less or equal zero.
|
|
|
/// </exception>
|
|
|
public FreeImageBitmap(FreeImageBitmap original, Size newSize)
|
|
|
: this(original, newSize.Width, newSize.Height)
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class
|
|
|
/// bases on the specified image with the specified size.
|
|
|
/// </summary>
|
|
|
/// <param name="original">The original to clone from.</param>
|
|
|
/// <param name="width">Width of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="height">Height of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="original"/> is a null reference.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="width"/> or <paramref name="height"/> are less or equal zero.</exception>
|
|
|
public FreeImageBitmap(FreeImageBitmap original, int width, int height)
|
|
|
{
|
|
|
if (original == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("original");
|
|
|
}
|
|
|
if (width <= 0)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("width");
|
|
|
}
|
|
|
if (height <= 0)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("height");
|
|
|
}
|
|
|
original.EnsureNotDisposed();
|
|
|
dib = FreeImage.Rescale(original.dib, width, height, FREE_IMAGE_FILTER.FILTER_BICUBIC);
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new Exception(ErrorLoadingBitmap);
|
|
|
}
|
|
|
originalFormat = original.originalFormat;
|
|
|
AddMemoryPressure();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class
|
|
|
/// bases on the specified image.
|
|
|
/// </summary>
|
|
|
/// <param name="original">The original to clone from.</param>
|
|
|
/// <remarks>
|
|
|
/// Although this constructor supports creating images in both formats
|
|
|
/// <see cref="System.Drawing.Imaging.PixelFormat.Format32bppPArgb"/>
|
|
|
/// and <see cref="System.Drawing.Imaging.PixelFormat.Format64bppPArgb"/>, bitmaps
|
|
|
/// created in these formats are treated like any normal 32-bit RGBA and 64-bit RGBA
|
|
|
/// images respectively. Currently, there is no support for automatic premultiplying images in
|
|
|
/// <see cref="FreeImageBitmap"/>.
|
|
|
/// </remarks>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
public FreeImageBitmap(Image original)
|
|
|
: this(original as Bitmap)
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class
|
|
|
/// bases on the specified image with the specified size.
|
|
|
/// </summary>
|
|
|
/// <param name="original">The original to clone from.</param>
|
|
|
/// <param name="newSize">The Size structure that represent the
|
|
|
/// size of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <remarks>
|
|
|
/// Although this constructor supports creating images in both formats
|
|
|
/// <see cref="System.Drawing.Imaging.PixelFormat.Format32bppPArgb"/>
|
|
|
/// and <see cref="System.Drawing.Imaging.PixelFormat.Format64bppPArgb"/>, bitmaps
|
|
|
/// created in these formats are treated like any normal 32-bit RGBA and 64-bit RGBA
|
|
|
/// images respectively. Currently, there is no support for automatic premultiplying images in
|
|
|
/// <see cref="FreeImageBitmap"/>.
|
|
|
/// </remarks>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="original"/> is a null reference.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="newSize.Width"/> or <paramref name="newSize.Height"/> are less or equal zero.
|
|
|
/// </exception>
|
|
|
public FreeImageBitmap(Image original, Size newSize)
|
|
|
: this(original as Bitmap, newSize.Width, newSize.Height)
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class
|
|
|
/// bases on the specified image with the specified size.
|
|
|
/// </summary>
|
|
|
/// <param name="original">The original to clone from.</param>
|
|
|
/// <param name="width">The width, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="height">The height, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <remarks>
|
|
|
/// Although this constructor supports creating images in both formats
|
|
|
/// <see cref="System.Drawing.Imaging.PixelFormat.Format32bppPArgb"/>
|
|
|
/// and <see cref="System.Drawing.Imaging.PixelFormat.Format64bppPArgb"/>, bitmaps
|
|
|
/// created in these formats are treated like any normal 32-bit RGBA and 64-bit RGBA
|
|
|
/// images respectively. Currently, there is no support for automatic premultiplying images in
|
|
|
/// <see cref="FreeImageBitmap"/>.
|
|
|
/// </remarks>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="original"/> is a null reference.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="width"/> or <paramref name="height"/> are less or equal zero.</exception>
|
|
|
public FreeImageBitmap(Image original, int width, int height)
|
|
|
: this(original as Bitmap, width, height)
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class
|
|
|
/// bases on the specified image.
|
|
|
/// </summary>
|
|
|
/// <param name="original">The original to clone from.</param>
|
|
|
/// <remarks>
|
|
|
/// Although this constructor supports creating images in both formats
|
|
|
/// <see cref="System.Drawing.Imaging.PixelFormat.Format32bppPArgb"/>
|
|
|
/// and <see cref="System.Drawing.Imaging.PixelFormat.Format64bppPArgb"/>, bitmaps
|
|
|
/// created in these formats are treated like any normal 32-bit RGBA and 64-bit RGBA
|
|
|
/// images respectively. Currently, there is no support for automatic premultiplying images in
|
|
|
/// <see cref="FreeImageBitmap"/>.
|
|
|
/// </remarks>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="original"/> is a null reference.</exception>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
public FreeImageBitmap(Bitmap original)
|
|
|
{
|
|
|
if (original == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("original");
|
|
|
}
|
|
|
dib = FreeImage.CreateFromBitmap(original, true);
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new Exception(ErrorLoadingBitmap);
|
|
|
}
|
|
|
originalFormat = FreeImage.GetFormat(original.RawFormat);
|
|
|
AddMemoryPressure();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class
|
|
|
/// bases on the specified image with the specified size.
|
|
|
/// </summary>
|
|
|
/// <param name="original">The original to clone from.</param>
|
|
|
/// <param name="newSize">The Size structure that represent the
|
|
|
/// size of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <remarks>
|
|
|
/// Although this constructor supports creating images in both formats
|
|
|
/// <see cref="System.Drawing.Imaging.PixelFormat.Format32bppPArgb"/>
|
|
|
/// and <see cref="System.Drawing.Imaging.PixelFormat.Format64bppPArgb"/>, bitmaps
|
|
|
/// created in these formats are treated like any normal 32-bit RGBA and 64-bit RGBA
|
|
|
/// images respectively. Currently, there is no support for automatic premultiplying images in
|
|
|
/// <see cref="FreeImageBitmap"/>.
|
|
|
/// </remarks>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="original"/> is a null reference.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="newSize.Width"/> or <paramref name="newSize.Height"/> are less or equal zero.
|
|
|
/// </exception>
|
|
|
public FreeImageBitmap(Bitmap original, Size newSize)
|
|
|
: this(original, newSize.Width, newSize.Height)
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class
|
|
|
/// bases on the specified image with the specified size.
|
|
|
/// </summary>
|
|
|
/// <param name="original">The original to clone from.</param>
|
|
|
/// <param name="width">The width, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="height">The height, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <remarks>
|
|
|
/// Although this constructor supports creating images in both formats
|
|
|
/// <see cref="System.Drawing.Imaging.PixelFormat.Format32bppPArgb"/>
|
|
|
/// and <see cref="System.Drawing.Imaging.PixelFormat.Format64bppPArgb"/>, bitmaps
|
|
|
/// created in these formats are treated like any normal 32-bit RGBA and 64-bit RGBA
|
|
|
/// images respectively. Currently, there is no support for automatic premultiplying images in
|
|
|
/// <see cref="FreeImageBitmap"/>.
|
|
|
/// </remarks>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="original"/> is a null reference.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="width"/> or <paramref name="height"/> are less or equal zero.</exception>
|
|
|
public FreeImageBitmap(Bitmap original, int width, int height)
|
|
|
{
|
|
|
if (original == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("original");
|
|
|
}
|
|
|
if (width <= 0)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("width");
|
|
|
}
|
|
|
if (height <= 0)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("height");
|
|
|
}
|
|
|
FIBITMAP temp = FreeImage.CreateFromBitmap(original, true);
|
|
|
if (temp.IsNull)
|
|
|
{
|
|
|
throw new Exception(ErrorLoadingBitmap);
|
|
|
}
|
|
|
dib = FreeImage.Rescale(temp, width, height, FREE_IMAGE_FILTER.FILTER_BICUBIC);
|
|
|
FreeImage.Unload(temp);
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new Exception(ErrorLoadingBitmap);
|
|
|
}
|
|
|
originalFormat = FreeImage.GetFormat(original.RawFormat);
|
|
|
AddMemoryPressure();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class
|
|
|
/// bases on the specified stream.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">Stream to read from.</param>
|
|
|
/// <param name="useIcm">Ignored.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="stream"/> is a null reference.</exception>
|
|
|
/// <remarks>
|
|
|
/// You must keep the stream open for the lifetime of the <see cref="FreeImageBitmap"/>.
|
|
|
/// </remarks>
|
|
|
public FreeImageBitmap(Stream stream, bool useIcm)
|
|
|
: this(stream)
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class
|
|
|
/// bases on the specified stream.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">Stream to read from.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="stream"/> is a null reference.</exception>
|
|
|
/// <remarks>
|
|
|
/// You must keep the stream open for the lifetime of the <see cref="FreeImageBitmap"/>.
|
|
|
/// </remarks>
|
|
|
public FreeImageBitmap(Stream stream)
|
|
|
: this(stream, FREE_IMAGE_FORMAT.FIF_UNKNOWN, FREE_IMAGE_LOAD_FLAGS.DEFAULT)
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class
|
|
|
/// bases on the specified stream in the specified format.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">Stream to read from.</param>
|
|
|
/// <param name="format">Format of the image.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="stream"/> is a null reference.</exception>
|
|
|
/// <remarks>
|
|
|
/// You must keep the stream open for the lifetime of the <see cref="FreeImageBitmap"/>.
|
|
|
/// </remarks>
|
|
|
public FreeImageBitmap(Stream stream, FREE_IMAGE_FORMAT format)
|
|
|
: this(stream, format, FREE_IMAGE_LOAD_FLAGS.DEFAULT)
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class
|
|
|
/// bases on the specified stream with the specified loading flags.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">Stream to read from.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="stream"/> is a null reference.</exception>
|
|
|
/// <remarks>
|
|
|
/// You must keep the stream open for the lifetime of the <see cref="FreeImageBitmap"/>.
|
|
|
/// </remarks>
|
|
|
public FreeImageBitmap(Stream stream, FREE_IMAGE_LOAD_FLAGS flags)
|
|
|
: this(stream, FREE_IMAGE_FORMAT.FIF_UNKNOWN, flags)
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class
|
|
|
/// bases on the specified stream in the specified format
|
|
|
/// with the specified loading flags.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">Stream to read from.</param>
|
|
|
/// <param name="format">Format of the image.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="stream"/> is a null reference.</exception>
|
|
|
/// <remarks>
|
|
|
/// You must keep the stream open for the lifetime of the <see cref="FreeImageBitmap"/>.
|
|
|
/// </remarks>
|
|
|
public FreeImageBitmap(Stream stream, FREE_IMAGE_FORMAT format, FREE_IMAGE_LOAD_FLAGS flags)
|
|
|
{
|
|
|
if (stream == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("stream");
|
|
|
}
|
|
|
this.stream = stream;
|
|
|
disposeStream = false;
|
|
|
LoadFromStream(stream, format, flags);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class bases on the specified file.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The complete name of the file to load.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="filename"/> is a null reference.</exception>
|
|
|
/// <exception cref="FileNotFoundException"><paramref name="filename"/> does not exist.</exception>
|
|
|
public FreeImageBitmap(string filename)
|
|
|
: this(filename, FREE_IMAGE_LOAD_FLAGS.DEFAULT)
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class bases on the specified file.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The complete name of the file to load.</param>
|
|
|
/// <param name="useIcm">Ignored.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="filename"/> is a null reference.</exception>
|
|
|
/// <exception cref="FileNotFoundException"><paramref name="filename"/> does not exist.</exception>
|
|
|
public FreeImageBitmap(string filename, bool useIcm)
|
|
|
: this(filename)
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class bases on the specified file
|
|
|
/// with the specified loading flags.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The complete name of the file to load.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="filename"/> is a null reference.</exception>
|
|
|
/// <exception cref="FileNotFoundException"><paramref name="filename"/> does not exist.</exception>
|
|
|
public FreeImageBitmap(string filename, FREE_IMAGE_LOAD_FLAGS flags)
|
|
|
: this(filename, FREE_IMAGE_FORMAT.FIF_UNKNOWN, flags)
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class bases on the specified file
|
|
|
/// in the specified format.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The complete name of the file to load.</param>
|
|
|
/// <param name="format">Format of the image.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="filename"/> is a null reference.</exception>
|
|
|
/// <exception cref="FileNotFoundException"><paramref name="filename"/> does not exist.</exception>
|
|
|
public FreeImageBitmap(string filename, FREE_IMAGE_FORMAT format)
|
|
|
: this(filename, format, FREE_IMAGE_LOAD_FLAGS.DEFAULT)
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class bases on the specified file
|
|
|
/// in the specified format with the specified loading flags.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The complete name of the file to load.</param>
|
|
|
/// <param name="format">Format of the image.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="filename"/> is a null reference.</exception>
|
|
|
/// <exception cref="FileNotFoundException"><paramref name="filename"/> does not exist.</exception>
|
|
|
public FreeImageBitmap(string filename, FREE_IMAGE_FORMAT format, FREE_IMAGE_LOAD_FLAGS flags)
|
|
|
{
|
|
|
if (filename == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("filename");
|
|
|
}
|
|
|
if (!File.Exists(filename))
|
|
|
{
|
|
|
throw new FileNotFoundException("filename");
|
|
|
}
|
|
|
|
|
|
saveInformation.filename = filename;
|
|
|
stream = new FileStream(filename, FileMode.Open, FileAccess.Read, FileShare.Read);
|
|
|
disposeStream = true;
|
|
|
LoadFromStream(stream, format, flags);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class
|
|
|
/// bases on the specified size.
|
|
|
/// </summary>
|
|
|
/// <param name="width">The width, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="height">The height, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
public FreeImageBitmap(int width, int height)
|
|
|
{
|
|
|
dib = FreeImage.Allocate(
|
|
|
width,
|
|
|
height,
|
|
|
24,
|
|
|
FreeImage.FI_RGBA_RED_MASK,
|
|
|
FreeImage.FI_RGBA_GREEN_MASK,
|
|
|
FreeImage.FI_RGBA_BLUE_MASK);
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new Exception(ErrorCreatingBitmap);
|
|
|
}
|
|
|
AddMemoryPressure();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class bases on the specified resource.
|
|
|
/// </summary>
|
|
|
/// <param name="type">The class used to extract the resource.</param>
|
|
|
/// <param name="resource">The name of the resource.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
public FreeImageBitmap(Type type, string resource)
|
|
|
: this(type.Module.Assembly.GetManifestResourceStream(type, resource))
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class bases on the specified size
|
|
|
/// and with the resolution of the specified <see cref="System.Drawing.Graphics"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="width">The width, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="height">The height, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="g">The Graphics object that specifies the resolution for the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="g"/> is a null reference.</exception>
|
|
|
public FreeImageBitmap(int width, int height, Graphics g)
|
|
|
: this(width, height)
|
|
|
{
|
|
|
FreeImage.SetResolutionX(dib, (uint)g.DpiX);
|
|
|
FreeImage.SetResolutionY(dib, (uint)g.DpiY);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class bases on the specified size and format.
|
|
|
/// </summary>
|
|
|
/// <param name="width">The width, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="height">The height, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="format">The PixelFormat enumeration for the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <remarks>
|
|
|
/// Although this constructor supports creating images in both formats
|
|
|
/// <see cref="System.Drawing.Imaging.PixelFormat.Format32bppPArgb"/>
|
|
|
/// and <see cref="System.Drawing.Imaging.PixelFormat.Format64bppPArgb"/>, bitmaps
|
|
|
/// created in these formats are treated like any normal 32-bit RGBA and 64-bit RGBA
|
|
|
/// images respectively. Currently, there is no support for automatic premultiplying images in
|
|
|
/// <see cref="FreeImageBitmap"/>.
|
|
|
/// </remarks>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentException"><paramref name="format"/> is invalid.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="width"/> or <paramref name="height"/> are less or equal zero.</exception>
|
|
|
public FreeImageBitmap(int width, int height, PixelFormat format)
|
|
|
{
|
|
|
if (width <= 0)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("width");
|
|
|
}
|
|
|
if (height <= 0)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("height");
|
|
|
}
|
|
|
uint bpp, redMask, greenMask, blueMask;
|
|
|
FREE_IMAGE_TYPE type;
|
|
|
if (!FreeImage.GetFormatParameters(format, out type, out bpp, out redMask, out greenMask, out blueMask))
|
|
|
{
|
|
|
throw new ArgumentException("format is invalid");
|
|
|
}
|
|
|
dib = FreeImage.AllocateT(type, width, height, (int)bpp, redMask, greenMask, blueMask);
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new Exception(ErrorCreatingBitmap);
|
|
|
}
|
|
|
AddMemoryPressure();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class bases on the specified size and type.
|
|
|
/// Only non standard bitmaps are supported.
|
|
|
/// </summary>
|
|
|
/// <param name="width">The width, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="height">The height, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="type">The type of the bitmap.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="type"/> is FIT_BITMAP or FIT_UNKNOWN.</exception>
|
|
|
/// <exception cref="ArgumentException"><paramref name="type"/> is invalid.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="width"/> or <paramref name="height"/> are less or equal zero.</exception>
|
|
|
public FreeImageBitmap(int width, int height, FREE_IMAGE_TYPE type)
|
|
|
{
|
|
|
if (width <= 0)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("width");
|
|
|
}
|
|
|
if (height <= 0)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("height");
|
|
|
}
|
|
|
if ((type == FREE_IMAGE_TYPE.FIT_BITMAP) || (type == FREE_IMAGE_TYPE.FIT_UNKNOWN))
|
|
|
{
|
|
|
throw new ArgumentException("type is invalid.");
|
|
|
}
|
|
|
dib = FreeImage.AllocateT(type, width, height, 0, 0u, 0u, 0u);
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new Exception(ErrorCreatingBitmap);
|
|
|
}
|
|
|
AddMemoryPressure();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class bases on the specified size,
|
|
|
/// pixel format and pixel data.
|
|
|
/// </summary>
|
|
|
/// <param name="width">The width, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="height">The height, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="stride">Integer that specifies the byte offset between the beginning
|
|
|
/// of one scan line and the next. This is usually (but not necessarily)
|
|
|
/// the number of bytes in the pixel format (for example, 2 for 16 bits per pixel)
|
|
|
/// multiplied by the width of the bitmap. The value passed to this parameter must
|
|
|
/// be a multiple of four..</param>
|
|
|
/// <param name="format">The PixelFormat enumeration for the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="scan0">Pointer to an array of bytes that contains the pixel data.</param>
|
|
|
/// <remarks>
|
|
|
/// Although this constructor supports creating images in both formats
|
|
|
/// <see cref="System.Drawing.Imaging.PixelFormat.Format32bppPArgb"/>
|
|
|
/// and <see cref="System.Drawing.Imaging.PixelFormat.Format64bppPArgb"/>, bitmaps
|
|
|
/// created in these formats are treated like any normal 32-bit RGBA and 64-bit RGBA
|
|
|
/// images respectively. Currently, there is no support for automatic premultiplying images in
|
|
|
/// <see cref="FreeImageBitmap"/>.
|
|
|
/// </remarks>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentException"><paramref name="format"/> is invalid.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="width"/> or <paramref name="height"/> are less or equal zero.</exception>
|
|
|
public FreeImageBitmap(int width, int height, int stride, PixelFormat format, IntPtr scan0)
|
|
|
{
|
|
|
if (width <= 0)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("width");
|
|
|
}
|
|
|
if (height <= 0)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("height");
|
|
|
}
|
|
|
uint bpp, redMask, greenMask, blueMask;
|
|
|
FREE_IMAGE_TYPE type;
|
|
|
bool topDown = (stride > 0);
|
|
|
stride = (stride > 0) ? stride : (stride * -1);
|
|
|
|
|
|
if (!FreeImage.GetFormatParameters(format, out type, out bpp, out redMask, out greenMask, out blueMask))
|
|
|
{
|
|
|
throw new ArgumentException("format is invalid.");
|
|
|
}
|
|
|
|
|
|
dib = FreeImage.ConvertFromRawBits(
|
|
|
scan0, type, width, height, stride, bpp, redMask, greenMask, blueMask, topDown);
|
|
|
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new Exception(ErrorCreatingBitmap);
|
|
|
}
|
|
|
AddMemoryPressure();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class bases on the specified size,
|
|
|
/// pixel format and pixel data.
|
|
|
/// </summary>
|
|
|
/// <param name="width">The width, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="height">The height, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="stride">Integer that specifies the byte offset between the beginning
|
|
|
/// of one scan line and the next. This is usually (but not necessarily)
|
|
|
/// the number of bytes in the pixel format (for example, 2 for 16 bits per pixel)
|
|
|
/// multiplied by the width of the bitmap. The value passed to this parameter must
|
|
|
/// be a multiple of four..</param>
|
|
|
/// <param name="format">The PixelFormat enumeration for the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="bits">Array of bytes containing the bitmap data.</param>
|
|
|
/// <remarks>
|
|
|
/// Although this constructor supports creating images in both formats
|
|
|
/// <see cref="System.Drawing.Imaging.PixelFormat.Format32bppPArgb"/>
|
|
|
/// and <see cref="System.Drawing.Imaging.PixelFormat.Format64bppPArgb"/>, bitmaps
|
|
|
/// created in these formats are treated like any normal 32-bit RGBA and 64-bit RGBA
|
|
|
/// images respectively. Currently, there is no support for automatic premultiplying images in
|
|
|
/// <see cref="FreeImageBitmap"/>.
|
|
|
/// </remarks>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentException"><paramref name="format"/> is invalid.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="width"/> or <paramref name="height"/> are less or equal zero.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="bits"/> is null</exception>
|
|
|
public FreeImageBitmap(int width, int height, int stride, PixelFormat format, byte[] bits)
|
|
|
{
|
|
|
if (width <= 0)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("width");
|
|
|
}
|
|
|
if (height <= 0)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("height");
|
|
|
}
|
|
|
if (bits == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("bits");
|
|
|
}
|
|
|
uint bpp, redMask, greenMask, blueMask;
|
|
|
FREE_IMAGE_TYPE type;
|
|
|
bool topDown = (stride > 0);
|
|
|
stride = (stride > 0) ? stride : (stride * -1);
|
|
|
|
|
|
if (!FreeImage.GetFormatParameters(format, out type, out bpp, out redMask, out greenMask, out blueMask))
|
|
|
{
|
|
|
throw new ArgumentException("format is invalid.");
|
|
|
}
|
|
|
|
|
|
dib = FreeImage.ConvertFromRawBits(
|
|
|
bits, type, width, height, stride, bpp, redMask, greenMask, blueMask, topDown);
|
|
|
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new Exception(ErrorCreatingBitmap);
|
|
|
}
|
|
|
AddMemoryPressure();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class bases on the specified size,
|
|
|
/// pixel format and pixel data.
|
|
|
/// </summary>
|
|
|
/// <param name="width">The width, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="height">The height, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="stride">Integer that specifies the byte offset between the beginning
|
|
|
/// of one scan line and the next. This is usually (but not necessarily)
|
|
|
/// the number of bytes in the pixel format (for example, 2 for 16 bits per pixel)
|
|
|
/// multiplied by the width of the bitmap. The value passed to this parameter must
|
|
|
/// be a multiple of four..</param>
|
|
|
/// <param name="bpp">The color depth of the new <see cref="FreeImageBitmap"/></param>
|
|
|
/// <param name="type">The type for the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="scan0">Pointer to an array of bytes that contains the pixel data.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentException"><paramref name="format"/> is invalid.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="width"/> or <paramref name="height"/> are less or equal zero.</exception>
|
|
|
public FreeImageBitmap(int width, int height, int stride, int bpp, FREE_IMAGE_TYPE type, IntPtr scan0)
|
|
|
{
|
|
|
if (width <= 0)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("width");
|
|
|
}
|
|
|
if (height <= 0)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("height");
|
|
|
}
|
|
|
uint redMask, greenMask, blueMask;
|
|
|
bool topDown = (stride > 0);
|
|
|
stride = (stride > 0) ? stride : (stride * -1);
|
|
|
|
|
|
if (!FreeImage.GetTypeParameters(type, bpp, out redMask, out greenMask, out blueMask))
|
|
|
{
|
|
|
throw new ArgumentException("bpp and type are invalid or not supported.");
|
|
|
}
|
|
|
|
|
|
dib = FreeImage.ConvertFromRawBits(
|
|
|
scan0, type, width, height, stride, (uint)bpp, redMask, greenMask, blueMask, topDown);
|
|
|
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new Exception(ErrorCreatingBitmap);
|
|
|
}
|
|
|
AddMemoryPressure();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class bases on the specified size,
|
|
|
/// pixel format and pixel data.
|
|
|
/// </summary>
|
|
|
/// <param name="width">The width, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="height">The height, in pixels, of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="stride">Integer that specifies the byte offset between the beginning
|
|
|
/// of one scan line and the next. This is usually (but not necessarily)
|
|
|
/// the number of bytes in the pixel format (for example, 2 for 16 bits per pixel)
|
|
|
/// multiplied by the width of the bitmap. The value passed to this parameter must
|
|
|
/// be a multiple of four..</param>
|
|
|
/// <param name="bpp">The color depth of the new <see cref="FreeImageBitmap"/></param>
|
|
|
/// <param name="type">The type for the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="bits">Array of bytes containing the bitmap data.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="ArgumentException"><paramref name="format"/> is invalid.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="width"/> or <paramref name="height"/> are less or equal zero.</exception>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="bits"/> is null</exception>
|
|
|
public FreeImageBitmap(int width, int height, int stride, int bpp, FREE_IMAGE_TYPE type, byte[] bits)
|
|
|
{
|
|
|
if (width <= 0)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("width");
|
|
|
}
|
|
|
if (height <= 0)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("height");
|
|
|
}
|
|
|
if (bits == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("bits");
|
|
|
}
|
|
|
uint redMask, greenMask, blueMask;
|
|
|
bool topDown = (stride > 0);
|
|
|
stride = (stride > 0) ? stride : (stride * -1);
|
|
|
|
|
|
if (!FreeImage.GetTypeParameters(type, bpp, out redMask, out greenMask, out blueMask))
|
|
|
{
|
|
|
throw new ArgumentException("bpp and type are invalid or not supported.");
|
|
|
}
|
|
|
|
|
|
dib = FreeImage.ConvertFromRawBits(
|
|
|
bits, type, width, height, stride, (uint)bpp, redMask, greenMask, blueMask, topDown);
|
|
|
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new Exception(ErrorCreatingBitmap);
|
|
|
}
|
|
|
AddMemoryPressure();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="FreeImageBitmap"/> class.
|
|
|
/// </summary>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="SerializationException">The operation failed.</exception>
|
|
|
public FreeImageBitmap(SerializationInfo info, StreamingContext context)
|
|
|
{
|
|
|
try
|
|
|
{
|
|
|
byte[] data = (byte[])info.GetValue("Bitmap Data", typeof(byte[]));
|
|
|
if ((data != null) && (data.Length > 0))
|
|
|
{
|
|
|
MemoryStream memory = new MemoryStream(data);
|
|
|
FREE_IMAGE_FORMAT format = FREE_IMAGE_FORMAT.FIF_TIFF;
|
|
|
dib = FreeImage.LoadFromStream(memory, ref format);
|
|
|
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new Exception(ErrorLoadingBitmap);
|
|
|
}
|
|
|
|
|
|
AddMemoryPressure();
|
|
|
}
|
|
|
}
|
|
|
catch (Exception ex)
|
|
|
{
|
|
|
throw new SerializationException("Deserialization failed.", ex);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Frees all managed and unmanaged ressources.
|
|
|
/// </summary>
|
|
|
~FreeImageBitmap()
|
|
|
{
|
|
|
Dispose(false);
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Operators
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a <see cref="FreeImageBitmap"/> instance to a <see cref="Bitmap"/> instance.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="FreeImageBitmap"/> instance.</param>
|
|
|
/// <returns>A new instance of <see cref="Bitmap"/> initialized to <paramref name="value"/>.</returns>
|
|
|
/// <remarks>
|
|
|
/// The explicit conversion from <see cref="FreeImageBitmap"/> into Bitmap
|
|
|
/// allows to create an instance on the fly and use it as if
|
|
|
/// was a Bitmap. This way it can be directly used with a
|
|
|
/// PixtureBox for example without having to call any
|
|
|
/// conversion operations.
|
|
|
/// </remarks>
|
|
|
public static explicit operator Bitmap(FreeImageBitmap value)
|
|
|
{
|
|
|
return value.ToBitmap();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a <see cref="Bitmap"/> instance to a <see cref="FreeImageBitmap"/> instance.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="Bitmap"/> instance.</param>
|
|
|
/// <returns>A new instance of <see cref="FreeImageBitmap"/> initialized to <paramref name="value"/>.</returns>
|
|
|
/// <remarks>
|
|
|
/// The explicit conversion from <see cref="Bitmap"/> into <see cref="FreeImageBitmap"/>
|
|
|
/// allows to create an instance on the fly to perform
|
|
|
/// image processing operations and converting it back.
|
|
|
/// </remarks>
|
|
|
public static explicit operator FreeImageBitmap(Bitmap value)
|
|
|
{
|
|
|
return new FreeImageBitmap(value);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Determines whether two specified <see cref="FreeImageBitmap"/> objects have the same value.
|
|
|
/// </summary>
|
|
|
/// <param name="left">A <see cref="FreeImageBitmap"/> or a null reference (<b>Nothing</b> in Visual Basic).</param>
|
|
|
/// <param name="right">A <see cref="FreeImageBitmap"/> or a null reference (<b>Nothing</b> in Visual Basic).</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the value of left is the same as the value of right; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(FreeImageBitmap left, FreeImageBitmap right)
|
|
|
{
|
|
|
if (object.ReferenceEquals(left, right))
|
|
|
{
|
|
|
return true;
|
|
|
}
|
|
|
else if (object.ReferenceEquals(left, null) || object.ReferenceEquals(right, null))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
left.EnsureNotDisposed();
|
|
|
right.EnsureNotDisposed();
|
|
|
return FreeImage.Compare(left.dib, right.dib, FREE_IMAGE_COMPARE_FLAGS.COMPLETE);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Determines whether two specified <see cref="FreeImageBitmap"/> objects have different values.
|
|
|
/// </summary>
|
|
|
/// <param name="left">A <see cref="FreeImageBitmap"/> or a null reference (<b>Nothing</b> in Visual Basic).</param>
|
|
|
/// <param name="right">A <see cref="FreeImageBitmap"/> or a null reference (<b>Nothing</b> in Visual Basic).</param>
|
|
|
/// <returns>
|
|
|
/// true if the value of left is different from the value of right; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(FreeImageBitmap left, FreeImageBitmap right)
|
|
|
{
|
|
|
return (!(left == right));
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Properties
|
|
|
|
|
|
/// <summary>
|
|
|
/// Type of the bitmap.
|
|
|
/// </summary>
|
|
|
public FREE_IMAGE_TYPE ImageType
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.GetImageType(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Number of palette entries.
|
|
|
/// </summary>
|
|
|
public int ColorsUsed
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return (int)FreeImage.GetColorsUsed(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// The number of unique colors actually used by the bitmap. This might be different from
|
|
|
/// what ColorsUsed returns, which actually returns the palette size for palletised images.
|
|
|
/// Works for FIT_BITMAP type bitmaps only.
|
|
|
/// </summary>
|
|
|
public int UniqueColors
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.GetUniqueColors(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// The size of one pixel in the bitmap in bits.
|
|
|
/// </summary>
|
|
|
public int ColorDepth
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return (int)FreeImage.GetBPP(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Width of the bitmap in pixel units.
|
|
|
/// </summary>
|
|
|
public int Width
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return (int)FreeImage.GetWidth(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Height of the bitmap in pixel units.
|
|
|
/// </summary>
|
|
|
public int Height
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return (int)FreeImage.GetHeight(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the width of the bitmap in bytes, rounded to the next 32-bit boundary.
|
|
|
/// </summary>
|
|
|
public int Pitch
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return (int)FreeImage.GetPitch(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Size of the bitmap in memory.
|
|
|
/// </summary>
|
|
|
public int DataSize
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return (int)FreeImage.GetDIBSize(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a structure that represents the palette of a FreeImage bitmap.
|
|
|
/// </summary>
|
|
|
/// <exception cref="InvalidOperationException"><see cref="HasPalette"/> is false.</exception>
|
|
|
public Palette Palette
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (HasPalette)
|
|
|
{
|
|
|
return new Palette(dib);
|
|
|
}
|
|
|
throw new InvalidOperationException("This bitmap does not have a palette.");
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets whether the bitmap is RGB 555.
|
|
|
/// </summary>
|
|
|
public bool IsRGB555
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.IsRGB555(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets whether the bitmap is RGB 565.
|
|
|
/// </summary>
|
|
|
public bool IsRGB565
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.IsRGB565(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the horizontal resolution, in pixels per inch, of this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public float HorizontalResolution
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return (float)FreeImage.GetResolutionX(dib);
|
|
|
}
|
|
|
private set
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImage.SetResolutionX(dib, (uint)value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the vertical resolution, in pixels per inch, of this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public float VerticalResolution
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return (float)FreeImage.GetResolutionY(dib);
|
|
|
}
|
|
|
private set
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImage.SetResolutionY(dib, (uint)value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the <see cref="BITMAPINFOHEADER"/> structure of this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public BITMAPINFOHEADER InfoHeader
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.GetInfoHeaderEx(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the <see cref="BITMAPINFO"/> structure of a this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public BITMAPINFO Info
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.GetInfoEx(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Investigates the color type of this <see cref="FreeImageBitmap"/>
|
|
|
/// by reading the bitmaps pixel bits and analysing them.
|
|
|
/// </summary>
|
|
|
public FREE_IMAGE_COLOR_TYPE ColorType
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.GetColorType(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Bit pattern describing the red color component of a pixel in this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public uint RedMask
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.GetRedMask(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Bit pattern describing the green color component of a pixel in this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public uint GreenMask
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.GetGreenMask(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Bit pattern describing the blue color component of a pixel in this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public uint BlueMask
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.GetBlueMask(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Number of transparent colors in a palletised <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public int TransparencyCount
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return (int)FreeImage.GetTransparencyCount(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Get or sets transparency table of this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public byte[] TransparencyTable
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.GetTransparencyTableEx(dib);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImage.SetTransparencyTable(dib, value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets whether this <see cref="FreeImageBitmap"/> is transparent.
|
|
|
/// </summary>
|
|
|
public bool IsTransparent
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.IsTransparent(dib);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImage.SetTransparent(dib, value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets whether this <see cref="FreeImageBitmap"/> has a file background color.
|
|
|
/// </summary>
|
|
|
public bool HasBackgroundColor
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.HasBackgroundColor(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the background color of this <see cref="FreeImageBitmap"/>.
|
|
|
/// In case the value is null, the background color is removed.
|
|
|
/// </summary>
|
|
|
/// <exception cref="InvalidOperationException">Get: There is no background color available.</exception>
|
|
|
/// <exception cref="Exception">Set: Setting background color failed.</exception>
|
|
|
public Color? BackgroundColor
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (!FreeImage.HasBackgroundColor(dib))
|
|
|
{
|
|
|
throw new InvalidOperationException("No background color available.");
|
|
|
}
|
|
|
RGBQUAD rgbq;
|
|
|
FreeImage.GetBackgroundColor(dib, out rgbq);
|
|
|
return rgbq.Color;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (!FreeImage.SetBackgroundColor(dib, (value.HasValue ? new RGBQUAD[] { value.Value } : null)))
|
|
|
{
|
|
|
throw new Exception("Setting background color failed.");
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Pointer to the data-bits of this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public IntPtr Bits
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.GetBits(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Width, in bytes, of this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public int Line
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return (int)FreeImage.GetLine(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Pointer to the scanline of the top most pixel row of this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public IntPtr Scan0
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.GetScanLine(dib, (int)(FreeImage.GetHeight(dib) - 1));
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Width, in bytes, of this <see cref="FreeImageBitmap"/>.
|
|
|
/// In case this <see cref="FreeImageBitmap"/> is top down <b>Stride</b> will be positive, else negative.
|
|
|
/// </summary>
|
|
|
public int Stride
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return -Line;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets attribute flags for the pixel data of this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public unsafe int Flags
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
int result = 0;
|
|
|
byte alpha;
|
|
|
int cd = ColorDepth;
|
|
|
|
|
|
if ((cd == 32) || (FreeImage.GetTransparencyCount(dib) != 0))
|
|
|
{
|
|
|
result += (int)ImageFlags.HasAlpha;
|
|
|
}
|
|
|
|
|
|
if (cd == 32)
|
|
|
{
|
|
|
uint width = FreeImage.GetWidth(dib);
|
|
|
uint height = FreeImage.GetHeight(dib);
|
|
|
for (int y = 0; y < height; y++)
|
|
|
{
|
|
|
RGBQUAD* scanline = (RGBQUAD*)FreeImage.GetScanLine(dib, y);
|
|
|
for (int x = 0; x < width; x++)
|
|
|
{
|
|
|
alpha = scanline[x].Color.A;
|
|
|
if (alpha != byte.MinValue && alpha != byte.MaxValue)
|
|
|
{
|
|
|
result += (int)ImageFlags.HasTranslucent;
|
|
|
y = (int)height;
|
|
|
break;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
else if (FreeImage.GetTransparencyCount(dib) != 0)
|
|
|
{
|
|
|
byte[] transTable = FreeImage.GetTransparencyTableEx(dib);
|
|
|
for (int i = 0; i < transTable.Length; i++)
|
|
|
{
|
|
|
if (transTable[i] != byte.MinValue && transTable[i] != byte.MaxValue)
|
|
|
{
|
|
|
result += (int)ImageFlags.HasTranslucent;
|
|
|
break;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
if (FreeImage.GetICCProfileEx(dib).IsCMYK)
|
|
|
{
|
|
|
result += (int)ImageFlags.ColorSpaceCmyk;
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
result += (int)ImageFlags.ColorSpaceRgb;
|
|
|
}
|
|
|
|
|
|
if (FreeImage.GetColorType(dib) == FREE_IMAGE_COLOR_TYPE.FIC_MINISBLACK ||
|
|
|
FreeImage.GetColorType(dib) == FREE_IMAGE_COLOR_TYPE.FIC_MINISWHITE)
|
|
|
{
|
|
|
result += (int)ImageFlags.ColorSpaceGray;
|
|
|
}
|
|
|
|
|
|
if (originalFormat == FREE_IMAGE_FORMAT.FIF_BMP ||
|
|
|
originalFormat == FREE_IMAGE_FORMAT.FIF_FAXG3 ||
|
|
|
originalFormat == FREE_IMAGE_FORMAT.FIF_ICO ||
|
|
|
originalFormat == FREE_IMAGE_FORMAT.FIF_JPEG ||
|
|
|
originalFormat == FREE_IMAGE_FORMAT.FIF_PCX ||
|
|
|
originalFormat == FREE_IMAGE_FORMAT.FIF_PNG ||
|
|
|
originalFormat == FREE_IMAGE_FORMAT.FIF_PSD ||
|
|
|
originalFormat == FREE_IMAGE_FORMAT.FIF_TIFF)
|
|
|
{
|
|
|
result += (int)ImageFlags.HasRealDpi;
|
|
|
}
|
|
|
|
|
|
return result;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the width and height of this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public SizeF PhysicalDimension
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return new SizeF((float)FreeImage.GetWidth(dib), (float)FreeImage.GetHeight(dib));
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the pixel format for this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public PixelFormat PixelFormat
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.GetPixelFormat(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets IDs of the property items stored in this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public int[] PropertyIdList
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
List<int> list = new List<int>();
|
|
|
ImageMetadata metaData = new ImageMetadata(dib, true);
|
|
|
|
|
|
foreach (MetadataModel metadataModel in metaData)
|
|
|
{
|
|
|
foreach (MetadataTag metadataTag in metadataModel)
|
|
|
{
|
|
|
list.Add(metadataTag.ID);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
return list.ToArray();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets all the property items (pieces of metadata) stored in this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public PropertyItem[] PropertyItems
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
List<PropertyItem> list = new List<PropertyItem>();
|
|
|
ImageMetadata metaData = new ImageMetadata(dib, true);
|
|
|
|
|
|
foreach (MetadataModel metadataModel in metaData)
|
|
|
{
|
|
|
foreach (MetadataTag metadataTag in metadataModel)
|
|
|
{
|
|
|
list.Add(metadataTag.GetPropertyItem());
|
|
|
}
|
|
|
}
|
|
|
|
|
|
return list.ToArray();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the format of this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public ImageFormat RawFormat
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
Attribute guidAttribute =
|
|
|
Attribute.GetCustomAttribute(
|
|
|
typeof(FreeImageBitmap), typeof(System.Runtime.InteropServices.GuidAttribute)
|
|
|
);
|
|
|
return (guidAttribute == null) ?
|
|
|
null :
|
|
|
new ImageFormat(new Guid(((GuidAttribute)guidAttribute).Value));
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the width and height, in pixels, of this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public Size Size
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return new Size(Width, Height);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets an object that provides additional data about the <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public Object Tag
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return tag;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
tag = value;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets whether this <see cref="FreeImageBitmap"/> has been disposed.
|
|
|
/// </summary>
|
|
|
public bool IsDisposed
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return disposed;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a new instance of a metadata representing class.
|
|
|
/// </summary>
|
|
|
public ImageMetadata Metadata
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return new ImageMetadata(dib, true);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the comment of this <see cref="FreeImageBitmap"/>.
|
|
|
/// Supported formats are JPEG, PNG and GIF.
|
|
|
/// </summary>
|
|
|
public string Comment
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.GetImageComment(dib);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImage.SetImageComment(dib, value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns whether this <see cref="FreeImageBitmap"/> has a palette.
|
|
|
/// </summary>
|
|
|
public bool HasPalette
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return (FreeImage.GetPalette(dib) != IntPtr.Zero);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the entry used as transparent color in this <see cref="FreeImageBitmap"/>.
|
|
|
/// Only works for 1-, 4- and 8-bpp.
|
|
|
/// </summary>
|
|
|
public int TransparentIndex
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.GetTransparentIndex(dib);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImage.SetTransparentIndex(dib, value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the number of frames in this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public int FrameCount
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return frameCount;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the ICCProfile structure of this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public FIICCPROFILE ICCProfile
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.GetICCProfileEx(dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the format of the original image in case
|
|
|
/// this <see cref="FreeImageBitmap"/> was loaded from a file or stream.
|
|
|
/// </summary>
|
|
|
public FREE_IMAGE_FORMAT ImageFormat
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return originalFormat;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the encapsulated FIBITMAP.
|
|
|
/// </summary>
|
|
|
internal FIBITMAP Dib
|
|
|
{
|
|
|
get { EnsureNotDisposed(); return dib; }
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Methods
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the bounds of this <see cref="FreeImageBitmap"/> in the specified unit.
|
|
|
/// </summary>
|
|
|
/// <param name="pageUnit">One of the <see cref="System.Drawing.GraphicsUnit"/> values indicating
|
|
|
/// the unit of measure for the bounding rectangle.</param>
|
|
|
/// <returns>The <see cref="System.Drawing.RectangleF"/> that represents the bounds of this
|
|
|
/// <see cref="FreeImageBitmap"/>, in the specified unit.</returns>
|
|
|
public RectangleF GetBounds(ref GraphicsUnit pageUnit)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
pageUnit = GraphicsUnit.Pixel;
|
|
|
return new RectangleF(
|
|
|
0f,
|
|
|
0f,
|
|
|
(float)FreeImage.GetWidth(dib),
|
|
|
(float)FreeImage.GetHeight(dib));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the specified property item from this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="propid">The ID of the property item to get.</param>
|
|
|
/// <returns>The <see cref="PropertyItem"/> this method gets.</returns>
|
|
|
public PropertyItem GetPropertyItem(int propid)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
ImageMetadata metadata = new ImageMetadata(dib, true);
|
|
|
foreach (MetadataModel metadataModel in metadata)
|
|
|
{
|
|
|
foreach (MetadataTag tag in metadataModel)
|
|
|
{
|
|
|
if (tag.ID == propid)
|
|
|
{
|
|
|
return tag.GetPropertyItem();
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
return null;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a thumbnail for this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="thumbWidth">The width, in pixels, of the requested thumbnail image.</param>
|
|
|
/// <param name="thumbHeight">The height, in pixels, of the requested thumbnail image.</param>
|
|
|
/// <param name="callback">Ignored.</param>
|
|
|
/// <param name="callBackData">Ignored.</param>
|
|
|
/// <returns>A <see cref="FreeImageBitmap"/> that represents the thumbnail.</returns>
|
|
|
public FreeImageBitmap GetThumbnailImage(int thumbWidth, int thumbHeight,
|
|
|
Image.GetThumbnailImageAbort callback, IntPtr callBackData)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImageBitmap result = null;
|
|
|
FIBITMAP newDib = FreeImage.Rescale(
|
|
|
dib, thumbWidth, thumbHeight, FREE_IMAGE_FILTER.FILTER_BICUBIC);
|
|
|
if (!newDib.IsNull)
|
|
|
{
|
|
|
result = new FreeImageBitmap(newDib);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a thumbnail for this <see cref="FreeImageBitmap"/>, keeping aspect ratio.
|
|
|
/// <paramref name="maxPixelSize"/> defines the maximum width or height
|
|
|
/// of the thumbnail.
|
|
|
/// </summary>
|
|
|
/// <param name="maxPixelSize">Thumbnail square size.</param>
|
|
|
/// <param name="convert">When true HDR images are transperantly
|
|
|
/// converted to standard images.</param>
|
|
|
/// <returns>The thumbnail in a new instance.</returns>
|
|
|
public FreeImageBitmap GetThumbnailImage(int maxPixelSize, bool convert)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImageBitmap result = null;
|
|
|
FIBITMAP newDib = FreeImage.MakeThumbnail(dib, maxPixelSize, convert);
|
|
|
if (!newDib.IsNull)
|
|
|
{
|
|
|
result = new FreeImageBitmap(newDib);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts this <see cref="FreeImageBitmap"/> instance to a <see cref="Bitmap"/> instance.
|
|
|
/// </summary>
|
|
|
/// <returns>A new instance of <see cref="Bitmap"/> initialized this instance.</returns>
|
|
|
public Bitmap ToBitmap()
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.GetBitmap(dib, true);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns an instance of <see cref="Scanline<T>"/>, representing the scanline
|
|
|
/// specified by <paramref name="scanline"/> of this <see cref="FreeImageBitmap"/>.
|
|
|
/// Since FreeImage bitmaps are always bottum up aligned, keep in mind that scanline 0 is the
|
|
|
/// bottom-most line of the image.
|
|
|
/// </summary>
|
|
|
/// <param name="scanline">Number of the scanline to retrieve.</param>
|
|
|
/// <returns>An instance of <see cref="Scanline<T>"/> representing the
|
|
|
/// <paramref name="scanline"/>th scanline.</returns>
|
|
|
/// <remarks>
|
|
|
/// List of return-types of <b>T</b>:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader><term>Color Depth / Type</term><description><see cref="Type">Result Type</see></description></listheader>
|
|
|
/// <item><term>1 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="FI1BIT"/></description></item>
|
|
|
/// <item><term>4 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="FI4BIT"/></description></item>
|
|
|
/// <item><term>8 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="Byte"/></description></item>
|
|
|
/// <item><term>16 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="UInt16"/></description></item>
|
|
|
/// <item><term>16 - 555 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="FI16RGB555"/></description></item>
|
|
|
/// <item><term>16 - 565 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="FI16RGB565"/></description></item>
|
|
|
/// <item><term>24 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="RGBTRIPLE"/></description></item>
|
|
|
/// <item><term>32 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="RGBQUAD"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_COMPLEX"/></term><description><see cref="FICOMPLEX"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_DOUBLE"/></term><description><see cref="Double"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_FLOAT"/></term><description><see cref="Single"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_INT16"/></term><description><see cref="Int16"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_INT32"/></term><description><see cref="Int32"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_RGB16"/></term><description><see cref="FIRGB16"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_RGBA16"/></term><description><see cref="FIRGBA16"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_RGBAF"/></term><description><see cref="FIRGBAF"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_RGBF"/></term><description><see cref="FIRGBF"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_UINT16"/></term><description><see cref="UInt16"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_UINT32"/></term><description><see cref="UInt32"/></description></item>
|
|
|
/// </list>
|
|
|
/// </remarks>
|
|
|
/// <example>
|
|
|
/// <code>
|
|
|
/// FreeImageBitmap bitmap = new FreeImageBitmap(@"C:\Pictures\picture.bmp");
|
|
|
/// if (bitmap.ColorDepth == 32)
|
|
|
/// {
|
|
|
/// Scanline<RGBQUAD> scanline = bitmap.GetScanline<RGBQUAD>(0);
|
|
|
/// foreach (RGBQUAD pixel in scanline)
|
|
|
/// {
|
|
|
/// Console.WriteLine(pixel);
|
|
|
/// }
|
|
|
/// }
|
|
|
/// </code>
|
|
|
/// </example>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// The bitmap's type or color depth are not supported.
|
|
|
/// </exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="scanline"/> is no valid value.
|
|
|
/// </exception>
|
|
|
public Scanline<T> GetScanline<T>(int scanline) where T : struct
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return new Scanline<T>(dib, scanline);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns an instance of <see cref="Scanline<T>"/>, representing the scanline
|
|
|
/// specified by <paramref name="scanline"/> of this <see cref="FreeImageBitmap"/>.
|
|
|
/// Since FreeImage bitmaps are always bottum up aligned, keep in mind that scanline 0 is the
|
|
|
/// bottom-most line of the image.
|
|
|
/// </summary>
|
|
|
/// <param name="scanline">Number of the scanline to retrieve.</param>
|
|
|
/// <returns>An instance of <see cref="Scanline<T>"/> representing the
|
|
|
/// <paramref name="scanline"/>th scanline.</returns>
|
|
|
/// <remarks>
|
|
|
/// List of return-types of <b>T</b>:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader><term>Color Depth / Type</term><description><see cref="Type">Result Type</see></description></listheader>
|
|
|
/// <item><term>1 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="FI1BIT"/></description></item>
|
|
|
/// <item><term>4 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="FI4BIT"/></description></item>
|
|
|
/// <item><term>8 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="Byte"/></description></item>
|
|
|
/// <item><term>16 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="UInt16"/></description></item>
|
|
|
/// <item><term>16 - 555 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="FI16RGB555"/></description></item>
|
|
|
/// <item><term>16 - 565 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="FI16RGB565"/></description></item>
|
|
|
/// <item><term>24 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="RGBTRIPLE"/></description></item>
|
|
|
/// <item><term>32 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="RGBQUAD"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_COMPLEX"/></term><description><see cref="FICOMPLEX"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_DOUBLE"/></term><description><see cref="Double"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_FLOAT"/></term><description><see cref="Single"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_INT16"/></term><description><see cref="Int16"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_INT32"/></term><description><see cref="Int32"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_RGB16"/></term><description><see cref="FIRGB16"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_RGBA16"/></term><description><see cref="FIRGBA16"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_RGBAF"/></term><description><see cref="FIRGBAF"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_RGBF"/></term><description><see cref="FIRGBF"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_UINT16"/></term><description><see cref="UInt16"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_UINT32"/></term><description><see cref="UInt32"/></description></item>
|
|
|
/// </list>
|
|
|
/// </remarks>
|
|
|
/// <example>
|
|
|
/// <code>
|
|
|
/// FreeImageBitmap bitmap = new FreeImageBitmap(@"C:\Pictures\picture.bmp");
|
|
|
/// if (bitmap.ColorDepth == 32)
|
|
|
/// {
|
|
|
/// Scanline<RGBQUAD> scanline = (Scanline<RGBQUAD>)bitmap.GetScanline(0);
|
|
|
/// foreach (RGBQUAD pixel in scanline)
|
|
|
/// {
|
|
|
/// Console.WriteLine(pixel);
|
|
|
/// }
|
|
|
/// }
|
|
|
/// </code>
|
|
|
/// </example>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// The type of the bitmap or color depth are not supported.
|
|
|
/// </exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="scanline"/> is no valid value.
|
|
|
/// </exception>
|
|
|
public object GetScanline(int scanline)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
object result = null;
|
|
|
int width = (int)FreeImage.GetWidth(dib);
|
|
|
|
|
|
switch (FreeImage.GetImageType(dib))
|
|
|
{
|
|
|
case FREE_IMAGE_TYPE.FIT_BITMAP:
|
|
|
|
|
|
switch (FreeImage.GetBPP(dib))
|
|
|
{
|
|
|
case 1u: result = new Scanline<FI1BIT>(dib, scanline, width); break;
|
|
|
case 4u: result = new Scanline<FI4BIT>(dib, scanline, width); break;
|
|
|
case 8u: result = new Scanline<Byte>(dib, scanline, width); break;
|
|
|
case 16u:
|
|
|
if ((RedMask == FreeImage.FI16_555_RED_MASK) &&
|
|
|
(GreenMask == FreeImage.FI16_555_GREEN_MASK) &&
|
|
|
(BlueMask == FreeImage.FI16_555_BLUE_MASK))
|
|
|
{
|
|
|
result = new Scanline<FI16RGB555>(dib, scanline, width);
|
|
|
}
|
|
|
else if ((RedMask == FreeImage.FI16_565_RED_MASK) &&
|
|
|
(GreenMask == FreeImage.FI16_565_GREEN_MASK) &&
|
|
|
(BlueMask == FreeImage.FI16_565_BLUE_MASK))
|
|
|
{
|
|
|
result = new Scanline<FI16RGB565>(dib, scanline, width);
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
result = new Scanline<UInt16>(dib, scanline, width);
|
|
|
}
|
|
|
break;
|
|
|
case 24u: result = new Scanline<RGBTRIPLE>(dib, scanline, width); break;
|
|
|
case 32u: result = new Scanline<RGBQUAD>(dib, scanline, width); break;
|
|
|
default: throw new ArgumentException("Color depth is not supported.");
|
|
|
}
|
|
|
break;
|
|
|
|
|
|
case FREE_IMAGE_TYPE.FIT_COMPLEX: result = new Scanline<FICOMPLEX>(dib, scanline, width); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_DOUBLE: result = new Scanline<Double>(dib, scanline, width); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_FLOAT: result = new Scanline<Single>(dib, scanline, width); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_INT16: result = new Scanline<Int16>(dib, scanline, width); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_INT32: result = new Scanline<Int32>(dib, scanline, width); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_RGB16: result = new Scanline<FIRGB16>(dib, scanline, width); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_RGBA16: result = new Scanline<FIRGBA16>(dib, scanline, width); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_RGBAF: result = new Scanline<FIRGBAF>(dib, scanline, width); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_RGBF: result = new Scanline<FIRGBF>(dib, scanline, width); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_UINT16: result = new Scanline<UInt16>(dib, scanline, width); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_UINT32: result = new Scanline<UInt32>(dib, scanline, width); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_UNKNOWN:
|
|
|
default: throw new ArgumentException("Type is not supported.");
|
|
|
}
|
|
|
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a pointer to the specified scanline.
|
|
|
/// Due to FreeImage bitmaps are bottum up,
|
|
|
/// scanline 0 is the most bottom line of the image.
|
|
|
/// </summary>
|
|
|
/// <param name="scanline">Number of the scanline.</param>
|
|
|
/// <returns>Pointer to the scanline.</returns>
|
|
|
public IntPtr GetScanlinePointer(int scanline)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.GetScanLine(dib, scanline);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a list of structures, representing the scanlines of this <see cref="FreeImageBitmap"/>.
|
|
|
/// Due to FreeImage bitmaps are bottum up, scanline 0 is the
|
|
|
/// bottom-most line of the image.
|
|
|
/// Each color depth has a different representing structure due to different memory layouts.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// List of return-types of <b>T</b>:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader><term>Color Depth / Type</term><description><see cref="Type">Result Type of IEnmuerable<Scanline<T>></see></description></listheader>
|
|
|
/// <item><term>1 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="FI1BIT"/></description></item>
|
|
|
/// <item><term>4 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="FI4BIT"/></description></item>
|
|
|
/// <item><term>8 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="Byte"/></description></item>
|
|
|
/// <item><term>16 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="UInt16"/></description></item>
|
|
|
/// <item><term>16 - 555 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="FI16RGB555"/></description></item>
|
|
|
/// <item><term>16 - 565 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="FI16RGB565"/></description></item>
|
|
|
/// <item><term>24 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="RGBTRIPLE"/></description></item>
|
|
|
/// <item><term>32 (<see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>)</term><description><see cref="RGBQUAD"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_COMPLEX"/></term><description><see cref="FICOMPLEX"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_DOUBLE"/></term><description><see cref="Double"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_FLOAT"/></term><description><see cref="Single"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_INT16"/></term><description><see cref="Int16"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_INT32"/></term><description><see cref="Int32"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_RGB16"/></term><description><see cref="FIRGB16"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_RGBA16"/></term><description><see cref="FIRGBA16"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_RGBAF"/></term><description><see cref="FIRGBAF"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_RGBF"/></term><description><see cref="FIRGBF"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_UINT16"/></term><description><see cref="UInt16"/></description></item>
|
|
|
/// <item><term><see cref="FREE_IMAGE_TYPE.FIT_UINT32"/></term><description><see cref="UInt32"/></description></item>
|
|
|
/// </list>
|
|
|
/// </remarks>
|
|
|
public IList GetScanlines()
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
|
|
|
int height = (int)FreeImage.GetHeight(dib);
|
|
|
IList list;
|
|
|
|
|
|
switch (FreeImage.GetImageType(dib))
|
|
|
{
|
|
|
case FREE_IMAGE_TYPE.FIT_BITMAP:
|
|
|
|
|
|
switch (FreeImage.GetBPP(dib))
|
|
|
{
|
|
|
case 1u: list = new List<Scanline<FI1BIT>>(height); break;
|
|
|
case 4u: list = new List<Scanline<FI4BIT>>(height); break;
|
|
|
case 8u: list = new List<Scanline<Byte>>(height); break;
|
|
|
case 16u:
|
|
|
if (FreeImage.IsRGB555(dib))
|
|
|
{
|
|
|
list = new List<Scanline<FI16RGB555>>(height);
|
|
|
}
|
|
|
else if (FreeImage.IsRGB565(dib))
|
|
|
{
|
|
|
list = new List<Scanline<FI16RGB565>>(height);
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
list = new List<Scanline<UInt16>>(height);
|
|
|
}
|
|
|
break;
|
|
|
case 24u: list = new List<Scanline<RGBTRIPLE>>(height); break;
|
|
|
case 32u: list = new List<Scanline<RGBQUAD>>(height); break;
|
|
|
default: throw new ArgumentException("Color depth is not supported.");
|
|
|
}
|
|
|
break;
|
|
|
|
|
|
case FREE_IMAGE_TYPE.FIT_COMPLEX: list = new List<Scanline<FICOMPLEX>>(height); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_DOUBLE: list = new List<Scanline<Double>>(height); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_FLOAT: list = new List<Scanline<Single>>(height); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_INT16: list = new List<Scanline<Int16>>(height); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_INT32: list = new List<Scanline<Int32>>(height); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_RGB16: list = new List<Scanline<FIRGB16>>(height); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_RGBA16: list = new List<Scanline<FIRGBA16>>(height); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_RGBAF: list = new List<Scanline<FIRGBAF>>(height); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_RGBF: list = new List<Scanline<FIRGBF>>(height); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_UINT16: list = new List<Scanline<UInt16>>(height); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_UINT32: list = new List<Scanline<UInt32>>(height); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_UNKNOWN:
|
|
|
default: throw new ArgumentException("Type is not supported.");
|
|
|
}
|
|
|
|
|
|
for (int i = 0; i < height; i++)
|
|
|
{
|
|
|
list.Add(GetScanline(i));
|
|
|
}
|
|
|
|
|
|
return list;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Removes the specified property item from this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="propid">The ID of the property item to remove.</param>
|
|
|
public void RemovePropertyItem(int propid)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
ImageMetadata mdata = new ImageMetadata(dib, true);
|
|
|
foreach (MetadataModel model in mdata)
|
|
|
{
|
|
|
foreach (MetadataTag tag in model)
|
|
|
{
|
|
|
if (tag.ID == propid)
|
|
|
{
|
|
|
model.RemoveTag(tag.Key);
|
|
|
return;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// This method rotates, flips, or rotates and flips this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="rotateFlipType">A RotateFlipType member
|
|
|
/// that specifies the type of rotation and flip to apply to this <see cref="FreeImageBitmap"/>.</param>
|
|
|
public void RotateFlip(RotateFlipType rotateFlipType)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
|
|
|
FIBITMAP newDib = new FIBITMAP();
|
|
|
uint bpp = FreeImage.GetBPP(dib);
|
|
|
|
|
|
switch (rotateFlipType)
|
|
|
{
|
|
|
case RotateFlipType.RotateNoneFlipX:
|
|
|
|
|
|
FreeImage.FlipHorizontal(dib);
|
|
|
break;
|
|
|
|
|
|
case RotateFlipType.RotateNoneFlipY:
|
|
|
|
|
|
FreeImage.FlipVertical(dib);
|
|
|
break;
|
|
|
|
|
|
case RotateFlipType.RotateNoneFlipXY:
|
|
|
|
|
|
FreeImage.FlipHorizontal(dib);
|
|
|
FreeImage.FlipVertical(dib);
|
|
|
break;
|
|
|
|
|
|
case RotateFlipType.Rotate90FlipNone:
|
|
|
|
|
|
newDib = (bpp == 4u) ? FreeImage.Rotate4bit(dib, 90d) : FreeImage.Rotate(dib, 90d);
|
|
|
break;
|
|
|
|
|
|
case RotateFlipType.Rotate90FlipX:
|
|
|
|
|
|
newDib = (bpp == 4u) ? FreeImage.Rotate4bit(dib, 90d) : FreeImage.Rotate(dib, 90d);
|
|
|
FreeImage.FlipHorizontal(newDib);
|
|
|
break;
|
|
|
|
|
|
case RotateFlipType.Rotate90FlipY:
|
|
|
|
|
|
newDib = (bpp == 4u) ? FreeImage.Rotate4bit(dib, 90d) : FreeImage.Rotate(dib, 90d);
|
|
|
FreeImage.FlipVertical(newDib);
|
|
|
break;
|
|
|
|
|
|
case RotateFlipType.Rotate90FlipXY:
|
|
|
|
|
|
newDib = (bpp == 4u) ? FreeImage.Rotate4bit(dib, 90d) : FreeImage.Rotate(dib, 90d);
|
|
|
FreeImage.FlipHorizontal(newDib);
|
|
|
FreeImage.FlipVertical(newDib);
|
|
|
break;
|
|
|
|
|
|
case RotateFlipType.Rotate180FlipXY:
|
|
|
newDib = FreeImage.Clone(dib);
|
|
|
break;
|
|
|
}
|
|
|
ReplaceDib(newDib);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies the metadata from another <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">The bitmap to read the metadata from.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="bitmap"/> is a null reference.
|
|
|
/// </exception>
|
|
|
public void CloneMetadataFrom(FreeImageBitmap bitmap)
|
|
|
{
|
|
|
if (bitmap == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("bitmap");
|
|
|
}
|
|
|
EnsureNotDisposed();
|
|
|
bitmap.EnsureNotDisposed();
|
|
|
FreeImage.CloneMetadata(dib, bitmap.dib);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies the metadata from another <see cref="FreeImageBitmap"/> using
|
|
|
/// the provided options.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">The bitmap to read the metadata from.</param>
|
|
|
/// <param name="flags">Specifies the way the metadata is copied.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="bitmap"/> is a null reference.
|
|
|
/// </exception>
|
|
|
public void CloneMetadataFrom(FreeImageBitmap bitmap, FREE_IMAGE_METADATA_COPY flags)
|
|
|
{
|
|
|
if (bitmap == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("bitmap");
|
|
|
}
|
|
|
EnsureNotDisposed();
|
|
|
bitmap.EnsureNotDisposed();
|
|
|
FreeImage.CloneMetadataEx(bitmap.dib, dib, flags);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves this <see cref="FreeImageBitmap"/> to the specified file.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">A string that contains the name of the file to which
|
|
|
/// to save this <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <exception cref="ArgumentException"><paramref name="filename"/> is null or empty.</exception>
|
|
|
/// <exception cref="Exception">Saving the image failed.</exception>
|
|
|
public void Save(string filename)
|
|
|
{
|
|
|
Save(filename, FREE_IMAGE_FORMAT.FIF_UNKNOWN, FREE_IMAGE_SAVE_FLAGS.DEFAULT);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves this <see cref="FreeImageBitmap"/> to the specified file in the specified format.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">A string that contains the name of the file to which
|
|
|
/// to save this <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="format">An <see cref="FREE_IMAGE_FORMAT"/> that specifies the format of the saved image.</param>
|
|
|
/// <exception cref="ArgumentException"><paramref name="filename"/> is null or empty.</exception>
|
|
|
/// <exception cref="Exception">Saving the image failed.</exception>
|
|
|
public void Save(string filename, FREE_IMAGE_FORMAT format)
|
|
|
{
|
|
|
Save(filename, format, FREE_IMAGE_SAVE_FLAGS.DEFAULT);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves this <see cref="FreeImageBitmap"/> to the specified file in the specified format
|
|
|
/// using the specified saving flags.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">A string that contains the name of the file to which
|
|
|
/// to save this <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="format">An <see cref="FREE_IMAGE_FORMAT"/> that specifies the format of the saved image.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <exception cref="ArgumentException"><paramref name="filename"/> is null or empty.</exception>
|
|
|
/// <exception cref="Exception">Saving the image failed.</exception>
|
|
|
public void Save(string filename, FREE_IMAGE_FORMAT format, FREE_IMAGE_SAVE_FLAGS flags)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (string.IsNullOrEmpty(filename))
|
|
|
{
|
|
|
throw new ArgumentException("filename");
|
|
|
}
|
|
|
if (!FreeImage.SaveEx(dib, filename, format, flags))
|
|
|
{
|
|
|
throw new Exception("Unable to save bitmap");
|
|
|
}
|
|
|
|
|
|
saveInformation.filename = filename;
|
|
|
saveInformation.format = format;
|
|
|
saveInformation.saveFlags = flags;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves this <see cref="FreeImageBitmap"/> to the specified stream in the specified format.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">The stream where this <see cref="FreeImageBitmap"/> will be saved.</param>
|
|
|
/// <param name="format">An <see cref="FREE_IMAGE_FORMAT"/> that specifies the format of the saved image.</param>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="stream"/> is a null reference.</exception>
|
|
|
/// <exception cref="Exception">Saving the image failed.</exception>
|
|
|
public void Save(Stream stream, FREE_IMAGE_FORMAT format)
|
|
|
{
|
|
|
Save(stream, format, FREE_IMAGE_SAVE_FLAGS.DEFAULT);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves this <see cref="FreeImageBitmap"/> to the specified stream in the specified format
|
|
|
/// using the specified saving flags.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">The stream where this <see cref="FreeImageBitmap"/> will be saved.</param>
|
|
|
/// <param name="format">An <see cref="FREE_IMAGE_FORMAT"/> that specifies the format of the saved image.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="stream"/> is a null reference.</exception>
|
|
|
/// <exception cref="Exception">Saving the image failed.</exception>
|
|
|
public void Save(Stream stream, FREE_IMAGE_FORMAT format, FREE_IMAGE_SAVE_FLAGS flags)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (stream == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("stream");
|
|
|
}
|
|
|
if (!FreeImage.SaveToStream(dib, stream, format, flags))
|
|
|
{
|
|
|
throw new Exception("Unable to save bitmap");
|
|
|
}
|
|
|
|
|
|
saveInformation.filename = null;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adds a frame to the file specified in a previous call to the <see cref="Save(String)"/>
|
|
|
/// method.
|
|
|
/// </summary>
|
|
|
/// <exception cref="InvalidOperationException">
|
|
|
/// This instance has not been saved to a file using Save(...) before.</exception>
|
|
|
public void SaveAdd()
|
|
|
{
|
|
|
SaveAdd(this);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adds a frame to the file specified in a previous call to the <see cref="Save(String)"/> method.
|
|
|
/// </summary>
|
|
|
/// <param name="insertPosition">The position at which the frame should be inserted.</param>
|
|
|
/// <exception cref="InvalidOperationException">
|
|
|
/// This instance has not yet been saved to a file using the Save(...) method.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException"><paramref name="insertPosition"/> is out of range.</exception>
|
|
|
public void SaveAdd(int insertPosition)
|
|
|
{
|
|
|
SaveAdd(this, insertPosition);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adds a frame to the file specified in a previous call to the <see cref="Save(String)"/> method.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">A <see cref="FreeImageBitmap"/> that contains the frame to add.</param>
|
|
|
/// <exception cref="InvalidOperationException">
|
|
|
/// This instance has not yet been saved to a file using the Save(...) method.</exception>
|
|
|
public void SaveAdd(FreeImageBitmap bitmap)
|
|
|
{
|
|
|
if (saveInformation.filename == null)
|
|
|
{
|
|
|
throw new InvalidOperationException("This operation requires a previous call of Save().");
|
|
|
}
|
|
|
|
|
|
SaveAdd(
|
|
|
saveInformation.filename,
|
|
|
bitmap,
|
|
|
saveInformation.format,
|
|
|
saveInformation.loadFlags,
|
|
|
saveInformation.saveFlags);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adds a frame to the file specified in a previous call to the <see cref="Save(String)"/> method.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">A <see cref="FreeImageBitmap"/> that contains the frame to add.</param>
|
|
|
/// <param name="insertPosition">The position at which the frame should be inserted.</param>
|
|
|
/// <exception cref="InvalidOperationException">
|
|
|
/// This instance has not yet been saved to a file using the Save(...) method.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException"><paramref name="insertPosition"/> is out of range.</exception>
|
|
|
public void SaveAdd(FreeImageBitmap bitmap, int insertPosition)
|
|
|
{
|
|
|
if (saveInformation.filename == null)
|
|
|
{
|
|
|
throw new InvalidOperationException("This operation requires a previous call of Save().");
|
|
|
}
|
|
|
|
|
|
SaveAdd(
|
|
|
saveInformation.filename,
|
|
|
bitmap,
|
|
|
insertPosition,
|
|
|
saveInformation.format,
|
|
|
saveInformation.loadFlags,
|
|
|
saveInformation.saveFlags);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adds a frame to the file specified.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">File to add this frame to.</param>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="filename"/> is a null reference.</exception>
|
|
|
/// <exception cref="FileNotFoundException"><paramref name="filename"/> does not exist.</exception>
|
|
|
/// <exception cref="Exception">Saving the image has failed.</exception>
|
|
|
public void SaveAdd(string filename)
|
|
|
{
|
|
|
SaveAdd(
|
|
|
filename,
|
|
|
this,
|
|
|
FREE_IMAGE_FORMAT.FIF_UNKNOWN,
|
|
|
FREE_IMAGE_LOAD_FLAGS.DEFAULT,
|
|
|
FREE_IMAGE_SAVE_FLAGS.DEFAULT);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adds a frame to the file specified.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">File to add this frame to.</param>
|
|
|
/// <param name="insertPosition">The position at which the frame should be inserted.</param>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="filename"/> is a null reference.</exception>
|
|
|
/// <exception cref="FileNotFoundException"><paramref name="filename"/> does not exist.</exception>
|
|
|
/// <exception cref="Exception">Saving the image has failed.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException"><paramref name="insertPosition"/> is out of range.</exception>
|
|
|
public void SaveAdd(string filename, int insertPosition)
|
|
|
{
|
|
|
SaveAdd(
|
|
|
filename,
|
|
|
this,
|
|
|
insertPosition,
|
|
|
FREE_IMAGE_FORMAT.FIF_UNKNOWN,
|
|
|
FREE_IMAGE_LOAD_FLAGS.DEFAULT,
|
|
|
FREE_IMAGE_SAVE_FLAGS.DEFAULT);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adds a frame to the file specified using the specified parameters.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">File to add this frame to.</param>
|
|
|
/// <param name="format">Format of the image.</param>
|
|
|
/// <param name="loadFlags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <param name="saveFlags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="filename"/> is a null reference.</exception>
|
|
|
/// <exception cref="FileNotFoundException"><paramref name="filename"/> does not exist.</exception>
|
|
|
/// <exception cref="Exception">Saving the image has failed.</exception>
|
|
|
public void SaveAdd(
|
|
|
string filename,
|
|
|
FREE_IMAGE_FORMAT format,
|
|
|
FREE_IMAGE_LOAD_FLAGS loadFlags,
|
|
|
FREE_IMAGE_SAVE_FLAGS saveFlags)
|
|
|
{
|
|
|
SaveAdd(
|
|
|
filename,
|
|
|
this,
|
|
|
format,
|
|
|
loadFlags,
|
|
|
saveFlags);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adds a frame to the file specified using the specified parameters.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">File to add this frame to.</param>
|
|
|
/// <param name="insertPosition">The position at which the frame should be inserted.</param>
|
|
|
/// <param name="format">Format of the image.</param>
|
|
|
/// <param name="loadFlags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <param name="saveFlags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="filename"/> is a null reference.</exception>
|
|
|
/// <exception cref="FileNotFoundException"><paramref name="filename"/> does not exist.</exception>
|
|
|
/// <exception cref="Exception">Saving the image has failed.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException"><paramref name="insertPosition"/> is out of range.</exception>
|
|
|
public void SaveAdd(
|
|
|
string filename,
|
|
|
int insertPosition,
|
|
|
FREE_IMAGE_FORMAT format,
|
|
|
FREE_IMAGE_LOAD_FLAGS loadFlags,
|
|
|
FREE_IMAGE_SAVE_FLAGS saveFlags)
|
|
|
{
|
|
|
SaveAdd(
|
|
|
filename,
|
|
|
this,
|
|
|
insertPosition,
|
|
|
format,
|
|
|
loadFlags,
|
|
|
saveFlags);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Selects the frame specified by the index.
|
|
|
/// </summary>
|
|
|
/// <param name="frameIndex">The index of the active frame.</param>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="frameIndex"/> is out of range.</exception>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="InvalidOperationException">The source of the bitmap is not available.
|
|
|
/// </exception>
|
|
|
public void SelectActiveFrame(int frameIndex)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if ((frameIndex < 0) || (frameIndex >= frameCount))
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("frameIndex");
|
|
|
}
|
|
|
|
|
|
if (frameIndex != this.frameIndex)
|
|
|
{
|
|
|
if (stream == null)
|
|
|
{
|
|
|
throw new InvalidOperationException("No source available.");
|
|
|
}
|
|
|
|
|
|
FREE_IMAGE_FORMAT format = originalFormat;
|
|
|
FIMULTIBITMAP mdib = FreeImage.OpenMultiBitmapFromStream(stream, ref format, saveInformation.loadFlags);
|
|
|
if (mdib.IsNull)
|
|
|
throw new Exception(ErrorLoadingBitmap);
|
|
|
|
|
|
try
|
|
|
{
|
|
|
if (frameIndex >= FreeImage.GetPageCount(mdib))
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("frameIndex");
|
|
|
}
|
|
|
|
|
|
FIBITMAP newDib = FreeImage.LockPage(mdib, frameIndex);
|
|
|
if (newDib.IsNull)
|
|
|
{
|
|
|
throw new Exception(ErrorLoadingFrame);
|
|
|
}
|
|
|
|
|
|
try
|
|
|
{
|
|
|
FIBITMAP clone = FreeImage.Clone(newDib);
|
|
|
if (clone.IsNull)
|
|
|
{
|
|
|
throw new Exception(ErrorCreatingBitmap);
|
|
|
}
|
|
|
ReplaceDib(clone);
|
|
|
}
|
|
|
finally
|
|
|
{
|
|
|
if (!newDib.IsNull)
|
|
|
{
|
|
|
FreeImage.UnlockPage(mdib, newDib, false);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
finally
|
|
|
{
|
|
|
if (!FreeImage.CloseMultiBitmapEx(ref mdib))
|
|
|
{
|
|
|
throw new Exception(ErrorUnloadBitmap);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
this.frameIndex = frameIndex;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a GDI bitmap object from this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
/// <returns>A handle to the GDI bitmap object that this method creates.</returns>
|
|
|
public IntPtr GetHbitmap()
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.GetHbitmap(dib, IntPtr.Zero, false);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a GDI bitmap object from this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="background">A <see cref="System.Drawing.Color"/> structure that specifies the background color.
|
|
|
/// This parameter is ignored if the bitmap is totally opaque.</param>
|
|
|
/// <returns>A handle to the GDI bitmap object that this method creates.</returns>
|
|
|
public IntPtr GetHbitmap(Color background)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
using (FreeImageBitmap temp = new FreeImageBitmap(this))
|
|
|
{
|
|
|
temp.BackgroundColor = background;
|
|
|
return temp.GetHbitmap();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the handle to an icon.
|
|
|
/// </summary>
|
|
|
/// <returns>A Windows handle to an icon with the same image as this <see cref="FreeImageBitmap"/>.</returns>
|
|
|
public IntPtr GetHicon()
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
using (Bitmap bitmap = FreeImage.GetBitmap(dib, true))
|
|
|
{
|
|
|
return bitmap.GetHicon();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a GDI bitmap object from this <see cref="FreeImageBitmap"/> with the same
|
|
|
/// color depth as the primary device.
|
|
|
/// </summary>
|
|
|
/// <returns>A handle to the GDI bitmap object that this method creates.</returns>
|
|
|
public IntPtr GetHbitmapForDevice()
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.GetBitmapForDevice(dib, IntPtr.Zero, false);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the <see cref="Color"/> of the specified pixel in this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="x">The x-coordinate of the pixel to retrieve.</param>
|
|
|
/// <param name="y">The y-coordinate of the pixel to retrieve.</param>
|
|
|
/// <returns>A <see cref="System.Drawing.Color"/> structure that represents the color of the specified pixel.</returns>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="NotSupportedException">The type of this bitmap is not supported.</exception>
|
|
|
public unsafe Color GetPixel(int x, int y)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (FreeImage.GetImageType(dib) == FREE_IMAGE_TYPE.FIT_BITMAP)
|
|
|
{
|
|
|
if (ColorDepth == 16 || ColorDepth == 24 || ColorDepth == 32)
|
|
|
{
|
|
|
RGBQUAD rgbq;
|
|
|
if (!FreeImage.GetPixelColor(dib, (uint)x, (uint)y, out rgbq))
|
|
|
{
|
|
|
throw new Exception("FreeImage.GetPixelColor() failed");
|
|
|
}
|
|
|
return rgbq.Color;
|
|
|
}
|
|
|
else if (ColorDepth == 1 || ColorDepth == 4 || ColorDepth == 8)
|
|
|
{
|
|
|
byte index;
|
|
|
if (!FreeImage.GetPixelIndex(dib, (uint)x, (uint)y, out index))
|
|
|
{
|
|
|
throw new Exception("FreeImage.GetPixelIndex() failed");
|
|
|
}
|
|
|
RGBQUAD* palette = (RGBQUAD*)FreeImage.GetPalette(dib);
|
|
|
return palette[index].Color;
|
|
|
}
|
|
|
}
|
|
|
throw new NotSupportedException("The type of the image is not supported");
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Makes the default transparent color transparent for this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
public void MakeTransparent()
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
MakeTransparent(Color.Transparent);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Makes the specified color transparent for this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="transparentColor">The <see cref="System.Drawing.Color"/> structure that represents
|
|
|
/// the color to make transparent.</param>
|
|
|
/// <exception cref="NotImplementedException">
|
|
|
/// This method is not implemented.</exception>
|
|
|
public void MakeTransparent(Color transparentColor)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
throw new System.NotImplementedException();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the <see cref="System.Drawing.Color"/> of the specified pixel in this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="x">The x-coordinate of the pixel to set.</param>
|
|
|
/// <param name="y">The y-coordinate of the pixel to set.</param>
|
|
|
/// <param name="color">A <see cref="System.Drawing.Color"/> structure that represents the color
|
|
|
/// to assign to the specified pixel.</param>
|
|
|
/// <exception cref="Exception">The operation failed.</exception>
|
|
|
/// <exception cref="NotSupportedException">The type of this bitmap is not supported.</exception>
|
|
|
public unsafe void SetPixel(int x, int y, Color color)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (FreeImage.GetImageType(dib) == FREE_IMAGE_TYPE.FIT_BITMAP)
|
|
|
{
|
|
|
if (ColorDepth == 16 || ColorDepth == 24 || ColorDepth == 32)
|
|
|
{
|
|
|
RGBQUAD rgbq = color;
|
|
|
if (!FreeImage.SetPixelColor(dib, (uint)x, (uint)y, ref rgbq))
|
|
|
{
|
|
|
throw new Exception("FreeImage.SetPixelColor() failed");
|
|
|
}
|
|
|
return;
|
|
|
}
|
|
|
else if (ColorDepth == 1 || ColorDepth == 4 || ColorDepth == 8)
|
|
|
{
|
|
|
uint colorsUsed = FreeImage.GetColorsUsed(dib);
|
|
|
RGBQUAD* palette = (RGBQUAD*)FreeImage.GetPalette(dib);
|
|
|
for (int i = 0; i < colorsUsed; i++)
|
|
|
{
|
|
|
if (palette[i].Color == color)
|
|
|
{
|
|
|
byte index = (byte)i;
|
|
|
if (!FreeImage.SetPixelIndex(dib, (uint)x, (uint)y, ref index))
|
|
|
{
|
|
|
throw new Exception("FreeImage.SetPixelIndex() failed");
|
|
|
}
|
|
|
return;
|
|
|
}
|
|
|
}
|
|
|
throw new ArgumentOutOfRangeException("color");
|
|
|
}
|
|
|
}
|
|
|
throw new NotSupportedException("The type of the image is not supported");
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the resolution for this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="xDpi">The horizontal resolution, in dots per inch, of this <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="yDpi">The vertical resolution, in dots per inch, of this <see cref="FreeImageBitmap"/>.</param>
|
|
|
public void SetResolution(float xDpi, float yDpi)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImage.SetResolutionX(dib, (uint)xDpi);
|
|
|
FreeImage.SetResolutionY(dib, (uint)yDpi);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// This function is not yet implemented.
|
|
|
/// </summary>
|
|
|
/// <exception cref="NotImplementedException">
|
|
|
/// This method is not implemented.</exception>
|
|
|
public BitmapData LockBits(Rectangle rect, ImageLockMode flags, PixelFormat format)
|
|
|
{
|
|
|
throw new NotImplementedException();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// This function is not yet implemented.
|
|
|
/// </summary>
|
|
|
/// <exception cref="NotImplementedException">
|
|
|
/// This method is not implemented.</exception>
|
|
|
public BitmapData LockBits(Rectangle rect, ImageLockMode flags, PixelFormat format, BitmapData bitmapData)
|
|
|
{
|
|
|
throw new NotImplementedException();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// This function is not yet implemented.
|
|
|
/// </summary>
|
|
|
/// <exception cref="NotImplementedException">
|
|
|
/// This method is not implemented.</exception>
|
|
|
public void UnlockBits(BitmapData bitmapdata)
|
|
|
{
|
|
|
throw new NotImplementedException();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts this <see cref="FreeImageBitmap"/> into a different color depth.
|
|
|
/// The parameter <paramref name="bpp"/> specifies color depth, greyscale conversion
|
|
|
/// and palette reorder.
|
|
|
/// <para>Adding the <see cref="FREE_IMAGE_COLOR_DEPTH.FICD_FORCE_GREYSCALE"/> flag
|
|
|
/// will first perform a convesion to greyscale. This can be done with any target
|
|
|
/// color depth.</para>
|
|
|
/// <para>Adding the <see cref="FREE_IMAGE_COLOR_DEPTH.FICD_REORDER_PALETTE"/> flag
|
|
|
/// will allow the algorithm to reorder the palette. This operation will not be performed to
|
|
|
/// non-greyscale images to prevent data loss by mistake.</para>
|
|
|
/// </summary>
|
|
|
/// <param name="bpp">A bitfield containing information about the conversion
|
|
|
/// to perform.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool ConvertColorDepth(FREE_IMAGE_COLOR_DEPTH bpp)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return ReplaceDib(FreeImage.ConvertColorDepth(dib, bpp, false));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts this <see cref="FreeImageBitmap"/> <see cref="FREE_IMAGE_TYPE"/> to
|
|
|
/// <paramref name="type"/> initializing a new instance.
|
|
|
/// In case source and destination type are the same, the operation fails.
|
|
|
/// An error message can be catched using the 'Message' event.
|
|
|
/// </summary>
|
|
|
/// <param name="type">Destination type.</param>
|
|
|
/// <param name="scaleLinear">True to scale linear, else false.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool ConvertType(FREE_IMAGE_TYPE type, bool scaleLinear)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return (ImageType == type) ? false : ReplaceDib(FreeImage.ConvertToType(dib, type, scaleLinear));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts this <see cref="FreeImageBitmap"/> <see cref="FreeImageBitmap"/> to <paramref name="type"/>.
|
|
|
/// In case source and destination type are the same, the operation fails.
|
|
|
/// An error message can be catched using the 'Message' event.
|
|
|
/// </summary>
|
|
|
/// <param name="type">Destination type.</param>
|
|
|
/// <param name="scaleLinear">True to scale linear, else false.</param>
|
|
|
/// <returns>The converted instance.</returns>
|
|
|
public FreeImageBitmap GetTypeConvertedInstance(FREE_IMAGE_TYPE type, bool scaleLinear)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImageBitmap result = null;
|
|
|
if (ImageType != type)
|
|
|
{
|
|
|
FIBITMAP newDib = FreeImage.ConvertToType(dib, type, scaleLinear);
|
|
|
if (!newDib.IsNull)
|
|
|
{
|
|
|
result = new FreeImageBitmap(newDib);
|
|
|
}
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts this <see cref="FreeImageBitmap"/> into a different color depth initializing
|
|
|
/// a new instance.
|
|
|
/// The parameter <paramref name="bpp"/> specifies color depth, greyscale conversion
|
|
|
/// and palette reorder.
|
|
|
/// <para>Adding the <see cref="FREE_IMAGE_COLOR_DEPTH.FICD_FORCE_GREYSCALE"/> flag will
|
|
|
/// first perform a convesion to greyscale. This can be done with any target color depth.</para>
|
|
|
/// <para>Adding the <see cref="FREE_IMAGE_COLOR_DEPTH.FICD_REORDER_PALETTE"/> flag will
|
|
|
/// allow the algorithm to reorder the palette. This operation will not be performed to
|
|
|
/// non-greyscale images to prevent data loss by mistake.</para>
|
|
|
/// </summary>
|
|
|
/// <param name="bpp">A bitfield containing information about the conversion
|
|
|
/// to perform.</param>
|
|
|
/// <returns>The converted instance.</returns>
|
|
|
public FreeImageBitmap GetColorConvertedInstance(FREE_IMAGE_COLOR_DEPTH bpp)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImageBitmap result = null;
|
|
|
FIBITMAP newDib = FreeImage.ConvertColorDepth(dib, bpp, false);
|
|
|
if (newDib == dib)
|
|
|
{
|
|
|
newDib = FreeImage.Clone(dib);
|
|
|
}
|
|
|
if (!newDib.IsNull)
|
|
|
{
|
|
|
result = new FreeImageBitmap(newDib);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Rescales this <see cref="FreeImageBitmap"/> to the specified size using the
|
|
|
/// specified filter.
|
|
|
/// </summary>
|
|
|
/// <param name="newSize">The Size structure that represent the
|
|
|
/// size of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="filter">Filter to use for resizing.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool Rescale(Size newSize, FREE_IMAGE_FILTER filter)
|
|
|
{
|
|
|
return Rescale(newSize.Width, newSize.Height, filter);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Rescales this <see cref="FreeImageBitmap"/> to the specified size using the
|
|
|
/// specified filter.
|
|
|
/// </summary>
|
|
|
/// <param name="width">Width of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="height">Height of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="filter">Filter to use for resizing.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool Rescale(int width, int height, FREE_IMAGE_FILTER filter)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return ReplaceDib(FreeImage.Rescale(dib, width, height, filter));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Rescales this <see cref="FreeImageBitmap"/> to the specified size using the
|
|
|
/// specified filter initializing a new instance.
|
|
|
/// </summary>
|
|
|
/// <param name="newSize">The Size structure that represent the
|
|
|
/// size of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="filter">Filter to use for resizing.</param>
|
|
|
/// <returns>The rescaled instance.</returns>
|
|
|
public FreeImageBitmap GetScaledInstance(Size newSize, FREE_IMAGE_FILTER filter)
|
|
|
{
|
|
|
return GetScaledInstance(newSize.Width, newSize.Height, filter);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Rescales this <see cref="FreeImageBitmap"/> to the specified size using the
|
|
|
/// specified filter initializing a new instance.
|
|
|
/// </summary>
|
|
|
/// <param name="width">Width of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="height">Height of the new <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="filter">Filter to use for resizing.</param>
|
|
|
/// <returns>The rescaled instance.</returns>
|
|
|
public FreeImageBitmap GetScaledInstance(int width, int height, FREE_IMAGE_FILTER filter)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImageBitmap result = null;
|
|
|
FIBITMAP newDib = FreeImage.Rescale(dib, width, height, filter);
|
|
|
if (!newDib.IsNull)
|
|
|
{
|
|
|
result = new FreeImageBitmap(newDib);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Enlarges or shrinks this <see cref="FreeImageBitmap"/> selectively per side and fills
|
|
|
/// newly added areas with the specified background color.
|
|
|
/// See <see cref="FreeImage.EnlargeCanvas<T>"/> for further details.
|
|
|
/// </summary>
|
|
|
/// <typeparam name="T">The type of the specified color.</typeparam>
|
|
|
/// <param name="left">The number of pixels, the image should be enlarged on its left side.
|
|
|
/// Negative values shrink the image on its left side.</param>
|
|
|
/// <param name="top">The number of pixels, the image should be enlarged on its top side.
|
|
|
/// Negative values shrink the image on its top side.</param>
|
|
|
/// <param name="right">The number of pixels, the image should be enlarged on its right side.
|
|
|
/// Negative values shrink the image on its right side.</param>
|
|
|
/// <param name="bottom">The number of pixels, the image should be enlarged on its bottom side.
|
|
|
/// Negative values shrink the image on its bottom side.</param>
|
|
|
/// <param name="color">The color, the enlarged sides of the image should be filled with.</param>
|
|
|
/// <returns><c>true</c> on success, <c>false</c> on failure.</returns>
|
|
|
public bool EnlargeCanvas<T>(int left, int top, int right, int bottom, T? color) where T : struct
|
|
|
{
|
|
|
return EnlargeCanvas(left, top, right, bottom, color, FREE_IMAGE_COLOR_OPTIONS.FICO_DEFAULT);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Enlarges or shrinks this <see cref="FreeImageBitmap"/> selectively per side and fills
|
|
|
/// newly added areas with the specified background color.
|
|
|
/// See <see cref="FreeImage.EnlargeCanvas<T>"/> for further details.
|
|
|
/// </summary>
|
|
|
/// <typeparam name="T">The type of the specified color.</typeparam>
|
|
|
/// <param name="left">The number of pixels, the image should be enlarged on its left side.
|
|
|
/// Negative values shrink the image on its left side.</param>
|
|
|
/// <param name="top">The number of pixels, the image should be enlarged on its top side.
|
|
|
/// Negative values shrink the image on its top side.</param>
|
|
|
/// <param name="right">The number of pixels, the image should be enlarged on its right side.
|
|
|
/// Negative values shrink the image on its right side.</param>
|
|
|
/// <param name="bottom">The number of pixels, the image should be enlarged on its bottom side.
|
|
|
/// Negative values shrink the image on its bottom side.</param>
|
|
|
/// <param name="color">The color, the enlarged sides of the image should be filled with.</param>
|
|
|
/// <param name="options">Options that affect the color search process for palletized images.</param>
|
|
|
/// <returns><c>true</c> on success, <c>false</c> on failure.</returns>
|
|
|
public bool EnlargeCanvas<T>(int left, int top, int right, int bottom,
|
|
|
T? color, FREE_IMAGE_COLOR_OPTIONS options) where T : struct
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return ReplaceDib(FreeImage.EnlargeCanvas(dib, left, top, right, bottom, color, options));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Enlarges or shrinks this <see cref="FreeImageBitmap"/> selectively per side and fills
|
|
|
/// newly added areas with the specified background color returning a new instance.
|
|
|
/// See <see cref="FreeImage.EnlargeCanvas<T>"/> for further details.
|
|
|
/// </summary>
|
|
|
/// <typeparam name="T">The type of the specified color.</typeparam>
|
|
|
/// <param name="left">The number of pixels, the image should be enlarged on its left side.
|
|
|
/// Negative values shrink the image on its left side.</param>
|
|
|
/// <param name="top">The number of pixels, the image should be enlarged on its top side.
|
|
|
/// Negative values shrink the image on its top side.</param>
|
|
|
/// <param name="right">The number of pixels, the image should be enlarged on its right side.
|
|
|
/// Negative values shrink the image on its right side.</param>
|
|
|
/// <param name="bottom">The number of pixels, the image should be enlarged on its bottom side.
|
|
|
/// Negative values shrink the image on its bottom side.</param>
|
|
|
/// <param name="color">The color, the enlarged sides of the image should be filled with.</param>
|
|
|
/// <returns>The enlarged instance.</returns>
|
|
|
public FreeImageBitmap GetEnlargedInstance<T>(int left, int top, int right, int bottom,
|
|
|
T? color) where T : struct
|
|
|
{
|
|
|
return GetEnlargedInstance(left, top, right, bottom, color, FREE_IMAGE_COLOR_OPTIONS.FICO_DEFAULT);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Enlarges or shrinks this <see cref="FreeImageBitmap"/> selectively per side and fills
|
|
|
/// newly added areas with the specified background color returning a new instance.
|
|
|
/// See <see cref="FreeImage.EnlargeCanvas<T>"/> for further details.
|
|
|
/// </summary>
|
|
|
/// <typeparam name="T">The type of the specified color.</typeparam>
|
|
|
/// <param name="left">The number of pixels, the image should be enlarged on its left side.
|
|
|
/// Negative values shrink the image on its left side.</param>
|
|
|
/// <param name="top">The number of pixels, the image should be enlarged on its top side.
|
|
|
/// Negative values shrink the image on its top side.</param>
|
|
|
/// <param name="right">The number of pixels, the image should be enlarged on its right side.
|
|
|
/// Negative values shrink the image on its right side.</param>
|
|
|
/// <param name="bottom">The number of pixels, the image should be enlarged on its bottom side.
|
|
|
/// Negative values shrink the image on its bottom side.</param>
|
|
|
/// <param name="color">The color, the enlarged sides of the image should be filled with.</param>
|
|
|
/// <param name="options">Options that affect the color search process for palletized images.</param>
|
|
|
/// <returns>The enlarged instance.</returns>
|
|
|
public FreeImageBitmap GetEnlargedInstance<T>(int left, int top, int right, int bottom,
|
|
|
T? color, FREE_IMAGE_COLOR_OPTIONS options) where T : struct
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImageBitmap result = null;
|
|
|
FIBITMAP newDib = FreeImage.EnlargeCanvas(dib, left, top, right, bottom, color, options);
|
|
|
if (!newDib.IsNull)
|
|
|
{
|
|
|
result = new FreeImageBitmap(newDib);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Quantizes this <see cref="FreeImageBitmap"/> from 24 bit to 8bit creating a new
|
|
|
/// palette with the specified <paramref name="paletteSize"/> using the specified
|
|
|
/// <paramref name="algorithm"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="algorithm">The color reduction algorithm to be used.</param>
|
|
|
/// <param name="paletteSize">Size of the desired output palette.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool Quantize(FREE_IMAGE_QUANTIZE algorithm, int paletteSize)
|
|
|
{
|
|
|
return Quantize(algorithm, paletteSize, 0, (RGBQUAD[])null);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Quantizes this <see cref="FreeImageBitmap"/> from 24 bit to 8bit creating a new
|
|
|
/// palette with the specified <paramref name="paletteSize"/> using the specified
|
|
|
/// <paramref name="algorithm"/> and the specified
|
|
|
/// <paramref name="reservePalette">palette</paramref> up to the
|
|
|
/// specified <paramref name="paletteSize">length</paramref>.
|
|
|
/// </summary>
|
|
|
/// <param name="algorithm">The color reduction algorithm to be used.</param>
|
|
|
/// <param name="paletteSize">Size of the desired output palette.</param>
|
|
|
/// <param name="reservePalette">The provided palette.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool Quantize(FREE_IMAGE_QUANTIZE algorithm, int paletteSize, Palette reservePalette)
|
|
|
{
|
|
|
return Quantize(algorithm, paletteSize, reservePalette.Length, reservePalette.Data);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Quantizes this <see cref="FreeImageBitmap"/> from 24 bit to 8bit creating a new
|
|
|
/// palette with the specified <paramref name="paletteSize"/> using the specified
|
|
|
/// <paramref name="algorithm"/> and the specified
|
|
|
/// <paramref name="reservePalette">palette</paramref> up to the
|
|
|
/// specified <paramref name="paletteSize">length</paramref>.
|
|
|
/// </summary>
|
|
|
/// <param name="algorithm">The color reduction algorithm to be used.</param>
|
|
|
/// <param name="paletteSize">Size of the desired output palette.</param>
|
|
|
/// <param name="reserveSize">Size of the provided palette of ReservePalette.</param>
|
|
|
/// <param name="reservePalette">The provided palette.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool Quantize(FREE_IMAGE_QUANTIZE algorithm, int paletteSize, int reserveSize, Palette reservePalette)
|
|
|
{
|
|
|
return Quantize(algorithm, paletteSize, reserveSize, reservePalette.Data);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Quantizes this <see cref="FreeImageBitmap"/> from 24 bit to 8bit creating a new
|
|
|
/// palette with the specified <paramref name="paletteSize"/> using the specified
|
|
|
/// <paramref name="algorithm"/> and the specified
|
|
|
/// <paramref name="reservePalette">palette</paramref> up to the
|
|
|
/// specified <paramref name="paletteSize">length</paramref>.
|
|
|
/// </summary>
|
|
|
/// <param name="algorithm">The color reduction algorithm to be used.</param>
|
|
|
/// <param name="paletteSize">Size of the desired output palette.</param>
|
|
|
/// <param name="reserveSize">Size of the provided palette of ReservePalette.</param>
|
|
|
/// <param name="reservePalette">The provided palette.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool Quantize(FREE_IMAGE_QUANTIZE algorithm, int paletteSize, int reserveSize, RGBQUAD[] reservePalette)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return ReplaceDib(FreeImage.ColorQuantizeEx(dib, algorithm, paletteSize, reserveSize, reservePalette));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Quantizes this <see cref="FreeImageBitmap"/> from 24 bit, using the specified
|
|
|
/// <paramref name="algorithm"/> initializing a new 8 bit instance with the
|
|
|
/// specified <paramref name="paletteSize"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="algorithm">The color reduction algorithm to be used.</param>
|
|
|
/// <param name="paletteSize">Size of the desired output palette.</param>
|
|
|
/// <returns>The quantized instance.</returns>
|
|
|
public FreeImageBitmap GetQuantizedInstance(FREE_IMAGE_QUANTIZE algorithm, int paletteSize)
|
|
|
{
|
|
|
return GetQuantizedInstance(algorithm, paletteSize, 0, (RGBQUAD[])null);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Quantizes this <see cref="FreeImageBitmap"/> from 24 bit, using the specified
|
|
|
/// <paramref name="algorithm"/> and <paramref name="reservePalette">palette</paramref>
|
|
|
/// initializing a new 8 bit instance with the specified <paramref name="paletteSize"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="algorithm">The color reduction algorithm to be used.</param>
|
|
|
/// <param name="paletteSize">Size of the desired output palette.</param>
|
|
|
/// <param name="reservePalette">The provided palette.</param>
|
|
|
/// <returns>The quantized instance.</returns>
|
|
|
public FreeImageBitmap GetQuantizedInstance(FREE_IMAGE_QUANTIZE algorithm, int paletteSize, Palette reservePalette)
|
|
|
{
|
|
|
return GetQuantizedInstance(algorithm, paletteSize, reservePalette.Length, reservePalette);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Quantizes this <see cref="FreeImageBitmap"/> from 24 bit, using the specified
|
|
|
/// <paramref name="algorithm"/> and up to <paramref name="reserveSize"/>
|
|
|
/// entries from <paramref name="reservePalette">palette</paramref> initializing
|
|
|
/// a new 8 bit instance with the specified <paramref name="paletteSize"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="algorithm">The color reduction algorithm to be used.</param>
|
|
|
/// <param name="paletteSize">Size of the desired output palette.</param>
|
|
|
/// <param name="reserveSize">Size of the provided palette.</param>
|
|
|
/// <param name="reservePalette">The provided palette.</param>
|
|
|
/// <returns>The quantized instance.</returns>
|
|
|
public FreeImageBitmap GetQuantizedInstance(FREE_IMAGE_QUANTIZE algorithm, int paletteSize, int reserveSize, Palette reservePalette)
|
|
|
{
|
|
|
return GetQuantizedInstance(algorithm, paletteSize, reserveSize, reservePalette.Data);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Quantizes this <see cref="FreeImageBitmap"/> from 24 bit, using the specified
|
|
|
/// <paramref name="algorithm"/> and up to <paramref name="reserveSize"/>
|
|
|
/// entries from <paramref name="reservePalette">palette</paramref> initializing
|
|
|
/// a new 8 bit instance with the specified <paramref name="paletteSize"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="algorithm">The color reduction algorithm to be used.</param>
|
|
|
/// <param name="paletteSize">Size of the desired output palette.</param>
|
|
|
/// <param name="reserveSize">Size of the provided palette.</param>
|
|
|
/// <param name="reservePalette">The provided palette.</param>
|
|
|
/// <returns>The quantized instance.</returns>
|
|
|
public FreeImageBitmap GetQuantizedInstance(FREE_IMAGE_QUANTIZE algorithm, int paletteSize, int reserveSize, RGBQUAD[] reservePalette)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImageBitmap result = null;
|
|
|
FIBITMAP newDib = FreeImage.ColorQuantizeEx(dib, algorithm, paletteSize, reserveSize, reservePalette);
|
|
|
if (!newDib.IsNull)
|
|
|
{
|
|
|
result = new FreeImageBitmap(newDib);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a High Dynamic Range image to a 24-bit RGB image using a global
|
|
|
/// operator based on logarithmic compression of luminance values, imitating
|
|
|
/// the human response to light.
|
|
|
/// </summary>
|
|
|
/// <param name="gamma">A gamma correction that is applied after the tone mapping.
|
|
|
/// A value of 1 means no correction.</param>
|
|
|
/// <param name="exposure">Scale factor allowing to adjust the brightness of the output image.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool TmoDrago03(double gamma, double exposure)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return ReplaceDib(FreeImage.TmoDrago03(dib, gamma, exposure));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a High Dynamic Range image to a 24-bit RGB image using a global operator inspired
|
|
|
/// by photoreceptor physiology of the human visual system.
|
|
|
/// </summary>
|
|
|
/// <param name="intensity">Controls the overall image intensity in the range [-8, 8].</param>
|
|
|
/// <param name="contrast">Controls the overall image contrast in the range [0.3, 1.0[.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool TmoReinhard05(double intensity, double contrast)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return ReplaceDib(FreeImage.TmoReinhard05(dib, intensity, contrast));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Apply the Gradient Domain High Dynamic Range Compression to a RGBF image and convert to 24-bit RGB.
|
|
|
/// </summary>
|
|
|
/// <param name="color_saturation">Color saturation (s parameter in the paper) in [0.4..0.6]</param>
|
|
|
/// <param name="attenuation">Atenuation factor (beta parameter in the paper) in [0.8..0.9]</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool TmoFattal02(double color_saturation, double attenuation)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return ReplaceDib(FreeImage.TmoFattal02(dib, color_saturation, attenuation));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// This method rotates a 1-, 4-, 8-bit greyscale or a 24-, 32-bit color image by means of 3 shears.
|
|
|
/// For 1- and 4-bit images, rotation is limited to angles whose value is an integer
|
|
|
/// multiple of 90.
|
|
|
/// </summary>
|
|
|
/// <param name="angle">The angle of rotation.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool Rotate(double angle)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
bool result = false;
|
|
|
if (ColorDepth == 4)
|
|
|
{
|
|
|
result = ReplaceDib(FreeImage.Rotate4bit(dib, angle));
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
result = ReplaceDib(FreeImage.Rotate(dib, angle));
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// This method rotates a 1-, 4-, 8-bit greyscale or a 24-, 32-bit color image by means of 3 shears.
|
|
|
/// For 1- and 4-bit images, rotation is limited to angles whose value is an integer
|
|
|
/// multiple of 90.
|
|
|
/// </summary>
|
|
|
/// <typeparam name="T">The type of the color to use as background.</typeparam>
|
|
|
/// <param name="angle">The angle of rotation.</param>
|
|
|
/// <param name="backgroundColor">The color used used to fill the bitmap's background.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool Rotate<T>(double angle, T? backgroundColor) where T : struct
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
bool result = false;
|
|
|
if (ColorDepth == 4)
|
|
|
{
|
|
|
result = ReplaceDib(FreeImage.Rotate4bit(dib, angle));
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
result = ReplaceDib(FreeImage.Rotate(dib, angle, backgroundColor));
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Rotates this <see cref="FreeImageBitmap"/> by the specified angle initializing a new instance.
|
|
|
/// For 1- and 4-bit images, rotation is limited to angles whose value is an integer
|
|
|
/// multiple of 90.
|
|
|
/// </summary>
|
|
|
/// <typeparam name="T">The type of the color to use as background.</typeparam>
|
|
|
/// <param name="angle">The angle of rotation.</param>
|
|
|
/// <param name="backgroundColor">The color used used to fill the bitmap's background.</param>
|
|
|
/// <returns>The rotated instance.</returns>
|
|
|
public FreeImageBitmap GetRotatedInstance<T>(double angle, T? backgroundColor) where T : struct
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImageBitmap result = null;
|
|
|
FIBITMAP newDib;
|
|
|
if (ColorDepth == 4)
|
|
|
{
|
|
|
newDib = FreeImage.Rotate4bit(dib, angle);
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
newDib = FreeImage.Rotate(dib, angle, backgroundColor);
|
|
|
}
|
|
|
if (!newDib.IsNull)
|
|
|
{
|
|
|
result = new FreeImageBitmap(newDib);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Rotates this <see cref="FreeImageBitmap"/> by the specified angle initializing a new instance.
|
|
|
/// For 1- and 4-bit images, rotation is limited to angles whose value is an integer
|
|
|
/// multiple of 90.
|
|
|
/// </summary>
|
|
|
/// <param name="angle">The angle of rotation.</param>
|
|
|
/// <returns>The rotated instance.</returns>
|
|
|
public FreeImageBitmap GetRotatedInstance(double angle)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImageBitmap result = null;
|
|
|
FIBITMAP newDib;
|
|
|
if (ColorDepth == 4)
|
|
|
{
|
|
|
newDib = FreeImage.Rotate4bit(dib, angle);
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
newDib = FreeImage.Rotate(dib, angle);
|
|
|
}
|
|
|
if (!newDib.IsNull)
|
|
|
{
|
|
|
result = new FreeImageBitmap(newDib);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// This method performs a rotation and / or translation of an 8-bit greyscale,
|
|
|
/// 24- or 32-bit image, using a 3rd order (cubic) B-Spline.
|
|
|
/// </summary>
|
|
|
/// <param name="angle">The angle of rotation.</param>
|
|
|
/// <param name="xShift">Horizontal image translation.</param>
|
|
|
/// <param name="yShift">Vertical image translation.</param>
|
|
|
/// <param name="xOrigin">Rotation center x-coordinate.</param>
|
|
|
/// <param name="yOrigin">Rotation center y-coordinate.</param>
|
|
|
/// <param name="useMask">When true the irrelevant part of the image is set to a black color,
|
|
|
/// otherwise, a mirroring technique is used to fill irrelevant pixels.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool Rotate(double angle, double xShift, double yShift,
|
|
|
double xOrigin, double yOrigin, bool useMask)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return ReplaceDib(FreeImage.RotateEx(dib, angle, xShift, yShift, xOrigin, yOrigin, useMask));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// This method performs a rotation and / or translation of an 8-bit greyscale,
|
|
|
/// 24- or 32-bit image, using a 3rd order (cubic) B-Spline initializing a new instance.
|
|
|
/// </summary>
|
|
|
/// <param name="angle">The angle of rotation.</param>
|
|
|
/// <param name="xShift">Horizontal image translation.</param>
|
|
|
/// <param name="yShift">Vertical image translation.</param>
|
|
|
/// <param name="xOrigin">Rotation center x-coordinate.</param>
|
|
|
/// <param name="yOrigin">Rotation center y-coordinate.</param>
|
|
|
/// <param name="useMask">When true the irrelevant part of the image is set to a black color,
|
|
|
/// otherwise, a mirroring technique is used to fill irrelevant pixels.</param>
|
|
|
/// <returns>The rotated instance.</returns>
|
|
|
public FreeImageBitmap GetRotatedInstance(double angle, double xShift, double yShift,
|
|
|
double xOrigin, double yOrigin, bool useMask)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImageBitmap result = null;
|
|
|
FIBITMAP newDib = FreeImage.RotateEx(
|
|
|
dib, angle, xShift, yShift, xOrigin, yOrigin, useMask);
|
|
|
if (!newDib.IsNull)
|
|
|
{
|
|
|
result = new FreeImageBitmap(newDib);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Perfoms an histogram transformation on a 8-, 24- or 32-bit image.
|
|
|
/// </summary>
|
|
|
/// <param name="lookUpTable">The lookup table (LUT).
|
|
|
/// It's size is assumed to be 256 in length.</param>
|
|
|
/// <param name="channel">The color channel to be transformed.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool AdjustCurve(byte[] lookUpTable, FREE_IMAGE_COLOR_CHANNEL channel)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.AdjustCurve(dib, lookUpTable, channel);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Performs gamma correction on a 8-, 24- or 32-bit image.
|
|
|
/// </summary>
|
|
|
/// <param name="gamma">The parameter represents the gamma value to use (gamma > 0).
|
|
|
/// A value of 1.0 leaves the image alone, less than one darkens it, and greater than one lightens it.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool AdjustGamma(double gamma)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.AdjustGamma(dib, gamma);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adjusts the brightness of a 8-, 24- or 32-bit image by a certain amount.
|
|
|
/// </summary>
|
|
|
/// <param name="percentage">A value 0 means no change,
|
|
|
/// less than 0 will make the image darker and greater than 0 will make the image brighter.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool AdjustBrightness(double percentage)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.AdjustBrightness(dib, percentage);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adjusts the contrast of a 8-, 24- or 32-bit image by a certain amount.
|
|
|
/// </summary>
|
|
|
/// <param name="percentage">A value 0 means no change,
|
|
|
/// less than 0 will decrease the contrast and greater than 0 will increase the contrast of the image.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool AdjustContrast(double percentage)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.AdjustContrast(dib, percentage);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Inverts each pixel data.
|
|
|
/// </summary>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool Invert()
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.Invert(dib);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Computes the image histogram.
|
|
|
/// </summary>
|
|
|
/// <param name="channel">Channel to compute from.</param>
|
|
|
/// <param name="histogram">Array of integers containing the histogram.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool GetHistogram(FREE_IMAGE_COLOR_CHANNEL channel, out int[] histogram)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
histogram = new int[256];
|
|
|
return FreeImage.GetHistogram(dib, histogram, channel);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the red, green, blue or alpha channel of a 24- or 32-bit image.
|
|
|
/// </summary>
|
|
|
/// <param name="channel">The color channel to extract.</param>
|
|
|
/// <returns>The color channel in a new instance.</returns>
|
|
|
public FreeImageBitmap GetChannel(FREE_IMAGE_COLOR_CHANNEL channel)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImageBitmap result = null;
|
|
|
FIBITMAP newDib = FreeImage.GetChannel(dib, channel);
|
|
|
if (!newDib.IsNull)
|
|
|
{
|
|
|
result = new FreeImageBitmap(newDib);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Insert a 8-bit dib into a 24- or 32-bit image.
|
|
|
/// Both images must have to same width and height.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">The <see cref="FreeImageBitmap"/> to insert.</param>
|
|
|
/// <param name="channel">The color channel to replace.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool SetChannel(FreeImageBitmap bitmap, FREE_IMAGE_COLOR_CHANNEL channel)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
bitmap.EnsureNotDisposed();
|
|
|
return FreeImage.SetChannel(dib, bitmap.dib, channel);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the real part, imaginary part, magnitude or phase of a complex image.
|
|
|
/// </summary>
|
|
|
/// <param name="channel">The color channel to extract.</param>
|
|
|
/// <returns>The color channel in a new instance.</returns>
|
|
|
public FreeImageBitmap GetComplexChannel(FREE_IMAGE_COLOR_CHANNEL channel)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImageBitmap result = null;
|
|
|
FIBITMAP newDib = FreeImage.GetComplexChannel(dib, channel);
|
|
|
if (!newDib.IsNull)
|
|
|
{
|
|
|
result = new FreeImageBitmap(newDib);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Set the real or imaginary part of a complex image.
|
|
|
/// Both images must have to same width and height.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">The <see cref="FreeImageBitmap"/> to insert.</param>
|
|
|
/// <param name="channel">The color channel to replace.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool SetComplexChannel(FreeImageBitmap bitmap, FREE_IMAGE_COLOR_CHANNEL channel)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
bitmap.EnsureNotDisposed();
|
|
|
return FreeImage.SetComplexChannel(dib, bitmap.dib, channel);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copy a sub part of this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="rect">The subpart to copy.</param>
|
|
|
/// <returns>The sub part in a new instance.</returns>
|
|
|
public FreeImageBitmap Copy(Rectangle rect)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return Copy(rect.Left, rect.Top, rect.Right, rect.Bottom);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copy a sub part of this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="left">Specifies the left position of the cropped rectangle.</param>
|
|
|
/// <param name="top">Specifies the top position of the cropped rectangle.</param>
|
|
|
/// <param name="right">Specifies the right position of the cropped rectangle.</param>
|
|
|
/// <param name="bottom">Specifies the bottom position of the cropped rectangle.</param>
|
|
|
/// <returns>The sub part in a new instance.</returns>
|
|
|
public FreeImageBitmap Copy(int left, int top, int right, int bottom)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImageBitmap result = null;
|
|
|
FIBITMAP newDib = FreeImage.Copy(dib, left, top, right, bottom);
|
|
|
if (!newDib.IsNull)
|
|
|
{
|
|
|
result = new FreeImageBitmap(newDib);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Alpha blend or combine a sub part image with this <see cref="FreeImageBitmap"/>.
|
|
|
/// The bit depth of <paramref name="bitmap"/> must be greater than or equal to the bit depth this instance.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">The <see cref="FreeImageBitmap"/> to paste into this instance.</param>
|
|
|
/// <param name="left">Specifies the left position of the sub image.</param>
|
|
|
/// <param name="top">Specifies the top position of the sub image.</param>
|
|
|
/// <param name="alpha">alpha blend factor.
|
|
|
/// The source and destination images are alpha blended if alpha=0..255.
|
|
|
/// If alpha > 255, then the source image is combined to the destination image.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool Paste(FreeImageBitmap bitmap, int left, int top, int alpha)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
bitmap.EnsureNotDisposed();
|
|
|
return FreeImage.Paste(dib, bitmap.dib, left, top, alpha);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Alpha blend or combine a sub part image with tthis <see cref="FreeImageBitmap"/>.
|
|
|
/// The bit depth of <paramref name="bitmap"/> must be greater than or equal to the bit depth this instance.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">The <see cref="FreeImageBitmap"/> to paste into this instance.</param>
|
|
|
/// <param name="point">Specifies the position of the sub image.</param>
|
|
|
/// <param name="alpha">alpha blend factor.
|
|
|
/// The source and destination images are alpha blended if alpha=0..255.
|
|
|
/// If alpha > 255, then the source image is combined to the destination image.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool Paste(FreeImageBitmap bitmap, Point point, int alpha)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return Paste(bitmap, point.X, point.Y, alpha);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// This method composite a transparent foreground image against a single background color or
|
|
|
/// against a background image.
|
|
|
/// In case <paramref name="useBitmapBackground"/> is false and <paramref name="applicationBackground"/>
|
|
|
/// and <paramref name="bitmapBackGround"/>
|
|
|
/// are null, a checkerboard will be used as background.
|
|
|
/// </summary>
|
|
|
/// <param name="useBitmapBackground">When true the background of this instance is used
|
|
|
/// if it contains one.</param>
|
|
|
/// <param name="applicationBackground">Backgroundcolor used in case <paramref name="useBitmapBackground"/> is false
|
|
|
/// and <paramref name="applicationBackground"/> is not null.</param>
|
|
|
/// <param name="bitmapBackGround">Background used in case <paramref name="useBitmapBackground"/>
|
|
|
/// is false and <paramref name="applicationBackground"/> is a null reference.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool Composite(bool useBitmapBackground, Color? applicationBackground, FreeImageBitmap bitmapBackGround)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
bitmapBackGround.EnsureNotDisposed();
|
|
|
RGBQUAD? rgb = applicationBackground;
|
|
|
return ReplaceDib(
|
|
|
FreeImage.Composite(
|
|
|
dib,
|
|
|
useBitmapBackground,
|
|
|
rgb.HasValue ? new RGBQUAD[] { rgb.Value } : null,
|
|
|
bitmapBackGround.dib));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Applies the alpha value of each pixel to its color components.
|
|
|
/// The aplha value stays unchanged.
|
|
|
/// Only works with 32-bits color depth.
|
|
|
/// </summary>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool PreMultiplyWithAlpha()
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.PreMultiplyWithAlpha(dib);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Solves a Poisson equation, remap result pixels to [0..1] and returns the solution.
|
|
|
/// </summary>
|
|
|
/// <param name="ncycle">Number of cycles in the multigrid algorithm (usually 2 or 3)</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool MultigridPoissonSolver(int ncycle)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return ReplaceDib(FreeImage.MultigridPoissonSolver(dib, ncycle));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adjusts an image's brightness, contrast and gamma as well as it may
|
|
|
/// optionally invert the image within a single operation.
|
|
|
/// </summary>
|
|
|
/// <param name="brightness">Percentage brightness value where -100 <= brightness <= 100.
|
|
|
/// <para>A value of 0 means no change, less than 0 will make the image darker and greater
|
|
|
/// than 0 will make the image brighter.</para></param>
|
|
|
/// <param name="contrast">Percentage contrast value where -100 <= contrast <= 100.
|
|
|
/// <para>A value of 0 means no change, less than 0 will decrease the contrast
|
|
|
/// and greater than 0 will increase the contrast of the image.</para></param>
|
|
|
/// <param name="gamma">Gamma value to be used for gamma correction.
|
|
|
/// <para>A value of 1.0 leaves the image alone, less than one darkens it,
|
|
|
/// and greater than one lightens it.</para>
|
|
|
/// This parameter must not be zero or smaller than zero.
|
|
|
/// If so, it will be ignored and no gamma correction will be performed on the image.</param>
|
|
|
/// <param name="invert">If set to true, the image will be inverted.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool AdjustColors(double brightness, double contrast, double gamma, bool invert)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.AdjustColors(dib, brightness, contrast, gamma, invert);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Applies color mapping for one or several colors on a 1-, 4- or 8-bit
|
|
|
/// palletized or a 16-, 24- or 32-bit high color image.
|
|
|
/// </summary>
|
|
|
/// <param name="srccolors">Array of colors to be used as the mapping source.</param>
|
|
|
/// <param name="dstcolors">Array of colors to be used as the mapping destination.</param>
|
|
|
/// <param name="ignore_alpha">If true, 32-bit images and colors are treated as 24-bit.</param>
|
|
|
/// <param name="swap">If true, source and destination colors are swapped, that is,
|
|
|
/// each destination color is also mapped to the corresponding source color.</param>
|
|
|
/// <returns>The total number of pixels changed.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="srccolors"/> or <paramref name="dstcolors"/> is a null reference.
|
|
|
/// </exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// <paramref name="srccolors"/> has a different length than <paramref name="dstcolors"/>.
|
|
|
/// </exception>
|
|
|
public uint ApplyColorMapping(RGBQUAD[] srccolors, RGBQUAD[] dstcolors, bool ignore_alpha, bool swap)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (srccolors == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("srccolors");
|
|
|
}
|
|
|
if (dstcolors == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("dstcolors");
|
|
|
}
|
|
|
if (srccolors.Length != dstcolors.Length)
|
|
|
{
|
|
|
throw new ArgumentException("srccolors and dstcolors must have the same length.");
|
|
|
}
|
|
|
return FreeImage.ApplyColorMapping(dib, srccolors, dstcolors, (uint)srccolors.Length, ignore_alpha, swap);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Swaps two specified colors on a 1-, 4- or 8-bit palletized
|
|
|
/// or a 16-, 24- or 32-bit high color image.
|
|
|
/// </summary>
|
|
|
/// <param name="color_a">One of the two colors to be swapped.</param>
|
|
|
/// <param name="color_b">The other of the two colors to be swapped.</param>
|
|
|
/// <param name="ignore_alpha">If true, 32-bit images and colors are treated as 24-bit.</param>
|
|
|
/// <returns>The total number of pixels changed.</returns>
|
|
|
public uint SwapColors(RGBQUAD color_a, RGBQUAD color_b, bool ignore_alpha)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.SwapColors(dib, ref color_a, ref color_b, ignore_alpha);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Applies palette index mapping for one or several indices
|
|
|
/// on a 1-, 4- or 8-bit palletized image.
|
|
|
/// </summary>
|
|
|
/// <param name="srcindices">Array of palette indices to be used as the mapping source.</param>
|
|
|
/// <param name="dstindices">Array of palette indices to be used as the mapping destination.</param>
|
|
|
/// <param name="count">The number of palette indices to be mapped. This is the size of both
|
|
|
/// srcindices and dstindices</param>
|
|
|
/// <param name="swap">If true, source and destination palette indices are swapped, that is,
|
|
|
/// each destination index is also mapped to the corresponding source index.</param>
|
|
|
/// <returns>The total number of pixels changed.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="srccolors"/> or <paramref name="dstcolors"/> is a null reference.
|
|
|
/// </exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// <paramref name="srccolors"/> has a different length than <paramref name="dstcolors"/>.
|
|
|
/// </exception>
|
|
|
public uint ApplyPaletteIndexMapping(byte[] srcindices, byte[] dstindices, uint count, bool swap)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (srcindices == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("srcindices");
|
|
|
}
|
|
|
if (dstindices == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("dstindices");
|
|
|
}
|
|
|
if (srcindices.Length != dstindices.Length)
|
|
|
{
|
|
|
throw new ArgumentException("srcindices and dstindices must have the same length.");
|
|
|
}
|
|
|
return FreeImage.ApplyPaletteIndexMapping(dib, srcindices, dstindices, (uint)srcindices.Length, swap);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Swaps two specified palette indices on a 1-, 4- or 8-bit palletized image.
|
|
|
/// </summary>
|
|
|
/// <param name="index_a">One of the two palette indices to be swapped.</param>
|
|
|
/// <param name="index_b">The other of the two palette indices to be swapped.</param>
|
|
|
/// <returns>The total number of pixels changed.</returns>
|
|
|
public uint SwapPaletteIndices(byte index_a, byte index_b)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.SwapPaletteIndices(dib, ref index_a, ref index_b);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets all pixels of this <see cref="FreeImageBitmap"/> to the specified color.
|
|
|
/// See <see cref="FreeImage.FillBackground<T>"/> for further details.
|
|
|
/// </summary>
|
|
|
/// <typeparam name="T">The type of the specified color.</typeparam>
|
|
|
/// <param name="color">The color to fill this <see cref="FreeImageBitmap"/> with.</param>
|
|
|
/// <returns><c>true</c> on success, <c>false</c> on failure.</returns>
|
|
|
public bool FillBackground<T>(T color) where T : struct
|
|
|
{
|
|
|
return FillBackground(color, FREE_IMAGE_COLOR_OPTIONS.FICO_DEFAULT);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets all pixels of this <see cref="FreeImageBitmap"/> to the specified color.
|
|
|
/// See <see cref="FreeImage.FillBackground<T>"/> for further details.
|
|
|
/// </summary>
|
|
|
/// <typeparam name="T">The type of the specified color.</typeparam>
|
|
|
/// <param name="color">The color to fill this <see cref="FreeImageBitmap"/> with.</param>
|
|
|
/// <param name="options">Options that affect the color search process for palletized images.</param>
|
|
|
/// <returns><c>true</c> on success, <c>false</c> on failure.</returns>
|
|
|
public bool FillBackground<T>(T color, FREE_IMAGE_COLOR_OPTIONS options) where T : struct
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return FreeImage.FillBackground(dib, color, options);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a new ICC-Profile.
|
|
|
/// </summary>
|
|
|
/// <param name="data">The data of the new ICC-Profile.</param>
|
|
|
/// <returns>The new ICC-Profile of the bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="data"/> is a null reference.</exception>
|
|
|
public FIICCPROFILE CreateICCProfile(byte[] data)
|
|
|
{
|
|
|
if (data == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("data");
|
|
|
}
|
|
|
return CreateICCProfile(data, data.Length);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a new ICC-Profile.
|
|
|
/// </summary>
|
|
|
/// <param name="data">The data of the new ICC-Profile.</param>
|
|
|
/// <param name="size">The number of bytes of <paramref name="data"/> to use.</param>
|
|
|
/// <returns>The new ICC-Profile of the bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="data"/> is null.</exception>
|
|
|
public FIICCPROFILE CreateICCProfile(byte[] data, int size)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (data == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("data");
|
|
|
}
|
|
|
return FreeImage.CreateICCProfileEx(dib, data, size);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Determines whether this and the specified instances are the same.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The object to test.</param>
|
|
|
/// <returns><b>true</b> if this instance is the same <paramref name="obj"/>
|
|
|
/// or if both are null references; otherwise, false.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return ReferenceEquals(this, obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="FreeImageBitmap"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="FreeImageBitmap"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return dib.GetHashCode();
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Static functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a value that indicates whether the pixel format for this <see cref="FreeImageBitmap"/> contains alpha information.
|
|
|
/// </summary>
|
|
|
/// <param name="pixfmt">The <see cref="System.Drawing.Imaging.PixelFormat"/> to test.</param>
|
|
|
/// <returns><b>true</b> if pixfmt contains alpha information; otherwise, <b>false</b>.</returns>
|
|
|
public static bool IsAlphaPixelFormat(PixelFormat pixfmt)
|
|
|
{
|
|
|
return Bitmap.IsAlphaPixelFormat(pixfmt);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a value that indicates whether the pixel format is 32 bits per pixel.
|
|
|
/// </summary>
|
|
|
/// <param name="pixfmt">The <see cref="System.Drawing.Imaging.PixelFormat"/> to test.</param>
|
|
|
/// <returns>true if pixfmt is canonical; otherwise, false.</returns>
|
|
|
public static bool IsCanonicalPixelFormat(PixelFormat pixfmt)
|
|
|
{
|
|
|
return Bitmap.IsCanonicalPixelFormat(pixfmt);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a value that indicates whether the pixel format is 64 bits per pixel.
|
|
|
/// </summary>
|
|
|
/// <param name="pixfmt">The <see cref="System.Drawing.Imaging.PixelFormat"/> enumeration to test.</param>
|
|
|
/// <returns>true if pixfmt is extended; otherwise, false.</returns>
|
|
|
public static bool IsExtendedPixelFormat(PixelFormat pixfmt)
|
|
|
{
|
|
|
return Bitmap.IsExtendedPixelFormat(pixfmt);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a <see cref="FreeImageBitmap"/> from a Windows handle to an icon.
|
|
|
/// </summary>
|
|
|
/// <param name="hicon">A handle to an icon.</param>
|
|
|
/// <returns>The <see cref="FreeImageBitmap"/> that this method creates.</returns>
|
|
|
public static FreeImageBitmap FromHicon(IntPtr hicon)
|
|
|
{
|
|
|
using (Bitmap bitmap = Bitmap.FromHicon(hicon))
|
|
|
{
|
|
|
return new FreeImageBitmap(bitmap);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a <see cref="FreeImageBitmap"/> from the specified Windows resource.
|
|
|
/// </summary>
|
|
|
/// <param name="hinstance">A handle to an instance of the executable
|
|
|
/// file that contains the resource.</param>
|
|
|
/// <param name="bitmapName">A string containing the name of the resource bitmap.</param>
|
|
|
/// <returns>The <see cref="FreeImageBitmap"/> that this method creates.</returns>
|
|
|
public static FreeImageBitmap FromResource(IntPtr hinstance, string bitmapName)
|
|
|
{
|
|
|
using (Bitmap bitmap = Bitmap.FromResource(hinstance, bitmapName))
|
|
|
{
|
|
|
return new FreeImageBitmap(bitmap);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a <see cref="FreeImageBitmap"/> from the specified file.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">A string that contains the name of the file
|
|
|
/// from which to create the <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <returns>The <see cref="FreeImageBitmap"/> this method creates.</returns>
|
|
|
public static FreeImageBitmap FromFile(string filename)
|
|
|
{
|
|
|
return new FreeImageBitmap(filename);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a <see cref="FreeImageBitmap"/> from the specified file
|
|
|
/// using embedded color management information in that file.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">A string that contains the
|
|
|
/// name of the file from which to create the <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="useEmbeddedColorManagement">Ignored.</param>
|
|
|
/// <returns>The <see cref="FreeImageBitmap"/> this method creates.</returns>
|
|
|
public static FreeImageBitmap FromFile(string filename, bool useEmbeddedColorManagement)
|
|
|
{
|
|
|
return new FreeImageBitmap(filename);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a <see cref="FreeImageBitmap"/> from a handle to a GDI bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="hbitmap">The GDI bitmap handle from which to create the <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <returns>The <see cref="FreeImageBitmap"/> this method creates.</returns>
|
|
|
public static FreeImageBitmap FromHbitmap(IntPtr hbitmap)
|
|
|
{
|
|
|
FreeImageBitmap result = null;
|
|
|
FIBITMAP newDib = FreeImage.CreateFromHbitmap(hbitmap, IntPtr.Zero);
|
|
|
if (!newDib.IsNull)
|
|
|
{
|
|
|
result = new FreeImageBitmap(newDib);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a <see cref="FreeImageBitmap"/> from a handle to a GDI bitmap and a handle to a GDI palette.
|
|
|
/// </summary>
|
|
|
/// <param name="hbitmap">The GDI bitmap handle from which to create the <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="hpalette">Ignored.</param>
|
|
|
/// <returns>The <see cref="FreeImageBitmap"/> this method creates.</returns>
|
|
|
public static FreeImageBitmap FromHbitmap(IntPtr hbitmap, IntPtr hpalette)
|
|
|
{
|
|
|
return FromHbitmap(hbitmap);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Frees a bitmap handle.
|
|
|
/// </summary>
|
|
|
/// <param name="hbitmap">Handle to a bitmap.</param>
|
|
|
/// <returns><b>true</b> on success, <b>false</b> on failure.</returns>
|
|
|
public static bool FreeHbitmap(IntPtr hbitmap)
|
|
|
{
|
|
|
return FreeImage.FreeHbitmap(hbitmap);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a <see cref="FreeImageBitmap"/> from the specified data stream.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">A <see cref="Stream"/> that contains the data for this <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <returns>The <see cref="FreeImageBitmap"/> this method creates.</returns>
|
|
|
public static FreeImageBitmap FromStream(Stream stream)
|
|
|
{
|
|
|
return new FreeImageBitmap(stream);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a <see cref="FreeImageBitmap"/> from the specified data stream.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">A <see cref="Stream"/> that contains the data for this <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="useEmbeddedColorManagement">Ignored.</param>
|
|
|
/// <returns>The <see cref="FreeImageBitmap"/> this method creates.</returns>
|
|
|
public static FreeImageBitmap FromStream(Stream stream, bool useEmbeddedColorManagement)
|
|
|
{
|
|
|
return new FreeImageBitmap(stream);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a <see cref="FreeImageBitmap"/> from the specified data stream.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">A <see cref="Stream"/> that contains the data for this <see cref="FreeImageBitmap"/>.</param>
|
|
|
/// <param name="useEmbeddedColorManagement">Ignored.</param>
|
|
|
/// <param name="validateImageData">Ignored.</param>
|
|
|
/// <returns>The <see cref="FreeImageBitmap"/> this method creates.</returns>
|
|
|
public static FreeImageBitmap FromStream(Stream stream, bool useEmbeddedColorManagement, bool validateImageData)
|
|
|
{
|
|
|
return new FreeImageBitmap(stream);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the color depth, in number of bits per pixel,
|
|
|
/// of the specified pixel format.
|
|
|
/// </summary>
|
|
|
/// <param name="pixfmt">The <see cref="System.Drawing.Imaging.PixelFormat"/> member that specifies
|
|
|
/// the format for which to find the size.</param>
|
|
|
/// <returns>The color depth of the specified pixel format.</returns>
|
|
|
public static int GetPixelFormatSize(PixelFormat pixfmt)
|
|
|
{
|
|
|
return Bitmap.GetPixelFormatSize(pixfmt);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Performs a lossless rotation or flipping on a JPEG file.
|
|
|
/// </summary>
|
|
|
/// <param name="source">Source file.</param>
|
|
|
/// <param name="destination">Destination file; can be the source file; will be overwritten.</param>
|
|
|
/// <param name="operation">The operation to apply.</param>
|
|
|
/// <param name="perfect">To avoid lossy transformation, you can set the perfect parameter to true.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public static bool JPEGTransform(string source, string destination, FREE_IMAGE_JPEG_OPERATION operation, bool perfect)
|
|
|
{
|
|
|
return FreeImage.JPEGTransform(source, destination, operation, perfect);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Performs a lossless crop on a JPEG file.
|
|
|
/// </summary>
|
|
|
/// <param name="source">Source filename.</param>
|
|
|
/// <param name="destination">Destination filename.</param>
|
|
|
/// <param name="rect">Specifies the cropped rectangle.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="source"/> or <paramref name="destination"/> is null.
|
|
|
/// </exception>
|
|
|
/// <exception cref="FileNotFoundException">
|
|
|
/// <paramref name="source"/> does not exist.
|
|
|
/// </exception>
|
|
|
public static bool JPEGCrop(string source, string destination, Rectangle rect)
|
|
|
{
|
|
|
if (source == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("source");
|
|
|
}
|
|
|
if (!File.Exists(source))
|
|
|
{
|
|
|
throw new FileNotFoundException("source");
|
|
|
}
|
|
|
if (destination == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("destination");
|
|
|
}
|
|
|
return JPEGCrop(source, destination, rect.Left, rect.Top, rect.Right, rect.Bottom);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Performs a lossless crop on a JPEG file.
|
|
|
/// </summary>
|
|
|
/// <param name="source">Source filename.</param>
|
|
|
/// <param name="destination">Destination filename.</param>
|
|
|
/// <param name="left">Specifies the left position of the cropped rectangle.</param>
|
|
|
/// <param name="top">Specifies the top position of the cropped rectangle.</param>
|
|
|
/// <param name="right">Specifies the right position of the cropped rectangle.</param>
|
|
|
/// <param name="bottom">Specifies the bottom position of the cropped rectangle.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="source"/> or <paramref name="destination"/> is null.
|
|
|
/// </exception>
|
|
|
/// <exception cref="FileNotFoundException">
|
|
|
/// <paramref name="source"/> does not exist.
|
|
|
/// </exception>
|
|
|
public static bool JPEGCrop(string source, string destination, int left, int top, int right, int bottom)
|
|
|
{
|
|
|
if (source == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("source");
|
|
|
}
|
|
|
if (!File.Exists(source))
|
|
|
{
|
|
|
throw new FileNotFoundException("source");
|
|
|
}
|
|
|
if (destination == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("destination");
|
|
|
}
|
|
|
return FreeImage.JPEGCrop(source, destination, left, top, right, bottom);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a X11 color name into a corresponding RGB value.
|
|
|
/// </summary>
|
|
|
/// <param name="color">Name of the color to convert.</param>
|
|
|
/// <param name="red">Red component.</param>
|
|
|
/// <param name="green">Green component.</param>
|
|
|
/// <param name="blue">Blue component.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="color"/> is null.</exception>
|
|
|
public static bool LookupX11Color(string color, out byte red, out byte green, out byte blue)
|
|
|
{
|
|
|
if (color == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("color");
|
|
|
}
|
|
|
return FreeImage.LookupX11Color(color, out red, out green, out blue);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a SVG color name into a corresponding RGB value.
|
|
|
/// </summary>
|
|
|
/// <param name="color">Name of the color to convert.</param>
|
|
|
/// <param name="red">Red component.</param>
|
|
|
/// <param name="green">Green component.</param>
|
|
|
/// <param name="blue">Blue component.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="color"/> is null.</exception>
|
|
|
public static bool LookupSVGColor(string color, out byte red, out byte green, out byte blue)
|
|
|
{
|
|
|
if (color == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("color");
|
|
|
}
|
|
|
return FreeImage.LookupSVGColor(color, out red, out green, out blue);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a lookup table to be used with AdjustCurve() which
|
|
|
/// may adjusts brightness and contrast, correct gamma and invert the image with a
|
|
|
/// single call to AdjustCurve().
|
|
|
/// </summary>
|
|
|
/// <param name="lookUpTable">Output lookup table to be used with AdjustCurve().
|
|
|
/// The size of <paramref name="lookUpTable"/> is assumed to be 256.</param>
|
|
|
/// <param name="brightness">Percentage brightness value where -100 <= brightness <= 100.
|
|
|
/// <para>A value of 0 means no change, less than 0 will make the image darker and greater
|
|
|
/// than 0 will make the image brighter.</para></param>
|
|
|
/// <param name="contrast">Percentage contrast value where -100 <= contrast <= 100.
|
|
|
/// <para>A value of 0 means no change, less than 0 will decrease the contrast
|
|
|
/// and greater than 0 will increase the contrast of the image.</para></param>
|
|
|
/// <param name="gamma">Gamma value to be used for gamma correction.
|
|
|
/// <para>A value of 1.0 leaves the image alone, less than one darkens it,
|
|
|
/// and greater than one lightens it.</para></param>
|
|
|
/// <param name="invert">If set to true, the image will be inverted.</param>
|
|
|
/// <returns>The number of adjustments applied to the resulting lookup table
|
|
|
/// compared to a blind lookup table.</returns>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="lookUpTable"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException"><paramref name="lookUpTable.Length"/> is not 256.</exception>
|
|
|
public static int GetAdjustColorsLookupTable(byte[] lookUpTable, double brightness, double contrast, double gamma, bool invert)
|
|
|
{
|
|
|
if (lookUpTable == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("lookUpTable");
|
|
|
}
|
|
|
if (lookUpTable.Length != 256)
|
|
|
{
|
|
|
throw new ArgumentException("lookUpTable");
|
|
|
}
|
|
|
return FreeImage.GetAdjustColorsLookupTable(lookUpTable, brightness, contrast, gamma, invert);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adds a specified frame to the file specified using the specified parameters.
|
|
|
/// Use this method to save selected frames from an to a multiple-frame image.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">File to add this frame to.</param>
|
|
|
/// <param name="bitmap">A <see cref="FreeImageBitmap"/> that contains the frame to add.</param>
|
|
|
/// <param name="format">Format of the image.</param>
|
|
|
/// <param name="loadFlags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <param name="saveFlags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="filename"/> or <paramref name="bitmap"/> is null.
|
|
|
/// </exception>
|
|
|
/// <exception cref="FileNotFoundException"><paramref name="filename"/> does not exist.</exception>
|
|
|
/// <exception cref="Exception">Saving the image failed.</exception>
|
|
|
public static void SaveAdd(
|
|
|
string filename,
|
|
|
FreeImageBitmap bitmap,
|
|
|
FREE_IMAGE_FORMAT format,
|
|
|
FREE_IMAGE_LOAD_FLAGS loadFlags,
|
|
|
FREE_IMAGE_SAVE_FLAGS saveFlags)
|
|
|
{
|
|
|
if (filename == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("filename");
|
|
|
}
|
|
|
if (!File.Exists(filename))
|
|
|
{
|
|
|
throw new FileNotFoundException("filename");
|
|
|
}
|
|
|
if (bitmap == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("bitmap");
|
|
|
}
|
|
|
bitmap.EnsureNotDisposed();
|
|
|
|
|
|
FIBITMAP dib = bitmap.dib;
|
|
|
if (dib.IsNull)
|
|
|
throw new ArgumentNullException("bitmap");
|
|
|
|
|
|
FIMULTIBITMAP mpBitmap =
|
|
|
FreeImage.OpenMultiBitmapEx(filename, ref format, loadFlags, false, false, true);
|
|
|
|
|
|
if (mpBitmap.IsNull)
|
|
|
throw new Exception(ErrorLoadingBitmap);
|
|
|
|
|
|
FreeImage.AppendPage(mpBitmap, bitmap.dib);
|
|
|
|
|
|
if (!FreeImage.CloseMultiBitmap(mpBitmap, saveFlags))
|
|
|
throw new Exception(ErrorUnloadBitmap);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adds a specified frame to the file specified using the specified parameters.
|
|
|
/// Use this method to save selected frames from an image to a multiple-frame image.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">File to add this frame to.</param>
|
|
|
/// <param name="bitmap">A <see cref="FreeImageBitmap"/> that contains the frame to add.</param>
|
|
|
/// <param name="insertPosition">The position of the inserted frame.</param>
|
|
|
/// <param name="format">Format of the image.</param>
|
|
|
/// <param name="loadFlags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <param name="saveFlags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="filename"/> or <paramref name="bitmap"/> is null.
|
|
|
/// </exception>
|
|
|
/// <exception cref="FileNotFoundException"><paramref name="filename"/> does not exist.</exception>
|
|
|
/// <exception cref="Exception">Saving the image failed.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException"><paramref name="insertPosition"/> is out of range.</exception>
|
|
|
public static void SaveAdd(
|
|
|
string filename,
|
|
|
FreeImageBitmap bitmap,
|
|
|
int insertPosition,
|
|
|
FREE_IMAGE_FORMAT format,
|
|
|
FREE_IMAGE_LOAD_FLAGS loadFlags,
|
|
|
FREE_IMAGE_SAVE_FLAGS saveFlags)
|
|
|
{
|
|
|
if (filename == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("filename");
|
|
|
}
|
|
|
if (!File.Exists(filename))
|
|
|
{
|
|
|
throw new FileNotFoundException("filename");
|
|
|
}
|
|
|
if (bitmap == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("bitmap");
|
|
|
}
|
|
|
if (insertPosition < 0)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("insertPosition");
|
|
|
}
|
|
|
bitmap.EnsureNotDisposed();
|
|
|
|
|
|
FIBITMAP dib = bitmap.dib;
|
|
|
if (dib.IsNull)
|
|
|
throw new ArgumentNullException("bitmap");
|
|
|
|
|
|
FIMULTIBITMAP mpBitmap =
|
|
|
FreeImage.OpenMultiBitmapEx(filename, ref format, loadFlags, false, false, true);
|
|
|
|
|
|
if (mpBitmap.IsNull)
|
|
|
throw new Exception(ErrorLoadingBitmap);
|
|
|
|
|
|
int pageCount = FreeImage.GetPageCount(mpBitmap);
|
|
|
|
|
|
if (insertPosition > pageCount)
|
|
|
throw new ArgumentOutOfRangeException("insertPosition");
|
|
|
|
|
|
if (insertPosition == pageCount)
|
|
|
FreeImage.AppendPage(mpBitmap, bitmap.dib);
|
|
|
else
|
|
|
FreeImage.InsertPage(mpBitmap, insertPosition, bitmap.dib);
|
|
|
|
|
|
if (!FreeImage.CloseMultiBitmap(mpBitmap, saveFlags))
|
|
|
throw new Exception(ErrorUnloadBitmap);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a new instance of the <see cref="PropertyItem"/> class which
|
|
|
/// has no public accessible constructor.
|
|
|
/// </summary>
|
|
|
/// <returns>A new instace of <see cref="PropertyItem"/>.</returns>
|
|
|
public static PropertyItem CreateNewPropertyItem()
|
|
|
{
|
|
|
return FreeImage.CreatePropertyItem();
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Helper functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Throws an exception in case the instance has already been disposed.
|
|
|
/// </summary>
|
|
|
private void EnsureNotDisposed()
|
|
|
{
|
|
|
lock (lockObject)
|
|
|
{
|
|
|
if (!this.disposed)
|
|
|
{
|
|
|
return;
|
|
|
}
|
|
|
}
|
|
|
throw new ObjectDisposedException(ToString());
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tries to replace the wrapped <see cref="FIBITMAP"/> with a new one.
|
|
|
/// In case the new dib is null or the same as the already
|
|
|
/// wrapped one, nothing will be changed and the result will
|
|
|
/// be false.
|
|
|
/// Otherwise the wrapped <see cref="FIBITMAP"/> will be unloaded and replaced.
|
|
|
/// </summary>
|
|
|
/// <param name="newDib">The new dib.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
private bool ReplaceDib(FIBITMAP newDib)
|
|
|
{
|
|
|
bool result = false;
|
|
|
if ((dib != newDib) && (!newDib.IsNull))
|
|
|
{
|
|
|
UnloadDib();
|
|
|
dib = newDib;
|
|
|
AddMemoryPressure();
|
|
|
result = true;
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Unloads currently wrapped <see cref="FIBITMAP"/> or unlocks the locked page
|
|
|
/// in case it came from a multipaged bitmap.
|
|
|
/// </summary>
|
|
|
private void UnloadDib()
|
|
|
{
|
|
|
if (!dib.IsNull)
|
|
|
{
|
|
|
long size = FreeImage.GetDIBSize(dib);
|
|
|
FreeImage.UnloadEx(ref dib);
|
|
|
if (size > 0L)
|
|
|
GC.RemoveMemoryPressure(size);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Informs the runtime about unmanaged allocoted memory.
|
|
|
/// </summary>
|
|
|
private void AddMemoryPressure()
|
|
|
{
|
|
|
long dataSize;
|
|
|
if ((dataSize = DataSize) > 0L)
|
|
|
GC.AddMemoryPressure(dataSize);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Opens the stream and reads the number of available pages.
|
|
|
/// Then loads the first page to this instance.
|
|
|
/// </summary>
|
|
|
private void LoadFromStream(Stream stream, FREE_IMAGE_FORMAT format, FREE_IMAGE_LOAD_FLAGS flags)
|
|
|
{
|
|
|
FIMULTIBITMAP mdib = FreeImage.OpenMultiBitmapFromStream(stream, ref format, flags);
|
|
|
if (mdib.IsNull)
|
|
|
{
|
|
|
throw new Exception(ErrorLoadingBitmap);
|
|
|
}
|
|
|
try
|
|
|
{
|
|
|
frameCount = FreeImage.GetPageCount(mdib);
|
|
|
}
|
|
|
finally
|
|
|
{
|
|
|
if (!FreeImage.CloseMultiBitmapEx(ref mdib))
|
|
|
{
|
|
|
throw new Exception(ErrorUnloadBitmap);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
dib = FreeImage.LoadFromStream(stream, flags, ref format);
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new Exception(ErrorLoadingBitmap);
|
|
|
}
|
|
|
|
|
|
saveInformation.loadFlags = flags;
|
|
|
originalFormat = format;
|
|
|
AddMemoryPressure();
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Interfaces
|
|
|
|
|
|
/// <summary>
|
|
|
/// Helper class to store informations for <see cref="FreeImageBitmap.SaveAdd()"/>.
|
|
|
/// </summary>
|
|
|
private sealed class SaveInformation : ICloneable
|
|
|
{
|
|
|
public string filename;
|
|
|
public FREE_IMAGE_FORMAT format = FREE_IMAGE_FORMAT.FIF_UNKNOWN;
|
|
|
public FREE_IMAGE_LOAD_FLAGS loadFlags = FREE_IMAGE_LOAD_FLAGS.DEFAULT;
|
|
|
public FREE_IMAGE_SAVE_FLAGS saveFlags = FREE_IMAGE_SAVE_FLAGS.DEFAULT;
|
|
|
|
|
|
public object Clone()
|
|
|
{
|
|
|
return base.MemberwiseClone();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a deep copy of this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
/// <returns>A deep copy of this <see cref="FreeImageBitmap"/>.</returns>
|
|
|
public object Clone()
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
FreeImageBitmap result = null;
|
|
|
FIBITMAP newDib = FreeImage.Clone(dib);
|
|
|
if (!dib.IsNull)
|
|
|
{
|
|
|
result = new FreeImageBitmap(newDib);
|
|
|
result.saveInformation = (SaveInformation)saveInformation.Clone();
|
|
|
result.tag = tag;
|
|
|
result.originalFormat = originalFormat;
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Performs application-defined tasks associated with freeing,
|
|
|
/// releasing, or resetting unmanaged resources.
|
|
|
/// </summary>
|
|
|
public void Dispose()
|
|
|
{
|
|
|
Dispose(true);
|
|
|
GC.SuppressFinalize(this);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Performs application-defined tasks associated with freeing,
|
|
|
/// releasing, or resetting unmanaged resources.
|
|
|
/// </summary>
|
|
|
/// <param name="disposing">If true managed ressources are released.</param>
|
|
|
protected virtual void Dispose(bool disposing)
|
|
|
{
|
|
|
// Only clean up once
|
|
|
lock (lockObject)
|
|
|
{
|
|
|
if (disposed)
|
|
|
{
|
|
|
return;
|
|
|
}
|
|
|
disposed = true;
|
|
|
}
|
|
|
|
|
|
// Clean up managed resources
|
|
|
if (disposing)
|
|
|
{
|
|
|
if (stream != null)
|
|
|
{
|
|
|
if (disposeStream)
|
|
|
{
|
|
|
stream.Dispose();
|
|
|
}
|
|
|
stream = null;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
tag = null;
|
|
|
saveInformation = null;
|
|
|
|
|
|
// Clean up unmanaged resources
|
|
|
UnloadDib();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves an object that can iterate through the individual scanlines in this <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
/// <returns>An <see cref="IEnumerator"/> for the <see cref="FreeImageBitmap"/>.</returns>
|
|
|
/// <exception cref="ArgumentException">The bitmaps's type is not supported.</exception>
|
|
|
IEnumerator IEnumerable.GetEnumerator()
|
|
|
{
|
|
|
return GetScanlines().GetEnumerator();
|
|
|
}
|
|
|
|
|
|
void ISerializable.GetObjectData(SerializationInfo info, StreamingContext context)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
using (MemoryStream memory = new MemoryStream(DataSize))
|
|
|
{
|
|
|
if (!FreeImage.SaveToStream(dib, memory, FREE_IMAGE_FORMAT.FIF_TIFF, FREE_IMAGE_SAVE_FLAGS.TIFF_LZW))
|
|
|
{
|
|
|
throw new SerializationException();
|
|
|
}
|
|
|
memory.Capacity = (int)memory.Length;
|
|
|
info.AddValue("Bitmap Data", memory.GetBuffer());
|
|
|
}
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Class handling non-bitmap related functions.
|
|
|
/// </summary>
|
|
|
public static class FreeImageEngine
|
|
|
{
|
|
|
#region Callback
|
|
|
|
|
|
// Callback delegate
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private static readonly OutputMessageFunction outputMessageFunction;
|
|
|
|
|
|
static FreeImageEngine()
|
|
|
{
|
|
|
// Check if FreeImage.dll is present and cancel setting the callbackfuntion if not
|
|
|
if (!IsAvailable)
|
|
|
{
|
|
|
return;
|
|
|
}
|
|
|
// Create a delegate (function pointer) to 'OnMessage'
|
|
|
outputMessageFunction = new OutputMessageFunction(OnMessage);
|
|
|
// Set the callback
|
|
|
FreeImage.SetOutputMessage(outputMessageFunction);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Internal callback
|
|
|
/// </summary>
|
|
|
private static void OnMessage(FREE_IMAGE_FORMAT fif, string message)
|
|
|
{
|
|
|
// Get a local copy of the multicast-delegate
|
|
|
OutputMessageFunction m = Message;
|
|
|
|
|
|
// Check the local copy instead of the static instance
|
|
|
// to prevent a second thread from setting the delegate
|
|
|
// to null, which would cause a nullreference exception
|
|
|
if (m != null)
|
|
|
{
|
|
|
// Invoke the multicast-delegate
|
|
|
m.Invoke(fif, message);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a value indicating if the FreeImage DLL is available or not.
|
|
|
/// </summary>
|
|
|
public static bool IsAvailable
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return FreeImage.IsAvailable();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Internal errors in FreeImage generate a logstring that can be
|
|
|
/// captured by this event.
|
|
|
/// </summary>
|
|
|
public static event OutputMessageFunction Message;
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a string containing the current version of the library.
|
|
|
/// </summary>
|
|
|
public static string Version
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return FreeImage.GetVersion();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a string containing a standard copyright message.
|
|
|
/// </summary>
|
|
|
public static string CopyrightMessage
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return FreeImage.GetCopyrightMessage();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets whether the platform is using Little Endian.
|
|
|
/// </summary>
|
|
|
public static bool IsLittleEndian
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return FreeImage.IsLittleEndian();
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI.Plugins
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Class representing a FreeImage format.
|
|
|
/// </summary>
|
|
|
public sealed class FreeImagePlugin
|
|
|
{
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private readonly FREE_IMAGE_FORMAT fif;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of this class.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">The FreeImage format to wrap.</param>
|
|
|
internal FreeImagePlugin(FREE_IMAGE_FORMAT fif)
|
|
|
{
|
|
|
this.fif = fif;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the format of this instance.
|
|
|
/// </summary>
|
|
|
public FREE_IMAGE_FORMAT FIFormat
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return fif;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets whether this plugin is enabled.
|
|
|
/// </summary>
|
|
|
public bool Enabled
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return (FreeImage.IsPluginEnabled(fif) == 1);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FreeImage.SetPluginEnabled(fif, value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a string describing the format.
|
|
|
/// </summary>
|
|
|
public string Format
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return FreeImage.GetFormatFromFIF(fif);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a comma-delimited file extension list describing the bitmap formats
|
|
|
/// this plugin can read and/or write.
|
|
|
/// </summary>
|
|
|
public string ExtentsionList
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return FreeImage.GetFIFExtensionList(fif);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a descriptive string that describes the bitmap formats
|
|
|
/// this plugin can read and/or write.
|
|
|
/// </summary>
|
|
|
public string Description
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return FreeImage.GetFIFDescription(fif);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a regular expression string that can be used by
|
|
|
/// a regular expression engine to identify the bitmap.
|
|
|
/// FreeImageQt makes use of this function.
|
|
|
/// </summary>
|
|
|
public string RegExpr
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return FreeImage.GetFIFRegExpr(fif);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets whether this plugin can load bitmaps.
|
|
|
/// </summary>
|
|
|
public bool SupportsReading
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return FreeImage.FIFSupportsReading(fif);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets whether this plugin can save bitmaps.
|
|
|
/// </summary>
|
|
|
public bool SupportsWriting
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return FreeImage.FIFSupportsWriting(fif);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Checks whether this plugin can save a bitmap in the desired data type.
|
|
|
/// </summary>
|
|
|
/// <param name="type">The desired image type.</param>
|
|
|
/// <returns>True if this plugin can save bitmaps as the desired type, else false.</returns>
|
|
|
public bool SupportsExportType(FREE_IMAGE_TYPE type)
|
|
|
{
|
|
|
return FreeImage.FIFSupportsExportType(fif, type);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Checks whether this plugin can save bitmaps in the desired bit depth.
|
|
|
/// </summary>
|
|
|
/// <param name="bpp">The desired bit depth.</param>
|
|
|
/// <returns>True if this plugin can save bitmaps in the desired bit depth, else false.</returns>
|
|
|
public bool SupportsExportBPP(int bpp)
|
|
|
{
|
|
|
return FreeImage.FIFSupportsExportBPP(fif, bpp);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets whether this plugin can load or save an ICC profile.
|
|
|
/// </summary>
|
|
|
public bool SupportsICCProfiles
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return FreeImage.FIFSupportsICCProfiles(fif);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Checks whether an extension is valid for this format.
|
|
|
/// </summary>
|
|
|
/// <param name="extension">The desired extension.</param>
|
|
|
/// <returns>True if the extension is valid for this format, false otherwise.</returns>
|
|
|
public bool ValidExtension(string extension)
|
|
|
{
|
|
|
return FreeImage.IsExtensionValidForFIF(fif, extension);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Checks whether an extension is valid for this format.
|
|
|
/// </summary>
|
|
|
/// <param name="extension">The desired extension.</param>
|
|
|
/// <param name="comparisonType">The string comparison type.</param>
|
|
|
/// <returns>True if the extension is valid for this format, false otherwise.</returns>
|
|
|
public bool ValidExtension(string extension, StringComparison comparisonType)
|
|
|
{
|
|
|
return FreeImage.IsExtensionValidForFIF(fif, extension, comparisonType);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Checks whether a filename is valid for this format.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The desired filename.</param>
|
|
|
/// <returns>True if the filename is valid for this format, false otherwise.</returns>
|
|
|
public bool ValidFilename(string filename)
|
|
|
{
|
|
|
return FreeImage.IsFilenameValidForFIF(fif, filename);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Checks whether a filename is valid for this format.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The desired filename.</param>
|
|
|
/// <param name="comparisonType">The string comparison type.</param>
|
|
|
/// <returns>True if the filename is valid for this format, false otherwise.</returns>
|
|
|
public bool ValidFilename(string filename, StringComparison comparisonType)
|
|
|
{
|
|
|
return FreeImage.IsFilenameValidForFIF(fif, filename, comparisonType);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a descriptive string that describes the bitmap formats
|
|
|
/// this plugin can read and/or write.
|
|
|
/// </summary>
|
|
|
/// <returns>A descriptive string that describes the bitmap formats.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return Description;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI.IO
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Internal class wrapping stream io functions.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// FreeImage can read files from a disk or a network drive but also allows the user to
|
|
|
/// implement their own loading or saving functions to load them directly from an ftp or web
|
|
|
/// server for example.
|
|
|
/// <para/>
|
|
|
/// In .NET streams are a common way to handle data. The <b>FreeImageStreamIO</b> class handles
|
|
|
/// the loading and saving from and to streams. It implements the funtions FreeImage needs
|
|
|
/// to load data from an an arbitrary source.
|
|
|
/// <para/>
|
|
|
/// The class is for internal use only.
|
|
|
/// </remarks>
|
|
|
internal static class FreeImageStreamIO
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// <see cref="FreeImageAPI.IO.FreeImageIO"/> structure that can be used to read from streams via
|
|
|
/// <see cref="FreeImageAPI.FreeImage.LoadFromHandle(FREE_IMAGE_FORMAT, ref FreeImageIO, fi_handle, FREE_IMAGE_LOAD_FLAGS)"/>.
|
|
|
/// </summary>
|
|
|
public static readonly FreeImageIO io;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instances which can be used to
|
|
|
/// create a FreeImage compatible <see cref="FreeImageAPI.IO.FreeImageIO"/> structure.
|
|
|
/// </summary>
|
|
|
static FreeImageStreamIO()
|
|
|
{
|
|
|
io.readProc = new ReadProc(streamRead);
|
|
|
io.writeProc = new WriteProc(streamWrite);
|
|
|
io.seekProc = new SeekProc(streamSeek);
|
|
|
io.tellProc = new TellProc(streamTell);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Reads the requested data from the stream and writes it to the given address.
|
|
|
/// </summary>
|
|
|
static unsafe uint streamRead(IntPtr buffer, uint size, uint count, fi_handle handle)
|
|
|
{
|
|
|
Stream stream = handle.GetObject() as Stream;
|
|
|
if ((stream == null) || (!stream.CanRead))
|
|
|
{
|
|
|
return 0;
|
|
|
}
|
|
|
uint readCount = 0;
|
|
|
byte* ptr = (byte*)buffer;
|
|
|
byte[] bufferTemp = new byte[size];
|
|
|
int read;
|
|
|
while (readCount < count)
|
|
|
{
|
|
|
read = stream.Read(bufferTemp, 0, (int)size);
|
|
|
if (read != (int)size)
|
|
|
{
|
|
|
stream.Seek(-read, SeekOrigin.Current);
|
|
|
break;
|
|
|
}
|
|
|
for (int i = 0; i < read; i++, ptr++)
|
|
|
{
|
|
|
*ptr = bufferTemp[i];
|
|
|
}
|
|
|
readCount++;
|
|
|
}
|
|
|
return (uint)readCount;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Reads the given data and writes it into the stream.
|
|
|
/// </summary>
|
|
|
static unsafe uint streamWrite(IntPtr buffer, uint size, uint count, fi_handle handle)
|
|
|
{
|
|
|
Stream stream = handle.GetObject() as Stream;
|
|
|
if ((stream == null) || (!stream.CanWrite))
|
|
|
{
|
|
|
return 0;
|
|
|
}
|
|
|
uint writeCount = 0;
|
|
|
byte[] bufferTemp = new byte[size];
|
|
|
byte* ptr = (byte*)buffer;
|
|
|
while (writeCount < count)
|
|
|
{
|
|
|
for (int i = 0; i < size; i++, ptr++)
|
|
|
{
|
|
|
bufferTemp[i] = *ptr;
|
|
|
}
|
|
|
try
|
|
|
{
|
|
|
stream.Write(bufferTemp, 0, bufferTemp.Length);
|
|
|
}
|
|
|
catch
|
|
|
{
|
|
|
return writeCount;
|
|
|
}
|
|
|
writeCount++;
|
|
|
}
|
|
|
return writeCount;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Moves the streams position.
|
|
|
/// </summary>
|
|
|
static int streamSeek(fi_handle handle, int offset, SeekOrigin origin)
|
|
|
{
|
|
|
Stream stream = handle.GetObject() as Stream;
|
|
|
if (stream == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
stream.Seek((long)offset, origin);
|
|
|
return 0;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the streams current position
|
|
|
/// </summary>
|
|
|
static int streamTell(fi_handle handle)
|
|
|
{
|
|
|
Stream stream = handle.GetObject() as Stream;
|
|
|
if (stream == null)
|
|
|
{
|
|
|
return -1;
|
|
|
}
|
|
|
return (int)stream.Position;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI.Metadata
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Provides additional information specific for GIF files. This class cannot be inherited.
|
|
|
/// </summary>
|
|
|
public class GifInformation : MDM_ANIMATION
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="GifInformation"/> class
|
|
|
/// with the specified <see cref="FreeImageBitmap"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">A reference to a <see cref="FreeImageBitmap"/> instance.</param>
|
|
|
public GifInformation(FreeImageBitmap bitmap)
|
|
|
: base(bitmap.Dib)
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a value indicating whether this frame uses the
|
|
|
/// GIF image's global palette. If set to <b>false</b>, this
|
|
|
/// frame uses its local palette.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public bool? UseGlobalPalette
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
byte? useGlobalPalette = GetTagValue<byte>("NoLocalPalette");
|
|
|
return useGlobalPalette.HasValue ? (useGlobalPalette.Value != 0) : default(bool?);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
byte? val = null;
|
|
|
if (value.HasValue)
|
|
|
{
|
|
|
val = (byte)(value.Value ? 1 : 0);
|
|
|
}
|
|
|
SetTagValue("NoLocalPalette", val);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a global palette for the GIF image, intialized with all entries of the
|
|
|
/// current local palette.
|
|
|
/// The property <see cref="UseGlobalPalette"/> will be set to <b>true</b> when
|
|
|
/// invoking this method. This effectively enables the newly created global palette.
|
|
|
/// </summary>
|
|
|
/// <exception cref="InvalidOperationException">
|
|
|
/// The image does not have a palette.
|
|
|
/// </exception>
|
|
|
public void CreateGlobalPalette()
|
|
|
{
|
|
|
CreateGlobalPalette(new Palette(dib));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a global palette for the GIF image with the specified size, intialized
|
|
|
/// with the first <paramref name="size"/> entries of the current local palette.
|
|
|
/// The property <see cref="UseGlobalPalette"/> will be set to <b>true</b> when
|
|
|
/// invoking this method. This effectively enables the newly created global palette.
|
|
|
/// </summary>
|
|
|
/// <param name="size">The size of the newly created global palette.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="palette"/> is a null reference.</exception>
|
|
|
public void CreateGlobalPalette(int size)
|
|
|
{
|
|
|
CreateGlobalPalette(new Palette(dib), size);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a global palette for the GIF image, intialized with the entries
|
|
|
/// of the specified palette.
|
|
|
/// The property <see cref="UseGlobalPalette"/> will be set to <b>true</b> when
|
|
|
/// invoking this method. This effectively enables the newly created global palette.
|
|
|
/// </summary>
|
|
|
/// <param name="palette">The palette that contains the initial values for
|
|
|
/// the newly created global palette.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="palette"/> is a null reference.</exception>
|
|
|
public void CreateGlobalPalette(Palette palette)
|
|
|
{
|
|
|
if (palette == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("palette");
|
|
|
}
|
|
|
|
|
|
GlobalPalette = palette;
|
|
|
UseGlobalPalette = true;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a global palette for the GIF image with the specified size, intialized
|
|
|
/// with the first <paramref name="size"/> entries of the specified palette.
|
|
|
/// The property <see cref="UseGlobalPalette"/> will be set to <b>true</b> when
|
|
|
/// invoking this method. This effectively enables the newly created global palette.
|
|
|
/// </summary>
|
|
|
/// <param name="palette">The palette that contains the initial values for
|
|
|
/// the newly created global palette.</param>
|
|
|
/// <param name="size">The size of the newly created global palette.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="palette"/> is a null reference.</exception>
|
|
|
public void CreateGlobalPalette(Palette palette, int size)
|
|
|
{
|
|
|
if (palette == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("palette");
|
|
|
}
|
|
|
if (size <= 0)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("size");
|
|
|
}
|
|
|
|
|
|
Palette pal = new Palette(size);
|
|
|
pal.CopyFrom(palette);
|
|
|
GlobalPalette = palette;
|
|
|
UseGlobalPalette = true;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI.Metadata
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Class handling metadata of a FreeImage bitmap.
|
|
|
/// </summary>
|
|
|
public class ImageMetadata : IEnumerable, IComparable, IComparable<ImageMetadata>
|
|
|
{
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private readonly List<MetadataModel> data;
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private readonly FIBITMAP dib;
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private bool hideEmptyModels;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified <see cref="FIBITMAP"/>,
|
|
|
/// showing all known models.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
public ImageMetadata(FIBITMAP dib) : this(dib, false) { }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified <see cref="FIBITMAP"/>,
|
|
|
/// showing or hiding empry models.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="hideEmptyModels">When <b>true</b>, empty metadata models
|
|
|
/// will be hidden until a tag to this model is added.</param>
|
|
|
public ImageMetadata(FIBITMAP dib, bool hideEmptyModels)
|
|
|
{
|
|
|
if (dib.IsNull) throw new ArgumentNullException("dib");
|
|
|
data = new List<MetadataModel>(FreeImage.FREE_IMAGE_MDMODELS.Length);
|
|
|
this.dib = dib;
|
|
|
this.hideEmptyModels = hideEmptyModels;
|
|
|
|
|
|
data.Add(new MDM_ANIMATION(dib));
|
|
|
data.Add(new MDM_COMMENTS(dib));
|
|
|
data.Add(new MDM_CUSTOM(dib));
|
|
|
data.Add(new MDM_EXIF_EXIF(dib));
|
|
|
data.Add(new MDM_EXIF_GPS(dib));
|
|
|
data.Add(new MDM_INTEROP(dib));
|
|
|
data.Add(new MDM_EXIF_MAIN(dib));
|
|
|
data.Add(new MDM_MAKERNOTE(dib));
|
|
|
data.Add(new MDM_GEOTIFF(dib));
|
|
|
data.Add(new MDM_IPTC(dib));
|
|
|
data.Add(new MDM_NODATA(dib));
|
|
|
data.Add(new MDM_XMP(dib));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the <see cref="MetadataModel"/> of the specified type.
|
|
|
/// <para>In case the getter returns <c>null</c> the model is not contained
|
|
|
/// by the list.</para>
|
|
|
/// <para><c>null</c> can be used calling the setter to destroy the model.</para>
|
|
|
/// </summary>
|
|
|
/// <param name="model">Type of the model.</param>
|
|
|
/// <returns>The <see cref="FreeImageAPI.Metadata.MetadataModel"/> object of the specified type.</returns>
|
|
|
public MetadataModel this[FREE_IMAGE_MDMODEL model]
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
for (int i = 0; i < data.Count; i++)
|
|
|
{
|
|
|
if (data[i].Model == model)
|
|
|
{
|
|
|
if (!data[i].Exists && hideEmptyModels)
|
|
|
{
|
|
|
return null;
|
|
|
}
|
|
|
return data[i];
|
|
|
}
|
|
|
}
|
|
|
return null;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the <see cref="FreeImageAPI.Metadata.MetadataModel"/> at the specified index.
|
|
|
/// <para>In case the getter returns <c>null</c> the model is not contained
|
|
|
/// by the list.</para>
|
|
|
/// <para><c>null</c> can be used calling the setter to destroy the model.</para>
|
|
|
/// </summary>
|
|
|
/// <param name="index">Index of the <see cref="FreeImageAPI.Metadata.MetadataModel"/> within
|
|
|
/// this instance.</param>
|
|
|
/// <returns>The <see cref="FreeImageAPI.Metadata.MetadataModel"/>
|
|
|
/// object at the specified index.</returns>
|
|
|
public MetadataModel this[int index]
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
if (index < 0 || index >= data.Count)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("index");
|
|
|
}
|
|
|
return (hideEmptyModels && !data[index].Exists) ? null : data[index];
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a list of all visible
|
|
|
/// <see cref="FreeImageAPI.Metadata.MetadataModel">MetadataModels</see>.
|
|
|
/// </summary>
|
|
|
public List<MetadataModel> List
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
if (hideEmptyModels)
|
|
|
{
|
|
|
List<MetadataModel> result = new List<MetadataModel>();
|
|
|
for (int i = 0; i < data.Count; i++)
|
|
|
{
|
|
|
if (data[i].Exists)
|
|
|
{
|
|
|
result.Add(data[i]);
|
|
|
}
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
return data;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adds new tag to the bitmap or updates its value in case it already exists.
|
|
|
/// <see cref="FreeImageAPI.Metadata.MetadataTag.Key"/> will be used as key.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag to add or update.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="tag"/> is null.</exception>
|
|
|
public bool AddTag(MetadataTag tag)
|
|
|
{
|
|
|
for (int i = 0; i < data.Count; i++)
|
|
|
{
|
|
|
if (tag.Model == data[i].Model)
|
|
|
{
|
|
|
return data[i].AddTag(tag);
|
|
|
}
|
|
|
}
|
|
|
return false;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the number of visible
|
|
|
/// <see cref="FreeImageAPI.Metadata.MetadataModel">MetadataModels</see>.
|
|
|
/// </summary>
|
|
|
public int Count
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
if (hideEmptyModels)
|
|
|
{
|
|
|
int count = 0;
|
|
|
for (int i = 0; i < data.Count; i++)
|
|
|
{
|
|
|
if (data[i].Exists)
|
|
|
{
|
|
|
count++;
|
|
|
}
|
|
|
}
|
|
|
return count;
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
return data.Count;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets whether empty
|
|
|
/// <see cref="FreeImageAPI.Metadata.MetadataModel">MetadataModels</see> are hidden.
|
|
|
/// </summary>
|
|
|
public bool HideEmptyModels
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return hideEmptyModels;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
hideEmptyModels = value;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves an object that can iterate through the individual
|
|
|
/// <see cref="FreeImageAPI.Metadata.MetadataModel">MetadataModels</see>
|
|
|
/// in this <see cref="ImageMetadata"/>.
|
|
|
/// </summary>
|
|
|
/// <returns>An <see cref="IEnumerator"/> for this <see cref="ImageMetadata"/>.</returns>
|
|
|
public IEnumerator GetEnumerator()
|
|
|
{
|
|
|
if (hideEmptyModels)
|
|
|
{
|
|
|
List<MetadataModel> tempList = new List<MetadataModel>(data.Count);
|
|
|
for (int i = 0; i < data.Count; i++)
|
|
|
{
|
|
|
if (data[i].Exists)
|
|
|
{
|
|
|
tempList.Add(data[i]);
|
|
|
}
|
|
|
}
|
|
|
return tempList.GetEnumerator();
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
return data.GetEnumerator();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer indicating the lexical relationship between the two comparands.</returns>
|
|
|
/// <exception cref="ArgumentException"><paramref name="obj"/> is not a <see cref="ImageMetadata"/>.</exception>
|
|
|
public int CompareTo(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
if (!(obj is ImageMetadata))
|
|
|
{
|
|
|
throw new ArgumentException("obj");
|
|
|
}
|
|
|
return CompareTo((ImageMetadata)obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="ImageMetadata"/> object.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="ImageMetadata"/> to compare.</param>
|
|
|
/// <returns>A signed number indicating the relative values of this instance
|
|
|
/// and <paramref name="other"/>.</returns>
|
|
|
public int CompareTo(ImageMetadata other)
|
|
|
{
|
|
|
return this.dib.CompareTo(other.dib);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI.Plugins
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Class representing own FreeImage-Plugins.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// FreeImages itself is plugin based. Each supported format is integrated by a seperat plugin,
|
|
|
/// that handles loading, saving, descriptions, identifing ect.
|
|
|
/// And of course the user can create own plugins and use them in FreeImage.
|
|
|
/// To do that the above mentioned predefined methodes need to be implemented.
|
|
|
/// <para/>
|
|
|
/// The class below handles the creation of such a plugin. The class itself is abstract
|
|
|
/// as well as some core functions that need to be implemented.
|
|
|
/// The class can be used to enable or disable the plugin in FreeImage after regististration or
|
|
|
/// retrieve the formatid, assigned by FreeImage.
|
|
|
/// The class handles the callback functions, garbage collector and pointer operation to make
|
|
|
/// the implementation as user friendly as possible.
|
|
|
/// <para/>
|
|
|
/// How to:
|
|
|
/// There are two functions that need to be implemented:
|
|
|
/// <see cref="FreeImageAPI.Plugins.LocalPlugin.GetImplementedMethods"/> and
|
|
|
/// <see cref="FreeImageAPI.Plugins.LocalPlugin.FormatProc"/>.
|
|
|
/// <see cref="FreeImageAPI.Plugins.LocalPlugin.GetImplementedMethods"/> is used by the constructor
|
|
|
/// of the abstract class. FreeImage wants a list of the implemented functions. Each function is
|
|
|
/// represented by a function pointer (a .NET <see cref="System.Delegate"/>). In case a function
|
|
|
/// is not implemented FreeImage receives an empty <b>delegate</b>). To tell the constructor
|
|
|
/// which functions have been implemented the information is represented by a disjunction of
|
|
|
/// <see cref="FreeImageAPI.Plugins.LocalPlugin.MethodFlags"/>.
|
|
|
/// <para/>
|
|
|
/// For example:
|
|
|
/// return MethodFlags.LoadProc | MethodFlags.SaveProc;
|
|
|
/// <para/>
|
|
|
/// The above statement means that LoadProc and SaveProc have been implemented by the user.
|
|
|
/// Keep in mind, that each function has a standard implementation that has static return
|
|
|
/// values that may cause errors if listed in
|
|
|
/// <see cref="FreeImageAPI.Plugins.LocalPlugin.GetImplementedMethods"/> without a real implementation.
|
|
|
/// <para/>
|
|
|
/// <see cref="FreeImageAPI.Plugins.LocalPlugin.FormatProc"/> is used by some checks of FreeImage and
|
|
|
/// must be implemented. <see cref="FreeImageAPI.Plugins.LocalPlugin.LoadProc"/> for example can be
|
|
|
/// implemented if the plugin supports reading, but it doesn't have to, the plugin could only
|
|
|
/// be used to save an already loaded bitmap in a special format.
|
|
|
/// </remarks>
|
|
|
public abstract class LocalPlugin
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Struct containing function pointers.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private Plugin plugin;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Delegate for register callback by FreeImage.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private InitProc initProc;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The format id assiged to the plugin.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
protected FREE_IMAGE_FORMAT format = FREE_IMAGE_FORMAT.FIF_UNKNOWN;
|
|
|
|
|
|
/// <summary>
|
|
|
/// When true the plugin was registered successfully else false.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
protected readonly bool registered = false;
|
|
|
|
|
|
/// <summary>
|
|
|
/// A copy of the functions used to register.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
protected readonly MethodFlags implementedMethods;
|
|
|
|
|
|
/// <summary>
|
|
|
/// MethodFlags defines values to fill a bitfield telling which
|
|
|
/// functions have been implemented by a plugin.
|
|
|
/// </summary>
|
|
|
[Flags]
|
|
|
protected enum MethodFlags
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// No mothods implemented.
|
|
|
/// </summary>
|
|
|
None = 0x0,
|
|
|
|
|
|
/// <summary>
|
|
|
/// DescriptionProc has been implemented.
|
|
|
/// </summary>
|
|
|
DescriptionProc = 0x1,
|
|
|
|
|
|
/// <summary>
|
|
|
/// ExtensionListProc has been implemented.
|
|
|
/// </summary>
|
|
|
ExtensionListProc = 0x2,
|
|
|
|
|
|
/// <summary>
|
|
|
/// RegExprProc has been implemented.
|
|
|
/// </summary>
|
|
|
RegExprProc = 0x4,
|
|
|
|
|
|
/// <summary>
|
|
|
/// OpenProc has been implemented.
|
|
|
/// </summary>
|
|
|
OpenProc = 0x8,
|
|
|
|
|
|
/// <summary>
|
|
|
/// CloseProc has been implemented.
|
|
|
/// </summary>
|
|
|
CloseProc = 0x10,
|
|
|
|
|
|
/// <summary>
|
|
|
/// PageCountProc has been implemented.
|
|
|
/// </summary>
|
|
|
PageCountProc = 0x20,
|
|
|
|
|
|
/// <summary>
|
|
|
/// PageCapabilityProc has been implemented.
|
|
|
/// </summary>
|
|
|
PageCapabilityProc = 0x40,
|
|
|
|
|
|
/// <summary>
|
|
|
/// LoadProc has been implemented.
|
|
|
/// </summary>
|
|
|
LoadProc = 0x80,
|
|
|
|
|
|
/// <summary>
|
|
|
/// SaveProc has been implemented.
|
|
|
/// </summary>
|
|
|
SaveProc = 0x100,
|
|
|
|
|
|
/// <summary>
|
|
|
/// ValidateProc has been implemented.
|
|
|
/// </summary>
|
|
|
ValidateProc = 0x200,
|
|
|
|
|
|
/// <summary>
|
|
|
/// MimeProc has been implemented.
|
|
|
/// </summary>
|
|
|
MimeProc = 0x400,
|
|
|
|
|
|
/// <summary>
|
|
|
/// SupportsExportBPPProc has been implemented.
|
|
|
/// </summary>
|
|
|
SupportsExportBPPProc = 0x800,
|
|
|
|
|
|
/// <summary>
|
|
|
/// SupportsExportTypeProc has been implemented.
|
|
|
/// </summary>
|
|
|
SupportsExportTypeProc = 0x1000,
|
|
|
|
|
|
/// <summary>
|
|
|
/// SupportsICCProfilesProc has been implemented.
|
|
|
/// </summary>
|
|
|
SupportsICCProfilesProc = 0x2000
|
|
|
}
|
|
|
|
|
|
// Functions that must be implemented.
|
|
|
|
|
|
/// <summary>
|
|
|
/// Function that returns a bitfield containing the
|
|
|
/// implemented methods.
|
|
|
/// </summary>
|
|
|
/// <returns>Bitfield of the implemented methods.</returns>
|
|
|
protected abstract MethodFlags GetImplementedMethods();
|
|
|
|
|
|
/// <summary>
|
|
|
/// Implementation of <b>FormatProc</b>
|
|
|
/// </summary>
|
|
|
/// <returns>A string containing the plugins format.</returns>
|
|
|
protected abstract string FormatProc();
|
|
|
|
|
|
// Functions that can be implemented.
|
|
|
|
|
|
/// <summary>
|
|
|
/// Function that can be implemented.
|
|
|
/// </summary>
|
|
|
protected virtual string DescriptionProc() { return ""; }
|
|
|
/// <summary>
|
|
|
/// Function that can be implemented.
|
|
|
/// </summary>
|
|
|
protected virtual string ExtensionListProc() { return ""; }
|
|
|
/// <summary>
|
|
|
/// Function that can be implemented.
|
|
|
/// </summary>
|
|
|
protected virtual string RegExprProc() { return ""; }
|
|
|
/// <summary>
|
|
|
/// Function that can be implemented.
|
|
|
/// </summary>
|
|
|
protected virtual IntPtr OpenProc(ref FreeImageIO io, fi_handle handle, bool read) { return IntPtr.Zero; }
|
|
|
/// <summary>
|
|
|
/// Function that can be implemented.
|
|
|
/// </summary>
|
|
|
protected virtual void CloseProc(ref FreeImageIO io, fi_handle handle, IntPtr data) { }
|
|
|
/// <summary>
|
|
|
/// Function that can be implemented.
|
|
|
/// </summary>
|
|
|
protected virtual int PageCountProc(ref FreeImageIO io, fi_handle handle, IntPtr data) { return 0; }
|
|
|
/// <summary>
|
|
|
/// Function that can be implemented.
|
|
|
/// </summary>
|
|
|
protected virtual int PageCapabilityProc(ref FreeImageIO io, fi_handle handle, IntPtr data) { return 0; }
|
|
|
/// <summary>
|
|
|
/// Function that can be implemented.
|
|
|
/// </summary>
|
|
|
protected virtual FIBITMAP LoadProc(ref FreeImageIO io, fi_handle handle, int page, int flags, IntPtr data) { return FIBITMAP.Zero; }
|
|
|
/// <summary>
|
|
|
/// Function that can be implemented.
|
|
|
/// </summary>
|
|
|
protected virtual bool SaveProc(ref FreeImageIO io, FIBITMAP dib, fi_handle handle, int page, int flags, IntPtr data) { return false; }
|
|
|
/// <summary>
|
|
|
/// Function that can be implemented.
|
|
|
/// </summary>
|
|
|
protected virtual bool ValidateProc(ref FreeImageIO io, fi_handle handle) { return false; }
|
|
|
/// <summary>
|
|
|
/// Function that can be implemented.
|
|
|
/// </summary>
|
|
|
protected virtual string MimeProc() { return ""; }
|
|
|
/// <summary>
|
|
|
/// Function that can be implemented.
|
|
|
/// </summary>
|
|
|
protected virtual bool SupportsExportBPPProc(int bpp) { return false; }
|
|
|
/// <summary>
|
|
|
/// Function that can be implemented.
|
|
|
/// </summary>
|
|
|
protected virtual bool SupportsExportTypeProc(FREE_IMAGE_TYPE type) { return false; }
|
|
|
/// <summary>
|
|
|
/// Function that can be implemented.
|
|
|
/// </summary>
|
|
|
protected virtual bool SupportsICCProfilesProc() { return false; }
|
|
|
|
|
|
/// <summary>
|
|
|
/// The constructor automatically registeres the plugin in FreeImage.
|
|
|
/// To do this it prepares a FreeImage defined structure with function pointers
|
|
|
/// to the implemented functions or null if not implemented.
|
|
|
/// Before registing the functions they are pinned in memory so the garbage collector
|
|
|
/// can't move them around in memory after we passed there addresses to FreeImage.
|
|
|
/// </summary>
|
|
|
public LocalPlugin()
|
|
|
{
|
|
|
implementedMethods = GetImplementedMethods();
|
|
|
|
|
|
if ((implementedMethods & MethodFlags.DescriptionProc) != 0)
|
|
|
{
|
|
|
plugin.descriptionProc = new DescriptionProc(DescriptionProc);
|
|
|
}
|
|
|
if ((implementedMethods & MethodFlags.ExtensionListProc) != 0)
|
|
|
{
|
|
|
plugin.extensionListProc = new ExtensionListProc(ExtensionListProc);
|
|
|
}
|
|
|
if ((implementedMethods & MethodFlags.RegExprProc) != 0)
|
|
|
{
|
|
|
plugin.regExprProc = new RegExprProc(RegExprProc);
|
|
|
}
|
|
|
if ((implementedMethods & MethodFlags.OpenProc) != 0)
|
|
|
{
|
|
|
plugin.openProc = new OpenProc(OpenProc);
|
|
|
}
|
|
|
if ((implementedMethods & MethodFlags.CloseProc) != 0)
|
|
|
{
|
|
|
plugin.closeProc = new CloseProc(CloseProc);
|
|
|
}
|
|
|
if ((implementedMethods & MethodFlags.PageCountProc) != 0)
|
|
|
{
|
|
|
plugin.pageCountProc = new PageCountProc(PageCountProc);
|
|
|
}
|
|
|
if ((implementedMethods & MethodFlags.PageCapabilityProc) != 0)
|
|
|
{
|
|
|
plugin.pageCapabilityProc = new PageCapabilityProc(PageCapabilityProc);
|
|
|
}
|
|
|
if ((implementedMethods & MethodFlags.LoadProc) != 0)
|
|
|
{
|
|
|
plugin.loadProc = new LoadProc(LoadProc);
|
|
|
}
|
|
|
if ((implementedMethods & MethodFlags.SaveProc) != 0)
|
|
|
{
|
|
|
plugin.saveProc = new SaveProc(SaveProc);
|
|
|
}
|
|
|
if ((implementedMethods & MethodFlags.ValidateProc) != 0)
|
|
|
{
|
|
|
plugin.validateProc = new ValidateProc(ValidateProc);
|
|
|
}
|
|
|
if ((implementedMethods & MethodFlags.MimeProc) != 0)
|
|
|
{
|
|
|
plugin.mimeProc = new MimeProc(MimeProc);
|
|
|
}
|
|
|
if ((implementedMethods & MethodFlags.SupportsExportBPPProc) != 0)
|
|
|
{
|
|
|
plugin.supportsExportBPPProc = new SupportsExportBPPProc(SupportsExportBPPProc);
|
|
|
}
|
|
|
if ((implementedMethods & MethodFlags.SupportsExportTypeProc) != 0)
|
|
|
{
|
|
|
plugin.supportsExportTypeProc = new SupportsExportTypeProc(SupportsExportTypeProc);
|
|
|
}
|
|
|
if ((implementedMethods & MethodFlags.SupportsICCProfilesProc) != 0)
|
|
|
{
|
|
|
plugin.supportsICCProfilesProc = new SupportsICCProfilesProc(SupportsICCProfilesProc);
|
|
|
}
|
|
|
|
|
|
// FormatProc is always implemented
|
|
|
plugin.formatProc = new FormatProc(FormatProc);
|
|
|
|
|
|
// InitProc is the register call back.
|
|
|
initProc = new InitProc(RegisterProc);
|
|
|
|
|
|
// Register the plugin. The result will be saved and can be accessed later.
|
|
|
registered = FreeImage.RegisterLocalPlugin(initProc, null, null, null, null) != FREE_IMAGE_FORMAT.FIF_UNKNOWN;
|
|
|
if (registered)
|
|
|
{
|
|
|
PluginRepository.RegisterLocalPlugin(this);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
private void RegisterProc(ref Plugin plugin, int format_id)
|
|
|
{
|
|
|
// Copy the function pointers
|
|
|
plugin = this.plugin;
|
|
|
// Retrieve the format if assigned to this plugin by FreeImage.
|
|
|
format = (FREE_IMAGE_FORMAT)format_id;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets if the plugin is enabled.
|
|
|
/// </summary>
|
|
|
public bool Enabled
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
if (registered)
|
|
|
{
|
|
|
return (FreeImage.IsPluginEnabled(format) > 0);
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
throw new ObjectDisposedException("plugin not registered");
|
|
|
}
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
if (registered)
|
|
|
{
|
|
|
FreeImage.SetPluginEnabled(format, value);
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
throw new ObjectDisposedException("plugin not registered");
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets if the plugin was registered successfully.
|
|
|
/// </summary>
|
|
|
public bool Registered
|
|
|
{
|
|
|
get { return registered; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the <see cref="FREE_IMAGE_FORMAT"/> FreeImage assigned to this plugin.
|
|
|
/// </summary>
|
|
|
public FREE_IMAGE_FORMAT Format
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return format;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Reads from an unmanaged stream.
|
|
|
/// </summary>
|
|
|
protected unsafe int Read(FreeImageIO io, fi_handle handle, uint size, uint count, ref byte[] buffer)
|
|
|
{
|
|
|
fixed (byte* ptr = buffer)
|
|
|
{
|
|
|
return (int)io.readProc(new IntPtr(ptr), size, count, handle);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Reads a single byte from an unmanaged stream.
|
|
|
/// </summary>
|
|
|
protected unsafe int ReadByte(FreeImageIO io, fi_handle handle)
|
|
|
{
|
|
|
byte buffer = 0;
|
|
|
return (int)io.readProc(new IntPtr(&buffer), 1, 1, handle) > 0 ? buffer : -1;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Writes to an unmanaged stream.
|
|
|
/// </summary>
|
|
|
protected unsafe int Write(FreeImageIO io, fi_handle handle, uint size, uint count, ref byte[] buffer)
|
|
|
{
|
|
|
fixed (byte* ptr = buffer)
|
|
|
{
|
|
|
return (int)io.writeProc(new IntPtr(ptr), size, count, handle);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Writes a single byte to an unmanaged stream.
|
|
|
/// </summary>
|
|
|
protected unsafe int WriteByte(FreeImageIO io, fi_handle handle, byte value)
|
|
|
{
|
|
|
return (int)io.writeProc(new IntPtr(&value), 1, 1, handle);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Seeks in an unmanaged stream.
|
|
|
/// </summary>
|
|
|
protected int Seek(FreeImageIO io, fi_handle handle, int offset, SeekOrigin origin)
|
|
|
{
|
|
|
return io.seekProc(handle, offset, origin);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the position of an unmanaged stream.
|
|
|
/// </summary>
|
|
|
protected int Tell(FreeImageIO io, fi_handle handle)
|
|
|
{
|
|
|
return io.tellProc(handle);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Represents unmanaged memory, containing an array of a given structure.
|
|
|
/// </summary>
|
|
|
/// <typeparam name="T">Structuretype represented by the instance.</typeparam>
|
|
|
/// <remarks>
|
|
|
/// <see cref="System.Boolean"/> and <see cref="System.Char"/> can not be marshalled.
|
|
|
/// <para/>
|
|
|
/// Use <see cref="System.Int32"/> instead of <see cref="System.Boolean"/> and
|
|
|
/// <see cref="System.Byte"/> instead of <see cref="System.Char"/>.
|
|
|
/// </remarks>
|
|
|
public unsafe class MemoryArray<T> : IDisposable, ICloneable, ICollection, IEnumerable<T>, IEquatable<MemoryArray<T>> where T : struct
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Baseaddress of the wrapped memory.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
protected byte* baseAddress;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Number of elements being wrapped.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
protected int length;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Size, in bytes, of each element.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private static readonly int size;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Array of <b>T</b> containing a single element.
|
|
|
/// The array is used as a workaround, because there are no pointer for generic types.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
protected T[] buffer;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Pointer to the element of <b>buffer</b>.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
protected byte* ptr;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Handle for pinning <b>buffer</b>.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
protected GCHandle handle;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Indicates whether the wrapped memory is handled like a bitfield.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
protected readonly bool isOneBit;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Indicates whther the wrapped memory is handles like 4-bit blocks.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
protected readonly bool isFourBit;
|
|
|
|
|
|
/// <summary>
|
|
|
/// An object that can be used to synchronize access to the <see cref="MemoryArray<T>"/>.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
protected object syncRoot = null;
|
|
|
|
|
|
static MemoryArray()
|
|
|
{
|
|
|
T[] dummy = new T[2];
|
|
|
long marshalledSize = Marshal.SizeOf(typeof(T));
|
|
|
long structureSize =
|
|
|
Marshal.UnsafeAddrOfPinnedArrayElement(dummy, 1).ToInt64() -
|
|
|
Marshal.UnsafeAddrOfPinnedArrayElement(dummy, 0).ToInt64();
|
|
|
if (marshalledSize != structureSize)
|
|
|
{
|
|
|
throw new NotSupportedException(
|
|
|
"The desired type can not be handled, " +
|
|
|
"because its managed and unmanaged size in bytes are different.");
|
|
|
}
|
|
|
|
|
|
size = (int)marshalledSize;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance.
|
|
|
/// </summary>
|
|
|
protected MemoryArray()
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="MemoryArray<T>"/> class.
|
|
|
/// </summary>
|
|
|
/// <param name="baseAddress">Address of the memory block.</param>
|
|
|
/// <param name="length">Length of the array.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="baseAddress"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="length"/> is less or equal zero.</exception>
|
|
|
/// <exception cref="NotSupportedException">
|
|
|
/// The type is not supported.</exception>
|
|
|
public MemoryArray(IntPtr baseAddress, int length)
|
|
|
: this(baseAddress.ToPointer(), length)
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of the <see cref="MemoryArray<T>"/> class.
|
|
|
/// </summary>
|
|
|
/// <param name="baseAddress">Address of the memory block.</param>
|
|
|
/// <param name="length">Length of the array.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="baseAddress"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="length"/> is less or equal zero.</exception>
|
|
|
/// <exception cref="NotSupportedException">
|
|
|
/// The type is not supported.</exception>
|
|
|
public MemoryArray(void* baseAddress, int length)
|
|
|
{
|
|
|
if (typeof(T) == typeof(FI1BIT))
|
|
|
{
|
|
|
isOneBit = true;
|
|
|
}
|
|
|
else if (typeof(T) == typeof(FI4BIT))
|
|
|
{
|
|
|
isFourBit = true;
|
|
|
}
|
|
|
|
|
|
if (baseAddress == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("baseAddress");
|
|
|
}
|
|
|
if (length < 1)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("length");
|
|
|
}
|
|
|
|
|
|
this.baseAddress = (byte*)baseAddress;
|
|
|
this.length = (int)length;
|
|
|
|
|
|
if (!isOneBit && !isFourBit)
|
|
|
{
|
|
|
// Create an array containing a single element.
|
|
|
// Due to the fact, that it's not possible to create pointers
|
|
|
// of generic types, an array is used to obtain the memory
|
|
|
// address of an element of T.
|
|
|
this.buffer = new T[1];
|
|
|
// The array is pinned immediately to prevent the GC from
|
|
|
// moving it to a different position in memory.
|
|
|
this.handle = GCHandle.Alloc(buffer, GCHandleType.Pinned);
|
|
|
// The array and its content have beed pinned, so that its address
|
|
|
// can be safely requested and stored for the whole lifetime
|
|
|
// of the instace.
|
|
|
this.ptr = (byte*)handle.AddrOfPinnedObject();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Frees the allocated <see cref="System.Runtime.InteropServices.GCHandle"/>.
|
|
|
/// </summary>
|
|
|
~MemoryArray()
|
|
|
{
|
|
|
Dispose(false);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="MemoryArray<T>"/> structures are equivalent.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="MemoryArray<T>"/> that is to the left of the equality operator.</param>
|
|
|
/// <param name="right">The <see cref="MemoryArray<T>"/> that is to the right of the equality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="MemoryArray<T>"/> structures are equal; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(MemoryArray<T> left, MemoryArray<T> right)
|
|
|
{
|
|
|
if (object.ReferenceEquals(left, right))
|
|
|
{
|
|
|
return true;
|
|
|
}
|
|
|
if (object.ReferenceEquals(right, null) ||
|
|
|
object.ReferenceEquals(left, null) ||
|
|
|
(left.length != right.length))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
if (left.baseAddress == right.baseAddress)
|
|
|
{
|
|
|
return true;
|
|
|
}
|
|
|
return FreeImage.CompareMemory(left.baseAddress, right.baseAddress, (uint)left.length);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether two specified <see cref="MemoryArray<T>"/> structures are different.
|
|
|
/// </summary>
|
|
|
/// <param name="left">The <see cref="MemoryArray<T>"/> that is to the left of the inequality operator.</param>
|
|
|
/// <param name="right">The <see cref="MemoryArray<T>"/> that is to the right of the inequality operator.</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the two <see cref="MemoryArray<T>"/> structures are different; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(MemoryArray<T> left, MemoryArray<T> right)
|
|
|
{
|
|
|
return (!(left == right));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the value at the specified position.
|
|
|
/// </summary>
|
|
|
/// <param name="index">A 32-bit integer that represents the position
|
|
|
/// of the array element to get.</param>
|
|
|
/// <returns>The value at the specified position.</returns>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="index"/> is outside the range of valid indexes
|
|
|
/// for the unmanaged array.</exception>
|
|
|
public T GetValue(int index)
|
|
|
{
|
|
|
if ((index >= this.length) || (index < 0))
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("index");
|
|
|
}
|
|
|
|
|
|
return GetValueInternal(index);
|
|
|
}
|
|
|
|
|
|
private T GetValueInternal(int index)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (isOneBit)
|
|
|
{
|
|
|
return (T)(object)(FI1BIT)(((baseAddress[index / 8] & ((1 << (7 - (index % 8))))) == 0) ? 0 : 1);
|
|
|
}
|
|
|
else if (isFourBit)
|
|
|
{
|
|
|
return (T)(object)(FI4BIT)(((index % 2) == 0) ? (baseAddress[index / 2] >> 4) : (baseAddress[index / 2] & 0x0F));
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
CopyMemory(ptr, baseAddress + (index * size), size);
|
|
|
return buffer[0];
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets a value to the element at the specified position.
|
|
|
/// </summary>
|
|
|
/// <param name="value">The new value for the specified element.</param>
|
|
|
/// <param name="index">A 32-bit integer that represents the
|
|
|
/// position of the array element to set.</param>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="index"/> is outside the range of valid indexes
|
|
|
/// for the unmanaged array.</exception>
|
|
|
public void SetValue(T value, int index)
|
|
|
{
|
|
|
if ((index >= this.length) || (index < 0))
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("index");
|
|
|
}
|
|
|
SetValueInternal(value, index);
|
|
|
}
|
|
|
|
|
|
private void SetValueInternal(T value, int index)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (isOneBit)
|
|
|
{
|
|
|
if ((FI1BIT)(object)value != 0)
|
|
|
{
|
|
|
baseAddress[index / 8] |= (byte)(1 << (7 - (index % 8)));
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
baseAddress[index / 8] &= (byte)(~(1 << (7 - (index % 8))));
|
|
|
}
|
|
|
}
|
|
|
else if (isFourBit)
|
|
|
{
|
|
|
if ((index % 2) == 0)
|
|
|
{
|
|
|
baseAddress[index / 2] = (byte)((baseAddress[index / 2] & 0x0F) | ((FI4BIT)(object)value << 4));
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
baseAddress[index / 2] = (byte)((baseAddress[index / 2] & 0xF0) | ((FI4BIT)(object)value & 0x0F));
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
buffer[0] = value;
|
|
|
CopyMemory(baseAddress + (index * size), ptr, size);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the values at the specified position and length.
|
|
|
/// </summary>
|
|
|
/// <param name="index">A 32-bit integer that represents the position
|
|
|
/// of the array elements to get.</param>
|
|
|
/// <param name="length"> A 32-bit integer that represents the length
|
|
|
/// of the array elements to get.</param>
|
|
|
/// <returns>The values at the specified position and length.</returns>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="index"/> is outside the range of valid indexes
|
|
|
/// for the unmanaged array or <paramref name="length"/> is greater than the number of elements
|
|
|
/// from <paramref name="index"/> to the end of the unmanaged array.</exception>
|
|
|
public T[] GetValues(int index, int length)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if ((index >= this.length) || (index < 0))
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("index");
|
|
|
}
|
|
|
if (((index + length) > this.length) || (length < 1))
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("length");
|
|
|
}
|
|
|
|
|
|
T[] data = new T[length];
|
|
|
if (isOneBit || isFourBit)
|
|
|
{
|
|
|
for (int i = 0; i < length; i++)
|
|
|
{
|
|
|
data[i] = GetValueInternal(i);
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
GCHandle handle = GCHandle.Alloc(data, GCHandleType.Pinned);
|
|
|
byte* dst = (byte*)Marshal.UnsafeAddrOfPinnedArrayElement(data, 0);
|
|
|
CopyMemory(dst, baseAddress + (size * index), size * length);
|
|
|
handle.Free();
|
|
|
}
|
|
|
return data;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the values at the specified position.
|
|
|
/// </summary>
|
|
|
/// <param name="values">An array containing the new values for the specified elements.</param>
|
|
|
/// <param name="index">A 32-bit integer that represents the position
|
|
|
/// of the array elements to set.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="values"/> is a null reference (Nothing in Visual Basic).</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="index"/> is outside the range of valid indexes
|
|
|
/// for the unmanaged array or <paramref name="values.Length"/> is greater than the number of elements
|
|
|
/// from <paramref name="index"/> to the end of the array.</exception>
|
|
|
public void SetValues(T[] values, int index)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (values == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("values");
|
|
|
}
|
|
|
if ((index >= this.length) || (index < 0))
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("index");
|
|
|
}
|
|
|
if ((index + values.Length) > this.length)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("values.Length");
|
|
|
}
|
|
|
|
|
|
if (isOneBit || isFourBit)
|
|
|
{
|
|
|
for (int i = 0; i != values.Length; )
|
|
|
{
|
|
|
SetValueInternal(values[i++], index++);
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
GCHandle handle = GCHandle.Alloc(values, GCHandleType.Pinned);
|
|
|
byte* src = (byte*)Marshal.UnsafeAddrOfPinnedArrayElement(values, 0);
|
|
|
CopyMemory(baseAddress + (index * size), src, size * length);
|
|
|
handle.Free();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies the entire array to a compatible one-dimensional <see cref="System.Array"/>,
|
|
|
/// starting at the specified index of the target array.
|
|
|
/// </summary>
|
|
|
/// <param name="array">The one-dimensional <see cref="System.Array"/> that is the destination
|
|
|
/// of the elements copied from <see cref="MemoryArray<T>"/>.
|
|
|
/// The <see cref="System.Array"/> must have zero-based indexing.</param>
|
|
|
/// <param name="index">The zero-based index in <paramref name="array"/>
|
|
|
/// at which copying begins.</param>
|
|
|
public void CopyTo(Array array, int index)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (!(array is T[]))
|
|
|
{
|
|
|
throw new InvalidCastException("array");
|
|
|
}
|
|
|
try
|
|
|
{
|
|
|
CopyTo((T[])array, 0, index, length);
|
|
|
}
|
|
|
catch (ArgumentOutOfRangeException ex)
|
|
|
{
|
|
|
throw new ArgumentException(ex.Message, ex);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies a range of elements from the unmanaged array starting at the specified
|
|
|
/// <typeparamref name="sourceIndex"/> and pastes them to <paramref name="array"/>
|
|
|
/// starting at the specified <paramref name="destinationIndex"/>.
|
|
|
/// The length and the indexes are specified as 32-bit integers.
|
|
|
/// </summary>
|
|
|
/// <param name="array">The array that receives the data.</param>
|
|
|
/// <param name="sourceIndex">A 32-bit integer that represents the index
|
|
|
/// in the unmanaged array at which copying begins.</param>
|
|
|
/// <param name="destinationIndex">A 32-bit integer that represents the index in
|
|
|
/// the destination array at which storing begins.</param>
|
|
|
/// <param name="length">A 32-bit integer that represents the number of elements to copy.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="array"/> is a null reference (Nothing in Visual Basic).</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="sourceIndex"/> is outside the range of valid indexes
|
|
|
/// for the unmanaged array or <paramref name="length"/> is greater than the number of elements
|
|
|
/// from <paramref name="index"/> to the end of the unmanaged array
|
|
|
/// <para>-or-</para>
|
|
|
/// <paramref name="destinationIndex"/> is outside the range of valid indexes
|
|
|
/// for the array or <paramref name="length"/> is greater than the number of elements
|
|
|
/// from <paramref name="index"/> to the end of the array.
|
|
|
/// </exception>
|
|
|
public void CopyTo(T[] array, int sourceIndex, int destinationIndex, int length)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (array == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("array");
|
|
|
}
|
|
|
if ((sourceIndex >= this.length) || (sourceIndex < 0))
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("sourceIndex");
|
|
|
}
|
|
|
if ((destinationIndex >= array.Length) || (destinationIndex < 0))
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("destinationIndex");
|
|
|
}
|
|
|
if ((sourceIndex + length > this.length) ||
|
|
|
(destinationIndex + length > array.Length) ||
|
|
|
(length < 1))
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("length");
|
|
|
}
|
|
|
|
|
|
if (isOneBit || isFourBit)
|
|
|
{
|
|
|
for (int i = 0; i != length; i++)
|
|
|
{
|
|
|
array[destinationIndex++] = GetValueInternal(sourceIndex++);
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
GCHandle handle = GCHandle.Alloc(array, GCHandleType.Pinned);
|
|
|
byte* dst = (byte*)Marshal.UnsafeAddrOfPinnedArrayElement(array, destinationIndex);
|
|
|
CopyMemory(dst, baseAddress + (size * sourceIndex), size * length);
|
|
|
handle.Free();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies a range of elements from the array starting at the specified
|
|
|
/// <typeparamref name="sourceIndex"/> and pastes them to the unmanaged array
|
|
|
/// starting at the specified <paramref name="destinationIndex"/>.
|
|
|
/// The length and the indexes are specified as 32-bit integers.
|
|
|
/// </summary>
|
|
|
/// <param name="array">The array that holds the data.</param>
|
|
|
/// <param name="sourceIndex">A 32-bit integer that represents the index
|
|
|
/// in the array at which copying begins.</param>
|
|
|
/// <param name="destinationIndex">A 32-bit integer that represents the index in
|
|
|
/// the unmanaged array at which storing begins.</param>
|
|
|
/// <param name="length">A 32-bit integer that represents the number of elements to copy.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="array"/> is a null reference (Nothing in Visual Basic).</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="sourceIndex"/> is outside the range of valid indexes
|
|
|
/// for the array or <paramref name="length"/> is greater than the number of elements
|
|
|
/// from <paramref name="index"/> to the end of the array
|
|
|
/// <para>-or-</para>
|
|
|
/// <paramref name="destinationIndex"/> is outside the range of valid indexes
|
|
|
/// for the unmanaged array or <paramref name="length"/> is greater than the number of elements
|
|
|
/// from <paramref name="index"/> to the end of the unmanaged array.
|
|
|
/// </exception>
|
|
|
public void CopyFrom(T[] array, int sourceIndex, int destinationIndex, int length)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (array == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("array");
|
|
|
}
|
|
|
if ((destinationIndex >= this.length) || (destinationIndex < 0))
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("destinationIndex");
|
|
|
}
|
|
|
if ((sourceIndex >= array.Length) || (sourceIndex < 0))
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("sourceIndex");
|
|
|
}
|
|
|
if ((destinationIndex + length > this.length) ||
|
|
|
(sourceIndex + length > array.Length) ||
|
|
|
(length < 1))
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("length");
|
|
|
}
|
|
|
|
|
|
if (isOneBit || isFourBit)
|
|
|
{
|
|
|
for (int i = 0; i != length; i++)
|
|
|
{
|
|
|
SetValueInternal(array[sourceIndex++], destinationIndex++);
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
GCHandle handle = GCHandle.Alloc(array, GCHandleType.Pinned);
|
|
|
byte* src = (byte*)Marshal.UnsafeAddrOfPinnedArrayElement(array, sourceIndex);
|
|
|
CopyMemory(baseAddress + (size * destinationIndex), src, size * length);
|
|
|
handle.Free();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the represented block of memory as an array of <see cref="Byte"/>.
|
|
|
/// </summary>
|
|
|
/// <returns>The represented block of memory.</returns>
|
|
|
public byte[] ToByteArray()
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
byte[] result;
|
|
|
if (isOneBit)
|
|
|
{
|
|
|
result = new byte[(length + 7) / 8];
|
|
|
}
|
|
|
else if (isFourBit)
|
|
|
{
|
|
|
result = new byte[(length + 3) / 4];
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
result = new byte[size * length];
|
|
|
}
|
|
|
fixed (byte* dst = result)
|
|
|
{
|
|
|
CopyMemory(dst, baseAddress, result.Length);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value at the specified position in the array.
|
|
|
/// </summary>
|
|
|
/// <param name="index">A 32-bit integer that represents the position
|
|
|
/// of the array element to get.</param>
|
|
|
/// <returns>The value at the specified position in the array.</returns>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="index"/> is outside the range of valid indexes
|
|
|
/// for the unmanaged array.</exception>
|
|
|
public T this[int index]
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetValue(index);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetValue(value, index);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the values of the unmanaged array.
|
|
|
/// </summary>
|
|
|
public T[] Data
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetValues(0, length);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
if (value == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("value");
|
|
|
}
|
|
|
if (value.Length != length)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("value.Lengt");
|
|
|
}
|
|
|
SetValues(value, 0);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the length of the unmanaged array.
|
|
|
/// </summary>
|
|
|
public int Length
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return length;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the base address of the represented memory block.
|
|
|
/// </summary>
|
|
|
public IntPtr BaseAddress
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return new IntPtr(baseAddress);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a shallow copy of the <see cref="MemoryArray<T>"/>.
|
|
|
/// </summary>
|
|
|
/// <returns>A shallow copy of the <see cref="MemoryArray<T>"/>.</returns>
|
|
|
public object Clone()
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return new MemoryArray<T>(baseAddress, length);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a 32-bit integer that represents the total number of elements
|
|
|
/// in the <see cref="MemoryArray<T>"/>.
|
|
|
/// </summary>
|
|
|
public int Count
|
|
|
{
|
|
|
get { EnsureNotDisposed(); return length; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a value indicating whether access to the <see cref="MemoryArray<T>"/>
|
|
|
/// is synchronized (thread safe).
|
|
|
/// </summary>
|
|
|
public bool IsSynchronized
|
|
|
{
|
|
|
get { EnsureNotDisposed(); return false; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets an object that can be used to synchronize access to the <see cref="MemoryArray<T>"/>.
|
|
|
/// </summary>
|
|
|
public object SyncRoot
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (syncRoot == null)
|
|
|
{
|
|
|
System.Threading.Interlocked.CompareExchange(ref syncRoot, new object(), null);
|
|
|
}
|
|
|
return syncRoot;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves an object that can iterate through the individual
|
|
|
/// elements in this <see cref="MemoryArray<T>"/>.
|
|
|
/// </summary>
|
|
|
/// <returns>An <see cref="IEnumerator"/> for the <see cref="MemoryArray<T>"/>.</returns>
|
|
|
public IEnumerator GetEnumerator()
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
T[] values = GetValues(0, length);
|
|
|
for (int i = 0; i != values.Length; i++)
|
|
|
{
|
|
|
yield return values[i];
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves an object that can iterate through the individual
|
|
|
/// elements in this <see cref="MemoryArray<T>"/>.
|
|
|
/// </summary>
|
|
|
/// <returns>An <see cref="IEnumerator<T>"/> for the <see cref="MemoryArray<T>"/>.</returns>
|
|
|
IEnumerator<T> IEnumerable<T>.GetEnumerator()
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
T[] values = GetValues(0, length);
|
|
|
for (int i = 0; i != values.Length; i++)
|
|
|
{
|
|
|
yield return values[i];
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Releases all ressources.
|
|
|
/// </summary>
|
|
|
public void Dispose()
|
|
|
{
|
|
|
Dispose(true);
|
|
|
GC.SuppressFinalize(this);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Releases allocated handles associated with this instance.
|
|
|
/// </summary>
|
|
|
/// <param name="disposing"><b>true</b> to release managed resources.</param>
|
|
|
protected virtual void Dispose(bool disposing)
|
|
|
{
|
|
|
if (baseAddress != null)
|
|
|
{
|
|
|
if (handle.IsAllocated)
|
|
|
handle.Free();
|
|
|
baseAddress = null;
|
|
|
buffer = null;
|
|
|
length = 0;
|
|
|
syncRoot = null;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Throws an <see cref="ObjectDisposedException"/> if
|
|
|
/// this instance is disposed.
|
|
|
/// </summary>
|
|
|
protected virtual void EnsureNotDisposed()
|
|
|
{
|
|
|
if (baseAddress == null)
|
|
|
throw new ObjectDisposedException("This instance is disposed.");
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified <see cref="MemoryArray<T>"/> structure is equivalent to this
|
|
|
/// <see cref="MemoryArray<T>"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The structure to test.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="MemoryArray<T>"/>
|
|
|
/// instance equivalent to this <see cref="MemoryArray<T>"/> structure; otherwise,
|
|
|
/// <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return ((obj is MemoryArray<T>) && Equals((MemoryArray<T>)obj));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified <see cref="MemoryArray<T>"/> structure is equivalent to this
|
|
|
/// <see cref="MemoryArray<T>"/> structure.
|
|
|
/// </summary>
|
|
|
/// <param name="other">The structure to test.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="other"/> is equivalent to this
|
|
|
/// <see cref="MemoryArray<T>"/> structure; otherwise,
|
|
|
/// <b>false</b>.</returns>
|
|
|
public bool Equals(MemoryArray<T> other)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return ((this.baseAddress == other.baseAddress) && (this.length == other.length));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Serves as a hash function for a particular type.
|
|
|
/// </summary>
|
|
|
/// <returns>A hash code for the current <see cref="MemoryArray<T>"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
return (int)baseAddress ^ length;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies a block of memory from one location to another.
|
|
|
/// </summary>
|
|
|
/// <param name="dest">Pointer to the starting address of the copy destination.</param>
|
|
|
/// <param name="src">Pointer to the starting address of the block of memory to be copied.</param>
|
|
|
/// <param name="len">Size of the block of memory to copy, in bytes.</param>
|
|
|
protected static unsafe void CopyMemory(byte* dest, byte* src, int len)
|
|
|
{
|
|
|
if (len >= 0x10)
|
|
|
{
|
|
|
do
|
|
|
{
|
|
|
*((int*)dest) = *((int*)src);
|
|
|
*((int*)(dest + 4)) = *((int*)(src + 4));
|
|
|
*((int*)(dest + 8)) = *((int*)(src + 8));
|
|
|
*((int*)(dest + 12)) = *((int*)(src + 12));
|
|
|
dest += 0x10;
|
|
|
src += 0x10;
|
|
|
}
|
|
|
while ((len -= 0x10) >= 0x10);
|
|
|
}
|
|
|
if (len > 0)
|
|
|
{
|
|
|
if ((len & 8) != 0)
|
|
|
{
|
|
|
*((int*)dest) = *((int*)src);
|
|
|
*((int*)(dest + 4)) = *((int*)(src + 4));
|
|
|
dest += 8;
|
|
|
src += 8;
|
|
|
}
|
|
|
if ((len & 4) != 0)
|
|
|
{
|
|
|
*((int*)dest) = *((int*)src);
|
|
|
dest += 4;
|
|
|
src += 4;
|
|
|
}
|
|
|
if ((len & 2) != 0)
|
|
|
{
|
|
|
*((short*)dest) = *((short*)src);
|
|
|
dest += 2;
|
|
|
src += 2;
|
|
|
}
|
|
|
if ((len & 1) != 0)
|
|
|
{
|
|
|
*dest = *src;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI.Metadata
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Base class that represents a collection of all tags contained in a metadata model.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The <b>MetedataModel</b> class is an abstract base class, which is inherited by
|
|
|
/// several derived classes, one for each existing metadata model.
|
|
|
/// </remarks>
|
|
|
public abstract class MetadataModel : IEnumerable
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Handle to the encapsulated FreeImage-bitmap.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
protected readonly FIBITMAP dib;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of this class.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
protected MetadataModel(FIBITMAP dib)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
this.dib = dib;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the datamodel that this instance represents.
|
|
|
/// </summary>
|
|
|
public abstract FREE_IMAGE_MDMODEL Model
|
|
|
{
|
|
|
get;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adds new tag to the bitmap or updates its value in case it already exists.
|
|
|
/// <see cref="FreeImageAPI.Metadata.MetadataTag.Key"/> will be used as key.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag to add or update.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="tag"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// The tags model differs from this instances model.</exception>
|
|
|
public bool AddTag(MetadataTag tag)
|
|
|
{
|
|
|
if (tag == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("tag");
|
|
|
}
|
|
|
if (tag.Model != Model)
|
|
|
{
|
|
|
throw new ArgumentException("tag.Model");
|
|
|
}
|
|
|
return tag.AddToImage(dib);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adds a list of tags to the bitmap or updates their values in case they already exist.
|
|
|
/// <see cref="FreeImageAPI.Metadata.MetadataTag.Key"/> will be used as key.
|
|
|
/// </summary>
|
|
|
/// <param name="list">A list of tags to add or update.</param>
|
|
|
/// <returns>Returns the number of successfully added tags.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="list"/> is null.</exception>
|
|
|
public int AddTag(IEnumerable<MetadataTag> list)
|
|
|
{
|
|
|
if (list == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("list");
|
|
|
}
|
|
|
int count = 0;
|
|
|
foreach (MetadataTag tag in list)
|
|
|
{
|
|
|
if (tag.Model == Model && tag.AddToImage(dib))
|
|
|
{
|
|
|
count++;
|
|
|
}
|
|
|
}
|
|
|
return count;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Removes the specified tag from the bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="key">The key of the tag.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="key"/> is null.</exception>
|
|
|
public bool RemoveTag(string key)
|
|
|
{
|
|
|
if (key == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("key");
|
|
|
}
|
|
|
return FreeImage.SetMetadata(Model, dib, key, FITAG.Zero);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Destroys the metadata model
|
|
|
/// which will remove all tags of this model from the bitmap.
|
|
|
/// </summary>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public bool DestoryModel()
|
|
|
{
|
|
|
return FreeImage.SetMetadata(Model, dib, null, FITAG.Zero);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the specified metadata tag.
|
|
|
/// </summary>
|
|
|
/// <param name="key">The key of the tag.</param>
|
|
|
/// <returns>The metadata tag.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="key"/> is null.</exception>
|
|
|
public MetadataTag GetTag(string key)
|
|
|
{
|
|
|
if (key == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("key");
|
|
|
}
|
|
|
MetadataTag tag;
|
|
|
return FreeImage.GetMetadata(Model, dib, key, out tag) ? tag : null;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns whether the specified tag exists.
|
|
|
/// </summary>
|
|
|
/// <param name="key">The key of the tag.</param>
|
|
|
/// <returns>True in case the tag exists, else false.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="key"/> is null.</exception>
|
|
|
public bool TagExists(string key)
|
|
|
{
|
|
|
if (key == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("key");
|
|
|
}
|
|
|
MetadataTag tag;
|
|
|
return FreeImage.GetMetadata(Model, dib, key, out tag);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a list of all metadata tags this instance represents.
|
|
|
/// </summary>
|
|
|
public List<MetadataTag> List
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
List<MetadataTag> list = new List<MetadataTag>((int)FreeImage.GetMetadataCount(Model, dib));
|
|
|
MetadataTag tag;
|
|
|
FIMETADATA mdHandle = FreeImage.FindFirstMetadata(Model, dib, out tag);
|
|
|
if (!mdHandle.IsNull)
|
|
|
{
|
|
|
do
|
|
|
{
|
|
|
list.Add(tag);
|
|
|
}
|
|
|
while (FreeImage.FindNextMetadata(mdHandle, out tag));
|
|
|
FreeImage.FindCloseMetadata(mdHandle);
|
|
|
}
|
|
|
return list;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the tag at the given index.
|
|
|
/// </summary>
|
|
|
/// <param name="index">Index of the tag to return.</param>
|
|
|
/// <returns>The tag at the given index.</returns>
|
|
|
protected MetadataTag GetTagFromIndex(int index)
|
|
|
{
|
|
|
if (index >= Count || index < 0)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("index");
|
|
|
}
|
|
|
MetadataTag tag;
|
|
|
int count = 0;
|
|
|
FIMETADATA mdHandle = FreeImage.FindFirstMetadata(Model, dib, out tag);
|
|
|
if (!mdHandle.IsNull)
|
|
|
{
|
|
|
try
|
|
|
{
|
|
|
do
|
|
|
{
|
|
|
if (count++ == index)
|
|
|
{
|
|
|
break;
|
|
|
}
|
|
|
}
|
|
|
while (FreeImage.FindNextMetadata(mdHandle, out tag));
|
|
|
}
|
|
|
finally
|
|
|
{
|
|
|
FreeImage.FindCloseMetadata(mdHandle);
|
|
|
}
|
|
|
}
|
|
|
return tag;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the metadata tag at the given index. This operation is slow when accessing all tags.
|
|
|
/// </summary>
|
|
|
/// <param name="index">Index of the tag.</param>
|
|
|
/// <returns>The metadata tag.</returns>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="index"/> is greater or equal <b>Count</b>
|
|
|
/// or index is less than zero.</exception>
|
|
|
public MetadataTag this[int index]
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagFromIndex(index);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves an object that can iterate through the individual MetadataTags in this MetadataModel.
|
|
|
/// </summary>
|
|
|
/// <returns>An <see cref="IEnumerator"/> for the
|
|
|
/// <see cref="FreeImageAPI.Metadata.MetadataModel"/>.</returns>
|
|
|
public IEnumerator GetEnumerator()
|
|
|
{
|
|
|
return List.GetEnumerator();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the number of metadata tags this instance represents.
|
|
|
/// </summary>
|
|
|
public int Count
|
|
|
{
|
|
|
get { return (int)FreeImage.GetMetadataCount(Model, dib); }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns whether this model exists in the bitmaps metadata structure.
|
|
|
/// </summary>
|
|
|
public bool Exists
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return Count > 0;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Searches for a pattern in each metadata tag and returns the result as a list.
|
|
|
/// </summary>
|
|
|
/// <param name="searchPattern">The regular expression to use for the search.</param>
|
|
|
/// <param name="flags">A bitfield that controls which fields should be searched in.</param>
|
|
|
/// <returns>A list containing all found metadata tags.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <typeparamref name="searchPattern"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// <typeparamref name="searchPattern"/> is empty.</exception>
|
|
|
public List<MetadataTag> RegexSearch(string searchPattern, MD_SEARCH_FLAGS flags)
|
|
|
{
|
|
|
if (searchPattern == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("searchString");
|
|
|
}
|
|
|
if (searchPattern.Length == 0)
|
|
|
{
|
|
|
throw new ArgumentException("searchString is empty");
|
|
|
}
|
|
|
List<MetadataTag> result = new List<MetadataTag>(Count);
|
|
|
Regex regex = new Regex(searchPattern);
|
|
|
List<MetadataTag> list = List;
|
|
|
foreach (MetadataTag tag in list)
|
|
|
{
|
|
|
if (((flags & MD_SEARCH_FLAGS.KEY) > 0) && regex.Match(tag.Key).Success)
|
|
|
{
|
|
|
result.Add(tag);
|
|
|
continue;
|
|
|
}
|
|
|
if (((flags & MD_SEARCH_FLAGS.DESCRIPTION) > 0) && regex.Match(tag.Description).Success)
|
|
|
{
|
|
|
result.Add(tag);
|
|
|
continue;
|
|
|
}
|
|
|
if (((flags & MD_SEARCH_FLAGS.TOSTRING) > 0) && regex.Match(tag.ToString()).Success)
|
|
|
{
|
|
|
result.Add(tag);
|
|
|
continue;
|
|
|
}
|
|
|
}
|
|
|
result.Capacity = result.Count;
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the value of the specified tag.
|
|
|
/// </summary>
|
|
|
/// <typeparam name="T">Type of the tag's data.</typeparam>
|
|
|
/// <param name="key">The key of the tag.</param>
|
|
|
/// <returns>The value of the specified tag.</returns>
|
|
|
protected T? GetTagValue<T>(string key) where T : struct
|
|
|
{
|
|
|
if (string.IsNullOrEmpty(key))
|
|
|
{
|
|
|
throw new ArgumentNullException("key");
|
|
|
}
|
|
|
MetadataTag tag = GetTag(key);
|
|
|
if (tag != null)
|
|
|
{
|
|
|
T[] value = tag.Value as T[];
|
|
|
if ((value != null) && (value.Length != 0))
|
|
|
{
|
|
|
return value[0];
|
|
|
}
|
|
|
}
|
|
|
return null;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns an array containing the data of the specified tag.
|
|
|
/// </summary>
|
|
|
/// <typeparam name="T">The type of the tag's data.</typeparam>
|
|
|
/// <param name="key">The key of the tag.</param>
|
|
|
/// <returns>An array containing the data of the specified tag.</returns>
|
|
|
protected T[] GetTagArray<T>(string key) where T : struct
|
|
|
{
|
|
|
if (string.IsNullOrEmpty(key))
|
|
|
{
|
|
|
throw new ArgumentNullException("key");
|
|
|
}
|
|
|
MetadataTag tag = GetTag(key);
|
|
|
return (tag == null) ? null : tag.Value as T[];
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the string contained by the specified tag.
|
|
|
/// </summary>
|
|
|
/// <param name="key">The key of the tag.</param>
|
|
|
/// <returns>The string contained by the specified tag.</returns>
|
|
|
protected string GetTagText(string key)
|
|
|
{
|
|
|
if (string.IsNullOrEmpty(key))
|
|
|
{
|
|
|
throw new ArgumentNullException("key");
|
|
|
}
|
|
|
MetadataTag tag = GetTag(key);
|
|
|
return (tag == null) ? null : tag.Value as string;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns an array containg the data of the specified tag
|
|
|
/// as unsigned 32bit integer.
|
|
|
/// </summary>
|
|
|
/// <param name="key">The key of the tag.</param>
|
|
|
/// <returns>An array containg the data of the specified tag
|
|
|
/// as unsigned 32bit integer.</returns>
|
|
|
protected uint[] GetUInt32Array(string key)
|
|
|
{
|
|
|
if (string.IsNullOrEmpty(key))
|
|
|
{
|
|
|
throw new ArgumentNullException("key");
|
|
|
}
|
|
|
uint[] result = null;
|
|
|
MetadataTag tag = GetTag(key);
|
|
|
if (tag != null)
|
|
|
{
|
|
|
object value = tag.Value;
|
|
|
if (value != null)
|
|
|
{
|
|
|
if (value is ushort[])
|
|
|
{
|
|
|
ushort[] array = (ushort[])value;
|
|
|
result = new uint[array.Length];
|
|
|
for (int i = 0, j = array.Length; i < j; i++)
|
|
|
{
|
|
|
result[i] = (uint)array[i];
|
|
|
}
|
|
|
}
|
|
|
else if (value is uint[])
|
|
|
{
|
|
|
result = (uint[])value;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the value of the tag as unsigned 32bit integer.
|
|
|
/// </summary>
|
|
|
/// <param name="key">The key of the tag.</param>
|
|
|
/// <returns>The value of the tag as unsigned 32bit integer.</returns>
|
|
|
protected uint? GetUInt32Value(string key)
|
|
|
{
|
|
|
uint[] value = GetUInt32Array(key);
|
|
|
return value == null ? default(uint?) : value[0];
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the value of the specified tag.
|
|
|
/// </summary>
|
|
|
/// <typeparam name="T">The type of the tag's data.</typeparam>
|
|
|
/// <param name="key">The key of the tag.</param>
|
|
|
/// <param name="value">The new value of the specified tag or null.</param>
|
|
|
protected void SetTagValue<T>(string key, T? value) where T : struct
|
|
|
{
|
|
|
SetTagValue(key, value.HasValue ? new T[] { value.Value } : null);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the value of the specified tag.
|
|
|
/// </summary>
|
|
|
/// <param name="key">The key of the tag.</param>
|
|
|
/// <param name="value">The new value of the specified tag or null.</param>
|
|
|
protected void SetTagValue(string key, object value)
|
|
|
{
|
|
|
if (string.IsNullOrEmpty(key))
|
|
|
{
|
|
|
throw new ArgumentNullException("key");
|
|
|
}
|
|
|
if (value == null)
|
|
|
{
|
|
|
RemoveTag(key);
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
MetadataTag tag = GetTag(key);
|
|
|
if (tag == null)
|
|
|
{
|
|
|
tag = new MetadataTag(Model);
|
|
|
tag.Key = key;
|
|
|
tag.Value = value;
|
|
|
AddTag(tag);
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
tag.Value = value;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the value of the specified tag as undefined.
|
|
|
/// </summary>
|
|
|
/// <param name="key">The key of the tag.</param>
|
|
|
/// <param name="value">The new value of the specified tag or null.</param>
|
|
|
protected void SetTagValueUndefined(string key, byte[] value)
|
|
|
{
|
|
|
if (string.IsNullOrEmpty(key))
|
|
|
{
|
|
|
throw new ArgumentNullException("key");
|
|
|
}
|
|
|
if (value == null)
|
|
|
{
|
|
|
RemoveTag(key);
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
MetadataTag tag = GetTag(key);
|
|
|
if (tag == null)
|
|
|
{
|
|
|
tag = new MetadataTag(Model);
|
|
|
tag.Key = key;
|
|
|
tag.SetValue(value, FREE_IMAGE_MDTYPE.FIDT_UNDEFINED);
|
|
|
AddTag(tag);
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
tag.Value = value;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the equivalent <see cref="DirectionReference"/> for the
|
|
|
/// specified <see cref="String"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="s">The string containing the <see cref="DirectionReference"/>.</param>
|
|
|
/// <returns>The equivalent <see cref="DirectionReference"/> for the
|
|
|
/// specified <see cref="String"/>.</returns>
|
|
|
protected static DirectionReference? ToDirectionType(string s)
|
|
|
{
|
|
|
if (string.IsNullOrEmpty(s))
|
|
|
return null;
|
|
|
switch (s[0])
|
|
|
{
|
|
|
case 'T':
|
|
|
return DirectionReference.TrueDirection;
|
|
|
case 'M':
|
|
|
return DirectionReference.MagneticDirection;
|
|
|
default:
|
|
|
return DirectionReference.Undefined;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the equivalent <see cref="String"/> for the
|
|
|
/// specified <see cref="DirectionReference"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="type">The <see cref="DirectionReference"/> to convert.</param>
|
|
|
/// <returns>The equivalent <see cref="String"/> for the
|
|
|
/// specified <see cref="DirectionReference"/>.</returns>
|
|
|
protected static string ToString(DirectionReference? type)
|
|
|
{
|
|
|
if (type.HasValue)
|
|
|
{
|
|
|
switch (type.Value)
|
|
|
{
|
|
|
case DirectionReference.TrueDirection:
|
|
|
return "T";
|
|
|
case DirectionReference.MagneticDirection:
|
|
|
return "M";
|
|
|
default:
|
|
|
return "\0";
|
|
|
}
|
|
|
}
|
|
|
return null;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the equivalent <see cref="VelocityUnit"/> for the
|
|
|
/// specified <see cref="String"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="s">The string containing the <see cref="VelocityUnit"/>.</param>
|
|
|
/// <returns>The equivalent <see cref="VelocityUnit"/> for the
|
|
|
/// specified <see cref="String"/>.</returns>
|
|
|
protected static VelocityUnit? ToUnitType(string s)
|
|
|
{
|
|
|
if (string.IsNullOrEmpty(s))
|
|
|
return null;
|
|
|
switch (s[0])
|
|
|
{
|
|
|
case 'K':
|
|
|
return VelocityUnit.Kilometers;
|
|
|
case 'M':
|
|
|
return VelocityUnit.Miles;
|
|
|
case 'N':
|
|
|
return VelocityUnit.Knots;
|
|
|
default:
|
|
|
return VelocityUnit.Undefinied;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the equivalent <see cref="String"/> for the
|
|
|
/// specified <see cref="VelocityUnit"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="type">The <see cref="VelocityUnit"/> to convert.</param>
|
|
|
/// <returns>The equivalent <see cref="String"/> for the
|
|
|
/// specified <see cref="VelocityUnit"/>.</returns>
|
|
|
protected static string ToString(VelocityUnit? type)
|
|
|
{
|
|
|
if (type.HasValue)
|
|
|
{
|
|
|
switch (type.Value)
|
|
|
{
|
|
|
case VelocityUnit.Kilometers:
|
|
|
return "K";
|
|
|
case VelocityUnit.Miles:
|
|
|
return "M";
|
|
|
case VelocityUnit.Knots:
|
|
|
return "N";
|
|
|
default:
|
|
|
return "\0";
|
|
|
}
|
|
|
}
|
|
|
return null;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the equivalent <see cref="LongitudeType"/> for the
|
|
|
/// specified <see cref="String"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="s">The string containing the <see cref="LongitudeType"/>.</param>
|
|
|
/// <returns>The equivalent <see cref="LongitudeType"/> for the
|
|
|
/// specified <see cref="String"/>.</returns>
|
|
|
protected static LongitudeType? ToLongitudeType(string s)
|
|
|
{
|
|
|
if (string.IsNullOrEmpty(s))
|
|
|
return null;
|
|
|
switch (s[0])
|
|
|
{
|
|
|
case 'E':
|
|
|
return LongitudeType.East;
|
|
|
case 'W':
|
|
|
return LongitudeType.West;
|
|
|
default:
|
|
|
return LongitudeType.Undefined;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the equivalent <see cref="String"/> for the
|
|
|
/// specified <see cref="LongitudeType"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="type">The <see cref="LongitudeType"/> to convert.</param>
|
|
|
/// <returns>The equivalent <see cref="String"/> for the
|
|
|
/// specified <see cref="LongitudeType"/>.</returns>
|
|
|
protected static string ToString(LongitudeType? type)
|
|
|
{
|
|
|
if (type.HasValue)
|
|
|
{
|
|
|
switch (type.Value)
|
|
|
{
|
|
|
case LongitudeType.East:
|
|
|
return "E";
|
|
|
case LongitudeType.West:
|
|
|
return "W";
|
|
|
default:
|
|
|
return "\0";
|
|
|
}
|
|
|
}
|
|
|
return null;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the equivalent <see cref="LatitudeType"/> for the
|
|
|
/// specified <see cref="String"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="s">The string containing the <see cref="LatitudeType"/>.</param>
|
|
|
/// <returns>The equivalent <see cref="LatitudeType"/> for the
|
|
|
/// specified <see cref="String"/>.</returns>
|
|
|
protected static LatitudeType? ToLatitudeType(string s)
|
|
|
{
|
|
|
if (string.IsNullOrEmpty(s))
|
|
|
return null;
|
|
|
switch (s[0])
|
|
|
{
|
|
|
case 'N':
|
|
|
return LatitudeType.North;
|
|
|
case 'S':
|
|
|
return LatitudeType.South;
|
|
|
default:
|
|
|
return LatitudeType.Undefined;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the equivalent <see cref="String"/> for the
|
|
|
/// specified <see cref="LatitudeType"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="type">The <see cref="LatitudeType"/> to convert.</param>
|
|
|
/// <returns>The equivalent <see cref="String"/> for the
|
|
|
/// specified <see cref="LatitudeType"/>.</returns>
|
|
|
protected static string ToString(LatitudeType? type)
|
|
|
{
|
|
|
if (type.HasValue)
|
|
|
{
|
|
|
switch (type.Value)
|
|
|
{
|
|
|
case LatitudeType.North:
|
|
|
return "N";
|
|
|
case LatitudeType.South:
|
|
|
return "S";
|
|
|
default:
|
|
|
return "\0";
|
|
|
}
|
|
|
}
|
|
|
return null;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the equivalent <see cref="InteroperabilityMode"/> for the
|
|
|
/// specified <see cref="String"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="s">The string containing the <see cref="InteroperabilityMode"/>.</param>
|
|
|
/// <returns>The equivalent <see cref="InteroperabilityMode"/> for the
|
|
|
/// specified <see cref="String"/>.</returns>
|
|
|
protected static InteroperabilityMode? ToInteroperabilityType(string s)
|
|
|
{
|
|
|
if (string.IsNullOrEmpty(s))
|
|
|
return null;
|
|
|
if (s.StartsWith("R98"))
|
|
|
return InteroperabilityMode.R98;
|
|
|
if (s.StartsWith("THM"))
|
|
|
return InteroperabilityMode.THM;
|
|
|
return InteroperabilityMode.Undefined;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the equivalent <see cref="String"/> for the
|
|
|
/// specified <see cref="InteroperabilityMode"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="type">The <see cref="InteroperabilityMode"/> to convert.</param>
|
|
|
/// <returns>The equivalent <see cref="String"/> for the
|
|
|
/// specified <see cref="InteroperabilityMode"/>.</returns>
|
|
|
protected static string ToString(InteroperabilityMode? type)
|
|
|
{
|
|
|
if (type.HasValue)
|
|
|
{
|
|
|
switch (type.Value)
|
|
|
{
|
|
|
case InteroperabilityMode.R98:
|
|
|
return "R98";
|
|
|
case InteroperabilityMode.THM:
|
|
|
return "THM";
|
|
|
default:
|
|
|
return "\0\0\0";
|
|
|
}
|
|
|
}
|
|
|
return null;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Specified different unit types.
|
|
|
/// </summary>
|
|
|
public enum VelocityUnit
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// No or unknown type.
|
|
|
/// </summary>
|
|
|
Undefinied,
|
|
|
|
|
|
/// <summary>
|
|
|
/// Kilometers per hour.
|
|
|
/// </summary>
|
|
|
Kilometers,
|
|
|
|
|
|
/// <summary>
|
|
|
/// Miles per hour.
|
|
|
/// </summary>
|
|
|
Miles,
|
|
|
|
|
|
/// <summary>
|
|
|
/// Knots.
|
|
|
/// </summary>
|
|
|
Knots,
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Specifies different direction types.
|
|
|
/// </summary>
|
|
|
public enum DirectionReference
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// No or unknown direction type.
|
|
|
/// </summary>
|
|
|
Undefined,
|
|
|
|
|
|
/// <summary>
|
|
|
/// True direction.
|
|
|
/// </summary>
|
|
|
TrueDirection,
|
|
|
|
|
|
/// <summary>
|
|
|
/// Magnatic direction.
|
|
|
/// </summary>
|
|
|
MagneticDirection,
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Specifies the type of a latitude value.
|
|
|
/// </summary>
|
|
|
public enum LatitudeType
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// No or unknown type.
|
|
|
/// </summary>
|
|
|
Undefined,
|
|
|
|
|
|
/// <summary>
|
|
|
/// North.
|
|
|
/// </summary>
|
|
|
North,
|
|
|
|
|
|
/// <summary>
|
|
|
/// South.
|
|
|
/// </summary>
|
|
|
South,
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Specifies the type of a longitude value.
|
|
|
/// </summary>
|
|
|
public enum LongitudeType
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// No or unknown type.
|
|
|
/// </summary>
|
|
|
Undefined,
|
|
|
|
|
|
/// <summary>
|
|
|
/// East.
|
|
|
/// </summary>
|
|
|
East,
|
|
|
|
|
|
/// <summary>
|
|
|
/// West.
|
|
|
/// </summary>
|
|
|
West,
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Specifies different altitude types.
|
|
|
/// </summary>
|
|
|
public enum AltitudeType
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// No or unknown type.
|
|
|
/// </summary>
|
|
|
Undefined,
|
|
|
|
|
|
/// <summary>
|
|
|
/// East.
|
|
|
/// </summary>
|
|
|
AboveSeaLevel,
|
|
|
|
|
|
/// <summary>
|
|
|
/// West.
|
|
|
/// </summary>
|
|
|
BelowSeaLevel,
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Specifies interoperability types.
|
|
|
/// </summary>
|
|
|
public enum InteroperabilityMode
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// No or unknown type.
|
|
|
/// </summary>
|
|
|
Undefined,
|
|
|
|
|
|
/// <summary>
|
|
|
/// Indicates a file conforming to R98 file specification of Recommended
|
|
|
/// Exif Interoperability Rules (ExifR98) or to DCF basic file stipulated
|
|
|
/// by Design Rule for Camera File System.
|
|
|
/// </summary>
|
|
|
R98,
|
|
|
|
|
|
/// <summary>
|
|
|
/// Indicates a file conforming to DCF thumbnail file stipulated by Design
|
|
|
/// rule for Camera File System.
|
|
|
/// </summary>
|
|
|
THM,
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Specifies orientation of images.
|
|
|
/// </summary>
|
|
|
public enum ExifImageOrientation : ushort
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Undefinied orientation.
|
|
|
/// </summary>
|
|
|
Undefined,
|
|
|
|
|
|
/// <summary>
|
|
|
/// TopLeft.
|
|
|
/// </summary>
|
|
|
TopLeft = 1,
|
|
|
|
|
|
/// <summary>
|
|
|
/// TopRight.
|
|
|
/// </summary>
|
|
|
TopRight,
|
|
|
|
|
|
/// <summary>
|
|
|
/// BottomRight.
|
|
|
/// </summary>
|
|
|
BottomRight,
|
|
|
|
|
|
/// <summary>
|
|
|
/// BottomLeft.
|
|
|
/// </summary>
|
|
|
BottomLeft,
|
|
|
|
|
|
/// <summary>
|
|
|
/// LeftTop.
|
|
|
/// </summary>
|
|
|
LeftTop,
|
|
|
|
|
|
/// <summary>
|
|
|
/// RightTop.
|
|
|
/// </summary>
|
|
|
RightTop,
|
|
|
|
|
|
/// <summary>
|
|
|
/// RightBottom.
|
|
|
/// </summary>
|
|
|
RightBottom,
|
|
|
|
|
|
/// <summary>
|
|
|
/// LeftBottom.
|
|
|
/// </summary>
|
|
|
LeftBottom,
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the model of the MetadataModel object to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
return Model.ToString();
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
#region Metadata Models
|
|
|
|
|
|
namespace FreeImageAPI.Metadata
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Represents a collection of all tags contained in the metadata model
|
|
|
/// <see cref="FREE_IMAGE_MDMODEL.FIMD_ANIMATION"/>.
|
|
|
/// </summary>
|
|
|
public class MDM_ANIMATION : MetadataModel
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of this class.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
public MDM_ANIMATION(FIBITMAP dib) : base(dib) { }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the datamodel that this instance represents.
|
|
|
/// </summary>
|
|
|
public override FREE_IMAGE_MDMODEL Model
|
|
|
{
|
|
|
get { return FREE_IMAGE_MDMODEL.FIMD_ANIMATION; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the width of the entire canvas area, that each page is displayed in.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? LogicalWidth
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("LogicalWidth");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("LogicalWidth", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the height of the entire canvas area, that each page is displayed in.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? LogicalHeight
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("LogicalHeight");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("LogicalHeight", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the global palette of the GIF image.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public Palette GlobalPalette
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
MetadataTag mdtag = GetTag("GlobalPalette");
|
|
|
return (mdtag == null) ? null : new Palette(mdtag);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GlobalPalette", (value != null) ? null : value.Data);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the number of replays for the animation.
|
|
|
/// Use 0 (zero) to specify an infinte number of replays.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public uint? LoopCount
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<uint>("Loop");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("Loop", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the horizontal offset within the logical canvas area, this frame is to be displayed at.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? FrameLeft
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("FrameLeft");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("FrameLeft", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the vertical offset within the logical canvas area, this frame is to be displayed at.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? FrameTop
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("FrameTop");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("FrameTop", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a flag to supress saving the dib's attached palette
|
|
|
/// (making it use the global palette). The local palette is the palette used by a page.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public bool? NoLocalPalette
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
byte? useGlobalPalette = GetTagValue<byte>("NoLocalPalette");
|
|
|
return useGlobalPalette.HasValue ? (useGlobalPalette.Value != 0) : default(bool?);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
byte? val = null;
|
|
|
if (value.HasValue)
|
|
|
{
|
|
|
val = (byte)(value.Value ? 1 : 0);
|
|
|
}
|
|
|
SetTagValue("NoLocalPalette", val);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a value indicating whether the image is interlaced.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public bool? Interlaced
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
byte? useGlobalPalette = GetTagValue<byte>("Interlaced");
|
|
|
return useGlobalPalette.HasValue ? (useGlobalPalette.Value != 0) : default(bool?);
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
byte? val = null;
|
|
|
if (value.HasValue)
|
|
|
{
|
|
|
val = (byte)(value.Value ? 1 : 0);
|
|
|
}
|
|
|
SetTagValue("Interlaced", val);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the amout of time in milliseconds this frame is to be displayed.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public uint? FrameTime
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<uint>("FrameTime");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("FrameTime", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets this frame's disposal method. Generally, this method defines, how to
|
|
|
/// remove or replace a frame when the next frame has to be drawn.<para/>
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public DisposalMethodType? DisposalMethod
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<DisposalMethodType>("DisposalMethod");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("DisposalMethod", value);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents a collection of all tags contained in the metadata model
|
|
|
/// <see cref="FREE_IMAGE_MDMODEL.FIMD_COMMENTS"/>.
|
|
|
/// </summary>
|
|
|
public class MDM_COMMENTS : MetadataModel
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of this class.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
public MDM_COMMENTS(FIBITMAP dib) : base(dib) { }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the datamodel that this instance represents.
|
|
|
/// </summary>
|
|
|
public override FREE_IMAGE_MDMODEL Model
|
|
|
{
|
|
|
get { return FREE_IMAGE_MDMODEL.FIMD_COMMENTS; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the comment of the image.
|
|
|
/// Supported formats are JPEG, PNG and GIF.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string Comment
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("Comment");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("Comment", value);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents a collection of all tags contained in the metadata model
|
|
|
/// <see cref="FREE_IMAGE_MDMODEL.FIMD_CUSTOM"/>.
|
|
|
/// </summary>
|
|
|
public class MDM_CUSTOM : MetadataModel
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of this class.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
public MDM_CUSTOM(FIBITMAP dib) : base(dib) { }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the datamodel that this instance represents.
|
|
|
/// </summary>
|
|
|
public override FREE_IMAGE_MDMODEL Model
|
|
|
{
|
|
|
get { return FREE_IMAGE_MDMODEL.FIMD_CUSTOM; }
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents a collection of all tags contained in the metadata model
|
|
|
/// <see cref="FREE_IMAGE_MDMODEL.FIMD_EXIF_EXIF"/>.
|
|
|
/// </summary>
|
|
|
public class MDM_EXIF_EXIF : MetadataModel
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of this class.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
public MDM_EXIF_EXIF(FIBITMAP dib) : base(dib) { }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the datamodel that this instance represents.
|
|
|
/// </summary>
|
|
|
public override FREE_IMAGE_MDMODEL Model
|
|
|
{
|
|
|
get { return FREE_IMAGE_MDMODEL.FIMD_EXIF_EXIF; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the version of this standard supported.
|
|
|
/// Constant length or 4.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public byte[] ExifVersion
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<byte>("ExifVersion");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FreeImage.Resize(ref value, 4);
|
|
|
SetTagValueUndefined("ExifVersion", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the Flashpix format version supported by a FPXR file.
|
|
|
/// Constant length or 4.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public byte[] FlashpixVersion
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<byte>("FlashpixVersion");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FreeImage.Resize(ref value, 4);
|
|
|
SetTagValueUndefined("FlashpixVersion", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the color space information tag.
|
|
|
/// See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The following values are defined:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>1</term>
|
|
|
/// <description>sRGB (default)</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>0xFFFF</term>
|
|
|
/// <description>uncalibrated</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>other</term>
|
|
|
/// <description>reserved</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? ColorSpace
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("ColorSpace");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ColorSpace", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the valid width of a compressed image.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public uint? PixelXDimension
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetUInt32Value("PixelXDimension");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
RemoveTag("PixelXDimension");
|
|
|
if (value.HasValue)
|
|
|
{
|
|
|
SetTagValue("PixelXDimension", value.Value);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the valid height of a compressed image.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public uint? PixelYDimension
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetUInt32Value("PixelYDimension");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
RemoveTag("PixelYDimension");
|
|
|
if (value.HasValue)
|
|
|
{
|
|
|
SetTagValue("PixelYDimension", value.Value);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets components configuration. See remarks for further information.
|
|
|
/// Constant length of 4.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The channels of each component are arranged in order from the 1st component to the 4th.
|
|
|
/// For uncompressed data the data arrangement is given in the PhotometricInterpretation tag.
|
|
|
/// However, since PhotometricInterpretation can only express the order of Y,Cb and Cr,
|
|
|
/// this tag is provided for cases when compressed data uses components other than Y, Cb,
|
|
|
/// and Cr and to enable support of other sequences.<para/>
|
|
|
/// Default = 4 5 6 0 (if RGB uncompressed)<para/>
|
|
|
/// The following values are defined:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>0</term>
|
|
|
/// <description>does not exist</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>1</term>
|
|
|
/// <description>Y</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>2</term>
|
|
|
/// <description>Cb</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>3</term>
|
|
|
/// <description>Cr</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>4</term>
|
|
|
/// <description>R</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>5</term>
|
|
|
/// <description>R</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>6</term>
|
|
|
/// <description>R</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>other</term>
|
|
|
/// <description>reserved</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public byte[] ComponentsConfiguration
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<byte>("ComponentsConfiguration");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FreeImage.Resize(ref value, 4);
|
|
|
SetTagValueUndefined("ComponentsConfiguration", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets compression mode used for a compressed image is indicated
|
|
|
/// in unit bits per pixel.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational? CompressedBitsPerPixel
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("CompressedBitsPerPixel");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("CompressedBitsPerPixel", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a tag for manufacturers of Exif writers to record any desired information.
|
|
|
/// The contents are up to the manufacturer, but this tag should not be used for any other
|
|
|
/// than its intended purpose.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public byte[] MakerNote
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<byte>("FlashpixVersion");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValueUndefined("FlashpixVersion", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a tag for Exif users to write keywords or comments on the image besides
|
|
|
/// those in ImageDescription, and without the character code limitations of the ImageDescription tag.
|
|
|
/// Minimum length of 8. See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The character code used in the UserComment tag is identified based on an ID code in a fixed 8-byte
|
|
|
/// area at the start of the tag data area. The unused portion of the area is padded with NULL.
|
|
|
/// The ID code for the UserComment area may be a Defined code such as JIS or ASCII, or may be Undefined.
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public byte[] UserComment
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<byte>("UserComment");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FreeImage.Resize(ref value, 8, int.MaxValue);
|
|
|
SetTagValueUndefined("UserComment", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the name of an audio file related to the image data.
|
|
|
/// The format is 8.3.
|
|
|
/// Constant length of 12
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string RelatedSoundFile
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
string text = GetTagText("RelatedSoundFile");
|
|
|
if (!string.IsNullOrEmpty(text))
|
|
|
{
|
|
|
text = text.Substring(0, text.Length - 1);
|
|
|
}
|
|
|
return text;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
if (value != null)
|
|
|
{
|
|
|
FreeImage.Resize(ref value, 12);
|
|
|
value += '\0';
|
|
|
}
|
|
|
SetTagValue("RelatedSoundFile", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the date and time when the original image data was generated.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public DateTime? DateTimeOriginal
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
DateTime? result = null;
|
|
|
string text = GetTagText("DateTimeOriginal");
|
|
|
if (text != null)
|
|
|
{
|
|
|
try
|
|
|
{
|
|
|
result = System.DateTime.ParseExact(text, "yyyy:MM:dd HH:mm:ss\0", null);
|
|
|
}
|
|
|
catch
|
|
|
{
|
|
|
}
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
string val = null;
|
|
|
if (value.HasValue)
|
|
|
{
|
|
|
try
|
|
|
{
|
|
|
val = value.Value.ToString("yyyy:MM:dd HH:mm:ss\0");
|
|
|
}
|
|
|
catch
|
|
|
{
|
|
|
}
|
|
|
}
|
|
|
SetTagValue("DateTimeOriginal", val);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the date and time when the image was stored as digital data.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public DateTime? DateTimeDigitized
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
DateTime? result = null;
|
|
|
string text = GetTagText("DateTimeDigitized");
|
|
|
if (text != null)
|
|
|
{
|
|
|
try
|
|
|
{
|
|
|
result = System.DateTime.ParseExact(text, "yyyy:MM:dd HH:mm:ss\0", null);
|
|
|
}
|
|
|
catch
|
|
|
{
|
|
|
}
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
string val = null;
|
|
|
if (value.HasValue)
|
|
|
{
|
|
|
try
|
|
|
{
|
|
|
val = value.Value.ToString("yyyy:MM:dd HH:mm:ss\0");
|
|
|
}
|
|
|
catch
|
|
|
{
|
|
|
}
|
|
|
}
|
|
|
SetTagValue("DateTimeDigitized", val);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a tag used to record fractions of seconds for the DateTime tag.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string SubsecTime
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
string text = GetTagText("SubsecTime");
|
|
|
if (!string.IsNullOrEmpty(text))
|
|
|
{
|
|
|
text = text.Substring(0, text.Length - 1);
|
|
|
}
|
|
|
return text;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
if (value != null)
|
|
|
{
|
|
|
value += '\0';
|
|
|
}
|
|
|
SetTagValue("SubsecTime", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a tag used to record fractions of seconds for the DateTimeOriginal tag.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string SubsecTimeOriginal
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
string text = GetTagText("SubsecTimeOriginal");
|
|
|
if (!string.IsNullOrEmpty(text))
|
|
|
{
|
|
|
text = text.Substring(0, text.Length - 1);
|
|
|
}
|
|
|
return text;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
if (value != null)
|
|
|
{
|
|
|
value += '\0';
|
|
|
}
|
|
|
SetTagValue("SubsecTimeOriginal", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a tag used to record fractions of seconds for the DateTimeDigitized tag.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string SubsecTimeDigitized
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
string text = GetTagText("SubsecTimeDigitized");
|
|
|
if (!string.IsNullOrEmpty(text))
|
|
|
{
|
|
|
text = text.Substring(0, text.Length - 1);
|
|
|
}
|
|
|
return text;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
if (value != null)
|
|
|
{
|
|
|
value += '\0';
|
|
|
}
|
|
|
SetTagValue("SubsecTimeDigitized", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or the exposure time, given in seconds (sec).
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational? ExposureTime
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("ExposureTime");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ExposureTime", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or the F number.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational? FNumber
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("FNumber");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("FNumber", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the class of the program used by the camera to set exposure when the
|
|
|
/// picture is taken.
|
|
|
/// See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The following values are defined:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>0</term>
|
|
|
/// <description>not defined</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>1</term>
|
|
|
/// <description>manual</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>2</term>
|
|
|
/// <description>normal program</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>3</term>
|
|
|
/// <description>aperture priority</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>4</term>
|
|
|
/// <description>shutter priority</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>5</term>
|
|
|
/// <description>create program</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>6</term>
|
|
|
/// <description>action program</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>7</term>
|
|
|
/// <description>portrait mode</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>8</term>
|
|
|
/// <description>landscape mode</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>others</term>
|
|
|
/// <description>reserved</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? ExposureProgram
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("ExposureProgram");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ExposureProgram", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the spectral sensitivity of each channel of the camera used.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string SpectralSensitivity
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
string text = GetTagText("SpectralSensitivity");
|
|
|
if (!string.IsNullOrEmpty(text))
|
|
|
{
|
|
|
text = text.Substring(0, text.Length - 1);
|
|
|
}
|
|
|
return text;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
if (value != null)
|
|
|
{
|
|
|
value += '\0';
|
|
|
}
|
|
|
SetTagValue("SpectralSensitivity", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the the ISO Speed and ISO Latitude of the camera or input device as
|
|
|
/// specified in ISO 12232.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort[] ISOSpeedRatings
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<ushort>("ISOSpeedRatings");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ISOSpeedRatings", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the Opto-Electric Conversion Function (OECF) specified in ISO 14524.
|
|
|
/// OECF is the relationship between the camera optical input and the image values.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public byte[] OECF
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<byte>("OECF");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValueUndefined("OECF", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the shutter speed. The unit is the APEX (Additive System of Photographic Exposure).
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIRational? ShutterSpeedValue
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIRational>("ShutterSpeedValue");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ShutterSpeedValue", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the lens aperture. The unit is the APEX value.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational? ApertureValue
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("ApertureValue");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ApertureValue", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of brightness. The unit is the APEX value.
|
|
|
/// Ordinarily it is given in the range of -99.99 to 99.99.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIRational? BrightnessValue
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIRational>("BrightnessValue");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("BrightnessValue", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the exposure bias. The unit is the APEX value.
|
|
|
/// Ordinarily it is given in the range of <20>99.99 to 99.99.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIRational? ExposureBiasValue
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIRational>("ExposureBiasValue");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ExposureBiasValue", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the smallest F number of the lens. The unit is the APEX value.
|
|
|
/// Ordinarily it is given in the range of 00.00 to 99.99,
|
|
|
/// but it is not limited to this range.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational? MaxApertureValue
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("MaxApertureValue");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("MaxApertureValue", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets distance to the subject, given in meters.
|
|
|
/// Note that if the numerator of the recorded value is FFFFFFFF, infinity shall be indicated;
|
|
|
/// and if the numerator is 0, distance unknown shall be indicated.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational? SubjectDistance
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("SubjectDistance");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("SubjectDistance", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the metering mode. See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The following values are defined:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>0</term>
|
|
|
/// <description>unknown</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>1</term>
|
|
|
/// <description>average</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>2</term>
|
|
|
/// <description>center-weighted-average</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>3</term>
|
|
|
/// <description>spot</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>4</term>
|
|
|
/// <description>multi-spot</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>5</term>
|
|
|
/// <description>pattern</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>6</term>
|
|
|
/// <description>partial</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>other</term>
|
|
|
/// <description>reserved</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>255</term>
|
|
|
/// <description>other</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? MeteringMode
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("MeteringMode");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("MeteringMode", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the kind of light source.
|
|
|
/// See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The following values are defined:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>0</term>
|
|
|
/// <description>unknown</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>1</term>
|
|
|
/// <description>daylight</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>2</term>
|
|
|
/// <description>fluorescent</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>3</term>
|
|
|
/// <description>tungsten</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>4</term>
|
|
|
/// <description>flash</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>9</term>
|
|
|
/// <description>fine weather</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>10</term>
|
|
|
/// <description>cloudy weather</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>11</term>
|
|
|
/// <description>shade</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>12</term>
|
|
|
/// <description>daylight fluorecent (D 5700 - 7100K)</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>13</term>
|
|
|
/// <description>day white fluorescent (N 4600 - 5400K)</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>14</term>
|
|
|
/// <description>cool white fluorescent (W 3900 - 4500K)</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>15</term>
|
|
|
/// <description>white fluorescent (WW 3200 - 3700K)</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>17</term>
|
|
|
/// <description>standard light A</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>18</term>
|
|
|
/// <description>standard light B</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>19</term>
|
|
|
/// <description>standard light C</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>20</term>
|
|
|
/// <description>D55</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>21</term>
|
|
|
/// <description>D65</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>22</term>
|
|
|
/// <description>D75</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>23</term>
|
|
|
/// <description>D50</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>24</term>
|
|
|
/// <description>ISO studio tungsten</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>255</term>
|
|
|
/// <description>other light source</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>other</term>
|
|
|
/// <description>reserved</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? LightSource
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("LightSource");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("LightSource", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a value indicating the status of flash when the image was shot.
|
|
|
/// Bit 0 indicates the flash firing status, bits 1 and 2 indicate the flash return
|
|
|
/// status, bits 3 and 4 indicate the flash mode, bit 5 indicates whether the flash
|
|
|
/// function is present, and bit 6 indicates "red eye" mode.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? Flash
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("Flash");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("Flash", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a value indicating the location and area of the main subject in
|
|
|
/// the overall scene. Variable length between 2 and 4.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort[] SubjectArea
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<ushort>("SubjectArea");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FreeImage.Resize(ref value, 2, 4);
|
|
|
SetTagValue("SubjectArea", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the actual focal length of the lens, in mm.
|
|
|
/// Conversion is not made to the focal length of a 35 mm film camera.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational? FocalLength
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("FocalLength");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("FocalLength", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the strobe energy at the time the image is captured,
|
|
|
/// as measured in Beam Candle Power Seconds (BCPS).
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational? FlashEnergy
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("FlashEnergy");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("FlashEnergy", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the camera or input device spatial frequency table and SFR values
|
|
|
/// in the direction of image width, image height, and diagonal direction,
|
|
|
/// as specified in ISO 12233.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public byte[] SpatialFrequencyResponse
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<byte>("SpatialFrequencyResponse");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValueUndefined("SpatialFrequencyResponse", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the number of pixels in the image width (X) direction per
|
|
|
/// FocalPlaneResolutionUnit on the camera focal plane.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational? FocalPlaneXResolution
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("FocalPlaneXResolution");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("FocalPlaneXResolution", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the number of pixels in the image height (Y) direction per
|
|
|
/// FocalPlaneResolutionUnit on the camera focal plane.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational? FocalPlaneYResolution
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("FocalPlaneYResolution");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("FocalPlaneYResolution", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the unit for measuring FocalPlaneXResolution and FocalPlaneYResolution.
|
|
|
/// This value is the same as the ResolutionUnit.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? FocalPlaneResolutionUnit
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("FocalPlaneResolutionUnit");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("FocalPlaneResolutionUnit", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the location of the main subject in the scene.
|
|
|
/// The value of this tag represents the pixel at the center of the main subject
|
|
|
/// relative to the left edge, prior to rotation processing as per the Rotation tag.
|
|
|
/// The first value indicates the X column number and second indicates the Y row number.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? SubjectLocation
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("SubjectLocation");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("SubjectLocation", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the exposure index selected on the camera or input device at the
|
|
|
/// time the image was captured.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational? ExposureIndex
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("ExposureIndex");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ExposureIndex", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the image sensor type on the camera or input device.
|
|
|
/// See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The following values are defined:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>1</term>
|
|
|
/// <description>not defined</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>2</term>
|
|
|
/// <description>one-chip color area sensor</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>3</term>
|
|
|
/// <description>two-chip color area sensor</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>4</term>
|
|
|
/// <description>three-chip color area sensor</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>5</term>
|
|
|
/// <description>color sequential area sensor</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>7</term>
|
|
|
/// <description>trilinear sensor</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>8</term>
|
|
|
/// <description>color sequential linear sensor</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>other</term>
|
|
|
/// <description>reserved</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? SensingMethod
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("SensingMethod");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("SensingMethod", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the image source. If a DSC recorded the image, this tag value of this
|
|
|
/// tag always be set to 3, indicating that the image was recorded on a DSC.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public byte? FileSource
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<byte>("FileSource");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValueUndefined("FileSource", value.HasValue ? new byte[] { value.Value } : null);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the type of scene. If a DSC recorded the image, this tag value shall
|
|
|
/// always be set to 1, indicating that the image was directly photographed.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public byte? SceneType
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<byte>("SceneType");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValueUndefined("SceneType", value.HasValue ? new byte[] { value.Value } : null);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the color filter array (CFA) geometric pattern of the image sensor
|
|
|
/// when a one-chip color area sensor is used. It does not apply to all sensing methods.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public byte[] CFAPattern
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<byte>("CFAPattern");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValueUndefined("CFAPattern", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the use of special processing on image data, such as rendering geared to output.
|
|
|
/// When special processing is performed, the reader is expected to disable or minimize any
|
|
|
/// further processing. See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The following values are definied:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>0</term>
|
|
|
/// <description>normal process</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>1</term>
|
|
|
/// <description>custom process</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>other</term>
|
|
|
/// <description>reserved</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? CustomRendered
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("CustomRendered");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("CustomRendered", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the exposure mode set when the image was shot.
|
|
|
/// In auto-bracketing mode, the camera shoots a series of frames of the same scene
|
|
|
/// at different exposure settings. See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The following values are definied:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>0</term>
|
|
|
/// <description>auto exposure</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>1</term>
|
|
|
/// <description>manual exposure</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>2</term>
|
|
|
/// <description>auto bracket</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>other</term>
|
|
|
/// <description>reserved</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? ExposureMode
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("ExposureMode");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ExposureMode", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the white balance mode set when the image was shot.
|
|
|
/// See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The following values are definied:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>0</term>
|
|
|
/// <description>auto white balance</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>1</term>
|
|
|
/// <description>manual white balance</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>other</term>
|
|
|
/// <description>reserved</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? WhiteBalance
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("WhiteBalance");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("WhiteBalance", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the digital zoom ratio when the image was shot.
|
|
|
/// If the numerator of the recorded value is 0, this indicates that digital zoom was not used.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational? DigitalZoomRatio
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("DigitalZoomRatio");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("DigitalZoomRatio", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the equivalent focal length assuming a 35mm film camera, in mm.
|
|
|
/// A value of 0 means the focal length is unknown. Note that this tag differs
|
|
|
/// from the FocalLength tag.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? FocalLengthIn35mmFilm
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("DigitalZoomRatio");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("DigitalZoomRatio", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the type of scene that was shot.
|
|
|
/// It can also be used to record the mode in which the image was shot.
|
|
|
/// See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The following values are definied:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>0</term>
|
|
|
/// <description>standard</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>1</term>
|
|
|
/// <description>landscape</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>2</term>
|
|
|
/// <description>portrait</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>3</term>
|
|
|
/// <description>night scene</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>other</term>
|
|
|
/// <description>reserved</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? SceneCaptureType
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("SceneCaptureType");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("SceneCaptureType", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the degree of overall image gain adjustment.
|
|
|
/// See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The following values are definied:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>0</term>
|
|
|
/// <description>none</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>1</term>
|
|
|
/// <description>low gain up</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>2</term>
|
|
|
/// <description>high gain up</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>3</term>
|
|
|
/// <description>low gain down</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>4</term>
|
|
|
/// <description>high gain down</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>other</term>
|
|
|
/// <description>reserved</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? GainControl
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("GainControl");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GainControl", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the direction of contrast processing applied by the camera
|
|
|
/// when the image was shot.
|
|
|
/// See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The following values are definied:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>0</term>
|
|
|
/// <description>normal</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>1</term>
|
|
|
/// <description>soft</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>2</term>
|
|
|
/// <description>hard</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>other</term>
|
|
|
/// <description>reserved</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? Contrast
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("Contrast");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("Contrast", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the direction of saturation processing applied by the camera
|
|
|
/// when the image was shot.
|
|
|
/// See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The following values are definied:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>0</term>
|
|
|
/// <description>normal</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>1</term>
|
|
|
/// <description>low saturation</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>2</term>
|
|
|
/// <description>high saturation</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>other</term>
|
|
|
/// <description>reserved</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? Saturation
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("Saturation");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("Saturation", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the direction of sharpness processing applied by the camera
|
|
|
/// when the image was shot.
|
|
|
/// See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The following values are definied:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>0</term>
|
|
|
/// <description>normal</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>1</term>
|
|
|
/// <description>soft</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>2</term>
|
|
|
/// <description>hard</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>other</term>
|
|
|
/// <description>reserved</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? Sharpness
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("Sharpness");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("Sharpness", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets information on the picture-taking conditions of a particular camera model.
|
|
|
/// The tag is used only to indicate the picture-taking conditions in the reader.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public byte[] DeviceSettingDescription
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<byte>("DeviceSettingDescription");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValueUndefined("DeviceSettingDescription", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the distance to the subject.
|
|
|
/// See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The following values are definied:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>0</term>
|
|
|
/// <description>unknown</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>1</term>
|
|
|
/// <description>macro</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>2</term>
|
|
|
/// <description>close view</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>3</term>
|
|
|
/// <description>distant view</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>other</term>
|
|
|
/// <description>reserved</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? SubjectDistanceRange
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("SubjectDistanceRange");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("SubjectDistanceRange", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets an identifier assigned uniquely to each image.
|
|
|
/// It is recorded as an ASCII string equivalent to hexadecimal notation and 128-bit fixed length.
|
|
|
/// Constant length of 32.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ImageUniqueID
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
string text = GetTagText("ImageUniqueID");
|
|
|
if (!string.IsNullOrEmpty(text))
|
|
|
{
|
|
|
text = text.Substring(0, text.Length - 1);
|
|
|
}
|
|
|
return text;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
if (value != null)
|
|
|
{
|
|
|
FreeImage.Resize(ref value, 32);
|
|
|
value += '\0';
|
|
|
}
|
|
|
SetTagValue("ImageUniqueID", value);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents a collection of all tags contained in the metadata model
|
|
|
/// <see cref="FREE_IMAGE_MDMODEL.FIMD_EXIF_GPS"/>.
|
|
|
/// </summary>
|
|
|
public class MDM_EXIF_GPS : MetadataModel
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of this class.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
public MDM_EXIF_GPS(FIBITMAP dib) : base(dib) { }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the datamodel that this instance represents.
|
|
|
/// </summary>
|
|
|
public override FREE_IMAGE_MDMODEL Model
|
|
|
{
|
|
|
get { return FREE_IMAGE_MDMODEL.FIMD_EXIF_GPS; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the GPS version ID. Constant length of 4.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public byte[] VersionID
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<byte>("GPSVersionID");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FreeImage.Resize(ref value, 4);
|
|
|
SetTagValue("GPSVersionID", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a value indicating whether the <see cref="Latitude"/>
|
|
|
/// is north or south latitude.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public LatitudeType? LatitudeDirection
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return ToLatitudeType(GetTagText("GPSLatitudeRef"));
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSLatitudeRef", ToString(value) + '\0');
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the latitude of the image. The latitude is expressed as three rational
|
|
|
/// values giving the degrees, minutes, and seconds, respectively. Constant length of 3.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
/// <seealso cref="LatitudeDirection"/>
|
|
|
public FIURational[] Latitude
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<FIURational>("GPSLatitude");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FreeImage.Resize(ref value, 3);
|
|
|
SetTagValue("GPSLatitude", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a value indicating whether <see cref="Longitude"/>
|
|
|
/// is east or west longitude.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public LongitudeType? LongitudeDirection
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return ToLongitudeType(GetTagText("GPSLongitudeRef"));
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSLongitudeRef", ToString(value) + '\0');
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the longitude of the image. The longitude is expressed as three rational
|
|
|
/// values giving the degrees, minutes, and seconds, respectively. Constant length of 3.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
/// <seealso cref="LongitudeDirection"/>
|
|
|
public FIURational[] Longitude
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<FIURational>("GPSLongitude");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FreeImage.Resize(ref value, 3);
|
|
|
SetTagValue("GPSLongitude", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a value indicating whether <see cref="Altitude"/> is sea level and the altitude
|
|
|
/// is above sea level. If the altitude is below sea level <see cref="Altitude"/> is
|
|
|
/// indicated as an absolute value.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public AltitudeType? AltitudeDirection
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
byte? flag = GetTagValue<byte>("GPSAltitudeRef");
|
|
|
if (flag.HasValue)
|
|
|
{
|
|
|
switch (flag.Value)
|
|
|
{
|
|
|
case 0:
|
|
|
return AltitudeType.AboveSeaLevel;
|
|
|
case 1:
|
|
|
return AltitudeType.BelowSeaLevel;
|
|
|
default:
|
|
|
return AltitudeType.Undefined;
|
|
|
}
|
|
|
}
|
|
|
return null;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
byte? val = null;
|
|
|
if (value.HasValue)
|
|
|
{
|
|
|
switch (value.Value)
|
|
|
{
|
|
|
case AltitudeType.AboveSeaLevel:
|
|
|
val = 0;
|
|
|
break;
|
|
|
|
|
|
case AltitudeType.BelowSeaLevel:
|
|
|
val = 1;
|
|
|
break;
|
|
|
|
|
|
default:
|
|
|
val = 2;
|
|
|
break;
|
|
|
}
|
|
|
}
|
|
|
SetTagValue("GPSAltitudeRef", val);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the altitude based on the reference in <see cref="AltitudeDirection"/>.
|
|
|
/// Altitude is expressed as one rational value. The reference unit is meters.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational? Altitude
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("GPSAltitude");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSAltitude", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the sign of the <see cref="SignedAltitude"/>.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// This is a derived property. There is no metadata tag directly associated
|
|
|
/// with this property value.
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public int? AltitudeSign
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
AltitudeType? seaLevel = AltitudeDirection;
|
|
|
if (seaLevel.HasValue)
|
|
|
{
|
|
|
return (seaLevel.Value == AltitudeType.BelowSeaLevel) ? -1 : 1;
|
|
|
}
|
|
|
return null;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
if (value.HasValue)
|
|
|
{
|
|
|
AltitudeDirection = value.Value >= 0 ? AltitudeType.AboveSeaLevel : AltitudeType.BelowSeaLevel;
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
AltitudeDirection = null;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the signed altitude.
|
|
|
/// Altitude is expressed as one rational value. The reference unit is meters.
|
|
|
/// </summary>
|
|
|
/// <exception cref="OverflowException">
|
|
|
/// Altitude is too large to fit into a FIRational.
|
|
|
/// </exception>
|
|
|
/// <remarks>
|
|
|
/// This is a derived property. There is no metadata tag directly associated
|
|
|
/// with this property value.
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIRational? SignedAltitude
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
FIRational? result = null;
|
|
|
FIURational? altitude = Altitude;
|
|
|
if (altitude.HasValue)
|
|
|
{
|
|
|
int sign = AltitudeSign ?? 1;
|
|
|
if (((int)altitude.Value.Numerator < 0) || ((int)altitude.Value.Denominator < 0))
|
|
|
throw new OverflowException();
|
|
|
result = new FIRational((int)altitude.Value.Numerator * sign, (int)altitude.Value.Denominator);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FIURational? val = null;
|
|
|
if (value.HasValue)
|
|
|
{
|
|
|
if (value.Value < 0)
|
|
|
{
|
|
|
AltitudeSign = -1;
|
|
|
value = -value.Value;
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
AltitudeSign = 1;
|
|
|
}
|
|
|
val = new FIURational((uint)value.Value.Numerator, (uint)value.Value.Denominator);
|
|
|
}
|
|
|
Altitude = val;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the time as UTC (Coordinated Universal Time). Constant length of 3.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public TimeSpan? TimeStamp
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
FIURational[] stamp = GetTagArray<FIURational>("GPSTimeStamp");
|
|
|
if ((stamp == null) || stamp.Length != 3)
|
|
|
{
|
|
|
return null;
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
return new TimeSpan((int)stamp[0], (int)stamp[1], (int)stamp[2]);
|
|
|
}
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FIURational[] stamp = null;
|
|
|
if (value.HasValue)
|
|
|
{
|
|
|
TimeSpan span = value.Value;
|
|
|
stamp = new FIURational[3];
|
|
|
stamp[0] = span.Hours;
|
|
|
stamp[1] = span.Minutes;
|
|
|
stamp[2] = span.Seconds;
|
|
|
}
|
|
|
SetTagValue("GPSTimeStamp", stamp);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the GPS satellites used for measurements. This tag can be used to describe
|
|
|
/// the number of satellites, their ID number, angle of elevation, azimuth, SNR and other
|
|
|
/// information in ASCII notation. The format is not specified.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string Satellites
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
string result = GetTagText("GPSSatellites");
|
|
|
if (!string.IsNullOrEmpty(result))
|
|
|
{
|
|
|
result = result.Substring(0, result.Length - 1);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
if (value != null)
|
|
|
{
|
|
|
value += '\0';
|
|
|
}
|
|
|
SetTagValue("GPSTimeStamp", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a value indicating the status of the GPS receiver when the image was recorded.
|
|
|
/// <b>true</b> indicates measurement was in progress;
|
|
|
/// <b>false</b> indicates measurement was Interoperability.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public bool? Status
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
string text = GetTagText("GPSStatus");
|
|
|
return string.IsNullOrEmpty(text) ? default(bool?) : text[0] == 'A';
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSStatus", value.HasValue ? (value.Value ? "A\0" : "V\0") : null);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a value indicating the GPS measurement mode.
|
|
|
/// <b>true</b> indicates three-dimensional measurement;
|
|
|
/// <b>false</b> indicated two-dimensional measurement was in progress.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public bool? MeasureMode3D
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
string text = GetTagText("GPSMeasureMode");
|
|
|
return string.IsNullOrEmpty(text) ? default(bool?) : text[0] == '3';
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSMeasureMode", value.HasValue ? (value.Value ? "3\0" : "2\0") : null);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the GPS DOP (data degree of precision). An HDOP value is written during
|
|
|
/// two-dimensional measurement, and PDOP during three-dimensional measurement.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational? DOP
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("GPSDOP");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSDOP", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the unit used to express the GPS receiver <see cref="Speed"/> of movement.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
/// <seealso cref="Speed"/>
|
|
|
public VelocityUnit? SpeedUnit
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return ToUnitType(GetTagText("GPSSpeedRef"));
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSSpeedRef", ToString(value) + '\0');
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the speed of GPS receiver movement.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
/// <seealso cref="SpeedUnit"/>
|
|
|
public FIURational? Speed
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("GPSSpeed");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSSpeed", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the reference for giving the direction of GPS receiver movement.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
/// <seealso cref="Track"/>
|
|
|
public DirectionReference? TrackDirectionReference
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return ToDirectionType(GetTagText("GPSTrackRef"));
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSTrackRef", ToString(value) + '\0');
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the direction of GPS receiver movement.
|
|
|
/// The range of values is from 0.00 to 359.99.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
/// <seealso cref="TrackDirectionReference"/>
|
|
|
public FIURational? Track
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("GPSTrack");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSTrack", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the reference for giving the direction of GPS receiver movement.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
/// <seealso cref="ImageDirection"/>
|
|
|
public DirectionReference? ImageDirectionReference
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return ToDirectionType(GetTagText("GPSImgDirectionRef"));
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSImgDirectionRef", ToString(value) + '\0');
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the direction of the image when it was captured.
|
|
|
/// The range of values is from 0.00 to 359.99.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
/// <seealso cref="ImageDirectionReference"/>
|
|
|
public FIURational? ImageDirection
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("GPSImgDirection");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSImgDirection", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the geodetic survey data used by the GPS receiver. If the survey data
|
|
|
/// is restricted to Japan, the value of this tag is 'TOKYO' or 'WGS-84'.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string MapDatum
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
string result = GetTagText("GPSMapDatum");
|
|
|
if (!string.IsNullOrEmpty(result))
|
|
|
{
|
|
|
result = result.Substring(0, result.Length - 1);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSMapDatum", value + '\0');
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a value indicating whether the destination point
|
|
|
/// is north or south latitude.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
/// <seealso cref="Latitude"/>
|
|
|
public LatitudeType? DestinationLatitudeDirection
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return ToLatitudeType(GetTagText("GPSDestLatitudeRef"));
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSDestLatitudeRef", ToString(value) + '\0');
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the latitude of the destination point. The latitude is expressed as three rational
|
|
|
/// values giving the degrees, minutes, and seconds, respectively. Constant length of 3.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
/// <seealso cref="DestinationLatitudeDirection"/>
|
|
|
public FIURational[] DestinationLatitude
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<FIURational>("GPSDestLatitude");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FreeImage.Resize(ref value, 3);
|
|
|
SetTagValue("GPSDestLatitude", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a value indicating whether the destination point
|
|
|
/// is east or west longitude.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
/// <seealso cref="Latitude"/>
|
|
|
public LongitudeType? DestinationLongitudeDirection
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return ToLongitudeType(GetTagText("GPSDestLongitudeRef"));
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSDestLongitudeRef", ToString(value) + '\0');
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the longitude of the destination point. The longitude is expressed as three rational
|
|
|
/// values giving the degrees, minutes, and seconds, respectively. Constant length of 3.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational[] DestinationLongitude
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<FIURational>("GPSDestLongitude");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FreeImage.Resize(ref value, 3);
|
|
|
SetTagValue("GPSDestLongitude", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the reference used for giving the bearing to the destination point.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
/// <seealso cref="DestinationBearing"/>
|
|
|
public DirectionReference? DestinationDirectionReference
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return ToDirectionType(GetTagText("GPSDestBearingRef"));
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSDestBearingRef", ToString(value) + '\0');
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the bearing to the destination point.
|
|
|
/// The range of values is from 0.00 to 359.99.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
/// <seealso cref="DestinationDirectionReference"/>
|
|
|
public FIURational? DestinationBearing
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("GPSDestBearing");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSDestBearing", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the unit used to express the distance to the destination point.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
/// <seealso cref="DestinationBearing"/>
|
|
|
public VelocityUnit? DestinationUnit
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return ToUnitType(GetTagText("GPSDestDistanceRef"));
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSDestDistanceRef", ToString(value) + '\0');
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a character string recording the name of the method used
|
|
|
/// for location finding. The first byte indicates the character code used,
|
|
|
/// and this is followed by the name of the method. Since the Type is not ASCII,
|
|
|
/// NULL termination is not necessary.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public byte[] ProcessingMethod
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<byte>("GPSProcessingMethod");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSProcessingMethod", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a character string recording the name of the GPS area.
|
|
|
/// The first byte indicates the character code used, and this is followed by
|
|
|
/// the name of the GPS area. Since the Type is not ASCII, NULL termination is
|
|
|
/// not necessary.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public byte[] AreaInformation
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<byte>("GPSAreaInformation");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSAreaInformation", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets date and time information relative to UTC (Coordinated Universal Time).
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// This is a derived property. There is no metadata tag directly associated
|
|
|
/// with this property value.
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public DateTime? DateTimeStamp
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
DateTime? date = DateStamp;
|
|
|
TimeSpan? time = TimeStamp;
|
|
|
if ((date == null) && (time == null))
|
|
|
{
|
|
|
return null;
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
if (date == null)
|
|
|
{
|
|
|
date = DateTime.MinValue;
|
|
|
}
|
|
|
if (time == null)
|
|
|
{
|
|
|
time = TimeSpan.MinValue;
|
|
|
}
|
|
|
return date.Value.Add(time.Value);
|
|
|
}
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
if (value.HasValue)
|
|
|
{
|
|
|
DateStamp = value.Value.Date;
|
|
|
TimeStamp = value.Value.TimeOfDay;
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
DateStamp = null;
|
|
|
TimeStamp = null;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets date information relative to UTC (Coordinated Universal Time).
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public DateTime? DateStamp
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
string stamp = GetTagText("GPSDateStamp");
|
|
|
if (stamp != null)
|
|
|
{
|
|
|
try
|
|
|
{
|
|
|
return DateTime.ParseExact(stamp, "yyyy:MM:dd\0", null);
|
|
|
}
|
|
|
catch
|
|
|
{
|
|
|
}
|
|
|
}
|
|
|
return null;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
string val = null;
|
|
|
if (value.HasValue)
|
|
|
{
|
|
|
try
|
|
|
{
|
|
|
val = value.Value.ToString("yyyy:MM:dd\0");
|
|
|
}
|
|
|
catch
|
|
|
{
|
|
|
}
|
|
|
}
|
|
|
SetTagValue("GPSDateStamp", val);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a value indicating whether differential correction was applied to
|
|
|
/// the GPS receiver.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public bool? IsDifferential
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
ushort? value = GetTagValue<ushort>("GPSDifferential");
|
|
|
return value.HasValue ? (value != 0) : (default(bool?));
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GPSDifferential", value.HasValue ? (object)(value.Value ? (ushort)1 : (ushort)0) : (null));
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents a collection of all tags contained in the metadata model
|
|
|
/// <see cref="FREE_IMAGE_MDMODEL.FIMD_EXIF_INTEROP"/>.
|
|
|
/// </summary>
|
|
|
public class MDM_INTEROP : MetadataModel
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of this class.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
public MDM_INTEROP(FIBITMAP dib) : base(dib) { }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the datamodel that this instance represents.
|
|
|
/// </summary>
|
|
|
public override FREE_IMAGE_MDMODEL Model
|
|
|
{
|
|
|
get { return FREE_IMAGE_MDMODEL.FIMD_EXIF_INTEROP; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the identification of the Interoperability rule.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public InteroperabilityMode? Identification
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return ToInteroperabilityType(GetTagText("InteroperabilityIndex"));
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("InteroperabilityIndex", ToString(value) + '\0');
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents a collection of all tags contained in the metadata model
|
|
|
/// <see cref="FREE_IMAGE_MDMODEL.FIMD_EXIF_MAIN"/>.
|
|
|
/// <para/>
|
|
|
/// <b>This class is obsolete. Use class <see cref="MDM_EXIF_MAIN"/> instead.</b>
|
|
|
/// </summary>
|
|
|
[Obsolete("To be removed in future releases. Use MDM_EXIF_MAIN instead.")]
|
|
|
public class MDM_MAIN : MDM_EXIF_MAIN
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of this class.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
public MDM_MAIN(FIBITMAP dib) : base(dib) { }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents a collection of all tags contained in the metadata model
|
|
|
/// <see cref="FREE_IMAGE_MDMODEL.FIMD_EXIF_MAIN"/>.
|
|
|
/// </summary>
|
|
|
public class MDM_EXIF_MAIN : MetadataModel
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of this class.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
public MDM_EXIF_MAIN(FIBITMAP dib) : base(dib) { }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the datamodel that this instance represents.
|
|
|
/// </summary>
|
|
|
public override FREE_IMAGE_MDMODEL Model
|
|
|
{
|
|
|
get { return FREE_IMAGE_MDMODEL.FIMD_EXIF_MAIN; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the number of columns of image data, equal to the number
|
|
|
/// of pixels per row. In JPEG compressed data a JPEG marker is used
|
|
|
/// instead of this tag.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public uint? ImageWidth
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetUInt32Value("ImageWidth");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
RemoveTag("ImageWidth");
|
|
|
if (value.HasValue)
|
|
|
{
|
|
|
SetTagValue("ImageWidth", value);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets number of rows of image data. In JPEG compressed data a JPEG marker
|
|
|
/// is used instead of this tag.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public uint? ImageHeight
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetUInt32Value("ImageLength");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
RemoveTag("ImageLength");
|
|
|
if (value.HasValue)
|
|
|
{
|
|
|
SetTagValue("ImageLength", value);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets number of bits per image component. In this standard
|
|
|
/// each component of the image is 8 bits, so the value for this tag is 8.
|
|
|
/// Constant length of 3.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort[] BitsPerSample
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<ushort>("BitsPerSample");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FreeImage.Resize(ref value, 3);
|
|
|
SetTagValue("BitsPerSample", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets compression scheme used for the image data. When a primary image
|
|
|
/// is JPEG compressed, this designation is not necessary and is omitted.
|
|
|
/// When thumbnails use JPEG compression, this tag value is set to 6.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? Compression
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("Compression");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("Compression", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets pixel composition. In JPEG compressed data a JPEG marker is
|
|
|
/// used instead of this tag. See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The following values are definied:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>2</term>
|
|
|
/// <description>RGB</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>6</term>
|
|
|
/// <description>YCbCr</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>other</term>
|
|
|
/// <description>reserved</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? PhotometricInterpretation
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("PhotometricInterpretation");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("PhotometricInterpretation", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the image orientation viewed in terms of rows and columns.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ExifImageOrientation? Orientation
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return (ExifImageOrientation?)GetTagValue<ushort>("Orientation");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("Orientation", (ushort?)value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the number of components per pixel. Since this standard applies
|
|
|
/// to RGB and YCbCr images, the value set for this tag is 3. In JPEG compressed
|
|
|
/// data a JPEG marker is used instead of this tag.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? SamplesPerPixel
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("SamplesPerPixel");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("SamplesPerPixel", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a value that indicates whether pixel components are recorded in
|
|
|
/// chunky or planar format. In JPEG compressed files a JPEG marker is used instead
|
|
|
/// of this tag. If this field does not exist, the TIFF default of 1 (chunky) is assumed.
|
|
|
/// See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The following values are definied:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>1</term>
|
|
|
/// <description>chunky format</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>2</term>
|
|
|
/// <description>planar format</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>other</term>
|
|
|
/// <description>reserved</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? PlanarConfiguration
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("PlanarConfiguration");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("PlanarConfiguration", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the sampling ratio of chrominance components in relation to
|
|
|
/// the luminance component. In JPEG compressed dat a JPEG marker is used
|
|
|
/// instead of this tag.
|
|
|
/// See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The following values are definied:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>[2,1]</term>
|
|
|
/// <description>YCbCr4:2:2</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>[2,2]</term>
|
|
|
/// <description>YCbCr4:2:0</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>other</term>
|
|
|
/// <description>reserved</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort[] YCbCrSubSampling
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<ushort>("YCbCrSubSampling");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FreeImage.Resize(ref value, 2);
|
|
|
SetTagValue("YCbCrSubSampling", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets position of chrominance components in relation to the luminance component.
|
|
|
/// See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// This field is designated only for JPEG compressed data or uncompressed YCbCr data.
|
|
|
/// The TIFF default is 1 (centered); but when Y:Cb:Cr = 4:2:2 it is recommended in
|
|
|
/// this standard that 2 (co-sited) be used to record data, in order to improve the
|
|
|
/// image quality when viewed on TV systems.
|
|
|
/// <para/>
|
|
|
/// When this field does not exist, the reader shall assume the TIFF default.
|
|
|
/// In the case of Y:Cb:Cr = 4:2:0, the TIFF default (centered) is recommended.
|
|
|
/// If the reader does not have the capability of supporting both kinds of YCbCrPositioning,
|
|
|
/// it shall follow the TIFF default regardless of the value in this field.
|
|
|
/// It is preferable that readers be able to support both centered and co-sited positioning.
|
|
|
/// <para/>
|
|
|
/// The following values are definied:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>1</term>
|
|
|
/// <description>centered</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>2</term>
|
|
|
/// <description>co-sited</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>other</term>
|
|
|
/// <description>reserved</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? YCbCrPositioning
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("YCbCrPositioning");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("YCbCrPositioning", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the number of pixels per <see cref="ResolutionUnit"/>
|
|
|
/// in the <see cref="ImageWidth"/> direction. When the image resolution is unknown,
|
|
|
/// 72 [dpi] is designated.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational? XResolution
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("XResolution");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("XResolution", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the number of pixels per <see cref="ResolutionUnit"/>
|
|
|
/// in the <see cref="ImageHeight"/> direction. When the image resolution is unknown,
|
|
|
/// 72 [dpi] is designated.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational? YResolution
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<FIURational>("YResolution");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("YResolution", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the unit for measuring <see cref="XResolution"/> and <see cref="YResolution"/>.
|
|
|
/// The same unit is used for both <see cref="XResolution"/> and <see cref="YResolution"/>.
|
|
|
/// If the image resolution in unknown, 2 (inches) is designated.
|
|
|
/// See remarks for further information.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The following values are definied:<para/>
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>ID</term>
|
|
|
/// <description>Description</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term>2</term>
|
|
|
/// <description>inches</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>3</term>
|
|
|
/// <description>YCbCr4:2:0</description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term>other</term>
|
|
|
/// <description>centimeters</description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort? ResolutionUnit
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<ushort>("ResolutionUnit");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ResolutionUnit", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the byte offset of that strip.
|
|
|
/// It is recommended that this be selected so the number of strip bytes
|
|
|
/// does not exceed 64 Kbytes.
|
|
|
/// With JPEG compressed data this designation is not needed and is omitted.
|
|
|
/// Constant length of <see cref="SamplesPerPixel"/> * StripsPerImage.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
/// <seealso cref="RowsPerStrip"/>
|
|
|
/// <see cref="StripByteCounts"/>
|
|
|
public uint[] StripOffsets
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetUInt32Array("StripOffsets");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
RemoveTag("StripOffsets");
|
|
|
if (value != null)
|
|
|
{
|
|
|
SetTagValue("StripOffsets", value);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets number of rows per strip. This is the number of rows in the image of
|
|
|
/// one strip when an image is divided into strips. With JPEG compressed data this
|
|
|
/// designation is not needed and is omitted.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
/// <seealso cref="StripByteCounts"/>
|
|
|
public uint? RowsPerStrip
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetUInt32Value("RowsPerStrip");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
RemoveTag("RowsPerStrip");
|
|
|
if (value.HasValue)
|
|
|
{
|
|
|
SetTagValue("RowsPerStrip", value);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the total number of bytes in each strip.
|
|
|
/// With JPEG compressed data this designation is not needed and is omitted.
|
|
|
/// Constant length of <see cref="SamplesPerPixel"/> * StripsPerImage.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public uint[] StripByteCounts
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetUInt32Array("StripByteCounts");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
RemoveTag("StripByteCounts");
|
|
|
if (value != null)
|
|
|
{
|
|
|
SetTagValue("StripByteCounts", value);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the offset to the start byte (SOI) of JPEG compressed thumbnail data.
|
|
|
/// This is not used for primary image JPEG data.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public uint? JPEGInterchangeFormat
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<uint>("JPEGInterchangeFormat");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("JPEGInterchangeFormat", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the number of bytes of JPEG compressed thumbnail data.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// This is not used for primary image JPEG data.
|
|
|
/// JPEG thumbnails are not divided but are recorded as a continuous
|
|
|
/// JPEG bitstream from SOI to EOI. APPn and COM markers should not be recorded.
|
|
|
/// Compressed thumbnails shall be recorded in no more than 64 Kbytes,
|
|
|
/// including all other data to be recorded in APP1.
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public uint? JPEGInterchangeFormatLength
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<uint>("JPEGInterchangeFormatLength");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("JPEGInterchangeFormatLength", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a transfer function for the image, described in tabular style.
|
|
|
/// Constant length of 3 * 256.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort[] TransferFunction
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<ushort>("TransferFunction");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FreeImage.Resize(ref value, 3 * 256);
|
|
|
SetTagValue("TransferFunction", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the chromaticity of the white point of the image.
|
|
|
/// Constant length of 2.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational[] WhitePoint
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<FIURational>("WhitePoint");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FreeImage.Resize(ref value, 2);
|
|
|
SetTagValue("WhitePoint", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the chromaticity of the three primary colors of the image.
|
|
|
/// Constant length of 6.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational[] PrimaryChromaticities
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<FIURational>("PrimaryChromaticities");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FreeImage.Resize(ref value, 6);
|
|
|
SetTagValue("PrimaryChromaticities", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the matrix coefficients for transformation from RGB to YCbCr image data.
|
|
|
/// Constant length of 3.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational[] YCbCrCoefficients
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<FIURational>("YCbCrCoefficients");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FreeImage.Resize(ref value, 3);
|
|
|
SetTagValue("PrimaryChromaticities", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the reference black point value and reference white point value.
|
|
|
/// Constant length of 6.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public FIURational[] ReferenceBlackWhite
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<FIURational>("ReferenceBlackWhite");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
FreeImage.Resize(ref value, 6);
|
|
|
SetTagValue("ReferenceBlackWhite", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the date and time of image creation.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public DateTime? DateTime
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
DateTime? result = null;
|
|
|
string text = GetTagText("DateTime");
|
|
|
if (text != null)
|
|
|
{
|
|
|
try
|
|
|
{
|
|
|
result = System.DateTime.ParseExact(text, "yyyy:MM:dd HH:mm:ss\0", null);
|
|
|
}
|
|
|
catch
|
|
|
{
|
|
|
}
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
string val = null;
|
|
|
if (value.HasValue)
|
|
|
{
|
|
|
try
|
|
|
{
|
|
|
val = value.Value.ToString("yyyy:MM:dd HH:mm:ss\0");
|
|
|
}
|
|
|
catch
|
|
|
{
|
|
|
}
|
|
|
}
|
|
|
SetTagValue("DateTime", val);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets a string giving the title of the image.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ImageDescription
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
string result = GetTagText("ImageDescription");
|
|
|
if (!string.IsNullOrEmpty(result))
|
|
|
{
|
|
|
result = result.Substring(0, result.Length - 1);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
if (value != null)
|
|
|
{
|
|
|
value += '\0';
|
|
|
}
|
|
|
SetTagValue("ImageDescription", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the manufacturer of the recording equipment.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string Make
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
string result = GetTagText("Make");
|
|
|
if (!string.IsNullOrEmpty(result))
|
|
|
{
|
|
|
result = result.Substring(0, result.Length - 1);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
if (value != null)
|
|
|
{
|
|
|
value += '\0';
|
|
|
}
|
|
|
SetTagValue("Make", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the model name or model number of the equipment.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string EquipmentModel
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
string result = GetTagText("Model");
|
|
|
if (!string.IsNullOrEmpty(result))
|
|
|
{
|
|
|
result = result.Substring(0, result.Length - 1);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
if (value != null)
|
|
|
{
|
|
|
value += '\0';
|
|
|
}
|
|
|
SetTagValue("Model", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the name and version of the software or firmware of the camera
|
|
|
/// or image input device used to generate the image.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string Software
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
string result = GetTagText("Software");
|
|
|
if (!string.IsNullOrEmpty(result))
|
|
|
{
|
|
|
result = result.Substring(0, result.Length - 1);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
if (value != null)
|
|
|
{
|
|
|
value += '\0';
|
|
|
}
|
|
|
SetTagValue("Software", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the name of the camera owner, photographer or image creator.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string Artist
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
string result = GetTagText("Artist");
|
|
|
if (!string.IsNullOrEmpty(result))
|
|
|
{
|
|
|
result = result.Substring(0, result.Length - 1);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
if (value != null)
|
|
|
{
|
|
|
value += '\0';
|
|
|
}
|
|
|
SetTagValue("Artist", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the photographer and editor copyrights.
|
|
|
/// Constant length of 1-2.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string[] Copyright
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
string[] result = null;
|
|
|
string text = GetTagText("Copyright");
|
|
|
if (!string.IsNullOrEmpty(text))
|
|
|
{
|
|
|
result = text.Split(new char[] { '\0' }, StringSplitOptions.RemoveEmptyEntries);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
string val = null;
|
|
|
if (value != null)
|
|
|
{
|
|
|
if (value.Length == 1)
|
|
|
{
|
|
|
if (value[0] != null)
|
|
|
{
|
|
|
val = value[0] + '\0';
|
|
|
}
|
|
|
}
|
|
|
else if (value.Length == 2)
|
|
|
{
|
|
|
if ((value[0] != null) && (value[1] != null))
|
|
|
{
|
|
|
val = value[0] + '\0' + value[1] + '\0';
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
SetTagValue("Copyright", val);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents a collection of all tags contained in the metadata model
|
|
|
/// <see cref="FREE_IMAGE_MDMODEL.FIMD_EXIF_MAKERNOTE"/>.
|
|
|
/// </summary>
|
|
|
public class MDM_MAKERNOTE : MetadataModel
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of this class.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
public MDM_MAKERNOTE(FIBITMAP dib) : base(dib) { }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the datamodel that this instance represents.
|
|
|
/// </summary>
|
|
|
public override FREE_IMAGE_MDMODEL Model
|
|
|
{
|
|
|
get { return FREE_IMAGE_MDMODEL.FIMD_EXIF_MAKERNOTE; }
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents a collection of all tags contained in the metadata model
|
|
|
/// <see cref="FREE_IMAGE_MDMODEL.FIMD_GEOTIFF"/>.
|
|
|
/// </summary>
|
|
|
public class MDM_GEOTIFF : MetadataModel
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of this class.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
public MDM_GEOTIFF(FIBITMAP dib) : base(dib) { }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the datamodel that this instance represents.
|
|
|
/// </summary>
|
|
|
public override FREE_IMAGE_MDMODEL Model
|
|
|
{
|
|
|
get { return FREE_IMAGE_MDMODEL.FIMD_GEOTIFF; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the GeoTIFF GeoASCIIParamsTag.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The GeoASCIIParamsTag is used to store all of the <see cref="String"/> valued
|
|
|
/// GeoKeys, referenced by the <see cref="GeoKeyDirectory"/> property. Since keys
|
|
|
/// defined in the GeoKeyDirectoryTag use offsets into this tag, any special
|
|
|
/// comments may be placed at the beginning of this tag.
|
|
|
/// For the most part, the only keys that are <see cref="String"/> valued are
|
|
|
/// <i>Citation</i> keys, giving documentation and references for obscure
|
|
|
/// projections, datums, etc.
|
|
|
/// <para/>
|
|
|
/// Special handling is required for <see cref="String"/>-valued keys. While it
|
|
|
/// is true that TIFF 6.0 permits multiple NULL-delimited strings within a single
|
|
|
/// ASCII tag, the secondary strings might not appear in the output of naive
|
|
|
/// <i>tiffdump</i> programs. For this reason, the NULL delimiter of each ASCII key
|
|
|
/// value shall be converted to a "|" (pipe) character before being installed
|
|
|
/// back into the <see cref="String"/> holding tag, so that a dump of the tag
|
|
|
/// will look like this.
|
|
|
/// <para/>
|
|
|
/// AsciiTag="first_value|second_value|etc...last_value|"
|
|
|
/// <para/>
|
|
|
/// A baseline GeoTIFF-reader must check for and convert the final "|" pipe
|
|
|
/// character of a key back into a NULL before returning it to the client
|
|
|
/// software.
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string GeoASCIIParams
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
string text = GetTagText("GeoASCIIParams");
|
|
|
if (!string.IsNullOrEmpty(text))
|
|
|
{
|
|
|
text = text.Substring(0, text.Length - 1);
|
|
|
}
|
|
|
return text;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
if (value != null)
|
|
|
{
|
|
|
value += '\0';
|
|
|
}
|
|
|
SetTagValue("GeoASCIIParams", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the GeoTIFF GeoDoubleParamsTag.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The GeoDoubleParamsTag is used to store all of the <see cref="Double"/> valued
|
|
|
/// GeoKeys, referenced by the <see cref="GeoKeyDirectory"/> property. The meaning of
|
|
|
/// any value of this double array is determined from the GeoKeyDirectoryTag reference
|
|
|
/// pointing to it. <see cref="Single"/> values should first be converted to
|
|
|
/// <see cref="Double"/> and stored here.
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public double[] GeoDoubleParams
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<double>("GeoDoubleParams");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GeoDoubleParams", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the GeoTIFF GeoKeyDirectoryTag.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The GeoKeyDirectoryTag may be used to store the GeoKey Directory, which defines and
|
|
|
/// references the <i>GeoKeys</i>.
|
|
|
/// <para/>
|
|
|
/// The tag is an array of unsigned <see cref="UInt16"/> values, which are primarily
|
|
|
/// grouped into blocks of 4. The first 4 values are special, and contain GeoKey directory
|
|
|
/// header information. The header values consist of the following information, in order:
|
|
|
/// <para/>
|
|
|
/// Header={KeyDirectoryVersion, KeyRevision, MinorRevision, NumberOfKeys}
|
|
|
/// <para/>
|
|
|
/// where
|
|
|
/// <para/>
|
|
|
/// <i>KeyDirectoryVersion</i> indicates the current version of Key implementation, and will
|
|
|
/// only change if this Tag's Key structure is changed. (Similar to the TIFFVersion (42)).
|
|
|
/// The current DirectoryVersion number is 1. This value will most likely never change,
|
|
|
/// and may be used to ensure that this is a valid Key-implementation.
|
|
|
/// <para/>
|
|
|
/// <i>KeyRevision</i> indicates what revision of Key-Sets are used.
|
|
|
/// <para/>
|
|
|
/// <i>MinorRevision</i> indicates what set of Key-Codes are used. The complete revision number
|
|
|
/// is denoted <KeyRevision>.<MinorRevision>.
|
|
|
/// <para/>
|
|
|
/// <i>NumberOfKeys</i> indicates how many Keys are defined by the rest of this Tag.
|
|
|
/// <para/>
|
|
|
/// This header is immediately followed by a collection of <NumberOfKeys> KeyEntry
|
|
|
/// sets, each of which is also 4-<see cref="UInt16"/> long. Each KeyEntry is modeled on the
|
|
|
/// <i>TIFFEntry</i> format of the TIFF directory header, and is of the form:
|
|
|
/// <para/>
|
|
|
/// KeyEntry = { KeyID, TIFFTagLocation, Count, Value_Offset }
|
|
|
/// <para/>
|
|
|
/// where
|
|
|
/// <para/>
|
|
|
/// <i>KeyID</i> gives the Key-ID value of the Key (identical in function to TIFF tag ID,
|
|
|
/// but completely independent of TIFF tag-space),
|
|
|
/// <para/>
|
|
|
/// <i>TIFFTagLocation</i> indicates which TIFF tag contains the value(s) of the Key: if
|
|
|
/// TIFFTagLocation is 0, then the value is <see cref="UInt16"/>, and is contained in the
|
|
|
/// <i>Value_Offset</i> entry. Otherwise, the type (format) of the value is implied by the
|
|
|
/// TIFF-Type of the tag containing the value.
|
|
|
/// <para/>
|
|
|
/// <i>Count</i> indicates the number of values in this key.
|
|
|
/// <para/>
|
|
|
/// <i>Value_Offset</i> Value_Offset indicates the index-offset into the TagArray indicated
|
|
|
/// by TIFFTagLocation, if it is nonzero. If TIFFTagLocation is 0 (zero) , then Value_Offset
|
|
|
/// contains the actual (<see cref="UInt16"/>) value of the Key, and Count=1 is implied.
|
|
|
/// Note that the offset is not a byte-offset, but rather an index based on the natural data
|
|
|
/// type of the specified tag array.
|
|
|
/// <para/>
|
|
|
/// Following the KeyEntry definitions, the KeyDirectory tag may also contain additional
|
|
|
/// values. For example, if a key requires multiple <see cref="UInt16"/> values, they shall
|
|
|
/// be placed at the end of this tag, and the KeyEntry will set
|
|
|
/// TIFFTagLocation=GeoKeyDirectoryTag, with the Value_Offset pointing to the location of the
|
|
|
/// value(s).
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public ushort[] GeoKeyDirectory
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<ushort>("GeoKeyDirectory");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GeoKeyDirectory", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the GeoTIFF ModelPixelScaleTag.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The ModelPixelScaleTag tag may be used to specify the size of raster pixel spacing
|
|
|
/// in the model space units, when the raster space can be embedded in the model space
|
|
|
/// coordinate system without rotation, and consists of the following 3 values:
|
|
|
/// <para/>
|
|
|
/// ModelPixelScaleTag = (ScaleX, ScaleY, ScaleZ)
|
|
|
/// <para/>
|
|
|
/// where <i>ScaleX</i> and <i>ScaleY</i> give the horizontal and vertical spacing of
|
|
|
/// raster pixels. The <i>ScaleZ</i> is primarily used to map the pixel value of a
|
|
|
/// digital elevation model into the correct Z-scale, and so for most other purposes
|
|
|
/// this value should be zero (since most model spaces are 2-D, with Z=0).
|
|
|
/// <para/>
|
|
|
/// A single tiepoint in the <see cref="ModelTiePoints"/> tag, together with this tag,
|
|
|
/// completely determine the relationship between raster and model space; thus they
|
|
|
/// comprise the two tags which Baseline GeoTIFF files most often will use to place a
|
|
|
/// raster image into a "standard position" in model space.
|
|
|
/// <para/>
|
|
|
/// Like the <see cref="ModelTiePoints"/> tag, this tag information is independent of the
|
|
|
/// XPosition, YPosition, Resolution and Orientation tags of the standard TIFF 6.0 spec.
|
|
|
/// However, simple reversals of orientation between raster and model space
|
|
|
/// (e.g. horizontal or vertical flips) may be indicated by reversal of sign in the
|
|
|
/// corresponding component of the ModelPixelScaleTag. GeoTIFF compliant readers must
|
|
|
/// honor this signreversal convention.
|
|
|
/// <para/>
|
|
|
/// This tag must not be used if the raster image requires rotation or shearing to place
|
|
|
/// it into the standard model space. In such cases the transformation shall be defined
|
|
|
/// with the more general <see cref="ModelTransformationMatrix"/>.
|
|
|
/// <para/>
|
|
|
/// <br/><b>Naming differences</b><para/>
|
|
|
/// In the native FreeImage library and thus, in the FreeImage API documentation, this
|
|
|
/// property's key is named <i>GeoPixelScale</i>. Since the GeoTIFF specification
|
|
|
/// as well as Java's <c>EXIFTIFFTagSet</c> class call this tag
|
|
|
/// <see cref="ModelPixelScale"/>, this property was renamed accordingly.
|
|
|
/// However, when accessing this property's tag by its <see cref="MetadataTag"/> object,
|
|
|
/// the native FreeImage tag key <i>GeoPixelScale</i> must be used.
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public double[] ModelPixelScale
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<double>("GeoPixelScale");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GeoPixelScale", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the GeoTIFF GeoTiePointsTag.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The GeoTiePointsTag stores raster -> model tiepoint pairs in the order
|
|
|
/// <para/>
|
|
|
/// ModelTiePoints = (...,I,J,K, X,Y,Z...),
|
|
|
/// <para/>
|
|
|
/// where <i>(I,J,K)</i> is the point at location <i>(I,J)</i> in raster space with
|
|
|
/// pixel-value <i>K</i>, and <i>(X,Y,Z)</i> is a vector in model space. In most cases
|
|
|
/// the model space is only two-dimensional, in which case both K and Z should be set
|
|
|
/// to zero; this third dimension is provided in anticipation of future support for 3D
|
|
|
/// digital elevation models and vertical coordinate systems.
|
|
|
/// <para/>
|
|
|
/// A raster image may be georeferenced simply by specifying its location, size and
|
|
|
/// orientation in the model coordinate space M. This may be done by specifying the
|
|
|
/// location of three of the four bounding corner points. However, tiepoints are only
|
|
|
/// to be considered exact at the points specified; thus defining such a set of
|
|
|
/// bounding tiepoints does not imply that the model space locations of the interior
|
|
|
/// of the image may be exactly computed by a linear interpolation of these tiepoints.
|
|
|
/// <para/>
|
|
|
/// However, since the relationship between the Raster space and the model space will
|
|
|
/// often be an exact, affine transformation, this relationship can be defined using
|
|
|
/// one set of tiepoints and the <see cref="ModelPixelScale"/>, described below, which
|
|
|
/// gives the vertical and horizontal raster grid cell size, specified in model units.
|
|
|
/// <para/>
|
|
|
/// If possible, the first tiepoint placed in this tag shall be the one establishing
|
|
|
/// the location of the point (0,0) in raster space. However, if this is not possible
|
|
|
/// (for example, if (0,0) is goes to a part of model space in which the projection is
|
|
|
/// ill-defined), then there is no particular order in which the tiepoints need be
|
|
|
/// listed.
|
|
|
/// <para/>
|
|
|
/// For orthorectification or mosaicking applications a large number of tiepoints may
|
|
|
/// be specified on a mesh over the raster image. However, the definition of associated
|
|
|
/// grid interpolation methods is not in the scope of the current GeoTIFF spec.
|
|
|
/// <para/>
|
|
|
/// <br/><b>Naming differences</b><para/>
|
|
|
/// In the native FreeImage library and thus, in the FreeImage API documentation, this
|
|
|
/// property's key is named <i>GeoTiePoints</i>. Since the GeoTIFF specification
|
|
|
/// as well as Java's <c>EXIFTIFFTagSet</c> class call this tag
|
|
|
/// <see cref="ModelTiePoints"/>, this property was renamed accordingly.
|
|
|
/// However, when accessing this property's tag by its <see cref="MetadataTag"/> object,
|
|
|
/// the native FreeImage tag key <i>GeoTiePoints</i> must be used.
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public double[] ModelTiePoints
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<double>("GeoTiePoints");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GeoTiePoints", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the GeoTIFF ModelTransformationMatrixTag.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// This tag may be used to specify the transformation matrix between the raster space
|
|
|
/// (and its dependent pixel-value space) and the (possibly 3D) model space.
|
|
|
/// <para/>
|
|
|
/// <br/><b>Naming differences</b><para/>
|
|
|
/// In the native FreeImage library and thus, in the FreeImage API documentation, this
|
|
|
/// property's key is named <i>GeoTransformationMatrix</i>. Since the GeoTIFF specification
|
|
|
/// as well as Java's <c>EXIFTIFFTagSet</c> class call this tag
|
|
|
/// <see cref="ModelTransformationMatrix"/>, this property was renamed accordingly.
|
|
|
/// However, when accessing this property's tag by its <see cref="MetadataTag"/> object,
|
|
|
/// the native FreeImage tag key <i>GeoTransformationMatrix</i> must be used.
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public double[] ModelTransformationMatrix
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<double>("GeoTransformationMatrix");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("GeoTransformationMatrix", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the GeoTIFF IntergraphTransformationMatrixTag.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// The IntergraphTransformationMatrixTag conflicts with an internal software implementation
|
|
|
/// at Intergraph, and so its use is no longer encouraged. A GeoTIFF reader should look first
|
|
|
/// for the new tag, and only if it is not found should it check for this older tag. If found,
|
|
|
/// it should only consider it to be contain valid GeoTIFF matrix information if the tag-count
|
|
|
/// is 16; the Intergraph version uses 17 values.
|
|
|
/// <para/>
|
|
|
/// <br/><b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public double[] IntergraphTransformationMatrix
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagArray<double>("Intergraph TransformationMatrix");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("Intergraph TransformationMatrix", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the GeoTIFF JPLCartoIFDOffsetTag.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public uint? JPLCartoIFDOffset
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<uint>("JPL Carto IFD offset");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("JPL Carto IFD offset", value);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents a collection of all tags contained in the metadata model
|
|
|
/// <see cref="FREE_IMAGE_MDMODEL.FIMD_IPTC"/>.
|
|
|
/// </summary>
|
|
|
public class MDM_IPTC : MetadataModel
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of this class.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
public MDM_IPTC(FIBITMAP dib) : base(dib) { }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the datamodel that this instance represents.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public override FREE_IMAGE_MDMODEL Model
|
|
|
{
|
|
|
get { return FREE_IMAGE_MDMODEL.FIMD_IPTC; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the Application Record Version.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public short? ApplicationRecordVersion
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagValue<short>("ApplicationRecordVersion");
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Object Type Reference.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ObjectTypeReference
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ObjectTypeReference");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ObjectTypeReference", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Object Attribute Reference.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ObjectAttributeReference
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ObjectAttributeReference");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ObjectAttributeReference", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Object Name.
|
|
|
/// This is also referred to as Title.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ObjectName
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ObjectName");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ObjectName", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Edit Status.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string EditStatus
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("EditStatus");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("EditStatus", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Editorial Update.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string EditorialUpdate
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("EditorialUpdate");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("EditorialUpdate", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Urgency.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string Urgency
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("Urgency");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("Urgency", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Subject Reference.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string SubjectReference
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("SubjectReference");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("SubjectReference", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Category.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string Category
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("Category");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("Category", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Supplemental Categories.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string SupplementalCategories
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("SupplementalCategories");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("SupplementalCategories", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Fixture Identifier.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string FixtureIdentifier
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("FixtureIdentifier");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("FixtureIdentifier", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Keywords.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string Keywords
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("Keywords");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("Keywords", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Content Location Code.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ContentLocationCode
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ContentLocationCode");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ContentLocationCode", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Content Location Name.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ContentLocationName
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ContentLocationName");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ContentLocationName", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Release Date.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ReleaseDate
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ReleaseDate");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ReleaseDate", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Release Time.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ReleaseTime
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ReleaseTime");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ReleaseTime", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Expiration Date.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ExpirationDate
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ExpirationDate");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ExpirationDate", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Expiration Time.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ExpirationTime
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ExpirationTime");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ExpirationTime", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Special Instructions.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string SpecialInstructions
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("SpecialInstructions");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("SpecialInstructions", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Action Advised.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ActionAdvised
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ActionAdvised");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ActionAdvised", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Reference Service.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ReferenceService
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ReferenceService");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ReferenceService", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Reference Date.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ReferenceDate
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ReferenceDate");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ReferenceDate", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Reference Number.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ReferenceNumber
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ReferenceNumber");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ReferenceNumber", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Date Created.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string DateCreated
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("DateCreated");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("DateCreated", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Time Created.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string TimeCreated
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("TimeCreated");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("TimeCreated", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Digital Creation Date.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string DigitalCreationDate
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("DigitalCreationDate");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("DigitalCreationDate", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Digital Creation Time.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string DigitalCreationTime
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("DigitalCreationTime");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("DigitalCreationTime", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Originating Program.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string OriginatingProgram
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("OriginatingProgram");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("OriginatingProgram", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Program Version.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ProgramVersion
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ProgramVersion");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ProgramVersion", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Object Cycle.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ObjectCycle
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ObjectCycle");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ObjectCycle", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag By Line.
|
|
|
/// This is the author's name.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ByLine
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("By-line");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("By-line", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag By Line Title.
|
|
|
/// This is the author's position.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ByLineTitle
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("By-lineTitle");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("By-lineTitle", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag City.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string City
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("City");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("City", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Sub Location.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string SubLocation
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("SubLocation");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("SubLocation", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Province State.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ProvinceState
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ProvinceState");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ProvinceState", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Country Primary Location Code.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string CountryPrimaryLocationCode
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("Country-PrimaryLocationCode");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("Country-PrimaryLocationCode", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Country Primary Location Name.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string CountryPrimaryLocationName
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("Country-PrimaryLocationName");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("Country-PrimaryLocationName", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Original Transmission Reference.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string OriginalTransmissionReference
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("OriginalTransmissionReference");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("OriginalTransmissionReference", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Headline.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string Headline
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("Headline");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("Headline", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Credit.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string Credit
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("Credit");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("Credit", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Source.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string Source
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("Source");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("Source", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Copyright Notice.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string CopyrightNotice
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("CopyrightNotice");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("CopyrightNotice", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Contact.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string Contact
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("Contact");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("Contact", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Caption Abstract.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string CaptionAbstract
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("CaptionAbstract");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("CaptionAbstract", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Writer Editor.
|
|
|
/// This is also referred to as Caption Writer.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string WriterEditor
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("WriterEditor");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("WriterEditor", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Rasterized Caption.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string RasterizedCaption
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("RasterizedCaption");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("RasterizedCaption", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Image Type.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ImageType
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ImageType");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ImageType", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Image Orientation.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ImageOrientation
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ImageOrientation");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ImageOrientation", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Language Identifier.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string LanguageIdentifier
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("LanguageIdentifier");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("LanguageIdentifier", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Audio Type.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string AudioType
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("AudioType");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("AudioType", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Audio Sampling Rate.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string AudioSamplingRate
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("AudioSamplingRate");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("AudioSamplingRate", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Audio Sampling Resolution.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string AudioSamplingResolution
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("AudioSamplingResolution");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("AudioSamplingResolution", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Audio Duration.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string AudioDuration
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("AudioDuration");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("AudioDuration", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Audio Outcue.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string AudioOutcue
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("AudioOutcue");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("AudioOutcue", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Job I D.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string JobID
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("JobID");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("JobID", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Master Document I D.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string MasterDocumentID
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("MasterDocumentID");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("MasterDocumentID", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Short Document I D.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ShortDocumentID
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ShortDocumentID");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ShortDocumentID", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Unique Document I D.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string UniqueDocumentID
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("UniqueDocumentID");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("UniqueDocumentID", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Owner I D.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string OwnerID
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("OwnerID");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("OwnerID", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Object Preview File Format.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ObjectPreviewFileFormat
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ObjectPreviewFileFormat");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ObjectPreviewFileFormat", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Object Preview File Version.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ObjectPreviewFileVersion
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ObjectPreviewFileVersion");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ObjectPreviewFileVersion", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Object Preview Data.
|
|
|
/// This is also referred to as Audio Outcue.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ObjectPreviewData
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ObjectPreviewData");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ObjectPreviewData", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Prefs.
|
|
|
/// This is also referred to as photo-mechanic preferences.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string Prefs
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("Prefs");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("Prefs", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Classify State.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ClassifyState
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ClassifyState");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ClassifyState", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Similarity Index.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string SimilarityIndex
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("SimilarityIndex");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("SimilarityIndex", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Document Notes.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string DocumentNotes
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("DocumentNotes");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("DocumentNotes", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Document History.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string DocumentHistory
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("DocumentHistory");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("DocumentHistory", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the IPTC/NAA tag Exif Camera Info.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string ExifCameraInfo
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("ExifCameraInfo");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("ExifCameraInfo", value);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents a collection of all tags contained in the metadata model
|
|
|
/// <see cref="FREE_IMAGE_MDMODEL.FIMD_NODATA"/>.
|
|
|
/// </summary>
|
|
|
public class MDM_NODATA : MetadataModel
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of this class.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
public MDM_NODATA(FIBITMAP dib) : base(dib) { }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the datamodel that this instance represents.
|
|
|
/// </summary>
|
|
|
public override FREE_IMAGE_MDMODEL Model
|
|
|
{
|
|
|
get { return FREE_IMAGE_MDMODEL.FIMD_NODATA; }
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Represents a collection of all tags contained in the metadata model
|
|
|
/// <see cref="FREE_IMAGE_MDMODEL.FIMD_XMP"/>.
|
|
|
/// </summary>
|
|
|
public class MDM_XMP : MetadataModel
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of this class.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
public MDM_XMP(FIBITMAP dib) : base(dib) { }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the datamodel that this instance represents.
|
|
|
/// </summary>
|
|
|
public override FREE_IMAGE_MDMODEL Model
|
|
|
{
|
|
|
get { return FREE_IMAGE_MDMODEL.FIMD_XMP; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the XMP XML content.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// <b>Handling of null values</b><para/>
|
|
|
/// A null value indicates, that the corresponding metadata tag is not
|
|
|
/// present in the metadata model.
|
|
|
/// Setting this property's value to a non-null reference creates the
|
|
|
/// metadata tag if necessary.
|
|
|
/// Setting this property's value to a null reference deletes the
|
|
|
/// metadata tag from the metadata model.
|
|
|
/// </remarks>
|
|
|
public string Xml
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return GetTagText("XMLPacket");
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetTagValue("XMLPacket", value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets an <see cref="XmlReader"/> initialized to read the XMP XML content.
|
|
|
/// Returns null, if the metadata tag <i>XMLPacket</i> is not present in
|
|
|
/// this model.
|
|
|
/// </summary>
|
|
|
public XmlReader XmlReader
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
string xmlString = Xml;
|
|
|
if (xmlString == null)
|
|
|
{
|
|
|
return null;
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
MemoryStream stream = new MemoryStream();
|
|
|
StreamWriter writer = new StreamWriter(stream);
|
|
|
writer.Write(xmlString);
|
|
|
return XmlReader.Create(stream);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
namespace FreeImageAPI.Metadata
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Manages metadata objects and operations.
|
|
|
/// </summary>
|
|
|
public sealed class MetadataTag : IComparable, IComparable<MetadataTag>, ICloneable, IEquatable<MetadataTag>, IDisposable
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The encapsulated FreeImage-tag.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
internal FITAG tag;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The metadata model of <see cref="tag"/>.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private FREE_IMAGE_MDMODEL model;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Indicates whether this instance has already been disposed.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private bool disposed = false;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Indicates whether this instance was created by FreeImage or
|
|
|
/// by the user.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private bool selfCreated;
|
|
|
|
|
|
/// <summary>
|
|
|
/// List linking metadata-model and Type.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private static readonly Dictionary<FREE_IMAGE_MDTYPE, Type> idList;
|
|
|
|
|
|
/// <summary>
|
|
|
/// List linking Type and metadata-model.
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private static readonly Dictionary<Type, FREE_IMAGE_MDTYPE> typeList;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of this class.
|
|
|
/// </summary>
|
|
|
private MetadataTag()
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of this class.
|
|
|
/// </summary>
|
|
|
/// <param name="model">The new model the tag should be of.</param>
|
|
|
public MetadataTag(FREE_IMAGE_MDMODEL model)
|
|
|
{
|
|
|
this.model = model;
|
|
|
tag = FreeImage.CreateTag();
|
|
|
selfCreated = true;
|
|
|
|
|
|
if (model == FREE_IMAGE_MDMODEL.FIMD_XMP)
|
|
|
{
|
|
|
Key = "XMLPacket";
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of this class.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The <see cref="FITAG"/> to represent.</param>
|
|
|
/// <param name="dib">The bitmap <paramref name="tag"/> was extracted from.</param>
|
|
|
public MetadataTag(FITAG tag, FIBITMAP dib)
|
|
|
{
|
|
|
if (tag.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("tag");
|
|
|
}
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
this.tag = tag;
|
|
|
model = GetModel(dib, tag);
|
|
|
selfCreated = false;
|
|
|
|
|
|
if (model == FREE_IMAGE_MDMODEL.FIMD_XMP)
|
|
|
{
|
|
|
Key = "XMLPacket";
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance of this class.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The <see cref="FITAG"/> to represent.</param>
|
|
|
/// <param name="model">The model of <paramref name="tag"/>.</param>
|
|
|
public MetadataTag(FITAG tag, FREE_IMAGE_MDMODEL model)
|
|
|
{
|
|
|
if (tag.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("tag");
|
|
|
}
|
|
|
this.tag = tag;
|
|
|
this.model = model;
|
|
|
selfCreated = false;
|
|
|
|
|
|
if (model == FREE_IMAGE_MDMODEL.FIMD_XMP)
|
|
|
{
|
|
|
Key = "XMLPacket";
|
|
|
}
|
|
|
}
|
|
|
|
|
|
static MetadataTag()
|
|
|
{
|
|
|
idList = new Dictionary<FREE_IMAGE_MDTYPE, Type>();
|
|
|
idList.Add(FREE_IMAGE_MDTYPE.FIDT_BYTE, typeof(byte));
|
|
|
idList.Add(FREE_IMAGE_MDTYPE.FIDT_SHORT, typeof(ushort));
|
|
|
idList.Add(FREE_IMAGE_MDTYPE.FIDT_LONG, typeof(uint));
|
|
|
idList.Add(FREE_IMAGE_MDTYPE.FIDT_RATIONAL, typeof(FIURational));
|
|
|
idList.Add(FREE_IMAGE_MDTYPE.FIDT_SBYTE, typeof(sbyte));
|
|
|
idList.Add(FREE_IMAGE_MDTYPE.FIDT_UNDEFINED, typeof(byte));
|
|
|
idList.Add(FREE_IMAGE_MDTYPE.FIDT_SSHORT, typeof(short));
|
|
|
idList.Add(FREE_IMAGE_MDTYPE.FIDT_SLONG, typeof(int));
|
|
|
idList.Add(FREE_IMAGE_MDTYPE.FIDT_SRATIONAL, typeof(FIRational));
|
|
|
idList.Add(FREE_IMAGE_MDTYPE.FIDT_FLOAT, typeof(float));
|
|
|
idList.Add(FREE_IMAGE_MDTYPE.FIDT_DOUBLE, typeof(double));
|
|
|
idList.Add(FREE_IMAGE_MDTYPE.FIDT_IFD, typeof(uint));
|
|
|
idList.Add(FREE_IMAGE_MDTYPE.FIDT_PALETTE, typeof(RGBQUAD));
|
|
|
|
|
|
typeList = new Dictionary<Type, FREE_IMAGE_MDTYPE>();
|
|
|
typeList.Add(typeof(ushort), FREE_IMAGE_MDTYPE.FIDT_SHORT);
|
|
|
typeList.Add(typeof(ushort[]), FREE_IMAGE_MDTYPE.FIDT_SHORT);
|
|
|
typeList.Add(typeof(string), FREE_IMAGE_MDTYPE.FIDT_ASCII);
|
|
|
typeList.Add(typeof(uint), FREE_IMAGE_MDTYPE.FIDT_LONG);
|
|
|
typeList.Add(typeof(uint[]), FREE_IMAGE_MDTYPE.FIDT_LONG);
|
|
|
typeList.Add(typeof(FIURational), FREE_IMAGE_MDTYPE.FIDT_RATIONAL);
|
|
|
typeList.Add(typeof(FIURational[]), FREE_IMAGE_MDTYPE.FIDT_RATIONAL);
|
|
|
typeList.Add(typeof(sbyte), FREE_IMAGE_MDTYPE.FIDT_SBYTE);
|
|
|
typeList.Add(typeof(sbyte[]), FREE_IMAGE_MDTYPE.FIDT_SBYTE);
|
|
|
typeList.Add(typeof(byte), FREE_IMAGE_MDTYPE.FIDT_BYTE);
|
|
|
typeList.Add(typeof(byte[]), FREE_IMAGE_MDTYPE.FIDT_BYTE);
|
|
|
typeList.Add(typeof(short), FREE_IMAGE_MDTYPE.FIDT_SSHORT);
|
|
|
typeList.Add(typeof(short[]), FREE_IMAGE_MDTYPE.FIDT_SSHORT);
|
|
|
typeList.Add(typeof(int), FREE_IMAGE_MDTYPE.FIDT_SLONG);
|
|
|
typeList.Add(typeof(int[]), FREE_IMAGE_MDTYPE.FIDT_SLONG);
|
|
|
typeList.Add(typeof(FIRational), FREE_IMAGE_MDTYPE.FIDT_SRATIONAL);
|
|
|
typeList.Add(typeof(FIRational[]), FREE_IMAGE_MDTYPE.FIDT_SRATIONAL);
|
|
|
typeList.Add(typeof(float), FREE_IMAGE_MDTYPE.FIDT_FLOAT);
|
|
|
typeList.Add(typeof(float[]), FREE_IMAGE_MDTYPE.FIDT_FLOAT);
|
|
|
typeList.Add(typeof(double), FREE_IMAGE_MDTYPE.FIDT_DOUBLE);
|
|
|
typeList.Add(typeof(double[]), FREE_IMAGE_MDTYPE.FIDT_DOUBLE);
|
|
|
typeList.Add(typeof(RGBQUAD), FREE_IMAGE_MDTYPE.FIDT_PALETTE);
|
|
|
typeList.Add(typeof(RGBQUAD[]), FREE_IMAGE_MDTYPE.FIDT_PALETTE);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Releases all resources used by the instance.
|
|
|
/// </summary>
|
|
|
~MetadataTag()
|
|
|
{
|
|
|
Dispose();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Determines whether two specified <see cref="MetadataTag"/> objects have the same value.
|
|
|
/// </summary>
|
|
|
/// <param name="left">A <see cref="MetadataTag"/> or a null reference (<b>Nothing</b> in Visual Basic).</param>
|
|
|
/// <param name="right">A <see cref="MetadataTag"/> or a null reference (<b>Nothing</b> in Visual Basic).</param>
|
|
|
/// <returns>
|
|
|
/// <b>true</b> if the value of left is the same as the value of right; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator ==(MetadataTag left, MetadataTag right)
|
|
|
{
|
|
|
// Check whether both are null
|
|
|
if ((object)left == (object)right)
|
|
|
{
|
|
|
return true;
|
|
|
}
|
|
|
else if ((object)left == null || (object)right == null)
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
left.CheckDisposed();
|
|
|
right.CheckDisposed();
|
|
|
// Check all properties
|
|
|
if ((left.Key != right.Key) ||
|
|
|
(left.ID != right.ID) ||
|
|
|
(left.Description != right.Description) ||
|
|
|
(left.Count != right.Count) ||
|
|
|
(left.Length != right.Length) ||
|
|
|
(left.Model != right.Model) ||
|
|
|
(left.Type != right.Type))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
if (left.Length == 0)
|
|
|
{
|
|
|
return true;
|
|
|
}
|
|
|
IntPtr ptr1 = FreeImage.GetTagValue(left.tag);
|
|
|
IntPtr ptr2 = FreeImage.GetTagValue(right.tag);
|
|
|
return FreeImage.CompareMemory(ptr1, ptr2, left.Length);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Determines whether two specified <see cref="MetadataTag"/> objects have different values.
|
|
|
/// </summary>
|
|
|
/// <param name="left">A <see cref="MetadataTag"/> or a null reference (<b>Nothing</b> in Visual Basic).</param>
|
|
|
/// <param name="right">A <see cref="MetadataTag"/> or a null reference (<b>Nothing</b> in Visual Basic).</param>
|
|
|
/// <returns>
|
|
|
/// true if the value of left is different from the value of right; otherwise, <b>false</b>.
|
|
|
/// </returns>
|
|
|
public static bool operator !=(MetadataTag left, MetadataTag right)
|
|
|
{
|
|
|
return !(left == right);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Extracts the value of a <see cref="MetadataTag"/> instance to a <see cref="FITAG"/> handle.
|
|
|
/// </summary>
|
|
|
/// <param name="value">A <see cref="MetadataTag"/> instance.</param>
|
|
|
/// <returns>A new instance of <see cref="FITAG"/> initialized to <paramref name="value"/>.</returns>
|
|
|
public static implicit operator FITAG(MetadataTag value)
|
|
|
{
|
|
|
return value.tag;
|
|
|
}
|
|
|
|
|
|
private static FREE_IMAGE_MDMODEL GetModel(FIBITMAP dib, FITAG tag)
|
|
|
{
|
|
|
FITAG value;
|
|
|
foreach (FREE_IMAGE_MDMODEL model in FreeImage.FREE_IMAGE_MDMODELS)
|
|
|
{
|
|
|
FIMETADATA mData = FreeImage.FindFirstMetadata(model, dib, out value);
|
|
|
if (mData.IsNull)
|
|
|
{
|
|
|
continue;
|
|
|
}
|
|
|
try
|
|
|
{
|
|
|
do
|
|
|
{
|
|
|
if (value == tag)
|
|
|
{
|
|
|
return model;
|
|
|
}
|
|
|
}
|
|
|
while (FreeImage.FindNextMetadata(mData, out value));
|
|
|
}
|
|
|
finally
|
|
|
{
|
|
|
if (!mData.IsNull)
|
|
|
{
|
|
|
FreeImage.FindCloseMetadata(mData);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
throw new ArgumentException("'tag' is no metadata object of 'dib'");
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the model of the metadata.
|
|
|
/// </summary>
|
|
|
public FREE_IMAGE_MDMODEL Model
|
|
|
{
|
|
|
get { CheckDisposed(); return model; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the key of the metadata.
|
|
|
/// </summary>
|
|
|
public string Key
|
|
|
{
|
|
|
get { CheckDisposed(); return FreeImage.GetTagKey(tag); }
|
|
|
set
|
|
|
{
|
|
|
CheckDisposed();
|
|
|
if ((model != FREE_IMAGE_MDMODEL.FIMD_XMP) || (value == "XMLPacket"))
|
|
|
{
|
|
|
FreeImage.SetTagKey(tag, value);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the description of the metadata.
|
|
|
/// </summary>
|
|
|
public string Description
|
|
|
{
|
|
|
get { CheckDisposed(); return FreeImage.GetTagDescription(tag); }
|
|
|
set { CheckDisposed(); FreeImage.SetTagDescription(tag, value); }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the ID of the metadata.
|
|
|
/// </summary>
|
|
|
public ushort ID
|
|
|
{
|
|
|
get { CheckDisposed(); return FreeImage.GetTagID(tag); }
|
|
|
set { CheckDisposed(); FreeImage.SetTagID(tag, value); }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the type of the metadata.
|
|
|
/// </summary>
|
|
|
public FREE_IMAGE_MDTYPE Type
|
|
|
{
|
|
|
get { CheckDisposed(); return FreeImage.GetTagType(tag); }
|
|
|
internal set { FreeImage.SetTagType(tag, value); }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the number of elements the metadata object contains.
|
|
|
/// </summary>
|
|
|
public uint Count
|
|
|
{
|
|
|
get { CheckDisposed(); return FreeImage.GetTagCount(tag); }
|
|
|
private set { FreeImage.SetTagCount(tag, value); }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the length of the value in bytes.
|
|
|
/// </summary>
|
|
|
public uint Length
|
|
|
{
|
|
|
get { CheckDisposed(); return FreeImage.GetTagLength(tag); }
|
|
|
private set { FreeImage.SetTagLength(tag, value); }
|
|
|
}
|
|
|
|
|
|
private unsafe byte[] GetData()
|
|
|
{
|
|
|
uint length = Length;
|
|
|
byte[] value = new byte[length];
|
|
|
byte* ptr = (byte*)FreeImage.GetTagValue(tag);
|
|
|
for (int i = 0; i < length; i++)
|
|
|
{
|
|
|
value[i] = ptr[i];
|
|
|
}
|
|
|
return value;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the value of the metadata.
|
|
|
/// </summary>
|
|
|
public object Value
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
unsafe
|
|
|
{
|
|
|
CheckDisposed();
|
|
|
int cnt = (int)Count;
|
|
|
|
|
|
if (Type == FREE_IMAGE_MDTYPE.FIDT_ASCII)
|
|
|
{
|
|
|
byte* value = (byte*)FreeImage.GetTagValue(tag);
|
|
|
StringBuilder sb = new StringBuilder();
|
|
|
for (int i = 0; i < cnt; i++)
|
|
|
{
|
|
|
sb.Append(Convert.ToChar(value[i]));
|
|
|
}
|
|
|
return sb.ToString();
|
|
|
}
|
|
|
else if (Type == FREE_IMAGE_MDTYPE.FIDT_NOTYPE)
|
|
|
{
|
|
|
return null;
|
|
|
}
|
|
|
|
|
|
Array array = Array.CreateInstance(idList[Type], Count);
|
|
|
void* src = (void*)FreeImage.GetTagValue(tag);
|
|
|
FreeImage.CopyMemory(array, src, Length);
|
|
|
return array;
|
|
|
}
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
SetValue(value);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the value of the metadata.
|
|
|
/// <para> In case value is of byte or byte[] <see cref="FREE_IMAGE_MDTYPE.FIDT_UNDEFINED"/> is assumed.</para>
|
|
|
/// <para> In case value is of uint or uint[] <see cref="FREE_IMAGE_MDTYPE.FIDT_LONG"/> is assumed.</para>
|
|
|
/// </summary>
|
|
|
/// <param name="value">New data of the metadata.</param>
|
|
|
/// <returns>True on success, false on failure.</returns>
|
|
|
/// <exception cref="NotSupportedException">
|
|
|
/// The data format is not supported.</exception>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="value"/> is null.</exception>
|
|
|
public bool SetValue(object value)
|
|
|
{
|
|
|
Type type = value.GetType();
|
|
|
if (!typeList.ContainsKey(type))
|
|
|
{
|
|
|
throw new NotSupportedException("The type of value is not supported");
|
|
|
}
|
|
|
return SetValue(value, typeList[type]);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the value of the metadata.
|
|
|
/// </summary>
|
|
|
/// <param name="value">New data of the metadata.</param>
|
|
|
/// <param name="type">Type of the data.</param>
|
|
|
/// <returns>True on success, false on failure.</returns>
|
|
|
/// <exception cref="NotSupportedException">
|
|
|
/// The data type is not supported.</exception>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="value"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// <paramref name="value"/> and <paramref name="type"/> to not fit.</exception>
|
|
|
public bool SetValue(object value, FREE_IMAGE_MDTYPE type)
|
|
|
{
|
|
|
CheckDisposed();
|
|
|
if ((!value.GetType().IsArray) && (!(value is string)))
|
|
|
{
|
|
|
Array array = Array.CreateInstance(value.GetType(), 1);
|
|
|
array.SetValue(value, 0);
|
|
|
return SetArrayValue(array, type);
|
|
|
}
|
|
|
return SetArrayValue(value, type);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the value of this tag to the value of <paramref name="value"/>
|
|
|
/// using the given type.
|
|
|
/// </summary>
|
|
|
/// <param name="value">New value of the tag.</param>
|
|
|
/// <param name="type">Data-type of the tag.</param>
|
|
|
/// <returns></returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="value"/> is a null reference.
|
|
|
/// </exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// <paramref name="type"/> is FIDT_ASCII and
|
|
|
/// <paramref name="value"/> is not String.
|
|
|
/// <paramref name="type"/> is not FIDT_ASCII and
|
|
|
/// <paramref name="value"/> is not Array.</exception>
|
|
|
/// <exception cref="NotSupportedException">
|
|
|
/// <paramref name="type"/> is FIDT_NOTYPE.</exception>
|
|
|
private unsafe bool SetArrayValue(object value, FREE_IMAGE_MDTYPE type)
|
|
|
{
|
|
|
if (value == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("value");
|
|
|
}
|
|
|
|
|
|
byte[] data = null;
|
|
|
|
|
|
if (type == FREE_IMAGE_MDTYPE.FIDT_ASCII)
|
|
|
{
|
|
|
string tempValue = value as string;
|
|
|
if (tempValue == null)
|
|
|
{
|
|
|
throw new ArgumentException("value");
|
|
|
}
|
|
|
Type = type;
|
|
|
Length = Count = (uint)tempValue.Length;
|
|
|
data = new byte[Length];
|
|
|
|
|
|
for (int i = 0; i < tempValue.Length; i++)
|
|
|
{
|
|
|
data[i] = (byte)tempValue[i];
|
|
|
}
|
|
|
}
|
|
|
else if (type == FREE_IMAGE_MDTYPE.FIDT_NOTYPE)
|
|
|
{
|
|
|
throw new NotSupportedException("type is not supported.");
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
Array array = value as Array;
|
|
|
if (array == null)
|
|
|
{
|
|
|
throw new ArgumentException("value");
|
|
|
}
|
|
|
|
|
|
if (array.Length != 0)
|
|
|
if (!CheckType(array.GetValue(0).GetType(), type))
|
|
|
throw new ArgumentException("The type of value is incorrect.");
|
|
|
|
|
|
Type = type;
|
|
|
Count = (uint)array.Length;
|
|
|
Length = (uint)(array.Length * Marshal.SizeOf(idList[type]));
|
|
|
data = new byte[Length];
|
|
|
FreeImage.CopyMemory(data, array, Length);
|
|
|
}
|
|
|
|
|
|
return FreeImage.SetTagValue(tag, data);
|
|
|
}
|
|
|
|
|
|
private static bool CheckType(Type dataType, FREE_IMAGE_MDTYPE type)
|
|
|
{
|
|
|
if (dataType != null)
|
|
|
switch (type)
|
|
|
{
|
|
|
case FREE_IMAGE_MDTYPE.FIDT_ASCII:
|
|
|
return dataType == typeof(string);
|
|
|
case FREE_IMAGE_MDTYPE.FIDT_BYTE:
|
|
|
return dataType == typeof(byte);
|
|
|
case FREE_IMAGE_MDTYPE.FIDT_DOUBLE:
|
|
|
return dataType == typeof(double);
|
|
|
case FREE_IMAGE_MDTYPE.FIDT_FLOAT:
|
|
|
return dataType == typeof(float);
|
|
|
case FREE_IMAGE_MDTYPE.FIDT_IFD:
|
|
|
return dataType == typeof(uint);
|
|
|
case FREE_IMAGE_MDTYPE.FIDT_LONG:
|
|
|
return dataType == typeof(uint);
|
|
|
case FREE_IMAGE_MDTYPE.FIDT_NOTYPE:
|
|
|
return false;
|
|
|
case FREE_IMAGE_MDTYPE.FIDT_PALETTE:
|
|
|
return dataType == typeof(RGBQUAD);
|
|
|
case FREE_IMAGE_MDTYPE.FIDT_RATIONAL:
|
|
|
return dataType == typeof(FIURational);
|
|
|
case FREE_IMAGE_MDTYPE.FIDT_SBYTE:
|
|
|
return dataType == typeof(sbyte);
|
|
|
case FREE_IMAGE_MDTYPE.FIDT_SHORT:
|
|
|
return dataType == typeof(ushort);
|
|
|
case FREE_IMAGE_MDTYPE.FIDT_SLONG:
|
|
|
return dataType == typeof(int);
|
|
|
case FREE_IMAGE_MDTYPE.FIDT_SRATIONAL:
|
|
|
return dataType == typeof(FIRational);
|
|
|
case FREE_IMAGE_MDTYPE.FIDT_SSHORT:
|
|
|
return dataType == typeof(short);
|
|
|
case FREE_IMAGE_MDTYPE.FIDT_UNDEFINED:
|
|
|
return dataType == typeof(byte);
|
|
|
}
|
|
|
return false;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Add this metadata to an image.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>True on success, false on failure.</returns>
|
|
|
public bool AddToImage(FIBITMAP dib)
|
|
|
{
|
|
|
CheckDisposed();
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
if (Key == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("Key");
|
|
|
}
|
|
|
if (!selfCreated)
|
|
|
{
|
|
|
tag = FreeImage.CloneTag(tag);
|
|
|
if (tag.IsNull)
|
|
|
{
|
|
|
throw new Exception("FreeImage.CloneTag() failed.");
|
|
|
}
|
|
|
selfCreated = true;
|
|
|
}
|
|
|
if (!FreeImage.SetMetadata(Model, dib, Key, tag))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
FREE_IMAGE_MDMODEL _model = Model;
|
|
|
string _key = Key;
|
|
|
selfCreated = false;
|
|
|
FreeImage.DeleteTag(tag);
|
|
|
return FreeImage.GetMetadata(_model, dib, _key, out tag);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a .NET PropertyItem for this metadata tag.
|
|
|
/// </summary>
|
|
|
/// <returns>The .NET PropertyItem.</returns>
|
|
|
public unsafe System.Drawing.Imaging.PropertyItem GetPropertyItem()
|
|
|
{
|
|
|
System.Drawing.Imaging.PropertyItem item = FreeImage.CreatePropertyItem();
|
|
|
item.Id = ID;
|
|
|
item.Len = (int)Length;
|
|
|
item.Type = (short)Type;
|
|
|
FreeImage.CopyMemory(item.Value = new byte[item.Len], FreeImage.GetTagValue(tag), item.Len);
|
|
|
return item;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts the value of the <see cref="MetadataTag"/> object
|
|
|
/// to its equivalent string representation.
|
|
|
/// </summary>
|
|
|
/// <returns>The string representation of the value of this instance.</returns>
|
|
|
public override string ToString()
|
|
|
{
|
|
|
CheckDisposed();
|
|
|
string fiString = FreeImage.TagToString(model, tag, 0);
|
|
|
|
|
|
if (String.IsNullOrEmpty(fiString))
|
|
|
{
|
|
|
return tag.ToString();
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
return fiString;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a deep copy of this <see cref="MetadataTag"/>.
|
|
|
/// </summary>
|
|
|
/// <returns>A deep copy of this <see cref="MetadataTag"/>.</returns>
|
|
|
public object Clone()
|
|
|
{
|
|
|
CheckDisposed();
|
|
|
MetadataTag clone = new MetadataTag();
|
|
|
clone.model = model;
|
|
|
clone.tag = FreeImage.CloneTag(tag);
|
|
|
clone.selfCreated = true;
|
|
|
return clone;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified object is a <see cref="MetadataTag"/> instance
|
|
|
/// and is equivalent to this <see cref="MetadataTag"/> instance.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">The object to test.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> is a <see cref="MetadataTag"/> instance
|
|
|
/// equivalent to this <see cref="MetadataTag"/> instance; otherwise, <b>false</b>.</returns>
|
|
|
public override bool Equals(object obj)
|
|
|
{
|
|
|
return ((obj is MetadataTag) && (Equals((MetadataTag)obj)));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tests whether the specified <see cref="MetadataTag"/> instance is equivalent to this <see cref="MetadataTag"/> instance.
|
|
|
/// </summary>
|
|
|
/// <param name="other">A <see cref="MetadataTag"/> instance to compare to this instance.</param>
|
|
|
/// <returns><b>true</b> if <paramref name="obj"/> equivalent to this <see cref="MetadataTag"/> instance;
|
|
|
/// otherwise, <b>false</b>.</returns>
|
|
|
public bool Equals(MetadataTag other)
|
|
|
{
|
|
|
return (this == other);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a hash code for this <see cref="MetadataTag"/> structure.
|
|
|
/// </summary>
|
|
|
/// <returns>An integer value that specifies the hash code for this <see cref="MetadataTag"/>.</returns>
|
|
|
public override int GetHashCode()
|
|
|
{
|
|
|
return tag.GetHashCode();
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares this instance with a specified <see cref="Object"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="obj">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer indicating the lexical relationship between the two comparands.</returns>
|
|
|
/// <exception cref="ArgumentException"><paramref name="obj"/> is not a <see cref="MetadataTag"/>.</exception>
|
|
|
public int CompareTo(object obj)
|
|
|
{
|
|
|
if (obj == null)
|
|
|
{
|
|
|
return 1;
|
|
|
}
|
|
|
if (!(obj is MetadataTag))
|
|
|
{
|
|
|
throw new ArgumentException("obj");
|
|
|
}
|
|
|
return CompareTo((MetadataTag)obj);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares the current instance with another object of the same type.
|
|
|
/// </summary>
|
|
|
/// <param name="other">An object to compare with this instance.</param>
|
|
|
/// <returns>A 32-bit signed integer that indicates the relative order of the objects being compared.</returns>
|
|
|
public int CompareTo(MetadataTag other)
|
|
|
{
|
|
|
CheckDisposed();
|
|
|
other.CheckDisposed();
|
|
|
return tag.CompareTo(other.tag);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Releases all resources used by the instance.
|
|
|
/// </summary>
|
|
|
public void Dispose()
|
|
|
{
|
|
|
if (!disposed)
|
|
|
{
|
|
|
disposed = true;
|
|
|
if (selfCreated)
|
|
|
{
|
|
|
FreeImage.DeleteTag(tag);
|
|
|
tag = FITAG.Zero;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets whether this instance has already been disposed.
|
|
|
/// </summary>
|
|
|
public bool Disposed
|
|
|
{
|
|
|
get { return disposed; }
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Throwns an <see cref="ObjectDisposedException"/> in case
|
|
|
/// this instance has already been disposed.
|
|
|
/// </summary>
|
|
|
private void CheckDisposed()
|
|
|
{
|
|
|
if (disposed)
|
|
|
{
|
|
|
throw new ObjectDisposedException("The object has already been disposed.");
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Provides methods for working with the standard bitmap palette.
|
|
|
/// </summary>
|
|
|
public sealed class Palette : MemoryArray<RGBQUAD>
|
|
|
{
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private GCHandle paletteHandle;
|
|
|
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private RGBQUAD[] array;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance for the given FreeImage bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="dib"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException"><paramref name="dib"/> is not
|
|
|
/// <see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/><para/>-or-<para/>
|
|
|
/// <paramref name="dib"/> has more than 8bpp.</exception>
|
|
|
public Palette(FIBITMAP dib)
|
|
|
: base(FreeImage.GetPalette(dib), (int)FreeImage.GetColorsUsed(dib))
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
if (FreeImage.GetImageType(dib) != FREE_IMAGE_TYPE.FIT_BITMAP)
|
|
|
{
|
|
|
throw new ArgumentException("dib");
|
|
|
}
|
|
|
if (FreeImage.GetBPP(dib) > 8u)
|
|
|
{
|
|
|
throw new ArgumentException("dib");
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance for the given FITAG that contains
|
|
|
/// a palette.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag containing the palette.</param>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="tag"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException"><paramref name="tag"/> is not
|
|
|
/// <see cref="FREE_IMAGE_MDTYPE.FIDT_PALETTE"/>.</exception>
|
|
|
public Palette(FITAG tag)
|
|
|
: base(FreeImage.GetTagValue(tag), (int)FreeImage.GetTagCount(tag))
|
|
|
{
|
|
|
if (FreeImage.GetTagType(tag) != FREE_IMAGE_MDTYPE.FIDT_PALETTE)
|
|
|
{
|
|
|
throw new ArgumentException("tag");
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance for the given MetadataTag that contains
|
|
|
/// a palette.
|
|
|
/// </summary>
|
|
|
/// <param name="tag">The tag containing the palette.</param>
|
|
|
/// <exception cref="ArgumentNullException"><paramref name="dib"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException"><paramref name="tag"/> is not
|
|
|
/// <see cref="FREE_IMAGE_MDTYPE.FIDT_PALETTE"/>.</exception>
|
|
|
public Palette(MetadataTag tag)
|
|
|
: base(FreeImage.GetTagValue(tag.tag), (int)tag.Count)
|
|
|
{
|
|
|
if (FreeImage.GetTagType(tag) != FREE_IMAGE_MDTYPE.FIDT_PALETTE)
|
|
|
{
|
|
|
throw new ArgumentException("tag");
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance for the given array of <see cref="RGBQUAD"/> that contains
|
|
|
/// a palette.
|
|
|
/// </summary>
|
|
|
/// <param name="palette">A RGBQUAD array containing the palette data to initialize this instance.</param>
|
|
|
public Palette(RGBQUAD[] palette)
|
|
|
{
|
|
|
unsafe
|
|
|
{
|
|
|
this.array = (RGBQUAD[])palette.Clone();
|
|
|
this.paletteHandle = GCHandle.Alloc(array, GCHandleType.Pinned);
|
|
|
|
|
|
base.baseAddress = (byte*)this.paletteHandle.AddrOfPinnedObject();
|
|
|
base.length = (int)this.array.Length;
|
|
|
|
|
|
// Create an array containing a single element.
|
|
|
// Due to the fact, that it's not possible to create pointers
|
|
|
// of generic types, an array is used to obtain the memory
|
|
|
// address of an element of T.
|
|
|
base.buffer = new RGBQUAD[1];
|
|
|
// The array is pinned immediately to prevent the GC from
|
|
|
// moving it to a different position in memory.
|
|
|
base.handle = GCHandle.Alloc(buffer, GCHandleType.Pinned);
|
|
|
// The array and its content have beed pinned, so that its address
|
|
|
// can be safely requested and stored for the whole lifetime
|
|
|
// of the instace.
|
|
|
base.ptr = (byte*)base.handle.AddrOfPinnedObject();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance for the given array of <see cref="Color"/> that contains
|
|
|
/// a palette.
|
|
|
/// </summary>
|
|
|
/// <param name="palette">A Color array containing the palette data to initialize this instance.</param>
|
|
|
public Palette(Color[] palette)
|
|
|
: this(RGBQUAD.ToRGBQUAD(palette))
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance with the specified size.
|
|
|
/// </summary>
|
|
|
/// <param name="size">The size of the palette.</param>
|
|
|
public Palette(int size)
|
|
|
: this(new RGBQUAD[size])
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets or sets the palette through an array of <see cref="RGBQUAD"/>.
|
|
|
/// </summary>
|
|
|
public RGBQUAD[] AsArray
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return Data;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
Data = value;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Get an array of <see cref="System.Drawing.Color"/> that the block of memory represents.
|
|
|
/// This property is used for internal palette operations.
|
|
|
/// </summary>
|
|
|
internal unsafe Color[] ColorData
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
Color[] data = new Color[length];
|
|
|
for (int i = 0; i < length; i++)
|
|
|
{
|
|
|
data[i] = Color.FromArgb((int)(((uint*)baseAddress)[i] | 0xFF000000));
|
|
|
}
|
|
|
return data;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the palette as an array of <see cref="RGBQUAD"/>.
|
|
|
/// </summary>
|
|
|
/// <returns>The palette as an array of <see cref="RGBQUAD"/>.</returns>
|
|
|
public RGBQUAD[] ToArray()
|
|
|
{
|
|
|
return Data;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a linear palette based on the provided <paramref name="color"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="color">The <see cref="System.Drawing.Color"/> used to colorize the palette.</param>
|
|
|
/// <remarks>
|
|
|
/// Only call this method on linear palettes.
|
|
|
/// </remarks>
|
|
|
public void Colorize(Color color)
|
|
|
{
|
|
|
Colorize(color, 0.5d);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a linear palette based on the provided <paramref name="color"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="color">The <see cref="System.Drawing.Color"/> used to colorize the palette.</param>
|
|
|
/// <param name="splitSize">The position of the color within the new palette.
|
|
|
/// 0 < <paramref name="splitSize"/> < 1.</param>
|
|
|
/// <remarks>
|
|
|
/// Only call this method on linear palettes.
|
|
|
/// </remarks>
|
|
|
public void Colorize(Color color, double splitSize)
|
|
|
{
|
|
|
Colorize(color, (int)(length * splitSize));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a linear palette based on the provided <paramref name="color"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="color">The <see cref="System.Drawing.Color"/> used to colorize the palette.</param>
|
|
|
/// <param name="splitSize">The position of the color within the new palette.
|
|
|
/// 0 < <paramref name="splitSize"/> < <see cref="MemoryArray<T>.Length"/>.</param>
|
|
|
/// <remarks>
|
|
|
/// Only call this method on linear palettes.
|
|
|
/// </remarks>
|
|
|
public void Colorize(Color color, int splitSize)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (splitSize < 1 || splitSize >= length)
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("splitSize");
|
|
|
}
|
|
|
|
|
|
RGBQUAD[] pal = new RGBQUAD[length];
|
|
|
|
|
|
double red = color.R;
|
|
|
double green = color.G;
|
|
|
double blue = color.B;
|
|
|
|
|
|
int i = 0;
|
|
|
double r, g, b;
|
|
|
|
|
|
r = red / splitSize;
|
|
|
g = green / splitSize;
|
|
|
b = blue / splitSize;
|
|
|
|
|
|
for (; i <= splitSize; i++)
|
|
|
{
|
|
|
pal[i].rgbRed = (byte)(i * r);
|
|
|
pal[i].rgbGreen = (byte)(i * g);
|
|
|
pal[i].rgbBlue = (byte)(i * b);
|
|
|
}
|
|
|
|
|
|
r = (255 - red) / (length - splitSize);
|
|
|
g = (255 - green) / (length - splitSize);
|
|
|
b = (255 - blue) / (length - splitSize);
|
|
|
|
|
|
for (; i < length; i++)
|
|
|
{
|
|
|
pal[i].rgbRed = (byte)(red + ((i - splitSize) * r));
|
|
|
pal[i].rgbGreen = (byte)(green + ((i - splitSize) * g));
|
|
|
pal[i].rgbBlue = (byte)(blue + ((i - splitSize) * b));
|
|
|
}
|
|
|
|
|
|
Data = pal;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a linear grayscale palette.
|
|
|
/// </summary>
|
|
|
public void CreateGrayscalePalette()
|
|
|
{
|
|
|
Colorize(Color.White, length - 1);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a linear grayscale palette.
|
|
|
/// </summary>
|
|
|
/// <param name="inverse"><b>true</b> to create an inverse grayscale palette.</param>
|
|
|
public void CreateGrayscalePalette(bool inverse)
|
|
|
{
|
|
|
Colorize(Color.White, inverse ? 0 : length - 1);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a linear palette with the specified <see cref="Color"/>.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// A linear grayscale palette contains all shades of colors from
|
|
|
/// black to white. This method creates a similar palette with the white
|
|
|
/// color being replaced by the specified color.
|
|
|
/// </remarks>
|
|
|
/// <param name="color">The <see cref="Color"/> used to create the palette.</param>
|
|
|
/// <param name="inverse"><b>true</b> to create an inverse palette.</param>
|
|
|
public void CreateGrayscalePalette(Color color, bool inverse)
|
|
|
{
|
|
|
Colorize(color, inverse ? 0 : length - 1);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Reverses the palette.
|
|
|
/// </summary>
|
|
|
public void Reverse()
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (array != null)
|
|
|
{
|
|
|
Array.Reverse(array);
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
RGBQUAD[] localArray = Data;
|
|
|
Array.Reverse(localArray);
|
|
|
Data = localArray;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies the values from the specified <see cref="Palette"/> to this instance.
|
|
|
/// </summary>
|
|
|
/// <param name="palette">The palette to copy from.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="palette"/> is a null reference.</exception>
|
|
|
public void CopyFrom(Palette palette)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
if (palette == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("palette");
|
|
|
}
|
|
|
CopyFrom(palette.Data, 0, 0, Math.Min(palette.Length, this.Length));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies the values from the specified <see cref="Palette"/> to this instance,
|
|
|
/// starting at the specified <paramref name="offset"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="palette">The palette to copy from.</param>
|
|
|
/// <param name="offset">The position in this instance where the values
|
|
|
/// will be copied to.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="palette"/> is a null reference.</exception>
|
|
|
/// <exception cref="ArgumentOutOfRangeException">
|
|
|
/// <paramref name="offset"/> is outside the range of valid indexes.</exception>
|
|
|
public void CopyFrom(Palette palette, int offset)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
CopyFrom(palette.Data, 0, offset, Math.Min(palette.Length, this.Length - offset));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves this <see cref="Palette"/> to the specified file.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">
|
|
|
/// A string that contains the name of the file to which to save this <see cref="Palette"/>.
|
|
|
/// </param>
|
|
|
public void Save(string filename)
|
|
|
{
|
|
|
using (Stream stream = new FileStream(filename, FileMode.Create, FileAccess.Write))
|
|
|
{
|
|
|
Save(stream);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves this <see cref="Palette"/> to the specified stream.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">
|
|
|
/// The <see cref="Stream"/> where the image will be saved.
|
|
|
/// </param>
|
|
|
public void Save(Stream stream)
|
|
|
{
|
|
|
Save(new BinaryWriter(stream));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves this <see cref="Palette"/> using the specified writer.
|
|
|
/// </summary>
|
|
|
/// <param name="writer">
|
|
|
/// The <see cref="BinaryWriter"/> used to save the image.
|
|
|
/// </param>
|
|
|
public void Save(BinaryWriter writer)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
writer.Write(ToByteArray());
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a palette from the specified file.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The name of the palette file.</param>
|
|
|
public void Load(string filename)
|
|
|
{
|
|
|
using (Stream stream = new FileStream(filename, FileMode.Open, FileAccess.Read))
|
|
|
{
|
|
|
Load(stream);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a palette from the specified stream.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">The stream to load the palette from.</param>
|
|
|
public void Load(Stream stream)
|
|
|
{
|
|
|
Load(new BinaryReader(stream));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a palette from the reader.
|
|
|
/// </summary>
|
|
|
/// <param name="reader">The reader to load the palette from.</param>
|
|
|
public void Load(BinaryReader reader)
|
|
|
{
|
|
|
EnsureNotDisposed();
|
|
|
unsafe
|
|
|
{
|
|
|
int size = length * sizeof(RGBQUAD);
|
|
|
byte[] data = reader.ReadBytes(size);
|
|
|
fixed (byte* src = data)
|
|
|
{
|
|
|
CopyMemory(baseAddress, src, data.Length);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Releases allocated handles associated with this instance.
|
|
|
/// </summary>
|
|
|
/// <param name="disposing"><b>true</b> to release managed resources.</param>
|
|
|
protected override void Dispose(bool disposing)
|
|
|
{
|
|
|
if (paletteHandle.IsAllocated)
|
|
|
paletteHandle.Free();
|
|
|
array = null;
|
|
|
|
|
|
base.Dispose(disposing);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI.Plugins
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Class representing all registered <see cref="FreeImageAPI.Plugins.FreeImagePlugin"/> in FreeImage.
|
|
|
/// </summary>
|
|
|
public static class PluginRepository
|
|
|
{
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private static readonly List<FreeImagePlugin> plugins = null;
|
|
|
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private static readonly List<FreeImagePlugin> localPlugins = null;
|
|
|
|
|
|
static PluginRepository()
|
|
|
{
|
|
|
plugins = new List<FreeImagePlugin>(FreeImage.GetFIFCount());
|
|
|
localPlugins = new List<FreeImagePlugin>(0);
|
|
|
for (int i = 0; i < plugins.Capacity; i++)
|
|
|
{
|
|
|
plugins.Add(new FreeImagePlugin((FREE_IMAGE_FORMAT)i));
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adds local plugin to this class.
|
|
|
/// </summary>
|
|
|
/// <param name="localPlugin">The registered plugin.</param>
|
|
|
internal static void RegisterLocalPlugin(LocalPlugin localPlugin)
|
|
|
{
|
|
|
FreeImagePlugin plugin = new FreeImagePlugin(localPlugin.Format);
|
|
|
plugins.Add(plugin);
|
|
|
localPlugins.Add(plugin);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns an instance of <see cref="FreeImageAPI.Plugins.FreeImagePlugin"/>, representing the given format.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">The representing format.</param>
|
|
|
/// <returns>An instance of <see cref="FreeImageAPI.Plugins.FreeImagePlugin"/>.</returns>
|
|
|
public static FreeImagePlugin Plugin(FREE_IMAGE_FORMAT fif)
|
|
|
{
|
|
|
return Plugin((int)fif);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns an instance of <see cref="FreeImageAPI.Plugins.FreeImagePlugin"/>,
|
|
|
/// representing the format at the given index.
|
|
|
/// </summary>
|
|
|
/// <param name="index">The index of the representing format.</param>
|
|
|
/// <returns>An instance of <see cref="FreeImagePlugin"/>.</returns>
|
|
|
public static FreeImagePlugin Plugin(int index)
|
|
|
{
|
|
|
return (index >= 0) ? plugins[index] : null;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns an instance of <see cref="FreeImageAPI.Plugins.FreeImagePlugin"/>.
|
|
|
/// <typeparamref name="expression"/> is searched in:
|
|
|
/// <c>Format</c>, <c>RegExpr</c>,
|
|
|
/// <c>ValidExtension</c> and <c>ValidFilename</c>.
|
|
|
/// </summary>
|
|
|
/// <param name="expression">The expression to search for.</param>
|
|
|
/// <returns>An instance of <see cref="FreeImageAPI.Plugins.FreeImagePlugin"/>.</returns>
|
|
|
public static FreeImagePlugin Plugin(string expression)
|
|
|
{
|
|
|
FreeImagePlugin result = null;
|
|
|
expression = expression.ToLower();
|
|
|
|
|
|
foreach (FreeImagePlugin plugin in plugins)
|
|
|
{
|
|
|
if (plugin.Format.ToLower().Contains(expression) ||
|
|
|
plugin.RegExpr.ToLower().Contains(expression) ||
|
|
|
plugin.ValidExtension(expression, StringComparison.CurrentCultureIgnoreCase) ||
|
|
|
plugin.ValidFilename(expression, StringComparison.CurrentCultureIgnoreCase))
|
|
|
{
|
|
|
result = plugin;
|
|
|
break;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns an instance of <see cref="FreeImageAPI.Plugins.FreeImagePlugin"/> for the given format.
|
|
|
/// </summary>
|
|
|
/// <param name="format">The format of the Plugin.</param>
|
|
|
/// <returns>An instance of <see cref="FreeImageAPI.Plugins.FreeImagePlugin"/>.</returns>
|
|
|
public static FreeImagePlugin PluginFromFormat(string format)
|
|
|
{
|
|
|
return Plugin(FreeImage.GetFIFFromFormat(format));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns an instance of <see cref="FreeImageAPI.Plugins.FreeImagePlugin"/> for the given filename.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The valid filename for the plugin.</param>
|
|
|
/// <returns>An instance of <see cref="FreeImageAPI.Plugins.FreeImagePlugin"/>.</returns>
|
|
|
public static FreeImagePlugin PluginFromFilename(string filename)
|
|
|
{
|
|
|
return Plugin(FreeImage.GetFIFFromFilename(filename));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns an instance of <see cref="FreeImageAPI.Plugins.FreeImagePlugin"/> for the given mime.
|
|
|
/// </summary>
|
|
|
/// <param name="mime">The valid mime for the plugin.</param>
|
|
|
/// <returns>An instance of <see cref="FreeImageAPI.Plugins.FreeImagePlugin"/>.</returns>
|
|
|
public static FreeImagePlugin PluginFromMime(string mime)
|
|
|
{
|
|
|
return Plugin(FreeImage.GetFIFFromMime(mime));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets the number of registered plugins.
|
|
|
/// </summary>
|
|
|
public static int FIFCount
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return FreeImage.GetFIFCount();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a readonly collection of all plugins.
|
|
|
/// </summary>
|
|
|
public static ReadOnlyCollection<FreeImagePlugin> PluginList
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return plugins.AsReadOnly();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a list of plugins that are only able to
|
|
|
/// read but not to write.
|
|
|
/// </summary>
|
|
|
public static List<FreeImagePlugin> ReadOnlyPlugins
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
List<FreeImagePlugin> list = new List<FreeImagePlugin>();
|
|
|
foreach (FreeImagePlugin p in plugins)
|
|
|
{
|
|
|
if (p.SupportsReading && !p.SupportsWriting)
|
|
|
{
|
|
|
list.Add(p);
|
|
|
}
|
|
|
}
|
|
|
return list;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a list of plugins that are only able to
|
|
|
/// write but not to read.
|
|
|
/// </summary>
|
|
|
public static List<FreeImagePlugin> WriteOnlyPlugins
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
List<FreeImagePlugin> list = new List<FreeImagePlugin>();
|
|
|
foreach (FreeImagePlugin p in plugins)
|
|
|
{
|
|
|
if (!p.SupportsReading && p.SupportsWriting)
|
|
|
{
|
|
|
list.Add(p);
|
|
|
}
|
|
|
}
|
|
|
return list;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a list of plugins that are not able to
|
|
|
/// read or write.
|
|
|
/// </summary>
|
|
|
public static List<FreeImagePlugin> StupidPlugins
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
List<FreeImagePlugin> list = new List<FreeImagePlugin>();
|
|
|
foreach (FreeImagePlugin p in plugins)
|
|
|
{
|
|
|
if (!p.SupportsReading && !p.SupportsWriting)
|
|
|
{
|
|
|
list.Add(p);
|
|
|
}
|
|
|
}
|
|
|
return list;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a list of plugins that are able to read.
|
|
|
/// </summary>
|
|
|
public static List<FreeImagePlugin> ReadablePlugins
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
List<FreeImagePlugin> list = new List<FreeImagePlugin>();
|
|
|
foreach (FreeImagePlugin p in plugins)
|
|
|
{
|
|
|
if (p.SupportsReading)
|
|
|
{
|
|
|
list.Add(p);
|
|
|
}
|
|
|
}
|
|
|
return list;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a list of plugins that are able to write.
|
|
|
/// </summary>
|
|
|
public static List<FreeImagePlugin> WriteablePlugins
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
List<FreeImagePlugin> list = new List<FreeImagePlugin>();
|
|
|
foreach (FreeImagePlugin p in plugins)
|
|
|
{
|
|
|
if (p.SupportsWriting)
|
|
|
{
|
|
|
list.Add(p);
|
|
|
}
|
|
|
}
|
|
|
return list;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a list of local plugins.
|
|
|
/// </summary>
|
|
|
public static ReadOnlyCollection<FreeImagePlugin> LocalPlugins
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
return localPlugins.AsReadOnly();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Gets a list of built-in plugins.
|
|
|
/// </summary>
|
|
|
public static List<FreeImagePlugin> BuiltInPlugins
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
List<FreeImagePlugin> list = new List<FreeImagePlugin>();
|
|
|
foreach (FreeImagePlugin p in plugins)
|
|
|
{
|
|
|
if (!localPlugins.Contains(p))
|
|
|
{
|
|
|
list.Add(p);
|
|
|
}
|
|
|
}
|
|
|
return list;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Windows or OS/2 Bitmap File (*.BMP)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin BMP { get { return plugins[0]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Independent JPEG Group (*.JPG, *.JIF, *.JPEG, *.JPE)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin ICO { get { return plugins[1]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Independent JPEG Group (*.JPG, *.JIF, *.JPEG, *.JPE)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin JPEG { get { return plugins[2]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// JPEG Network Graphics (*.JNG)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin JNG { get { return plugins[3]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Commodore 64 Koala format (*.KOA)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin KOALA { get { return plugins[4]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Amiga IFF (*.IFF, *.LBM)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin LBM { get { return plugins[5]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Amiga IFF (*.IFF, *.LBM)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin IFF { get { return plugins[5]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Multiple Network Graphics (*.MNG)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin MNG { get { return plugins[6]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Portable Bitmap (ASCII) (*.PBM)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin PBM { get { return plugins[7]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Portable Bitmap (BINARY) (*.PBM)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin PBMRAW { get { return plugins[8]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Kodak PhotoCD (*.PCD)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin PCD { get { return plugins[9]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Zsoft Paintbrush PCX bitmap format (*.PCX)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin PCX { get { return plugins[10]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Portable Graymap (ASCII) (*.PGM)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin PGM { get { return plugins[11]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Portable Graymap (BINARY) (*.PGM)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin PGMRAW { get { return plugins[12]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Portable Network Graphics (*.PNG)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin PNG { get { return plugins[13]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Portable Pixelmap (ASCII) (*.PPM)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin PPM { get { return plugins[14]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Portable Pixelmap (BINARY) (*.PPM)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin PPMRAW { get { return plugins[15]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sun Rasterfile (*.RAS)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin RAS { get { return plugins[16]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// truevision Targa files (*.TGA, *.TARGA)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin TARGA { get { return plugins[17]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tagged Image File Format (*.TIF, *.TIFF)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin TIFF { get { return plugins[18]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Wireless Bitmap (*.WBMP)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin WBMP { get { return plugins[19]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Adobe Photoshop (*.PSD)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin PSD { get { return plugins[20]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Dr. Halo (*.CUT)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin CUT { get { return plugins[21]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// X11 Bitmap Format (*.XBM)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin XBM { get { return plugins[22]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// X11 Pixmap Format (*.XPM)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin XPM { get { return plugins[23]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// DirectDraw Surface (*.DDS)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin DDS { get { return plugins[24]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Graphics Interchange Format (*.GIF)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin GIF { get { return plugins[25]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// High Dynamic Range (*.HDR)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin HDR { get { return plugins[26]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Raw Fax format CCITT G3 (*.G3)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin FAXG3 { get { return plugins[27]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Silicon Graphics SGI image format (*.SGI)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin SGI { get { return plugins[28]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// OpenEXR format (*.EXR)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin EXR { get { return plugins[29]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// JPEG-2000 format (*.J2K, *.J2C)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin J2K { get { return plugins[30]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// JPEG-2000 format (*.JP2)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin JP2 { get { return plugins[31]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Portable FloatMap (*.PFM)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin PFM { get { return plugins[32]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// Macintosh PICT (*.PICT)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin PICT { get { return plugins[33]; } }
|
|
|
|
|
|
/// <summary>
|
|
|
/// RAW camera image (*.*)
|
|
|
/// </summary>
|
|
|
public static FreeImagePlugin RAW { get { return plugins[34]; } }
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Provides methods for working with generic bitmap scanlines.
|
|
|
/// </summary>
|
|
|
/// <typeparam name="T">Type of the bitmaps' scanlines.</typeparam>
|
|
|
public sealed class Scanline<T> : MemoryArray<T> where T : struct
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified FreeImage bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
public Scanline(FIBITMAP dib)
|
|
|
: this(dib, 0)
|
|
|
{
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified FreeImage bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="scanline">Index of the zero based scanline.</param>
|
|
|
public Scanline(FIBITMAP dib, int scanline)
|
|
|
: this(dib, scanline, (int)(typeof(T) == typeof(FI1BIT) ?
|
|
|
FreeImage.GetBPP(dib) * FreeImage.GetWidth(dib) :
|
|
|
typeof(T) == typeof(FI4BIT) ?
|
|
|
FreeImage.GetBPP(dib) * FreeImage.GetWidth(dib) / 4 :
|
|
|
(FreeImage.GetBPP(dib) * FreeImage.GetWidth(dib)) / (Marshal.SizeOf(typeof(T)) * 8)))
|
|
|
{
|
|
|
}
|
|
|
|
|
|
internal Scanline(FIBITMAP dib, int scanline, int length)
|
|
|
: base(FreeImage.GetScanLine(dib, scanline), length)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
if ((scanline < 0) || (scanline >= FreeImage.GetHeight(dib)))
|
|
|
{
|
|
|
throw new ArgumentOutOfRangeException("scanline");
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI.IO
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Class wrapping streams, implementing a buffer for read data,
|
|
|
/// so that seek operations can be made.
|
|
|
/// </summary>
|
|
|
/// <remarks>
|
|
|
/// FreeImage can load bitmaps from arbitrary sources.
|
|
|
/// .NET works with different streams like File- or NetConnection-strams.
|
|
|
/// NetConnection streams, which are used to load files from web servers,
|
|
|
/// for example cannot seek.
|
|
|
/// But FreeImage frequently uses the seek operation when loading bitmaps.
|
|
|
/// <b>StreamWrapper</b> wrapps a stream and makes it seekable by caching all read
|
|
|
/// data into an internal MemoryStream to jump back- and forward.
|
|
|
/// StreamWapper is for internal use and only for loading from streams.
|
|
|
/// </remarks>
|
|
|
internal class StreamWrapper : Stream
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The stream to wrap
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private readonly Stream stream;
|
|
|
|
|
|
/// <summary>
|
|
|
/// The caching stream
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private MemoryStream memoryStream = new MemoryStream();
|
|
|
|
|
|
/// <summary>
|
|
|
/// Indicates if the wrapped stream reached its end
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private bool eos = false;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Tells the wrapper to block readings or not
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private bool blocking = false;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Indicates if the wrapped stream is disposed or not
|
|
|
/// </summary>
|
|
|
[DebuggerBrowsable(DebuggerBrowsableState.Never)]
|
|
|
private bool disposed = false;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Initializes a new instance based on the specified <see cref="Stream"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">The stream to wrap.</param>
|
|
|
/// <param name="blocking">When true the wrapper always tries to read the requested
|
|
|
/// amount of data from the wrapped stream.</param>
|
|
|
public StreamWrapper(Stream stream, bool blocking)
|
|
|
{
|
|
|
if (!stream.CanRead)
|
|
|
{
|
|
|
throw new ArgumentException("stream is not capable of reading.");
|
|
|
}
|
|
|
this.stream = stream;
|
|
|
this.blocking = blocking;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Releases all resources used by the instance.
|
|
|
/// </summary>
|
|
|
~StreamWrapper()
|
|
|
{
|
|
|
Dispose(false);
|
|
|
}
|
|
|
|
|
|
// The wrapper only accepts readable streams
|
|
|
public override bool CanRead
|
|
|
{
|
|
|
get { checkDisposed(); return true; }
|
|
|
}
|
|
|
|
|
|
// We implement that feature
|
|
|
public override bool CanSeek
|
|
|
{
|
|
|
get { checkDisposed(); return true; }
|
|
|
}
|
|
|
|
|
|
// The wrapper is readonly
|
|
|
public override bool CanWrite
|
|
|
{
|
|
|
get { checkDisposed(); return false; }
|
|
|
}
|
|
|
|
|
|
// Just forward it
|
|
|
public override void Flush()
|
|
|
{
|
|
|
checkDisposed();
|
|
|
stream.Flush();
|
|
|
}
|
|
|
|
|
|
// Calling this property will cause the wrapper to read the stream
|
|
|
// to its end and cache it completely.
|
|
|
public override long Length
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
checkDisposed();
|
|
|
if (!eos)
|
|
|
{
|
|
|
Fill();
|
|
|
}
|
|
|
return memoryStream.Length;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
// Gets or sets the current position
|
|
|
public override long Position
|
|
|
{
|
|
|
get
|
|
|
{
|
|
|
checkDisposed();
|
|
|
return memoryStream.Position;
|
|
|
}
|
|
|
set
|
|
|
{
|
|
|
checkDisposed();
|
|
|
Seek(value, SeekOrigin.Begin);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
// Implements the reading feature
|
|
|
public override int Read(byte[] buffer, int offset, int count)
|
|
|
{
|
|
|
checkDisposed();
|
|
|
// total bytes read from memory-stream
|
|
|
int memoryBytes = 0;
|
|
|
// total bytes read from the original stream
|
|
|
int streamBytes = 0;
|
|
|
memoryBytes = memoryStream.Read(buffer, offset, count);
|
|
|
if ((count > memoryBytes) && (!eos))
|
|
|
{
|
|
|
// read the rest from the original stream (can be 0 bytes)
|
|
|
do
|
|
|
{
|
|
|
int read = stream.Read(
|
|
|
buffer,
|
|
|
offset + memoryBytes + streamBytes,
|
|
|
count - memoryBytes - streamBytes);
|
|
|
streamBytes += read;
|
|
|
if (read == 0)
|
|
|
{
|
|
|
eos = true;
|
|
|
break;
|
|
|
}
|
|
|
if (!blocking)
|
|
|
{
|
|
|
break;
|
|
|
}
|
|
|
} while ((memoryBytes + streamBytes) < count);
|
|
|
// copy the bytes from the original stream into the memory stream
|
|
|
// if 0 bytes were read we write 0 so the memory-stream is not changed
|
|
|
memoryStream.Write(buffer, offset + memoryBytes, streamBytes);
|
|
|
}
|
|
|
return memoryBytes + streamBytes;
|
|
|
}
|
|
|
|
|
|
// Implements the seeking feature
|
|
|
public override long Seek(long offset, SeekOrigin origin)
|
|
|
{
|
|
|
checkDisposed();
|
|
|
long newPosition = 0L;
|
|
|
// get new position
|
|
|
switch (origin)
|
|
|
{
|
|
|
case SeekOrigin.Begin:
|
|
|
newPosition = offset;
|
|
|
break;
|
|
|
case SeekOrigin.Current:
|
|
|
newPosition = memoryStream.Position + offset;
|
|
|
break;
|
|
|
case SeekOrigin.End:
|
|
|
// to seek from the end have have to read to the end first
|
|
|
if (!eos)
|
|
|
{
|
|
|
Fill();
|
|
|
}
|
|
|
newPosition = memoryStream.Length + offset;
|
|
|
break;
|
|
|
default:
|
|
|
throw new ArgumentOutOfRangeException("origin");
|
|
|
}
|
|
|
// in case the new position is beyond the memory-streams end
|
|
|
// and the original streams end hasn't been reached
|
|
|
// the original stream is read until either the stream ends or
|
|
|
// enough bytes have been read
|
|
|
if ((newPosition > memoryStream.Length) && (!eos))
|
|
|
{
|
|
|
memoryStream.Position = memoryStream.Length;
|
|
|
int bytesToRead = (int)(newPosition - memoryStream.Length);
|
|
|
byte[] buffer = new byte[1024];
|
|
|
do
|
|
|
{
|
|
|
bytesToRead -= Read(buffer, 0, (bytesToRead >= buffer.Length) ? buffer.Length : bytesToRead);
|
|
|
} while ((bytesToRead > 0) && (!eos));
|
|
|
}
|
|
|
memoryStream.Position = (newPosition <= memoryStream.Length) ? newPosition : memoryStream.Length;
|
|
|
return 0;
|
|
|
}
|
|
|
|
|
|
// No write-support
|
|
|
public override void SetLength(long value)
|
|
|
{
|
|
|
throw new Exception("The method or operation is not implemented.");
|
|
|
}
|
|
|
|
|
|
// No write-support
|
|
|
public override void Write(byte[] buffer, int offset, int count)
|
|
|
{
|
|
|
throw new Exception("The method or operation is not implemented.");
|
|
|
}
|
|
|
|
|
|
public void Reset()
|
|
|
{
|
|
|
checkDisposed();
|
|
|
Position = 0;
|
|
|
}
|
|
|
|
|
|
// Reads the wrapped stream until its end.
|
|
|
private void Fill()
|
|
|
{
|
|
|
if (!eos)
|
|
|
{
|
|
|
memoryStream.Position = memoryStream.Length;
|
|
|
int bytesRead = 0;
|
|
|
byte[] buffer = new byte[1024];
|
|
|
do
|
|
|
{
|
|
|
bytesRead = stream.Read(buffer, 0, buffer.Length);
|
|
|
memoryStream.Write(buffer, 0, bytesRead);
|
|
|
} while (bytesRead != 0);
|
|
|
eos = true;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
public new void Dispose()
|
|
|
{
|
|
|
Dispose(true);
|
|
|
GC.SuppressFinalize(this);
|
|
|
}
|
|
|
|
|
|
private new void Dispose(bool disposing)
|
|
|
{
|
|
|
if (!disposed)
|
|
|
{
|
|
|
disposed = true;
|
|
|
if (disposing)
|
|
|
{
|
|
|
if (memoryStream != null)
|
|
|
{
|
|
|
memoryStream.Dispose();
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
public bool Disposed
|
|
|
{
|
|
|
get { return disposed; }
|
|
|
}
|
|
|
|
|
|
private void checkDisposed()
|
|
|
{
|
|
|
if (disposed) throw new ObjectDisposedException("StreamWrapper");
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Enums
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Enumeration used for color conversions.
|
|
|
/// FREE_IMAGE_COLOR_DEPTH contains several colors to convert to.
|
|
|
/// The default value 'FICD_AUTO'.
|
|
|
/// </summary>
|
|
|
[System.Flags]
|
|
|
public enum FREE_IMAGE_COLOR_DEPTH
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Unknown.
|
|
|
/// </summary>
|
|
|
FICD_UNKNOWN = 0,
|
|
|
/// <summary>
|
|
|
/// Auto selected by the used algorithm.
|
|
|
/// </summary>
|
|
|
FICD_AUTO = FICD_UNKNOWN,
|
|
|
/// <summary>
|
|
|
/// 1-bit.
|
|
|
/// </summary>
|
|
|
FICD_01_BPP = 1,
|
|
|
/// <summary>
|
|
|
/// 1-bit using dithering.
|
|
|
/// </summary>
|
|
|
FICD_01_BPP_DITHER = FICD_01_BPP,
|
|
|
/// <summary>
|
|
|
/// 1-bit using threshold.
|
|
|
/// </summary>
|
|
|
FICD_01_BPP_THRESHOLD = FICD_01_BPP | 2,
|
|
|
/// <summary>
|
|
|
/// 4-bit.
|
|
|
/// </summary>
|
|
|
FICD_04_BPP = 4,
|
|
|
/// <summary>
|
|
|
/// 8-bit.
|
|
|
/// </summary>
|
|
|
FICD_08_BPP = 8,
|
|
|
/// <summary>
|
|
|
/// 16-bit 555 (1 bit remains unused).
|
|
|
/// </summary>
|
|
|
FICD_16_BPP_555 = FICD_16_BPP | 2,
|
|
|
/// <summary>
|
|
|
/// 16-bit 565 (all bits are used).
|
|
|
/// </summary>
|
|
|
FICD_16_BPP = 16,
|
|
|
/// <summary>
|
|
|
/// 24-bit.
|
|
|
/// </summary>
|
|
|
FICD_24_BPP = 24,
|
|
|
/// <summary>
|
|
|
/// 32-bit.
|
|
|
/// </summary>
|
|
|
FICD_32_BPP = 32,
|
|
|
/// <summary>
|
|
|
/// Reorder palette (make it linear). Only affects 1-, 4- and 8-bit images.
|
|
|
/// <para>The palette is only reordered in case the image is greyscale
|
|
|
/// (all palette entries have the same red, green and blue value).</para>
|
|
|
/// </summary>
|
|
|
FICD_REORDER_PALETTE = 1024,
|
|
|
/// <summary>
|
|
|
/// Converts the image to greyscale.
|
|
|
/// </summary>
|
|
|
FICD_FORCE_GREYSCALE = 2048,
|
|
|
/// <summary>
|
|
|
/// Flag to mask out all non color depth flags.
|
|
|
/// </summary>
|
|
|
FICD_COLOR_MASK = FICD_01_BPP | FICD_04_BPP | FICD_08_BPP | FICD_16_BPP | FICD_24_BPP | FICD_32_BPP
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// List of combinable compare modes.
|
|
|
/// </summary>
|
|
|
[System.Flags]
|
|
|
public enum FREE_IMAGE_COMPARE_FLAGS
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Compare headers.
|
|
|
/// </summary>
|
|
|
HEADER = 0x1,
|
|
|
/// <summary>
|
|
|
/// Compare palettes.
|
|
|
/// </summary>
|
|
|
PALETTE = 0x2,
|
|
|
/// <summary>
|
|
|
/// Compare pixel data.
|
|
|
/// </summary>
|
|
|
DATA = 0x4,
|
|
|
/// <summary>
|
|
|
/// Compare meta data.
|
|
|
/// </summary>
|
|
|
METADATA = 0x8,
|
|
|
/// <summary>
|
|
|
/// Compare everything.
|
|
|
/// </summary>
|
|
|
COMPLETE = (HEADER | PALETTE | DATA | METADATA)
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Flags for copying data from a bitmap to another.
|
|
|
/// </summary>
|
|
|
public enum FREE_IMAGE_METADATA_COPY
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Exisiting metadata will remain unchanged.
|
|
|
/// </summary>
|
|
|
KEEP_EXISITNG = 0x0,
|
|
|
/// <summary>
|
|
|
/// Existing metadata will be cleared.
|
|
|
/// </summary>
|
|
|
CLEAR_EXISTING = 0x1,
|
|
|
/// <summary>
|
|
|
/// Existing metadata will be overwritten.
|
|
|
/// </summary>
|
|
|
REPLACE_EXISTING = 0x2
|
|
|
}
|
|
|
}
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// List different search modes.
|
|
|
/// </summary>
|
|
|
[System.Flags]
|
|
|
public enum MD_SEARCH_FLAGS
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// The key of the metadata.
|
|
|
/// </summary>
|
|
|
KEY = 0x1,
|
|
|
/// <summary>
|
|
|
/// The description of the metadata
|
|
|
/// </summary>
|
|
|
DESCRIPTION = 0x2,
|
|
|
/// <summary>
|
|
|
/// The ToString value of the metadata
|
|
|
/// </summary>
|
|
|
TOSTRING = 0x4,
|
|
|
}
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
namespace FreeImageAPI
|
|
|
{
|
|
|
/// <summary>
|
|
|
/// Static class importing functions from the FreeImage library
|
|
|
/// and providing additional functions.
|
|
|
/// </summary>
|
|
|
public static partial class FreeImage
|
|
|
{
|
|
|
#region Constants
|
|
|
|
|
|
/// <summary>
|
|
|
/// Array containing all 'FREE_IMAGE_MDMODEL's.
|
|
|
/// </summary>
|
|
|
public static readonly FREE_IMAGE_MDMODEL[] FREE_IMAGE_MDMODELS =
|
|
|
(FREE_IMAGE_MDMODEL[])Enum.GetValues(typeof(FREE_IMAGE_MDMODEL));
|
|
|
|
|
|
/// <summary>
|
|
|
/// Stores handles used to read from streams.
|
|
|
/// </summary>
|
|
|
private static Dictionary<FIMULTIBITMAP, fi_handle> streamHandles =
|
|
|
new Dictionary<FIMULTIBITMAP, fi_handle>();
|
|
|
|
|
|
/// <summary>
|
|
|
/// Version of the wrapper library.
|
|
|
/// </summary>
|
|
|
private static Version WrapperVersion;
|
|
|
|
|
|
private const int DIB_RGB_COLORS = 0;
|
|
|
private const int DIB_PAL_COLORS = 1;
|
|
|
private const int CBM_INIT = 0x4;
|
|
|
|
|
|
/// <summary>
|
|
|
/// An uncompressed format.
|
|
|
/// </summary>
|
|
|
public const int BI_RGB = 0;
|
|
|
|
|
|
/// <summary>
|
|
|
/// A run-length encoded (RLE) format for bitmaps with 8 bpp. The compression format is a 2-byte
|
|
|
/// format consisting of a count byte followed by a byte containing a color index.
|
|
|
/// </summary>
|
|
|
public const int BI_RLE8 = 1;
|
|
|
|
|
|
/// <summary>
|
|
|
/// An RLE format for bitmaps with 4 bpp. The compression format is a 2-byte format consisting
|
|
|
/// of a count byte followed by two word-length color indexes.
|
|
|
/// </summary>
|
|
|
public const int BI_RLE4 = 2;
|
|
|
|
|
|
/// <summary>
|
|
|
/// Specifies that the bitmap is not compressed and that the color table consists of three
|
|
|
/// <b>DWORD</b> color masks that specify the red, green, and blue components, respectively,
|
|
|
/// of each pixel. This is valid when used with 16- and 32-bpp bitmaps.
|
|
|
/// </summary>
|
|
|
public const int BI_BITFIELDS = 3;
|
|
|
|
|
|
/// <summary>
|
|
|
/// <b>Windows 98/Me, Windows 2000/XP:</b> Indicates that the image is a JPEG image.
|
|
|
/// </summary>
|
|
|
public const int BI_JPEG = 4;
|
|
|
|
|
|
/// <summary>
|
|
|
/// <b>Windows 98/Me, Windows 2000/XP:</b> Indicates that the image is a PNG image.
|
|
|
/// </summary>
|
|
|
public const int BI_PNG = 5;
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region General functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the internal version of this FreeImage .NET wrapper.
|
|
|
/// </summary>
|
|
|
/// <returns>The internal version of this FreeImage .NET wrapper.</returns>
|
|
|
public static Version GetWrapperVersion()
|
|
|
{
|
|
|
if (WrapperVersion == null)
|
|
|
{
|
|
|
try
|
|
|
{
|
|
|
object[] attributes = Assembly.GetAssembly(typeof(FreeImage))
|
|
|
.GetCustomAttributes(typeof(AssemblyFileVersionAttribute), false);
|
|
|
if ((attributes != null) && (attributes.Length != 0))
|
|
|
{
|
|
|
AssemblyFileVersionAttribute attribute =
|
|
|
attributes[0] as AssemblyFileVersionAttribute;
|
|
|
if ((attribute != null) && (attribute.Version != null))
|
|
|
{
|
|
|
return (WrapperVersion = new Version(attribute.Version));
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
catch
|
|
|
{
|
|
|
|
|
|
}
|
|
|
|
|
|
WrapperVersion = new Version();
|
|
|
}
|
|
|
|
|
|
return WrapperVersion;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the version of the native FreeImage library.
|
|
|
/// </summary>
|
|
|
/// <returns>The version of the native FreeImage library.</returns>
|
|
|
public static Version GetNativeVersion()
|
|
|
{
|
|
|
return new Version(GetVersion());
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a value indicating if the FreeImage library is available or not.
|
|
|
/// See remarks for further details.
|
|
|
/// </summary>
|
|
|
/// <returns><c>false</c> if the file is not available or out of date;
|
|
|
/// <c>true</c>, otherwise.</returns>
|
|
|
/// <remarks>
|
|
|
/// The FreeImage.NET library is a wrapper for the native C++ library
|
|
|
/// (FreeImage.dll ... dont mix ist up with this library FreeImageNet.dll).
|
|
|
/// The native library <b>must</b> be either in the same folder as the program's
|
|
|
/// executable or in a folder contained in the envirent variable <i>PATH</i>
|
|
|
/// (for example %WINDIR%\System32).<para/>
|
|
|
/// Further more must both libraries, including the program itself,
|
|
|
/// be the same architecture (x86 or x64).
|
|
|
/// </remarks>
|
|
|
public static bool IsAvailable()
|
|
|
{
|
|
|
try
|
|
|
{
|
|
|
// Call a static fast executing function
|
|
|
Version nativeVersion = new Version(GetVersion());
|
|
|
Version wrapperVersion = GetWrapperVersion();
|
|
|
// No exception thrown, the library seems to be present
|
|
|
return
|
|
|
(nativeVersion.Major >= wrapperVersion.Major) &&
|
|
|
(nativeVersion.Minor >= wrapperVersion.Minor) &&
|
|
|
(nativeVersion.Build >= wrapperVersion.Build);
|
|
|
}
|
|
|
catch (DllNotFoundException)
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
catch (EntryPointNotFoundException)
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
catch (BadImageFormatException)
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Bitmap management functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a new bitmap in memory.
|
|
|
/// </summary>
|
|
|
/// <param name="width">Width of the new bitmap.</param>
|
|
|
/// <param name="height">Height of the new bitmap.</param>
|
|
|
/// <param name="bpp">Bit depth of the new Bitmap.
|
|
|
/// Supported pixel depth: 1-, 4-, 8-, 16-, 24-, 32-bit per pixel for standard bitmap</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
public static FIBITMAP Allocate(int width, int height, int bpp)
|
|
|
{
|
|
|
return Allocate(width, height, bpp, 0, 0, 0);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a new bitmap in memory.
|
|
|
/// </summary>
|
|
|
/// <param name="type">Type of the image.</param>
|
|
|
/// <param name="width">Width of the new bitmap.</param>
|
|
|
/// <param name="height">Height of the new bitmap.</param>
|
|
|
/// <param name="bpp">Bit depth of the new Bitmap.
|
|
|
/// Supported pixel depth: 1-, 4-, 8-, 16-, 24-, 32-bit per pixel for standard bitmap</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
public static FIBITMAP AllocateT(FREE_IMAGE_TYPE type, int width, int height, int bpp)
|
|
|
{
|
|
|
return AllocateT(type, width, height, bpp, 0, 0, 0);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Allocates a new image of the specified width, height and bit depth and optionally
|
|
|
/// fills it with the specified color. See remarks for further details.
|
|
|
/// </summary>
|
|
|
/// <param name="width">Width of the new bitmap.</param>
|
|
|
/// <param name="height">Height of the new bitmap.</param>
|
|
|
/// <param name="bpp">Bit depth of the new bitmap.
|
|
|
/// Supported pixel depth: 1-, 4-, 8-, 16-, 24-, 32-bit per pixel for standard bitmaps.</param>
|
|
|
/// <param name="color">The color to fill the bitmap with or <c>null</c>.</param>
|
|
|
/// <param name="options">Options to enable or disable function-features.</param>
|
|
|
/// <param name="palette">The palette of the bitmap or <c>null</c>.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <remarks>
|
|
|
/// This function is an extension to <see cref="Allocate"/>, which additionally supports
|
|
|
/// specifying a palette to be set for the newly create image, as well as specifying a
|
|
|
/// background color, the newly created image should initially be filled with.
|
|
|
/// <para/>
|
|
|
/// Basically, this function internally relies on function <see cref="Allocate"/>, followed by a
|
|
|
/// call to <see cref="FillBackground<T>"/>. This is why both parameters
|
|
|
/// <paramref name="color"/> and <paramref name="options"/> behave the same as it is
|
|
|
/// documented for function <see cref="FillBackground<T>"/>.
|
|
|
/// So, please refer to the documentation of <see cref="FillBackground<T>"/> to
|
|
|
/// learn more about parameters <paramref name="color"/> and <paramref name="options"/>.
|
|
|
/// <para/>
|
|
|
/// The palette specified through parameter <paramref name="palette"/> is only copied to the
|
|
|
/// newly created image, if the desired bit depth is smaller than or equal to 8 bits per pixel.
|
|
|
/// In other words, the <paramref name="palette"/> parameter is only taken into account for
|
|
|
/// palletized images. So, for an 8-bit image, the length is 256, for an 4-bit image it is 16
|
|
|
/// and it is 2 for a 1-bit image. In other words, this function does not support partial palettes.
|
|
|
/// <para/>
|
|
|
/// However, specifying a palette is not necesarily needed, even for palletized images. This
|
|
|
/// function is capable of implicitly creating a palette, if <paramref name="palette"/> is <c>null</c>.
|
|
|
/// If the specified background color is a greyscale value (red = green = blue) or if option
|
|
|
/// <see cref="FREE_IMAGE_COLOR_OPTIONS.FICO_ALPHA_IS_INDEX"/> is specified, a greyscale palette
|
|
|
/// is created. For a 1-bit image, only if the specified background color is either black or white,
|
|
|
/// a monochrome palette, consisting of black and white only is created. In any case, the darker
|
|
|
/// colors are stored at the smaller palette indices.
|
|
|
/// <para/>
|
|
|
/// If the specified background color is not a greyscale value, or is neither black nor white
|
|
|
/// for a 1-bit image, solely this specified color is injected into the otherwise black-initialized
|
|
|
/// palette. For this operation, option <see cref="FREE_IMAGE_COLOR_OPTIONS.FICO_ALPHA_IS_INDEX"/>
|
|
|
/// is implicit, so the specified <paramref name="color"/> is applied to the palette entry,
|
|
|
/// specified by the background color's <see cref="RGBQUAD.rgbReserved"/> field.
|
|
|
/// The image is then filled with this palette index.
|
|
|
/// <para/>
|
|
|
/// This function returns a newly created image as function <see cref="Allocate"/> does, if both
|
|
|
/// parameters <paramref name="color"/> and <paramref name="palette"/> are <c>null</c>.
|
|
|
/// If only <paramref name="color"/> is <c>null</c>, the palette pointed to by
|
|
|
/// parameter <paramref name="palette"/> is initially set for the new image, if a palletized
|
|
|
/// image of type <see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/> is created.
|
|
|
/// However, in the latter case, this function returns an image, whose
|
|
|
/// pixels are all initialized with zeros so, the image will be filled with the color of the
|
|
|
/// first palette entry.
|
|
|
/// </remarks>
|
|
|
public static FIBITMAP AllocateEx(int width, int height, int bpp,
|
|
|
RGBQUAD? color, FREE_IMAGE_COLOR_OPTIONS options, RGBQUAD[] palette)
|
|
|
{
|
|
|
return AllocateEx(width, height, bpp, color, options, palette, 0, 0, 0);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Allocates a new image of the specified width, height and bit depth and optionally
|
|
|
/// fills it with the specified color. See remarks for further details.
|
|
|
/// </summary>
|
|
|
/// <param name="width">Width of the new bitmap.</param>
|
|
|
/// <param name="height">Height of the new bitmap.</param>
|
|
|
/// <param name="bpp">Bit depth of the new bitmap.
|
|
|
/// Supported pixel depth: 1-, 4-, 8-, 16-, 24-, 32-bit per pixel for standard bitmaps.</param>
|
|
|
/// <param name="color">The color to fill the bitmap with or <c>null</c>.</param>
|
|
|
/// <param name="options">Options to enable or disable function-features.</param>
|
|
|
/// <param name="palette">The palette of the bitmap or <c>null</c>.</param>
|
|
|
/// <param name="red_mask">Red part of the color layout.
|
|
|
/// eg: 0xFF0000</param>
|
|
|
/// <param name="green_mask">Green part of the color layout.
|
|
|
/// eg: 0x00FF00</param>
|
|
|
/// <param name="blue_mask">Blue part of the color layout.
|
|
|
/// eg: 0x0000FF</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <remarks>
|
|
|
/// This function is an extension to <see cref="Allocate"/>, which additionally supports
|
|
|
/// specifying a palette to be set for the newly create image, as well as specifying a
|
|
|
/// background color, the newly created image should initially be filled with.
|
|
|
/// <para/>
|
|
|
/// Basically, this function internally relies on function <see cref="Allocate"/>, followed by a
|
|
|
/// call to <see cref="FillBackground<T>"/>. This is why both parameters
|
|
|
/// <paramref name="color"/> and <paramref name="options"/> behave the same as it is
|
|
|
/// documented for function <see cref="FillBackground<T>"/>.
|
|
|
/// So, please refer to the documentation of <see cref="FillBackground<T>"/> to
|
|
|
/// learn more about parameters <paramref name="color"/> and <paramref name="options"/>.
|
|
|
/// <para/>
|
|
|
/// The palette specified through parameter <paramref name="palette"/> is only copied to the
|
|
|
/// newly created image, if the desired bit depth is smaller than or equal to 8 bits per pixel.
|
|
|
/// In other words, the <paramref name="palette"/> parameter is only taken into account for
|
|
|
/// palletized images. So, for an 8-bit image, the length is 256, for an 4-bit image it is 16
|
|
|
/// and it is 2 for a 1-bit image. In other words, this function does not support partial palettes.
|
|
|
/// <para/>
|
|
|
/// However, specifying a palette is not necesarily needed, even for palletized images. This
|
|
|
/// function is capable of implicitly creating a palette, if <paramref name="palette"/> is <c>null</c>.
|
|
|
/// If the specified background color is a greyscale value (red = green = blue) or if option
|
|
|
/// <see cref="FREE_IMAGE_COLOR_OPTIONS.FICO_ALPHA_IS_INDEX"/> is specified, a greyscale palette
|
|
|
/// is created. For a 1-bit image, only if the specified background color is either black or white,
|
|
|
/// a monochrome palette, consisting of black and white only is created. In any case, the darker
|
|
|
/// colors are stored at the smaller palette indices.
|
|
|
/// <para/>
|
|
|
/// If the specified background color is not a greyscale value, or is neither black nor white
|
|
|
/// for a 1-bit image, solely this specified color is injected into the otherwise black-initialized
|
|
|
/// palette. For this operation, option <see cref="FREE_IMAGE_COLOR_OPTIONS.FICO_ALPHA_IS_INDEX"/>
|
|
|
/// is implicit, so the specified <paramref name="color"/> is applied to the palette entry,
|
|
|
/// specified by the background color's <see cref="RGBQUAD.rgbReserved"/> field.
|
|
|
/// The image is then filled with this palette index.
|
|
|
/// <para/>
|
|
|
/// This function returns a newly created image as function <see cref="Allocate"/> does, if both
|
|
|
/// parameters <paramref name="color"/> and <paramref name="palette"/> are <c>null</c>.
|
|
|
/// If only <paramref name="color"/> is <c>null</c>, the palette pointed to by
|
|
|
/// parameter <paramref name="palette"/> is initially set for the new image, if a palletized
|
|
|
/// image of type <see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/> is created.
|
|
|
/// However, in the latter case, this function returns an image, whose
|
|
|
/// pixels are all initialized with zeros so, the image will be filled with the color of the
|
|
|
/// first palette entry.
|
|
|
/// </remarks>
|
|
|
public static FIBITMAP AllocateEx(int width, int height, int bpp,
|
|
|
RGBQUAD? color, FREE_IMAGE_COLOR_OPTIONS options, RGBQUAD[] palette,
|
|
|
uint red_mask, uint green_mask, uint blue_mask)
|
|
|
{
|
|
|
if ((palette != null) && (bpp <= 8) && (palette.Length < (1 << bpp)))
|
|
|
return FIBITMAP.Zero;
|
|
|
|
|
|
if (color.HasValue)
|
|
|
{
|
|
|
GCHandle handle = new GCHandle();
|
|
|
try
|
|
|
{
|
|
|
RGBQUAD[] buffer = new RGBQUAD[] { color.Value };
|
|
|
handle = GCHandle.Alloc(buffer, GCHandleType.Pinned);
|
|
|
return AllocateEx(width, height, bpp, handle.AddrOfPinnedObject(),
|
|
|
options, palette, red_mask, green_mask, blue_mask);
|
|
|
}
|
|
|
finally
|
|
|
{
|
|
|
if (handle.IsAllocated)
|
|
|
handle.Free();
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
return AllocateEx(width, height, bpp, IntPtr.Zero,
|
|
|
options, palette, red_mask, green_mask, blue_mask);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Allocates a new image of the specified type, width, height and bit depth and optionally
|
|
|
/// fills it with the specified color. See remarks for further details.
|
|
|
/// </summary>
|
|
|
/// <typeparam name="T">The type of the specified color.</typeparam>
|
|
|
/// <param name="type">Type of the image.</param>
|
|
|
/// <param name="width">Width of the new bitmap.</param>
|
|
|
/// <param name="height">Height of the new bitmap.</param>
|
|
|
/// <param name="bpp">Bit depth of the new bitmap.
|
|
|
/// Supported pixel depth: 1-, 4-, 8-, 16-, 24-, 32-bit per pixel for standard bitmap</param>
|
|
|
/// <param name="color">The color to fill the bitmap with or <c>null</c>.</param>
|
|
|
/// <param name="options">Options to enable or disable function-features.</param>
|
|
|
/// <param name="palette">The palette of the bitmap or <c>null</c>.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <remarks>
|
|
|
/// This function is an extension to <see cref="AllocateT"/>, which additionally supports
|
|
|
/// specifying a palette to be set for the newly create image, as well as specifying a
|
|
|
/// background color, the newly created image should initially be filled with.
|
|
|
/// <para/>
|
|
|
/// Basically, this function internally relies on function <see cref="AllocateT"/>, followed by a
|
|
|
/// call to <see cref="FillBackground<T>"/>. This is why both parameters
|
|
|
/// <paramref name="color"/> and <paramref name="options"/> behave the same as it is
|
|
|
/// documented for function <see cref="FillBackground<T>"/>. So, please refer to the
|
|
|
/// documentation of <see cref="FillBackground<T>"/> to learn more about parameters color and options.
|
|
|
/// <para/>
|
|
|
/// The palette specified through parameter palette is only copied to the newly created
|
|
|
/// image, if its image type is <see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/> and the desired bit
|
|
|
/// depth is smaller than or equal to 8 bits per pixel. In other words, the <paramref name="palette"/>
|
|
|
/// palette is only taken into account for palletized images. However, if the preceding conditions
|
|
|
/// match and if <paramref name="palette"/> is not <c>null</c>, the palette is assumed to be at
|
|
|
/// least as large as the size of a fully populated palette for the desired bit depth.
|
|
|
/// So, for an 8-bit image, this length is 256, for an 4-bit image it is 16 and it is
|
|
|
/// 2 for a 1-bit image. In other words, this function does not support partial palettes.
|
|
|
/// <para/>
|
|
|
/// However, specifying a palette is not necesarily needed, even for palletized images. This
|
|
|
/// function is capable of implicitly creating a palette, if <paramref name="palette"/> is <c>null</c>.
|
|
|
/// If the specified background color is a greyscale value (red = green = blue) or if option
|
|
|
/// <see cref="FREE_IMAGE_COLOR_OPTIONS.FICO_ALPHA_IS_INDEX"/> is specified, a greyscale palette
|
|
|
/// is created. For a 1-bit image, only if the specified background color is either black or white,
|
|
|
/// a monochrome palette, consisting of black and white only is created. In any case, the darker
|
|
|
/// colors are stored at the smaller palette indices.
|
|
|
/// <para/>
|
|
|
/// If the specified background color is not a greyscale value, or is neither black nor white
|
|
|
/// for a 1-bit image, solely this specified color is injected into the otherwise black-initialized
|
|
|
/// palette. For this operation, option <see cref="FREE_IMAGE_COLOR_OPTIONS.FICO_ALPHA_IS_INDEX"/>
|
|
|
/// is implicit, so the specified color is applied to the palette entry, specified by the
|
|
|
/// background color's <see cref="RGBQUAD.rgbReserved"/> field. The image is then filled with
|
|
|
/// this palette index.
|
|
|
/// <para/>
|
|
|
/// This function returns a newly created image as function <see cref="AllocateT"/> does, if both
|
|
|
/// parameters <paramref name="color"/> and <paramref name="palette"/> are <c>null</c>.
|
|
|
/// If only <paramref name="color"/> is <c>null</c>, the palette pointed to by
|
|
|
/// parameter <paramref name="palette"/> is initially set for the new image, if a palletized
|
|
|
/// image of type <see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/> is created.
|
|
|
/// However, in the latter case, this function returns an image, whose
|
|
|
/// pixels are all initialized with zeros so, the image will be filled with the color of the
|
|
|
/// first palette entry.
|
|
|
/// </remarks>
|
|
|
public static FIBITMAP AllocateExT<T>(FREE_IMAGE_TYPE type, int width, int height, int bpp,
|
|
|
T? color, FREE_IMAGE_COLOR_OPTIONS options, RGBQUAD[] palette) where T : struct
|
|
|
{
|
|
|
return AllocateExT(type, width, height, bpp, color, options, palette, 0, 0, 0);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Allocates a new image of the specified type, width, height and bit depth and optionally
|
|
|
/// fills it with the specified color. See remarks for further details.
|
|
|
/// </summary>
|
|
|
/// <typeparam name="T">The type of the specified color.</typeparam>
|
|
|
/// <param name="type">Type of the image.</param>
|
|
|
/// <param name="width">Width of the new bitmap.</param>
|
|
|
/// <param name="height">Height of the new bitmap.</param>
|
|
|
/// <param name="bpp">Bit depth of the new bitmap.
|
|
|
/// Supported pixel depth: 1-, 4-, 8-, 16-, 24-, 32-bit per pixel for standard bitmap</param>
|
|
|
/// <param name="color">The color to fill the bitmap with or <c>null</c>.</param>
|
|
|
/// <param name="options">Options to enable or disable function-features.</param>
|
|
|
/// <param name="palette">The palette of the bitmap or <c>null</c>.</param>
|
|
|
/// <param name="red_mask">Red part of the color layout.
|
|
|
/// eg: 0xFF0000</param>
|
|
|
/// <param name="green_mask">Green part of the color layout.
|
|
|
/// eg: 0x00FF00</param>
|
|
|
/// <param name="blue_mask">Blue part of the color layout.
|
|
|
/// eg: 0x0000FF</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <remarks>
|
|
|
/// This function is an extension to <see cref="AllocateT"/>, which additionally supports
|
|
|
/// specifying a palette to be set for the newly create image, as well as specifying a
|
|
|
/// background color, the newly created image should initially be filled with.
|
|
|
/// <para/>
|
|
|
/// Basically, this function internally relies on function <see cref="AllocateT"/>, followed by a
|
|
|
/// call to <see cref="FillBackground<T>"/>. This is why both parameters
|
|
|
/// <paramref name="color"/> and <paramref name="options"/> behave the same as it is
|
|
|
/// documented for function <see cref="FillBackground<T>"/>. So, please refer to the
|
|
|
/// documentation of <see cref="FillBackground<T>"/> to learn more about parameters color and options.
|
|
|
/// <para/>
|
|
|
/// The palette specified through parameter palette is only copied to the newly created
|
|
|
/// image, if its image type is <see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/> and the desired bit
|
|
|
/// depth is smaller than or equal to 8 bits per pixel. In other words, the <paramref name="palette"/>
|
|
|
/// palette is only taken into account for palletized images. However, if the preceding conditions
|
|
|
/// match and if <paramref name="palette"/> is not <c>null</c>, the palette is assumed to be at
|
|
|
/// least as large as the size of a fully populated palette for the desired bit depth.
|
|
|
/// So, for an 8-bit image, this length is 256, for an 4-bit image it is 16 and it is
|
|
|
/// 2 for a 1-bit image. In other words, this function does not support partial palettes.
|
|
|
/// <para/>
|
|
|
/// However, specifying a palette is not necesarily needed, even for palletized images. This
|
|
|
/// function is capable of implicitly creating a palette, if <paramref name="palette"/> is <c>null</c>.
|
|
|
/// If the specified background color is a greyscale value (red = green = blue) or if option
|
|
|
/// <see cref="FREE_IMAGE_COLOR_OPTIONS.FICO_ALPHA_IS_INDEX"/> is specified, a greyscale palette
|
|
|
/// is created. For a 1-bit image, only if the specified background color is either black or white,
|
|
|
/// a monochrome palette, consisting of black and white only is created. In any case, the darker
|
|
|
/// colors are stored at the smaller palette indices.
|
|
|
/// <para/>
|
|
|
/// If the specified background color is not a greyscale value, or is neither black nor white
|
|
|
/// for a 1-bit image, solely this specified color is injected into the otherwise black-initialized
|
|
|
/// palette. For this operation, option <see cref="FREE_IMAGE_COLOR_OPTIONS.FICO_ALPHA_IS_INDEX"/>
|
|
|
/// is implicit, so the specified color is applied to the palette entry, specified by the
|
|
|
/// background color's <see cref="RGBQUAD.rgbReserved"/> field. The image is then filled with
|
|
|
/// this palette index.
|
|
|
/// <para/>
|
|
|
/// This function returns a newly created image as function <see cref="AllocateT"/> does, if both
|
|
|
/// parameters <paramref name="color"/> and <paramref name="palette"/> are <c>null</c>.
|
|
|
/// If only <paramref name="color"/> is <c>null</c>, the palette pointed to by
|
|
|
/// parameter <paramref name="palette"/> is initially set for the new image, if a palletized
|
|
|
/// image of type <see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/> is created.
|
|
|
/// However, in the latter case, this function returns an image, whose
|
|
|
/// pixels are all initialized with zeros so, the image will be filled with the color of the
|
|
|
/// first palette entry.
|
|
|
/// </remarks>
|
|
|
public static FIBITMAP AllocateExT<T>(FREE_IMAGE_TYPE type, int width, int height, int bpp,
|
|
|
T? color, FREE_IMAGE_COLOR_OPTIONS options, RGBQUAD[] palette,
|
|
|
uint red_mask, uint green_mask, uint blue_mask) where T : struct
|
|
|
{
|
|
|
if ((palette != null) && (bpp <= 8) && (palette.Length < (1 << bpp)))
|
|
|
return FIBITMAP.Zero;
|
|
|
|
|
|
if (!CheckColorType(type, color))
|
|
|
return FIBITMAP.Zero;
|
|
|
|
|
|
if (color.HasValue)
|
|
|
{
|
|
|
GCHandle handle = new GCHandle();
|
|
|
try
|
|
|
{
|
|
|
T[] buffer = new T[] { color.Value };
|
|
|
handle = GCHandle.Alloc(buffer, GCHandleType.Pinned);
|
|
|
return AllocateExT(type, width, height, bpp, handle.AddrOfPinnedObject(),
|
|
|
options, palette, red_mask, green_mask, blue_mask);
|
|
|
}
|
|
|
finally
|
|
|
{
|
|
|
if (handle.IsAllocated)
|
|
|
handle.Free();
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
return AllocateExT(type, width, height, bpp, IntPtr.Zero,
|
|
|
options, palette, red_mask, green_mask, blue_mask);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a FreeImage bitmap to a .NET <see cref="System.Drawing.Bitmap"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>The converted .NET <see cref="System.Drawing.Bitmap"/>.</returns>
|
|
|
/// <remarks>Copying metadata has been disabled until a proper way
|
|
|
/// of reading and storing metadata in a .NET bitmap is found.</remarks>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// The image type of <paramref name="dib"/> is not FIT_BITMAP.</exception>
|
|
|
public static Bitmap GetBitmap(FIBITMAP dib)
|
|
|
{
|
|
|
return GetBitmap(dib, true);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a FreeImage bitmap to a .NET <see cref="System.Drawing.Bitmap"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="copyMetadata">When true existing metadata will be copied.</param>
|
|
|
/// <returns>The converted .NET <see cref="System.Drawing.Bitmap"/>.</returns>
|
|
|
/// <remarks>Copying metadata has been disabled until a proper way
|
|
|
/// of reading and storing metadata in a .NET bitmap is found.</remarks>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// The image type of <paramref name="dib"/> is not FIT_BITMAP.</exception>
|
|
|
internal static Bitmap GetBitmap(FIBITMAP dib, bool copyMetadata)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
if (GetImageType(dib) != FREE_IMAGE_TYPE.FIT_BITMAP)
|
|
|
{
|
|
|
throw new ArgumentException("Only bitmaps with type of FIT_BITMAP can be converted.");
|
|
|
}
|
|
|
|
|
|
PixelFormat format = GetPixelFormat(dib);
|
|
|
|
|
|
if ((format == PixelFormat.Undefined) && (GetBPP(dib) == 16u))
|
|
|
{
|
|
|
throw new ArgumentException("Only 16bit 555 and 565 are supported.");
|
|
|
}
|
|
|
|
|
|
int height = (int)GetHeight(dib);
|
|
|
int width = (int)GetWidth(dib);
|
|
|
int pitch = (int)GetPitch(dib);
|
|
|
|
|
|
Bitmap result = new Bitmap(width, height, format);
|
|
|
BitmapData data;
|
|
|
// Locking the complete bitmap in writeonly mode
|
|
|
data = result.LockBits(new Rectangle(0, 0, width, height), ImageLockMode.WriteOnly, format);
|
|
|
// Writing the bitmap data directly into the new created .NET bitmap.
|
|
|
ConvertToRawBits(data.Scan0, dib, pitch, GetBPP(dib),
|
|
|
GetRedMask(dib), GetGreenMask(dib), GetBlueMask(dib), true);
|
|
|
// Unlock the bitmap
|
|
|
result.UnlockBits(data);
|
|
|
// Apply the bitmaps resolution
|
|
|
result.SetResolution(GetResolutionX(dib), GetResolutionY(dib));
|
|
|
// Check whether the bitmap has a palette
|
|
|
if (GetPalette(dib) != IntPtr.Zero)
|
|
|
{
|
|
|
// Get the bitmaps palette to apply changes
|
|
|
ColorPalette palette = result.Palette;
|
|
|
// Get the orgininal palette
|
|
|
Color[] colorPalette = new Palette(dib).ColorData;
|
|
|
// Get the maximum number of palette entries to copy
|
|
|
int entriesToCopy = Math.Min(colorPalette.Length, palette.Entries.Length);
|
|
|
|
|
|
// Check whether the bitmap is transparent
|
|
|
if (IsTransparent(dib))
|
|
|
{
|
|
|
byte[] transTable = GetTransparencyTableEx(dib);
|
|
|
int i = 0;
|
|
|
int maxEntriesWithTrans = Math.Min(entriesToCopy, transTable.Length);
|
|
|
// Copy palette entries and include transparency
|
|
|
for (; i < maxEntriesWithTrans; i++)
|
|
|
{
|
|
|
palette.Entries[i] = Color.FromArgb(transTable[i], colorPalette[i]);
|
|
|
}
|
|
|
// Copy palette entries and that have no transparancy
|
|
|
for (; i < entriesToCopy; i++)
|
|
|
{
|
|
|
palette.Entries[i] = Color.FromArgb(0xFF, colorPalette[i]);
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
for (int i = 0; i < entriesToCopy; i++)
|
|
|
{
|
|
|
palette.Entries[i] = colorPalette[i];
|
|
|
}
|
|
|
}
|
|
|
|
|
|
// Set the bitmaps palette
|
|
|
result.Palette = palette;
|
|
|
}
|
|
|
// Copy metadata
|
|
|
if (copyMetadata)
|
|
|
{
|
|
|
try
|
|
|
{
|
|
|
List<PropertyItem> list = new List<PropertyItem>();
|
|
|
// Get a list of all types
|
|
|
FITAG tag;
|
|
|
FIMETADATA mData;
|
|
|
foreach (FREE_IMAGE_MDMODEL model in FREE_IMAGE_MDMODELS)
|
|
|
{
|
|
|
// Get a unique search handle
|
|
|
mData = FindFirstMetadata(model, dib, out tag);
|
|
|
// Check if metadata exists for this type
|
|
|
if (mData.IsNull) continue;
|
|
|
do
|
|
|
{
|
|
|
PropertyItem propItem = CreatePropertyItem();
|
|
|
propItem.Len = (int)GetTagLength(tag);
|
|
|
propItem.Id = (int)GetTagID(tag);
|
|
|
propItem.Type = (short)GetTagType(tag);
|
|
|
byte[] buffer = new byte[propItem.Len];
|
|
|
|
|
|
unsafe
|
|
|
{
|
|
|
byte* src = (byte*)GetTagValue(tag);
|
|
|
fixed (byte* dst = buffer)
|
|
|
{
|
|
|
CopyMemory(dst, src, (uint)propItem.Len);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
propItem.Value = buffer;
|
|
|
list.Add(propItem);
|
|
|
}
|
|
|
while (FindNextMetadata(mData, out tag));
|
|
|
FindCloseMetadata(mData);
|
|
|
}
|
|
|
foreach (PropertyItem propItem in list)
|
|
|
{
|
|
|
result.SetPropertyItem(propItem);
|
|
|
}
|
|
|
}
|
|
|
catch
|
|
|
{
|
|
|
}
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts an .NET <see cref="System.Drawing.Bitmap"/> into a FreeImage bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">The <see cref="System.Drawing.Bitmap"/> to convert.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <remarks>Copying metadata has been disabled until a proper way
|
|
|
/// of reading and storing metadata in a .NET bitmap is found.</remarks>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="bitmap"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// The bitmaps pixelformat is invalid.</exception>
|
|
|
public static FIBITMAP CreateFromBitmap(Bitmap bitmap)
|
|
|
{
|
|
|
return CreateFromBitmap(bitmap, false);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts an .NET <see cref="System.Drawing.Bitmap"/> into a FreeImage bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">The <see cref="System.Drawing.Bitmap"/> to convert.</param>
|
|
|
/// <param name="copyMetadata">When true existing metadata will be copied.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <remarks>Copying metadata has been disabled until a proper way
|
|
|
/// of reading and storing metadata in a .NET bitmap is found.</remarks>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="bitmap"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// The bitmaps pixelformat is invalid.</exception>
|
|
|
internal static FIBITMAP CreateFromBitmap(Bitmap bitmap, bool copyMetadata)
|
|
|
{
|
|
|
if (bitmap == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("bitmap");
|
|
|
}
|
|
|
uint bpp, red_mask, green_mask, blue_mask;
|
|
|
FREE_IMAGE_TYPE type;
|
|
|
if (!GetFormatParameters(bitmap.PixelFormat, out type, out bpp, out red_mask, out green_mask, out blue_mask))
|
|
|
{
|
|
|
throw new ArgumentException("The bitmaps pixelformat is invalid.");
|
|
|
}
|
|
|
|
|
|
// Locking the complete bitmap in readonly mode
|
|
|
BitmapData data = bitmap.LockBits(
|
|
|
new Rectangle(0, 0, bitmap.Width, bitmap.Height), ImageLockMode.ReadOnly, bitmap.PixelFormat);
|
|
|
// Copying the bitmap data directly from the .NET bitmap
|
|
|
FIBITMAP result = ConvertFromRawBits(
|
|
|
data.Scan0,
|
|
|
type,
|
|
|
data.Width,
|
|
|
data.Height,
|
|
|
data.Stride,
|
|
|
bpp,
|
|
|
red_mask,
|
|
|
green_mask,
|
|
|
blue_mask,
|
|
|
true);
|
|
|
bitmap.UnlockBits(data);
|
|
|
// Handle palette
|
|
|
if (GetPalette(result) != IntPtr.Zero)
|
|
|
{
|
|
|
Palette palette = new Palette(result);
|
|
|
Color[] colors = bitmap.Palette.Entries;
|
|
|
// Only copy available palette entries
|
|
|
int entriesToCopy = Math.Min(palette.Length, colors.Length);
|
|
|
byte[] transTable = new byte[entriesToCopy];
|
|
|
for (int i = 0; i < entriesToCopy; i++)
|
|
|
{
|
|
|
RGBQUAD color = (RGBQUAD)colors[i];
|
|
|
color.rgbReserved = 0x00;
|
|
|
palette[i] = color;
|
|
|
transTable[i] = colors[i].A;
|
|
|
}
|
|
|
if ((bitmap.Flags & (int)ImageFlags.HasAlpha) != 0)
|
|
|
{
|
|
|
FreeImage.SetTransparencyTable(result, transTable);
|
|
|
}
|
|
|
}
|
|
|
// Handle meta data
|
|
|
// Disabled
|
|
|
//if (copyMetadata)
|
|
|
//{
|
|
|
// foreach (PropertyItem propItem in bitmap.PropertyItems)
|
|
|
// {
|
|
|
// FITAG tag = CreateTag();
|
|
|
// SetTagLength(tag, (uint)propItem.Len);
|
|
|
// SetTagID(tag, (ushort)propItem.Id);
|
|
|
// SetTagType(tag, (FREE_IMAGE_MDTYPE)propItem.Type);
|
|
|
// SetTagValue(tag, propItem.Value);
|
|
|
// SetMetadata(FREE_IMAGE_MDMODEL.FIMD_EXIF_EXIF, result, "", tag);
|
|
|
// }
|
|
|
//}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a raw bitmap to a FreeImage bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="bits">Array of bytes containing the raw bitmap.</param>
|
|
|
/// <param name="type">The type of the raw bitmap.</param>
|
|
|
/// <param name="width">The width in pixels of the raw bitmap.</param>
|
|
|
/// <param name="height">The height in pixels of the raw bitmap.</param>
|
|
|
/// <param name="pitch">Defines the total width of a scanline in the raw bitmap,
|
|
|
/// including padding bytes.</param>
|
|
|
/// <param name="bpp">The bit depth (bits per pixel) of the raw bitmap.</param>
|
|
|
/// <param name="red_mask">The bit mask describing the bits used to store a single
|
|
|
/// pixel's red component in the raw bitmap. This is only applied to 16-bpp raw bitmaps.</param>
|
|
|
/// <param name="green_mask">The bit mask describing the bits used to store a single
|
|
|
/// pixel's green component in the raw bitmap. This is only applied to 16-bpp raw bitmaps.</param>
|
|
|
/// <param name="blue_mask">The bit mask describing the bits used to store a single
|
|
|
/// pixel's blue component in the raw bitmap. This is only applied to 16-bpp raw bitmaps.</param>
|
|
|
/// <param name="topdown">If true, the raw bitmap is stored in top-down order (top-left pixel first)
|
|
|
/// and in bottom-up order (bottom-left pixel first) otherwise.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
public static unsafe FIBITMAP ConvertFromRawBits(
|
|
|
byte[] bits,
|
|
|
FREE_IMAGE_TYPE type,
|
|
|
int width,
|
|
|
int height,
|
|
|
int pitch,
|
|
|
uint bpp,
|
|
|
uint red_mask,
|
|
|
uint green_mask,
|
|
|
uint blue_mask,
|
|
|
bool topdown)
|
|
|
{
|
|
|
fixed (byte* ptr = bits)
|
|
|
{
|
|
|
return ConvertFromRawBits(
|
|
|
(IntPtr)ptr,
|
|
|
type,
|
|
|
width,
|
|
|
height,
|
|
|
pitch,
|
|
|
bpp,
|
|
|
red_mask,
|
|
|
green_mask,
|
|
|
blue_mask,
|
|
|
topdown);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a raw bitmap to a FreeImage bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="bits">Pointer to the memory block containing the raw bitmap.</param>
|
|
|
/// <param name="type">The type of the raw bitmap.</param>
|
|
|
/// <param name="width">The width in pixels of the raw bitmap.</param>
|
|
|
/// <param name="height">The height in pixels of the raw bitmap.</param>
|
|
|
/// <param name="pitch">Defines the total width of a scanline in the raw bitmap,
|
|
|
/// including padding bytes.</param>
|
|
|
/// <param name="bpp">The bit depth (bits per pixel) of the raw bitmap.</param>
|
|
|
/// <param name="red_mask">The bit mask describing the bits used to store a single
|
|
|
/// pixel's red component in the raw bitmap. This is only applied to 16-bpp raw bitmaps.</param>
|
|
|
/// <param name="green_mask">The bit mask describing the bits used to store a single
|
|
|
/// pixel's green component in the raw bitmap. This is only applied to 16-bpp raw bitmaps.</param>
|
|
|
/// <param name="blue_mask">The bit mask describing the bits used to store a single
|
|
|
/// pixel's blue component in the raw bitmap. This is only applied to 16-bpp raw bitmaps.</param>
|
|
|
/// <param name="topdown">If true, the raw bitmap is stored in top-down order (top-left pixel first)
|
|
|
/// and in bottom-up order (bottom-left pixel first) otherwise.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
public static unsafe FIBITMAP ConvertFromRawBits(
|
|
|
IntPtr bits,
|
|
|
FREE_IMAGE_TYPE type,
|
|
|
int width,
|
|
|
int height,
|
|
|
int pitch,
|
|
|
uint bpp,
|
|
|
uint red_mask,
|
|
|
uint green_mask,
|
|
|
uint blue_mask,
|
|
|
bool topdown)
|
|
|
{
|
|
|
byte* addr = (byte*)bits;
|
|
|
if ((addr == null) || (width <= 0) || (height <= 0))
|
|
|
{
|
|
|
return FIBITMAP.Zero;
|
|
|
}
|
|
|
|
|
|
FIBITMAP dib = AllocateT(type, width, height, (int)bpp, red_mask, green_mask, blue_mask);
|
|
|
if (dib != FIBITMAP.Zero)
|
|
|
{
|
|
|
if (topdown)
|
|
|
{
|
|
|
for (int i = height - 1; i >= 0; --i)
|
|
|
{
|
|
|
CopyMemory((byte*)GetScanLine(dib, i), addr, (int)GetLine(dib));
|
|
|
addr += pitch;
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
for (int i = 0; i < height; ++i)
|
|
|
{
|
|
|
CopyMemory((byte*)GetScanLine(dib, i), addr, (int)GetLine(dib));
|
|
|
addr += pitch;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
return dib;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a .NET <see cref="System.Drawing.Bitmap"/> to a file.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">The .NET <see cref="System.Drawing.Bitmap"/> to save.</param>
|
|
|
/// <param name="filename">Name of the file to save to.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="bitmap"/> or <paramref name="filename"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// The bitmaps pixelformat is invalid.</exception>
|
|
|
public static bool SaveBitmap(Bitmap bitmap, string filename)
|
|
|
{
|
|
|
return SaveBitmap(
|
|
|
bitmap,
|
|
|
filename,
|
|
|
FREE_IMAGE_FORMAT.FIF_UNKNOWN,
|
|
|
FREE_IMAGE_SAVE_FLAGS.DEFAULT);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a .NET <see cref="System.Drawing.Bitmap"/> to a file.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">The .NET <see cref="System.Drawing.Bitmap"/> to save.</param>
|
|
|
/// <param name="filename">Name of the file to save to.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="bitmap"/> or <paramref name="filename"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// The bitmaps pixelformat is invalid.</exception>
|
|
|
public static bool SaveBitmap(Bitmap bitmap, string filename, FREE_IMAGE_SAVE_FLAGS flags)
|
|
|
{
|
|
|
return SaveBitmap(
|
|
|
bitmap,
|
|
|
filename,
|
|
|
FREE_IMAGE_FORMAT.FIF_UNKNOWN,
|
|
|
flags);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a .NET <see cref="System.Drawing.Bitmap"/> to a file.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">The .NET <see cref="System.Drawing.Bitmap"/> to save.</param>
|
|
|
/// <param name="filename">Name of the file to save to.</param>
|
|
|
/// <param name="format">Format of the bitmap. If the format should be taken from the
|
|
|
/// filename use <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/>.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="bitmap"/> or <paramref name="filename"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// The bitmaps pixelformat is invalid.</exception>
|
|
|
public static bool SaveBitmap(
|
|
|
Bitmap bitmap,
|
|
|
string filename,
|
|
|
FREE_IMAGE_FORMAT format,
|
|
|
FREE_IMAGE_SAVE_FLAGS flags)
|
|
|
{
|
|
|
FIBITMAP dib = CreateFromBitmap(bitmap);
|
|
|
bool result = SaveEx(dib, filename, format, flags);
|
|
|
Unload(dib);
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a FreeImage bitmap.
|
|
|
/// The file will be loaded with default loading flags.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The complete name of the file to load.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <exception cref="FileNotFoundException">
|
|
|
/// <paramref name="filename"/> does not exists.</exception>
|
|
|
public static FIBITMAP LoadEx(string filename)
|
|
|
{
|
|
|
FREE_IMAGE_FORMAT format = FREE_IMAGE_FORMAT.FIF_UNKNOWN;
|
|
|
return LoadEx(filename, FREE_IMAGE_LOAD_FLAGS.DEFAULT, ref format);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a FreeImage bitmap.
|
|
|
/// Load flags can be provided by the flags parameter.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The complete name of the file to load.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <exception cref="FileNotFoundException">
|
|
|
/// <paramref name="filename"/> does not exists.</exception>
|
|
|
public static FIBITMAP LoadEx(string filename, FREE_IMAGE_LOAD_FLAGS flags)
|
|
|
{
|
|
|
FREE_IMAGE_FORMAT format = FREE_IMAGE_FORMAT.FIF_UNKNOWN;
|
|
|
return LoadEx(filename, flags, ref format);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a FreeImage bitmap.
|
|
|
/// In case the loading format is <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/> the files
|
|
|
/// real format is being analysed. If no plugin can read the file, format remains
|
|
|
/// <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/> and 0 is returned.
|
|
|
/// The file will be loaded with default loading flags.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The complete name of the file to load.</param>
|
|
|
/// <param name="format">Format of the image. If the format is unknown use
|
|
|
/// <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/>.
|
|
|
/// In case a suitable format was found by LoadEx it will be returned in format.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <exception cref="FileNotFoundException">
|
|
|
/// <paramref name="filename"/> does not exists.</exception>
|
|
|
public static FIBITMAP LoadEx(string filename, ref FREE_IMAGE_FORMAT format)
|
|
|
{
|
|
|
return LoadEx(filename, FREE_IMAGE_LOAD_FLAGS.DEFAULT, ref format);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a FreeImage bitmap.
|
|
|
/// In case the loading format is <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/> the files
|
|
|
/// real format is being analysed. If no plugin can read the file, format remains
|
|
|
/// <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/> and 0 is returned.
|
|
|
/// Load flags can be provided by the flags parameter.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The complete name of the file to load.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <param name="format">Format of the image. If the format is unknown use
|
|
|
/// <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/>.
|
|
|
/// In case a suitable format was found by LoadEx it will be returned in format.
|
|
|
/// </param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <exception cref="FileNotFoundException">
|
|
|
/// <paramref name="filename"/> does not exists.</exception>
|
|
|
public static FIBITMAP LoadEx(string filename, FREE_IMAGE_LOAD_FLAGS flags, ref FREE_IMAGE_FORMAT format)
|
|
|
{
|
|
|
// check if file exists
|
|
|
if (!File.Exists(filename))
|
|
|
{
|
|
|
throw new FileNotFoundException(filename + " could not be found.");
|
|
|
}
|
|
|
FIBITMAP dib = new FIBITMAP();
|
|
|
if (format == FREE_IMAGE_FORMAT.FIF_UNKNOWN)
|
|
|
{
|
|
|
// query all plugins to see if one can read the file
|
|
|
format = GetFileType(filename, 0);
|
|
|
}
|
|
|
// check if the plugin is capable of loading files
|
|
|
if (FIFSupportsReading(format))
|
|
|
{
|
|
|
dib = Load(format, filename, flags);
|
|
|
}
|
|
|
return dib;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a .NET <see cref="System.Drawing.Bitmap"/> from a file.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">Name of the file to be loaded.</param>
|
|
|
/// <param name="format">Format of the image. If the format should be taken from the
|
|
|
/// filename use <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/>.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>The loaded .NET <see cref="System.Drawing.Bitmap"/>.</returns>
|
|
|
/// <exception cref="FileNotFoundException">
|
|
|
/// <paramref name="filename"/> does not exists.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// The image type of the image is not <see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>.</exception>
|
|
|
public static Bitmap LoadBitmap(string filename, FREE_IMAGE_LOAD_FLAGS flags, ref FREE_IMAGE_FORMAT format)
|
|
|
{
|
|
|
FIBITMAP dib = LoadEx(filename, flags, ref format);
|
|
|
Bitmap result = GetBitmap(dib, true);
|
|
|
Unload(dib);
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Deletes a previously loaded FreeImage bitmap from memory and resets the handle to 0.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
public static void UnloadEx(ref FIBITMAP dib)
|
|
|
{
|
|
|
if (!dib.IsNull)
|
|
|
{
|
|
|
Unload(dib);
|
|
|
dib.SetNull();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a previously loaded FreeImage bitmap to a file.
|
|
|
/// The format is taken off the filename.
|
|
|
/// If no suitable format was found false will be returned.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="filename">The complete name of the file to save to.
|
|
|
/// The extension will be corrected if it is no valid extension for the
|
|
|
/// selected format or if no extension was specified.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> or <paramref name="filename"/> is null.</exception>
|
|
|
public static bool SaveEx(FIBITMAP dib, string filename)
|
|
|
{
|
|
|
return SaveEx(
|
|
|
ref dib,
|
|
|
filename,
|
|
|
FREE_IMAGE_FORMAT.FIF_UNKNOWN,
|
|
|
FREE_IMAGE_SAVE_FLAGS.DEFAULT,
|
|
|
FREE_IMAGE_COLOR_DEPTH.FICD_AUTO,
|
|
|
false);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a previously loaded FreeImage bitmap to a file.
|
|
|
/// In case the loading format is <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/>
|
|
|
/// the format is taken off the filename.
|
|
|
/// If no suitable format was found false will be returned.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="filename">The complete name of the file to save to.
|
|
|
/// The extension will be corrected if it is no valid extension for the
|
|
|
/// selected format or if no extension was specified.</param>
|
|
|
/// <param name="format">Format of the image. If the format should be taken from the
|
|
|
/// filename use <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/>.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> or <paramref name="filename"/> is null.</exception>
|
|
|
public static bool SaveEx(
|
|
|
FIBITMAP dib,
|
|
|
string filename,
|
|
|
FREE_IMAGE_FORMAT format)
|
|
|
{
|
|
|
return SaveEx(
|
|
|
ref dib,
|
|
|
filename,
|
|
|
format,
|
|
|
FREE_IMAGE_SAVE_FLAGS.DEFAULT,
|
|
|
FREE_IMAGE_COLOR_DEPTH.FICD_AUTO,
|
|
|
false);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a previously loaded FreeImage bitmap to a file.
|
|
|
/// The format is taken off the filename.
|
|
|
/// If no suitable format was found false will be returned.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="filename">The complete name of the file to save to.
|
|
|
/// The extension will be corrected if it is no valid extension for the
|
|
|
/// selected format or if no extension was specified.</param>
|
|
|
/// <param name="unloadSource">When true the structure will be unloaded on success.
|
|
|
/// If the function failed and returned false, the bitmap was not unloaded.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> or <paramref name="filename"/> is null.</exception>
|
|
|
public static bool SaveEx(
|
|
|
ref FIBITMAP dib,
|
|
|
string filename,
|
|
|
bool unloadSource)
|
|
|
{
|
|
|
return SaveEx(
|
|
|
ref dib,
|
|
|
filename,
|
|
|
FREE_IMAGE_FORMAT.FIF_UNKNOWN,
|
|
|
FREE_IMAGE_SAVE_FLAGS.DEFAULT,
|
|
|
FREE_IMAGE_COLOR_DEPTH.FICD_AUTO,
|
|
|
unloadSource);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a previously loaded FreeImage bitmap to a file.
|
|
|
/// The format is taken off the filename.
|
|
|
/// If no suitable format was found false will be returned.
|
|
|
/// Save flags can be provided by the flags parameter.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="filename">The complete name of the file to save to.
|
|
|
/// The extension will be corrected if it is no valid extension for the
|
|
|
/// selected format or if no extension was specified</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> or <paramref name="filename"/> is null.</exception>
|
|
|
public static bool SaveEx(
|
|
|
FIBITMAP dib,
|
|
|
string filename,
|
|
|
FREE_IMAGE_SAVE_FLAGS flags)
|
|
|
{
|
|
|
return SaveEx(
|
|
|
ref dib,
|
|
|
filename,
|
|
|
FREE_IMAGE_FORMAT.FIF_UNKNOWN,
|
|
|
flags,
|
|
|
FREE_IMAGE_COLOR_DEPTH.FICD_AUTO,
|
|
|
false);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a previously loaded FreeImage bitmap to a file.
|
|
|
/// The format is taken off the filename.
|
|
|
/// If no suitable format was found false will be returned.
|
|
|
/// Save flags can be provided by the flags parameter.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="filename">The complete name of the file to save to.
|
|
|
/// The extension will be corrected if it is no valid extension for the
|
|
|
/// selected format or if no extension was specified.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <param name="unloadSource">When true the structure will be unloaded on success.
|
|
|
/// If the function failed and returned false, the bitmap was not unloaded.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> or <paramref name="filename"/> is null.</exception>
|
|
|
public static bool SaveEx(
|
|
|
ref FIBITMAP dib,
|
|
|
string filename,
|
|
|
FREE_IMAGE_SAVE_FLAGS flags,
|
|
|
bool unloadSource)
|
|
|
{
|
|
|
return SaveEx(
|
|
|
ref dib,
|
|
|
filename,
|
|
|
FREE_IMAGE_FORMAT.FIF_UNKNOWN,
|
|
|
flags,
|
|
|
FREE_IMAGE_COLOR_DEPTH.FICD_AUTO,
|
|
|
unloadSource);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a previously loaded FreeImage bitmap to a file.
|
|
|
/// In case the loading format is <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/>
|
|
|
/// the format is taken off the filename.
|
|
|
/// If no suitable format was found false will be returned.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="filename">The complete name of the file to save to.
|
|
|
/// The extension will be corrected if it is no valid extension for the
|
|
|
/// selected format or if no extension was specified.</param>
|
|
|
/// <param name="format">Format of the image. If the format should be taken from the
|
|
|
/// filename use <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/>.</param>
|
|
|
/// <param name="unloadSource">When true the structure will be unloaded on success.
|
|
|
/// If the function failed and returned false, the bitmap was not unloaded.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> or <paramref name="filename"/> is null.</exception>
|
|
|
public static bool SaveEx(
|
|
|
ref FIBITMAP dib,
|
|
|
string filename,
|
|
|
FREE_IMAGE_FORMAT format,
|
|
|
bool unloadSource)
|
|
|
{
|
|
|
return SaveEx(
|
|
|
ref dib,
|
|
|
filename,
|
|
|
format,
|
|
|
FREE_IMAGE_SAVE_FLAGS.DEFAULT,
|
|
|
FREE_IMAGE_COLOR_DEPTH.FICD_AUTO,
|
|
|
unloadSource);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a previously loaded FreeImage bitmap to a file.
|
|
|
/// In case the loading format is <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/>
|
|
|
/// the format is taken off the filename.
|
|
|
/// If no suitable format was found false will be returned.
|
|
|
/// Save flags can be provided by the flags parameter.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="filename">The complete name of the file to save to.
|
|
|
/// The extension will be corrected if it is no valid extension for the
|
|
|
/// selected format or if no extension was specified.</param>
|
|
|
/// <param name="format">Format of the image. If the format should be taken from the
|
|
|
/// filename use <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/>.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> or <paramref name="filename"/> is null.</exception>
|
|
|
public static bool SaveEx(
|
|
|
FIBITMAP dib,
|
|
|
string filename,
|
|
|
FREE_IMAGE_FORMAT format,
|
|
|
FREE_IMAGE_SAVE_FLAGS flags)
|
|
|
{
|
|
|
return SaveEx(
|
|
|
ref dib,
|
|
|
filename,
|
|
|
format,
|
|
|
flags,
|
|
|
FREE_IMAGE_COLOR_DEPTH.FICD_AUTO,
|
|
|
false);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a previously loaded FreeImage bitmap to a file.
|
|
|
/// In case the loading format is <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/>
|
|
|
/// the format is taken off the filename.
|
|
|
/// If no suitable format was found false will be returned.
|
|
|
/// Save flags can be provided by the flags parameter.
|
|
|
/// The bitmaps color depth can be set by 'colorDepth'.
|
|
|
/// If set to <see cref="FREE_IMAGE_COLOR_DEPTH.FICD_AUTO"/> a suitable color depth
|
|
|
/// will be taken if available.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="filename">The complete name of the file to save to.
|
|
|
/// The extension will be corrected if it is no valid extension for the
|
|
|
/// selected format or if no extension was specified.</param>
|
|
|
/// <param name="format">Format of the image. If the format should be taken from the
|
|
|
/// filename use <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/>.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <param name="colorDepth">The new color depth of the bitmap.
|
|
|
/// Set to <see cref="FREE_IMAGE_COLOR_DEPTH.FICD_AUTO"/> if Save should take the
|
|
|
/// best suitable color depth.
|
|
|
/// If a color depth is selected that the provided format cannot write an
|
|
|
/// error-message will be thrown.</param>
|
|
|
/// <param name="unloadSource">When true the structure will be unloaded on success.
|
|
|
/// If the function failed and returned false, the bitmap was not unloaded.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// A direct color conversion failed.</exception>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> or <paramref name="filename"/> is null.</exception>
|
|
|
public static bool SaveEx(
|
|
|
ref FIBITMAP dib,
|
|
|
string filename,
|
|
|
FREE_IMAGE_FORMAT format,
|
|
|
FREE_IMAGE_SAVE_FLAGS flags,
|
|
|
FREE_IMAGE_COLOR_DEPTH colorDepth,
|
|
|
bool unloadSource)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
if (filename == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("filename");
|
|
|
}
|
|
|
bool result = false;
|
|
|
// Gets format from filename if the format is unknown
|
|
|
if (format == FREE_IMAGE_FORMAT.FIF_UNKNOWN)
|
|
|
{
|
|
|
format = GetFIFFromFilename(filename);
|
|
|
}
|
|
|
if (format != FREE_IMAGE_FORMAT.FIF_UNKNOWN)
|
|
|
{
|
|
|
// Checks writing support
|
|
|
if (FIFSupportsWriting(format) && FIFSupportsExportType(format, GetImageType(dib)))
|
|
|
{
|
|
|
// Check valid filename and correct it if needed
|
|
|
if (!IsFilenameValidForFIF(format, filename))
|
|
|
{
|
|
|
string extension = GetPrimaryExtensionFromFIF(format);
|
|
|
filename = Path.ChangeExtension(filename, extension);
|
|
|
}
|
|
|
|
|
|
FIBITMAP dibToSave = PrepareBitmapColorDepth(dib, format, colorDepth);
|
|
|
try
|
|
|
{
|
|
|
result = Save(format, dibToSave, filename, flags);
|
|
|
}
|
|
|
finally
|
|
|
{
|
|
|
// Always unload a temporary created bitmap.
|
|
|
if (dibToSave != dib)
|
|
|
{
|
|
|
UnloadEx(ref dibToSave);
|
|
|
}
|
|
|
// On success unload the bitmap
|
|
|
if (result && unloadSource)
|
|
|
{
|
|
|
UnloadEx(ref dib);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a FreeImage bitmap.
|
|
|
/// The stream must be set to the correct position before calling LoadFromStream.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">The stream to read from.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="stream"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// <paramref name="stream"/> is not capable of reading.</exception>
|
|
|
public static FIBITMAP LoadFromStream(Stream stream)
|
|
|
{
|
|
|
FREE_IMAGE_FORMAT format = FREE_IMAGE_FORMAT.FIF_UNKNOWN;
|
|
|
return LoadFromStream(stream, FREE_IMAGE_LOAD_FLAGS.DEFAULT, ref format);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a FreeImage bitmap.
|
|
|
/// The stream must be set to the correct position before calling LoadFromStream.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">The stream to read from.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="stream"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// <paramref name="stream"/> is not capable of reading.</exception>
|
|
|
public static FIBITMAP LoadFromStream(Stream stream, FREE_IMAGE_LOAD_FLAGS flags)
|
|
|
{
|
|
|
FREE_IMAGE_FORMAT format = FREE_IMAGE_FORMAT.FIF_UNKNOWN;
|
|
|
return LoadFromStream(stream, flags, ref format);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a FreeImage bitmap.
|
|
|
/// In case the loading format is <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/> the
|
|
|
/// bitmaps real format is being analysed.
|
|
|
/// The stream must be set to the correct position before calling LoadFromStream.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">The stream to read from.</param>
|
|
|
/// <param name="format">Format of the image. If the format is unknown use
|
|
|
/// <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/>.
|
|
|
/// In case a suitable format was found by LoadFromStream it will be returned in format.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="stream"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// <paramref name="stream"/> is not capable of reading.</exception>
|
|
|
public static FIBITMAP LoadFromStream(Stream stream, ref FREE_IMAGE_FORMAT format)
|
|
|
{
|
|
|
return LoadFromStream(stream, FREE_IMAGE_LOAD_FLAGS.DEFAULT, ref format);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a FreeImage bitmap.
|
|
|
/// In case the loading format is <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/>
|
|
|
/// the bitmaps real format is being analysed.
|
|
|
/// The stream must be set to the correct position before calling LoadFromStream.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">The stream to read from.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <param name="format">Format of the image. If the format is unknown use
|
|
|
/// <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/>.
|
|
|
/// In case a suitable format was found by LoadFromStream it will be returned in format.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="stream"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// <paramref name="stream"/> is not capable of reading.</exception>
|
|
|
public static FIBITMAP LoadFromStream(
|
|
|
Stream stream,
|
|
|
FREE_IMAGE_LOAD_FLAGS flags,
|
|
|
ref FREE_IMAGE_FORMAT format)
|
|
|
{
|
|
|
if (stream == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("stream");
|
|
|
}
|
|
|
if (!stream.CanRead)
|
|
|
{
|
|
|
throw new ArgumentException("stream is not capable of reading.");
|
|
|
}
|
|
|
// Wrap the source stream if it is unable to seek (which is required by FreeImage)
|
|
|
stream = (stream.CanSeek) ? stream : new StreamWrapper(stream, true);
|
|
|
|
|
|
stream.Position = 0L;
|
|
|
if (format == FREE_IMAGE_FORMAT.FIF_UNKNOWN)
|
|
|
{
|
|
|
// Get the format of the bitmap
|
|
|
format = GetFileTypeFromStream(stream);
|
|
|
// Restore the streams position
|
|
|
stream.Position = 0L;
|
|
|
}
|
|
|
if (!FIFSupportsReading(format))
|
|
|
{
|
|
|
return FIBITMAP.Zero;
|
|
|
}
|
|
|
// Create a 'FreeImageIO' structure for calling 'LoadFromHandle'
|
|
|
// using the internal structure 'FreeImageStreamIO'.
|
|
|
FreeImageIO io = FreeImageStreamIO.io;
|
|
|
using (fi_handle handle = new fi_handle(stream))
|
|
|
{
|
|
|
return LoadFromHandle(format, ref io, handle, flags);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a previously loaded FreeImage bitmap to a stream.
|
|
|
/// The stream must be set to the correct position before calling SaveToStream.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="stream">The stream to write to.</param>
|
|
|
/// <param name="format">Format of the image.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> or <paramref name="stream"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// <paramref name="stream"/> cannot write.</exception>
|
|
|
public static bool SaveToStream(
|
|
|
FIBITMAP dib,
|
|
|
Stream stream,
|
|
|
FREE_IMAGE_FORMAT format)
|
|
|
{
|
|
|
return SaveToStream(
|
|
|
ref dib,
|
|
|
stream,
|
|
|
format,
|
|
|
FREE_IMAGE_SAVE_FLAGS.DEFAULT,
|
|
|
FREE_IMAGE_COLOR_DEPTH.FICD_AUTO,
|
|
|
false);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a previously loaded FreeImage bitmap to a stream.
|
|
|
/// The stream must be set to the correct position before calling SaveToStream.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="stream">The stream to write to.</param>
|
|
|
/// <param name="format">Format of the image.</param>
|
|
|
/// <param name="unloadSource">When true the structure will be unloaded on success.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> or <paramref name="stream"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// <paramref name="stream"/> cannot write.</exception>
|
|
|
public static bool SaveToStream(
|
|
|
ref FIBITMAP dib,
|
|
|
Stream stream,
|
|
|
FREE_IMAGE_FORMAT format,
|
|
|
bool unloadSource)
|
|
|
{
|
|
|
return SaveToStream(
|
|
|
ref dib,
|
|
|
stream,
|
|
|
format,
|
|
|
FREE_IMAGE_SAVE_FLAGS.DEFAULT,
|
|
|
FREE_IMAGE_COLOR_DEPTH.FICD_AUTO,
|
|
|
unloadSource);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a previously loaded FreeImage bitmap to a stream.
|
|
|
/// The stream must be set to the correct position before calling SaveToStream.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="stream">The stream to write to.</param>
|
|
|
/// <param name="format">Format of the image.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> or <paramref name="stream"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// <paramref name="stream"/> cannot write.</exception>
|
|
|
public static bool SaveToStream(
|
|
|
FIBITMAP dib,
|
|
|
Stream stream,
|
|
|
FREE_IMAGE_FORMAT format,
|
|
|
FREE_IMAGE_SAVE_FLAGS flags)
|
|
|
{
|
|
|
return SaveToStream(
|
|
|
ref dib,
|
|
|
stream,
|
|
|
format,
|
|
|
flags,
|
|
|
FREE_IMAGE_COLOR_DEPTH.FICD_AUTO,
|
|
|
false);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a previously loaded FreeImage bitmap to a stream.
|
|
|
/// The stream must be set to the correct position before calling SaveToStream.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="stream">The stream to write to.</param>
|
|
|
/// <param name="format">Format of the image.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <param name="unloadSource">When true the structure will be unloaded on success.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> or <paramref name="stream"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// <paramref name="stream"/> cannot write.</exception>
|
|
|
public static bool SaveToStream(
|
|
|
ref FIBITMAP dib,
|
|
|
Stream stream,
|
|
|
FREE_IMAGE_FORMAT format,
|
|
|
FREE_IMAGE_SAVE_FLAGS flags,
|
|
|
bool unloadSource)
|
|
|
{
|
|
|
return SaveToStream(
|
|
|
ref dib, stream,
|
|
|
format,
|
|
|
flags,
|
|
|
FREE_IMAGE_COLOR_DEPTH.FICD_AUTO,
|
|
|
unloadSource);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a previously loaded FreeImage bitmap to a stream.
|
|
|
/// The stream must be set to the correct position before calling SaveToStream.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="stream">The stream to write to.</param>
|
|
|
/// <param name="format">Format of the image.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <param name="colorDepth">The new color depth of the bitmap.
|
|
|
/// Set to <see cref="FREE_IMAGE_COLOR_DEPTH.FICD_AUTO"/> if SaveToStream should
|
|
|
/// take the best suitable color depth.
|
|
|
/// If a color depth is selected that the provided format cannot write an
|
|
|
/// error-message will be thrown.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> or <paramref name="stream"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// <paramref name="stream"/> cannot write.</exception>
|
|
|
public static bool SaveToStream(
|
|
|
FIBITMAP dib,
|
|
|
Stream stream,
|
|
|
FREE_IMAGE_FORMAT format,
|
|
|
FREE_IMAGE_SAVE_FLAGS flags,
|
|
|
FREE_IMAGE_COLOR_DEPTH colorDepth)
|
|
|
{
|
|
|
return SaveToStream(
|
|
|
ref dib,
|
|
|
stream,
|
|
|
format,
|
|
|
flags,
|
|
|
colorDepth,
|
|
|
false);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Saves a previously loaded FreeImage bitmap to a stream.
|
|
|
/// The stream must be set to the correct position before calling SaveToStream.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="stream">The stream to write to.</param>
|
|
|
/// <param name="format">Format of the image.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <param name="colorDepth">The new color depth of the bitmap.
|
|
|
/// Set to <see cref="FREE_IMAGE_COLOR_DEPTH.FICD_AUTO"/> if SaveToStream should
|
|
|
/// take the best suitable color depth.
|
|
|
/// If a color depth is selected that the provided format cannot write an
|
|
|
/// error-message will be thrown.</param>
|
|
|
/// <param name="unloadSource">When true the structure will be unloaded on success.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> or <paramref name="stream"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// <paramref name="stream"/> cannot write.</exception>
|
|
|
public static bool SaveToStream(
|
|
|
ref FIBITMAP dib,
|
|
|
Stream stream,
|
|
|
FREE_IMAGE_FORMAT format,
|
|
|
FREE_IMAGE_SAVE_FLAGS flags,
|
|
|
FREE_IMAGE_COLOR_DEPTH colorDepth,
|
|
|
bool unloadSource)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
if (stream == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("stream");
|
|
|
}
|
|
|
if (!stream.CanWrite)
|
|
|
{
|
|
|
throw new ArgumentException("stream is not capable of writing.");
|
|
|
}
|
|
|
if ((!FIFSupportsWriting(format)) || (!FIFSupportsExportType(format, GetImageType(dib))))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
|
|
|
FIBITMAP dibToSave = PrepareBitmapColorDepth(dib, format, colorDepth);
|
|
|
bool result = false;
|
|
|
|
|
|
try
|
|
|
{
|
|
|
// Create a 'FreeImageIO' structure for calling 'SaveToHandle'
|
|
|
FreeImageIO io = FreeImageStreamIO.io;
|
|
|
|
|
|
using (fi_handle handle = new fi_handle(stream))
|
|
|
{
|
|
|
result = SaveToHandle(format, dibToSave, ref io, handle, flags);
|
|
|
}
|
|
|
}
|
|
|
finally
|
|
|
{
|
|
|
// Always unload a temporary created bitmap.
|
|
|
if (dibToSave != dib)
|
|
|
{
|
|
|
UnloadEx(ref dibToSave);
|
|
|
}
|
|
|
// On success unload the bitmap
|
|
|
if (result && unloadSource)
|
|
|
{
|
|
|
UnloadEx(ref dib);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Plugin functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Checks if an extension is valid for a certain format.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">The desired format.</param>
|
|
|
/// <param name="extension">The desired extension.</param>
|
|
|
/// <returns>True if the extension is valid for the given format, false otherwise.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="extension"/> is null.</exception>
|
|
|
public static bool IsExtensionValidForFIF(FREE_IMAGE_FORMAT fif, string extension)
|
|
|
{
|
|
|
return IsExtensionValidForFIF(fif, extension, StringComparison.CurrentCultureIgnoreCase);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Checks if an extension is valid for a certain format.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">The desired format.</param>
|
|
|
/// <param name="extension">The desired extension.</param>
|
|
|
/// <param name="comparisonType">The string comparison type.</param>
|
|
|
/// <returns>True if the extension is valid for the given format, false otherwise.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="extension"/> is null.</exception>
|
|
|
public static bool IsExtensionValidForFIF(FREE_IMAGE_FORMAT fif, string extension, StringComparison comparisonType)
|
|
|
{
|
|
|
if (extension == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("extension");
|
|
|
}
|
|
|
bool result = false;
|
|
|
// Split up the string and compare each with the given extension
|
|
|
string tempList = GetFIFExtensionList(fif);
|
|
|
if (tempList != null)
|
|
|
{
|
|
|
string[] extensionList = tempList.Split(',');
|
|
|
foreach (string ext in extensionList)
|
|
|
{
|
|
|
if (extension.Equals(ext, comparisonType))
|
|
|
{
|
|
|
result = true;
|
|
|
break;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Checks if a filename is valid for a certain format.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">The desired format.</param>
|
|
|
/// <param name="filename">The desired filename.</param>
|
|
|
/// <returns>True if the filename is valid for the given format, false otherwise.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="filename"/> is null.</exception>
|
|
|
public static bool IsFilenameValidForFIF(FREE_IMAGE_FORMAT fif, string filename)
|
|
|
{
|
|
|
return IsFilenameValidForFIF(fif, filename, StringComparison.CurrentCultureIgnoreCase);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Checks if a filename is valid for a certain format.
|
|
|
/// </summary>
|
|
|
/// <param name="fif">The desired format.</param>
|
|
|
/// <param name="filename">The desired filename.</param>
|
|
|
/// <param name="comparisonType">The string comparison type.</param>
|
|
|
/// <returns>True if the filename is valid for the given format, false otherwise.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="filename"/> is null.</exception>
|
|
|
public static bool IsFilenameValidForFIF(FREE_IMAGE_FORMAT fif, string filename, StringComparison comparisonType)
|
|
|
{
|
|
|
if (filename == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("filename");
|
|
|
}
|
|
|
bool result = false;
|
|
|
// Extract the filenames extension if it exists
|
|
|
string extension = Path.GetExtension(filename);
|
|
|
if (extension.Length != 0)
|
|
|
{
|
|
|
extension = extension.Remove(0, 1);
|
|
|
result = IsExtensionValidForFIF(fif, extension, comparisonType);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// This function returns the primary (main or most commonly used?) extension of a certain
|
|
|
/// image format (fif). This is done by returning the first of all possible extensions
|
|
|
/// returned by GetFIFExtensionList().
|
|
|
/// That assumes, that the plugin returns the extensions in ordered form.</summary>
|
|
|
/// <param name="fif">The image format to obtain the primary extension for.</param>
|
|
|
/// <returns>The primary extension of the specified image format.</returns>
|
|
|
public static string GetPrimaryExtensionFromFIF(FREE_IMAGE_FORMAT fif)
|
|
|
{
|
|
|
string result = null;
|
|
|
string extensions = GetFIFExtensionList(fif);
|
|
|
if (extensions != null)
|
|
|
{
|
|
|
int position = extensions.IndexOf(',');
|
|
|
if (position < 0)
|
|
|
{
|
|
|
result = extensions;
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
result = extensions.Substring(0, position);
|
|
|
}
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Multipage functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a FreeImage multi-paged bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The complete name of the file to load.</param>
|
|
|
/// <returns>Handle to a FreeImage multi-paged bitmap.</returns>
|
|
|
/// <exception cref="FileNotFoundException">
|
|
|
/// <paramref name="filename"/> does not exists while opening.</exception>
|
|
|
public static FIMULTIBITMAP OpenMultiBitmapEx(string filename)
|
|
|
{
|
|
|
FREE_IMAGE_FORMAT format = FREE_IMAGE_FORMAT.FIF_UNKNOWN;
|
|
|
return OpenMultiBitmapEx(
|
|
|
filename,
|
|
|
ref format,
|
|
|
FREE_IMAGE_LOAD_FLAGS.DEFAULT,
|
|
|
false,
|
|
|
false,
|
|
|
false);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a FreeImage multi-paged bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The complete name of the file to load.</param>
|
|
|
/// <param name="keep_cache_in_memory">When true performance is increased at the cost of memory.</param>
|
|
|
/// <returns>Handle to a FreeImage multi-paged bitmap.</returns>
|
|
|
/// <exception cref="FileNotFoundException">
|
|
|
/// <paramref name="filename"/> does not exists while opening.</exception>
|
|
|
public static FIMULTIBITMAP OpenMultiBitmapEx(string filename, bool keep_cache_in_memory)
|
|
|
{
|
|
|
FREE_IMAGE_FORMAT format = FREE_IMAGE_FORMAT.FIF_UNKNOWN;
|
|
|
return OpenMultiBitmapEx(
|
|
|
filename,
|
|
|
ref format,
|
|
|
FREE_IMAGE_LOAD_FLAGS.DEFAULT,
|
|
|
false,
|
|
|
false,
|
|
|
keep_cache_in_memory);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a FreeImage multi-paged bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The complete name of the file to load.</param>
|
|
|
/// <param name="read_only">When true the bitmap will be loaded read only.</param>
|
|
|
/// <param name="keep_cache_in_memory">When true performance is increased at the cost of memory.</param>
|
|
|
/// <returns>Handle to a FreeImage multi-paged bitmap.</returns>
|
|
|
/// <exception cref="FileNotFoundException">
|
|
|
/// <paramref name="filename"/> does not exists while opening.</exception>
|
|
|
public static FIMULTIBITMAP OpenMultiBitmapEx(
|
|
|
string filename,
|
|
|
bool read_only,
|
|
|
bool keep_cache_in_memory)
|
|
|
{
|
|
|
FREE_IMAGE_FORMAT format = FREE_IMAGE_FORMAT.FIF_UNKNOWN;
|
|
|
return OpenMultiBitmapEx(
|
|
|
filename,
|
|
|
ref format,
|
|
|
FREE_IMAGE_LOAD_FLAGS.DEFAULT,
|
|
|
false,
|
|
|
read_only,
|
|
|
keep_cache_in_memory);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a FreeImage multi-paged bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The complete name of the file to load.</param>
|
|
|
/// <param name="create_new">When true a new bitmap is created.</param>
|
|
|
/// <param name="read_only">When true the bitmap will be loaded read only.</param>
|
|
|
/// <param name="keep_cache_in_memory">When true performance is increased at the cost of memory.</param>
|
|
|
/// <returns>Handle to a FreeImage multi-paged bitmap.</returns>
|
|
|
/// <exception cref="FileNotFoundException">
|
|
|
/// <paramref name="filename"/> does not exists while opening.</exception>
|
|
|
public static FIMULTIBITMAP OpenMultiBitmapEx(
|
|
|
string filename,
|
|
|
bool create_new,
|
|
|
bool read_only,
|
|
|
bool keep_cache_in_memory)
|
|
|
{
|
|
|
FREE_IMAGE_FORMAT format = FREE_IMAGE_FORMAT.FIF_UNKNOWN;
|
|
|
return OpenMultiBitmapEx(
|
|
|
filename,
|
|
|
ref format,
|
|
|
FREE_IMAGE_LOAD_FLAGS.DEFAULT,
|
|
|
create_new,
|
|
|
read_only,
|
|
|
keep_cache_in_memory);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a FreeImage multi-paged bitmap.
|
|
|
/// In case the loading format is <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/> the files real
|
|
|
/// format is being analysed. If no plugin can read the file, format remains
|
|
|
/// <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/> and 0 is returned.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The complete name of the file to load.</param>
|
|
|
/// <param name="format">Format of the image. If the format is unknown use
|
|
|
/// <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/>.
|
|
|
/// In case a suitable format was found by LoadEx it will be returned in format.</param>
|
|
|
/// <param name="create_new">When true a new bitmap is created.</param>
|
|
|
/// <param name="read_only">When true the bitmap will be loaded read only.</param>
|
|
|
/// <param name="keep_cache_in_memory">When true performance is increased at the cost of memory.</param>
|
|
|
/// <returns>Handle to a FreeImage multi-paged bitmap.</returns>
|
|
|
/// <exception cref="FileNotFoundException">
|
|
|
/// <paramref name="filename"/> does not exists while opening.</exception>
|
|
|
public static FIMULTIBITMAP OpenMultiBitmapEx(
|
|
|
string filename,
|
|
|
ref FREE_IMAGE_FORMAT format,
|
|
|
bool create_new,
|
|
|
bool read_only,
|
|
|
bool keep_cache_in_memory)
|
|
|
{
|
|
|
return OpenMultiBitmapEx(
|
|
|
filename,
|
|
|
ref format,
|
|
|
FREE_IMAGE_LOAD_FLAGS.DEFAULT,
|
|
|
create_new,
|
|
|
read_only,
|
|
|
keep_cache_in_memory);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a FreeImage multi-paged bitmap.
|
|
|
/// In case the loading format is <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/> the files
|
|
|
/// real format is being analysed. If no plugin can read the file, format remains
|
|
|
/// <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/> and 0 is returned.
|
|
|
/// Load flags can be provided by the flags parameter.
|
|
|
/// </summary>
|
|
|
/// <param name="filename">The complete name of the file to load.</param>
|
|
|
/// <param name="format">Format of the image. If the format is unknown use
|
|
|
/// <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/>.
|
|
|
/// In case a suitable format was found by LoadEx it will be returned in format.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <param name="create_new">When true a new bitmap is created.</param>
|
|
|
/// <param name="read_only">When true the bitmap will be loaded read only.</param>
|
|
|
/// <param name="keep_cache_in_memory">When true performance is increased at the cost of memory.</param>
|
|
|
/// <returns>Handle to a FreeImage multi-paged bitmap.</returns>
|
|
|
/// <exception cref="FileNotFoundException">
|
|
|
/// <paramref name="filename"/> does not exists while opening.</exception>
|
|
|
public static FIMULTIBITMAP OpenMultiBitmapEx(
|
|
|
string filename,
|
|
|
ref FREE_IMAGE_FORMAT format,
|
|
|
FREE_IMAGE_LOAD_FLAGS flags,
|
|
|
bool create_new,
|
|
|
bool read_only,
|
|
|
bool keep_cache_in_memory)
|
|
|
{
|
|
|
if (!File.Exists(filename) && !create_new)
|
|
|
{
|
|
|
throw new FileNotFoundException(filename + " could not be found.");
|
|
|
}
|
|
|
if (format == FREE_IMAGE_FORMAT.FIF_UNKNOWN)
|
|
|
{
|
|
|
// Check if a plugin can read the data
|
|
|
format = GetFileType(filename, 0);
|
|
|
}
|
|
|
FIMULTIBITMAP dib = new FIMULTIBITMAP();
|
|
|
if (FIFSupportsReading(format))
|
|
|
{
|
|
|
dib = OpenMultiBitmap(format, filename, create_new, read_only, keep_cache_in_memory, flags);
|
|
|
}
|
|
|
return dib;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a FreeImage multi-paged bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">The stream to load the bitmap from.</param>
|
|
|
/// <returns>Handle to a FreeImage multi-paged bitmap.</returns>
|
|
|
public static FIMULTIBITMAP OpenMultiBitmapFromStream(Stream stream)
|
|
|
{
|
|
|
FREE_IMAGE_FORMAT format = FREE_IMAGE_FORMAT.FIF_UNKNOWN;
|
|
|
return OpenMultiBitmapFromStream(stream, ref format, FREE_IMAGE_LOAD_FLAGS.DEFAULT);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a FreeImage multi-paged bitmap.
|
|
|
/// In case the loading format is <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/> the files
|
|
|
/// real format is being analysed. If no plugin can read the file, format remains
|
|
|
/// <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/> and 0 is returned.
|
|
|
/// Load flags can be provided by the flags parameter.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">The stream to load the bitmap from.</param>
|
|
|
/// <param name="format">Format of the image. If the format is unknown use
|
|
|
/// <see cref="FREE_IMAGE_FORMAT.FIF_UNKNOWN"/></param>.
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Handle to a FreeImage multi-paged bitmap.</returns>
|
|
|
public static FIMULTIBITMAP OpenMultiBitmapFromStream(Stream stream, ref FREE_IMAGE_FORMAT format, FREE_IMAGE_LOAD_FLAGS flags)
|
|
|
{
|
|
|
if (stream == null)
|
|
|
return FIMULTIBITMAP.Zero;
|
|
|
|
|
|
if (!stream.CanSeek)
|
|
|
stream = new StreamWrapper(stream, true);
|
|
|
|
|
|
FIMULTIBITMAP mdib = FIMULTIBITMAP.Zero;
|
|
|
FreeImageIO io = FreeImageStreamIO.io;
|
|
|
fi_handle handle = new fi_handle(stream);
|
|
|
|
|
|
try
|
|
|
{
|
|
|
if (format == FREE_IMAGE_FORMAT.FIF_UNKNOWN)
|
|
|
{
|
|
|
format = GetFileTypeFromHandle(ref io, handle, checked((int)stream.Length));
|
|
|
}
|
|
|
|
|
|
mdib = OpenMultiBitmapFromHandle(format, ref io, handle, flags);
|
|
|
|
|
|
if (mdib.IsNull)
|
|
|
{
|
|
|
handle.Dispose();
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
lock (streamHandles)
|
|
|
{
|
|
|
streamHandles.Add(mdib, handle);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
return mdib;
|
|
|
}
|
|
|
catch
|
|
|
{
|
|
|
if (!mdib.IsNull)
|
|
|
CloseMultiBitmap(mdib, FREE_IMAGE_SAVE_FLAGS.DEFAULT);
|
|
|
|
|
|
if (handle != null)
|
|
|
handle.Dispose();
|
|
|
|
|
|
throw;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Closes a previously opened multi-page bitmap and, when the bitmap was not opened read-only, applies any changes made to it.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">Handle to a FreeImage multi-paged bitmap.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public static bool CloseMultiBitmap(FIMULTIBITMAP bitmap, FREE_IMAGE_SAVE_FLAGS flags)
|
|
|
{
|
|
|
if (CloseMultiBitmap_(bitmap, flags))
|
|
|
{
|
|
|
fi_handle handle;
|
|
|
lock (streamHandles)
|
|
|
{
|
|
|
if (streamHandles.TryGetValue(bitmap, out handle))
|
|
|
{
|
|
|
streamHandles.Remove(bitmap);
|
|
|
handle.Dispose();
|
|
|
}
|
|
|
}
|
|
|
return true;
|
|
|
}
|
|
|
return false;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Closes a previously opened multi-page bitmap and, when the bitmap was not opened read-only,
|
|
|
/// applies any changes made to it.
|
|
|
/// On success the handle will be reset to null.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">Handle to a FreeImage multi-paged bitmap.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public static bool CloseMultiBitmapEx(ref FIMULTIBITMAP bitmap)
|
|
|
{
|
|
|
return CloseMultiBitmapEx(ref bitmap, FREE_IMAGE_SAVE_FLAGS.DEFAULT);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Closes a previously opened multi-page bitmap and, when the bitmap was not opened read-only,
|
|
|
/// applies any changes made to it.
|
|
|
/// On success the handle will be reset to null.
|
|
|
/// </summary>
|
|
|
/// <param name="bitmap">Handle to a FreeImage multi-paged bitmap.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public static bool CloseMultiBitmapEx(ref FIMULTIBITMAP bitmap, FREE_IMAGE_SAVE_FLAGS flags)
|
|
|
{
|
|
|
bool result = false;
|
|
|
if (!bitmap.IsNull)
|
|
|
{
|
|
|
if (CloseMultiBitmap(bitmap, flags))
|
|
|
{
|
|
|
bitmap.SetNull();
|
|
|
result = true;
|
|
|
}
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the number of pages that are locked in a multi-paged bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage multi-paged bitmap.</param>
|
|
|
/// <returns>Number of locked pages.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static int GetLockedPageCount(FIMULTIBITMAP dib)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
int result = 0;
|
|
|
GetLockedPageNumbers(dib, null, ref result);
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves a list locked pages of a multi-paged bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage multi-paged bitmap.</param>
|
|
|
/// <returns>List containing the indexes of the locked pages.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static int[] GetLockedPages(FIMULTIBITMAP dib)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
// Get the number of pages and create an array to save the information
|
|
|
int count = 0;
|
|
|
int[] result = null;
|
|
|
// Get count
|
|
|
if (GetLockedPageNumbers(dib, result, ref count))
|
|
|
{
|
|
|
result = new int[count];
|
|
|
// Fill array
|
|
|
if (!GetLockedPageNumbers(dib, result, ref count))
|
|
|
{
|
|
|
result = null;
|
|
|
}
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Loads a FreeImage multi-paged bitmap from a stream and returns the
|
|
|
/// FreeImage memory stream used as temporary buffer.
|
|
|
/// The bitmap can not be modified by calling
|
|
|
/// <see cref="FreeImage.AppendPage(FIMULTIBITMAP,FIBITMAP)"/>,
|
|
|
/// <see cref="FreeImage.InsertPage(FIMULTIBITMAP,Int32,FIBITMAP)"/>,
|
|
|
/// <see cref="FreeImage.MovePage(FIMULTIBITMAP,Int32,Int32)"/> or
|
|
|
/// <see cref="FreeImage.DeletePage(FIMULTIBITMAP,Int32)"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">The stream to read from.</param>
|
|
|
/// <param name="format">Format of the image.</param>
|
|
|
/// <param name="flags">Flags to enable or disable plugin-features.</param>
|
|
|
/// <param name="memory">The temporary memory buffer used to load the bitmap.</param>
|
|
|
/// <returns>Handle to a FreeImage multi-paged bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="stream"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// <paramref name="stream"/> can not read.</exception>
|
|
|
public static FIMULTIBITMAP LoadMultiBitmapFromStream(
|
|
|
Stream stream,
|
|
|
FREE_IMAGE_FORMAT format,
|
|
|
FREE_IMAGE_LOAD_FLAGS flags,
|
|
|
out FIMEMORY memory)
|
|
|
{
|
|
|
if (stream == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("stream");
|
|
|
}
|
|
|
if (!stream.CanRead)
|
|
|
{
|
|
|
throw new ArgumentException("stream");
|
|
|
}
|
|
|
const int blockSize = 1024;
|
|
|
int bytesRead;
|
|
|
byte[] buffer = new byte[blockSize];
|
|
|
|
|
|
stream = stream.CanSeek ? stream : new StreamWrapper(stream, true);
|
|
|
memory = OpenMemory(IntPtr.Zero, 0);
|
|
|
|
|
|
do
|
|
|
{
|
|
|
bytesRead = stream.Read(buffer, 0, blockSize);
|
|
|
WriteMemory(buffer, (uint)blockSize, (uint)1, memory);
|
|
|
}
|
|
|
while (bytesRead == blockSize);
|
|
|
|
|
|
return LoadMultiBitmapFromMemory(format, memory, flags);
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Filetype functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Orders FreeImage to analyze the bitmap signature.
|
|
|
/// In case the stream is not seekable, the stream will have been used
|
|
|
/// and must be recreated for loading.
|
|
|
/// </summary>
|
|
|
/// <param name="stream">Name of the stream to analyze.</param>
|
|
|
/// <returns>Type of the bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="stream"/> is null.</exception>
|
|
|
/// <exception cref="ArgumentException">
|
|
|
/// <paramref name="stream"/> can not read.</exception>
|
|
|
public static FREE_IMAGE_FORMAT GetFileTypeFromStream(Stream stream)
|
|
|
{
|
|
|
if (stream == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("stream");
|
|
|
}
|
|
|
if (!stream.CanRead)
|
|
|
{
|
|
|
throw new ArgumentException("stream is not capable of reading.");
|
|
|
}
|
|
|
// Wrap the stream if it cannot seek
|
|
|
stream = (stream.CanSeek) ? stream : new StreamWrapper(stream, true);
|
|
|
// Create a 'FreeImageIO' structure for the stream
|
|
|
FreeImageIO io = FreeImageStreamIO.io;
|
|
|
using (fi_handle handle = new fi_handle(stream))
|
|
|
{
|
|
|
return GetFileTypeFromHandle(ref io, handle, 0);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Pixel access functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves an hBitmap for a FreeImage bitmap.
|
|
|
/// Call FreeHbitmap(IntPtr) to free the handle.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="hdc">A reference device context.
|
|
|
/// Use IntPtr.Zero if no reference is available.</param>
|
|
|
/// <param name="unload">When true dib will be unloaded if the function succeeded.</param>
|
|
|
/// <returns>The hBitmap for the FreeImage bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static unsafe IntPtr GetHbitmap(FIBITMAP dib, IntPtr hdc, bool unload)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
IntPtr hBitmap = IntPtr.Zero;
|
|
|
bool release = false;
|
|
|
IntPtr ppvBits = IntPtr.Zero;
|
|
|
// Check if we have destination
|
|
|
if (release = (hdc == IntPtr.Zero))
|
|
|
{
|
|
|
// We don't so request dc
|
|
|
hdc = GetDC(IntPtr.Zero);
|
|
|
}
|
|
|
if (hdc != IntPtr.Zero)
|
|
|
{
|
|
|
// Get pointer to the infoheader of the bitmap
|
|
|
IntPtr info = GetInfo(dib);
|
|
|
// Create a bitmap in the dc
|
|
|
hBitmap = CreateDIBSection(hdc, info, DIB_RGB_COLORS, out ppvBits, IntPtr.Zero, 0);
|
|
|
if (hBitmap != IntPtr.Zero && ppvBits != IntPtr.Zero)
|
|
|
{
|
|
|
// Copy the data into the dc
|
|
|
CopyMemory(ppvBits, GetBits(dib), (GetHeight(dib) * GetPitch(dib)));
|
|
|
// Success: we unload the bitmap
|
|
|
if (unload)
|
|
|
{
|
|
|
Unload(dib);
|
|
|
}
|
|
|
}
|
|
|
// We have to release the dc
|
|
|
if (release)
|
|
|
{
|
|
|
ReleaseDC(IntPtr.Zero, hdc);
|
|
|
}
|
|
|
}
|
|
|
return hBitmap;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns an HBITMAP created by the <c>CreateDIBitmap()</c> function which in turn
|
|
|
/// has always the same color depth as the reference DC, which may be provided
|
|
|
/// through <paramref name="hdc"/>. The desktop DC will be used,
|
|
|
/// if <c>IntPtr.Zero</c> DC is specified.
|
|
|
/// Call <see cref="FreeImage.FreeHbitmap(IntPtr)"/> to free the handle.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="hdc">Handle to a device context.</param>
|
|
|
/// <param name="unload">When true the structure will be unloaded on success.
|
|
|
/// If the function failed and returned false, the bitmap was not unloaded.</param>
|
|
|
/// <returns>If the function succeeds, the return value is a handle to the
|
|
|
/// compatible bitmap. If the function fails, the return value is <see cref="IntPtr.Zero"/>.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static IntPtr GetBitmapForDevice(FIBITMAP dib, IntPtr hdc, bool unload)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
IntPtr hbitmap = IntPtr.Zero;
|
|
|
bool release = false;
|
|
|
if (release = (hdc == IntPtr.Zero))
|
|
|
{
|
|
|
hdc = GetDC(IntPtr.Zero);
|
|
|
}
|
|
|
if (hdc != IntPtr.Zero)
|
|
|
{
|
|
|
hbitmap = CreateDIBitmap(
|
|
|
hdc,
|
|
|
GetInfoHeader(dib),
|
|
|
CBM_INIT,
|
|
|
GetBits(dib),
|
|
|
GetInfo(dib),
|
|
|
DIB_RGB_COLORS);
|
|
|
if (unload)
|
|
|
{
|
|
|
Unload(dib);
|
|
|
}
|
|
|
if (release)
|
|
|
{
|
|
|
ReleaseDC(IntPtr.Zero, hdc);
|
|
|
}
|
|
|
}
|
|
|
return hbitmap;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a FreeImage DIB from a Device Context/Compatible Bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="hbitmap">Handle to the bitmap.</param>
|
|
|
/// <param name="hdc">Handle to a device context.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="hbitmap"/> is null.</exception>
|
|
|
public unsafe static FIBITMAP CreateFromHbitmap(IntPtr hbitmap, IntPtr hdc)
|
|
|
{
|
|
|
if (hbitmap == IntPtr.Zero)
|
|
|
{
|
|
|
throw new ArgumentNullException("hbitmap");
|
|
|
}
|
|
|
|
|
|
FIBITMAP dib = new FIBITMAP();
|
|
|
BITMAP bm;
|
|
|
uint colors;
|
|
|
bool release;
|
|
|
|
|
|
if (GetObject(hbitmap, sizeof(BITMAP), (IntPtr)(&bm)) != 0)
|
|
|
{
|
|
|
dib = Allocate(bm.bmWidth, bm.bmHeight, bm.bmBitsPixel, 0, 0, 0);
|
|
|
if (!dib.IsNull)
|
|
|
{
|
|
|
colors = GetColorsUsed(dib);
|
|
|
if (release = (hdc == IntPtr.Zero))
|
|
|
{
|
|
|
hdc = GetDC(IntPtr.Zero);
|
|
|
}
|
|
|
if (GetDIBits(
|
|
|
hdc,
|
|
|
hbitmap,
|
|
|
0,
|
|
|
(uint)bm.bmHeight,
|
|
|
GetBits(dib),
|
|
|
GetInfo(dib),
|
|
|
DIB_RGB_COLORS) != 0)
|
|
|
{
|
|
|
if (colors != 0)
|
|
|
{
|
|
|
BITMAPINFOHEADER* bmih = (BITMAPINFOHEADER*)GetInfo(dib);
|
|
|
bmih[0].biClrImportant = bmih[0].biClrUsed = colors;
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
UnloadEx(ref dib);
|
|
|
}
|
|
|
if (release)
|
|
|
{
|
|
|
ReleaseDC(IntPtr.Zero, hdc);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
return dib;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Frees a bitmap handle.
|
|
|
/// </summary>
|
|
|
/// <param name="hbitmap">Handle to a bitmap.</param>
|
|
|
/// <returns>True on success, false on failure.</returns>
|
|
|
public static bool FreeHbitmap(IntPtr hbitmap)
|
|
|
{
|
|
|
return DeleteObject(hbitmap);
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Bitmap information functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves a DIB's resolution in X-direction measured in 'dots per inch' (DPI) and not in
|
|
|
/// 'dots per meter'.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>The resolution in 'dots per inch'.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static uint GetResolutionX(FIBITMAP dib)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
return (uint)(0.5d + 0.0254d * GetDotsPerMeterX(dib));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves a DIB's resolution in Y-direction measured in 'dots per inch' (DPI) and not in
|
|
|
/// 'dots per meter'.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>The resolution in 'dots per inch'.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static uint GetResolutionY(FIBITMAP dib)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
return (uint)(0.5d + 0.0254d * GetDotsPerMeterY(dib));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets a DIB's resolution in X-direction measured in 'dots per inch' (DPI) and not in
|
|
|
/// 'dots per meter'.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="res">The new resolution in 'dots per inch'.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static void SetResolutionX(FIBITMAP dib, uint res)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
SetDotsPerMeterX(dib, (uint)((double)res / 0.0254d + 0.5d));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets a DIB's resolution in Y-direction measured in 'dots per inch' (DPI) and not in
|
|
|
/// 'dots per meter'.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="res">The new resolution in 'dots per inch'.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static void SetResolutionY(FIBITMAP dib, uint res)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
SetDotsPerMeterY(dib, (uint)((double)res / 0.0254d + 0.5d));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns whether the image is a greyscale image or not.
|
|
|
/// The function scans all colors in the bitmaps palette for entries where
|
|
|
/// red, green and blue are not all the same (not a grey color).
|
|
|
/// Supports 1-, 4- and 8-bit bitmaps.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>True if the image is a greyscale image, else false.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static unsafe bool IsGreyscaleImage(FIBITMAP dib)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
bool result = true;
|
|
|
uint bpp = GetBPP(dib);
|
|
|
switch (bpp)
|
|
|
{
|
|
|
case 1:
|
|
|
case 4:
|
|
|
case 8:
|
|
|
RGBQUAD* palette = (RGBQUAD*)GetPalette(dib);
|
|
|
uint paletteLength = GetColorsUsed(dib);
|
|
|
for (int i = 0; i < paletteLength; i++)
|
|
|
{
|
|
|
if (palette[i].rgbRed != palette[i].rgbGreen ||
|
|
|
palette[i].rgbRed != palette[i].rgbBlue)
|
|
|
{
|
|
|
result = false;
|
|
|
break;
|
|
|
}
|
|
|
}
|
|
|
break;
|
|
|
default:
|
|
|
result = false;
|
|
|
break;
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns a structure that represents the palette of a FreeImage bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>A structure representing the bitmaps palette.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static Palette GetPaletteEx(FIBITMAP dib)
|
|
|
{
|
|
|
return new Palette(dib);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the <see cref="BITMAPINFOHEADER"/> structure of a FreeImage bitmap.
|
|
|
/// The structure is a copy, so changes will have no effect on
|
|
|
/// the bitmap itself.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns><see cref="BITMAPINFOHEADER"/> structure of the bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static unsafe BITMAPINFOHEADER GetInfoHeaderEx(FIBITMAP dib)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
return *(BITMAPINFOHEADER*)GetInfoHeader(dib);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the <see cref="BITMAPINFO"/> structure of a FreeImage bitmap.
|
|
|
/// The structure is a copy, so changes will have no effect on
|
|
|
/// the bitmap itself.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns><see cref="BITMAPINFO"/> structure of the bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static BITMAPINFO GetInfoEx(FIBITMAP dib)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
BITMAPINFO result = new BITMAPINFO();
|
|
|
result.bmiHeader = GetInfoHeaderEx(dib);
|
|
|
IntPtr ptr = GetPalette(dib);
|
|
|
if (ptr == IntPtr.Zero)
|
|
|
{
|
|
|
result.bmiColors = new RGBQUAD[0];
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
result.bmiColors = new MemoryArray<RGBQUAD>(ptr, (int)result.bmiHeader.biClrUsed).Data;
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the pixelformat of the bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns><see cref="System.Drawing.Imaging.PixelFormat"/> of the bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static PixelFormat GetPixelFormat(FIBITMAP dib)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
|
|
|
PixelFormat result = PixelFormat.Undefined;
|
|
|
|
|
|
if (GetImageType(dib) == FREE_IMAGE_TYPE.FIT_BITMAP)
|
|
|
{
|
|
|
switch (GetBPP(dib))
|
|
|
{
|
|
|
case 1:
|
|
|
result = PixelFormat.Format1bppIndexed;
|
|
|
break;
|
|
|
case 4:
|
|
|
result = PixelFormat.Format4bppIndexed;
|
|
|
break;
|
|
|
case 8:
|
|
|
result = PixelFormat.Format8bppIndexed;
|
|
|
break;
|
|
|
case 16:
|
|
|
if ((GetBlueMask(dib) == FI16_565_BLUE_MASK) &&
|
|
|
(GetGreenMask(dib) == FI16_565_GREEN_MASK) &&
|
|
|
(GetRedMask(dib) == FI16_565_RED_MASK))
|
|
|
{
|
|
|
result = PixelFormat.Format16bppRgb565;
|
|
|
}
|
|
|
if ((GetBlueMask(dib) == FI16_555_BLUE_MASK) &&
|
|
|
(GetGreenMask(dib) == FI16_555_GREEN_MASK) &&
|
|
|
(GetRedMask(dib) == FI16_555_RED_MASK))
|
|
|
{
|
|
|
result = PixelFormat.Format16bppRgb555;
|
|
|
}
|
|
|
break;
|
|
|
case 24:
|
|
|
result = PixelFormat.Format24bppRgb;
|
|
|
break;
|
|
|
case 32:
|
|
|
result = PixelFormat.Format32bppArgb;
|
|
|
break;
|
|
|
}
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves all parameters needed to create a new FreeImage bitmap from
|
|
|
/// the format of a .NET <see cref="System.Drawing.Image"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="format">The <see cref="System.Drawing.Imaging.PixelFormat"/>
|
|
|
/// of the .NET <see cref="System.Drawing.Image"/>.</param>
|
|
|
/// <param name="type">Returns the type used for the new bitmap.</param>
|
|
|
/// <param name="bpp">Returns the color depth for the new bitmap.</param>
|
|
|
/// <param name="red_mask">Returns the red_mask for the new bitmap.</param>
|
|
|
/// <param name="green_mask">Returns the green_mask for the new bitmap.</param>
|
|
|
/// <param name="blue_mask">Returns the blue_mask for the new bitmap.</param>
|
|
|
/// <returns>True in case a matching conversion exists; else false.
|
|
|
/// </returns>
|
|
|
public static bool GetFormatParameters(
|
|
|
PixelFormat format,
|
|
|
out FREE_IMAGE_TYPE type,
|
|
|
out uint bpp,
|
|
|
out uint red_mask,
|
|
|
out uint green_mask,
|
|
|
out uint blue_mask)
|
|
|
{
|
|
|
bool result = false;
|
|
|
type = FREE_IMAGE_TYPE.FIT_UNKNOWN;
|
|
|
bpp = 0;
|
|
|
red_mask = 0;
|
|
|
green_mask = 0;
|
|
|
blue_mask = 0;
|
|
|
switch (format)
|
|
|
{
|
|
|
case PixelFormat.Format1bppIndexed:
|
|
|
type = FREE_IMAGE_TYPE.FIT_BITMAP;
|
|
|
bpp = 1;
|
|
|
result = true;
|
|
|
break;
|
|
|
case PixelFormat.Format4bppIndexed:
|
|
|
type = FREE_IMAGE_TYPE.FIT_BITMAP;
|
|
|
bpp = 4;
|
|
|
result = true;
|
|
|
break;
|
|
|
case PixelFormat.Format8bppIndexed:
|
|
|
type = FREE_IMAGE_TYPE.FIT_BITMAP;
|
|
|
bpp = 8;
|
|
|
result = true;
|
|
|
break;
|
|
|
case PixelFormat.Format16bppRgb565:
|
|
|
type = FREE_IMAGE_TYPE.FIT_BITMAP;
|
|
|
bpp = 16;
|
|
|
red_mask = FI16_565_RED_MASK;
|
|
|
green_mask = FI16_565_GREEN_MASK;
|
|
|
blue_mask = FI16_565_BLUE_MASK;
|
|
|
result = true;
|
|
|
break;
|
|
|
case PixelFormat.Format16bppRgb555:
|
|
|
case PixelFormat.Format16bppArgb1555:
|
|
|
type = FREE_IMAGE_TYPE.FIT_BITMAP;
|
|
|
bpp = 16;
|
|
|
red_mask = FI16_555_RED_MASK;
|
|
|
green_mask = FI16_555_GREEN_MASK;
|
|
|
blue_mask = FI16_555_BLUE_MASK;
|
|
|
result = true;
|
|
|
break;
|
|
|
case PixelFormat.Format24bppRgb:
|
|
|
type = FREE_IMAGE_TYPE.FIT_BITMAP;
|
|
|
bpp = 24;
|
|
|
red_mask = FI_RGBA_RED_MASK;
|
|
|
green_mask = FI_RGBA_GREEN_MASK;
|
|
|
blue_mask = FI_RGBA_BLUE_MASK;
|
|
|
result = true;
|
|
|
break;
|
|
|
case PixelFormat.Format32bppRgb:
|
|
|
case PixelFormat.Format32bppArgb:
|
|
|
case PixelFormat.Format32bppPArgb:
|
|
|
type = FREE_IMAGE_TYPE.FIT_BITMAP;
|
|
|
bpp = 32;
|
|
|
red_mask = FI_RGBA_RED_MASK;
|
|
|
green_mask = FI_RGBA_GREEN_MASK;
|
|
|
blue_mask = FI_RGBA_BLUE_MASK;
|
|
|
result = true;
|
|
|
break;
|
|
|
case PixelFormat.Format16bppGrayScale:
|
|
|
type = FREE_IMAGE_TYPE.FIT_UINT16;
|
|
|
bpp = 16;
|
|
|
result = true;
|
|
|
break;
|
|
|
case PixelFormat.Format48bppRgb:
|
|
|
type = FREE_IMAGE_TYPE.FIT_RGB16;
|
|
|
bpp = 48;
|
|
|
result = true;
|
|
|
break;
|
|
|
case PixelFormat.Format64bppArgb:
|
|
|
case PixelFormat.Format64bppPArgb:
|
|
|
type = FREE_IMAGE_TYPE.FIT_RGBA16;
|
|
|
bpp = 64;
|
|
|
result = true;
|
|
|
break;
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the <see cref="FREE_IMAGE_FORMAT"/> for the specified
|
|
|
/// <see cref="ImageFormat"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="imageFormat">The <see cref="ImageFormat"/>
|
|
|
/// for which to return the corresponding <see cref="FREE_IMAGE_FORMAT"/>.</param>
|
|
|
/// <returns>The <see cref="FREE_IMAGE_FORMAT"/> for the specified
|
|
|
/// <see cref="ImageFormat"/></returns>
|
|
|
public static FREE_IMAGE_FORMAT GetFormat(ImageFormat imageFormat)
|
|
|
{
|
|
|
if (imageFormat != null)
|
|
|
{
|
|
|
if (imageFormat.Equals(ImageFormat.Bmp))
|
|
|
return FREE_IMAGE_FORMAT.FIF_BMP;
|
|
|
if (imageFormat.Equals(ImageFormat.Gif))
|
|
|
return FREE_IMAGE_FORMAT.FIF_GIF;
|
|
|
if (imageFormat.Equals(ImageFormat.Icon))
|
|
|
return FREE_IMAGE_FORMAT.FIF_ICO;
|
|
|
if (imageFormat.Equals(ImageFormat.Jpeg))
|
|
|
return FREE_IMAGE_FORMAT.FIF_JPEG;
|
|
|
if (imageFormat.Equals(ImageFormat.Png))
|
|
|
return FREE_IMAGE_FORMAT.FIF_PNG;
|
|
|
if (imageFormat.Equals(ImageFormat.Tiff))
|
|
|
return FREE_IMAGE_FORMAT.FIF_TIFF;
|
|
|
}
|
|
|
return FREE_IMAGE_FORMAT.FIF_UNKNOWN;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves all parameters needed to create a new FreeImage bitmap from
|
|
|
/// raw bits <see cref="System.Drawing.Image"/>.
|
|
|
/// </summary>
|
|
|
/// <param name="type">The <see cref="FREE_IMAGE_TYPE"/>
|
|
|
/// of the data in memory.</param>
|
|
|
/// <param name="bpp">The color depth for the data.</param>
|
|
|
/// <param name="red_mask">Returns the red_mask for the data.</param>
|
|
|
/// <param name="green_mask">Returns the green_mask for the data.</param>
|
|
|
/// <param name="blue_mask">Returns the blue_mask for the data.</param>
|
|
|
/// <returns>True in case a matching conversion exists; else false.
|
|
|
/// </returns>
|
|
|
public static bool GetTypeParameters(
|
|
|
FREE_IMAGE_TYPE type,
|
|
|
int bpp,
|
|
|
out uint red_mask,
|
|
|
out uint green_mask,
|
|
|
out uint blue_mask)
|
|
|
{
|
|
|
bool result = false;
|
|
|
red_mask = 0;
|
|
|
green_mask = 0;
|
|
|
blue_mask = 0;
|
|
|
switch (type)
|
|
|
{
|
|
|
case FREE_IMAGE_TYPE.FIT_BITMAP:
|
|
|
switch (bpp)
|
|
|
{
|
|
|
case 1:
|
|
|
case 4:
|
|
|
case 8:
|
|
|
result = true;
|
|
|
break;
|
|
|
case 16:
|
|
|
result = true;
|
|
|
red_mask = FI16_555_RED_MASK;
|
|
|
green_mask = FI16_555_GREEN_MASK;
|
|
|
blue_mask = FI16_555_BLUE_MASK;
|
|
|
break;
|
|
|
case 24:
|
|
|
case 32:
|
|
|
result = true;
|
|
|
red_mask = FI_RGBA_RED_MASK;
|
|
|
green_mask = FI_RGBA_GREEN_MASK;
|
|
|
blue_mask = FI_RGBA_BLUE_MASK;
|
|
|
break;
|
|
|
}
|
|
|
break;
|
|
|
case FREE_IMAGE_TYPE.FIT_UNKNOWN:
|
|
|
break;
|
|
|
default:
|
|
|
result = true;
|
|
|
break;
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares two FreeImage bitmaps.
|
|
|
/// </summary>
|
|
|
/// <param name="dib1">The first bitmap to compare.</param>
|
|
|
/// <param name="dib2">The second bitmap to compare.</param>
|
|
|
/// <param name="flags">Determines which components of the bitmaps will be compared.</param>
|
|
|
/// <returns>True in case both bitmaps match the compare conditions, false otherwise.</returns>
|
|
|
public static bool Compare(FIBITMAP dib1, FIBITMAP dib2, FREE_IMAGE_COMPARE_FLAGS flags)
|
|
|
{
|
|
|
// Check whether one bitmap is null
|
|
|
if (dib1.IsNull ^ dib2.IsNull)
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
// Check whether both pointers are the same
|
|
|
if (dib1 == dib2)
|
|
|
{
|
|
|
return true;
|
|
|
}
|
|
|
if (((flags & FREE_IMAGE_COMPARE_FLAGS.HEADER) > 0) && (!CompareHeader(dib1, dib2)))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
if (((flags & FREE_IMAGE_COMPARE_FLAGS.PALETTE) > 0) && (!ComparePalette(dib1, dib2)))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
if (((flags & FREE_IMAGE_COMPARE_FLAGS.DATA) > 0) && (!CompareData(dib1, dib2)))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
if (((flags & FREE_IMAGE_COMPARE_FLAGS.METADATA) > 0) && (!CompareMetadata(dib1, dib2)))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
return true;
|
|
|
}
|
|
|
|
|
|
private static unsafe bool CompareHeader(FIBITMAP dib1, FIBITMAP dib2)
|
|
|
{
|
|
|
IntPtr i1 = GetInfoHeader(dib1);
|
|
|
IntPtr i2 = GetInfoHeader(dib2);
|
|
|
return CompareMemory((void*)i1, (void*)i2, sizeof(BITMAPINFOHEADER));
|
|
|
}
|
|
|
|
|
|
private static unsafe bool ComparePalette(FIBITMAP dib1, FIBITMAP dib2)
|
|
|
{
|
|
|
IntPtr pal1 = GetPalette(dib1), pal2 = GetPalette(dib2);
|
|
|
bool hasPalette1 = pal1 != IntPtr.Zero;
|
|
|
bool hasPalette2 = pal2 != IntPtr.Zero;
|
|
|
if (hasPalette1 ^ hasPalette2)
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
if (!hasPalette1)
|
|
|
{
|
|
|
return true;
|
|
|
}
|
|
|
uint colors = GetColorsUsed(dib1);
|
|
|
if (colors != GetColorsUsed(dib2))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
return CompareMemory((void*)pal1, (void*)pal2, sizeof(RGBQUAD) * colors);
|
|
|
}
|
|
|
|
|
|
private static unsafe bool CompareData(FIBITMAP dib1, FIBITMAP dib2)
|
|
|
{
|
|
|
uint width = GetWidth(dib1);
|
|
|
if (width != GetWidth(dib2))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
uint height = GetHeight(dib1);
|
|
|
if (height != GetHeight(dib2))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
uint bpp = GetBPP(dib1);
|
|
|
if (bpp != GetBPP(dib2))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
if (GetColorType(dib1) != GetColorType(dib2))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
FREE_IMAGE_TYPE type = GetImageType(dib1);
|
|
|
if (type != GetImageType(dib2))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
if (GetRedMask(dib1) != GetRedMask(dib2))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
if (GetGreenMask(dib1) != GetGreenMask(dib2))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
if (GetBlueMask(dib1) != GetBlueMask(dib2))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
|
|
|
byte* ptr1, ptr2;
|
|
|
int fullBytes;
|
|
|
int shift;
|
|
|
uint line = GetLine(dib1);
|
|
|
|
|
|
if (type == FREE_IMAGE_TYPE.FIT_BITMAP)
|
|
|
{
|
|
|
switch (bpp)
|
|
|
{
|
|
|
case 32:
|
|
|
for (int i = 0; i < height; i++)
|
|
|
{
|
|
|
ptr1 = (byte*)GetScanLine(dib1, i);
|
|
|
ptr2 = (byte*)GetScanLine(dib2, i);
|
|
|
if (!CompareMemory(ptr1, ptr2, line))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
}
|
|
|
break;
|
|
|
case 24:
|
|
|
for (int i = 0; i < height; i++)
|
|
|
{
|
|
|
ptr1 = (byte*)GetScanLine(dib1, i);
|
|
|
ptr2 = (byte*)GetScanLine(dib2, i);
|
|
|
if (!CompareMemory(ptr1, ptr2, line))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
}
|
|
|
break;
|
|
|
case 16:
|
|
|
short* sPtr1, sPtr2;
|
|
|
short mask = (short)(GetRedMask(dib1) | GetGreenMask(dib1) | GetBlueMask(dib1));
|
|
|
if (mask == -1)
|
|
|
{
|
|
|
for (int i = 0; i < height; i++)
|
|
|
{
|
|
|
sPtr1 = (short*)GetScanLine(dib1, i);
|
|
|
sPtr2 = (short*)GetScanLine(dib2, i);
|
|
|
if (!CompareMemory(sPtr1, sPtr1, line))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
for (int i = 0; i < height; i++)
|
|
|
{
|
|
|
sPtr1 = (short*)GetScanLine(dib1, i);
|
|
|
sPtr2 = (short*)GetScanLine(dib2, i);
|
|
|
for (int x = 0; x < width; x++)
|
|
|
{
|
|
|
if ((sPtr1[x] & mask) != (sPtr2[x] & mask))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
break;
|
|
|
case 8:
|
|
|
for (int i = 0; i < height; i++)
|
|
|
{
|
|
|
ptr1 = (byte*)GetScanLine(dib1, i);
|
|
|
ptr2 = (byte*)GetScanLine(dib2, i);
|
|
|
if (!CompareMemory(ptr1, ptr2, line))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
}
|
|
|
break;
|
|
|
case 4:
|
|
|
fullBytes = (int)width / 2;
|
|
|
shift = (width % 2) == 0 ? 8 : 4;
|
|
|
for (int i = 0; i < height; i++)
|
|
|
{
|
|
|
ptr1 = (byte*)GetScanLine(dib1, i);
|
|
|
ptr2 = (byte*)GetScanLine(dib2, i);
|
|
|
if (fullBytes != 0)
|
|
|
{
|
|
|
if (!CompareMemory(ptr1, ptr2, fullBytes))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
ptr1 += fullBytes;
|
|
|
ptr2 += fullBytes;
|
|
|
}
|
|
|
if (shift != 8)
|
|
|
{
|
|
|
if ((ptr1[0] >> shift) != (ptr2[0] >> shift))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
break;
|
|
|
case 1:
|
|
|
fullBytes = (int)width / 8;
|
|
|
shift = 8 - ((int)width % 8);
|
|
|
for (int i = 0; i < height; i++)
|
|
|
{
|
|
|
ptr1 = (byte*)GetScanLine(dib1, i);
|
|
|
ptr2 = (byte*)GetScanLine(dib2, i);
|
|
|
if (fullBytes != 0)
|
|
|
{
|
|
|
if (!CompareMemory(ptr1, ptr2, fullBytes))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
ptr1 += fullBytes;
|
|
|
ptr2 += fullBytes;
|
|
|
}
|
|
|
if (shift != 8)
|
|
|
{
|
|
|
if ((ptr1[0] >> shift) != (ptr2[0] >> shift))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
break;
|
|
|
default:
|
|
|
throw new NotSupportedException("Only 1, 4, 8, 16, 24 and 32 bpp bitmaps are supported.");
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
for (int i = 0; i < height; i++)
|
|
|
{
|
|
|
ptr1 = (byte*)GetScanLine(dib1, i);
|
|
|
ptr2 = (byte*)GetScanLine(dib2, i);
|
|
|
if (!CompareMemory(ptr1, ptr2, line))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
return true;
|
|
|
}
|
|
|
|
|
|
private static bool CompareMetadata(FIBITMAP dib1, FIBITMAP dib2)
|
|
|
{
|
|
|
MetadataTag tag1, tag2;
|
|
|
|
|
|
foreach (FREE_IMAGE_MDMODEL metadataModel in FREE_IMAGE_MDMODELS)
|
|
|
{
|
|
|
if (GetMetadataCount(metadataModel, dib1) !=
|
|
|
GetMetadataCount(metadataModel, dib2))
|
|
|
{
|
|
|
return false;
|
|
|
}
|
|
|
if (GetMetadataCount(metadataModel, dib1) == 0)
|
|
|
{
|
|
|
continue;
|
|
|
}
|
|
|
|
|
|
FIMETADATA mdHandle = FindFirstMetadata(metadataModel, dib1, out tag1);
|
|
|
if (mdHandle.IsNull)
|
|
|
{
|
|
|
continue;
|
|
|
}
|
|
|
do
|
|
|
{
|
|
|
if ((!GetMetadata(metadataModel, dib2, tag1.Key, out tag2)) || (tag1 != tag2))
|
|
|
{
|
|
|
FindCloseMetadata(mdHandle);
|
|
|
return false;
|
|
|
}
|
|
|
}
|
|
|
while (FindNextMetadata(mdHandle, out tag1));
|
|
|
FindCloseMetadata(mdHandle);
|
|
|
}
|
|
|
|
|
|
return true;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the FreeImage bitmap's transparency table.
|
|
|
/// The array is empty in case the bitmap has no transparency table.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>The FreeImage bitmap's transparency table.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static unsafe byte[] GetTransparencyTableEx(FIBITMAP dib)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
uint count = GetTransparencyCount(dib);
|
|
|
byte[] result = new byte[count];
|
|
|
byte* ptr = (byte*)GetTransparencyTable(dib);
|
|
|
fixed (byte* dst = result)
|
|
|
{
|
|
|
CopyMemory(dst, ptr, count);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Set the FreeImage bitmap's transparency table. Only affects palletised bitmaps.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="table">The FreeImage bitmap's new transparency table.</param>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> or <paramref name="table"/> is null.</exception>
|
|
|
public static void SetTransparencyTable(FIBITMAP dib, byte[] table)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
if (table == null)
|
|
|
{
|
|
|
throw new ArgumentNullException("table");
|
|
|
}
|
|
|
SetTransparencyTable(dib, table, table.Length);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// This function returns the number of unique colors actually used by the
|
|
|
/// specified 1-, 4-, 8-, 16-, 24- or 32-bit image. This might be different from
|
|
|
/// what function FreeImage_GetColorsUsed() returns, which actually returns the
|
|
|
/// palette size for palletised images. Works for
|
|
|
/// <see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/> type images only.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Returns the number of unique colors used by the image specified or
|
|
|
/// zero, if the image type cannot be handled.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static unsafe int GetUniqueColors(FIBITMAP dib)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
|
|
|
int result = 0;
|
|
|
|
|
|
if (GetImageType(dib) == FREE_IMAGE_TYPE.FIT_BITMAP)
|
|
|
{
|
|
|
BitArray bitArray;
|
|
|
int uniquePalEnts;
|
|
|
int hashcode;
|
|
|
byte[] lut;
|
|
|
int width = (int)GetWidth(dib);
|
|
|
int height = (int)GetHeight(dib);
|
|
|
|
|
|
switch (GetBPP(dib))
|
|
|
{
|
|
|
case 1:
|
|
|
|
|
|
result = 1;
|
|
|
lut = CreateShrunkenPaletteLUT(dib, out uniquePalEnts);
|
|
|
if (uniquePalEnts == 1)
|
|
|
{
|
|
|
break;
|
|
|
}
|
|
|
|
|
|
if ((*(byte*)GetScanLine(dib, 0) & 0x80) == 0)
|
|
|
{
|
|
|
for (int y = 0; y < height; y++)
|
|
|
{
|
|
|
byte* scanline = (byte*)GetScanLine(dib, y);
|
|
|
int mask = 0x80;
|
|
|
for (int x = 0; x < width; x++)
|
|
|
{
|
|
|
if ((scanline[x / 8] & mask) > 0)
|
|
|
{
|
|
|
return 2;
|
|
|
}
|
|
|
mask = (mask == 0x1) ? 0x80 : (mask >> 1);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
for (int y = 0; y < height; y++)
|
|
|
{
|
|
|
byte* scanline = (byte*)GetScanLine(dib, y);
|
|
|
int mask = 0x80;
|
|
|
for (int x = 0; x < width; x++)
|
|
|
{
|
|
|
if ((scanline[x / 8] & mask) == 0)
|
|
|
{
|
|
|
return 2;
|
|
|
}
|
|
|
mask = (mask == 0x1) ? 0x80 : (mask >> 1);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
break;
|
|
|
|
|
|
case 4:
|
|
|
|
|
|
bitArray = new BitArray(0x10);
|
|
|
lut = CreateShrunkenPaletteLUT(dib, out uniquePalEnts);
|
|
|
if (uniquePalEnts == 1)
|
|
|
{
|
|
|
result = 1;
|
|
|
break;
|
|
|
}
|
|
|
|
|
|
for (int y = 0; (y < height) && (result < uniquePalEnts); y++)
|
|
|
{
|
|
|
byte* scanline = (byte*)GetScanLine(dib, y);
|
|
|
bool top = true;
|
|
|
for (int x = 0; (x < width) && (result < uniquePalEnts); x++)
|
|
|
{
|
|
|
if (top)
|
|
|
{
|
|
|
hashcode = lut[scanline[x / 2] >> 4];
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
hashcode = lut[scanline[x / 2] & 0xF];
|
|
|
}
|
|
|
top = !top;
|
|
|
if (!bitArray[hashcode])
|
|
|
{
|
|
|
bitArray[hashcode] = true;
|
|
|
result++;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
break;
|
|
|
|
|
|
case 8:
|
|
|
|
|
|
bitArray = new BitArray(0x100);
|
|
|
lut = CreateShrunkenPaletteLUT(dib, out uniquePalEnts);
|
|
|
if (uniquePalEnts == 1)
|
|
|
{
|
|
|
result = 1;
|
|
|
break;
|
|
|
}
|
|
|
|
|
|
for (int y = 0; (y < height) && (result < uniquePalEnts); y++)
|
|
|
{
|
|
|
byte* scanline = (byte*)GetScanLine(dib, y);
|
|
|
for (int x = 0; (x < width) && (result < uniquePalEnts); x++)
|
|
|
{
|
|
|
hashcode = lut[scanline[x]];
|
|
|
if (!bitArray[hashcode])
|
|
|
{
|
|
|
bitArray[hashcode] = true;
|
|
|
result++;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
break;
|
|
|
|
|
|
case 16:
|
|
|
|
|
|
bitArray = new BitArray(0x10000);
|
|
|
|
|
|
for (int y = 0; y < height; y++)
|
|
|
{
|
|
|
short* scanline = (short*)GetScanLine(dib, y);
|
|
|
for (int x = 0; x < width; x++, scanline++)
|
|
|
{
|
|
|
hashcode = *scanline;
|
|
|
if (!bitArray[hashcode])
|
|
|
{
|
|
|
bitArray[hashcode] = true;
|
|
|
result++;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
break;
|
|
|
|
|
|
case 24:
|
|
|
|
|
|
bitArray = new BitArray(0x1000000);
|
|
|
|
|
|
for (int y = 0; y < height; y++)
|
|
|
{
|
|
|
byte* scanline = (byte*)GetScanLine(dib, y);
|
|
|
for (int x = 0; x < width; x++, scanline += 3)
|
|
|
{
|
|
|
hashcode = *((int*)scanline) & 0x00FFFFFF;
|
|
|
if (!bitArray[hashcode])
|
|
|
{
|
|
|
bitArray[hashcode] = true;
|
|
|
result++;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
break;
|
|
|
|
|
|
case 32:
|
|
|
|
|
|
bitArray = new BitArray(0x1000000);
|
|
|
|
|
|
for (int y = 0; y < height; y++)
|
|
|
{
|
|
|
int* scanline = (int*)GetScanLine(dib, y);
|
|
|
for (int x = 0; x < width; x++, scanline++)
|
|
|
{
|
|
|
hashcode = *scanline & 0x00FFFFFF;
|
|
|
if (!bitArray[hashcode])
|
|
|
{
|
|
|
bitArray[hashcode] = true;
|
|
|
result++;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
break;
|
|
|
}
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Verifies whether the FreeImage bitmap is 16bit 555.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">The FreeImage bitmap to verify.</param>
|
|
|
/// <returns><b>true</b> if the bitmap is RGB16-555; otherwise <b>false</b>.</returns>
|
|
|
public static bool IsRGB555(FIBITMAP dib)
|
|
|
{
|
|
|
return ((GetRedMask(dib) == FI16_555_RED_MASK) &&
|
|
|
(GetGreenMask(dib) == FI16_555_GREEN_MASK) &&
|
|
|
(GetBlueMask(dib) == FI16_555_BLUE_MASK));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Verifies whether the FreeImage bitmap is 16bit 565.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">The FreeImage bitmap to verify.</param>
|
|
|
/// <returns><b>true</b> if the bitmap is RGB16-565; otherwise <b>false</b>.</returns>
|
|
|
public static bool IsRGB565(FIBITMAP dib)
|
|
|
{
|
|
|
return ((GetRedMask(dib) == FI16_565_RED_MASK) &&
|
|
|
(GetGreenMask(dib) == FI16_565_GREEN_MASK) &&
|
|
|
(GetBlueMask(dib) == FI16_565_BLUE_MASK));
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region ICC profile functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a new ICC-Profile for a FreeImage bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="data">The data of the new ICC-Profile.</param>
|
|
|
/// <returns>The new ICC-Profile of the bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static FIICCPROFILE CreateICCProfileEx(FIBITMAP dib, byte[] data)
|
|
|
{
|
|
|
return new FIICCPROFILE(dib, data);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a new ICC-Profile for a FreeImage bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="data">The data of the new ICC-Profile.</param>
|
|
|
/// <param name="size">The number of bytes of <paramref name="data"/> to use.</param>
|
|
|
/// <returns>The new ICC-Profile of the FreeImage bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static FIICCPROFILE CreateICCProfileEx(FIBITMAP dib, byte[] data, int size)
|
|
|
{
|
|
|
return new FIICCPROFILE(dib, data, size);
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Conversion functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a FreeImage bitmap from one color depth to another.
|
|
|
/// If the conversion fails the original FreeImage bitmap is returned.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="conversion">The desired output format.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static FIBITMAP ConvertColorDepth(
|
|
|
FIBITMAP dib,
|
|
|
FREE_IMAGE_COLOR_DEPTH conversion)
|
|
|
{
|
|
|
return ConvertColorDepth(
|
|
|
dib,
|
|
|
conversion,
|
|
|
128,
|
|
|
FREE_IMAGE_DITHER.FID_FS,
|
|
|
FREE_IMAGE_QUANTIZE.FIQ_WUQUANT,
|
|
|
false);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a FreeImage bitmap from one color depth to another.
|
|
|
/// If the conversion fails the original FreeImage bitmap is returned.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="conversion">The desired output format.</param>
|
|
|
/// <param name="unloadSource">When true the structure will be unloaded on success.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static FIBITMAP ConvertColorDepth(
|
|
|
FIBITMAP dib,
|
|
|
FREE_IMAGE_COLOR_DEPTH conversion,
|
|
|
bool unloadSource)
|
|
|
{
|
|
|
return ConvertColorDepth(
|
|
|
dib,
|
|
|
conversion,
|
|
|
128,
|
|
|
FREE_IMAGE_DITHER.FID_FS,
|
|
|
FREE_IMAGE_QUANTIZE.FIQ_WUQUANT,
|
|
|
unloadSource);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a FreeImage bitmap from one color depth to another.
|
|
|
/// If the conversion fails the original FreeImage bitmap is returned.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="conversion">The desired output format.</param>
|
|
|
/// <param name="threshold">Threshold value when converting with
|
|
|
/// <see cref="FREE_IMAGE_COLOR_DEPTH.FICD_01_BPP_THRESHOLD"/>.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static FIBITMAP ConvertColorDepth(
|
|
|
FIBITMAP dib,
|
|
|
FREE_IMAGE_COLOR_DEPTH conversion,
|
|
|
byte threshold)
|
|
|
{
|
|
|
return ConvertColorDepth(
|
|
|
dib,
|
|
|
conversion,
|
|
|
threshold,
|
|
|
FREE_IMAGE_DITHER.FID_FS,
|
|
|
FREE_IMAGE_QUANTIZE.FIQ_WUQUANT,
|
|
|
false);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a FreeImage bitmap from one color depth to another.
|
|
|
/// If the conversion fails the original FreeImage bitmap is returned.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="conversion">The desired output format.</param>
|
|
|
/// <param name="ditherMethod">Dither algorithm when converting
|
|
|
/// with <see cref="FREE_IMAGE_COLOR_DEPTH.FICD_01_BPP_DITHER"/>.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static FIBITMAP ConvertColorDepth(
|
|
|
FIBITMAP dib,
|
|
|
FREE_IMAGE_COLOR_DEPTH conversion,
|
|
|
FREE_IMAGE_DITHER ditherMethod)
|
|
|
{
|
|
|
return ConvertColorDepth(
|
|
|
dib,
|
|
|
conversion,
|
|
|
128,
|
|
|
ditherMethod,
|
|
|
FREE_IMAGE_QUANTIZE.FIQ_WUQUANT,
|
|
|
false);
|
|
|
}
|
|
|
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a FreeImage bitmap from one color depth to another.
|
|
|
/// If the conversion fails the original FreeImage bitmap is returned.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="conversion">The desired output format.</param>
|
|
|
/// <param name="quantizationMethod">The quantization algorithm for conversion to 8-bit color depth.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static FIBITMAP ConvertColorDepth(
|
|
|
FIBITMAP dib,
|
|
|
FREE_IMAGE_COLOR_DEPTH conversion,
|
|
|
FREE_IMAGE_QUANTIZE quantizationMethod)
|
|
|
{
|
|
|
return ConvertColorDepth(
|
|
|
dib,
|
|
|
conversion,
|
|
|
128,
|
|
|
FREE_IMAGE_DITHER.FID_FS,
|
|
|
quantizationMethod,
|
|
|
false);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a FreeImage bitmap from one color depth to another.
|
|
|
/// If the conversion fails the original FreeImage bitmap is returned.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="conversion">The desired output format.</param>
|
|
|
/// <param name="threshold">Threshold value when converting with
|
|
|
/// <see cref="FREE_IMAGE_COLOR_DEPTH.FICD_01_BPP_THRESHOLD"/>.</param>
|
|
|
/// <param name="unloadSource">When true the structure will be unloaded on success.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static FIBITMAP ConvertColorDepth(
|
|
|
FIBITMAP dib,
|
|
|
FREE_IMAGE_COLOR_DEPTH conversion,
|
|
|
byte threshold,
|
|
|
bool unloadSource)
|
|
|
{
|
|
|
return ConvertColorDepth(
|
|
|
dib,
|
|
|
conversion,
|
|
|
threshold,
|
|
|
FREE_IMAGE_DITHER.FID_FS,
|
|
|
FREE_IMAGE_QUANTIZE.FIQ_WUQUANT,
|
|
|
unloadSource);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a FreeImage bitmap from one color depth to another.
|
|
|
/// If the conversion fails the original FreeImage bitmap is returned.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="conversion">The desired output format.</param>
|
|
|
/// <param name="ditherMethod">Dither algorithm when converting with
|
|
|
/// <see cref="FREE_IMAGE_COLOR_DEPTH.FICD_01_BPP_DITHER"/>.</param>
|
|
|
/// <param name="unloadSource">When true the structure will be unloaded on success.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static FIBITMAP ConvertColorDepth(
|
|
|
FIBITMAP dib,
|
|
|
FREE_IMAGE_COLOR_DEPTH conversion,
|
|
|
FREE_IMAGE_DITHER ditherMethod,
|
|
|
bool unloadSource)
|
|
|
{
|
|
|
return ConvertColorDepth(
|
|
|
dib,
|
|
|
conversion,
|
|
|
128,
|
|
|
ditherMethod,
|
|
|
FREE_IMAGE_QUANTIZE.FIQ_WUQUANT,
|
|
|
unloadSource);
|
|
|
}
|
|
|
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a FreeImage bitmap from one color depth to another.
|
|
|
/// If the conversion fails the original FreeImage bitmap is returned.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="conversion">The desired output format.</param>
|
|
|
/// <param name="quantizationMethod">The quantization algorithm for conversion to 8-bit color depth.</param>
|
|
|
/// <param name="unloadSource">When true the structure will be unloaded on success.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static FIBITMAP ConvertColorDepth(
|
|
|
FIBITMAP dib,
|
|
|
FREE_IMAGE_COLOR_DEPTH conversion,
|
|
|
FREE_IMAGE_QUANTIZE quantizationMethod,
|
|
|
bool unloadSource)
|
|
|
{
|
|
|
return ConvertColorDepth(
|
|
|
dib,
|
|
|
conversion,
|
|
|
128,
|
|
|
FREE_IMAGE_DITHER.FID_FS,
|
|
|
quantizationMethod,
|
|
|
unloadSource);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Converts a FreeImage bitmap from one color depth to another.
|
|
|
/// If the conversion fails the original FreeImage bitmap is returned.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="conversion">The desired output format.</param>
|
|
|
/// <param name="threshold">Threshold value when converting with
|
|
|
/// <see cref="FREE_IMAGE_COLOR_DEPTH.FICD_01_BPP_THRESHOLD"/>.</param>
|
|
|
/// <param name="ditherMethod">Dither algorithm when converting with
|
|
|
/// <see cref="FREE_IMAGE_COLOR_DEPTH.FICD_01_BPP_DITHER"/>.</param>
|
|
|
/// <param name="quantizationMethod">The quantization algorithm for conversion to 8-bit color depth.</param>
|
|
|
/// <param name="unloadSource">When true the structure will be unloaded on success.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
internal static FIBITMAP ConvertColorDepth(
|
|
|
FIBITMAP dib,
|
|
|
FREE_IMAGE_COLOR_DEPTH conversion,
|
|
|
byte threshold,
|
|
|
FREE_IMAGE_DITHER ditherMethod,
|
|
|
FREE_IMAGE_QUANTIZE quantizationMethod,
|
|
|
bool unloadSource)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
|
|
|
FIBITMAP result = new FIBITMAP();
|
|
|
FIBITMAP dibTemp = new FIBITMAP();
|
|
|
uint bpp = GetBPP(dib);
|
|
|
bool reorderPalette = ((conversion & FREE_IMAGE_COLOR_DEPTH.FICD_REORDER_PALETTE) > 0);
|
|
|
bool forceGreyscale = ((conversion & FREE_IMAGE_COLOR_DEPTH.FICD_FORCE_GREYSCALE) > 0);
|
|
|
|
|
|
if (GetImageType(dib) == FREE_IMAGE_TYPE.FIT_BITMAP)
|
|
|
{
|
|
|
switch (conversion & (FREE_IMAGE_COLOR_DEPTH)0xFF)
|
|
|
{
|
|
|
case FREE_IMAGE_COLOR_DEPTH.FICD_01_BPP_THRESHOLD:
|
|
|
|
|
|
if (bpp != 1)
|
|
|
{
|
|
|
if (forceGreyscale)
|
|
|
{
|
|
|
result = Threshold(dib, threshold);
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
dibTemp = ConvertTo24Bits(dib);
|
|
|
result = ColorQuantizeEx(dibTemp, quantizationMethod, 2, null, 1);
|
|
|
Unload(dibTemp);
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
bool isGreyscale = IsGreyscaleImage(dib);
|
|
|
if ((forceGreyscale && (!isGreyscale)) ||
|
|
|
(reorderPalette && isGreyscale))
|
|
|
{
|
|
|
result = Threshold(dib, threshold);
|
|
|
}
|
|
|
}
|
|
|
break;
|
|
|
|
|
|
case FREE_IMAGE_COLOR_DEPTH.FICD_01_BPP_DITHER:
|
|
|
|
|
|
if (bpp != 1)
|
|
|
{
|
|
|
if (forceGreyscale)
|
|
|
{
|
|
|
result = Dither(dib, ditherMethod);
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
dibTemp = ConvertTo24Bits(dib);
|
|
|
result = ColorQuantizeEx(dibTemp, quantizationMethod, 2, null, 1);
|
|
|
Unload(dibTemp);
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
bool isGreyscale = IsGreyscaleImage(dib);
|
|
|
if ((forceGreyscale && (!isGreyscale)) ||
|
|
|
(reorderPalette && isGreyscale))
|
|
|
{
|
|
|
result = Dither(dib, ditherMethod);
|
|
|
}
|
|
|
}
|
|
|
break;
|
|
|
|
|
|
case FREE_IMAGE_COLOR_DEPTH.FICD_04_BPP:
|
|
|
|
|
|
if (bpp != 4)
|
|
|
{
|
|
|
// Special case when 1bpp and FIC_PALETTE
|
|
|
if (forceGreyscale ||
|
|
|
((bpp == 1) && (GetColorType(dib) == FREE_IMAGE_COLOR_TYPE.FIC_PALETTE)))
|
|
|
{
|
|
|
dibTemp = ConvertToGreyscale(dib);
|
|
|
result = ConvertTo4Bits(dibTemp);
|
|
|
Unload(dibTemp);
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
dibTemp = ConvertTo24Bits(dib);
|
|
|
result = ColorQuantizeEx(dibTemp, quantizationMethod, 16, null, 4);
|
|
|
Unload(dibTemp);
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
bool isGreyscale = IsGreyscaleImage(dib);
|
|
|
if ((forceGreyscale && (!isGreyscale)) ||
|
|
|
(reorderPalette && isGreyscale))
|
|
|
{
|
|
|
dibTemp = ConvertToGreyscale(dib);
|
|
|
result = ConvertTo4Bits(dibTemp);
|
|
|
Unload(dibTemp);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
break;
|
|
|
|
|
|
case FREE_IMAGE_COLOR_DEPTH.FICD_08_BPP:
|
|
|
|
|
|
if (bpp != 8)
|
|
|
{
|
|
|
if (forceGreyscale)
|
|
|
{
|
|
|
result = ConvertToGreyscale(dib);
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
dibTemp = ConvertTo24Bits(dib);
|
|
|
result = ColorQuantize(dibTemp, quantizationMethod);
|
|
|
Unload(dibTemp);
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
bool isGreyscale = IsGreyscaleImage(dib);
|
|
|
if ((forceGreyscale && (!isGreyscale)) || (reorderPalette && isGreyscale))
|
|
|
{
|
|
|
result = ConvertToGreyscale(dib);
|
|
|
}
|
|
|
}
|
|
|
break;
|
|
|
|
|
|
case FREE_IMAGE_COLOR_DEPTH.FICD_16_BPP_555:
|
|
|
|
|
|
if (forceGreyscale)
|
|
|
{
|
|
|
dibTemp = ConvertToGreyscale(dib);
|
|
|
result = ConvertTo16Bits555(dibTemp);
|
|
|
Unload(dibTemp);
|
|
|
}
|
|
|
else if (bpp != 16 || GetRedMask(dib) != FI16_555_RED_MASK || GetGreenMask(dib) != FI16_555_GREEN_MASK || GetBlueMask(dib) != FI16_555_BLUE_MASK)
|
|
|
{
|
|
|
result = ConvertTo16Bits555(dib);
|
|
|
}
|
|
|
break;
|
|
|
|
|
|
case FREE_IMAGE_COLOR_DEPTH.FICD_16_BPP:
|
|
|
|
|
|
if (forceGreyscale)
|
|
|
{
|
|
|
dibTemp = ConvertToGreyscale(dib);
|
|
|
result = ConvertTo16Bits565(dibTemp);
|
|
|
Unload(dibTemp);
|
|
|
}
|
|
|
else if (bpp != 16 || GetRedMask(dib) != FI16_565_RED_MASK || GetGreenMask(dib) != FI16_565_GREEN_MASK || GetBlueMask(dib) != FI16_565_BLUE_MASK)
|
|
|
{
|
|
|
result = ConvertTo16Bits565(dib);
|
|
|
}
|
|
|
break;
|
|
|
|
|
|
case FREE_IMAGE_COLOR_DEPTH.FICD_24_BPP:
|
|
|
|
|
|
if (forceGreyscale)
|
|
|
{
|
|
|
dibTemp = ConvertToGreyscale(dib);
|
|
|
result = ConvertTo24Bits(dibTemp);
|
|
|
Unload(dibTemp);
|
|
|
}
|
|
|
else if (bpp != 24)
|
|
|
{
|
|
|
result = ConvertTo24Bits(dib);
|
|
|
}
|
|
|
break;
|
|
|
|
|
|
case FREE_IMAGE_COLOR_DEPTH.FICD_32_BPP:
|
|
|
|
|
|
if (forceGreyscale)
|
|
|
{
|
|
|
dibTemp = ConvertToGreyscale(dib);
|
|
|
result = ConvertTo32Bits(dibTemp);
|
|
|
Unload(dibTemp);
|
|
|
}
|
|
|
else if (bpp != 32)
|
|
|
{
|
|
|
result = ConvertTo32Bits(dib);
|
|
|
}
|
|
|
break;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
if (result.IsNull)
|
|
|
{
|
|
|
return dib;
|
|
|
}
|
|
|
if (unloadSource)
|
|
|
{
|
|
|
Unload(dib);
|
|
|
}
|
|
|
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// ColorQuantizeEx is an extension to the <see cref="ColorQuantize(FIBITMAP, FREE_IMAGE_QUANTIZE)"/>
|
|
|
/// method that provides additional options used to quantize a 24-bit image to any
|
|
|
/// number of colors (up to 256), as well as quantize a 24-bit image using a
|
|
|
/// provided palette.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="quantize">Specifies the color reduction algorithm to be used.</param>
|
|
|
/// <param name="PaletteSize">Size of the desired output palette.</param>
|
|
|
/// <param name="ReservePalette">The provided palette.</param>
|
|
|
/// <param name="minColorDepth"><b>true</b> to create a bitmap with the smallest possible
|
|
|
/// color depth for the specified <paramref name="PaletteSize"/>.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
public static FIBITMAP ColorQuantizeEx(FIBITMAP dib, FREE_IMAGE_QUANTIZE quantize, int PaletteSize, RGBQUAD[] ReservePalette, bool minColorDepth)
|
|
|
{
|
|
|
FIBITMAP result;
|
|
|
if (minColorDepth)
|
|
|
{
|
|
|
int bpp;
|
|
|
if (PaletteSize >= 256)
|
|
|
bpp = 8;
|
|
|
else if (PaletteSize > 2)
|
|
|
bpp = 4;
|
|
|
else
|
|
|
bpp = 1;
|
|
|
result = ColorQuantizeEx(dib, quantize, PaletteSize, ReservePalette, bpp);
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
result = ColorQuantizeEx(dib, quantize, PaletteSize, ReservePalette, 8);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// ColorQuantizeEx is an extension to the <see cref="ColorQuantize(FIBITMAP, FREE_IMAGE_QUANTIZE)"/>
|
|
|
/// method that provides additional options used to quantize a 24-bit image to any
|
|
|
/// number of colors (up to 256), as well as quantize a 24-bit image using a
|
|
|
/// partial or full provided palette.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="quantize">Specifies the color reduction algorithm to be used.</param>
|
|
|
/// <param name="PaletteSize">Size of the desired output palette.</param>
|
|
|
/// <param name="ReservePalette">The provided palette.</param>
|
|
|
/// <param name="bpp">The desired color depth of the created image.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
public static FIBITMAP ColorQuantizeEx(FIBITMAP dib, FREE_IMAGE_QUANTIZE quantize, int PaletteSize, RGBQUAD[] ReservePalette, int bpp)
|
|
|
{
|
|
|
unsafe
|
|
|
{
|
|
|
FIBITMAP result = FIBITMAP.Zero;
|
|
|
FIBITMAP temp = FIBITMAP.Zero;
|
|
|
int reservedSize = (ReservePalette == null) ? 0 : ReservePalette.Length;
|
|
|
|
|
|
if (bpp == 8)
|
|
|
{
|
|
|
result = ColorQuantizeEx(dib, quantize, PaletteSize, reservedSize, ReservePalette);
|
|
|
}
|
|
|
else if (bpp == 4)
|
|
|
{
|
|
|
temp = ColorQuantizeEx(dib, quantize, Math.Min(16, PaletteSize), reservedSize, ReservePalette);
|
|
|
if (!temp.IsNull)
|
|
|
{
|
|
|
result = Allocate((int)GetWidth(temp), (int)GetHeight(temp), 4, 0, 0, 0);
|
|
|
CloneMetadata(result, temp);
|
|
|
CopyMemory(GetPalette(result), GetPalette(temp), sizeof(RGBQUAD) * 16);
|
|
|
|
|
|
for (int y = (int)GetHeight(temp) - 1; y >= 0; y--)
|
|
|
{
|
|
|
Scanline<byte> srcScanline = new Scanline<byte>(temp, y);
|
|
|
Scanline<FI4BIT> dstScanline = new Scanline<FI4BIT>(result, y);
|
|
|
|
|
|
for (int x = (int)GetWidth(temp) - 1; x >= 0; x--)
|
|
|
{
|
|
|
dstScanline[x] = srcScanline[x];
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
else if (bpp == 1)
|
|
|
{
|
|
|
temp = ColorQuantizeEx(dib, quantize, 2, reservedSize, ReservePalette);
|
|
|
if (!temp.IsNull)
|
|
|
{
|
|
|
result = Allocate((int)GetWidth(temp), (int)GetHeight(temp), 1, 0, 0, 0);
|
|
|
CloneMetadata(result, temp);
|
|
|
CopyMemory(GetPalette(result), GetPalette(temp), sizeof(RGBQUAD) * 2);
|
|
|
|
|
|
for (int y = (int)GetHeight(temp) - 1; y >= 0; y--)
|
|
|
{
|
|
|
Scanline<byte> srcScanline = new Scanline<byte>(temp, y);
|
|
|
Scanline<FI1BIT> dstScanline = new Scanline<FI1BIT>(result, y);
|
|
|
|
|
|
for (int x = (int)GetWidth(temp) - 1; x >= 0; x--)
|
|
|
{
|
|
|
dstScanline[x] = srcScanline[x];
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
UnloadEx(ref temp);
|
|
|
return result;
|
|
|
}
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Metadata
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies metadata from one FreeImage bitmap to another.
|
|
|
/// </summary>
|
|
|
/// <param name="src">Source FreeImage bitmap containing the metadata.</param>
|
|
|
/// <param name="dst">FreeImage bitmap to copy the metadata to.</param>
|
|
|
/// <param name="flags">Flags to switch different copy modes.</param>
|
|
|
/// <returns>Returns -1 on failure else the number of copied tags.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="src"/> or <paramref name="dst"/> is null.</exception>
|
|
|
public static int CloneMetadataEx(FIBITMAP src, FIBITMAP dst, FREE_IMAGE_METADATA_COPY flags)
|
|
|
{
|
|
|
if (src.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("src");
|
|
|
}
|
|
|
if (dst.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dst");
|
|
|
}
|
|
|
|
|
|
FITAG tag = new FITAG(), tag2 = new FITAG();
|
|
|
int copied = 0;
|
|
|
|
|
|
// Clear all existing metadata
|
|
|
if ((flags & FREE_IMAGE_METADATA_COPY.CLEAR_EXISTING) > 0)
|
|
|
{
|
|
|
foreach (FREE_IMAGE_MDMODEL model in FREE_IMAGE_MDMODELS)
|
|
|
{
|
|
|
if (!SetMetadata(model, dst, null, tag))
|
|
|
{
|
|
|
return -1;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
bool keep = !((flags & FREE_IMAGE_METADATA_COPY.REPLACE_EXISTING) > 0);
|
|
|
|
|
|
foreach (FREE_IMAGE_MDMODEL model in FREE_IMAGE_MDMODELS)
|
|
|
{
|
|
|
FIMETADATA mData = FindFirstMetadata(model, src, out tag);
|
|
|
if (mData.IsNull) continue;
|
|
|
do
|
|
|
{
|
|
|
string key = GetTagKey(tag);
|
|
|
if (!(keep && GetMetadata(model, dst, key, out tag2)))
|
|
|
{
|
|
|
if (SetMetadata(model, dst, key, tag))
|
|
|
{
|
|
|
copied++;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
while (FindNextMetadata(mData, out tag));
|
|
|
FindCloseMetadata(mData);
|
|
|
}
|
|
|
|
|
|
return copied;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the comment of a JPEG, PNG or GIF image.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <returns>Comment of the FreeImage bitmp, or null in case no comment exists.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static string GetImageComment(FIBITMAP dib)
|
|
|
{
|
|
|
string result = null;
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
FITAG tag;
|
|
|
if (GetMetadata(FREE_IMAGE_MDMODEL.FIMD_COMMENTS, dib, "Comment", out tag))
|
|
|
{
|
|
|
MetadataTag metadataTag = new MetadataTag(tag, FREE_IMAGE_MDMODEL.FIMD_COMMENTS);
|
|
|
result = metadataTag.Value as string;
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets the comment of a JPEG, PNG or GIF image.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="comment">New comment of the FreeImage bitmap.
|
|
|
/// Use null to remove the comment.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static bool SetImageComment(FIBITMAP dib, string comment)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
bool result;
|
|
|
if (comment != null)
|
|
|
{
|
|
|
FITAG tag = CreateTag();
|
|
|
MetadataTag metadataTag = new MetadataTag(tag, FREE_IMAGE_MDMODEL.FIMD_COMMENTS);
|
|
|
metadataTag.Value = comment;
|
|
|
result = SetMetadata(FREE_IMAGE_MDMODEL.FIMD_COMMENTS, dib, "Comment", tag);
|
|
|
DeleteTag(tag);
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
result = SetMetadata(FREE_IMAGE_MDMODEL.FIMD_COMMENTS, dib, "Comment", FITAG.Zero);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieve a metadata attached to a FreeImage bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="model">The metadata model to look for.</param>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="key">The metadata field name.</param>
|
|
|
/// <param name="tag">A <see cref="MetadataTag"/> structure returned by the function.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static bool GetMetadata(
|
|
|
FREE_IMAGE_MDMODEL model,
|
|
|
FIBITMAP dib,
|
|
|
string key,
|
|
|
out MetadataTag tag)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
|
|
|
FITAG _tag;
|
|
|
bool result;
|
|
|
if (GetMetadata(model, dib, key, out _tag))
|
|
|
{
|
|
|
tag = new MetadataTag(_tag, model);
|
|
|
result = true;
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
tag = null;
|
|
|
result = false;
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Attach a new metadata tag to a FreeImage bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="model">The metadata model used to store the tag.</param>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="key">The tag field name.</param>
|
|
|
/// <param name="tag">The <see cref="MetadataTag"/> to be attached.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static bool SetMetadata(
|
|
|
FREE_IMAGE_MDMODEL model,
|
|
|
FIBITMAP dib,
|
|
|
string key,
|
|
|
MetadataTag tag)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
return SetMetadata(model, dib, key, tag.tag);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Provides information about the first instance of a tag that matches the metadata model.
|
|
|
/// </summary>
|
|
|
/// <param name="model">The model to match.</param>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="tag">Tag that matches the metadata model.</param>
|
|
|
/// <returns>Unique search handle that can be used to call FindNextMetadata or FindCloseMetadata.
|
|
|
/// Null if the metadata model does not exist.</returns>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static FIMETADATA FindFirstMetadata(
|
|
|
FREE_IMAGE_MDMODEL model,
|
|
|
FIBITMAP dib,
|
|
|
out MetadataTag tag)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
FITAG _tag;
|
|
|
FIMETADATA result = FindFirstMetadata(model, dib, out _tag);
|
|
|
if (result.IsNull)
|
|
|
{
|
|
|
tag = null;
|
|
|
return result;
|
|
|
}
|
|
|
tag = new MetadataTag(_tag, model);
|
|
|
if (metaDataSearchHandler.ContainsKey(result))
|
|
|
{
|
|
|
metaDataSearchHandler[result] = model;
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
metaDataSearchHandler.Add(result, model);
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Find the next tag, if any, that matches the metadata model argument in a previous call
|
|
|
/// to FindFirstMetadata, and then alters the tag object contents accordingly.
|
|
|
/// </summary>
|
|
|
/// <param name="mdhandle">Unique search handle provided by FindFirstMetadata.</param>
|
|
|
/// <param name="tag">Tag that matches the metadata model.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
public static bool FindNextMetadata(FIMETADATA mdhandle, out MetadataTag tag)
|
|
|
{
|
|
|
FITAG _tag;
|
|
|
bool result;
|
|
|
if (FindNextMetadata(mdhandle, out _tag))
|
|
|
{
|
|
|
tag = new MetadataTag(_tag, metaDataSearchHandler[mdhandle]);
|
|
|
result = true;
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
tag = null;
|
|
|
result = false;
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Closes the specified metadata search handle and releases associated resources.
|
|
|
/// </summary>
|
|
|
/// <param name="mdhandle">The handle to close.</param>
|
|
|
public static void FindCloseMetadata(FIMETADATA mdhandle)
|
|
|
{
|
|
|
if (metaDataSearchHandler.ContainsKey(mdhandle))
|
|
|
{
|
|
|
metaDataSearchHandler.Remove(mdhandle);
|
|
|
}
|
|
|
FindCloseMetadata_(mdhandle);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// This dictionary links FIMETADATA handles and FREE_IMAGE_MDMODEL models.
|
|
|
/// </summary>
|
|
|
private static Dictionary<FIMETADATA, FREE_IMAGE_MDMODEL> metaDataSearchHandler
|
|
|
= new Dictionary<FIMETADATA, FREE_IMAGE_MDMODEL>(1);
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Rotation and Flipping
|
|
|
|
|
|
/// <summary>
|
|
|
/// This function rotates a 1-, 8-bit greyscale or a 24-, 32-bit color image by means of 3 shears.
|
|
|
/// 1-bit images rotation is limited to integer multiple of 90<39>.
|
|
|
/// <c>null</c> is returned for other values.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="angle">The angle of rotation.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
public static FIBITMAP Rotate(FIBITMAP dib, double angle)
|
|
|
{
|
|
|
return Rotate(dib, angle, IntPtr.Zero);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// This function rotates a 1-, 8-bit greyscale or a 24-, 32-bit color image by means of 3 shears.
|
|
|
/// 1-bit images rotation is limited to integer multiple of 90<39>.
|
|
|
/// <c>null</c> is returned for other values.
|
|
|
/// </summary>
|
|
|
/// <typeparam name="T">The type of the color to use as background.</typeparam>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="angle">The angle of rotation.</param>
|
|
|
/// <param name="backgroundColor">The color used used to fill the bitmap's background.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
public static FIBITMAP Rotate<T>(FIBITMAP dib, double angle, T? backgroundColor) where T : struct
|
|
|
{
|
|
|
if (backgroundColor.HasValue)
|
|
|
{
|
|
|
GCHandle handle = new GCHandle();
|
|
|
try
|
|
|
{
|
|
|
T[] buffer = new T[] { backgroundColor.Value };
|
|
|
handle = GCHandle.Alloc(buffer, GCHandleType.Pinned);
|
|
|
return Rotate(dib, angle, handle.AddrOfPinnedObject());
|
|
|
}
|
|
|
finally
|
|
|
{
|
|
|
if (handle.IsAllocated)
|
|
|
handle.Free();
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
return Rotate(dib, angle, IntPtr.Zero);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Rotates a 4-bit color FreeImage bitmap.
|
|
|
/// Allowed values for <paramref name="angle"/> are 90, 180 and 270.
|
|
|
/// In case <paramref name="angle"/> is 0 or 360 a clone is returned.
|
|
|
/// 0 is returned for other values or in case the rotation fails.
|
|
|
/// </summary>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="angle">The angle of rotation.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <remarks>
|
|
|
/// This function is kind of temporary due to FreeImage's lack of
|
|
|
/// rotating 4-bit images. It's particularly used by <see cref="FreeImageBitmap"/>'s
|
|
|
/// method RotateFlip. This function will be removed as soon as FreeImage
|
|
|
/// supports rotating 4-bit images.
|
|
|
/// </remarks>
|
|
|
/// <exception cref="ArgumentNullException">
|
|
|
/// <paramref name="dib"/> is null.</exception>
|
|
|
public static unsafe FIBITMAP Rotate4bit(FIBITMAP dib, double angle)
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
{
|
|
|
throw new ArgumentNullException("dib");
|
|
|
}
|
|
|
|
|
|
FIBITMAP result = new FIBITMAP();
|
|
|
int ang = (int)angle;
|
|
|
|
|
|
if ((GetImageType(dib) == FREE_IMAGE_TYPE.FIT_BITMAP) &&
|
|
|
(GetBPP(dib) == 4) &&
|
|
|
((ang % 90) == 0))
|
|
|
{
|
|
|
int width, height, xOrg, yOrg;
|
|
|
Scanline<FI4BIT>[] src, dst;
|
|
|
width = (int)GetWidth(dib);
|
|
|
height = (int)GetHeight(dib);
|
|
|
byte index = 0;
|
|
|
switch (ang)
|
|
|
{
|
|
|
case 90:
|
|
|
result = Allocate(height, width, 4, 0, 0, 0);
|
|
|
if (result.IsNull)
|
|
|
{
|
|
|
break;
|
|
|
}
|
|
|
CopyPalette(dib, result);
|
|
|
src = Get04BitScanlines(dib);
|
|
|
dst = Get04BitScanlines(result);
|
|
|
for (int y = 0; y < width; y++)
|
|
|
{
|
|
|
yOrg = height - 1;
|
|
|
for (int x = 0; x < height; x++, yOrg--)
|
|
|
{
|
|
|
index = src[yOrg][y];
|
|
|
dst[y][x] = index;
|
|
|
}
|
|
|
}
|
|
|
break;
|
|
|
case 180:
|
|
|
result = Allocate(width, height, 4, 0, 0, 0);
|
|
|
if (result.IsNull)
|
|
|
{
|
|
|
break;
|
|
|
}
|
|
|
CopyPalette(dib, result);
|
|
|
src = Get04BitScanlines(dib);
|
|
|
dst = Get04BitScanlines(result);
|
|
|
|
|
|
yOrg = height - 1;
|
|
|
for (int y = 0; y < height; y++, yOrg--)
|
|
|
{
|
|
|
xOrg = width - 1;
|
|
|
for (int x = 0; x < width; x++, xOrg--)
|
|
|
{
|
|
|
index = src[yOrg][xOrg];
|
|
|
dst[y][x] = index;
|
|
|
}
|
|
|
}
|
|
|
break;
|
|
|
case 270:
|
|
|
result = Allocate(height, width, 4, 0, 0, 0);
|
|
|
if (result.IsNull)
|
|
|
{
|
|
|
break;
|
|
|
}
|
|
|
CopyPalette(dib, result);
|
|
|
src = Get04BitScanlines(dib);
|
|
|
dst = Get04BitScanlines(result);
|
|
|
xOrg = width - 1;
|
|
|
for (int y = 0; y < width; y++, xOrg--)
|
|
|
{
|
|
|
for (int x = 0; x < height; x++)
|
|
|
{
|
|
|
index = src[x][xOrg];
|
|
|
dst[y][x] = index;
|
|
|
}
|
|
|
}
|
|
|
break;
|
|
|
case 0:
|
|
|
case 360:
|
|
|
result = Clone(dib);
|
|
|
break;
|
|
|
}
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Upsampling / downsampling
|
|
|
|
|
|
/// <summary>
|
|
|
/// Enlarges or shrinks the FreeImage bitmap selectively per side and fills newly added areas
|
|
|
/// with the specified background color. See remarks for further details.
|
|
|
/// </summary>
|
|
|
/// <typeparam name="T">The type of the specified color.</typeparam>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="left">The number of pixels, the image should be enlarged on its left side.
|
|
|
/// Negative values shrink the image on its left side.</param>
|
|
|
/// <param name="top">The number of pixels, the image should be enlarged on its top side.
|
|
|
/// Negative values shrink the image on its top side.</param>
|
|
|
/// <param name="right">The number of pixels, the image should be enlarged on its right side.
|
|
|
/// Negative values shrink the image on its right side.</param>
|
|
|
/// <param name="bottom">The number of pixels, the image should be enlarged on its bottom side.
|
|
|
/// Negative values shrink the image on its bottom side.</param>
|
|
|
/// <param name="color">The color, the enlarged sides of the image should be filled with.</param>
|
|
|
/// <param name="options">Options that affect the color search process for palletized images.</param>
|
|
|
/// <returns>Handle to a FreeImage bitmap.</returns>
|
|
|
/// <remarks>
|
|
|
/// This function enlarges or shrinks an image selectively per side.
|
|
|
/// The main purpose of this function is to add borders to an image.
|
|
|
/// To add a border to any of the image's sides, a positive integer value must be passed in
|
|
|
/// any of the parameters <paramref name="left"/>, <paramref name="top"/>, <paramref name="right"/>
|
|
|
/// or <paramref name="bottom"/>. This value represents the border's
|
|
|
/// width in pixels. Newly created parts of the image (the border areas) are filled with the
|
|
|
/// specified <paramref name="color"/>.
|
|
|
/// Specifying a negative integer value for a certain side, will shrink or crop the image on
|
|
|
/// this side. Consequently, specifying zero for a certain side will not change the image's
|
|
|
/// extension on that side.
|
|
|
/// <para/>
|
|
|
/// So, calling this function with all parameters <paramref name="left"/>, <paramref name="top"/>,
|
|
|
/// <paramref name="right"/> and <paramref name="bottom"/> set to zero, is
|
|
|
/// effectively the same as calling function <see cref="Clone"/>; setting all parameters
|
|
|
/// <paramref name="left"/>, <paramref name="top"/>, <paramref name="right"/> and
|
|
|
/// <paramref name="bottom"/> to value equal to or smaller than zero, my easily be substituted
|
|
|
/// by a call to function <see cref="Copy"/>. Both these cases produce a new image, which is
|
|
|
/// guaranteed not to be larger than the input image. Thus, since the specified
|
|
|
/// <paramref name="color"/> is not needed in these cases, <paramref name="color"/>
|
|
|
/// may be <c>null</c>.
|
|
|
/// <para/>
|
|
|
/// Both parameters <paramref name="color"/> and <paramref name="options"/> work according to
|
|
|
/// function <see cref="FillBackground<T>"/>. So, please refer to the documentation of
|
|
|
/// <see cref="FillBackground<T>"/> to learn more about parameters <paramref name="color"/>
|
|
|
/// and <paramref name="options"/>. For palletized images, the palette of the input image is
|
|
|
/// transparently copied to the newly created enlarged or shrunken image, so any color look-ups
|
|
|
/// are performed on this palette.
|
|
|
/// </remarks>
|
|
|
/// <example>
|
|
|
/// // create a white color<br/>
|
|
|
/// RGBQUAD c;<br/>
|
|
|
/// c.rgbRed = 0xFF;<br/>
|
|
|
/// c.rgbGreen = 0xFF;<br/>
|
|
|
/// c.rgbBlue = 0xFF;<br/>
|
|
|
/// c.rgbReserved = 0x00;<br/>
|
|
|
/// <br/>
|
|
|
/// // add a white, symmetric 10 pixel wide border to the image<br/>
|
|
|
/// dib2 = FreeImage_EnlargeCanvas(dib, 10, 10, 10, 10, c, FREE_IMAGE_COLOR_OPTIONS.FICO_RGB);<br/>
|
|
|
/// <br/>
|
|
|
/// // add white, 20 pixel wide stripes to the top and bottom side of the image<br/>
|
|
|
/// dib3 = FreeImage_EnlargeCanvas(dib, 0, 20, 0, 20, c, FREE_IMAGE_COLOR_OPTIONS.FICO_RGB);<br/>
|
|
|
/// <br/>
|
|
|
/// // add white, 30 pixel wide stripes to the right side of the image and<br/>
|
|
|
/// // cut off the 40 leftmost pixel columns<br/>
|
|
|
/// dib3 = FreeImage_EnlargeCanvas(dib, -40, 0, 30, 0, c, FREE_IMAGE_COLOR_OPTIONS.FICO_RGB);<br/>
|
|
|
/// </example>
|
|
|
public static FIBITMAP EnlargeCanvas<T>(FIBITMAP dib, int left, int top, int right, int bottom,
|
|
|
T? color, FREE_IMAGE_COLOR_OPTIONS options) where T : struct
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
return FIBITMAP.Zero;
|
|
|
|
|
|
if (!CheckColorType(GetImageType(dib), color))
|
|
|
return FIBITMAP.Zero;
|
|
|
|
|
|
if (color.HasValue)
|
|
|
{
|
|
|
GCHandle handle = new GCHandle();
|
|
|
try
|
|
|
{
|
|
|
T[] buffer = new T[] { color.Value };
|
|
|
handle = GCHandle.Alloc(buffer, GCHandleType.Pinned);
|
|
|
return EnlargeCanvas(dib, left, top, right, bottom, handle.AddrOfPinnedObject(), options);
|
|
|
}
|
|
|
finally
|
|
|
{
|
|
|
if (handle.IsAllocated)
|
|
|
handle.Free();
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
return EnlargeCanvas(dib, left, top, right, bottom, IntPtr.Zero, options);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Color
|
|
|
|
|
|
/// <summary>
|
|
|
/// Sets all pixels of the specified image to the color provided through the
|
|
|
/// <paramref name="color"/> parameter. See remarks for further details.
|
|
|
/// </summary>
|
|
|
/// <typeparam name="T">The type of the specified color.</typeparam>
|
|
|
/// <param name="dib">Handle to a FreeImage bitmap.</param>
|
|
|
/// <param name="color">The color to fill the bitmap with. See remarks for further details.</param>
|
|
|
/// <param name="options">Options that affect the color search process for palletized images.</param>
|
|
|
/// <returns><c>true</c> on success, <c>false</c> on failure.</returns>
|
|
|
/// <remarks>
|
|
|
/// This function sets all pixels of an image to the color provided through
|
|
|
/// the <paramref name="color"/> parameter. <see cref="RGBQUAD"/> is used for standard type images.
|
|
|
/// For non standard type images the underlaying structure is used.
|
|
|
/// <para/>
|
|
|
/// So, <paramref name="color"/> must be of type <see cref="Double"/>, if the image to be filled is of type
|
|
|
/// <see cref="FREE_IMAGE_TYPE.FIT_DOUBLE"/> and must be a <see cref="FIRGBF"/> structure if the
|
|
|
/// image is of type <see cref="FREE_IMAGE_TYPE.FIT_RGBF"/> and so on.
|
|
|
/// <para/>
|
|
|
/// However, the fill color is always specified through a <see cref="RGBQUAD"/> structure
|
|
|
/// for all images of type <see cref="FREE_IMAGE_TYPE.FIT_BITMAP"/>.
|
|
|
/// So, for 32- and 24-bit images, the red, green and blue members of the <see cref="RGBQUAD"/>
|
|
|
/// structure are directly used for the image's red, green and blue channel respectively.
|
|
|
/// Although alpha transparent <see cref="RGBQUAD"/> colors are
|
|
|
/// supported, the alpha channel of a 32-bit image never gets modified by this function.
|
|
|
/// A fill color with an alpha value smaller than 255 gets blended with the image's actual
|
|
|
/// background color, which is determined from the image's bottom-left pixel.
|
|
|
/// So, currently using alpha enabled colors, assumes the image to be unicolor before the
|
|
|
/// fill operation. However, the <see cref="RGBQUAD.rgbReserved"/> field is only taken into account,
|
|
|
/// if option <see cref="FREE_IMAGE_COLOR_OPTIONS.FICO_RGBA"/> has been specified.
|
|
|
/// <para/>
|
|
|
/// For 16-bit images, the red-, green- and blue components of the specified color are
|
|
|
/// transparently translated into either the 16-bit 555 or 565 representation. This depends
|
|
|
/// on the image's actual red- green- and blue masks.
|
|
|
/// <para/>
|
|
|
/// Special attention must be payed for palletized images. Generally, the RGB color specified
|
|
|
/// is looked up in the image's palette. The found palette index is then used to fill the image.
|
|
|
/// There are some option flags, that affect this lookup process:
|
|
|
/// <list type="table">
|
|
|
/// <listheader>
|
|
|
/// <term>Value</term>
|
|
|
/// <description>Meaning</description>
|
|
|
/// </listheader>
|
|
|
/// <item>
|
|
|
/// <term><see cref="FREE_IMAGE_COLOR_OPTIONS.FICO_DEFAULT"/></term>
|
|
|
/// <description>
|
|
|
/// Uses the color, that is nearest to the specified color.
|
|
|
/// This is the default behavior and should always find a
|
|
|
/// color in the palette. However, the visual result may
|
|
|
/// far from what was expected and mainly depends on the
|
|
|
/// image's palette.
|
|
|
/// </description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term><see cref="FREE_IMAGE_COLOR_OPTIONS.FICO_EQUAL_COLOR"/></term>
|
|
|
/// <description>
|
|
|
/// Searches the image's palette for the specified color
|
|
|
/// but only uses the returned palette index, if the specified
|
|
|
/// color exactly matches the palette entry. Of course,
|
|
|
/// depending on the image's actual palette entries, this
|
|
|
/// operation may fail. In this case, the function falls back
|
|
|
/// to option <see cref="FREE_IMAGE_COLOR_OPTIONS.FICO_ALPHA_IS_INDEX"/>
|
|
|
/// and uses the RGBQUAD's rgbReserved member (or its low nibble for 4-bit images
|
|
|
/// or its least significant bit (LSB) for 1-bit images) as
|
|
|
/// the palette index used for the fill operation.
|
|
|
/// </description>
|
|
|
/// </item>
|
|
|
/// <item>
|
|
|
/// <term><see cref="FREE_IMAGE_COLOR_OPTIONS.FICO_ALPHA_IS_INDEX"/></term>
|
|
|
/// <description>
|
|
|
/// Does not perform any color lookup from the palette, but
|
|
|
/// uses the RGBQUAD's alpha channel member rgbReserved as
|
|
|
/// the palette index to be used for the fill operation.
|
|
|
/// However, for 4-bit images, only the low nibble of the
|
|
|
/// rgbReserved member are used and for 1-bit images, only
|
|
|
/// the least significant bit (LSB) is used.
|
|
|
/// </description>
|
|
|
/// </item>
|
|
|
/// </list>
|
|
|
/// </remarks>
|
|
|
public static bool FillBackground<T>(FIBITMAP dib, T color, FREE_IMAGE_COLOR_OPTIONS options)
|
|
|
where T : struct
|
|
|
{
|
|
|
if (dib.IsNull)
|
|
|
return false;
|
|
|
|
|
|
if (!CheckColorType(GetImageType(dib), color))
|
|
|
return false;
|
|
|
|
|
|
GCHandle handle = new GCHandle();
|
|
|
try
|
|
|
{
|
|
|
T[] buffer = new T[] { color };
|
|
|
handle = GCHandle.Alloc(buffer, GCHandleType.Pinned);
|
|
|
return FillBackground(dib, handle.AddrOfPinnedObject(), options);
|
|
|
}
|
|
|
finally
|
|
|
{
|
|
|
if (handle.IsAllocated)
|
|
|
handle.Free();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Wrapper functions
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the next higher possible color depth.
|
|
|
/// </summary>
|
|
|
/// <param name="bpp">Color depth to increase.</param>
|
|
|
/// <returns>The next higher color depth or 0 if there is no valid color depth.</returns>
|
|
|
internal static int GetNextColorDepth(int bpp)
|
|
|
{
|
|
|
int result = 0;
|
|
|
switch (bpp)
|
|
|
{
|
|
|
case 1:
|
|
|
result = 4;
|
|
|
break;
|
|
|
case 4:
|
|
|
result = 8;
|
|
|
break;
|
|
|
case 8:
|
|
|
result = 16;
|
|
|
break;
|
|
|
case 16:
|
|
|
result = 24;
|
|
|
break;
|
|
|
case 24:
|
|
|
result = 32;
|
|
|
break;
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Returns the next lower possible color depth.
|
|
|
/// </summary>
|
|
|
/// <param name="bpp">Color depth to decrease.</param>
|
|
|
/// <returns>The next lower color depth or 0 if there is no valid color depth.</returns>
|
|
|
internal static int GetPrevousColorDepth(int bpp)
|
|
|
{
|
|
|
int result = 0;
|
|
|
switch (bpp)
|
|
|
{
|
|
|
case 32:
|
|
|
result = 24;
|
|
|
break;
|
|
|
case 24:
|
|
|
result = 16;
|
|
|
break;
|
|
|
case 16:
|
|
|
result = 8;
|
|
|
break;
|
|
|
case 8:
|
|
|
result = 4;
|
|
|
break;
|
|
|
case 4:
|
|
|
result = 1;
|
|
|
break;
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Reads a null-terminated c-string.
|
|
|
/// </summary>
|
|
|
/// <param name="ptr">Pointer to the first char of the string.</param>
|
|
|
/// <returns>The converted string.</returns>
|
|
|
internal static unsafe string PtrToStr(byte* ptr)
|
|
|
{
|
|
|
string result = null;
|
|
|
if (ptr != null)
|
|
|
{
|
|
|
System.Text.StringBuilder sb = new System.Text.StringBuilder();
|
|
|
|
|
|
while (*ptr != 0)
|
|
|
{
|
|
|
sb.Append((char)(*(ptr++)));
|
|
|
}
|
|
|
result = sb.ToString();
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
internal static unsafe byte[] CreateShrunkenPaletteLUT(FIBITMAP dib, out int uniqueColors)
|
|
|
{
|
|
|
byte[] result = null;
|
|
|
uniqueColors = 0;
|
|
|
|
|
|
if ((!dib.IsNull) && (GetImageType(dib) == FREE_IMAGE_TYPE.FIT_BITMAP) && (GetBPP(dib) <= 8))
|
|
|
{
|
|
|
int size = (int)GetColorsUsed(dib);
|
|
|
List<RGBQUAD> newPalette = new List<RGBQUAD>(size);
|
|
|
List<byte> lut = new List<byte>(size);
|
|
|
RGBQUAD* palette = (RGBQUAD*)GetPalette(dib);
|
|
|
RGBQUAD color;
|
|
|
int index;
|
|
|
|
|
|
for (int i = 0; i < size; i++)
|
|
|
{
|
|
|
color = palette[i];
|
|
|
color.rgbReserved = 255; // ignore alpha
|
|
|
|
|
|
index = newPalette.IndexOf(color);
|
|
|
if (index < 0)
|
|
|
{
|
|
|
newPalette.Add(color);
|
|
|
lut.Add((byte)(newPalette.Count - 1));
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
lut.Add((byte)index);
|
|
|
}
|
|
|
}
|
|
|
result = lut.ToArray();
|
|
|
uniqueColors = newPalette.Count;
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
internal static PropertyItem CreatePropertyItem()
|
|
|
{
|
|
|
return (PropertyItem)Activator.CreateInstance(typeof(PropertyItem), true);
|
|
|
}
|
|
|
|
|
|
private static unsafe void CopyPalette(FIBITMAP src, FIBITMAP dst)
|
|
|
{
|
|
|
RGBQUAD* orgPal = (RGBQUAD*)GetPalette(src);
|
|
|
RGBQUAD* newPal = (RGBQUAD*)GetPalette(dst);
|
|
|
uint size = (uint)(sizeof(RGBQUAD) * GetColorsUsed(src));
|
|
|
CopyMemory(newPal, orgPal, size);
|
|
|
}
|
|
|
|
|
|
private static unsafe Scanline<FI4BIT>[] Get04BitScanlines(FIBITMAP dib)
|
|
|
{
|
|
|
int height = (int)GetHeight(dib);
|
|
|
Scanline<FI4BIT>[] array = new Scanline<FI4BIT>[height];
|
|
|
for (int i = 0; i < height; i++)
|
|
|
{
|
|
|
array[i] = new Scanline<FI4BIT>(dib, i);
|
|
|
}
|
|
|
return array;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Changes a bitmaps color depth.
|
|
|
/// Used by SaveEx and SaveToStream.
|
|
|
/// </summary>
|
|
|
private static FIBITMAP PrepareBitmapColorDepth(FIBITMAP dibToSave, FREE_IMAGE_FORMAT format, FREE_IMAGE_COLOR_DEPTH colorDepth)
|
|
|
{
|
|
|
FREE_IMAGE_TYPE type = GetImageType(dibToSave);
|
|
|
if (type == FREE_IMAGE_TYPE.FIT_BITMAP)
|
|
|
{
|
|
|
int bpp = (int)GetBPP(dibToSave);
|
|
|
int targetBpp = (int)(colorDepth & FREE_IMAGE_COLOR_DEPTH.FICD_COLOR_MASK);
|
|
|
|
|
|
if (colorDepth != FREE_IMAGE_COLOR_DEPTH.FICD_AUTO)
|
|
|
{
|
|
|
// A fix colordepth was chosen
|
|
|
if (FIFSupportsExportBPP(format, targetBpp))
|
|
|
{
|
|
|
dibToSave = ConvertColorDepth(dibToSave, colorDepth, false);
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
throw new ArgumentException("FreeImage\n\nFreeImage Library plugin " +
|
|
|
GetFormatFromFIF(format) + " is unable to write images with a color depth of " +
|
|
|
targetBpp + " bpp.");
|
|
|
}
|
|
|
}
|
|
|
else
|
|
|
{
|
|
|
// Auto selection was chosen
|
|
|
if (!FIFSupportsExportBPP(format, bpp))
|
|
|
{
|
|
|
// The color depth is not supported
|
|
|
int bppUpper = bpp;
|
|
|
int bppLower = bpp;
|
|
|
// Check from the bitmaps current color depth in both directions
|
|
|
do
|
|
|
{
|
|
|
bppUpper = GetNextColorDepth(bppUpper);
|
|
|
if (FIFSupportsExportBPP(format, bppUpper))
|
|
|
{
|
|
|
dibToSave = ConvertColorDepth(dibToSave, (FREE_IMAGE_COLOR_DEPTH)bppUpper, false);
|
|
|
break;
|
|
|
}
|
|
|
bppLower = GetPrevousColorDepth(bppLower);
|
|
|
if (FIFSupportsExportBPP(format, bppLower))
|
|
|
{
|
|
|
dibToSave = ConvertColorDepth(dibToSave, (FREE_IMAGE_COLOR_DEPTH)bppLower, false);
|
|
|
break;
|
|
|
}
|
|
|
} while (!((bppLower == 0) && (bppUpper == 0)));
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
return dibToSave;
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares blocks of memory.
|
|
|
/// </summary>
|
|
|
/// <param name="buf1">A pointer to a block of memory to compare.</param>
|
|
|
/// <param name="buf2">A pointer to a block of memory to compare.</param>
|
|
|
/// <param name="length">Specifies the number of bytes to be compared.</param>
|
|
|
/// <returns>true, if all bytes compare as equal, false otherwise.</returns>
|
|
|
public static unsafe bool CompareMemory(void* buf1, void* buf2, uint length)
|
|
|
{
|
|
|
return (length == RtlCompareMemory(buf1, buf2, length));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares blocks of memory.
|
|
|
/// </summary>
|
|
|
/// <param name="buf1">A pointer to a block of memory to compare.</param>
|
|
|
/// <param name="buf2">A pointer to a block of memory to compare.</param>
|
|
|
/// <param name="length">Specifies the number of bytes to be compared.</param>
|
|
|
/// <returns>true, if all bytes compare as equal, false otherwise.</returns>
|
|
|
public static unsafe bool CompareMemory(void* buf1, void* buf2, long length)
|
|
|
{
|
|
|
return (length == RtlCompareMemory(buf1, buf2, checked((uint)length)));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares blocks of memory.
|
|
|
/// </summary>
|
|
|
/// <param name="buf1">A pointer to a block of memory to compare.</param>
|
|
|
/// <param name="buf2">A pointer to a block of memory to compare.</param>
|
|
|
/// <param name="length">Specifies the number of bytes to be compared.</param>
|
|
|
/// <returns>true, if all bytes compare as equal, false otherwise.</returns>
|
|
|
public static unsafe bool CompareMemory(IntPtr buf1, IntPtr buf2, uint length)
|
|
|
{
|
|
|
return (length == RtlCompareMemory(buf1.ToPointer(), buf2.ToPointer(), length));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Compares blocks of memory.
|
|
|
/// </summary>
|
|
|
/// <param name="buf1">A pointer to a block of memory to compare.</param>
|
|
|
/// <param name="buf2">A pointer to a block of memory to compare.</param>
|
|
|
/// <param name="length">Specifies the number of bytes to be compared.</param>
|
|
|
/// <returns>true, if all bytes compare as equal, false otherwise.</returns>
|
|
|
public static unsafe bool CompareMemory(IntPtr buf1, IntPtr buf2, long length)
|
|
|
{
|
|
|
return (length == RtlCompareMemory(buf1.ToPointer(), buf2.ToPointer(), checked((uint)length)));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Moves a block of memory from one location to another.
|
|
|
/// </summary>
|
|
|
/// <param name="dst">A pointer to the starting address of the move destination.</param>
|
|
|
/// <param name="src">A pointer to the starting address of the block of memory to be moved.</param>
|
|
|
/// <param name="size">The size of the block of memory to move, in bytes.</param>
|
|
|
public static unsafe void MoveMemory(void* dst, void* src, long size)
|
|
|
{
|
|
|
MoveMemory(dst, src, checked((uint)size));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Moves a block of memory from one location to another.
|
|
|
/// </summary>
|
|
|
/// <param name="dst">A pointer to the starting address of the move destination.</param>
|
|
|
/// <param name="src">A pointer to the starting address of the block of memory to be moved.</param>
|
|
|
/// <param name="size">The size of the block of memory to move, in bytes.</param>
|
|
|
public static unsafe void MoveMemory(IntPtr dst, IntPtr src, uint size)
|
|
|
{
|
|
|
MoveMemory(dst.ToPointer(), src.ToPointer(), size);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Moves a block of memory from one location to another.
|
|
|
/// </summary>
|
|
|
/// <param name="dst">A pointer to the starting address of the move destination.</param>
|
|
|
/// <param name="src">A pointer to the starting address of the block of memory to be moved.</param>
|
|
|
/// <param name="size">The size of the block of memory to move, in bytes.</param>
|
|
|
public static unsafe void MoveMemory(IntPtr dst, IntPtr src, long size)
|
|
|
{
|
|
|
MoveMemory(dst.ToPointer(), src.ToPointer(), checked((uint)size));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies a block of memory from one location to another.
|
|
|
/// </summary>
|
|
|
/// <param name="dest">A pointer to the starting address of the copied block's destination.</param>
|
|
|
/// <param name="src">A pointer to the starting address of the block of memory to copy.</param>
|
|
|
/// <param name="len">The size of the block of memory to copy, in bytes.</param>
|
|
|
/// <remarks>
|
|
|
/// <b>CopyMemory</b> runs faster than <see cref="MoveMemory(void*, void*, uint)"/>.
|
|
|
/// However, if both blocks overlap the result is undefined.
|
|
|
/// </remarks>
|
|
|
public static unsafe void CopyMemory(byte* dest, byte* src, int len)
|
|
|
{
|
|
|
if (len >= 0x10)
|
|
|
{
|
|
|
do
|
|
|
{
|
|
|
*((int*)dest) = *((int*)src);
|
|
|
*((int*)(dest + 4)) = *((int*)(src + 4));
|
|
|
*((int*)(dest + 8)) = *((int*)(src + 8));
|
|
|
*((int*)(dest + 12)) = *((int*)(src + 12));
|
|
|
dest += 0x10;
|
|
|
src += 0x10;
|
|
|
}
|
|
|
while ((len -= 0x10) >= 0x10);
|
|
|
}
|
|
|
if (len > 0)
|
|
|
{
|
|
|
if ((len & 8) != 0)
|
|
|
{
|
|
|
*((int*)dest) = *((int*)src);
|
|
|
*((int*)(dest + 4)) = *((int*)(src + 4));
|
|
|
dest += 8;
|
|
|
src += 8;
|
|
|
}
|
|
|
if ((len & 4) != 0)
|
|
|
{
|
|
|
*((int*)dest) = *((int*)src);
|
|
|
dest += 4;
|
|
|
src += 4;
|
|
|
}
|
|
|
if ((len & 2) != 0)
|
|
|
{
|
|
|
*((short*)dest) = *((short*)src);
|
|
|
dest += 2;
|
|
|
src += 2;
|
|
|
}
|
|
|
if ((len & 1) != 0)
|
|
|
{
|
|
|
*dest = *src;
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies a block of memory from one location to another.
|
|
|
/// </summary>
|
|
|
/// <param name="dest">A pointer to the starting address of the copied block's destination.</param>
|
|
|
/// <param name="src">A pointer to the starting address of the block of memory to copy.</param>
|
|
|
/// <param name="len">The size of the block of memory to copy, in bytes.</param>
|
|
|
/// <remarks>
|
|
|
/// <b>CopyMemory</b> runs faster than <see cref="MoveMemory(void*, void*, long)"/>.
|
|
|
/// However, if both blocks overlap the result is undefined.
|
|
|
/// </remarks>
|
|
|
public static unsafe void CopyMemory(byte* dest, byte* src, long len)
|
|
|
{
|
|
|
CopyMemory(dest, src, checked((int)len));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies a block of memory from one location to another.
|
|
|
/// </summary>
|
|
|
/// <param name="dest">A pointer to the starting address of the copied block's destination.</param>
|
|
|
/// <param name="src">A pointer to the starting address of the block of memory to copy.</param>
|
|
|
/// <param name="len">The size of the block of memory to copy, in bytes.</param>
|
|
|
/// <remarks>
|
|
|
/// <b>CopyMemory</b> runs faster than <see cref="MoveMemory(void*, void*, long)"/>.
|
|
|
/// However, if both blocks overlap the result is undefined.
|
|
|
/// </remarks>
|
|
|
public static unsafe void CopyMemory(void* dest, void* src, long len)
|
|
|
{
|
|
|
CopyMemory((byte*)dest, (byte*)src, checked((int)len));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies a block of memory from one location to another.
|
|
|
/// </summary>
|
|
|
/// <param name="dest">A pointer to the starting address of the copied block's destination.</param>
|
|
|
/// <param name="src">A pointer to the starting address of the block of memory to copy.</param>
|
|
|
/// <param name="len">The size of the block of memory to copy, in bytes.</param>
|
|
|
/// <remarks>
|
|
|
/// <b>CopyMemory</b> runs faster than <see cref="MoveMemory(void*, void*, uint)"/>.
|
|
|
/// However, if both blocks overlap the result is undefined.
|
|
|
/// </remarks>
|
|
|
public static unsafe void CopyMemory(void* dest, void* src, int len)
|
|
|
{
|
|
|
CopyMemory((byte*)dest, (byte*)src, len);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies a block of memory from one location to another.
|
|
|
/// </summary>
|
|
|
/// <param name="dest">A pointer to the starting address of the copied block's destination.</param>
|
|
|
/// <param name="src">A pointer to the starting address of the block of memory to copy.</param>
|
|
|
/// <param name="len">The size of the block of memory to copy, in bytes.</param>
|
|
|
/// <remarks>
|
|
|
/// <b>CopyMemory</b> runs faster than <see cref="MoveMemory(IntPtr, IntPtr, uint)"/>.
|
|
|
/// However, if both blocks overlap the result is undefined.
|
|
|
/// </remarks>
|
|
|
public static unsafe void CopyMemory(IntPtr dest, IntPtr src, int len)
|
|
|
{
|
|
|
CopyMemory((byte*)dest, (byte*)src, len);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies a block of memory from one location to another.
|
|
|
/// </summary>
|
|
|
/// <param name="dest">A pointer to the starting address of the copied block's destination.</param>
|
|
|
/// <param name="src">A pointer to the starting address of the block of memory to copy.</param>
|
|
|
/// <param name="len">The size of the block of memory to copy, in bytes.</param>
|
|
|
/// <remarks>
|
|
|
/// <b>CopyMemory</b> runs faster than <see cref="MoveMemory(IntPtr, IntPtr, long)"/>.
|
|
|
/// However, if both blocks overlap the result is undefined.
|
|
|
/// </remarks>
|
|
|
public static unsafe void CopyMemory(IntPtr dest, IntPtr src, long len)
|
|
|
{
|
|
|
CopyMemory((byte*)dest, (byte*)src, checked((int)len));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies a block of memory into an array.
|
|
|
/// </summary>
|
|
|
/// <param name="dest">An array used as the destination of the copy process.</param>
|
|
|
/// <param name="src">A pointer to the starting address of the block of memory to copy.</param>
|
|
|
/// <param name="len">The size of the block of memory to copy, in bytes.</param>
|
|
|
public static unsafe void CopyMemory(Array dest, void* src, int len)
|
|
|
{
|
|
|
GCHandle handle = GCHandle.Alloc(dest, GCHandleType.Pinned);
|
|
|
try
|
|
|
{
|
|
|
CopyMemory((byte*)handle.AddrOfPinnedObject(), (byte*)src, len);
|
|
|
}
|
|
|
finally
|
|
|
{
|
|
|
handle.Free();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies a block of memory into an array.
|
|
|
/// </summary>
|
|
|
/// <param name="dest">An array used as the destination of the copy process.</param>
|
|
|
/// <param name="src">A pointer to the starting address of the block of memory to copy.</param>
|
|
|
/// <param name="len">The size of the block of memory to copy, in bytes.</param>
|
|
|
public static unsafe void CopyMemory(Array dest, void* src, long len)
|
|
|
{
|
|
|
CopyMemory(dest, (byte*)src, checked((int)len));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies a block of memory into an array.
|
|
|
/// </summary>
|
|
|
/// <param name="dest">An array used as the destination of the copy process.</param>
|
|
|
/// <param name="src">A pointer to the starting address of the block of memory to copy.</param>
|
|
|
/// <param name="len">The size of the block of memory to copy, in bytes.</param>
|
|
|
public static unsafe void CopyMemory(Array dest, IntPtr src, int len)
|
|
|
{
|
|
|
CopyMemory(dest, (byte*)src, len);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies a block of memory into an array.
|
|
|
/// </summary>
|
|
|
/// <param name="dest">An array used as the destination of the copy process.</param>
|
|
|
/// <param name="src">A pointer to the starting address of the block of memory to copy.</param>
|
|
|
/// <param name="len">The size of the block of memory to copy, in bytes.</param>
|
|
|
public static unsafe void CopyMemory(Array dest, IntPtr src, long len)
|
|
|
{
|
|
|
CopyMemory(dest, (byte*)src, checked((int)len));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies the content of an array to a memory location.
|
|
|
/// </summary>
|
|
|
/// <param name="dest">A pointer to the starting address of the copied block's destination.</param>
|
|
|
/// <param name="src">An array used as the source of the copy process.</param>
|
|
|
/// <param name="len">The size of the block of memory to copy, in bytes.</param>
|
|
|
public static unsafe void CopyMemory(void* dest, Array src, int len)
|
|
|
{
|
|
|
GCHandle handle = GCHandle.Alloc(src, GCHandleType.Pinned);
|
|
|
try
|
|
|
{
|
|
|
CopyMemory((byte*)dest, (byte*)handle.AddrOfPinnedObject(), len);
|
|
|
}
|
|
|
finally
|
|
|
{
|
|
|
handle.Free();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies the content of an array to a memory location.
|
|
|
/// </summary>
|
|
|
/// <param name="dest">A pointer to the starting address of the copied block's destination.</param>
|
|
|
/// <param name="src">An array used as the source of the copy process.</param>
|
|
|
/// <param name="len">The size of the block of memory to copy, in bytes.</param>
|
|
|
public static unsafe void CopyMemory(void* dest, Array src, long len)
|
|
|
{
|
|
|
CopyMemory((byte*)dest, src, checked((int)len));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies the content of an array to a memory location.
|
|
|
/// </summary>
|
|
|
/// <param name="dest">A pointer to the starting address of the copied block's destination.</param>
|
|
|
/// <param name="src">An array used as the source of the copy process.</param>
|
|
|
/// <param name="len">The size of the block of memory to copy, in bytes.</param>
|
|
|
public static unsafe void CopyMemory(IntPtr dest, Array src, int len)
|
|
|
{
|
|
|
CopyMemory((byte*)dest, src, len);
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies the content of an array to a memory location.
|
|
|
/// </summary>
|
|
|
/// <param name="dest">A pointer to the starting address of the copied block's destination.</param>
|
|
|
/// <param name="src">An array used as the source of the copy process.</param>
|
|
|
/// <param name="len">The size of the block of memory to copy, in bytes.</param>
|
|
|
public static unsafe void CopyMemory(IntPtr dest, Array src, long len)
|
|
|
{
|
|
|
CopyMemory((byte*)dest, src, checked((int)len));
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies the content of one array into another array.
|
|
|
/// </summary>
|
|
|
/// <param name="dest">An array used as the destination of the copy process.</param>
|
|
|
/// <param name="src">An array used as the source of the copy process.</param>
|
|
|
/// <param name="len">The size of the content to copy, in bytes.</param>
|
|
|
public static unsafe void CopyMemory(Array dest, Array src, int len)
|
|
|
{
|
|
|
GCHandle dHandle = GCHandle.Alloc(dest, GCHandleType.Pinned);
|
|
|
try
|
|
|
{
|
|
|
GCHandle sHandle = GCHandle.Alloc(src, GCHandleType.Pinned);
|
|
|
try
|
|
|
{
|
|
|
CopyMemory((byte*)dHandle.AddrOfPinnedObject(), (byte*)sHandle.AddrOfPinnedObject(), len);
|
|
|
}
|
|
|
finally
|
|
|
{
|
|
|
sHandle.Free();
|
|
|
}
|
|
|
}
|
|
|
finally
|
|
|
{
|
|
|
dHandle.Free();
|
|
|
}
|
|
|
}
|
|
|
|
|
|
/// <summary>
|
|
|
/// Copies the content of one array into another array.
|
|
|
/// </summary>
|
|
|
/// <param name="dest">An array used as the destination of the copy process.</param>
|
|
|
/// <param name="src">An array used as the source of the copy process.</param>
|
|
|
/// <param name="len">The size of the content to copy, in bytes.</param>
|
|
|
public static unsafe void CopyMemory(Array dest, Array src, long len)
|
|
|
{
|
|
|
CopyMemory(dest, src, checked((int)len));
|
|
|
}
|
|
|
|
|
|
internal static string ColorToString(Color color)
|
|
|
{
|
|
|
return string.Format(
|
|
|
System.Globalization.CultureInfo.CurrentCulture,
|
|
|
"{{Name={0}, ARGB=({1}, {2}, {3}, {4})}}",
|
|
|
new object[] { color.Name, color.A, color.R, color.G, color.B });
|
|
|
}
|
|
|
|
|
|
internal static void Resize(ref string str, int length)
|
|
|
{
|
|
|
if ((str != null) && (length >= 0) && (str.Length != length))
|
|
|
{
|
|
|
char[] chars = str.ToCharArray();
|
|
|
Array.Resize(ref chars, length);
|
|
|
str = new string(chars);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
internal static void Resize(ref string str, int min, int max)
|
|
|
{
|
|
|
if ((str != null) && (min >= 0) && (max >= 0) && (min <= max))
|
|
|
{
|
|
|
if (str.Length < min)
|
|
|
{
|
|
|
char[] chars = str.ToCharArray();
|
|
|
Array.Resize(ref chars, min);
|
|
|
str = new string(chars);
|
|
|
}
|
|
|
else if (str.Length > max)
|
|
|
{
|
|
|
char[] chars = str.ToCharArray();
|
|
|
Array.Resize(ref chars, max);
|
|
|
str = new string(chars);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
internal static void Resize<T>(ref T[] array, int length)
|
|
|
{
|
|
|
if ((array != null) && (length >= 0) && (array.Length != length))
|
|
|
{
|
|
|
Array.Resize(ref array, length);
|
|
|
}
|
|
|
}
|
|
|
|
|
|
internal static void Resize<T>(ref T[] array, int min, int max)
|
|
|
{
|
|
|
if ((array != null) && (min >= 0) && (max >= 0) && (min <= max))
|
|
|
{
|
|
|
if (array.Length < min)
|
|
|
{
|
|
|
Array.Resize(ref array, min);
|
|
|
}
|
|
|
else if (array.Length > max)
|
|
|
{
|
|
|
Array.Resize(ref array, max);
|
|
|
}
|
|
|
}
|
|
|
}
|
|
|
|
|
|
internal static bool CheckColorType<T>(FREE_IMAGE_TYPE imageType, T color)
|
|
|
{
|
|
|
Type type = typeof(T);
|
|
|
bool result;
|
|
|
switch (imageType)
|
|
|
{
|
|
|
case FREE_IMAGE_TYPE.FIT_BITMAP:
|
|
|
result = (type == typeof(RGBQUAD)); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_COMPLEX:
|
|
|
result = (type == typeof(FICOMPLEX)); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_DOUBLE:
|
|
|
result = (type == typeof(double)); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_FLOAT:
|
|
|
result = (type == typeof(float)); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_INT16:
|
|
|
result = (type == typeof(Int16)); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_INT32:
|
|
|
result = (type == typeof(Int32)); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_RGB16:
|
|
|
result = (type == typeof(FIRGB16)); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_RGBA16:
|
|
|
result = (type == typeof(FIRGBA16)); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_RGBAF:
|
|
|
result = (type == typeof(FIRGBAF)); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_RGBF:
|
|
|
result = (type == typeof(FIRGBF)); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_UINT16:
|
|
|
result = (type == typeof(UInt16)); break;
|
|
|
case FREE_IMAGE_TYPE.FIT_UINT32:
|
|
|
result = (type == typeof(UInt32)); break;
|
|
|
default:
|
|
|
result = false; break;
|
|
|
}
|
|
|
return result;
|
|
|
}
|
|
|
|
|
|
#endregion
|
|
|
|
|
|
#region Dll-Imports
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves a handle to a display device context (DC) for the client area of a specified window
|
|
|
/// or for the entire screen. You can use the returned handle in subsequent GDI functions to draw in the DC.
|
|
|
/// </summary>
|
|
|
/// <param name="hWnd">Handle to the window whose DC is to be retrieved.
|
|
|
/// If this value is IntPtr.Zero, GetDC retrieves the DC for the entire screen. </param>
|
|
|
/// <returns>If the function succeeds, the return value is a handle to the DC for the specified window's client area.
|
|
|
/// If the function fails, the return value is NULL.</returns>
|
|
|
[DllImport("user32.dll")]
|
|
|
private static extern IntPtr GetDC(IntPtr hWnd);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Releases a device context (DC), freeing it for use by other applications.
|
|
|
/// The effect of the ReleaseDC function depends on the type of DC. It frees only common and window DCs.
|
|
|
/// It has no effect on class or private DCs.
|
|
|
/// </summary>
|
|
|
/// <param name="hWnd">Handle to the window whose DC is to be released.</param>
|
|
|
/// <param name="hDC">Handle to the DC to be released.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport("user32.dll")]
|
|
|
private static extern bool ReleaseDC(IntPtr hWnd, IntPtr hDC);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a DIB that applications can write to directly.
|
|
|
/// The function gives you a pointer to the location of the bitmap bit values.
|
|
|
/// You can supply a handle to a file-mapping object that the function will use to create the bitmap,
|
|
|
/// or you can let the system allocate the memory for the bitmap.
|
|
|
/// </summary>
|
|
|
/// <param name="hdc">Handle to a device context.</param>
|
|
|
/// <param name="pbmi">Pointer to a BITMAPINFO structure that specifies various attributes of the DIB,
|
|
|
/// including the bitmap dimensions and colors.</param>
|
|
|
/// <param name="iUsage">Specifies the type of data contained in the bmiColors array member of the BITMAPINFO structure
|
|
|
/// pointed to by pbmi (either logical palette indexes or literal RGB values).</param>
|
|
|
/// <param name="ppvBits">Pointer to a variable that receives a pointer to the location of the DIB bit values.</param>
|
|
|
/// <param name="hSection">Handle to a file-mapping object that the function will use to create the DIB.
|
|
|
/// This parameter can be NULL.</param>
|
|
|
/// <param name="dwOffset">Specifies the offset from the beginning of the file-mapping object referenced by hSection
|
|
|
/// where storage for the bitmap bit values is to begin. This value is ignored if hSection is NULL.</param>
|
|
|
/// <returns>If the function succeeds, the return value is a handle to the newly created DIB,
|
|
|
/// and *ppvBits points to the bitmap bit values. If the function fails, the return value is NULL, and *ppvBits is NULL.</returns>
|
|
|
[DllImport("gdi32.dll")]
|
|
|
private static extern IntPtr CreateDIBSection(
|
|
|
IntPtr hdc,
|
|
|
[In] IntPtr pbmi,
|
|
|
uint iUsage,
|
|
|
out IntPtr ppvBits,
|
|
|
IntPtr hSection,
|
|
|
uint dwOffset);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Deletes a logical pen, brush, font, bitmap, region, or palette, freeing all system resources associated with the object.
|
|
|
/// After the object is deleted, the specified handle is no longer valid.
|
|
|
/// </summary>
|
|
|
/// <param name="hObject">Handle to a logical pen, brush, font, bitmap, region, or palette.</param>
|
|
|
/// <returns>Returns true on success, false on failure.</returns>
|
|
|
[DllImport("gdi32.dll")]
|
|
|
private static extern bool DeleteObject(IntPtr hObject);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Creates a compatible bitmap (DDB) from a DIB and, optionally, sets the bitmap bits.
|
|
|
/// </summary>
|
|
|
/// <param name="hdc">Handle to a device context.</param>
|
|
|
/// <param name="lpbmih">Pointer to a bitmap information header structure.</param>
|
|
|
/// <param name="fdwInit">Specifies how the system initializes the bitmap bits - (use 4).</param>
|
|
|
/// <param name="lpbInit">Pointer to an array of bytes containing the initial bitmap data.</param>
|
|
|
/// <param name="lpbmi">Pointer to a BITMAPINFO structure that describes the dimensions
|
|
|
/// and color format of the array pointed to by the lpbInit parameter.</param>
|
|
|
/// <param name="fuUsage">Specifies whether the bmiColors member of the BITMAPINFO structure
|
|
|
/// was initialized - (use 0).</param>
|
|
|
/// <returns>Handle to a DIB or null on failure.</returns>
|
|
|
[DllImport("gdi32.dll")]
|
|
|
private static extern IntPtr CreateDIBitmap(
|
|
|
IntPtr hdc,
|
|
|
IntPtr lpbmih,
|
|
|
uint fdwInit,
|
|
|
IntPtr lpbInit,
|
|
|
IntPtr lpbmi,
|
|
|
uint fuUsage);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves information for the specified graphics object.
|
|
|
/// </summary>
|
|
|
/// <param name="hgdiobj">Handle to the graphics object of interest.</param>
|
|
|
/// <param name="cbBuffer">Specifies the number of bytes of information to
|
|
|
/// be written to the buffer.</param>
|
|
|
/// <param name="lpvObject">Pointer to a buffer that receives the information
|
|
|
/// about the specified graphics object.</param>
|
|
|
/// <returns>0 on failure.</returns>
|
|
|
[DllImport("gdi32.dll")]
|
|
|
private static extern int GetObject(IntPtr hgdiobj, int cbBuffer, IntPtr lpvObject);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Retrieves the bits of the specified compatible bitmap and copies them into a buffer
|
|
|
/// as a DIB using the specified format.
|
|
|
/// </summary>
|
|
|
/// <param name="hdc">Handle to the device context.</param>
|
|
|
/// <param name="hbmp">Handle to the bitmap. This must be a compatible bitmap (DDB).</param>
|
|
|
/// <param name="uStartScan">Specifies the first scan line to retrieve.</param>
|
|
|
/// <param name="cScanLines">Specifies the number of scan lines to retrieve.</param>
|
|
|
/// <param name="lpvBits">Pointer to a buffer to receive the bitmap data.</param>
|
|
|
/// <param name="lpbmi">Pointer to a BITMAPINFO structure that specifies the desired
|
|
|
/// format for the DIB data.</param>
|
|
|
/// <param name="uUsage">Specifies the format of the bmiColors member of the
|
|
|
/// BITMAPINFO structure - (use 0).</param>
|
|
|
/// <returns>0 on failure.</returns>
|
|
|
[DllImport("gdi32.dll")]
|
|
|
private static extern unsafe int GetDIBits(
|
|
|
IntPtr hdc,
|
|
|
IntPtr hbmp,
|
|
|
uint uStartScan,
|
|
|
uint cScanLines,
|
|
|
IntPtr lpvBits,
|
|
|
IntPtr lpbmi,
|
|
|
uint uUsage);
|
|
|
|
|
|
/// <summary>
|
|
|
/// Moves a block of memory from one location to another.
|
|
|
/// </summary>
|
|
|
/// <param name="dst">Pointer to the starting address of the move destination.</param>
|
|
|
/// <param name="src">Pointer to the starting address of the block of memory to be moved.</param>
|
|
|
/// <param name="size">Size of the block of memory to move, in bytes.</param>
|
|
|
[DllImport("Kernel32.dll", EntryPoint = "RtlMoveMemory", SetLastError = false)]
|
|
|
public static unsafe extern void MoveMemory(void* dst, void* src, uint size);
|
|
|
|
|
|
/// <summary>
|
|
|
/// The RtlCompareMemory routine compares blocks of memory
|
|
|
/// and returns the number of bytes that are equivalent.
|
|
|
/// </summary>
|
|
|
/// <param name="buf1">A pointer to a block of memory to compare.</param>
|
|
|
/// <param name="buf2">A pointer to a block of memory to compare.</param>
|
|
|
/// <param name="count">Specifies the number of bytes to be compared.</param>
|
|
|
/// <returns>RtlCompareMemory returns the number of bytes that compare as equal.
|
|
|
/// If all bytes compare as equal, the input Length is returned.</returns>
|
|
|
[DllImport("ntdll.dll", EntryPoint = "RtlCompareMemory", SetLastError = false)]
|
|
|
internal static unsafe extern uint RtlCompareMemory(void* buf1, void* buf2, uint count);
|
|
|
|
|
|
#endregion
|
|
|
}
|
|
|
}
|